{"version":3,"sources":["umbracoforms-dependencies.js","lazyload.js","scripts.js","auth.resource.js","svg4everybody.js","picturefill.js","jquery.js","jquery.validate.js","jquery.validate.unobtrusive.js","umbracoforms.js","umbracoforms-conditions.js","bootstrap.js","core.js","datepicker.js","datepicker-sv.js","datepicker-no.js","datepicker-en-GB.js","datepicker-de.js","datepicker-da.js","jquery.cookie.js","jquery.panzoom.js","jquery.mobile.custom.min.js","jquery.fancybox.min.js","viewer.min.js","lightslider.js","jquery.countdown.min.js","booking-service-modal.js","image-gallery.js","angular.js","tmhDynamicLocale.js","angular-cookies.js","date.js","angular-promise-extras.js","angular-filter.js","nya-bs-select.js","app.config.js","app.core.js","app.services.js","app.resources.js","app.filters.js","app.js","nya.bootstrap.js","booking.resource.js","toTrusted.js","truncate.js","travelFilter.js","travelSearchService.js","hotelService.js","settings.service.js","errorHandler.service.js","cookie.service.js","utils.service.js","compile.js","prevent-default.js","convert-to-number.js","travelsearch.js","lastminute.controller.js","lastminute-filter.controller.js","my-booking.controller.js","my-booking-overview.controller.js","guestpayments.controller.js","mypage.controller.js"],"names":["performDependencyChecks","formId","Umbraco","Sys","umbracoForm","document","getElementById","errorElement","createElement","className","style","color","backgroundColor","padding","margin","errorMessage","jQuery","$","validator","unobtrusive","innerHTML","insertBefore","childNodes","initLazyLoad","srcSets","slice","call","querySelectorAll","srcSetImgs","images","iframes","window","options","rootMargin","srcSetObserver","IntersectionObserver","entries","observer","forEach","entry","isIntersecting","srcSet","target","srcset","dataset","parentElement","classList","remove","unobserve","imageObserver","img","src","iframeObserver","iframe","html","observe","image","nextElementSibling","viewport","e","a","documentElement","body","width","height","listFavoriteCheck","each","undefined","cookie","indexOf","this","data","find","removeClass","addClass","sortDestinations","matchPercentage","index","datavar","attr","toLowerCase","calcvar","startvalue","val","Math","abs","sumtotal","parseInt","round","text","parent","ascending","sorted","sort","b","after","radio_select","radioId","price","bookUrl","realignTabs","length","totalWidth","tabsWidth","dropdownCopy","clone","css","visibility","display","position","append","dropdownWidth","empty","appendTo","getBrand","brandId","hostName","location","hostname","replace","root","factory","define","amd","svg4everybody","exports","module","embed","svg","fragment","createDocumentFragment","viewBox","getAttribute","setAttribute","cloneNode","appendChild","firstChild","loadreadystatechange","xhr","onreadystatechange","readyState","cachedDocument","_cachedDocument","implementation","createHTMLDocument","responseText","_cachedTarget","_embeds","splice","map","item","id","rawopts","oninterval","uses","use","parentNode","test","nodeName","polyfill","opts","validate","removeChild","srcSplit","split","url","shift","join","requests","XMLHttpRequest","open","send","push","requestAnimationFrame","Object","newerIEUA","webkitUA","olderEdgeUA","navigator","userAgent","match","setTimeout","getElementsByTagName","ua","HTMLPictureElement","RegExp","$1","addEventListener","timer","dummySrc","fixRespimg","source","sizes","picture","toUpperCase","firstElementChild","_pfLastSize","offsetWidth","findPictureImgs","i","imgs","onResize","clearTimeout","mq","matchMedia","init","addListener","isSpace","c","detectTypeSupport","type","typeUri","Image","onerror","types","picturefill","onload","updateMetrics","isVwDirty","DPR","devicePixelRatio","cssCache","sizeLengthCache","pf","units","max","innerWidth","docElem","clientWidth","innerHeight","clientHeight","vw","vh","evalId","em","getEmValue","rem","chooseLowRes","lowerValue","higherValue","dprValue","isCached","bonusFactor","tooMuch","bonus","meanDensity","cfg","algorithm","pow","sqrt","applyBestCandidate","srcSetCandidates","matchingSet","getSet","evaluated","setRes","applySetCandidate","ns","evaled","ascendingSort","res","setSrcToCur","set","candidate","sets","getCandidateForSrc","makeUrl","curSrc","curCan","setResolution","candidates","parseSet","getAllSourceElements","len","sources","media","parseSrcset","input","collectCharacters","regEx","chars","exec","substring","pos","parseDescriptors","w","d","h","desc","lastChar","value","intVal","floatVal","pError","descriptors","parseFloat","regexNonNegativeInteger","regexFloatingPoint","has1x","tokenize","regexLeadingSpaces","currentDescriptor","state","charAt","inputLength","regexLeadingCommasOrSpaces","regexLeadingNotSpaces","regexTrailingCommas","parseSizes","strValue","parseComponentValues","str","pushComponent","component","componentArray","pushComponentArray","listArray","chrctr","parenDepth","inComment","isValidNonNegativeSourceSizeValue","s","regexCssLengthWithUnits","regexCssCalc","unparsedSizesList","unparsedSizesListLength","unparsedSize","lastComponentValue","size","pop","matchesMedia","warn","eminpx","alwaysCheckWDescriptor","isSupportTestReady","noop","getImgAttr","setImgAttr","removeImgAttr","removeAttribute","srcAttr","srcsetAttr","supportAbort","curSrcProp","regWDesc","regSize","setOptions","picturefillCFG","baseStyle","fsCss","px","in","anchor","alreadyRun","on","obj","evt","fn","capture","attachEvent","memoize","cache","evalCSS","regLength","args","arguments","string","buildStr","parsedLength","Function","sizesattr","cWidth","calcListLength","opt","elements","plen","nodeType","context","qsa","reevaluate","reselect","sel","selShort","setupRun","fillImg","teardownRun","console","message","hasFeature","Date","getTime","substr","supSrcset","supSizes","supPicture","image2","complete","width2","width1","u","setSize","href","matches","mMQ","apply","calcLength","sourceSizeValue","supportsType","parseSize","sourceSizeStr","cands","div","originalHTMLCSS","cssText","originalBodyCSS","sourceSizeListStr","uT","winningLength","j","bestCandidate","candidateSrc","abortCurSrc","imageData","dpr","cached","setSrc","origWidth","parseSets","element","srcsetAttribute","imageSet","isWDescripor","srcsetParsed","hasPicture","pic","supported","parsed","extreme","isDomReady","regReady","run","timerId","fillImgs","debounce","func","wait","timeout","timestamp","later","last","lastClientWidth","_","name","global","Error","noGlobal","isArraylike","isWindow","winnow","qualifier","not","isFunction","grep","elem","risSimple","filter","inArray","sibling","cur","dir","createOptions","object","optionsCache","rnotwhite","flag","detach","removeEventListener","completed","detachEvent","event","ready","dataAttr","key","rmultiDash","rbrace","parseJSON","isEmptyDataObject","isEmptyObject","internalData","pvt","acceptData","ret","thisCache","internalKey","expando","isNode","deletedIds","guid","toJSON","extend","camelCase","internalRemoveData","isArray","concat","cleanData","support","deleteExpando","returnTrue","returnFalse","safeActiveElement","activeElement","err","createSafeFragment","list","nodeNames","safeFrag","getAll","tag","elems","found","strundefined","merge","fixDefaultChecked","rcheckableType","defaultChecked","checked","manipulationTarget","content","ownerDocument","disableScript","restoreScript","rscriptTypeMasked","setGlobalEval","refElements","_data","cloneCopyEvent","dest","hasData","l","oldData","curData","events","handle","add","fixCloneNodeIssues","noCloneEvent","removeEvent","outerHTML","html5Clone","trim","defaultSelected","selected","defaultValue","actualDisplay","doc","getDefaultComputedStyle","defaultDisplay","elemdisplay","contentWindow","contentDocument","write","close","addGetHookIf","conditionFn","hookFn","get","condition","vendorPropName","capName","origName","cssPrefixes","showHide","show","hidden","values","isHidden","setPositiveNumber","subtract","rnumsplit","augmentWidthOrHeight","extra","isBorderBox","styles","cssExpand","getWidthOrHeight","valueIsBorderBox","offsetHeight","getStyles","boxSizing","curCSS","rnumnonpx","boxSizingReliable","Tween","prop","end","easing","prototype","createFxNow","fxNow","now","genFx","includeWidth","which","attrs","opacity","createTween","animation","tween","collection","tweeners","defaultPrefilter","props","toggle","hooks","oldfire","checkDisplay","anim","orig","dataShow","queue","_queueHooks","unqueued","fire","always","overflow","overflowX","overflowY","inlineBlockNeedsLayout","zoom","shrinkWrapBlocks","rfxtypes","done","hide","_removeData","start","propFilter","specialEasing","cssHooks","expand","Animation","properties","result","stopped","animationPrefilters","deferred","Deferred","tick","currentTime","remaining","startTime","duration","temp","percent","tweens","notifyWith","resolveWith","promise","originalProperties","originalOptions","stop","gotoEnd","rejectWith","fx","progress","fail","addToPrefiltersOrTransports","structure","dataTypeExpression","dataType","dataTypes","unshift","inspectPrefiltersOrTransports","jqXHR","inspect","inspected","prefilterOrFactory","dataTypeOrTransport","seekingTransport","transports","ajaxExtend","deep","flatOptions","ajaxSettings","ajaxHandleResponses","responses","firstDataType","ct","finalDataType","contents","mimeType","getResponseHeader","converters","ajaxConvert","response","isSuccess","conv2","current","conv","tmp","prev","responseFields","dataFilter","error","buildParams","prefix","traditional","v","rbracket","createStandardXHR","createActiveXHR","ActiveXObject","getWindow","defaultView","parentWindow","class2type","toString","hasOwn","hasOwnProperty","version","selector","rtrim","rmsPrefix","rdashAlpha","fcamelCase","all","letter","jquery","constructor","toArray","num","pushStack","prevObject","callback","first","eq","copyIsArray","copy","isPlainObject","random","isReady","msg","Array","isNumeric","ownLast","globalEval","execScript","makeArray","arr","results","second","invert","callbackInverse","callbackExpect","arg","proxy","Sizzle","seed","m","groups","old","nid","newContext","newSelector","preferredDoc","setDocument","documentIsHTML","rquickExpr","contains","getElementsByClassName","rbuggyQSA","rescape","toSelector","rsibling","testContext","qsaError","select","createCache","keys","Expr","cacheLength","markFunction","assert","addHandle","handler","attrHandle","siblingCheck","diff","sourceIndex","MAX_NEGATIVE","nextSibling","createInputPseudo","createButtonPseudo","createPositionalPseudo","argument","matchIndexes","setFilters","tokens","addCombinator","matcher","combinator","base","checkNonElements","doneName","xml","oldCache","outerCache","newCache","dirruns","elementMatcher","matchers","multipleContexts","contexts","condense","unmatched","newUnmatched","mapped","setMatcher","preFilter","postFilter","postFinder","postSelector","preMap","postMap","preexisting","matcherIn","matcherOut","matcherFromTokens","checkContext","leadingRelative","relative","implicitRelative","matchContext","matchAnyContext","outermostContext","matcherFromGroupMatchers","elementMatchers","setMatchers","bySet","byElement","superMatcher","outermost","matchedCount","setMatched","contextBackup","dirrunsUnique","uniqueSort","getText","isXML","compile","sortInput","hasDuplicate","rbuggyMatches","classCache","tokenCache","compilerCache","sortOrder","push_native","booleans","whitespace","characterEncoding","identifier","attributes","pseudos","rwhitespace","rcomma","rcombinators","rattributeQuotes","rpseudo","ridentifier","matchExpr","ID","CLASS","TAG","ATTR","PSEUDO","CHILD","bool","needsContext","rinputs","rheader","rnative","runescape","funescape","escaped","escapedWhitespace","high","String","fromCharCode","unloadHandler","els","node","hasCompare","top","createComment","getById","getElementsByName","attrId","getAttributeNode","matchesSelector","webkitMatchesSelector","mozMatchesSelector","oMatchesSelector","msMatchesSelector","disconnectedMatch","compareDocumentPosition","adown","bup","compare","sortDetached","aup","ap","bp","expr","specified","duplicates","detectDuplicates","sortStable","textContent","nodeValue","selectors","createPseudo",">"," ","+","~","excess","unquoted","nodeNameSelector","pattern","operator","check","what","simple","forward","ofType","nodeIndex","useCache","lastChild","pseudo","idx","matched","has","innerText","lang","elemLang","hash","focus","hasFocus","tabIndex","enabled","disabled","selectedIndex","header","button","even","odd","lt","gt","radio","checkbox","file","password","submit","reset","filters","parseOnly","soFar","preFilters","token","compiled","div1","unique","isXMLDoc","rneedsContext","rsingleTag","self","is","rootjQuery","parseHTML","rparentsprev","guaranteedUnique","children","next","until","n","r","targets","closest","prevAll","addBack","parents","parentsUntil","nextAll","nextUntil","prevUntil","siblings","reverse","Callbacks","firing","memory","fired","firingLength","firingIndex","firingStart","stack","once","stopOnFalse","disable","lock","locked","fireWith","tuples","then","fns","newDefer","tuple","returned","resolve","reject","notify","pipe","stateString","when","subordinate","progressValues","progressContexts","resolveContexts","resolveValues","updateFunc","readyList","readyWait","holdReady","hold","triggerHandler","off","frameElement","doScroll","doScrollCheck","container","noData","applet ","embed ","object ","removeData","dequeue","startLength","setter","clearQueue","count","defer","pnum","el","access","chainable","emptyGet","raw","bulk","leadingWhitespace","tbody","htmlSerialize","appendChecked","noCloneChecked","checkClone","click","eventName","change","focusin","rformElems","rkeyEvent","rmouseEvent","rfocusMorph","rtypenamespace","t","handleObjIn","special","eventHandle","handleObj","handlers","namespaces","origType","elemData","triggered","dispatch","delegateType","bindType","namespace","delegateCount","setup","mappedTypes","origCount","teardown","trigger","onlyHandlers","ontype","bubbleType","eventPath","Event","isTrigger","namespace_re","noBubble","isPropagationStopped","preventDefault","isDefaultPrevented","_default","fix","handlerQueue","delegateTarget","preDispatch","currentTarget","isImmediatePropagationStopped","stopPropagation","postDispatch","originalEvent","fixHook","fixHooks","mouseHooks","keyHooks","srcElement","metaKey","original","charCode","keyCode","eventDoc","fromElement","pageX","clientX","scrollLeft","clientLeft","pageY","clientY","scrollTop","clientTop","relatedTarget","toElement","load","blur","beforeunload","returnValue","simulate","bubble","isSimulated","defaultPrevented","timeStamp","cancelBubble","stopImmediatePropagation","mouseenter","mouseleave","pointerenter","pointerleave","related","submitBubbles","form","_submit_bubble","changeBubbles","propertyName","_just_changed","focusinBubbles","attaches","one","origFn","rinlinejQuery","rnoshimcache","rleadingWhitespace","rxhtmlTag","rtagName","rtbody","rhtml","rnoInnerhtml","rchecked","rscriptType","rcleanScript","wrapMap","option","legend","area","param","thead","tr","col","td","safeFragment","fragmentDiv","optgroup","tfoot","colgroup","caption","th","dataAndEvents","deepDataAndEvents","destElements","srcElements","inPage","buildFragment","scripts","selection","wrap","safe","nodes","createTextNode","domManip","prepend","before","keepData","replaceWith","replaceChild","hasScripts","iNoClone","_evalUrl","prependTo","insertAfter","replaceAll","insert","shrinkWrapBlocksVal","rmargin","rposition","getComputedStyle","opener","computed","minWidth","maxWidth","getPropertyValue","currentStyle","left","rs","rsLeft","runtimeStyle","pixelLeft","computeStyleTests","pixelPositionVal","boxSizingReliableVal","reliableMarginRightVal","marginRight","reliableHiddenOffsetsVal","cssFloat","backgroundClip","clearCloneStyle","MozBoxSizing","WebkitBoxSizing","reliableHiddenOffsets","pixelPosition","reliableMarginRight","swap","ralpha","ropacity","rdisplayswap","rrelNum","cssShow","cssNormalTransform","letterSpacing","fontWeight","cssNumber","columnCount","fillOpacity","flexGrow","flexShrink","lineHeight","order","orphans","widows","zIndex","cssProps","float","border","suffix","expanded","parts","unit","propHooks","eased","step","linear","p","swing","cos","PI","rfxnum","rrun","*","scale","maxIterations","tweener","prefilter","speed","speeds","fadeTo","to","animate","optall","doAnimation","finish","stopQueue","timers","cssFn","slideDown","slideUp","slideToggle","fadeIn","fadeOut","fadeToggle","interval","setInterval","clearInterval","slow","fast","delay","time","getSetAttribute","hrefNormalized","checkOn","optSelected","enctype","optDisabled","radioValue","rreturn","valHooks","optionSet","scrollHeight","nodeHook","boolHook","ruseDefault","getSetInput","removeAttr","nType","attrHooks","propName","attrNames","propFix","getter","setAttributeNode","createAttribute","coords","contenteditable","rfocusable","rclickable","removeProp","for","class","notxml","tabindex","rclass","classes","clazz","finalValue","proceed","toggleClass","stateVal","classNames","hasClass","hover","fnOver","fnOut","bind","unbind","delegate","undelegate","nonce","rquery","rvalidtokens","JSON","parse","requireNonComma","depth","comma","parseXML","DOMParser","parseFromString","async","loadXML","ajaxLocParts","ajaxLocation","rhash","rts","rheaders","rlocalProtocol","rnoContent","rprotocol","rurl","prefilters","allTypes","active","lastModified","etag","isLocal","processData","contentType","accepts","json","* text","text html","text json","text xml","ajaxSetup","settings","ajaxPrefilter","ajaxTransport","ajax","status","nativeStatusText","headers","success","modified","statusText","timeoutTimer","transport","responseHeadersString","ifModified","cacheURL","callbackContext","statusCode","fireGlobals","globalEventContext","completeDeferred","responseHeaders","requestHeaders","requestHeadersNames","strAbort","getAllResponseHeaders","setRequestHeader","lname","overrideMimeType","code","abort","finalText","method","crossDomain","hasContent","beforeSend","getJSON","getScript","throws","wrapAll","wrapInner","unwrap","visible","r20","rCRLF","rsubmitterTypes","rsubmittable","encodeURIComponent","serialize","serializeArray","xhrId","xhrCallbacks","xhrSupported","cors","username","xhrFields","isAbort","script","text script","head","scriptCharset","charset","oldCallbacks","rjsonp","jsonp","jsonpCallback","originalSettings","callbackName","overwritten","responseContainer","jsonProp","keepScripts","_load","params","animated","offset","setOffset","curPosition","curLeft","curCSSTop","curTop","curOffset","curCSSLeft","calculatePosition","curElem","using","win","box","getBoundingClientRect","pageYOffset","pageXOffset","offsetParent","parentOffset","scrollTo","Height","Width","","defaultExtra","funcName","andSelf","_jQuery","_$","noConflict","require","debug","onsubmit","submitButton","cancelSubmit","submitHandler","formSubmitted","currentForm","pendingRequest","focusInvalid","valid","errorList","rules","command","staticRules","existingRules","filtered","hasAttribute","normalizeRule","messages","normalizeRules","classRules","attributeRules","dataRules","required","remote","blank","filled","unchecked","defaults","format","errorClass","pendingClass","validClass","focusCleanup","errorContainer","errorLabelContainer","ignore","ignoreTitle","onfocusin","lastActive","unhighlight","hideThese","errorsFor","onfocusout","checkable","submitted","optional","onkeyup","excludedKeys","elementValue","invalid","onclick","highlight","findByName","setDefaults","email","date","dateISO","number","digits","equalTo","maxlength","minlength","rangelength","range","min","autoCreateRanges","eventType","labelContainer","errorContext","containers","valueCache","pending","invalidHandler","checkForm","errorMap","showErrors","prepareForm","currentElements","group","cleanElement","clean","checkElement","validationTargetFor","prepareElement","testgroup","numberOfInvalids","toHide","errors","successList","defaultShowErrors","resetForm","hideErrors","resetElements","objectLength","addWrapper","findLastActive","rulesCache","resetInternals","toShow","$element","validity","badInput","lastIndexOf","rule","normalizer","rulesCount","dependencyMismatch","TypeError","parameters","methods","formatAndAdd","log","customDataMessage","customMessage","findDefined","defaultMessage","title","theregex","toToggle","wrapper","showLabel","validElements","invalidElements","place","errorID","elementID","idOrName","describedBy","errorPlacement","escapeCssMeta","describer","getLength","depend","dependTypes","boolean","function","startRequest","stopRequest","previousValue","destroy","classRuleSettings","creditcard","addClassRules","normalizeAttributeRule","Number","isNaN","depends","keepRule","parameter","transformed","addMethod","decimals","supportedTypes","re","notSupported","decimalPlaces","toInt","optionDataString","previous","originalMessage","mode","port","pendingRequests","setValidationValues","ruleName","splitAndTrim","escapeAttributeValue","getModelPrefix","fieldName","appendModelPrefix","onError","inputElement","replaceAttrValue","onErrors","onSuccess","onReset","$form","validationInfo","data_validation","onResetProxy","defaultOptions","$jQval","execInContext","attachValidation","adapters","parseElement","skipAttach","valInfo","paramValues","adapt","__dummy__","$selector","$forms","info","adapterName","addBool","addMinMax","minRuleName","maxRuleName","minMaxRuleName","minAttribute","maxAttribute","addSingleVal","attribute","nonalphamin","extension","other","fullOtherName","tagName","additionalfields","paramName","field","regex","extensions","frm","umbracoForms","uf","conditions","operators","Is","expected","IsNot","unexpected","GreaterThen","limit","LessThen","StartsWith","criteria","EndsWith","Contains","evaluateRuleInstance","evaluateRule","dependencyIsVisible","fieldConditions","isVisible","evaluateCondition","any","logicType","fieldsetVisibilities","hasHiddenFieldset","fieldsetId","fsConditions","evaluateConditionVisibility","actionType","cachedResult","cachedResults","handleCondition","shouldShow","fsId","fieldId","transitionEnd","transEndEventNames","WebkitTransition","MozTransition","OTransition","transition","emulateTransitionEnd","called","$el","bsTransitionEnd","Plugin","$this","Alert","dismiss","VERSION","TRANSITION_DURATION","removeElement","$parent","alert","Constructor","Button","setState","DEFAULTS","isLoading","loadingText","resetText","changed","$input","$btn","Carousel","action","slide","pause","cycle","$indicators","paused","sliding","$active","$items","keyboard","keydown","getItemIndex","getItemForDirection","direction","activeIndex","willWrap","delta","itemIndex","that","$next","isCycling","slideEvent","$nextIndicator","slidEvent","carousel","clickHandler","$target","slideIndex","$carousel","getTargetFromTrigger","$trigger","Collapse","transitioning","getParent","addAriaAndCollapsedClass","dimension","hasWidth","activesData","actives","startEvent","scrollSize","isOpen","collapse","clearMenus","backdrop","Dropdown","isActive","dropdown","_relatedTarget","Modal","$body","$dialog","$backdrop","isShown","originalBodyPad","scrollbarWidth","ignoreBackdropClick","BACKDROP_TRANSITION_DURATION","checkScrollbar","setScrollbar","escape","resize","adjustDialog","enforceFocus","hideModal","handleUpdate","resetAdjustments","resetScrollbar","removeBackdrop","doAnimate","callbackRemove","modalIsOverflowing","paddingLeft","bodyIsOverflowing","paddingRight","fullWindowWidth","documentElementRect","right","measureScrollbar","bodyPad","scrollDiv","modal","showEvent","Tooltip","hoverState","inState","placement","template","getOptions","$viewport","triggers","eventIn","eventOut","enter","leave","_options","fixTitle","getDefaults","getDelegateOptions","tip","isInStateTrue","inDom","$tip","tipId","getUID","setContent","autoToken","autoPlace","getPosition","actualWidth","actualHeight","orgPlacement","viewportDim","bottom","calculatedOffset","getCalculatedOffset","applyPlacement","prevHoverState","marginTop","marginLeft","getViewportAdjustedDelta","isVertical","arrowDelta","arrowOffsetPosition","replaceArrow","arrow","getTitle","$e","isBody","elRect","isSvg","SVGElement","elOffset","scroll","outerDims","viewportPadding","viewportDimensions","topEdgeOffset","bottomEdgeOffset","leftEdgeOffset","rightEdgeOffset","o","$arrow","enable","toggleEnabled","tooltip","Popover","getContent","popover","ScrollSpy","$scrollElement","offsets","activeTarget","process","refresh","getScrollHeight","offsetMethod","offsetBase","$href","maxScroll","activate","clear","scrollspy","$spy","Tab","$ul","$previous","hideEvent","tab","Affix","checkPosition","checkPositionWithEventLoop","affixed","unpin","pinnedOffset","RESET","getState","offsetTop","offsetBottom","targetHeight","initializing","colliderTop","colliderHeight","getPinnedOffset","affix","affixType","focusable","isTabIndexNotNaN","mapName","ui","BACKSPACE","COMMA","DELETE","DOWN","END","ENTER","ESCAPE","HOME","LEFT","PAGE_DOWN","PAGE_UP","PERIOD","RIGHT","SPACE","TAB","UP","scrollParent","includeHidden","excludeStaticParent","overflowRegex","uniqueId","uuid","removeUniqueId","dataName","tabbable","isTabIndexNaN","outerWidth","reduce","side","outerHeight","ie","disableSelection","enableSelection","plugin","proto","plugins","instance","allowDisconnected","datepicker_getZindex","Datepicker","_curInst","_keyEvent","_disabledInputs","_datepickerShowing","_inDialog","_mainDivId","_inlineClass","_appendClass","_triggerClass","_dialogClass","_disableClass","_unselectableClass","_currentClass","_dayOverClass","regional","closeText","prevText","nextText","currentText","monthNames","monthNamesShort","dayNames","dayNamesShort","dayNamesMin","weekHeader","dateFormat","firstDay","isRTL","showMonthAfterYear","yearSuffix","_defaults","showOn","showAnim","showOptions","defaultDate","appendText","buttonText","buttonImage","buttonImageOnly","hideIfNoPrevNext","navigationAsDateFormat","gotoCurrent","changeMonth","changeYear","yearRange","showOtherMonths","selectOtherMonths","showWeek","calculateWeek","iso8601Week","shortYearCutoff","minDate","maxDate","beforeShowDay","beforeShow","onSelect","onChangeMonthYear","onClose","numberOfMonths","showCurrentAtPos","stepMonths","stepBigMonths","altField","altFormat","constrainInput","showButtonPanel","autoSize","en","dpDiv","datepicker_bindHover","datepicker_handleMouseover","datepicker","_isDisabledDatepicker","datepicker_instActive","inline","datepicker_extendRemove","markerClassName","maxRows","_widgetDatepicker","_attachDatepicker","inst","_newInst","_connectDatepicker","_inlineDatepicker","selectedDay","selectedMonth","selectedYear","drawMonth","drawYear","_attachments","_doKeyDown","keypress","_doKeyPress","keyup","_doKeyUp","_autoSize","_disableDatepicker","_get","_showDatepicker","alt","_lastInput","_hideDatepicker","findMax","maxI","names","setMonth","setDate","getDay","_formatDate","divSpan","_setDate","_getDefaultDate","_updateDatepicker","_updateAlternate","_dialogDatepicker","browserWidth","browserHeight","scrollX","scrollY","_dialogInst","_dialogInput","_pos","blockUI","_destroyDatepicker","_enableDatepicker","cursor","_getInst","_optionDatepicker","_getDateDatepicker","_getMinMaxDate","_changeDatepicker","_refreshDatepicker","_setDateDatepicker","noDefault","_setDateFromField","_getDate","dateStr","handled","_selectDay","_adjustDate","ctrlKey","_clearDate","_gotoToday","altKey","chr","_possibleChars","lastVal","parseDate","_getFormatConfig","beforeShowSettings","isFixed","_findPos","_checkOffset","effects","effect","_shouldFocusInput","_generateHTML","_attachHandlers","origyearshtml","numMonths","_getNumberOfMonths","cols","activeCell","yearshtml","dpWidth","dpHeight","inputWidth","inputHeight","viewWidth","viewHeight","postProcess","_tidyDialog","unblockUI","_checkExternalClick","period","_adjustInstDate","currentDay","currentMonth","currentYear","getDate","getMonth","getFullYear","_notifyChange","_selectMonthYear","month","year","_selectDate","formatDate","noWeekends","day","checkDate","floor","iFormat","dim","iValue","shortYearCutoffTemp","doy","literal","lookAhead","getNumber","isDoubled","minSize","getName","shortNames","longNames","k","pair","checkLiteral","_ticksTo1970","_getDaysInMonth","_daylightSavingAdjust","ATOM","COOKIE","ISO_8601","RFC_822","RFC_850","RFC_1036","RFC_1123","RFC_2822","RSS","TICKS","TIMESTAMP","W3C","formatNumber","formatName","output","getYear","dates","_restrictMinMax","_determineDate","offsetNumeric","offsetString","newDate","setHours","setMinutes","setSeconds","setMilliseconds","getHours","noChange","origMonth","origYear","startDate","today","selectDay","selectMonth","selectYear","maxDraw","gotoDate","controls","buttonPanel","dow","row","selectedDate","cornerClass","calender","daysInMonth","leadDays","curRows","numRows","printDate","dRow","daySettings","otherMonth","unselectable","tempDate","isMultiMonth","currentDate","_canAdjustMonth","_isInRange","_generateMonthYearHeader","_getFirstDayOfMonth","ceil","secondary","inMinYear","inMaxYear","years","thisYear","determineYear","endYear","monthHtml","onChange","minMax","curYear","curMonth","yearSplit","minYear","maxYear","initialized","mousedown","otherArgs","encode","config","decode","decodeURIComponent","stringifyCookieValue","stringify","parseCookieValue","pluses","read","converter","expires","days","setTime","toUTCString","path","domain","secure","cookies","removeCookie","matrixEquals","createResetOptions","Matrix","f","g","Vector","x","y","z","Panzoom","datakey","$elem","$set","$doc","isSVG","rsvg","namespaceURI","panning","_buildTransform","_transform","transform","rupper","_buildTransition","resetDimensions","$empty","hook","PointerEvent","mouseProps","touch","touches","pointertouch","pointerEvents","supportsInputEvent","oninput","rinline","floating","commaSpace","rmatrix","matrix","isVector","inverse","determinant","eventNamespace","disablePan","disableZoom","increment","minScale","maxScale","rangeStep","contain","_initStyle","_bind","_resetStyle","_unbind","isDisabled","dims","po","widthBorder","heightBorder","dimensions","setMatrix","_origTransform","silent","_trigger","resetZoom","origMatrix","getMatrix","dValue","resetPan","pan","setTransform","getTransform","transformElem","marginW","marginH","diffW","diffH","_checkDims","$zoomRange","isPanning","_transition","focal","clientV","surfaceM","offsetM","surfaceV","scaleBy","noSetRange","_setOptions","backface-visibility","transform-origin","str_start","str_click","$reset","_startMove","$zoomIn","$zoomOut","startTransform","_getDistance","touch1","touch2","_getMiddle","move","moveEvent","endEvent","startDistance","startScale","startMiddle","startPageX","startPageY","origPageX","origPageY","panOptions","middle","panzoom","mobile","T","search","changedTouches","N","hasVirtualBinding","C","L","A","E","O","M","vmouse","resetTimerDuration","D","P","H","B","moveDistanceThreshold","F","touchID","I","q","R","touchstart","S","clickDistanceThreshold","U","attrFn","scrollstart","tap","tapholdThreshold","swipe","scrollSupressionThreshold","durationThreshold","horizontalDistanceThreshold","verticalDistanceThreshold","origin","handleSwipe","scrollstop","taphold","swipeleft","swiperight","querySelector","ourObserver","MutationObserver","childList","subtree","fancybox","getInstance","items","closeExisting","loop","gutter","preventCaptionOverlap","arrows","infobar","smallBtn","toolbar","buttons","idleTime","protect","preload","tpl","scrolling","video","autoStart","defaultType","animationEffect","animationDuration","zoomOpacity","transitionEffect","transitionDuration","slideClass","baseClass","baseTpl","spinnerTpl","errorTpl","btnTpl","download","arrowLeft","arrowRight","parentEl","hideScrollbar","autoFocus","backFocus","trapFocus","fullScreen","vertical","momentum","slideShow","thumbs","hideOnClose","axis","wheel","onInit","beforeLoad","afterLoad","afterShow","beforeClose","afterClose","onActivate","onDeactivate","clickContent","clickSlide","clickOutside","dblclickContent","dblclickSlide","dblclickOutside","i18n","CLOSE","NEXT","PREV","ERROR","PLAY_START","PLAY_STOP","FULL_SCREEN","THUMBS","DOWNLOAD","SHARE","ZOOM","de","webkitRequestAnimationFrame","mozRequestAnimationFrame","oRequestAnimationFrame","cancelAnimationFrame","webkitCancelAnimationFrame","mozCancelAnimationFrame","oCancelAnimationFrame","elementFromPoint","isMobile","currIndex","prevIndex","prevPos","currPos","firstRun","slides","addContent","translate","$refs","jumpTo","$orig","$thumb","thumb","updateControls","Thumbs","create","addEvents","removeEvents","isScaledDown","requestId","update","stage","shiftKey","idleSecondsCounter","isIdle","showControls","idleInterval","isDragging","hideControls","isClosing","isAnimating","createSlide","forcedDuration","isMoved","$slide","loadSlide","getTranslate","isComplete","setTranslate","isLoaded","revealContent","updateSlide","scaleToActual","$content","hasError","updateCursor","scaleX","scaleY","SlideShow","scaleToFit","getFitPos","ratio","adjustCaption","adjustLayout","navigation","centerSlide","Guestures","canPan","isZoomable","setImage","setIframe","videoFormat","setError","showLoading","$image","checkSrcset","$ghost","setBigImage","postfix","resolveImageSlideSize","naturalWidth","naturalHeight","hideLoading","$iframe","max-width","isRevealed","$placeholder","$smallBtn","$spinner","$caption","disableLayoutFix","getThumbPos","Document","exitFullscreen","webkitExitFullscreen","cleanUp","hasHiddenControls","toggleControls","use3d","documentMode","youtube","autoplay","autohide","fs","rel","hd","wmode","enablejsapi","html5","paramPlace","vimeo","show_title","show_byline","show_portrait","fullscreen","instagram","gmap_place","gmap_search","origSrc","contentSource","loading","loaded","onYouTubeIframeAPIReady","YT","Player","onStateChange","Vimeo","afterShow.fb","scrollWidth","$bg","bg","$stage","$container","tapped","ontouchstart","realPoints","startPoints","canTap","isSwiping","isZooming","isScrolling","distanceX","distanceY","distance","canvasWidth","canvasHeight","contentLastPos","contentStartPos","sliderStartPos","stagePos","onscroll","isScrollable","centerPointStartX","centerPointStartY","percentageOfImageAtPinchPointX","percentageOfImageAtPinchPointY","startDistanceBetweenFingers","ontouchmove","ontouchend","newPoints","onSwipe","onPan","onZoom","sliderLastPos","atan2","transition-duration","limitMovement","limitPosition","newWidth","newHeight","endPoints","dMs","onTap","velocityX","velocityY","endPanning","endZooming","endSwiping","tapX","tapY","$button","$progress","inner","onInit.fb","beforeShow.fb","afterKeydown.fb","beforeClose.fb onDeactivate.fb","request","requestFullscreen","ALLOW_KEYBOARD_INPUT","exit","isFullscreen","Boolean","fullscreenElement","fullscreenEnabled","fullscreenchange","FullScreen","beforeClose.fb","$grid","$list","&","<","\"","'","/","`","=","share","currentHash","gallery","escapeSelector","charCodeAt","origHash","hashTimer","history","pathname","hasCreatedHistory","back","replaceState","deltaY","deltaX","wheelDelta","detail","Viewer","G","J","from","Q","assign","K","Z","dispatchEvent","CustomEvent","bubbles","cancelable","createEvent","initEvent","initCustomEvent","fireEvent","Y","X","rotate","W","endX","endY","startX","startY","V","navbar","movable","zoomable","rotatable","scalable","minHeight","zoomRatio","minZoomRatio","maxZoomRatio","zIndexInline","shown","view","viewed","Symbol","iterator","ee","render","initContainer","initViewer","initList","renderViewer","containerData","parentData","fulled","viewerData","viewer","loadImage","renderList","resetList","initImage","footer","aspectRatio","initialImageData","renderImage","WebkitTransform","msTransform","resetImage","te","ne","ae","onClick","onWheel","onDragstart","dragstart","canvas","onPointerdown","pointerdown","onPointermove","pointermove","onPointerup","pointerup","onKeydown","oe","played","full","play","originalImage","player","wheeling","pointers","pointerId","pointerType","isSwitchable","le","build","zoomTo","moveTo","rotateTo","playing","tooltipBox","tooltiping","fading","isImg","onStart","unbuild","se","mozFullScreenElement","webkitFullscreenElement","msFullscreenElement","msRequestFullscreen","mozRequestFullScreen","webkitRequestFullscreen","Element","msExitFullscreen","mozCancelFullScreen","ce","enumerable","configurable","writable","defineProperty","ue","ve","autoWidth","slideMove","slideMargin","useCSS","cssEasing","auto","pauseOnHover","slideEndAnimation","keyPress","prevHtml","nextHtml","rtl","adaptiveHeight","verticalHeight","vThumbWidth","thumbItem","pager","galleryMargin","thumbMargin","currentPagerPosition","enableTouch","enableDrag","freeMove","swipeThreshold","responsive","onBeforeStart","onSliderLoad","onBeforeSlide","scene","onAfterSlide","onBeforeNextSlide","onBeforePrevSlide","lightSlider","settingsTemp","$children","windowW","breakpoint","resposiveObj","elSize","property","slideValue","pagerWidth","slideWidth","thumbWidth","isTouch","chbreakpoint","calSW","calWidth","cln","ln","doCss","goToPrevSlide","goToNextSlide","initialStyle","tWr","tI","tItem","sSW","calL","setHeight","createPager","pagers","minPgr","$cSouter","$pager","slideThumb","cl","gMargin","ob","fade","setCss","tH","tP","tHT","padding-bottom","sc","nl","-webkit-transform","calSlide","resetSlide","_sV","thumbSlide","touchMove","endCoords","startCoords","swipeVal","swipeValT","touchEnd","mxVal","_next","gC","ad","tW","isDraging","targetTouches","xMovement","yMovement","nextI","_slideValue","_touch","getCurrentSlideCount","getTotalSlideCount","goToSlide","precision","elapse","instanceNumber","setFinalDate","resume","countdownInstance","finalDate","totalSecsLeft","elapsed","seconds","minutes","hours","daysToWeek","daysToMonth","weeks","weeksToMonth","months","totalDays","totalHours","totalMinutes","totalSeconds","strftime","countdown","serviceId","$zopim","livechat","setOnStatus","travelScroll","st","lastScrollTop","updateFavoriteHeart","showMarkers","mgr","hideMarkers","getHotelBookingInfo","currentUrl","hotelElement","hotelCode","hotelName","season","adults","agesFields","ages","is_last_item","titleHide","titleShow","chatUrl","affixHeight","viewportWidth","tooltipTrigger","mainContainerInner","searchAlertHeight","currentId","idNumber","bookLink","nr","linket","bruger_bredde","screen","bruger_hojde","mvenstre","mtop","bredde","hojde","book","bookBtn","shareLink","hotelElem","favoriteElem","favoriteLabel","textAdded","textNotAdded","cookieValue","windowTimer","imgSrc","imgHover","deviceAgent","DocumentTouch","isTouchDevice","stateOpen","basicElement","mouseover","hotelId","$section","zoomOut","kabinelift","slaebelift","stolelift","skole","udlejning","langrend","hotels","currenthotel","otherhotels","hashLocation","initialize","modalId","modalContent","modalNr","minErr","ErrorConstructor","paramPrefix","SKIP_INDEXES","templateArgs","shiftedIndex","toDebugString","isArrayLike","NODE_TYPE_ELEMENT","isString","isPrimitive","isBlankObject","forEachSorted","reverseParams","iteratorFn","nextUid","uid","setHashKey","$$hashKey","baseExtend","dst","objs","ii","isObject","jj","isDate","valueOf","inherit","identity","valueFn","hasCustomToString","isUndefined","isDefined","getPrototypeOf","isNumber","isRegExp","isScope","$evalAsync","$watch","isFile","isFormData","isBlob","isBoolean","isPromiseLike","isTypedArray","TYPED_ARRAY_REGEXP","isElement","makeMap","nodeName_","lowercase","arrayRemove","array","destination","stackSource","stackDest","ngMinErr","emptyObject","lastIndex","shallowCopy","equals","o1","o2","keySet","t1","t2","createMap","array1","array2","sliceArgs","startIndex","curryArgs","toJsonReplacer","toJson","pretty","fromJson","timezoneToOffset","timezone","fallback","requestedTimezoneOffset","addDateMinutes","getMinutes","convertTimezoneToLocal","timezoneOffset","getTimezoneOffset","startingTag","jqLite","elemHtml","NODE_TYPE_TEXT","tryDecodeURIComponent","parseKeyValue","keyValue","key_value","toKeyValue","arrayValue","encodeUriQuery","encodeUriSegment","pctEncodeSpaces","getNgAttribute","ngAttr","ngAttrPrefixes","angularInit","bootstrap","appElement","strictDi","modules","defaultConfig","doBootstrap","injector","$provide","debugInfoEnabled","$compileProvider","createInjector","invoke","scope","$apply","NG_ENABLE_DEBUG_INFO","NG_DEFER_BOOTSTRAP","angular","resumeBootstrap","extraModules","resumeDeferredBootstrap","reloadWithDebugInfo","reload","getTestability","rootElement","snake_case","separator","SNAKE_CASE_REGEXP","bindJQuery","originalCleanData","bindJQueryFired","jqName","jq","JQLitePrototype","isolateScope","controller","inheritedData","skipDestroyOnNextJQueryCleanData","$destroy","JQLite","assertArg","reason","assertArgFn","acceptArrayAnnotation","assertNotHasOwnProperty","bindFnToScope","lastInstance","getBlockNodes","endNode","blockNodes","setupModuleLoader","ensure","$injectorMinErr","$$minErr","requires","configFn","invokeLater","provider","insertMethod","invokeQueue","moduleInstance","invokeLaterAndSetModuleName","recipeName","factoryFunction","$$moduleName","configBlocks","runBlocks","_invokeQueue","_configBlocks","_runBlocks","service","constant","decorator","directive","block","serializeObject","seen","publishExternalAPI","uppercase","callbacks","counter","$$csp","csp","angularModule","$LocaleProvider","$$sanitizeUri","$$SanitizeUriProvider","$CompileProvider","htmlAnchorDirective","inputDirective","textarea","formDirective","scriptDirective","selectDirective","styleDirective","optionDirective","ngBind","ngBindDirective","ngBindHtml","ngBindHtmlDirective","ngBindTemplate","ngBindTemplateDirective","ngClass","ngClassDirective","ngClassEven","ngClassEvenDirective","ngClassOdd","ngClassOddDirective","ngCloak","ngCloakDirective","ngController","ngControllerDirective","ngForm","ngFormDirective","ngHide","ngHideDirective","ngIf","ngIfDirective","ngInclude","ngIncludeDirective","ngInit","ngInitDirective","ngNonBindable","ngNonBindableDirective","ngPluralize","ngPluralizeDirective","ngRepeat","ngRepeatDirective","ngShow","ngShowDirective","ngStyle","ngStyleDirective","ngSwitch","ngSwitchDirective","ngSwitchWhen","ngSwitchWhenDirective","ngSwitchDefault","ngSwitchDefaultDirective","ngOptions","ngOptionsDirective","ngTransclude","ngTranscludeDirective","ngModel","ngModelDirective","ngList","ngListDirective","ngChange","ngChangeDirective","patternDirective","ngPattern","requiredDirective","ngRequired","minlengthDirective","ngMinlength","maxlengthDirective","ngMaxlength","ngValue","ngValueDirective","ngModelOptions","ngModelOptionsDirective","ngIncludeFillContentDirective","ngAttributeAliasDirectives","ngEventDirectives","$anchorScroll","$AnchorScrollProvider","$animate","$AnimateProvider","$$animateQueue","$$CoreAnimateQueueProvider","$$AnimateRunner","$$CoreAnimateRunnerProvider","$browser","$BrowserProvider","$cacheFactory","$CacheFactoryProvider","$controller","$ControllerProvider","$document","$DocumentProvider","$exceptionHandler","$ExceptionHandlerProvider","$filter","$FilterProvider","$interpolate","$InterpolateProvider","$interval","$IntervalProvider","$http","$HttpProvider","$httpParamSerializer","$HttpParamSerializerProvider","$httpParamSerializerJQLike","$HttpParamSerializerJQLikeProvider","$httpBackend","$HttpBackendProvider","$location","$LocationProvider","$log","$LogProvider","$parse","$ParseProvider","$rootScope","$RootScopeProvider","$q","$QProvider","$$q","$$QProvider","$sce","$SceProvider","$sceDelegate","$SceDelegateProvider","$sniffer","$SnifferProvider","$templateCache","$TemplateCacheProvider","$templateRequest","$TemplateRequestProvider","$$testability","$$TestabilityProvider","$timeout","$TimeoutProvider","$window","$WindowProvider","$$rAF","$$RAFProvider","$$asyncCallback","$$AsyncCallbackProvider","$$jqLite","$$jqLiteProvider","$$HashMap","$$HashMapProvider","$$cookieReader","$$CookieReaderProvider","jqNextId","jqId","SPECIAL_CHARS_REGEXP","MOZ_HACK_REGEXP","jqLiteIsTextNode","HTML_REGEXP","jqLiteAcceptsData","NODE_TYPE_DOCUMENT","jqLiteHasData","jqCache","ng339","jqLiteBuildFragment","TAG_NAME_REGEXP","XHTML_TAG_REGEXP","jqLiteParseHTML","SINGLE_TAG_REGEXP","argIsString","jqLiteMinErr","jqLiteAddNodes","jqLiteClone","jqLiteDealoc","onlyDescendants","jqLiteRemoveData","descendants","jqLiteOff","unsupported","expandoStore","jqLiteExpandoStore","listenerFns","removeEventListenerFn","expandoId","createIfNecessary","jqLiteData","isSimpleSetter","isSimpleGetter","massGetter","jqLiteHasClass","jqLiteRemoveClass","cssClasses","cssClass","jqLiteAddClass","existingClasses","jqLiteController","jqLiteInheritedData","NODE_TYPE_DOCUMENT_FRAGMENT","host","jqLiteEmpty","jqLiteRemove","jqLiteDocumentLoaded","getBooleanAttrName","booleanAttr","BOOLEAN_ATTR","BOOLEAN_ELEMENTS","getAliasedAttrName","ALIASED_ATTR","createEventHandler","eventHandler","eventFns","eventFnsLength","immediatePropagationStopped","originalStopImmediatePropagation","$get","hashKey","nextUidFn","objType","HashMap","isolatedUid","put","anonFn","fnText","STRIP_COMMENTS","FN_ARGS","annotate","$inject","argDecl","FN_ARG_SPLIT","FN_ARG","underscore","modulesToLoad","supportObject","provider_","providerInjector","instantiate","providerCache","providerSuffix","enforceReturnValue","instanceInjector","factoryFn","enforce","$injector","instanceCache","serviceName","decorFn","origProvider","orig$get","origInstance","$delegate","loadModules","moduleFn","runInvokeQueue","invokeArgs","loadedModules","createInternalInjector","getService","caller","INSTANTIATING","locals","$$annotate","Type","returnedValue","autoScrollingEnabled","disableAutoScrolling","getFirstAnchor","some","getYOffset","yOffset","scrollIntoView","elemTop","scrollBy","elm","newVal","oldVal","mergeClasses","extractElementNode","ELEMENT_NODE","splitClasses","klass","prepareAnimateOptions","Browser","completeOutstandingRequest","outstandingRequestCount","outstandingRequestCallbacks","getHash","cacheStateAndFireUrlChange","cacheState","fireUrlChange","getCurrentState","cachedState","lastCachedState","lastBrowserUrl","lastHistoryState","urlChangeListeners","listener","pendingDeferIds","isMock","$$completeOutstandingRequest","$$incOutstandingRequestCount","notifyWhenNoOutstandingRequests","baseElement","reloadLocation","sameState","sameBase","stripHash","urlChangeInit","onUrlChange","$$applicationDestroyed","$$checkUrlChange","baseHref","timeoutId","cancel","deferId","cacheFactory","cacheId","freshEnd","staleEnd","link","nextEntry","prevEntry","caches","stats","capacity","MAX_VALUE","lruHash","lruEntry","removeAll","$$sanitizeUriProvider","parseIsolateBindings","directiveName","isController","LOCAL_REGEXP","bindings","definition","scopeName","$compileMinErr","attrName","parseDirectiveBindings","bindToController","controllerAs","identifierForController","assertValidDirectiveName","hasDirectives","Suffix","COMMENT_DIRECTIVE_REGEXP","CLASS_DIRECTIVE_REGEXP","ALL_OR_NOTHING_ATTRS","REQUIRE_PREFIX_REGEXP","EVENT_HANDLER_ATTR_REGEXP","registerDirective","directiveFactory","directives","priority","restrict","$$bindings","$$isolateBindings","aHrefSanitizationWhitelist","regexp","imgSrcSanitizationWhitelist","safeAddClass","$compileNodes","transcludeFn","maxPriority","ignoreDirective","previousCompileContext","compositeLinkFn","compileNodes","$$addScopeClass","cloneConnectFn","parentBoundTranscludeFn","transcludeControllers","futureParentElement","$$boundTransclude","detectNamespaceForChildElements","$linkNode","wrapTemplate","controllerName","$$addScopeInfo","nodeList","$rootElement","nodeLinkFn","childLinkFn","childScope","childBoundTranscludeFn","stableNodeList","nodeLinkFnFound","nodeListLength","linkFns","$new","destroyBindings","$$destroyBindings","$on","transcludeOnThisElement","createBoundTranscludeFn","transclude","templateOnThisElement","linkFnFound","Attributes","collectDirectives","applyDirectivesToNode","$$element","terminal","previousBoundTranscludeFn","boundTranscludeFn","transcludedScope","cloneFn","controllers","containingScope","$$transcluded","attrsMap","$attr","addDirective","directiveNormalize","nName","ngAttrName","isNgAttr","nAttrs","attrStartName","attrEndName","NG_ATTR_BINDING","PREFIX_REGEXP","directiveNName","directiveIsMultiElement","addAttrInterpolateDirective","animVal","msie","addTextInterpolateDirective","NODE_TYPE_COMMENT","byPriority","groupScan","attrStart","attrEnd","groupElementsLinkFnWrapper","linkFn","compileNode","templateAttrs","jqCollection","originalReplaceDirective","preLinkFns","postLinkFns","addLinkFns","pre","post","newIsolateScopeDirective","$$isolateScope","cloneAndAnnotateFn","getControllers","elementControllers","inheritType","setupControllers","controllerDirectives","controllerKey","$scope","$attrs","$transclude","controllerInstance","hasElementTranscludeDirective","linkNode","thisLinkFn","controllersBoundTransclude","cloneAttachFn","scopeToChild","templateDirective","$$originalDirective","initializeDirectiveBindings","controllerForBindings","scopeDirective","newScopeDirective","controllerResult","invokeLinkFn","templateUrl","$template","directiveValue","terminalPriority","nonTlbTranscludeDirective","hasTranscludeDirective","hasTemplate","$compileNode","replaceDirective","childTranscludeFn","$$start","$$end","assertNoDuplicate","$$tlb","denormalizeTemplate","removeComments","templateNamespace","newTemplateAttrs","templateDirectives","unprocessedDirectives","markDirectivesAsIsolate","mergeTemplateAttributes","compileTemplateUrl","tDirectives","startAttrName","endAttrName","multiElement","dstAttr","tAttrs","afterTemplateNodeLinkFn","afterTemplateChildLinkFn","linkQueue","beforeTemplateCompileNode","origAsyncDirective","derivedSyncDirective","tempTemplateAttrs","beforeTemplateLinkNode","linkRootElement","$$destroyed","oldClasses","ignoreChildLinkFn","previousDirective","wrapModuleNameIfDefined","moduleName","interpolateFn","templateNode","templateNodeParent","hasCompileParent","$$addBindingClass","$$addBindingInfo","expressions","getTrustedContext","attrNormalizedName","HTML","RESOURCE_URL","allOrNothing","trustedContext","$$observers","newValue","$$inter","$$scope","oldValue","$updateClass","elementsToRemove","newNode","firstElementToRemove","removeCount","j2","kk","annotation","newScope","onNewScopeDestroyed","lastValue","parentGet","parentSet","$observe","parentValueWatch","parentValue","$stateful","unwatch","$watchCollection","attributesToCopy","$normalize","$addClass","classVal","$removeClass","newClasses","toAdd","tokenDifference","toRemove","writeAttr","booleanKey","aliasedKey","trimmedSrcset","srcPattern","rawUris","nbrUrisWith2parts","innerIdx","lastTuple","listeners","startSymbol","endSymbol","binding","isolated","noTemplate","str1","str2","tokens1","tokens2","outer","jqNodes","ident","CNTRL_REG","globals","register","allowGlobals","addIdentifier","expression","$controllerMinErr","controllerPrototype","exception","cause","serializeValue","toISOString","toSerialize","topLevel","defaultHttpResponseTransform","tempData","JSON_PROTECTION_PREFIX","APPLICATION_JSON","isJsonLike","jsonStart","JSON_START","JSON_ENDS","parseHeaders","fillInParsed","line","headerVal","headerKey","headersGetter","headersObj","transformData","transformResponse","transformRequest","common","Accept","CONTENT_TYPE_APPLICATION_JSON","patch","xsrfCookieName","xsrfHeaderName","paramSerializer","useApplyAsync","interceptorFactories","interceptors","requestConfig","resp","executeHeaderFns","headerContent","processedHeaders","headerFn","mergeHeaders","defHeaderName","lowercaseDefHeaderName","reqHeaderName","defHeaders","reqHeaders","defaultHeadersIteration","serverRequest","reqData","withCredentials","sendReq","chain","reversedInterceptors","interceptor","requestError","responseError","thenFn","rejectFn","createShortMethods","createShortMethodsWithData","headersString","resolveHttpPromise","resolvePromise","$applyAsync","$$phase","resolvePromiseWithResult","removePendingReq","cachedResp","buildUrl","defaultCache","xsrfValue","urlIsSameOrigin","responseType","serializedParams","interceptorFactory","createXhr","createHttpBackend","$browserDefer","rawDocument","jsonpReq","callbackId","addEventListenerFn","timeoutRequest","jsonpDone","completeRequest","urlResolve","protocol","onabort","ch","unescapeText","escapedStartRegexp","escapedEndRegexp","mustHaveExpression","parseStringifyInterceptor","getValue","$interpolateMinErr","interr","endIndex","exp","parseFns","textLength","expressionPositions","startSymbolLength","endSymbolLength","throwNoconcat","compute","getTrusted","$$watchDelegate","$watchGroup","oldValues","currValue","invokeApply","hasParams","iteration","skipApply","$$intervalId","intervals","NUMBER_FORMATS","DECIMAL_SEP","GROUP_SEP","PATTERNS","minInt","minFrac","maxFrac","posPre","posSuf","negPre","negSuf","gSize","lgSize","CURRENCY_SYM","DATETIME_FORMATS","MONTH","SHORTMONTH","DAY","SHORTDAY","AMPMS","medium","short","fullDate","longDate","mediumDate","shortDate","mediumTime","shortTime","ERANAMES","ERAS","pluralCat","encodePath","segments","parseAbsoluteUrl","absoluteUrl","locationObj","parsedUrl","$$protocol","$$host","$$port","DEFAULT_PORTS","parseAppUrl","relativeUrl","prefixed","$$path","$$search","$$hash","beginsWith","begin","whole","trimEmptyHash","stripFile","serverBase","LocationHtml5Url","appBase","basePrefix","$$html5","appBaseNoFile","$$parse","pathUrl","$locationMinErr","$$compose","$$url","$$absUrl","$$parseLinkUrl","relHref","appUrl","prevAppUrl","rewrittenUrl","LocationHashbangUrl","hashPrefix","removeWindowsDriveName","firstPathSegmentMatch","windowsFilePathExp","withoutHashUrl","withoutBaseUrl","LocationHashbangInHtml5Url","locationGetter","locationGetterSetter","preprocess","html5Mode","requireBase","rewriteLinks","setBrowserUrlWithFallback","oldUrl","oldState","$$state","afterLocationChange","$broadcast","absUrl","LocationMode","initialUrl","IGNORE_URI_REGEXP","absHref","newUrl","newState","$digest","currentReplace","$$replace","urlOrStateChanged","debugEnabled","formatError","sourceURL","consoleLog","logFn","hasApply","arg1","arg2","ensureSafeMemberName","fullExpression","$parseMinErr","ensureSafeObject","ensureSafeFunction","CALL","APPLY","BIND","ifDefined","plusFn","isStateless","filterName","findConstantAndWatchExpressions","ast","allConstants","argsToWatch","AST","Program","Literal","toWatch","UnaryExpression","BinaryExpression","LogicalExpression","ConditionalExpression","alternate","consequent","Identifier","MemberExpression","CallExpression","callee","AssignmentExpression","ArrayExpression","ObjectExpression","ThisExpression","getInputs","lastExpression","isAssignable","assignableAST","NGValueParameter","isLiteral","isConstant","ASTCompiler","astBuilder","ASTInterpreter","setValue","fullExp","propertyObj","isPossiblyDangerousMemberName","getValueOf","objectValueOf","cacheDefault","cacheExpensive","expressionInputDirtyCheck","oldValueOfValue","inputsWatchDelegate","objectEquality","parsedExpression","prettyPrintExpression","lastResult","inputExpressions","inputs","oldInputValueOf","newInputValue","oldInputValueOfValues","oldInputValues","oneTimeWatchDelegate","$$postDigest","oneTimeLiteralWatchDelegate","isAllDefined","allDefined","constantWatchDelegate","addInterceptor","interceptorFn","watchDelegate","regularWatch","$parseOptions","expensiveChecks","$parseOptionsExpensive","oneTime","cacheKey","parseOptions","lexer","Lexer","parser","Parser","qFactory","nextTick","exceptionHandler","callOnce","resolveFn","Promise","simpleBind","processQueue","processScheduled","scheduleProcessQueue","promises","$qMinErr","onFulfilled","onRejected","progressBack","catch","finally","handleCallback","$$reject","$$resolve","makePromise","resolved","isResolved","callbackOutput","errback","$Q","resolver","flush","taskQueue","task","taskCount","queueFn","asyncFn","cancelLastRAF","rafFn","webkitCancelRequestAnimationFrame","rafSupported","createChildScopeClass","ChildScope","$$watchers","$$nextSibling","$$childHead","$$childTail","$$listeners","$$listenerCount","$$watchersCount","$id","$$ChildScope","TTL","$rootScopeMinErr","lastDirtyWatch","applyAsyncId","digestTtl","destroyChildScope","$event","currentScope","Scope","$$prevSibling","$root","beginPhase","phase","clearPhase","incrementWatchersCount","decrementListenerCount","initWatchVal","flushApplyAsync","applyAsyncQueue","scheduleApplyAsync","isolate","child","watchExp","watcher","watchExpressions","watchGroupAction","changeReactionScheduled","newValues","deregisterFns","shouldCall","unwatchFn","$watchCollectionInterceptor","_value","newLength","bothNaN","newItem","oldItem","internalArray","oldLength","changeDetected","internalObject","$watchCollectionAction","initRun","veryOldValue","trackVeryOldValue","changeDetector","watch","watchers","dirty","logIdx","asyncTask","ttl","watchLog","asyncQueue","$eval","traverseScopesLoop","postDigestQueue","$applyAsyncExpression","namedListeners","indexOfListener","$emit","targetScope","listenerArgs","$$asyncQueue","$$postDigestQueue","$$applyAsyncQueue","uri","isImage","normalizedVal","adjustMatcher","$sceMinErr","escapeForRegexp","adjustMatchers","adjustedMatchers","SCE_CONTEXTS","resourceUrlWhitelist","resourceUrlBlacklist","matchUrl","isResourceUrlAllowedByPolicy","allowed","generateHolderType","Base","holderType","trustedValue","$$unwrapTrustedValue","trustAs","byType","maybeTrusted","trustedValueHolderBase","htmlSanitizer","CSS","URL","JS","sce","isEnabled","parseAs","enumValue","lName","vendorPrefix","eventSupport","android","boxee","vendorRegex","bodyStyle","transitions","animations","webkitTransition","webkitAnimation","pushState","hasEvent","divElm","handleRequestFn","ignoreRequestError","handleError","totalPendingRequests","getTrustedResourceUrl","transformer","httpOptions","testability","findBindings","opt_exactMatch","dataBinding","bindingName","findModels","prefixes","attributeEquals","getLocation","setLocation","whenStable","deferreds","$$timeoutId","urlParsingNode","requestUrl","originUrl","$$CookieReader","safeDecodeURIComponent","lastCookies","lastCookieString","cookieArray","currentCookieString","currencyFilter","dateFilter","filterFilter","jsonFilter","limitToFilter","lowercaseFilter","numberFilter","orderByFilter","uppercaseFilter","comparator","predicateFn","matchAgainstAnyProp","expressionType","getTypeForFilter","createPredicateFn","shouldMatchPrimitives","actual","deepCompare","dontMatchWholeObject","actualType","expectedType","expectedVal","matchAnyProperty","actualVal","$locale","formats","amount","currencySymbol","fractionSize","groupSep","decimalSep","isNegative","isInfinity","Infinity","isFinite","numStr","formatedText","hasExponent","toFixed","fractionLen","fraction","lgroup","padNumber","neg","dateGetter","dateStrGetter","shortForm","timeZoneGetter","zone","paddedZone","getFirstThursdayOfYear","dayOfWeekOnFirst","getThursdayThisWeek","datetime","weekGetter","firstThurs","thisThurs","ampmGetter","eraGetter","longEraGetter","jsonStringToDate","R_ISO8601_STR","tzHour","tzMin","dateSetter","setUTCFullYear","setFullYear","timeSetter","setUTCHours","ms","NUMBER_STRING","DATE_FORMATS_SPLIT","dateTimezoneOffset","DATE_FORMATS","spacing","processPredicates","sortPredicate","reverseOrder","predicate","descending","objectValue","getPredicateValue","v1","v2","getComparisonObject","predicateValues","predicates","doComparison","compareValues","ngDirective","nullFormRenameControl","control","$name","FormController","parentForm","$$parentForm","nullFormCtrl","$error","$$success","$pending","$dirty","$pristine","$valid","$invalid","$submitted","$addControl","$rollbackViewValue","$commitViewValue","$$renameControl","newName","oldName","$removeControl","$setValidity","addSetValidityMethod","ctrl","unset","$setDirty","PRISTINE_CLASS","DIRTY_CLASS","$setPristine","setClass","SUBMITTED_CLASS","$setUntouched","$setSubmitted","stringBasedInputType","$formatters","$isEmpty","textInputType","baseInputType","composing","ev","ngTrim","$viewValue","$$hasNativeValidators","$setViewValue","deferListener","origValue","$render","weekParser","isoWeek","existingDate","WEEK_REGEXP","week","milliseconds","addDays","getSeconds","getMilliseconds","NaN","createDateParser","mapping","iso","ISO_DATE_REGEXP","yyyy","MM","dd","HH","mm","ss","sss","part","createDateInputType","isValidDate","parseObservedDateValue","badInputChecker","previousDate","$options","$$parserName","$parsers","parsedDate","$ngModelMinErr","ngMin","minVal","$validators","$validate","ngMax","maxVal","nativeValidation","VALIDITY_STATE_PROPERTY","typeMismatch","numberInputType","NUMBER_REGEXP","urlInputType","modelValue","viewValue","URL_REGEXP","emailInputType","EMAIL_REGEXP","radioInputType","parseConstantExpr","parseFn","checkboxInputType","trueValue","ngTrueValue","falseValue","ngFalseValue","classDirective","arrayDifference","arrayClasses","addClasses","digestClassCounts","removeClasses","classCounts","classesToUpdate","updateClasses","ngClassWatchAction","$index","old$index","mod","setValidity","validationErrorKey","createAndSet","unsetAndCleanup","cachedToggleClass","PENDING_CLASS","toggleValidationCss","isObjectEmpty","combinedState","switchValue","isValid","VALID_CLASS","INVALID_CLASS","REGEX_STRING_REGEXP","manualLowercase","manualUppercase","isActive_","name_","NODE_TYPE_ATTRIBUTE","major","minor","dot","codeName","MOUSE_EVENT_MAP","lowercasedName","getNamedItem","$dv","multiple","nodeCount","jqLiteOn","onFn","replaceNode","wrapNode","newElement","classCondition","extraParameters","dummyEvent","eventFnsCopy","handlerArgs","arg3","$animateMinErr","NG_ANIMATE_CLASSNAME","AnimateRunner","pass","postDigestElements","addRemoveClassesPostDigest","existing","pin","domOperation","$$registeredAnimations","classNameFilter","$$classNameFilter","reservedRegex","domInsert","afterElement","afterNode","previousElementSibling","runner","addclass","tempClasses","Content-Type","[","{","PATH_MATCH","http","https","ftp","locationPrototype","paramValue","Location","OPERATORS","lex","readString","peek","readNumber","isIdent","readIdent","isWhitespace","ch2","ch3","op1","op2","op3","throwError","isExpOperator","colStr","peekCh","quote","rawString","hex","rep","ExpressionStatement","Property","program","expressionStatement","expect","filterChain","assignment","ternary","logicalOR","consume","logicalAND","equality","relational","additive","multiplicative","unary","primary","arrayDeclaration","constants","parseArguments","baseExpression","peekToken","kind","e1","e2","e3","e4","peekAhead","true","false","null","nextId","vars","own","assignable","computing","recurse","generateFunction","fnKey","intoId","return_","watchId","fnString","USE","STRICT","filterPrefix","watchFns","varsPrefix","section","nameId","recursionFn","skipWatchIdCheck","if_","lazyAssign","computedMember","lazyRecurse","plus","getHasOwnProperty","nonComputedMember","addEnsureSafeObject","notNull","addEnsureSafeMemberName","addEnsureSafeFunction","member","stringEscapeRegex","stringEscapeFn","skip","rhs","lhs","unary+","unary-","unary!","binary+","binary-","binary*","binary/","binary%","binary===","binary!==","binary==","binary!=","binary<","binary>","binary<=","binary>=","binary&&","binary||","ternary?:","astCompiler","yy","MMMM","MMM","hh","EEEE","EEE","ww","GG","GGG","GGGG","xlinkHref","defaultLinkFn","normalized","htmlAttr","formDirectiveFactory","isNgForm","formElement","nameAttr","handleFormSubmission","parentFormCtrl","DATE_REGEXP","DATETIMELOCAL_REGEXP","MONTH_REGEXP","TIME_REGEXP","inputType","datetime-local","ctrls","CONSTANT_VALUE_REGEXP","tplAttr","$compile","templateElement","tElement","ngBindHtmlGetter","ngBindHtmlWatch","getTrustedHtml","$viewChangeListeners","forceAsyncEvents","previousElements","srcExp","onloadExp","autoScrollExp","autoscroll","previousElement","currentElement","changeCounter","cleanupLastIncludeContent","afterAnimation","thisChangeId","trimValues","UNTOUCHED_CLASS","TOUCHED_CLASS","NgModelController","$modelValue","$$rawModelValue","$asyncValidators","$untouched","$touched","parserValid","parsedNgModel","parsedNgModelAssign","ngModelGet","ngModelSet","pendingDebounce","$$setOptions","getterSetter","invokeModelGetter","invokeModelSetter","$$$p","currentValidationRunId","$setTouched","$$lastCommittedViewValue","prevValid","prevModelValue","allowInvalid","$$runValidators","allValid","$$writeModelToScope","doneCallback","processParseErrors","errorKey","processSyncValidators","syncValidatorsValid","processAsyncValidators","validatorPromises","validationDone","localValidationRunId","$$parseAndValidate","writeToModelIfNeeded","updateOnDefault","$$debounceViewValueCommit","debounceDelay","formatters","modelCtrl","formCtrl","updateOn","DEFAULT_REGEXP","ngOptionsMinErr","NG_OPTIONS_REGEXP","parseOptionsExpression","optionsExp","selectElement","Option","selectValue","label","getOptionValuesKeys","optionValues","optionValuesKeys","keyName","itemKey","valueName","selectAs","trackBy","selectAsFn","viewValueFn","trackByFn","getTrackByValueFn","getTrackByValue","getLocals","displayFn","groupByFn","disableWhenFn","valuesFn","getWatchables","watchedArray","optionValuesLength","disableWhen","optionItems","selectValueMap","optionItem","getOptionFromViewValue","getViewValueFromOption","optionTemplate","optGroupTemplate","updateOptionElement","addOrReuseElement","removeExcessElements","skipEmptyAndUnknownOptions","emptyOption_","emptyOption","unknownOption_","unknownOption","updateOptions","selectCtrl","readValue","groupMap","providedEmptyOption","groupElement","optionElement","currentOptionElement","ngModelCtrl","nextValue","renderEmptyOption","removeEmptyOption","renderUnknownOption","removeUnknownOption","writeValue","selectedValues","selections","selectedOption","BRACE","IS_WHEN","updateElementText","newText","lastCount","numberExp","whenExp","whens","whensExpFns","braceReplacement","watchRemover","attributeName","tmpMatch","whenKey","countIsNaN","whenExpFn","NG_REMOVED","ngRepeatMinErr","updateScope","valueIdentifier","keyIdentifier","arrayLength","$first","$last","$middle","$odd","$even","getBlockStart","getBlockEnd","ngRepeatEndComment","aliasAs","trackByExp","trackByExpGetter","trackByIdExpFn","trackByIdArrayFn","trackByIdObjFn","hashFnLocals","lastBlockMap","nextNode","collectionLength","trackById","trackByIdFn","collectionKeys","nextBlockOrder","previousNode","nextBlockMap","blockKey","NG_HIDE_CLASS","NG_HIDE_IN_PROGRESS_CLASS","newStyles","oldStyles","cases","ngSwitchController","watchExpr","selectedTranscludes","selectedElements","previousLeaveAnimations","selectedScopes","spliceFactory","selectedTransclude","caseElement","selectedScope","noopNgModelController","SelectController","optionsMap","unknownVal","hasOption","addOption","removeOption","lastView","lastViewRef","chromeHack","selectCtrlName","patternExp","makeStateful","STORAGE_KEY","loadScript","errorCallback","nodeToAppend","removed","loadLocale","localeUrl","localeId","localeCache","overrideValues","oldObject","newObject","activeLocale","promiseCache","cachedLocale","storage","storagePut","storageKey","localInjector","externalLocale","defaultLocale","localeLocationPattern","storageFactory","storageGet","extraProperties","appendScriptTo","nodeElement","useStorage","storageName","useCookieStorage","addLocalePatternValue","interpolate","locale","tmhDynamicLocaleCache","loadLocaleFn","baseProperties","angularVersion","localeLocation","initialLocale","$$CookieWriter","buildCookieString","cookiePath","cookieLength","calcOptions","$$cookieWriter","getObject","putObject","$cookies","uiDateFormatConfig","dateToString","formatException","stringToDate","valueToParse","isoDate","uiDateConfig","uiDateConverter","uiDate","initDateWidget","setVal","preserve","toDateString","showing","_onSelect","picker","_beforeShow","_onClose","uiDateValidator","uiDateFormat","mapValues","allSettled","promiseOrValue","mapSettled","isNull","objectContains","partial","hasApproxPattern","word","getFirstMatches","rest","convertToDecimal","decimal","deepKeys","isGreaterThanFilter","isGreaterThanOrEqualToFilter","isLessThanFilter","isLessThanOrEqualToFilter","isEqualToFilter","isNotEqualToFilter","isIdenticalToFilter","isNotIdenticalToFilter","containsFilter","flatten","uniqFilter","uniqueItems","strRepeat","sep","ucfirstFilter","isGreaterThan","isGreaterThanOrEqualTo",">=","isLessThan","isLessThanOrEqualTo","<=","isEqualTo","==","isNotEqualTo","!=","isIdenticalTo","===","isNotIdenticalTo","!==","filterWatcher","fillVal","fill","_chunkBy","isMemoized","joined","every","strict","propList","shallow","csensitive","sensitive","_hasApproximateKey","_groupBy","delimiter","reversed","total","cb","nest","searchField","addKey","$key","uniq","col1","col2","dElm","compared","bytes","radians","degrees","indexByMax","mappedArray","indexByMin","divided","divider","radix","RANGE","initial","curr","ends","removeDiacritics","diacriticsMap","defaultDiacriticsRemovalap","letters","reg","times","sub","escapeRegExp","_regexp","_matches","_splitted","_temp","ucfirst","titleize","encodeURI","getHashKey","fName","replacerFactory","removeCache","$$cache","cleanStateless","$$timeout","$$isMemoized","$$memoize","sortByGroup","unknownGroup","resultArray","$group","setElementIsolateScope","deepEquals","filterTarget","getClassList","hasKeyword","keyword","childElements","deepCopy","nyaBsSelect","defaultText","en-us","defaultNoneSelection","noSearchResult","numberItemSelected","selectAll","deselectAll","interfaceText","setLocalizedText","useLocale","localizedText","isMultiple","onCollectionChange","setId","nyaBsConfig","DEFAULT_NONE_SELECTION","DROPDOWN_TOGGLE","DROPDOWN_CONTAINER","SEARCH_BOX","DROPDOWN_MENU","NO_SEARCH_RESULT","ACTIONS_BOX","searchBox","actionsBox","liElement","nyaBsOptionValue","getDefaultNoneSelectionContent","titleTpl","defaultNoneSelectionTpl","dropdownToggle","dropdownContainer","dropdownMenu","liveSearch","noSearchTitle","noSearchTitleTpl","noSearchResultTpl","selectAllTpl","deselectAllTpl","disabledHandling","previousTabIndex","reset_search","nyaBsOptionNode","findFocus","findActive","setFocus","supportsSelector","sheet","cssRules","fromFirst","firstLiElement","childElement","findNextFocus","setAllOptions","liElements","wv","ngCtrl","nyaBsOption","getOptionValue","updateButtonContent","selectOption","scopeOfOption","valueExpFn","nyaBsSelectCtrl","getOptionText","filterOption","optionTitle","bsOptionElements","optionScopes","selectedTextFormat","numberItemSelectedTpl","calcMenuSize","liHeight","dropdownSize","valueExpGetter","valueExp","ngDisabled","deepWatched","valuesForSelect","modelValueChanged","outClick","searchKeyword","menuContainer","searchBoxContainer","toggleButton","BS_OPTION_REGEX","nyaBsOptionEndComment","collectionExp","groupByExpGetter","nyaBsOptionAction","groupName","lastGroup","removedClone","valueObj","valueExpLocals","deepWatch","tmhDynamicLocaleProvider","tmhDynamicLocale","addLegends","legends","$datepicker","numChildren","reauthorized","historyHotels","language","shortDateFormat","longDateFormat","datePickerLanguage","datePickerRegional","culture","getParameterByName","getDateDiff","endDate","hour","minute","dage","dato","voksne","born","alderArray","alderObj","alder","sorter","ownhotels","standard2","standard3","standard4","standard5","standards","noboard","quarterboard","halfboard","fullboard","addon","allinclusive","boards","none","quarter","half","addonboard","closeToLifts","closeToCenter","distances","lifts","center","internet","tv","bar","parking","playroom","kidactivities","pool","sauna","hottub","tanningbed","wellness","facilities","addZero","no","isGroupTravel","getFilterSorting","sorting","getLastMinuteFiltersFromQueryString","boardArr","dateArr","transportArr","destinationArr","destinations","fmt","getClosestDate","dateList","lowestDiff","returnDate","singleDate","timeDiff","setDatePicker","inputId","displayDays","firstDate","lastDate","monthSpan","setMinDate","setMaxDate","highlightTraveldays","objStartDay","intDaysCounter","intWeekDay","intTravelDays","inputFieldID","intIndex1","intIndex2","intIndex3","monthNumber","addDatePickerLegends","dateOptions","date_str","hasDate","objCurrent","dateText","anyInvalidFields","initFavorites","favoriteHotels","favoriteTab","heartElem","widgetTabsContent","favHotels","travelSearchApp","nyaBsConfigProvider","getAuthToken","settingsService","travifyApi","clientIP","authorizationToken","checkPinCode","pincode","getAuthenticationToken","req","getOrder","onlyselectedservices","getOrderByUuid","getPickupLocations","participantid","createOrder","periodId","roomString","transportId","ageString","finalizeOrder","updateParticipant","orderId","participantId","gender","age","birthdate","pickupLocationId","getCountries","updateCustomer","emailAddress","firstName","lastName","address","postalCode","city","country","phone","phoneCode","attachService","serviceGroupId","servicePriceId","startDay","detachService","getPayments","requestPayment","paymentIdentification","gateway","customer","first_name","last_name","postal_code","countryCode","country_code","phone_number","email_address","hotel_name","accomodation_code","destinationCode","destination_code","total_amount","pinCode","pin_code","authorization","returnurl","paymentmethod","subscribeNewsletter","getTicket","sendTicket","getHotel","getServiceInfo","getArticles","destinationId","departureDate","destinationid","hotelid","addDiscountCode","discountCode","trustAsHtml","getBoardValueFromKey","replaceHotelMarkingChars","travels","filterval","ownhotel","marking","fields","hotelmarking","rating","board","fieldsPass","facility","departuredate","transportinfo","translatedcode","destinationcode","travelSearchService","convertToCSV","objArray","convertObjectToCSV","replaceChars","checkDestCode","generateQueryString","queryString","csvString","setCookie","cookiename","cookieobject","cookievalue","cookieoptions","cookieObj","getCookie","checkCookie","getDestinations","getTransports","getRequestUrl","currentDomain","bookDomain","getQueryString","getNightsAndDates","transportCode","searchString","getHotels","hotelSearch","hotel","hoteller","periodid","childAges","transport_id","getLastMinuteHotels","fac","hotelCodes","authResource","authToken","forceRefresh","authCookie","setCookieData","expiredays","getCookieData","clearCookieData","isUndefinedOrNull","capitalize","maxHeight","childHeight","ngClick","travelSearchServices","errorHandler","seasonObj","alias","updateSearch","agesReminder","adultsError","childrenError","agesError","anyChildren","showAges","setTrigger","openDatePicker","updateSeason","destinationObj","hasDestination","DestinationType","DestinationCode","destid","DestinationId","contentid","countryid","currentDestId","updateDestination","standardSelectName","getDestinationLabel","DestinationName","getTransportLabel","TransportCode","TransportName","getTravelDaysLabel","travellength","daysLabel","nightsLabel","displaydays","transport_display_days","DestinationHotelCodes","soldoutwinter","DestinationSoldOutWinter","soldoutsummer","DestinationSoldOutSummer","getSoldOutHotels","searchTransportObj","hasTransport","updateTransport","searchError","allNightsAndDates","dageObj","hasDays","hasDays7","updateNights","searchObj","datoObj","searchDate","dt","updateDates","selectedNightsAndDate","transportDisplayDays","period_id","updateAdults","updateChildren","createAgesFields","remindUser","tipIsVisible","minusCount","checkAges","plusCount","hideAgeWarning","updateAges","ageIsValid","showAlert","textSelfDriveHasValue","textBusHasValue","textFlightHasValue","transportAlertInfo","transportAlertInfoShown","sc_t1AlertShownCount","sc_t2AlertShownCount","sc_t3AlertShownCount","alerts","c_t1AlertShownCount","c_t2AlertShownCount","c_t3AlertShownCount","getAlertClass","getTransportType","transportType","closeAlert","groupTravel","travelsearch","utilsService","getPersons","totalPrice","totalPersons","pricePerPerson","adult","pushToDataLayer","hotellist","dataLayer","travelCheckinDate","travelCheckoutDate","returndate","travelDays","travelContentIds","travelCity","travelCountry","travelAdults","travelChildren","travelTotalPersons","travelTransport","loadProgress","errorType","setNewDate","formattedDate","loadComplete","updateTravelDate","isDateActive","searchdate","buildQueryString","urlQueryString","initTravelDates","traveldates","ResCarouselSize","incno","sampwidth","bodyWidth","btnParentSb","itemsSplit","itemWidth","allElementsWidth","itemscount","activedate","traveldate","translateXval","ResCarousel","divStyle","xds","itemsCondition","resizeTimer","docWidth","showPriceIncludes","priceIncludeContent","priceincludes","modalBody","sortBy","sortValue","errorResponse","soldout","soldoutTravels","firstTravel","summer2021","winter2022","iscoming","travelFilters","hotelMarkings","departureduration","departuretimedeparture","arrivaltimedeparture","returnduration","departuretimereturn","arrivaltimereturn","markings","hotelmarkings","filteredTravels","filteredOutTravels","includes","persons","favCookieValue","favorites","createAgestring","updatePriceButton","totalprice","discountprice","pricebefore","offer","totalpriceString","discountpriceString","pricebeforeString","generateStructuredData","room","nameString","travel_length","travelJSON","departure_date","return_date","description","@type","addressLocality","performer","offers","rooms_description","priceCurrency","availability","validFrom","insertStructuredData","roomoptions","jsonld","previous_week","rooms","current_week","next_week","travelHotel","ecommerce","products","category","noresults","vispris","hotelTransportObj","updateTravel","room_string","discount_price","doSearch","roomsoptions","previous_week_number","previous_week_departure_date","previous_week_return_date","current_week_number","current_week_departure_date","current_week_return_date","next_week_number","next_week_departure_date","next_week_return_date","firstSelected","transport_code","departure_time_for_departure","arrival_time_for_departure","departureairportdeparture","departure_airport_for_departure","departureairportcodedeparture","departure_airport_code_for_departure","arrivalairportdeparture","arrival_airport_for_departure","arrivalairportcodedeparture","arrival_airport_code_for_departure","departure_time_for_return","arrival_time_for_return","departureairportreturn","departure_airport_for_return","departureairportcodereturn","departure_airport_code_for_return","arrivalairportreturn","arrival_airport_for_return","arrivalairportcodereturn","arrival_airport_code_for_return","age_string","roomOptions","behavior","hotelsearch","filterData","filterFields","statustext","statustextInline","openMobileFilters","openFilters","setFilterText","setFilterTextInline","resetFilters","updateFilters","filterObj","hotelService","renderStars","icon","stars","getImageUrl","imageUrl","photo","app","buildLastMinuteQueryString","getBoardDetails","vm","lastminutelist","bdt","weekno","codename","destinationname","travel","queryParams","bookingResource","cookieService","bookingNo","bookId","orderInfo","showLogin","order_status","adjustServiceData","orderTotal","participants","participant","potentialServices","services","total_price_for_participant","hasBirthdate","showParticipantBirthdateAlert","hasUniqueService","service_group_id","hasAvailableService","availableServices","firstChangableService","web_change","activeServiceGroupId","firstname","watchOrderChange","payments","loadingPayments","loadingPaymentsError","chosen","initService","serviceGroupOptions","filteredServices","included","includedServices","selectedServices","serviceIsSelected","selectedUnits","number_of_units","selectedService","service_price_id","service_price","serviceIsIncluded","serviceIsDisabled","serviceChosenChange","successOrderUpdate","participant_id","participantServices","prevService","newService","updatedService","full_name","additionalServices","found2","changedServices","ref","removeFromArray","servicesInGroup","expr1","item1","expr2","item2","allChosenServices","updateOrderTotal","selectUnit","selectService","svcAdded","additionalService","expression2","expression3","potentialService","filteredService","setStartDays","updateParticipantTotal","selectStartDay","startDayChanged","submitLogin","submitOrder","firstInvalid","loopPromises","currentPickupLocation","departure_location_id","return_location_id","pData","pickupLocation","pickup_location","deferred1","selectedStartDay","startday","deferred2","cs","prevServicePriceId","pServicesInGroup","sameService","def1","def2","submitPayment","order_payment_identification","submitCustomPayment","paymentAmount","servicesTotal","servicePrice","service_order_price","package_price","updateParticipantBirthdate","dateNotValid","dateNotAllowed","initStartDays","arrStartDays","startday_minimum","startday_maximum","startdays","currentStartDay","startday_default","printTicket","order_no","ticketMailState","newdate","changePickupLocation","pickupLocationChanged","transactionStatus","transaction","pickupLocations","orderPrefix","excludedServices","isAdult","setPickupLocation","check_in_date","check_out_date","room_description","calculateServiceGroupTotalPrice","filterParticipantService","participantService","serviceInfo","serviceinfo","usp","uspitems","serviceEditMode","departure_duration","return_duration","hotel_address","hotel_zip","zip","hotel_city","destinationcountry","image_url","photos","watchDestinationInfoChange","logout","orderUuid","deposit_amount_remaining","total_deposit_for_participant","total_paid_for_participant","booking_amount_remaining","articles"],"mappings":"AAIA,QAAAA,yBAAAC,GAKA,IAAA,mBAAAC,UAAA,mBAAAA,SAAAC,MAKAF,EAAA,CAIA,GAAAG,GAAAC,SAAAC,eAAA,gBAAAL,GAEAM,EAAAF,SAAAG,cAAA,MACAD,GAAAE,UAAA,gCACAF,EAAAG,MAAAC,MAAA,OACAJ,EAAAG,MAAAE,gBAAA,UACAL,EAAAG,MAAAG,QAAA,OACAN,EAAAG,MAAAI,OAAA,QACA,IAAAC,GAAA,EAGAX,KAGA,mBAAAY,QACAD,GAAA,+DAKAE,EAAAC,YACAH,GAAA,8EAKAE,EAAAC,YAAAD,EAAAC,UAAAC,cACAJ,GAAA,2FAGA,KAAAA,IACAR,EAAAa,UAAAL,EAAA,8MACAX,EAAAiB,aAAAd,EAAAH,EAAAkB,WAAA,OC1CA,QAAAC,gBACA,GAAAC,MAAAC,MAAAC,KAAArB,SAAAsB,iBAAA,mBACAC,KAAAH,MAAAC,KAAArB,SAAAsB,iBAAA,gBAEAE,KAAAJ,MAAAC,KAAArB,SAAAsB,iBAAA,kBACAG,KAAAL,MAAAC,KAAArB,SAAAsB,iBAAA,kBAEA,IAAA,wBAAAI,QAAA,CAEA,GAAAC,IACAC,WAAA,SAGAC,EAAA,GAAAC,sBAAA,SAAAC,EAAAC,GACAD,EAAAE,QAAA,SAAAC,GACA,GAAAA,EAAAC,eAAA,CACA,GAAAC,GAAAF,EAAAG,MACAD,GAAAE,OAAAF,EAAAG,QAAAD,OACAF,EAAAI,cAAAC,UAAAC,OAAA,QACAb,EAAAc,UAAAP,OAGAT,GAEAiB,EAAA,GAAAd,sBAAA,SAAAC,EAAAC,GACAD,EAAAE,QAAA,SAAAC,GACA,GAAAA,EAAAC,eAAA,CACA,GAAAU,GAAAX,EAAAG,MACAQ,GAAAC,IAAAD,EAAAN,QAAAO,IACAD,EAAAJ,UAAAC,OAAA,aACAE,EAAAD,UAAAE,OAGAlB,GAEAoB,EAAA,GAAAjB,sBAAA,SAAAC,EAAAC,GACAD,EAAAE,QAAA,SAAAC,GACA,GAAAA,EAAAC,eAAA,CACA,GAAAa,GAAAd,EAAAG,MACAW,GAAAjC,UAAAiC,EAAAT,QAAAU,KACAD,EAAAP,UAAAC,OAAA,cACAK,EAAAJ,UAAAK,OAGArB,EAEAR,GAAAc,QAAA,SAAAG,GACAP,EAAAqB,QAAAd,KAGAZ,EAAAS,QAAA,SAAAkB,GACAP,EAAAM,QAAAC,KAGA1B,EAAAQ,QAAA,SAAAe,GACAD,EAAAG,QAAAF,SAIA7B,GAAAc,QAAA,SAAAG,GACAA,EAAAI,cAAAC,UAAAC,OAAA,QACAN,EAAAU,IAAAV,EAAAG,QAAAD,OACAF,EAAAgB,mBAAAd,OAAAF,EAAAG,QAAAD,SAEAf,EAAAU,QAAA,SAAAkB,GACAA,EAAAL,IAAAK,EAAAZ,QAAAO,MAGAtB,EAAAS,QAAA,SAAAkB,GACAA,EAAAL,IAAAK,EAAAZ,QAAAO,MAGArB,EAAAQ,QAAA,SAAAe,GACAA,EAAAjC,UAAAiC,EAAAT,QAAAU,OC08BA,QAAAI,YACA,GAAAC,GAAA5B,OAAA6B,EAAA,OAKA,OAJA,cAAA7B,UACA6B,EAAA,SACAD,EAAAtD,SAAAwD,iBAAAxD,SAAAyD,OAEAC,MAAAJ,EAAAC,EAAA,SAAAI,OAAAL,EAAAC,EAAA,WAGA,QAAAK,qBACAhD,EAAA,sBAAAiD,KAAA,WACAC,QAAAlD,EAAAmD,OAAA,YACAnD,EAAAmD,OAAA,WAAAC,QAAApD,EAAAqD,MAAAC,KAAA,eAAA,GACAtD,EAAAqD,MAAAE,KAAA,aAAAC,YAAA,OAAAC,SAAA,SAMA,QAAAC,oBACA,GAAAC,GAAA,CACA3D,GAAA,2BAAAiD,KAAA,SAAAW,GACA,GAAAC,GAAA7D,EAAAqD,MAAAS,KAAA,QAAAC,cACAC,EAAA,aAAAhE,EAAAqD,MAAAS,KAAA,QAAAC,cACAE,EAAAjE,EAAAqD,MAAAa,KACAlE,GAAA,gBAAAiD,KAAA,WACAjD,EAAAqD,MAAAS,KAAAE,EAAAG,KAAAC,IAAApE,EAAAqD,MAAAC,KAAAO,GAAAI,GACA,IAAAI,GAAAC,SAAAtE,EAAAqD,MAAAS,KAAA,wBACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,0BACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,4BACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,yBACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,uBACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,uBACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,0BACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,2BACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,uBACAQ,SAAAtE,EAAAqD,MAAAS,KAAA,sBACA9D,GAAAqD,MAAAS,KAAA,eAAAO,GACAV,EAAAQ,KAAAI,MAAA,IAAA,IAAA,GAAAF,GACArE,EAAAqD,MAAAE,KAAA,iBAAAiB,KAAAb,EAAA,MAAAc,SAAAjB,YAAA,aAIA,IAAAkB,IAAA,EACAC,EAAA3E,EAAA,uCAAA4E,KAAA,SAAAjC,EAAAkC,GACA,MAAAH,IAAA1E,EAAA2C,GAAAW,KAAA,WAAAtD,EAAA6E,GAAAvB,KAAA,WAAA,MAEAoB,IAAAA,EACA1E,EAAA,0BAAAqC,KAAAsC,GACA3E,EAAA,gBAAAiD,KAAA,WACAjD,EAAAqD,MAAAyB,MAAA,UAIA,QAAAC,cAAAC,GACA,GAAAC,GAAAjF,EAAA,UAAAgF,GAAA1B,KAAA,QACAtD,GAAA,4BAAAqC,KAAA4C,EAGA,IAAAC,GAAAlF,EAAA,qCAAAsD,KAAA,UACAtD,GAAA,gDAAA8D,KAAA,OAAAoB,GAGA,QAAAC,eACA,GAAAnF,EAAA,cAAAoF,OAAA,CACA,GAAAC,GAAArF,EAAA,wBAAA8C,QACAwC,EAAA,GAGAC,EAAAvF,EAAA,0CAAAwF,QACAhC,YAAA,UACAiC,KAAAC,WAAA,SAAAC,QAAA,QAAAC,SAAA,YAEA5F,GAAA,wBAAA6F,OAAAN,EACA,IAAAO,GAAAP,EAAAzC,OACAgD,IAAA,IAEAA,EAAA,KAEAP,EAAAzD,SAEA9B,EAAA,uCAAA+F,QACA/F,EAAA,gDAAAiD,KAAA,SAAAW,GACA5D,EAAAqD,MAAAG,YAAA,UACA8B,GAAAtF,EAAAqD,MAAAP,SAGAwC,EAAAD,GAAAA,EAAAC,EAAAQ,KACA9F,EAAAqD,MAAAmC,QAAAQ,SAAA,uCACAhG,EAAAqD,MAAAI,SAAA,aAGA6B,EAAAD,GAAAA,EAAAC,EAAAQ,EACA9F,EAAA,kCAAAwD,YAAA,UAEAxD,EAAA,kCAAAyD,SAAA,WChnCA,QAAAwC,YACA,GAAAC,GAAA,GACAC,EAAArF,OAAAsF,SAAAC,SAAAC,QAAA,OAAA,IAAAA,QAAA,QAAA,IAAAA,QAAA,WAAA,IAAAA,QAAA,WAAA,IAAAA,QAAA,aAAA,IAAAA,QAAA,SAAA,GAEA,QAAAH,GACA,IAAA,aACAD,EAAA,GACA,MACA,KAAA,eACAA,EAAA,IACA,MACA,KAAA,eACAA,EAAA,GACA,MACA,KAAA,sBACAA,EAAA,IACA,MACA,KAAA,qBACAA,EAAA,IACA,MACA,KAAA,eACAA,EAAA,GACA,MACA,KAAA,cACAA,EAAA,IACA,MACA,KAAA,eACAA,EAAA,IACA,MACA,SACAA,EAAA,GAGA,MAAAA,IC3CA,SAAAK,EAAAC,GACA,kBAAAC,SAAAA,OAAAC,IACAD,UAAA,WACA,MAAAF,GAAAI,cAAAH,MACA,gBAAAI,SAAAC,OAAAD,QAAAJ,IAAAD,EAAAI,cAAAH,KACAnD,KAAA,WAEA,QAAAyD,GAAAC,EAAAtF,GAEA,GAAAA,EAAA,CAEA,GAAAuF,GAAA5H,SAAA6H,yBAAAC,GAAAH,EAAAI,aAAA,YAAA1F,EAAA0F,aAAA,UAEAD,IAAAH,EAAAK,aAAA,UAAAF,EAEA,KACA,GAAA1B,GAAA/D,EAAA4F,WAAA,GAAA7B,EAAAnF,WAAA+E,QACA4B,EAAAM,YAAA9B,EAAA+B,WAGAR,GAAAO,YAAAN,IAGA,QAAAQ,GAAAC,GAEAA,EAAAC,mBAAA,WAEA,GAAA,IAAAD,EAAAE,WAAA,CAEA,GAAAC,GAAAH,EAAAI,eAEAD,KAAAA,EAAAH,EAAAI,gBAAAzI,SAAA0I,eAAAC,mBAAA,IACAH,EAAA/E,KAAA1C,UAAAsH,EAAAO,aAAAP,EAAAQ,kBACAR,EAAAS,QAAAC,OAAA,GAAAC,IAAA,SAAAC,GAEA,GAAA5G,GAAAgG,EAAAQ,cAAAI,EAAAC,GAEA7G,KAAAA,EAAAgG,EAAAQ,cAAAI,EAAAC,IAAAV,EAAAvI,eAAAgJ,EAAAC,KAEAxB,EAAAuB,EAAAtB,IAAAtF,OAIAgG,EAAAC,qBAEA,QAAAf,GAAA4B,GACA,QAAAC,KAEA,IACA,GAAA5E,GAAA,EAAAA,EAAA6E,EAAArD,QAAA,CAEA,GAAAsD,GAAAD,EAAA7E,GAAAmD,EAAA2B,EAAAC,UACA,IAAA5B,GAAA,OAAA6B,KAAA7B,EAAA8B,UAAA,CACA,GAAA3G,GAAAwG,EAAAvB,aAAA,aACA,IAAA2B,KAAAC,EAAAC,UAAAD,EAAAC,SAAA9G,EAAA6E,EAAA2B,IAAA,CAEA3B,EAAAkC,YAAAP,EAEA,IAAAQ,GAAAhH,EAAAiH,MAAA,KAAAC,EAAAF,EAAAG,QAAAf,EAAAY,EAAAI,KAAA,IAEA,IAAAF,EAAAhE,OAAA,CAEA,GAAAqC,GAAA8B,EAAAH,EAEA3B,KAAAA,EAAA8B,EAAAH,GAAA,GAAAI,gBAAA/B,EAAAgC,KAAA,MAAAL,GAAA3B,EAAAiC,OACAjC,EAAAS,YACAT,EAAAS,QAAAyB,MACA5C,IAAAA,EACAuB,GAAAA,IAEAd,EAAAC,OAGAX,GAAAC,EAAA3H,SAAAC,eAAAiJ,WAKA1E,EAIAgG,EAAApB,EAAA,IAEA,GAAAM,GAAAC,EAAAc,OAAAtB,GAAAuB,EAAA,0CAAAC,EAAA,yBAAAC,EAAA,qBACAlB,GAAA,YAAAC,GAAAA,EAAAD,SAAAgB,EAAAlB,KAAAqB,UAAAC,aAAAD,UAAAC,UAAAC,MAAAH,QAAA,GAAA,QAAAC,UAAAC,UAAAC,MAAAJ,QAAA,GAAA,GAEA,IAAAR,MAAAK,EAAA9I,OAAA8I,uBAAAQ,WAAA3B,EAAArJ,SAAAiL,qBAAA,MAEAvB,IAAAN,IAEA,MAAA7B,KClFA,SAAA7F,GAEA,GAAAwJ,GAAAL,UAAAC,SAEApJ,GAAAyJ,oBAAA,OAAA3B,KAAA0B,IAAAA,EAAAH,MAAA,cAAAK,OAAAC,GAAA,IACAC,iBAAA,SAAA,WACA,GAAAC,GAEAC,EAAAxL,SAAAG,cAAA,UAEAsL,EAAA,SAAA5I,GACA,GAAA6I,GAAAC,EACAC,EAAA/I,EAAA0G,UAEA,aAAAqC,EAAAnC,SAAAoC,eACAH,EAAAF,EAAAvD,YAEA2D,EAAA5K,aAAA0K,EAAAE,EAAAE,mBACAd,WAAA,WACAY,EAAA/B,YAAA6B,QAEA7I,EAAAkJ,aAAAlJ,EAAAmJ,YAAAnJ,EAAAkJ,eACAlJ,EAAAkJ,YAAAlJ,EAAAmJ,YACAL,EAAA9I,EAAA8I,MACA9I,EAAA8I,OAAA,SACAX,WAAA,WACAnI,EAAA8I,MAAAA,MAKAM,EAAA,WACA,GAAAC,GACAC,EAAAnM,SAAAsB,iBAAA,oCACA,KAAA4K,EAAA,EAAAA,EAAAC,EAAAnG,OAAAkG,IACAT,EAAAU,EAAAD,KAGAE,EAAA,WACAC,aAAAd,GACAA,EAAAP,WAAAiB,EAAA,KAEAK,EAAA5K,EAAA6K,YAAAA,WAAA,4BACAC,EAAA,WACAJ,IAEAE,GAAAA,EAAAG,aACAH,EAAAG,YAAAL,GAYA,OARAZ,GAAAlJ,OAAA,6EAEA,YAAAkH,KAAAxJ,SAAAuI,YAAA,IACAiE,IAEAxM,SAAAsL,iBAAA,mBAAAkB,GAGAJ,OAGA1K,QAQA,SAAAA,EAAA1B,EAAA8D,GAEA,YA8FA,SAAA4I,GAAAC,GACA,MAAA,MAAAA,GACA,OAAAA,GACA,OAAAA,GACA,OAAAA,GACA,OAAAA,EAoIA,QAAAC,GAAAC,EAAAC,GAGA,GAAA3J,GAAA,GAAAzB,GAAAqL,KAUA,OATA5J,GAAA6J,QAAA,WACAC,EAAAJ,IAAA,EACAK,MAEA/J,EAAAgK,OAAA,WACAF,EAAAJ,GAAA,IAAA1J,EAAAO,MACAwJ,MAEA/J,EAAAL,IAAAgK,EACA,UASA,QAAAM,KAEAC,GAAA,EACAC,EAAA5L,EAAA6L,iBACAC,KACAC,KAEAC,EAAAJ,IAAAA,GAAA,EAEAK,EAAAjK,MAAAqB,KAAA6I,IAAAlM,EAAAmM,YAAA,EAAAC,EAAAC,aACAJ,EAAAhK,OAAAoB,KAAA6I,IAAAlM,EAAAsM,aAAA,EAAAF,EAAAG,cAEAN,EAAAO,GAAAP,EAAAjK,MAAA,IACAiK,EAAAQ,GAAAR,EAAAhK,OAAA,IAEAyK,GAAAT,EAAAhK,OAAAgK,EAAAjK,MAAA4J,GAAApD,KAAA,KAEAyD,EAAAU,GAAAX,EAAAY,aACAX,EAAAY,IAAAZ,EAAAU,GAGA,QAAAG,GAAAC,EAAAC,EAAAC,EAAAC,GACA,GAAAC,GAAAC,EAAAC,EAAAC,CAwBA,OArBA,aAAAC,EAAAC,UACAT,EAAA,IACAO,EAAAL,EAAA,GAEAG,EAAAJ,EAAAC,EACAE,EAAA9J,KAAAoK,IAAAV,EAAA,GAAA,KAEAM,EAAAD,EAAAD,EAEAD,IACAG,GAAA,GAAAF,GAGAG,EAAAP,EAAAM,GAGAC,EAAAL,EAAA,EACA5J,KAAAqK,KAAAX,EAAAC,GACAD,EAGAO,EAAAL,EAGA,QAAAU,GAAAxM,GACA,GAAAyM,GACAC,EAAA7B,EAAA8B,OAAA3M,GACA4M,GAAA,CACA,aAAAF,IACAE,EAAArB,EACAmB,IACAD,EAAA5B,EAAAgC,OAAAH,GACA7B,EAAAiC,kBAAAL,EAAAzM,KAGAA,EAAA6K,EAAAkC,IAAAC,OAAAJ,EAGA,QAAAK,GAAAvM,EAAAkC,GACA,MAAAlC,GAAAwM,IAAAtK,EAAAsK,IAGA,QAAAC,GAAAnN,EAAAC,EAAAmN,GACA,GAAAC,EAiBA,QAhBAD,GAAAnN,IACAmN,EAAApN,EAAA6K,EAAAkC,IAAAO,KACAF,EAAAA,GAAAA,EAAAA,EAAAjK,OAAA,IAGAkK,EAAAE,EAAAtN,EAAAmN,GAEAC,IACApN,EAAA4K,EAAA2C,QAAAvN,GACAD,EAAA6K,EAAAkC,IAAAU,OAAAxN,EACAD,EAAA6K,EAAAkC,IAAAW,OAAAL,EAEAA,EAAAH,KACAS,GAAAN,EAAAA,EAAAD,IAAAtE,QAGAuE,EAGA,QAAAE,GAAAtN,EAAAmN,GACA,GAAA/D,GAAAgE,EAAAO,CACA,IAAA3N,GAAAmN,EAGA,IAFAQ,EAAA/C,EAAAgD,SAAAT,GACAnN,EAAA4K,EAAA2C,QAAAvN,GACAoJ,EAAA,EAAAA,EAAAuE,EAAAzK,OAAAkG,IACA,GAAApJ,IAAA4K,EAAA2C,QAAAI,EAAAvE,GAAAlC,KAAA,CACAkG,EAAAO,EAAAvE,EACA,OAIA,MAAAgE,GAGA,QAAAS,GAAA/E,EAAA6E,GACA,GAAAvE,GAAA0E,EAAAlF,EAAApJ,EAKAuO,EAAAjF,EAAAX,qBAAA,SAEA,KAAAiB,EAAA,EAAA0E,EAAAC,EAAA7K,OAAAkG,EAAA0E,EAAA1E,IACAR,EAAAmF,EAAA3E,GACAR,EAAAgC,EAAAkC,KAAA,EACAtN,EAAAoJ,EAAA3D,aAAA,UAGAzF,GACAmO,EAAAlG,MACAjI,OAAAA,EACAwO,MAAApF,EAAA3D,aAAA,SACA8E,KAAAnB,EAAA3D,aAAA,QACA4D,MAAAD,EAAA3D,aAAA,WAqBA,QAAAgJ,GAAAC,EAAAf,GAEA,QAAAgB,GAAAC,GACA,GAAAC,GACApG,EAAAmG,EAAAE,KAAAJ,EAAAK,UAAAC,GACA,IAAAvG,EAGA,MAFAoG,GAAApG,EAAA,GACAuG,GAAAH,EAAAnL,OACAmL,EAyBA,QAAAI,KAGA,GAKAC,GAAAC,EAAAC,EAAAxF,EAEAyF,EAAAC,EAAAC,EAAAC,EAAAC,EAPAC,GAAA,EAMA9B,IAKA,KAAAhE,EAAA,EAAAA,EAAA+F,EAAAjM,OAAAkG,IACAyF,EAAAM,EAAA/F,GAEA0F,EAAAD,EAAAA,EAAA3L,OAAA,GACA6L,EAAAF,EAAAN,UAAA,EAAAM,EAAA3L,OAAA,GACA8L,EAAA5M,SAAA2M,EAAA,IACAE,EAAAG,WAAAL,GAIAM,EAAA3I,KAAAqI,IAAA,MAAAD,IAGAJ,GAAAC,KAAAO,GAAA,GAKA,IAAAF,EAAAE,GAAA,EAAAR,EAAAM,GAIAM,EAAA5I,KAAAqI,IAAA,MAAAD,IAIAJ,GAAAC,GAAAC,KAAAM,GAAA,GAKAD,EAAA,EAAAC,GAAA,EAAAP,EAAAM,GAIAI,EAAA3I,KAAAqI,IAAA,MAAAD,IAGAF,GAAAD,KAAAO,GAAA,GAKA,IAAAF,EAAAE,GAAA,EAAAN,EAAAI,GAGAE,GAAA,CAMAA,KACA9B,EAAAlG,IAAAA,EAEAwH,IAAAtB,EAAAsB,EAAAA,GACAC,IAAAvB,EAAAuB,EAAAA,GACAC,IAAAxB,EAAAwB,EAAAA,GACAA,GAAAD,GAAAD,IAAAtB,EAAAuB,EAAA,GACA,IAAAvB,EAAAuB,IAAAxB,EAAAoC,OAAA,GACAnC,EAAAD,IAAAA,EAEAQ,EAAAlG,KAAA2F,IAUA,QAAAoC,KAWA,IARArB,EAAAsB,GAGAC,EAAA,GAGAC,EAAA,kBAEA,CAUA,GAPA9F,EAAAqE,EAAA0B,OAAApB,GAOA,kBAAAmB,EAOA,GAAA/F,EAAAC,GACA6F,IACAP,EAAA1H,KAAAiI,GACAA,EAAA,GACAC,EAAA,wBAOA,CAAA,GAAA,MAAA9F,EAMA,MALA2E,IAAA,EACAkB,GACAP,EAAA1H,KAAAiI,OAEAjB,IAKA,IAAA,MAAA5E,EACA6F,GAAA7F,EACA8F,EAAA,gBAKA,CAAA,GAAA,KAAA9F,EAKA,MAJA6F,IACAP,EAAA1H,KAAAiI,OAEAjB,IAMAiB,IAAA7F,OAKA,IAAA,cAAA8F,EAIA,GAAA,MAAA9F,EACA6F,GAAA7F,EACA8F,EAAA,oBAKA,CAAA,GAAA,KAAA9F,EAGA,MAFAsF,GAAA1H,KAAAiI,OACAjB,IAMAiB,IAAA7F,MAIA,IAAA,qBAAA8F,EAIA,GAAA/F,EAAAC,QAGA,CAAA,GAAA,KAAAA,EAEA,WADA4E,IAMAkB,GAAA,gBACAnB,GAAA,EAMAA,GAAA,GASA,IAvOA,GACAtH,GACAiI,EACAO,EACAC,EACA9F,EALAgG,EAAA3B,EAAAhL,OASAsL,EAAA,EAGAb,OA2NA,CAIA,GAHAQ,EAAA2B,GAGAtB,GAAAqB,EACA,MAAAlC,EAKAzG,GAAAiH,EAAA4B,GAGAZ,KAKA,MAAAjI,EAAA5I,WACA4I,EAAAA,EAAA9C,QAAA4L,EAAA,IAEAvB,KAIAe,KAkCA,QAAAS,GAAAC,GA8BA,QAAAC,GAAAC,GASA,QAAAC,KACAC,IACAC,EAAA9I,KAAA6I,GACAA,EAAA,IAIA,QAAAE,KACAD,EAAA,KACAE,EAAAhJ,KAAA8I,GACAA,MAKA,IAvBA,GAAAG,GACAJ,EAAA,GACAC,KACAE,KACAE,EAAA,EACAnC,EAAA,EACAoC,GAAA,IAiBA,CAGA,GAFAF,EAAAN,EAAAR,OAAApB,GAEA,KAAAkC,EAGA,MAFAL,KACAG,IACAC,CACA,IAAAG,EAAA,CACA,GAAA,MAAAF,GAAA,MAAAN,EAAA5B,EAAA,GAAA,CACAoC,GAAA,EACApC,GAAA,EACA6B,GACA,UAEA7B,GAAA,MAPA,CAUA,GAAA5E,EAAA8G,GAAA,CAIA,GAAAN,EAAAR,OAAApB,EAAA,IAAA5E,EAAAwG,EAAAR,OAAApB,EAAA,MAAA8B,EAAA,CACA9B,GAAA,CACA,UACA,GAAA,IAAAmC,EAAA,CACAN,IACA7B,GAAA,CACA,UAGAkC,EAAA,QAEA,IAAA,MAAAA,EACAC,GAAA,MACA,IAAA,MAAAD,EACAC,GAAA,MACA,CAAA,GAAA,MAAAD,EAAA,CACAL,IACAG,IACAhC,GAAA,CACA,UACA,GAAA,MAAAkC,GAAA,MAAAN,EAAAR,OAAApB,EAAA,GAAA,CACAoC,GAAA,EACApC,GAAA,CACA,WAGA8B,GAAAI,EACAlC,GAAA,IAIA,QAAAqC,GAAAC,GACA,SAAAC,EAAArK,KAAAoK,IAAA1B,WAAA0B,IAAA,OACAE,EAAAtK,KAAAoK,KAIA,MAAAA,GAAA,OAAAA,GAAA,OAAAA,IAtGA,GAMA1H,GACA6H,EACAC,EACAC,EACAC,EACAC,EAXAN,EAAA,0GAIAC,EAAA,yCAgHA,KAJAC,EAAAd,EAAAD,GACAgB,EAAAD,EAAA/N,OAGAkG,EAAA,EAAAA,EAAA8H,EAAA9H,IAkBA,GAjBA+H,EAAAF,EAAA7H,GAeAgI,EAAAD,EAAAA,EAAAjO,OAAA,GAEA2N,EAAAO,GAAA,CAUA,GATAC,EAAAD,EACAD,EAAAG,MAQA,IAAAH,EAAAjO,OACA,MAAAmO,EAYA,IADAF,EAAAA,EAAA/J,KAAA,KACAwD,EAAA2G,aAAAJ,GAKA,MAAAE,GAKA,MAAA,QAx2BAnU,EAAAG,cAAA,UAEA,IAAAmU,GAAAC,EAAAC,EAAApG,EAEAV,KACA+G,GAAA,EACAC,EAAA,aACAvR,EAAAnD,EAAAG,cAAA,OACAwU,EAAAxR,EAAA4E,aACA6M,EAAAzR,EAAA6E,aACA6M,EAAA1R,EAAA2R,gBACAhH,EAAA9N,EAAAwD,gBACAyJ,KACAgC,GAEAC,UAAA,IAEA6F,EAAA,aACAC,EAAAD,EAAA,MAGA7J,EAAAL,UAAAC,UACAmK,EAAA,SAAAzL,KAAA0B,IAAA,OAAA1B,KAAA0B,IAAAA,EAAAH,MAAA,cAAAK,OAAAC,GAAA,GACA6J,EAAA,aACAC,EAAA,oBACAC,EAAA,sBACAC,EAAA3T,EAAA4T,eAKAC,EAAA,uJACAC,EAAA,4BACAnI,GAAA,EAEAG,KACAC,KACAH,EAAA5L,EAAA6L,iBACAI,GACA8H,GAAA,EACAC,KAAA,IAEAC,EAAA3V,EAAAG,cAAA,KAKAyV,GAAA,EAKArD,EAAA,oBACAK,EAAA,qBACAC,EAAA,qBACAC,EAAA,QACAX,EAAA,QAOAC,EAAA,oDAEAyD,EAAA,SAAAC,EAAAC,EAAAC,EAAAC,GACAH,EAAAxK,iBACAwK,EAAAxK,iBAAAyK,EAAAC,EAAAC,IAAA,GACAH,EAAAI,aACAJ,EAAAI,YAAA,KAAAH,EAAAC,IAQAG,EAAA,SAAAH,GACA,GAAAI,KACA,OAAA,UAAApF,GAIA,MAHAA,KAAAoF,KACAA,EAAApF,GAAAgF,EAAAhF,IAEAoF,EAAApF,KAuBAqF,EAAA,WAEA,GAAAC,GAAA,wBACApP,EAAA,WAEA,IADA,GAAAqP,GAAAC,UAAAhS,EAAA,EAAAiS,EAAAF,EAAA,KACA/R,IAAA+R,IACAE,EAAAA,EAAAvP,QAAAqP,EAAA/R,GAAA+R,IAAA/R,GAEA,OAAAiS,IAGAC,EAAAP,EAAA,SAAA9P,GAEA,MAAA,UAAAa,GAAAb,GAAA,IAAA1B,cAEA,WAAA,KAGA,KAAA,KAGA,oBAAA,SAGA,oBAAA,SAGA,eAAA,OAGA,2BAAA,cAEA,8CAAA,IACA,KAGA,OAAA,UAAA0B,EAAAL,GACA,GAAA2Q,EACA,MAAAtQ,IAAAmH,IAEA,GADAA,EAAAnH,IAAA,EACAL,IAAA2Q,EAAAtQ,EAAA0E,MAAAuL,IACA9I,EAAAnH,GAAAsQ,EAAA,GAAAhJ,EAAAgJ,EAAA,QAGA,KACAnJ,EAAAnH,GAAA,GAAAuQ,UAAA,IAAAF,EAAArQ,IAAAsH,GACA,MAAArK,IAIA,MAAAkK,GAAAnH,OAIAmK,GAAA,SAAAN,EAAA2G,GAOA,MANA3G,GAAAsB,GACAtB,EAAA4G,OAAApJ,EAAAqJ,eAAAF,GAAA,SACA3G,EAAAH,IAAAG,EAAAsB,EAAAtB,EAAA4G,QAEA5G,EAAAH,IAAAG,EAAAuB,EAEAvB,GAOAhD,GAAA,SAAA8J,GAEA,GAAAvC,EAAA,CAEA,GAAAwC,GAAA/K,EAAAgL,EAEAvV,EAAAqV,KAaA,IAXArV,EAAAsV,UAAA,IAAAtV,EAAAsV,SAAAE,WACA,QAAAxV,EAAAsV,SAAAxN,SAAAoC,cACAlK,EAAAsV,UAAAtV,EAAAsV,WAEAtV,EAAAyV,QAAAzV,EAAAsV,SACAtV,EAAAsV,SAAA,OAIAA,EAAAtV,EAAAsV,UAAAvJ,EAAA2J,IAAA1V,EAAAyV,SAAApX,EAAA2B,EAAA2V,YAAA3V,EAAA4V,SAAA7J,EAAA8J,IAAA9J,EAAA+J,UAEAP,EAAAD,EAAAjR,OAAA,CAMA,IAJA0H,EAAAgK,SAAA/V,GACAiU,GAAA,EAGA1J,EAAA,EAAAA,EAAAgL,EAAAhL,IACAwB,EAAAiK,QAAAV,EAAA/K,GAAAvK,EAGA+L,GAAAkK,YAAAjW,KASA2S,GAAA5S,EAAAmW,SAAAA,QAAAvD,KACA,SAAAwD,GACAD,QAAAvD,KAAAwD,IAEApD,EAGAQ,IAAA/R,KACA+R,EAAA,OAIAjI,EAAA,eAAA,EACAA,EAAA,cAAA,EACAA,EAAA,cAAA,EAmBAA,EAAA,iBAAAjN,EAAA0I,eAAAqP,WAAA,2CAAA,OAunBArK,EAAAkC,IAAA,MAAA,GAAAoI,OAAAC,WAAAC,OAAA,EAAA,GAGAxK,EAAAyK,UAAA,UAAAhV,GACAuK,EAAA0K,SAAA,SAAAjV,GACAuK,EAAA2K,aAAA3W,EAAAyJ,mBAIAuC,EAAAyK,WAAAzK,EAAA2K,aAAA3K,EAAA0K,WACA,SAAAE,GACAnV,EAAAb,OAAA,UACAgW,EAAAxV,IAAA,UACA4K,EAAAyK,UAAAhV,EAAAoV,WAAAD,EAAAC,SACA7K,EAAA2K,WAAA3K,EAAAyK,WAAAzK,EAAA2K,YACArY,EAAAG,cAAA,QAIAuN,EAAAyK,YAAAzK,EAAA0K,UAEA,WACA,GAAAI,GAAA,qFACAC,EAAA,6EACA5V,EAAA7C,EAAAG,cAAA,OACAqJ,EAAA,WACA,GAAA9F,GAAAb,EAAAa,KAEA,KAAAA,IACAgK,EAAA0K,UAAA,GAGA5D,EAAA9G,EAAAyK,YAAAzK,EAAA0K,SAEA3D,GAAA,EAEAzJ,WAAAkC,IAGArK,GAAAsK,OAAA3D,EACA3G,EAAAmK,QAAAxD,EACA3G,EAAAmF,aAAA,QAAA,OAEAnF,EAAAP,OAAAmW,EAAA,OAAAD,EAAA,MACA3V,EAAAC,IAAA2V,KAIAhE,GAAA,EAKA/G,EAAA+J,SAAA,0BACA/J,EAAA8J,IAAA9J,EAAA+J,SACA/J,EAAAuB,IAAAA,EAKAvB,EAAAJ,IAAAA,GAAA,EACAI,EAAAgL,EAAA/K,EAGAD,EAAAT,MAAAA,EAEAS,EAAAiL,QAAAjE,EAQAhH,EAAA2C,QAAA8F,EAAA,SAAArT,GAEA,MADA6S,GAAAiD,KAAA9V,EACA6S,EAAAiD,OAUAlL,EAAA2J,IAAA,SAAAD,EAAAI,GACA,MAAA,iBAAAJ,GAAAA,EAAA9V,iBAAAkW,OAQA9J,EAAA2G,aAAA,WASA,MARA3S,GAAA6K,aAAAA,WAAA,2BAAAsM,QACAnL,EAAA2G,aAAA,SAAAvD,GACA,OAAAA,GAAAvE,WAAAuE,GAAA,SAGApD,EAAA2G,aAAA3G,EAAAoL,IAGApL,EAAA2G,aAAA0E,MAAA9U,KAAAuS,YASA9I,EAAAoL,IAAA,SAAAhI,GACA,OAAAA,GAAAuF,EAAAvF,IAYApD,EAAAsL,WAAA,SAAAC,GAEA,GAAApH,GAAAwE,EAAA4C,GAAA,KAAA,CAKA,OAJApH,GAAA,IACAA,GAAA,GAGAA,GAOAnE,EAAAwL,aAAA,SAAArM,GACA,OAAA,GAAAI,EAAAJ,IAQAa,EAAAyL,UAAAhD,EAAA,SAAAiD,GACA,GAAArO,IAAAqO,GAAA,IAAArO,MAAAqK,EACA,QACAtE,MAAA/F,GAAAA,EAAA,GACA/E,OAAA+E,GAAAA,EAAA,MAIA2C,EAAAgD,SAAA,SAAAT,GAIA,MAHAA,GAAAoJ,QACApJ,EAAAoJ,MAAAtI,EAAAd,EAAA3N,OAAA2N,IAEAA,EAAAoJ,OAQA3L,EAAAY,WAAA,WACA,GAAA7K,EACA,KAAA8Q,IAAA9Q,EAAAzD,EAAAyD,MAAA,CACA,GAAA6V,GAAAtZ,EAAAG,cAAA,OACAoZ,EAAAzL,EAAAzN,MAAAmZ,QACAC,EAAAhW,EAAApD,MAAAmZ,OAEAF,GAAAjZ,MAAAmZ,QAAAjE,EAIAzH,EAAAzN,MAAAmZ,QAAAhE,EACA/R,EAAApD,MAAAmZ,QAAAhE,EAEA/R,EAAAyE,YAAAoR,GACA/E,EAAA+E,EAAAtN,YACAvI,EAAAoG,YAAAyP,GAGA/E,EAAArC,WAAAqC,EAAA,IAGAzG,EAAAzN,MAAAmZ,QAAAD,EACA9V,EAAApD,MAAAmZ,QAAAC,EAGA,MAAAlF,IAAA,IAMA7G,EAAAqJ,eAAA,SAAA2C,GAIA,KAAAA,IAAAjM,KAAAwB,EAAA0K,GAAA,CACA,GAAAC,GAAAlM,EAAAsL,WAAAjG,EAAA2G,GAEAjM,GAAAiM,GAAAE,EAAAA,EAAAjM,EAAAjK,MAGA,MAAA+J,GAAAiM,IAaAhM,EAAAgC,OAAA,SAAAO,GACA,GAAAQ,EACA,IAAAR,EAAA,CAEAQ,EAAA/C,EAAAgD,SAAAT,EAEA,KAAA,GAAA/D,GAAA,EAAA0E,EAAAH,EAAAzK,OAAAkG,EAAA0E,EAAA1E,IACAsE,GAAAC,EAAAvE,GAAA+D,EAAAtE,OAGA,MAAA8E,IAGA/C,EAAAgC,OAAAK,IAAAS,GAEA9C,EAAAiC,kBAAA,SAAAc,EAAA5N,GACA,GAAA4N,EAAAzK,OAAA,CACA,GAAAkK,GACAhE,EACA2N,EACA7T,EACA8T,EACAxJ,EACAC,EACAwJ,EACAC,EAEAC,EAAApX,EAAA6K,EAAAkC,IACAsK,EAAAxM,EAAAJ,GAwBA,IAtBAgD,EAAA2J,EAAA3J,QAAAzN,EAAAqS,GAEA3E,EAAA0J,EAAA1J,QAAAP,EAAAnN,EAAAyN,EAAAG,EAAA,GAAAR,KAGAM,GAAAA,EAAAN,MAAAQ,EAAA,GAAAR,MAIA+J,EAAA/E,IAAApS,EAAA0V,UAAAhI,EAAAR,IAAA,GAAAmK,EAEAF,IACAzJ,EAAA4J,QAAA,EAIA5J,EAAAR,KAAAmK,IACAJ,EAAAvJ,MAKAuJ,EAOA,IALArJ,EAAAjL,KAAAsK,GAEA9J,EAAAyK,EAAAzK,OACA8T,EAAArJ,EAAAzK,EAAA,GAEAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IAEA,GADAgE,EAAAO,EAAAvE,GACAgE,EAAAH,KAAAmK,EAAA,CACAL,EAAA3N,EAAA,EAQA4N,EAJArJ,EAAAoJ,KACAG,GAAA1J,IAAA5C,EAAA2C,QAAAH,EAAAlG,OACAwE,EAAAiC,EAAAoJ,GAAA9J,IAAAG,EAAAH,IAAAmK,EAAAzJ,EAAAoJ,GAAAM,QAEA1J,EAAAoJ,GAGA3J,CAEA,OAKA4J,IAEAC,EAAArM,EAAA2C,QAAAyJ,EAAA9P,KAEAiQ,EAAA3J,OAAAyJ,EACAE,EAAA1J,OAAAuJ,EAEAC,IAAAzJ,GACA5C,EAAA0M,OAAAvX,EAAAiX,GAEApM,EAAAiL,QAAA9V,MAIA6K,EAAA0M,OAAA,SAAAvX,EAAAiX,GACA,GAAAO,EACAxX,GAAAC,IAAAgX,EAAA9P,IAGA,kBAAA8P,EAAA7J,IAAApD,OACAwN,EAAAxX,EAAAxC,MAAAqD,MACAb,EAAAxC,MAAAqD,MAAAb,EAAAmJ,YAAA,EAAA,KAIAnJ,EAAAmJ,YAAA,IACAnJ,EAAAxC,MAAAqD,MAAA2W,KAKA3M,EAAA8B,OAAA,SAAA3M,GACA,GAAAqJ,GAAA+D,EAAAiJ,EACAnO,GAAA,EACAoF,EAAAtN,EAAA6K,EAAAkC,IAAAO,IAEA,KAAAjE,EAAA,EAAAA,EAAAiE,EAAAnK,SAAA+E,EAAAmB,IAGA,GAFA+D,EAAAE,EAAAjE,GAEA+D,EAAA3N,QAAAoL,EAAA2G,aAAApE,EAAAa,SAAAoI,EAAAxL,EAAAwL,aAAAjJ,EAAApD,OAAA,CAIA,YAAAqM,IACAjJ,EAAAiJ,GAGAnO,EAAAkF,CACA,OAGA,MAAAlF,IAGA2C,EAAA4M,UAAA,SAAAC,EAAAlV,EAAA1D,GACA,GAAA6Y,GAAAC,EAAAC,EAAAC,EAEAC,EAAAvV,GAAA,YAAAA,EAAAoE,SAAAoC,cACAoO,EAAAM,EAAA7M,EAAAkC,KAEAqK,EAAAnX,MAAAgB,GAAAnC,EAAAmB,OACAmX,EAAAnX,IAAA6R,EAAAtT,KAAAkZ,EAAA,OACAN,EAAAnX,IACA8R,EAAAvT,KAAAkZ,EAAAxF,EAAAkF,EAAAnX,KAEA+R,EAAAxT,KAAAkZ,EAAAxF,KAIAkF,EAAA3X,SAAAwB,GAAAnC,EAAAW,SAAAoL,EAAAyK,WAAAoC,EAAAjY,UACAkY,EAAA7F,EAAAtT,KAAAkZ,EAAA,UACAN,EAAA3X,OAAAkY,EACAG,GAAA,GAGAV,EAAA9J,QAEAyK,IACAX,EAAAY,KAAA,EACAlK,EAAAtL,EAAA4U,EAAA9J,OAGA8J,EAAA3X,QACAmY,GACAnY,OAAA2X,EAAA3X,OACAqJ,MAAAgJ,EAAAtT,KAAAkZ,EAAA,UAGAN,EAAA9J,KAAA5F,KAAAkQ,GAEAC,GAAAlG,GAAAyF,EAAAnX,MAAAqS,EAAA3L,KAAAyQ,EAAA3X,QAAA,IAGAoY,IAAAT,EAAAnX,KAAAsN,EAAA6J,EAAAnX,IAAA2X,IAAAA,EAAApI,QACAoI,EAAAnY,QAAA,KAAA2X,EAAAnX,IACA2X,EAAApB,MAAA9O,MACAP,IAAAiQ,EAAAnX,IACA2O,EAAA,EACAxB,IAAAwK,MAIAR,EAAAnX,KACAmX,EAAA9J,KAAA5F,MACAjI,OAAA2X,EAAAnX,IACA6I,MAAA,OAIAsO,EAAA1J,OAAA,KACA0J,EAAA3J,OAAAxM,EAIAmW,EAAAa,YAAAF,GAAAH,IAAA/M,EAAAyK,WAAAuC,IAAAhN,EAAA0K,UAEAuC,GAAAjN,EAAAyK,YAAA8B,EAAAa,YACAN,GACA5F,EAAAvT,KAAAkZ,EAAAvF,EAAAwF,GACAD,EAAAjY,OAAA,IAEAuS,EAAAxT,KAAAkZ,EAAAvF,IAIAiF,EAAAa,YAAAb,EAAA3X,UAAA2X,EAAAnX,KAAAyX,EAAAzX,KAAAyX,EAAAzX,MAAA4K,EAAA2C,QAAA4J,EAAAnX,QACA,OAAAmX,EAAAnX,IACAyX,EAAAzF,gBAAA,OAEAyF,EAAAzX,IAAAmX,EAAAnX,KAIAmX,EAAAc,QAAA,GAGArN,EAAAiK,QAAA,SAAA4C,EAAA5Y,GACA,GAAAsY,GACAe,EAAArZ,EAAA4V,UAAA5V,EAAA2V,UAGAiD,GAAA7M,EAAAkC,MACA2K,EAAA7M,EAAAkC,QAGAqK,EAAAM,EAAA7M,EAAAkC,KAKAoL,GAAAf,EAAApK,SAAAzB,KAIA6L,EAAAc,SAAApZ,EAAA2V,YACA5J,EAAA4M,UAAAC,EAAAA,EAAAhR,WAAA5H,GAGAsY,EAAAa,UAGAb,EAAApK,OAAAzB,EAFAiB,EAAAkL,KAMA7M,EAAAgK,SAAA,WACA9B,IAAAvI,GAAAC,IAAA5L,EAAA6L,kBACAH,KAKAM,EAAA2K,YACAnL,GAAAwH,EACAhH,EAAAiK,QAAAjD,IAIA,WACA,GAAAuG,GACAC,EAAAxZ,EAAAwU,YAAA,QAAA,WAEAiF,EAAA,WACA,GAAA5S,GAAAvI,EAAAuI,YAAA,EAEA6S,GAAApQ,WAAAmQ,EAAA,YAAA5S,EAAA,IAAA,KACAvI,EAAAyD,OACAiK,EAAA2N,WACAJ,EAAAA,GAAAC,EAAA1R,KAAAjB,GACA0S,GACA5O,aAAA+O,KAMAA,EAAApQ,WAAAmQ,EAAAnb,EAAAyD,KAAA,EAAA,IAIA6X,EAAA,SAAAC,EAAAC,GACA,GAAAC,GAAAC,EACAC,EAAA,WACA,GAAAC,GAAA,GAAA5D,MAAA0D,CAEAE,GAAAJ,EACAC,EAAAzQ,WAAA2Q,EAAAH,EAAAI,IAEAH,EAAA,KACAF,KAIA,OAAA,YACAG,EAAA,GAAA1D,MAEAyD,IACAA,EAAAzQ,WAAA2Q,EAAAH,MAIAK,EAAA/N,EAAAG,aACA7B,EAAA,WACAiB,EAAAtI,KAAA6I,IAAAlM,EAAAmM,YAAA,EAAAC,EAAAC,eAAAJ,EAAAjK,OAAAoK,EAAAG,eAAA4N,EACAA,EAAA/N,EAAAG,aACAZ,GACAK,EAAA2N,WAIAxF,GAAAnU,EAAA,SAAA4Z,EAAAlP,EAAA,KACAyJ,EAAA7V,EAAA,mBAAAmb,MAIAzN,EAAAR,YAAAA,GAEAQ,EAAA2N,SAAAnO,GACAQ,EAAAkK,YAAAlD,EAGAxH,GAAA4O,EAAApO,EAEAhM,EAAA4T,gBACA5H,GAAAA,EACAnD,KAAA,SAAAgM,GACA,GAAAwF,GAAAxF,EAAAtM,OACA,mBAAAyD,GAAAqO,GACArO,EAAAqO,GAAAhD,MAAArL,EAAA6I,IAEAtH,EAAA8M,GAAAxF,EAAA,GACAX,GACAlI,EAAA2N,UAAA9D,UAAA,MAMA,MAAAlC,GAAAA,EAAArP,QACAtE,EAAA4T,eAAA/K,KAAA8K,EAAApL,QAIAvI,GAAAwL,YAAAA,GAGA,gBAAAzF,SAAA,gBAAAA,QAAAD,QAEAC,OAAAD,QAAA0F,GACA,kBAAA7F,SAAAA,OAAAC,KAEAD,OAAA,cAAA,WAAA,MAAA6F,MAIAQ,EAAA2K,aACApL,EAAA,cAAAL,EAAA,aAAA,6IAGAlL,OAAA1B,UCz/CA,SAAAgc,EAAA5U,GAEA,gBAAAK,SAAA,gBAAAA,QAAAD,QAQAC,OAAAD,QAAAwU,EAAAhc,SACAoH,EAAA4U,GAAA,GACA,SAAAxK,GACA,IAAAA,EAAAxR,SACA,KAAA,IAAAic,OAAA,2CAEA,OAAA7U,GAAAoK,IAGApK,EAAA4U,IAIA,mBAAAta,QAAAA,OAAAuC,KAAA,SAAAvC,EAAAwa,GAqhBA,QAAAC,GAAArG,GAMA,GAAA9P,GAAA,UAAA8P,IAAAA,EAAA9P,OACA6G,EAAAlM,GAAAkM,KAAAiJ,EAEA,OAAA,aAAAjJ,IAAAlM,GAAAyb,SAAAtG,OAIA,IAAAA,EAAAqB,WAAAnR,KAIA,UAAA6G,GAAA,IAAA7G,GACA,gBAAAA,IAAAA,EAAA,GAAAA,EAAA,IAAA8P,KAmiEA,QAAAuG,GAAApF,EAAAqF,EAAAC,GACA,GAAA5b,GAAA6b,WAAAF,GACA,MAAA3b,IAAA8b,KAAAxF,EAAA,SAAAyF,EAAAxQ,GAEA,QAAAoQ,EAAAjb,KAAAqb,EAAAxQ,EAAAwQ,KAAAH,GAKA,IAAAD,EAAAnF,SACA,MAAAxW,IAAA8b,KAAAxF,EAAA,SAAAyF,GACA,MAAAA,KAAAJ,IAAAC,GAKA,IAAA,gBAAAD,GAAA,CACA,GAAAK,GAAAnT,KAAA8S,GACA,MAAA3b,IAAAic,OAAAN,EAAArF,EAAAsF,EAGAD,GAAA3b,GAAAic,OAAAN,EAAArF,GAGA,MAAAtW,IAAA8b,KAAAxF,EAAA,SAAAyF,GACA,MAAA/b,IAAAkc,QAAAH,EAAAJ,IAAA,IAAAC,IAiTA,QAAAO,GAAAC,EAAAC,GACA,EACAD,GAAAA,EAAAC,SACAD,GAAA,IAAAA,EAAA5F,SAEA,OAAA4F,GA8EA,QAAAE,GAAAtb,GACA,GAAAub,GAAAC,GAAAxb,KAIA,OAHAhB,IAAAkD,KAAAlC,EAAAoJ,MAAAqS,QAAA,SAAAtB,EAAAuB,GACAH,EAAAG,IAAA,IAEAH,EA2YA,QAAAI,KACAtd,GAAAsL,kBACAtL,GAAAud,oBAAA,mBAAAC,GAAA,GACA9b,EAAA6b,oBAAA,OAAAC,GAAA,KAGAxd,GAAAyd,YAAA,qBAAAD,GACA9b,EAAA+b,YAAA,SAAAD,IAOA,QAAAA,MAEAxd,GAAAsL,kBAAA,SAAAoS,MAAA7Q,MAAA,aAAA7M,GAAAuI,cACA+U,IACA3c,GAAAgd,SA+JA,QAAAC,GAAAlB,EAAAmB,EAAA3Z,GAGA,GAAAJ,SAAAI,GAAA,IAAAwY,EAAAvF,SAAA,CAEA,GAAA4E,GAAA,QAAA8B,EAAA3W,QAAA4W,GAAA,OAAAnZ,aAIA,IAFAT,EAAAwY,EAAA3U,aAAAgU,GAEA,gBAAA7X,GAAA,CACA,IACAA,EAAA,SAAAA,GACA,UAAAA,IACA,SAAAA,EAAA,MAEAA,EAAA,KAAAA,GAAAA,EACA6Z,GAAAvU,KAAAtF,GAAAvD,GAAAqd,UAAA9Z,GACAA,GACA,MAAAZ,IAGA3C,GAAAuD,KAAAwY,EAAAmB,EAAA3Z,OAGAA,GAAAJ,OAIA,MAAAI,GAIA,QAAA+Z,GAAAnI,GACA,GAAAiG,EACA,KAAAA,IAAAjG,GAGA,IAAA,SAAAiG,IAAApb,GAAAud,cAAApI,EAAAiG,MAGA,WAAAA,EACA,OAAA,CAIA,QAAA,EAGA,QAAAoC,GAAAzB,EAAAX,EAAA7X,EAAAka,GACA,GAAAzd,GAAA0d,WAAA3B,GAAA,CAIA,GAAA4B,GAAAC,EACAC,EAAA7d,GAAA8d,QAIAC,EAAAhC,EAAAvF,SAIAf,EAAAsI,EAAA/d,GAAAyV,MAAAsG,EAIAxT,EAAAwV,EAAAhC,EAAA8B,GAAA9B,EAAA8B,IAAAA,CAIA,IAAAtV,GAAAkN,EAAAlN,KAAAkV,GAAAhI,EAAAlN,GAAAhF,OAAAJ,SAAAI,GAAA,gBAAA6X,GAgEA,MA5DA7S,KAIAA,EADAwV,EACAhC,EAAA8B,GAAAG,EAAAvK,OAAAzT,GAAAie,OAEAJ,GAIApI,EAAAlN,KAGAkN,EAAAlN,GAAAwV,MAAAG,OAAAle,GAAA+T,OAKA,gBAAAqH,IAAA,kBAAAA,KACAqC,EACAhI,EAAAlN,GAAAvI,GAAAme,OAAA1I,EAAAlN,GAAA6S,GAEA3F,EAAAlN,GAAAhF,KAAAvD,GAAAme,OAAA1I,EAAAlN,GAAAhF,KAAA6X,IAIAwC,EAAAnI,EAAAlN,GAKAkV,IACAG,EAAAra,OACAqa,EAAAra,SAGAqa,EAAAA,EAAAra,MAGAJ,SAAAI,IACAqa,EAAA5d,GAAAoe,UAAAhD,IAAA7X,GAKA,gBAAA6X,IAGAuC,EAAAC,EAAAxC,GAGA,MAAAuC,IAGAA,EAAAC,EAAA5d,GAAAoe,UAAAhD,MAGAuC,EAAAC,EAGAD,GAGA,QAAAU,GAAAtC,EAAAX,EAAAqC,GACA,GAAAzd,GAAA0d,WAAA3B,GAAA,CAIA,GAAA6B,GAAArS,EACAwS,EAAAhC,EAAAvF,SAGAf,EAAAsI,EAAA/d,GAAAyV,MAAAsG,EACAxT,EAAAwV,EAAAhC,EAAA/b,GAAA8d,SAAA9d,GAAA8d,OAIA,IAAArI,EAAAlN,GAAA,CAIA,GAAA6S,IAEAwC,EAAAH,EAAAhI,EAAAlN,GAAAkN,EAAAlN,GAAAhF,MAEA,CAGAvD,GAAAse,QAAAlD,GAsBAA,EAAAA,EAAAmD,OAAAve,GAAAqI,IAAA+S,EAAApb,GAAAoe,YAnBAhD,IAAAwC,GACAxC,GAAAA,IAIAA,EAAApb,GAAAoe,UAAAhD,GAEAA,EADAA,IAAAwC,IACAxC,GAEAA,EAAAhS,MAAA,MAaAmC,EAAA6P,EAAA/V,MACA,MAAAkG,WACAqS,GAAAxC,EAAA7P,GAKA,IAAAkS,GAAAH,EAAAM,IAAA5d,GAAAud,cAAAK,GACA,QAMAH,UACAhI,GAAAlN,GAAAhF,KAIA+Z,EAAA7H,EAAAlN,QAMAwV,EACA/d,GAAAwe,WAAAzC,IAAA,GAIA0C,GAAAC,eAAAjJ,GAAAA,EAAA1U,aAEA0U,GAAAlN,GAIAkN,EAAAlN,GAAA,QA+YA,QAAAoW,KACA,OAAA,EAGA,QAAAC,KACA,OAAA,EAGA,QAAAC,KACA,IACA,MAAAxf,IAAAyf,cACA,MAAAC,KA8+BA,QAAAC,GAAA3f,GACA,GAAA4f,GAAAC,GAAA9V,MAAA,KACA+V,EAAA9f,EAAA6H,wBAEA,IAAAiY,EAAA3f,cACA,KAAAyf,EAAA5Z,QACA8Z,EAAA3f,cACAyf,EAAAxL,MAIA,OAAA0L,GAyCA,QAAAC,GAAA3I,EAAA4I,GACA,GAAAC,GAAAvD,EACAxQ,EAAA,EACAgU,QAAA9I,GAAAnM,uBAAAkV,GAAA/I,EAAAnM,qBAAA+U,GAAA,WACA5I,GAAA9V,mBAAA6e,GAAA/I,EAAA9V,iBAAA0e,GAAA,KACAlc,MAEA,KAAAoc,EACA,IAAAA,KAAAD,EAAA7I,EAAAnW,YAAAmW,EAAA,OAAAsF,EAAAuD,EAAA/T,IAAAA,KACA8T,GAAArf,GAAA8I,SAAAiT,EAAAsD,GACAE,EAAA3V,KAAAmS,GAEA/b,GAAAyf,MAAAF,EAAAH,EAAArD,EAAAsD,GAKA,OAAAlc,UAAAkc,GAAAA,GAAArf,GAAA8I,SAAA2N,EAAA4I,GACArf,GAAAyf,OAAAhJ,GAAA8I,GACAA,EAIA,QAAAG,GAAA3D,GACA4D,GAAA9W,KAAAkT,EAAA7P,QACA6P,EAAA6D,eAAA7D,EAAA8D,SAMA,QAAAC,GAAA/D,EAAAgE,GACA,MAAA/f,IAAA8I,SAAAiT,EAAA,UACA/b,GAAA8I,SAAA,KAAAiX,EAAAvJ,SAAAuJ,EAAAA,EAAAvY,WAAA,MAEAuU,EAAAzR,qBAAA,SAAA,IACAyR,EAAAxU,YAAAwU,EAAAiE,cAAAxgB,cAAA,UACAuc,EAIA,QAAAkE,GAAAlE,GAEA,MADAA,GAAA7P,MAAA,OAAAlM,GAAAwD,KAAAO,KAAAgY,EAAA,SAAA,IAAAA,EAAA7P,KACA6P,EAEA,QAAAmE,GAAAnE,GACA,GAAA3R,GAAA+V,GAAA1P,KAAAsL,EAAA7P,KAMA,OALA9B,GACA2R,EAAA7P,KAAA9B,EAAA,GAEA2R,EAAA5H,gBAAA,QAEA4H,EAIA,QAAAqE,GAAAd,EAAAe,GAGA,IAFA,GAAAtE,GACAxQ,EAAA,EACA,OAAAwQ,EAAAuD,EAAA/T,IAAAA,IACAvL,GAAAsgB,MAAAvE,EAAA,cAAAsE,GAAArgB,GAAAsgB,MAAAD,EAAA9U,GAAA,eAIA,QAAAgV,GAAApe,EAAAqe,GAEA,GAAA,IAAAA,EAAAhK,UAAAxW,GAAAygB,QAAAte,GAAA,CAIA,GAAA+J,GAAAX,EAAAmV,EACAC,EAAA3gB,GAAAsgB,MAAAne,GACAye,EAAA5gB,GAAAsgB,MAAAE,EAAAG,GACAE,EAAAF,EAAAE,MAEA,IAAAA,EAAA,OACAD,GAAAE,OACAF,EAAAC,SAEA,KAAA3U,IAAA2U,GACA,IAAAtV,EAAA,EAAAmV,EAAAG,EAAA3U,GAAA7G,OAAAkG,EAAAmV,EAAAnV,IACAvL,GAAA+c,MAAAgE,IAAAP,EAAAtU,EAAA2U,EAAA3U,GAAAX,IAMAqV,EAAArd,OACAqd,EAAArd,KAAAvD,GAAAme,UAAAyC,EAAArd,QAIA,QAAAyd,GAAA7e,EAAAqe,GACA,GAAA1X,GAAAnG,EAAAY,CAGA,IAAA,IAAAid,EAAAhK,SAAA,CAOA,GAHA1N,EAAA0X,EAAA1X,SAAA9E,eAGAya,GAAAwC,cAAAT,EAAAxgB,GAAA8d,SAAA,CACAva,EAAAvD,GAAAsgB,MAAAE,EAEA,KAAA7d,IAAAY,GAAAsd,OACA7gB,GAAAkhB,YAAAV,EAAA7d,EAAAY,EAAAud,OAIAN,GAAArM,gBAAAnU,GAAA8d,SAIA,WAAAhV,GAAA0X,EAAA/b,OAAAtC,EAAAsC,MACAwb,EAAAO,GAAA/b,KAAAtC,EAAAsC,KACAyb,EAAAM,IAIA,WAAA1X,GACA0X,EAAA5X,aACA4X,EAAAW,UAAAhf,EAAAgf,WAOA1C,GAAA2C,YAAAjf,EAAA/B,YAAAJ,GAAAqhB,KAAAb,EAAApgB,aACAogB,EAAApgB,UAAA+B,EAAA/B,YAGA,UAAA0I,GAAA6W,GAAA9W,KAAA1G,EAAA+J,OAKAsU,EAAAZ,eAAAY,EAAAX,QAAA1d,EAAA0d,QAIAW,EAAAtP,QAAA/O,EAAA+O,QACAsP,EAAAtP,MAAA/O,EAAA+O,QAKA,WAAApI,EACA0X,EAAAc,gBAAAd,EAAAe,SAAApf,EAAAmf,gBAIA,UAAAxY,GAAA,aAAAA,IACA0X,EAAAgB,aAAArf,EAAAqf,eAghBA,QAAAC,GAAArG,EAAAsG,GACA,GAAAhiB,GACAqc,EAAA/b,GAAA0hB,EAAAliB,cAAA4b,IAAAnV,SAAAyb,EAAA5e,MAGA8C,EAAA7E,EAAA4gB,0BAAAjiB,EAAAqB,EAAA4gB,wBAAA5F,EAAA,KAIArc,EAAAkG,QAAA5F,GAAA0F,IAAAqW,EAAA,GAAA,UAMA,OAFAA,GAAAY,SAEA/W,EAOA,QAAAgc,GAAA9Y,GACA,GAAA4Y,GAAAriB,GACAuG,EAAAic,GAAA/Y,EA0BA,OAxBAlD,KACAA,EAAA6b,EAAA3Y,EAAA4Y,GAGA,SAAA9b,GAAAA,IAGAvD,IAAAA,IAAArC,GAAA,mDAAAiG,SAAAyb,EAAA7e,iBAGA6e,GAAArf,GAAA,GAAAyf,eAAAzf,GAAA,GAAA0f,iBAAA1iB,SAGAqiB,EAAAM,QACAN,EAAAO,QAEArc,EAAA6b,EAAA3Y,EAAA4Y,GACArf,GAAAsa,UAIAkF,GAAA/Y,GAAAlD,GAGAA,EA2KA,QAAAsc,GAAAC,EAAAC,GAEA,OACAC,IAAA,WACA,GAAAC,GAAAH,GAEA,IAAA,MAAAG,EAMA,MAAAA,cAIAhf,MAAA+e,KAMA/e,KAAA+e,IAAAD,GAAAhK,MAAA9U,KAAAuS,aAgMA,QAAA0M,GAAA7iB,EAAA0b,GAGA,GAAAA,IAAA1b,GACA,MAAA0b,EAQA,KAJA,GAAAoH,GAAApH,EAAArJ,OAAA,GAAA7G,cAAAkQ,EAAA3a,MAAA,GACAgiB,EAAArH,EACA7P,EAAAmX,GAAArd,OAEAkG,KAEA,GADA6P,EAAAsH,GAAAnX,GAAAiX,EACApH,IAAA1b,GACA,MAAA0b,EAIA,OAAAqH,GAGA,QAAAE,GAAArM,EAAAsM,GAMA,IALA,GAAAhd,GAAAmW,EAAA8G,EACAC,KACAjf,EAAA,EACAwB,EAAAiR,EAAAjR,OAEAxB,EAAAwB,EAAAxB,IACAkY,EAAAzF,EAAAzS,GACAkY,EAAArc,QAIAojB,EAAAjf,GAAA7D,GAAAsgB,MAAAvE,EAAA,cACAnW,EAAAmW,EAAArc,MAAAkG,QACAgd,GAGAE,EAAAjf,IAAA,SAAA+B,IACAmW,EAAArc,MAAAkG,QAAA,IAMA,KAAAmW,EAAArc,MAAAkG,SAAAmd,GAAAhH,KACA+G,EAAAjf,GAAA7D,GAAAsgB,MAAAvE,EAAA,aAAA6F,EAAA7F,EAAAjT,cAGA+Z,EAAAE,GAAAhH,IAEAnW,GAAA,SAAAA,IAAAid,IACA7iB,GAAAsgB,MAAAvE,EAAA,aAAA8G,EAAAjd,EAAA5F,GAAA0F,IAAAqW,EAAA,aAOA,KAAAlY,EAAA,EAAAA,EAAAwB,EAAAxB,IACAkY,EAAAzF,EAAAzS,GACAkY,EAAArc,QAGAkjB,GAAA,SAAA7G,EAAArc,MAAAkG,SAAA,KAAAmW,EAAArc,MAAAkG,UACAmW,EAAArc,MAAAkG,QAAAgd,EAAAE,EAAAjf,IAAA,GAAA,QAIA,OAAAyS,GAGA,QAAA0M,GAAAjH,EAAA7K,EAAA+R,GACA,GAAA/K,GAAAgL,GAAAzS,KAAAS,EACA,OAAAgH,GAEA9T,KAAA6I,IAAA,EAAAiL,EAAA,IAAA+K,GAAA,KAAA/K,EAAA,IAAA,MACAhH,EAGA,QAAAiS,GAAApH,EAAAX,EAAAgI,EAAAC,EAAAC,GASA,IARA,GAAA/X,GAAA6X,KAAAC,EAAA,SAAA,WAEA,EAEA,UAAAjI,EAAA,EAAA,EAEAjX,EAAA,EAEAoH,EAAA,EAAAA,GAAA,EAEA,WAAA6X,IACAjf,GAAAnE,GAAA0F,IAAAqW,EAAAqH,EAAAG,GAAAhY,IAAA,EAAA+X,IAGAD,GAEA,YAAAD,IACAjf,GAAAnE,GAAA0F,IAAAqW,EAAA,UAAAwH,GAAAhY,IAAA,EAAA+X,IAIA,WAAAF,IACAjf,GAAAnE,GAAA0F,IAAAqW,EAAA,SAAAwH,GAAAhY,GAAA,SAAA,EAAA+X,MAIAnf,GAAAnE,GAAA0F,IAAAqW,EAAA,UAAAwH,GAAAhY,IAAA,EAAA+X,GAGA,YAAAF,IACAjf,GAAAnE,GAAA0F,IAAAqW,EAAA,SAAAwH,GAAAhY,GAAA,SAAA,EAAA+X,IAKA,OAAAnf,GAGA,QAAAqf,GAAAzH,EAAAX,EAAAgI,GAGA,GAAAK,IAAA,EACAtf,EAAA,UAAAiX,EAAAW,EAAA1Q,YAAA0Q,EAAA2H,aACAJ,EAAAK,GAAA5H,GACAsH,EAAA5E,GAAAmF,WAAA,eAAA5jB,GAAA0F,IAAAqW,EAAA,aAAA,EAAAuH,EAKA,IAAAnf,GAAA,GAAA,MAAAA,EAAA,CAQA,GANAA,EAAA0f,GAAA9H,EAAAX,EAAAkI,IACAnf,EAAA,GAAA,MAAAA,KACAA,EAAA4X,EAAArc,MAAA0b,IAIA0I,GAAAjb,KAAA1E,GACA,MAAAA,EAKAsf,GAAAJ,IAAA5E,GAAAsF,qBAAA5f,IAAA4X,EAAArc,MAAA0b,IAGAjX,EAAAoN,WAAApN,IAAA,EAIA,MAAAA,GACAgf,EACApH,EACAX,EACAgI,IAAAC,EAAA,SAAA,WACAI,EACAH,GAEA,KA2SA,QAAAU,GAAAjI,EAAA/a,EAAAijB,EAAAC,EAAAC,GACA,MAAA,IAAAH,GAAAI,UAAAvY,KAAAkQ,EAAA/a,EAAAijB,EAAAC,EAAAC,GAwKA,QAAAE,KAIA,MAHAha,YAAA,WACAia,GAAAnhB,SAEAmhB,GAAAtkB,GAAAukB,MAIA,QAAAC,GAAAtY,EAAAuY,GACA,GAAAC,GACAC,GAAA3hB,OAAAkJ,GACAX,EAAA,CAKA,KADAkZ,EAAAA,EAAA,EAAA,EACAlZ,EAAA,EAAAA,GAAA,EAAAkZ,EACAC,EAAAnB,GAAAhY,GACAoZ,EAAA,SAAAD,GAAAC,EAAA,UAAAD,GAAAxY,CAOA,OAJAuY,KACAE,EAAAC,QAAAD,EAAA5hB,MAAAmJ,GAGAyY,EAGA,QAAAE,GAAA3T,EAAA+S,EAAAa,GAKA,IAJA,GAAAC,GACAC,GAAAC,GAAAhB,QAAA1F,OAAA0G,GAAA,MACAphB,EAAA,EACAwB,EAAA2f,EAAA3f,OACAxB,EAAAwB,EAAAxB,IACA,GAAAkhB,EAAAC,EAAAnhB,GAAAnD,KAAAokB,EAAAb,EAAA/S,GAGA,MAAA6T,GAKA,QAAAG,GAAAnJ,EAAAoJ,EAAAnc,GAEA,GAAAib,GAAA/S,EAAAkU,EAAAL,EAAAM,EAAAC,EAAA1f,EAAA2f,EACAC,EAAAliB,KACAmiB,KACA/lB,EAAAqc,EAAArc,MACAmjB,EAAA9G,EAAAvF,UAAAuM,GAAAhH,GACA2J,EAAA1lB,GAAAsgB,MAAAvE,EAAA,SAGA/S,GAAA2c,QACAN,EAAArlB,GAAA4lB,YAAA7J,EAAA,MACA,MAAAsJ,EAAAQ,WACAR,EAAAQ,SAAA,EACAP,EAAAD,EAAArf,MAAA8f,KACAT,EAAArf,MAAA8f,KAAA,WACAT,EAAAQ,UACAP,MAIAD,EAAAQ,WAEAL,EAAAO,OAAA,WAGAP,EAAAO,OAAA,WACAV,EAAAQ,WACA7lB,GAAA2lB,MAAA5J,EAAA,MAAA1W,QACAggB,EAAArf,MAAA8f,YAOA,IAAA/J,EAAAvF,WAAA,UAAA2O,IAAA,SAAAA,MAKAnc,EAAAgd,UAAAtmB,EAAAsmB,SAAAtmB,EAAAumB,UAAAvmB,EAAAwmB,WAIAtgB,EAAA5F,GAAA0F,IAAAqW,EAAA,WAGAwJ,EAAA,SAAA3f,EACA5F,GAAAsgB,MAAAvE,EAAA,eAAA6F,EAAA7F,EAAAjT,UAAAlD,EAEA,WAAA2f,GAAA,SAAAvlB,GAAA0F,IAAAqW,EAAA,WAIA0C,GAAA0H,wBAAA,WAAAvE,EAAA7F,EAAAjT,UAGApJ,EAAA0mB,KAAA,EAFA1mB,EAAAkG,QAAA,iBAOAoD,EAAAgd,WACAtmB,EAAAsmB,SAAA,SACAvH,GAAA4H,oBACAb,EAAAO,OAAA,WACArmB,EAAAsmB,SAAAhd,EAAAgd,SAAA,GACAtmB,EAAAumB,UAAAjd,EAAAgd,SAAA,GACAtmB,EAAAwmB,UAAAld,EAAAgd,SAAA,KAMA,KAAA/B,IAAAkB,GAEA,GADAjU,EAAAiU,EAAAlB,GACAqC,GAAA7V,KAAAS,GAAA,CAGA,SAFAiU,GAAAlB,GACAmB,EAAAA,GAAA,WAAAlU,EACAA,KAAA2R,EAAA,OAAA,QAAA,CAGA,GAAA,SAAA3R,IAAAwU,GAAAviB,SAAAuiB,EAAAzB,GAGA,QAFApB,IAAA,EAKA4C,EAAAxB,GAAAyB,GAAAA,EAAAzB,IAAAjkB,GAAAN,MAAAqc,EAAAkI,OAIAre,GAAAzC,MAIA,IAAAnD,GAAAud,cAAAkI,GAwCA,YAAA,SAAA7f,EAAAgc,EAAA7F,EAAAjT,UAAAlD,KACAlG,EAAAkG,QAAAA,OAzCA,CACA8f,EACA,UAAAA,KACA7C,EAAA6C,EAAA7C,QAGA6C,EAAA1lB,GAAAsgB,MAAAvE,EAAA,aAIAqJ,IACAM,EAAA7C,QAAAA,GAEAA,EACA7iB,GAAA+b,GAAA6G,OAEA4C,EAAAe,KAAA,WACAvmB,GAAA+b,GAAAyK,SAGAhB,EAAAe,KAAA,WACA,GAAAtC,EACAjkB,IAAAymB,YAAA1K,EAAA,SACA,KAAAkI,IAAAwB,GACAzlB,GAAAN,MAAAqc,EAAAkI,EAAAwB,EAAAxB,KAGA,KAAAA,IAAAwB,GACAV,EAAAF,EAAAhC,EAAA6C,EAAAzB,GAAA,EAAAA,EAAAuB,GAEAvB,IAAAyB,KACAA,EAAAzB,GAAAc,EAAA2B,MACA7D,IACAkC,EAAAb,IAAAa,EAAA2B,MACA3B,EAAA2B,MAAA,UAAAzC,GAAA,WAAAA,EAAA,EAAA,KAWA,QAAA0C,GAAAxB,EAAAyB,GACA,GAAA/iB,GAAAuX,EAAA+I,EAAAjT,EAAAmU,CAGA,KAAAxhB,IAAAshB,GAeA,GAdA/J,EAAApb,GAAAoe,UAAAva,GACAsgB,EAAAyC,EAAAxL,GACAlK,EAAAiU,EAAAthB,GACA7D,GAAAse,QAAApN,KACAiT,EAAAjT,EAAA,GACAA,EAAAiU,EAAAthB,GAAAqN,EAAA,IAGArN,IAAAuX,IACA+J,EAAA/J,GAAAlK,QACAiU,GAAAthB,IAGAwhB,EAAArlB,GAAA6mB,SAAAzL,GACAiK,GAAA,UAAAA,GAAA,CACAnU,EAAAmU,EAAAyB,OAAA5V,SACAiU,GAAA/J,EAIA,KAAAvX,IAAAqN,GACArN,IAAAshB,KACAA,EAAAthB,GAAAqN,EAAArN,GACA+iB,EAAA/iB,GAAAsgB,OAIAyC,GAAAxL,GAAA+I,EAKA,QAAA4C,GAAAhL,EAAAiL,EAAAhmB,GACA,GAAAimB,GACAC,EACArjB,EAAA,EACAwB,EAAA8hB,GAAA9hB,OACA+hB,EAAApnB,GAAAqnB,WAAAtB,OAAA,iBAEAuB,GAAAvL,OAEAuL,EAAA,WACA,GAAAJ,EACA,OAAA,CAUA,KARA,GAAAK,GAAAjD,IAAAD,IACAmD,EAAApjB,KAAA6I,IAAA,EAAA6X,EAAA2C,UAAA3C,EAAA4C,SAAAH,GAEAI,EAAAH,EAAA1C,EAAA4C,UAAA,EACAE,EAAA,EAAAD,EACA9jB,EAAA,EACAwB,EAAAyf,EAAA+C,OAAAxiB,OAEAxB,EAAAwB,EAAAxB,IACAihB,EAAA+C,OAAAhkB,GAAA2W,IAAAoN,EAKA,OAFAR,GAAAU,WAAA/L,GAAA+I,EAAA8C,EAAAJ,IAEAI,EAAA,GAAAviB,EACAmiB,GAEAJ,EAAAW,YAAAhM,GAAA+I,KACA,IAGAA,EAAAsC,EAAAY,SACAjM,KAAAA,EACAoJ,MAAAnlB,GAAAme,UAAA6I,GACAhe,KAAAhJ,GAAAme,QAAA,GAAAyI,kBAAA5lB,GACAinB,mBAAAjB,EACAkB,gBAAAlnB,EACAymB,UAAAnD,IAAAD,IACAqD,SAAA1mB,EAAA0mB,SACAG,UACAhD,YAAA,SAAAZ,EAAAC,GACA,GAAAa,GAAA/kB,GAAAgkB,MAAAjI,EAAA+I,EAAA9b,KAAAib,EAAAC,EACAY,EAAA9b,KAAA4d,cAAA3C,IAAAa,EAAA9b,KAAAmb,OAEA,OADAW,GAAA+C,OAAAje,KAAAmb,GACAA,GAEAoD,KAAA,SAAAC,GACA,GAAAvkB,GAAA,EAGAwB,EAAA+iB,EAAAtD,EAAA+C,OAAAxiB,OAAA,CACA,IAAA6hB,EACA,MAAA5jB,KAGA,KADA4jB,GAAA,EACArjB,EAAAwB,EAAAxB,IACAihB,EAAA+C,OAAAhkB,GAAA2W,IAAA,EAUA,OALA4N,GACAhB,EAAAW,YAAAhM,GAAA+I,EAAAsD,IAEAhB,EAAAiB,WAAAtM,GAAA+I,EAAAsD,IAEA9kB,QAGA6hB,EAAAL,EAAAK,KAIA,KAFAwB,EAAAxB,EAAAL,EAAA9b,KAAA4d,eAEA/iB,EAAAwB,EAAAxB,IAEA,GADAojB,EAAAE,GAAAtjB,GAAAnD,KAAAokB,EAAA/I,EAAAoJ,EAAAL,EAAA9b,MAEA,MAAAie,EAmBA,OAfAjnB,IAAAqI,IAAA8c,EAAAN,EAAAC,GAEA9kB,GAAA6b,WAAAiJ,EAAA9b,KAAA0d,QACA5B,EAAA9b,KAAA0d,MAAAhmB,KAAAqb,EAAA+I,GAGA9kB,GAAAsoB,GAAA1d,MACA5K,GAAAme,OAAAmJ,GACAvL,KAAAA,EACAyJ,KAAAV,EACAa,MAAAb,EAAA9b,KAAA2c,SAKAb,EAAAyD,SAAAzD,EAAA9b,KAAAuf,UACAhC,KAAAzB,EAAA9b,KAAAud,KAAAzB,EAAA9b,KAAA4O,UACA4Q,KAAA1D,EAAA9b,KAAAwf,MACAzC,OAAAjB,EAAA9b,KAAA+c,QA6rCA,QAAA0C,GAAAC,GAGA,MAAA,UAAAC,EAAA/N,GAEA,gBAAA+N,KACA/N,EAAA+N,EACAA,EAAA,IAGA,IAAAC,GACArd,EAAA,EACAsd,EAAAF,EAAA3kB,cAAAoG,MAAAqS,OAEA,IAAAzc,GAAA6b,WAAAjB,GAEA,KAAAgO,EAAAC,EAAAtd,MAEA,MAAAqd,EAAA7W,OAAA,IACA6W,EAAAA,EAAAnoB,MAAA,IAAA,KACAioB,EAAAE,GAAAF,EAAAE,QAAAE,QAAAlO,KAIA8N,EAAAE,GAAAF,EAAAE,QAAAhf,KAAAgR,IAQA,QAAAmO,GAAAL,EAAA1nB,EAAAknB,EAAAc,GAKA,QAAAC,GAAAL,GACA,GAAArH,EAYA,OAXA2H,GAAAN,IAAA,EACA5oB,GAAAkD,KAAAwlB,EAAAE,OAAA,SAAAzN,EAAAgO,GACA,GAAAC,GAAAD,EAAAnoB,EAAAknB,EAAAc,EACA,OAAA,gBAAAI,IAAAC,GAAAH,EAAAE,GAIAC,IACA9H,EAAA6H,GADA,QAHApoB,EAAA6nB,UAAAC,QAAAM,GACAH,EAAAG,IACA,KAKA7H,EAhBA,GAAA2H,MACAG,EAAAX,IAAAY,EAkBA,OAAAL,GAAAjoB,EAAA6nB,UAAA,MAAAK,EAAA,MAAAD,EAAA,KAMA,QAAAM,GAAA7nB,EAAAS,GACA,GAAAqnB,GAAAtM,EACAuM,EAAAzpB,GAAA0pB,aAAAD,eAEA,KAAAvM,IAAA/a,GACAgB,SAAAhB,EAAA+a,MACAuM,EAAAvM,GAAAxb,EAAA8nB,IAAAA,OAAAtM,GAAA/a,EAAA+a,GAOA,OAJAsM,IACAxpB,GAAAme,QAAA,EAAAzc,EAAA8nB,GAGA9nB,EAOA,QAAAioB,GAAA1W,EAAA+V,EAAAY,GAMA,IALA,GAAAC,GAAAC,EAAAC,EAAA7d,EACA8d,EAAA/W,EAAA+W,SACAnB,EAAA5V,EAAA4V,UAGA,MAAAA,EAAA,IACAA,EAAAvf,QACAnG,SAAA2mB,IACAA,EAAA7W,EAAAgX,UAAAjB,EAAAkB,kBAAA,gBAKA,IAAAJ,EACA,IAAA5d,IAAA8d,GACA,GAAAA,EAAA9d,IAAA8d,EAAA9d,GAAArD,KAAAihB,GAAA,CACAjB,EAAAC,QAAA5c,EACA,OAMA,GAAA2c,EAAA,IAAAe,GACAG,EAAAlB,EAAA,OACA,CAEA,IAAA3c,IAAA0d,GAAA,CACA,IAAAf,EAAA,IAAA5V,EAAAkX,WAAAje,EAAA,IAAA2c,EAAA,IAAA,CACAkB,EAAA7d,CACA,OAEA2d,IACAA,EAAA3d,GAIA6d,EAAAA,GAAAF,EAMA,GAAAE,EAIA,MAHAA,KAAAlB,EAAA,IACAA,EAAAC,QAAAiB,GAEAH,EAAAG,GAOA,QAAAK,GAAAnX,EAAAoX,EAAArB,EAAAsB,GACA,GAAAC,GAAAC,EAAAC,EAAAC,EAAAC,EACAR,KAEAtB,EAAA5V,EAAA4V,UAAApoB,OAGA,IAAAooB,EAAA,GACA,IAAA4B,IAAAxX,GAAAkX,WACAA,EAAAM,EAAAzmB,eAAAiP,EAAAkX,WAAAM,EAOA,KAHAD,EAAA3B,EAAAvf,QAGAkhB,GAcA,GAZAvX,EAAA2X,eAAAJ,KACAxB,EAAA/V,EAAA2X,eAAAJ,IAAAH,IAIAM,GAAAL,GAAArX,EAAA4X,aACAR,EAAApX,EAAA4X,WAAAR,EAAApX,EAAA2V,WAGA+B,EAAAH,EACAA,EAAA3B,EAAAvf,QAKA,GAAA,MAAAkhB,EAEAA,EAAAG,MAGA,IAAA,MAAAA,GAAAA,IAAAH,EAAA,CAMA,GAHAC,EAAAN,EAAAQ,EAAA,IAAAH,IAAAL,EAAA,KAAAK,IAGAC,EACA,IAAAF,IAAAJ,GAIA,GADAO,EAAAH,EAAAnhB,MAAA,KACAshB,EAAA,KAAAF,IAGAC,EAAAN,EAAAQ,EAAA,IAAAD,EAAA,KACAP,EAAA,KAAAO,EAAA,KACA,CAEAD,KAAA,EACAA,EAAAN,EAAAI,GAGAJ,EAAAI,MAAA,IACAC,EAAAE,EAAA,GACA7B,EAAAC,QAAA4B,EAAA,IAEA,OAOA,GAAAD,KAAA,EAGA,GAAAA,GAAAxX,EAAA,UACAoX,EAAAI,EAAAJ,OAEA,KACAA,EAAAI,EAAAJ,GACA,MAAA1nB,GACA,OAAAmP,MAAA,cAAAgZ,MAAAL,EAAA9nB,EAAA,sBAAAgoB,EAAA,OAAAH,IAQA,OAAA1Y,MAAA,UAAAvO,KAAA8mB,GAymBA,QAAAU,GAAAC,EAAA7V,EAAA8V,EAAAlK,GACA,GAAA3F,EAEA,IAAApb,GAAAse,QAAAnJ,GAEAnV,GAAAkD,KAAAiS,EAAA,SAAA5J,EAAA2f,GACAD,GAAAE,GAAAtiB,KAAAmiB,GAEAjK,EAAAiK,EAAAE,GAIAH,EAAAC,EAAA,KAAA,gBAAAE,GAAA3f,EAAA,IAAA,IAAA2f,EAAAD,EAAAlK,SAIA,IAAAkK,GAAA,WAAAjrB,GAAAkM,KAAAiJ,GAQA4L,EAAAiK,EAAA7V,OANA,KAAAiG,IAAAjG,GACA4V,EAAAC,EAAA,IAAA5P,EAAA,IAAAjG,EAAAiG,GAAA6P,EAAAlK,GA8PA,QAAAqK,KACA,IACA,MAAA,IAAArqB,GAAA0I,eACA,MAAA9G,KAGA,QAAA0oB,KACA,IACA,MAAA,IAAAtqB,GAAAuqB,cAAA,qBACA,MAAA3oB,KA8SA,QAAA4oB,GAAAxP,GACA,MAAA/b,IAAAyb,SAAAM,GACAA,EACA,IAAAA,EAAAvF,WACAuF,EAAAyP,aAAAzP,EAAA0P,cA/xTA,GAAAzN,MAEAvd,EAAAud,EAAAvd,MAEA8d,EAAAP,EAAAO,OAEA3U,EAAAoU,EAAApU,KAEAvG,EAAA2a,EAAA3a,QAEAqoB,KAEAC,GAAAD,EAAAC,SAEAC,GAAAF,EAAAG,eAEApN,MAKAqN,GAAA,SAGA9rB,GAAA,SAAA+rB,EAAAtV,GAGA,MAAA,IAAAzW,IAAAqV,GAAAxJ,KAAAkgB,EAAAtV,IAKAuV,GAAA,qCAGAC,GAAA,QACAC,GAAA,eAGAC,GAAA,SAAAC,EAAAC,GACA,MAAAA,GAAAnhB,cAGAlL,IAAAqV,GAAArV,GAAAokB,WAEAkI,OAAAR,GAEAS,YAAAvsB,GAGA+rB,SAAA,GAGA1mB,OAAA,EAEAmnB,QAAA,WACA,MAAA/rB,GAAAC,KAAA4C,OAKA+e,IAAA,SAAAoK,GACA,MAAA,OAAAA,EAGAA,EAAA,EAAAnpB,KAAAmpB,EAAAnpB,KAAA+B,QAAA/B,KAAAmpB,GAGAhsB,EAAAC,KAAA4C,OAKAopB,UAAA,SAAApN,GAGA,GAAA3B,GAAA3d,GAAAyf,MAAAnc,KAAAipB,cAAAjN,EAOA,OAJA3B,GAAAgP,WAAArpB,KACAqa,EAAAlH,QAAAnT,KAAAmT,QAGAkH,GAMAza,KAAA,SAAA0pB,EAAAhX,GACA,MAAA5V,IAAAkD,KAAAI,KAAAspB,EAAAhX,IAGAvN,IAAA,SAAAukB,GACA,MAAAtpB,MAAAopB,UAAA1sB,GAAAqI,IAAA/E,KAAA,SAAAyY,EAAAxQ,GACA,MAAAqhB,GAAAlsB,KAAAqb,EAAAxQ,EAAAwQ,OAIAtb,MAAA,WACA,MAAA6C,MAAAopB,UAAAjsB,EAAA2X,MAAA9U,KAAAuS,aAGAgX,MAAA,WACA,MAAAvpB,MAAAwpB,GAAA,IAGA7R,KAAA,WACA,MAAA3X,MAAAwpB,QAGAA,GAAA,SAAAvhB,GACA,GAAA0E,GAAA3M,KAAA+B,OACA6T,GAAA3N,GAAAA,EAAA,EAAA0E,EAAA,EACA,OAAA3M,MAAAopB,UAAAxT,GAAA,GAAAA,EAAAjJ,GAAA3M,KAAA4V,SAGAgL,IAAA,WACA,MAAA5gB,MAAAqpB,YAAArpB,KAAAipB,YAAA,OAKA3iB,KAAAA,EACA/E,KAAAmZ,EAAAnZ,KACAuD,OAAA4V,EAAA5V,QAGApI,GAAAme,OAAAne,GAAAqV,GAAA8I,OAAA,WACA,GAAAhc,GAAA4qB,EAAAC,EAAA5R,EAAApa,EAAAyE,EACA/D,EAAAmU,UAAA,OACAtK,EAAA,EACAlG,EAAAwQ,UAAAxQ,OACAmkB,GAAA,CAsBA,KAnBA,iBAAA9nB,KACA8nB,EAAA9nB,EAGAA,EAAAmU,UAAAtK,OACAA,KAIA,gBAAA7J,IAAA1B,GAAA6b,WAAAna,KACAA,MAIA6J,IAAAlG,IACA3D,EAAA4B,KACAiI,KAGAA,EAAAlG,EAAAkG,IAEA,GAAA,OAAAvK,EAAA6U,UAAAtK,IAEA,IAAA6P,IAAApa,GACAmB,EAAAT,EAAA0Z,GACA4R,EAAAhsB,EAAAoa,GAGA1Z,IAAAsrB,IAKAxD,GAAAwD,IAAAhtB,GAAAitB,cAAAD,KAAAD,EAAA/sB,GAAAse,QAAA0O,MACAD,GACAA,GAAA,EACAtnB,EAAAtD,GAAAnC,GAAAse,QAAAnc,GAAAA,MAGAsD,EAAAtD,GAAAnC,GAAAitB,cAAA9qB,GAAAA,KAIAT,EAAA0Z,GAAApb,GAAAme,OAAAqL,EAAA/jB,EAAAunB,IAGA7pB,SAAA6pB,IACAtrB,EAAA0Z,GAAA4R,GAOA,OAAAtrB,IAGA1B,GAAAme,QAEAL,QAAA,UAAAgO,GAAA1nB,KAAA8oB,UAAA3mB,QAAA,MAAA,IAGA4mB,SAAA,EAEArC,MAAA,SAAAsC,GACA,KAAA,IAAA9R,OAAA8R,IAGArZ,KAAA,aAKA8H,WAAA,SAAA1G,GACA,MAAA,aAAAnV,GAAAkM,KAAAiJ,IAGAmJ,QAAA+O,MAAA/O,SAAA,SAAAnJ,GACA,MAAA,UAAAnV,GAAAkM,KAAAiJ,IAGAsG,SAAA,SAAAtG,GAEA,MAAA,OAAAA,GAAAA,GAAAA,EAAApU,QAGAusB,UAAA,SAAAnY,GAKA,OAAAnV,GAAAse,QAAAnJ,IAAAA,EAAA5D,WAAA4D,GAAA,GAAA,GAGAoI,cAAA,SAAApI,GACA,GAAAiG,EACA,KAAAA,IAAAjG,GACA,OAAA,CAEA,QAAA,GAGA8X,cAAA,SAAA9X,GACA,GAAA+H,EAKA,KAAA/H,GAAA,WAAAnV,GAAAkM,KAAAiJ,IAAAA,EAAAqB,UAAAxW,GAAAyb,SAAAtG,GACA,OAAA,CAGA,KAEA,GAAAA,EAAAoX,cACAX,GAAAlrB,KAAAyU,EAAA,iBACAyW,GAAAlrB,KAAAyU,EAAAoX,YAAAnI,UAAA,iBACA,OAAA,EAEA,MAAAzhB,GAEA,OAAA,EAKA,GAAA8b,GAAA8O,QACA,IAAArQ,IAAA/H,GACA,MAAAyW,IAAAlrB,KAAAyU,EAAA+H,EAMA,KAAAA,IAAA/H,IAEA,MAAAhS,UAAA+Z,GAAA0O,GAAAlrB,KAAAyU,EAAA+H,IAGAhR,KAAA,SAAAiJ,GACA,MAAA,OAAAA,EACAA,EAAA,GAEA,gBAAAA,IAAA,kBAAAA,GACAuW,EAAAC,GAAAjrB,KAAAyU,KAAA,eACAA;EAMAqY,WAAA,SAAAjqB,GACAA,GAAAvD,GAAAqhB,KAAA9d,KAIAxC,EAAA0sB,YAAA,SAAAlqB,GACAxC,EAAA,KAAAL,KAAAK,EAAAwC,KACAA,IAMA6a,UAAA,SAAAtI,GACA,MAAAA,GAAAvP,QAAA0lB,GAAA,OAAA1lB,QAAA2lB,GAAAC,KAGArjB,SAAA,SAAAiT,EAAAX,GACA,MAAAW,GAAAjT,UAAAiT,EAAAjT,SAAA9E,gBAAAoX,EAAApX,eAIAd,KAAA,SAAAiS,EAAAyX,EAAAhX,GACA,GAAA1E,GACA3F,EAAA,EACAlG,EAAA8P,EAAA9P,OACAiZ,EAAA9C,EAAArG,EAEA,IAAAS,GACA,GAAA0I,EACA,KAAA/S,EAAAlG,IACA6L,EAAA0b,EAAAxU,MAAAjD,EAAA5J,GAAAqK,GAEA1E,KAAA,GAHA3F,SAQA,KAAAA,IAAA4J,GAGA,GAFAjE,EAAA0b,EAAAxU,MAAAjD,EAAA5J,GAAAqK,GAEA1E,KAAA,EACA,UAOA,IAAAoN,EACA,KAAA/S,EAAAlG,IACA6L,EAAA0b,EAAAlsB,KAAAyU,EAAA5J,GAAAA,EAAA4J,EAAA5J,IAEA2F,KAAA,GAHA3F,SAQA,KAAAA,IAAA4J,GAGA,GAFAjE,EAAA0b,EAAAlsB,KAAAyU,EAAA5J,GAAAA,EAAA4J,EAAA5J,IAEA2F,KAAA,EACA,KAMA,OAAAiE,IAIAkM,KAAA,SAAA5c,GACA,MAAA,OAAAA,EACA,IACAA,EAAA,IAAA8B,QAAAylB,GAAA,KAIA0B,UAAA,SAAAC,EAAAC,GACA,GAAAjQ,GAAAiQ,KAaA,OAXA,OAAAD,IACAnS,EAAA1R,OAAA6jB,IACA3tB,GAAAyf,MAAA9B,EACA,gBAAAgQ,IACAA,GAAAA,GAGA/jB,EAAAlJ,KAAAid,EAAAgQ,IAIAhQ,GAGAzB,QAAA,SAAAH,EAAA4R,EAAApiB,GACA,GAAA0E,EAEA,IAAA0d,EAAA,CACA,GAAAtqB,EACA,MAAAA,GAAA3C,KAAAitB,EAAA5R,EAAAxQ,EAMA,KAHA0E,EAAA0d,EAAAtoB,OACAkG,EAAAA,EAAAA,EAAA,EAAAnH,KAAA6I,IAAA,EAAAgD,EAAA1E,GAAAA,EAAA,EAEAA,EAAA0E,EAAA1E,IAEA,GAAAA,IAAAoiB,IAAAA,EAAApiB,KAAAwQ,EACA,MAAAxQ,GAKA,UAGAkU,MAAA,SAAAoN,EAAAgB,GAKA,IAJA,GAAA5d,IAAA4d,EAAAxoB,OACA6T,EAAA,EACA3N,EAAAshB,EAAAxnB,OAEA6T,EAAAjJ,GACA4c,EAAAthB,KAAAsiB,EAAA3U,IAKA,IAAAjJ,IAAAA,EACA,KAAA9M,SAAA0qB,EAAA3U,IACA2T,EAAAthB,KAAAsiB,EAAA3U,IAMA,OAFA2T,GAAAxnB,OAAAkG,EAEAshB,GAGA/Q,KAAA,SAAAwD,EAAAsN,EAAAkB,GASA,IARA,GAAAC,GACA7V,KACA3M,EAAA,EACAlG,EAAAia,EAAAja,OACA2oB,GAAAF,EAIAviB,EAAAlG,EAAAkG,IACAwiB,GAAAnB,EAAAtN,EAAA/T,GAAAA,GACAwiB,IAAAC,GACA9V,EAAAtO,KAAA0V,EAAA/T,GAIA,OAAA2M,IAIA7P,IAAA,SAAAiX,EAAAsN,EAAAqB,GACA,GAAA/c,GACA3F,EAAA,EACAlG,EAAAia,EAAAja,OACAiZ,EAAA9C,EAAA8D,GACA3B,IAGA,IAAAW,EACA,KAAA/S,EAAAlG,EAAAkG,IACA2F,EAAA0b,EAAAtN,EAAA/T,GAAAA,EAAA0iB,GAEA,MAAA/c,GACAyM,EAAA/T,KAAAsH,OAMA,KAAA3F,IAAA+T,GACApO,EAAA0b,EAAAtN,EAAA/T,GAAAA,EAAA0iB,GAEA,MAAA/c,GACAyM,EAAA/T,KAAAsH,EAMA,OAAAqN,GAAAnG,SAAAuF,IAIAM,KAAA,EAIAiQ,MAAA,SAAA7Y,EAAAoB,GACA,GAAAb,GAAAsY,EAAAxD,CAUA,IARA,gBAAAjU,KACAiU,EAAArV,EAAAoB,GACAA,EAAApB,EACAA,EAAAqV,GAKA1qB,GAAA6b,WAAAxG,GAaA,MARAO,GAAAnV,EAAAC,KAAAmV,UAAA,GACAqY,EAAA,WACA,MAAA7Y,GAAA+C,MAAA3B,GAAAnT,KAAAsS,EAAA2I,OAAA9d,EAAAC,KAAAmV,cAIAqY,EAAAjQ,KAAA5I,EAAA4I,KAAA5I,EAAA4I,MAAAje,GAAAie,OAEAiQ,GAGA3J,IAAA,WACA,OAAA,GAAAlN,OAKAoH,QAAAA,KAIAze,GAAAkD,KAAA,gEAAAkG,MAAA,KAAA,SAAAmC,EAAA6P,GACAsQ,EAAA,WAAAtQ,EAAA,KAAAA,EAAApX,eAuBA,IAAAmqB,IAWA,SAAAptB,GA0LA,QAAAotB,GAAApC,EAAAtV,EAAAmX,EAAAQ,GACA,GAAAhkB,GAAA2R,EAAAsS,EAAA7X,EAEAjL,EAAA+iB,EAAAC,EAAAC,EAAAC,EAAAC,CAUA,KARAjY,EAAAA,EAAAuJ,eAAAvJ,EAAAkY,KAAAtvB,GACAuvB,EAAAnY,GAGAA,EAAAA,GAAApX,EACAuuB,EAAAA,MACApX,EAAAC,EAAAD,SAEA,gBAAAuV,KAAAA,GACA,IAAAvV,GAAA,IAAAA,GAAA,KAAAA,EAEA,MAAAoX,EAGA,KAAAQ,GAAAS,EAAA,CAGA,GAAA,KAAArY,IAAApM,EAAA0kB,GAAAre,KAAAsb,IAEA,GAAAsC,EAAAjkB,EAAA,IACA,GAAA,IAAAoM,EAAA,CAIA,GAHAuF,EAAAtF,EAAAnX,eAAA+uB,IAGAtS,IAAAA,EAAAnT,WAQA,MAAAglB,EALA,IAAA7R,EAAAxT,KAAA8lB,EAEA,MADAT,GAAAhkB,KAAAmS,GACA6R,MAOA,IAAAnX,EAAAuJ,gBAAAjE,EAAAtF,EAAAuJ,cAAA1gB,eAAA+uB,KACAU,EAAAtY,EAAAsF,IAAAA,EAAAxT,KAAA8lB,EAEA,MADAT,GAAAhkB,KAAAmS,GACA6R,MAKA,CAAA,GAAAxjB,EAAA,GAEA,MADAR,GAAAwO,MAAAwV,EAAAnX,EAAAnM,qBAAAyhB,IACA6B,CAGA,KAAAS,EAAAjkB,EAAA,KAAAqU,EAAAuQ,uBAEA,MADAplB,GAAAwO,MAAAwV,EAAAnX,EAAAuY,uBAAAX,IACAT,EAKA,GAAAnP,EAAA/H,OAAAuY,IAAAA,EAAApmB,KAAAkjB,IAAA,CASA,GARAyC,EAAAD,EAAAzQ,EACA2Q,EAAAhY,EACAiY,EAAA,IAAAlY,GAAAuV,EAMA,IAAAvV,GAAA,WAAAC,EAAA3N,SAAA9E,cAAA,CAWA,IAVAsqB,EAAA3c,EAAAoa,IAEAwC,EAAA9X,EAAArP,aAAA,OACAonB,EAAAD,EAAAhoB,QAAA2oB,GAAA,QAEAzY,EAAApP,aAAA,KAAAmnB,GAEAA,EAAA,QAAAA,EAAA,MAEAjjB,EAAA+iB,EAAAjpB,OACAkG,KACA+iB,EAAA/iB,GAAAijB,EAAAW,EAAAb,EAAA/iB,GAEAkjB,GAAAW,GAAAvmB,KAAAkjB,IAAAsD,EAAA5Y,EAAA7N,aAAA6N,EACAiY,EAAAJ,EAAA/kB,KAAA,KAGA,GAAAmlB,EACA,IAIA,MAHA9kB,GAAAwO,MAAAwV,EACAa,EAAA9tB,iBAAA+tB,IAEAd,EACA,MAAA0B,IACA,QACAf,GACA9X,EAAAtC,gBAAA,QAQA,MAAAob,GAAAxD,EAAAxlB,QAAAylB,GAAA,MAAAvV,EAAAmX,EAAAQ,GASA,QAAAoB,KAGA,QAAA/Z,GAAAyH,EAAAhM,GAMA,MAJAue,GAAA7lB,KAAAsT,EAAA,KAAAwS,EAAAC,mBAEAla,GAAAga,EAAAnmB,SAEAmM,EAAAyH,EAAA,KAAAhM,EARA,GAAAue,KAUA,OAAAha,GAOA,QAAAma,GAAAva,GAEA,MADAA,GAAAyI,IAAA,EACAzI,EAOA,QAAAwa,GAAAxa,GACA,GAAAsD,GAAAtZ,EAAAG,cAAA,MAEA,KACA,QAAA6V,EAAAsD,GACA,MAAAhW,GACA,OAAA,EACA,QAEAgW,EAAA/P,YACA+P,EAAA/P,WAAAM,YAAAyP,GAGAA,EAAA,MASA,QAAAmX,GAAAnL,EAAAoL,GAIA,IAHA,GAAApC,GAAAhJ,EAAAvb,MAAA,KACAmC,EAAAoZ,EAAAtf,OAEAkG,KACAmkB,EAAAM,WAAArC,EAAApiB,IAAAwkB,EAUA,QAAAE,GAAArtB,EAAAkC,GACA,GAAAsX,GAAAtX,GAAAlC,EACAstB,EAAA9T,GAAA,IAAAxZ,EAAA4T,UAAA,IAAA1R,EAAA0R,YACA1R,EAAAqrB,aAAAC,KACAxtB,EAAAutB,aAAAC,EAGA,IAAAF,EACA,MAAAA,EAIA,IAAA9T,EACA,KAAAA,EAAAA,EAAAiU,aACA,GAAAjU,IAAAtX,EACA,QAKA,OAAAlC,GAAA,KAOA,QAAA0tB,GAAApkB,GACA,MAAA,UAAA6P,GACA,GAAAX,GAAAW,EAAAjT,SAAA9E,aACA,OAAA,UAAAoX,GAAAW,EAAA7P,OAAAA,GAQA,QAAAqkB,GAAArkB,GACA,MAAA,UAAA6P,GACA,GAAAX,GAAAW,EAAAjT,SAAA9E,aACA,QAAA,UAAAoX,GAAA,WAAAA,IAAAW,EAAA7P,OAAAA,GAQA,QAAAskB,GAAAnb,GACA,MAAAua,GAAA,SAAAa,GAEA,MADAA,IAAAA,EACAb,EAAA,SAAAxB,EAAAlW,GAMA,IALA,GAAAgB,GACAwX,EAAArb,KAAA+Y,EAAA/oB,OAAAorB,GACAllB,EAAAmlB,EAAArrB,OAGAkG,KACA6iB,EAAAlV,EAAAwX,EAAAnlB,MACA6iB,EAAAlV,KAAAhB,EAAAgB,GAAAkV,EAAAlV,SAYA,QAAAmW,GAAA5Y,GACA,MAAAA,IAAA,mBAAAA,GAAAnM,sBAAAmM,EAg/BA,QAAAka,MAuEA,QAAAxB,GAAAyB,GAIA,IAHA,GAAArlB,GAAA,EACA0E,EAAA2gB,EAAAvrB,OACA0mB,EAAA,GACAxgB,EAAA0E,EAAA1E,IACAwgB,GAAA6E,EAAArlB,GAAA2F,KAEA,OAAA6a,GAGA,QAAA8E,GAAAC,EAAAC,EAAAC,GACA,GAAA3U,GAAA0U,EAAA1U,IACA4U,EAAAD,GAAA,eAAA3U,EACA6U,EAAA3K,GAEA,OAAAwK,GAAAlE,MAEA,SAAA9Q,EAAAtF,EAAA0a,GACA,KAAApV,EAAAA,EAAAM,IACA,GAAA,IAAAN,EAAAvF,UAAAya,EACA,MAAAH,GAAA/U,EAAAtF,EAAA0a,IAMA,SAAApV,EAAAtF,EAAA0a,GACA,GAAAC,GAAAC,EACAC,GAAAC,EAAAL,EAGA,IAAAC,GACA,KAAApV,EAAAA,EAAAM,IACA,IAAA,IAAAN,EAAAvF,UAAAya,IACAH,EAAA/U,EAAAtF,EAAA0a,GACA,OAAA,MAKA,MAAApV,EAAAA,EAAAM,IACA,GAAA,IAAAN,EAAAvF,UAAAya,EAAA,CAEA,GADAI,EAAAtV,EAAA+B,KAAA/B,EAAA+B,QACAsT,EAAAC,EAAAhV,KACA+U,EAAA,KAAAG,GAAAH,EAAA,KAAAF,EAGA,MAAAI,GAAA,GAAAF,EAAA,EAMA,IAHAC,EAAAhV,GAAAiV,EAGAA,EAAA,GAAAR,EAAA/U,EAAAtF,EAAA0a,GACA,OAAA,IASA,QAAAK,GAAAC,GACA,MAAAA,GAAApsB,OAAA,EACA,SAAA0W,EAAAtF,EAAA0a,GAEA,IADA,GAAA5lB,GAAAkmB,EAAApsB,OACAkG,KACA,IAAAkmB,EAAAlmB,GAAAwQ,EAAAtF,EAAA0a,GACA,OAAA,CAGA,QAAA,GAEAM,EAAA,GAGA,QAAAC,GAAA3F,EAAA4F,EAAA/D,GAGA,IAFA,GAAAriB,GAAA,EACA0E,EAAA0hB,EAAAtsB,OACAkG,EAAA0E,EAAA1E,IACA4iB,EAAApC,EAAA4F,EAAApmB,GAAAqiB,EAEA,OAAAA,GAGA,QAAAgE,GAAAC,EAAAxpB,EAAA4T,EAAAxF,EAAA0a,GAOA,IANA,GAAApV,GACA+V,KACAvmB,EAAA,EACA0E,EAAA4hB,EAAAxsB,OACA0sB,EAAA,MAAA1pB,EAEAkD,EAAA0E,EAAA1E,KACAwQ,EAAA8V,EAAAtmB,MACA0Q,IAAAA,EAAAF,EAAAtF,EAAA0a,KACAW,EAAAloB,KAAAmS,GACAgW,GACA1pB,EAAAuB,KAAA2B,IAMA,OAAAumB,GAGA,QAAAE,GAAAC,EAAAlG,EAAA+E,EAAAoB,EAAAC,EAAAC,GAOA,MANAF,KAAAA,EAAApU,KACAoU,EAAAF,EAAAE,IAEAC,IAAAA,EAAArU,KACAqU,EAAAH,EAAAG,EAAAC,IAEAxC,EAAA,SAAAxB,EAAAR,EAAAnX,EAAA0a,GACA,GAAAxJ,GAAApc,EAAAwQ,EACAsW,KACAC,KACAC,EAAA3E,EAAAvoB,OAGAia,EAAA8O,GAAAsD,EAAA3F,GAAA,IAAAtV,EAAAD,UAAAC,GAAAA,MAGA+b,GAAAP,IAAA7D,GAAArC,EAEAzM,EADAsS,EAAAtS,EAAA+S,EAAAJ,EAAAxb,EAAA0a,GAGAsB,EAAA3B,EAEAqB,IAAA/D,EAAA6D,EAAAM,GAAAL,MAMAtE,EACA4E,CAQA,IALA1B,GACAA,EAAA0B,EAAAC,EAAAhc,EAAA0a,GAIAe,EAMA,IALAvK,EAAAiK,EAAAa,EAAAH,GACAJ,EAAAvK,KAAAlR,EAAA0a,GAGA5lB,EAAAoc,EAAAtiB,OACAkG,MACAwQ,EAAA4L,EAAApc,MACAknB,EAAAH,EAAA/mB,MAAAinB,EAAAF,EAAA/mB,IAAAwQ,GAKA,IAAAqS,GACA,GAAA+D,GAAAF,EAAA,CACA,GAAAE,EAAA,CAIA,IAFAxK,KACApc,EAAAknB,EAAAptB,OACAkG,MACAwQ,EAAA0W,EAAAlnB,KAEAoc,EAAA/d,KAAA4oB,EAAAjnB,GAAAwQ,EAGAoW,GAAA,KAAAM,KAAA9K,EAAAwJ,GAKA,IADA5lB,EAAAknB,EAAAptB,OACAkG,MACAwQ,EAAA0W,EAAAlnB,MACAoc,EAAAwK,EAAA9uB,GAAA+qB,EAAArS,GAAAsW,EAAA9mB,SAEA6iB,EAAAzG,KAAAiG,EAAAjG,GAAA5L,SAOA0W,GAAAb,EACAa,IAAA7E,EACA6E,EAAArqB,OAAAmqB,EAAAE,EAAAptB,QACAotB,GAEAN,EACAA,EAAA,KAAAvE,EAAA6E,EAAAtB,GAEAvnB,EAAAwO,MAAAwV,EAAA6E,KAMA,QAAAC,GAAA9B,GAwBA,IAvBA,GAAA+B,GAAA7B,EAAA5X,EACAjJ,EAAA2gB,EAAAvrB,OACAutB,EAAAlD,EAAAmD,SAAAjC,EAAA,GAAA1kB,MACA4mB,EAAAF,GAAAlD,EAAAmD,SAAA,KACAtnB,EAAAqnB,EAAA,EAAA,EAGAG,EAAAlC,EAAA,SAAA9U,GACA,MAAAA,KAAA4W,GACAG,GAAA,GACAE,EAAAnC,EAAA,SAAA9U,GACA,MAAA1Y,IAAAsvB,EAAA5W,OACA+W,GAAA,GACArB,GAAA,SAAA1V,EAAAtF,EAAA0a,GACA,GAAAxT,IAAAiV,IAAAzB,GAAA1a,IAAAwc,MACAN,EAAAlc,GAAAD,SACAuc,EAAAhX,EAAAtF,EAAA0a,GACA6B,EAAAjX,EAAAtF,EAAA0a,GAGA,OADAwB,GAAA,KACAhV,IAGApS,EAAA0E,EAAA1E,IACA,GAAAulB,EAAApB,EAAAmD,SAAAjC,EAAArlB,GAAAW,MACAulB,GAAAZ,EAAAW,EAAAC,GAAAX,QACA,CAIA,GAHAA,EAAApB,EAAAzT,OAAA2U,EAAArlB,GAAAW,MAAAkM,MAAA,KAAAwY,EAAArlB,GAAA2M,SAGA4Y,EAAAhT,GAAA,CAGA,IADA5E,IAAA3N,EACA2N,EAAAjJ,IACAyf,EAAAmD,SAAAjC,EAAA1X,GAAAhN,MADAgN,KAKA,MAAA8Y,GACAzmB,EAAA,GAAAimB,EAAAC,GACAlmB,EAAA,GAAA4jB,EAEAyB,EAAAnwB,MAAA,EAAA8K,EAAA,GAAAgT,QAAArN,MAAA,MAAA0f,EAAArlB,EAAA,GAAAW,KAAA,IAAA,MACA3F,QAAAylB,GAAA,MACA8E,EACAvlB,EAAA2N,GAAAwZ,EAAA9B,EAAAnwB,MAAA8K,EAAA2N,IACAA,EAAAjJ,GAAAyiB,EAAA9B,EAAAA,EAAAnwB,MAAAyY,IACAA,EAAAjJ,GAAAkf,EAAAyB,IAGAa,EAAA7nB,KAAAknB,GAIA,MAAAU,GAAAC,GAGA,QAAAyB,GAAAC,EAAAC,GACA,GAAAC,GAAAD,EAAA/tB,OAAA,EACAiuB,EAAAH,EAAA9tB,OAAA,EACAkuB,EAAA,SAAAnF,EAAA3X,EAAA0a,EAAAvD,EAAA4F,GACA,GAAAzX,GAAA7C,EAAA4X,EACA2C,EAAA,EACAloB,EAAA,IACAsmB,EAAAzD,MACAsF,KACAC,EAAAV,EAEA3T,EAAA8O,GAAAkF,GAAA5D,EAAAlsB,KAAA,IAAA,IAAAgwB,GAEAI,EAAArC,GAAA,MAAAoC,EAAA,EAAAvvB,KAAA8oB,UAAA,GACAjd,EAAAqP,EAAAja,MAUA,KARAmuB,IACAP,EAAAxc,IAAApX,GAAAoX,GAOAlL,IAAA0E,GAAA,OAAA8L,EAAAuD,EAAA/T,IAAAA,IAAA,CACA,GAAA+nB,GAAAvX,EAAA,CAEA,IADA7C,EAAA,EACA4X,EAAAqC,EAAAja,MACA,GAAA4X,EAAA/U,EAAAtF,EAAA0a,GAAA,CACAvD,EAAAhkB,KAAAmS,EACA,OAGAyX,IACAjC,EAAAqC,GAKAP,KAEAtX,GAAA+U,GAAA/U,IACA0X,IAIArF,GACAyD,EAAAjoB,KAAAmS,IAOA,GADA0X,GAAAloB,EACA8nB,GAAA9nB,IAAAkoB,EAAA,CAEA,IADAva,EAAA,EACA4X,EAAAsC,EAAAla,MACA4X,EAAAe,EAAA6B,EAAAjd,EAAA0a,EAGA,IAAA/C,EAAA,CAEA,GAAAqF,EAAA,EACA,KAAAloB,KACAsmB,EAAAtmB,IAAAmoB,EAAAnoB,KACAmoB,EAAAnoB,GAAAkI,EAAA/S,KAAAktB,GAMA8F,GAAA9B,EAAA8B,GAIA9pB,EAAAwO,MAAAwV,EAAA8F,GAGAF,IAAApF,GAAAsF,EAAAruB,OAAA,GACAouB,EAAAL,EAAA/tB,OAAA,GAEA8oB,EAAA0F,WAAAjG,GAUA,MALA4F,KACAjC,EAAAqC,EACAX,EAAAU,GAGA9B,EAGA,OAAAwB,GACAzD,EAAA2D,GACAA,EA50DA,GAAAhoB,GACAkT,EACAiR,EACAoE,EACAC,EACApiB,EACAqiB,EACAzE,EACA0D,EACAgB,EACAC,EAGAtF,EACAvvB,EACA8N,EACA0hB,EACAI,EACAkF,EACAjc,EACA6W,EAGAjR,EAAA,SAAA,EAAA,GAAAzG,MACAsX,EAAA5tB,EAAA1B,SACAkyB,EAAA,EACAhL,EAAA,EACA6N,EAAA5E,IACA6E,EAAA7E,IACA8E,EAAA9E,IACA+E,EAAA,SAAA3xB,EAAAkC,GAIA,MAHAlC,KAAAkC,IACAovB,GAAA,GAEA,GAIA9D,EAAA,GAAA,GAGAxE,KAAAC,eACA8B,KACAla,EAAAka,EAAAla,IACA+gB,EAAA7G,EAAA/jB,KACAA,EAAA+jB,EAAA/jB,KACAnJ,EAAAktB,EAAAltB,MAGA4C,GAAA,SAAA4b,EAAAlD,GAGA,IAFA,GAAAxQ,GAAA,EACA0E,EAAAgP,EAAA5Z,OACAkG,EAAA0E,EAAA1E,IACA,GAAA0T,EAAA1T,KAAAwQ,EACA,MAAAxQ,EAGA,WAGAkpB,GAAA,6HAKAC,GAAA,sBAEAC,GAAA,mCAKAC,GAAAD,GAAApuB,QAAA,IAAA,MAGAsuB,GAAA,MAAAH,GAAA,KAAAC,GAAA,OAAAD,GAEA,gBAAAA,GAEA,2DAAAE,GAAA,OAAAF,GACA,OAEAI,GAAA,KAAAH,GAAA,wFAKAE,GAAA,eAMAE,GAAA,GAAAtqB,QAAAiqB,GAAA,IAAA,KACA1I,GAAA,GAAAvhB,QAAA,IAAAiqB,GAAA,8BAAAA,GAAA,KAAA,KAEAM,GAAA,GAAAvqB,QAAA,IAAAiqB,GAAA,KAAAA,GAAA,KACAO,GAAA,GAAAxqB,QAAA,IAAAiqB,GAAA,WAAAA,GAAA,IAAAA,GAAA,KAEAQ,GAAA,GAAAzqB,QAAA,IAAAiqB,GAAA,iBAAAA,GAAA,OAAA,KAEAS,GAAA,GAAA1qB,QAAAqqB,IACAM,GAAA,GAAA3qB,QAAA,IAAAmqB,GAAA,KAEAS,IACAC,GAAA,GAAA7qB,QAAA,MAAAkqB,GAAA,KACAY,MAAA,GAAA9qB,QAAA,QAAAkqB,GAAA,KACAa,IAAA,GAAA/qB,QAAA,KAAAkqB,GAAApuB,QAAA,IAAA,MAAA,KACAkvB,KAAA,GAAAhrB,QAAA,IAAAoqB,IACAa,OAAA,GAAAjrB,QAAA,IAAAqqB,IACAa,MAAA,GAAAlrB,QAAA,yDAAAiqB,GACA,+BAAAA,GAAA,cAAAA,GACA,aAAAA,GAAA,SAAA,KACAkB,KAAA,GAAAnrB,QAAA,OAAAgqB,GAAA,KAAA,KAGAoB,aAAA,GAAAprB,QAAA,IAAAiqB,GAAA,mDACAA,GAAA,mBAAAA,GAAA,mBAAA,MAGAoB,GAAA,sCACAC,GAAA,SAEAC,GAAA,yBAGAlH,GAAA,mCAEAM,GAAA,OACAF,GAAA,QAGA+G,GAAA,GAAAxrB,QAAA,qBAAAiqB,GAAA,MAAAA,GAAA,OAAA,MACAwB,GAAA,SAAA/a,EAAAgb,EAAAC,GACA,GAAAC,GAAA,KAAAF,EAAA,KAIA,OAAAE,KAAAA,GAAAD,EACAD,EACAE,EAAA,EAEAC,OAAAC,aAAAF,EAAA,OAEAC,OAAAC,aAAAF,GAAA,GAAA,MAAA,KAAAA,EAAA,QAOAG,GAAA,WACA5H,IAIA,KACAhlB,EAAAwO,MACAuV,EAAAltB,EAAAC,KAAAiuB,EAAAruB,YACAquB,EAAAruB,YAIAqtB,EAAAgB,EAAAruB,WAAA+E,QAAAmR,SACA,MAAA7T,IACAiH,GAAAwO,MAAAuV,EAAAtoB,OAGA,SAAA3D,EAAA+0B,GACAjC,EAAApc,MAAA1W,EAAAjB,EAAAC,KAAA+1B,KAKA,SAAA/0B,EAAA+0B,GAIA,IAHA,GAAAvd,GAAAxX,EAAA2D,OACAkG,EAAA,EAEA7J,EAAAwX,KAAAud,EAAAlrB,OACA7J,EAAA2D,OAAA6T,EAAA,IAoQAuF,EAAA0P,EAAA1P,WAOAsV,EAAA5F,EAAA4F,MAAA,SAAAhY,GAGA,GAAAlZ,GAAAkZ,IAAAA,EAAAiE,eAAAjE,GAAAlZ,eACA,SAAAA,GAAA,SAAAA,EAAAiG,UAQA8lB,EAAAT,EAAAS,YAAA,SAAA8H,GACA,GAAAC,GAAAjyB,EACAgd,EAAAgV,EAAAA,EAAA1W,eAAA0W,EAAA/H,CAGA,OAAAjN,KAAAriB,GAAA,IAAAqiB,EAAAlL,UAAAkL,EAAA7e,iBAKAxD,EAAAqiB,EACAvU,EAAAuU,EAAA7e,gBACA6B,EAAAgd,EAAA8J,YAMA9mB,GAAAA,IAAAA,EAAAkyB,MAEAlyB,EAAAiG,iBACAjG,EAAAiG,iBAAA,SAAA6rB,IAAA,GACA9xB,EAAA6Q,aACA7Q,EAAA6Q,YAAA,WAAAihB,KAMA3H,GAAAkF,EAAArS,GAQAjD,EAAAoW,WAAAhF,EAAA,SAAAlX,GAEA,MADAA,GAAAlZ,UAAA,KACAkZ,EAAAvR,aAAA,eAOAqX,EAAAnU,qBAAAulB,EAAA,SAAAlX,GAEA,MADAA,GAAApR,YAAAma,EAAAmV,cAAA,MACAle,EAAArO,qBAAA,KAAAjF,SAIAoZ,EAAAuQ,uBAAAgH,GAAAntB,KAAA6Y,EAAAsN,wBAMAvQ,EAAAqY,QAAAjH,EAAA,SAAAlX,GAEA,MADAxL,GAAA5F,YAAAoR,GAAApQ,GAAAuV,GACA4D,EAAAqV,oBAAArV,EAAAqV,kBAAAjZ,GAAAzY,SAIAoZ,EAAAqY,SACApH,EAAAlsB,KAAA,GAAA,SAAA+E,EAAAkO,GACA,GAAA,mBAAAA,GAAAnX,gBAAAuvB,EAAA,CACA,GAAAR,GAAA5X,EAAAnX,eAAAiJ,EAGA,OAAA8lB,IAAAA,EAAAzlB,YAAAylB,QAGAqB,EAAAzT,OAAA,GAAA,SAAA1T,GACA,GAAAyuB,GAAAzuB,EAAAhC,QAAA0vB,GAAAC,GACA,OAAA,UAAAna,GACA,MAAAA,GAAA3U,aAAA,QAAA4vB,YAMAtH,GAAAlsB,KAAA,GAEAksB,EAAAzT,OAAA,GAAA,SAAA1T,GACA,GAAAyuB,GAAAzuB,EAAAhC,QAAA0vB,GAAAC,GACA,OAAA,UAAAna,GACA,GAAA2a,GAAA,mBAAA3a,GAAAkb,kBAAAlb,EAAAkb,iBAAA,KACA,OAAAP,IAAAA,EAAAxlB,QAAA8lB,KAMAtH,EAAAlsB,KAAA,IAAAib,EAAAnU,qBACA,SAAA+U,EAAA5I,GACA,MAAA,mBAAAA,GAAAnM,qBACAmM,EAAAnM,qBAAA+U,GAGAZ,EAAA/H,IACAD,EAAA9V,iBAAA0e,GADA,QAKA,SAAAA,EAAA5I,GACA,GAAAsF,GACA2O,KACAnf,EAAA,EAEAqiB,EAAAnX,EAAAnM,qBAAA+U,EAGA,IAAA,MAAAA,EAAA,CACA,KAAAtD,EAAA6R,EAAAriB,MACA,IAAAwQ,EAAAvF,UACAkU,EAAA9gB,KAAAmS,EAIA,OAAA2O,GAEA,MAAAkD,IAIA8B,EAAAlsB,KAAA,MAAAib,EAAAuQ,wBAAA,SAAAvvB,EAAAgX,GACA,GAAAoY,EACA,MAAApY,GAAAuY,uBAAAvvB,IAUA00B,KAOAlF,MAEAxQ,EAAA/H,IAAAsf,GAAAntB,KAAA6Y,EAAA/gB,qBAGAkvB,EAAA,SAAAlX,GAMAxL,EAAA5F,YAAAoR,GAAAvY,UAAA,UAAA0d,EAAA,qBACAA,EAAA,iEAOAnF,EAAAhY,iBAAA,wBAAA0E,QACA4pB,EAAArlB,KAAA,SAAA8qB,GAAA,gBAKA/b,EAAAhY,iBAAA,cAAA0E,QACA4pB,EAAArlB,KAAA,MAAA8qB,GAAA,aAAAD,GAAA,KAIA9b,EAAAhY,iBAAA,QAAAmd,EAAA,MAAAzY,QACA4pB,EAAArlB,KAAA,MAMA+O,EAAAhY,iBAAA,YAAA0E,QACA4pB,EAAArlB,KAAA,YAMA+O,EAAAhY,iBAAA,KAAAmd,EAAA,MAAAzY,QACA4pB,EAAArlB,KAAA,cAIAimB,EAAA,SAAAlX,GAGA,GAAAtI,GAAAqR,EAAAliB,cAAA,QACA6Q,GAAAhJ,aAAA,OAAA,UACAsR,EAAApR,YAAA8I,GAAAhJ,aAAA,OAAA,KAIAsR,EAAAhY,iBAAA,YAAA0E,QACA4pB,EAAArlB,KAAA,OAAA8qB,GAAA,eAKA/b,EAAAhY,iBAAA,YAAA0E,QACA4pB,EAAArlB,KAAA,WAAA,aAIA+O,EAAAhY,iBAAA,QACAsuB,EAAArlB,KAAA,YAIA6U,EAAAyY,gBAAAlB,GAAAntB,KAAAqP,EAAA/K,EAAA+K,SACA/K,EAAAgqB,uBACAhqB,EAAAiqB,oBACAjqB,EAAAkqB,kBACAlqB,EAAAmqB,qBAEAzH,EAAA,SAAAlX,GAGA8F,EAAA8Y,kBAAArf,EAAAxX,KAAAiY,EAAA,OAIAT,EAAAxX,KAAAiY,EAAA,aACAwb,EAAAvqB,KAAA,KAAAkrB,MAIA7F,EAAAA,EAAA5pB,QAAA,GAAAoF,QAAAwkB,EAAA1lB,KAAA,MACA4qB,EAAAA,EAAA9uB,QAAA,GAAAoF,QAAA0pB,EAAA5qB,KAAA,MAIAotB,EAAAX,GAAAntB,KAAAsE,EAAAqqB,yBAKAzI,EAAA4H,GAAAX,GAAAntB,KAAAsE,EAAA4hB,UACA,SAAAnsB,EAAAkC,GACA,GAAA2yB,GAAA,IAAA70B,EAAA4T,SAAA5T,EAAAC,gBAAAD,EACA80B,EAAA5yB,GAAAA,EAAA8D,UACA,OAAAhG,KAAA80B,MAAAA,GAAA,IAAAA,EAAAlhB,YACAihB,EAAA1I,SACA0I,EAAA1I,SAAA2I,GACA90B,EAAA40B,yBAAA,GAAA50B,EAAA40B,wBAAAE,MAGA,SAAA90B,EAAAkC,GACA,GAAAA,EACA,KAAAA,EAAAA,EAAA8D,YACA,GAAA9D,IAAAlC,EACA,OAAA,CAIA,QAAA,GAOA2xB,EAAAoC,EACA,SAAA/zB,EAAAkC,GAGA,GAAAlC,IAAAkC,EAEA,MADAovB,IAAA,EACA,CAIA,IAAAyD,IAAA/0B,EAAA40B,yBAAA1yB,EAAA0yB,uBACA,OAAAG,GACAA,GAIAA,GAAA/0B,EAAAod,eAAApd,MAAAkC,EAAAkb,eAAAlb,GACAlC,EAAA40B,wBAAA1yB,GAGA,EAGA,EAAA6yB,IACAlZ,EAAAmZ,cAAA9yB,EAAA0yB,wBAAA50B,KAAA+0B,EAGA/0B,IAAA8e,GAAA9e,EAAAod,gBAAA2O,GAAAI,EAAAJ,EAAA/rB,MAGAkC,IAAA4c,GAAA5c,EAAAkb,gBAAA2O,GAAAI,EAAAJ,EAAA7pB,GACA,EAIAmvB,EACA5wB,GAAA4wB,EAAArxB,GAAAS,GAAA4wB,EAAAnvB,GACA,EAGA,EAAA6yB,KAAA,IAEA,SAAA/0B,EAAAkC,GAEA,GAAAlC,IAAAkC,EAEA,MADAovB,IAAA,EACA,CAGA,IAAA9X,GACA7Q,EAAA,EACAssB,EAAAj1B,EAAAgG,WACA8uB,EAAA5yB,EAAA8D,WACAkvB,GAAAl1B,GACAm1B,GAAAjzB,EAGA,KAAA+yB,IAAAH,EACA,MAAA90B,KAAA8e,KACA5c,IAAA4c,EAAA,EACAmW,KACAH,EAAA,EACAzD,EACA5wB,GAAA4wB,EAAArxB,GAAAS,GAAA4wB,EAAAnvB,GACA,CAGA,IAAA+yB,IAAAH,EACA,MAAAzH,GAAArtB,EAAAkC,EAKA,KADAsX,EAAAxZ,EACAwZ,EAAAA,EAAAxT,YACAkvB,EAAAhP,QAAA1M,EAGA,KADAA,EAAAtX,EACAsX,EAAAA,EAAAxT,YACAmvB,EAAAjP,QAAA1M,EAIA,MAAA0b,EAAAvsB,KAAAwsB,EAAAxsB,IACAA,GAGA,OAAAA,GAEA0kB,EAAA6H,EAAAvsB,GAAAwsB,EAAAxsB,IAGAusB,EAAAvsB,KAAAojB,KACAoJ,EAAAxsB,KAAAojB,EAAA,EACA,GAGAjN,GA1WAriB,GA6WA8uB,EAAAjW,QAAA,SAAA8f,EAAA1hB,GACA,MAAA6X,GAAA6J,EAAA,KAAA,KAAA1hB,IAGA6X,EAAA+I,gBAAA,SAAAnb,EAAAic,GASA,IAPAjc,EAAAiE,eAAAjE,KAAA1c,GACAuvB,EAAA7S,GAIAic,EAAAA,EAAAzxB,QAAA2uB,GAAA,UAEAzW,EAAAyY,iBAAArI,KACAsF,IAAAA,EAAAtrB,KAAAmvB,OACA/I,IAAAA,EAAApmB,KAAAmvB,IAEA,IACA,GAAAra,GAAAzF,EAAAxX,KAAAqb,EAAAic,EAGA,IAAAra,GAAAc,EAAA8Y,mBAGAxb,EAAA1c,UAAA,KAAA0c,EAAA1c,SAAAmX,SACA,MAAAmH,GAEA,MAAAhb,IAGA,MAAAwrB,GAAA6J,EAAA34B,EAAA,MAAA0c,IAAA1W,OAAA,GAGA8oB,EAAAY,SAAA,SAAAtY,EAAAsF,GAKA,OAHAtF,EAAAuJ,eAAAvJ,KAAApX,GACAuvB,EAAAnY,GAEAsY,EAAAtY,EAAAsF,IAGAoS,EAAApqB,KAAA,SAAAgY,EAAAX,IAEAW,EAAAiE,eAAAjE,KAAA1c,GACAuvB,EAAA7S,EAGA,IAAA1G,GAAAqa,EAAAM,WAAA5U,EAAApX,eAEAG,EAAAkR,GAAAuW,EAAAlrB,KAAAgvB,EAAAM,WAAA5U,EAAApX,eACAqR,EAAA0G,EAAAX,GAAAyT,GACA1rB,MAEA,OAAAA,UAAAgB,EACAA,EACAsa,EAAAoW,aAAAhG,EACA9S,EAAA3U,aAAAgU,IACAjX,EAAA4X,EAAAkb,iBAAA7b,KAAAjX,EAAA8zB,UACA9zB,EAAA+M,MACA,MAGAid,EAAArD,MAAA,SAAAsC,GACA,KAAA,IAAA9R,OAAA,0CAAA8R,IAOAe,EAAA0F,WAAA,SAAAjG,GACA,GAAA7R,GACAmc,KACAhf,EAAA,EACA3N,EAAA,CAOA,IAJA2oB,GAAAzV,EAAA0Z,iBACAlE,GAAAxV,EAAA2Z,YAAAxK,EAAAntB,MAAA,GACAmtB,EAAA/oB,KAAA0vB,GAEAL,EAAA,CACA,KAAAnY,EAAA6R,EAAAriB,MACAwQ,IAAA6R,EAAAriB,KACA2N,EAAAgf,EAAAtuB,KAAA2B,GAGA,MAAA2N,KACA0U,EAAAxlB,OAAA8vB,EAAAhf,GAAA,GAQA,MAFA+a,GAAA,KAEArG,GAOAkG,EAAA3F,EAAA2F,QAAA,SAAA/X,GACA,GAAA2a,GACA/Y,EAAA,GACApS,EAAA,EACAiL,EAAAuF,EAAAvF,QAEA,IAAAA,GAMA,GAAA,IAAAA,GAAA,IAAAA,GAAA,KAAAA,EAAA,CAGA,GAAA,gBAAAuF,GAAAsc,YACA,MAAAtc,GAAAsc,WAGA,KAAAtc,EAAAA,EAAAvU,WAAAuU,EAAAA,EAAAA,EAAAsU,YACA1S,GAAAmW,EAAA/X,OAGA,IAAA,IAAAvF,GAAA,IAAAA,EACA,MAAAuF,GAAAuc,cAhBA,MAAA5B,EAAA3a,EAAAxQ,MAEAoS,GAAAmW,EAAA4C,EAkBA,OAAA/Y,IAGA+R,EAAAvB,EAAAoK,WAGA5I,YAAA,GAEA6I,aAAA5I,EAEAxlB,MAAAirB,GAEArF,cAEAxsB,QAEAqvB,UACA4F,KAAApc,IAAA,aAAAwQ,OAAA,GACA6L,KAAArc,IAAA,cACAsc,KAAAtc,IAAA,kBAAAwQ,OAAA,GACA+L,KAAAvc,IAAA,oBAGA4V,WACAwD,KAAA,SAAArrB,GAUA,MATAA,GAAA,GAAAA,EAAA,GAAA7D,QAAA0vB,GAAAC,IAGA9rB,EAAA,IAAAA,EAAA,IAAAA,EAAA,IAAAA,EAAA,IAAA,IAAA7D,QAAA0vB,GAAAC,IAEA,OAAA9rB,EAAA,KACAA,EAAA,GAAA,IAAAA,EAAA,GAAA,KAGAA,EAAA3J,MAAA,EAAA,IAGAk1B,MAAA,SAAAvrB,GA6BA,MAlBAA,GAAA,GAAAA,EAAA,GAAApG,cAEA,QAAAoG,EAAA,GAAA3J,MAAA,EAAA,IAEA2J,EAAA,IACA+jB,EAAArD,MAAA1gB,EAAA,IAKAA,EAAA,KAAAA,EAAA,GAAAA,EAAA,IAAAA,EAAA,IAAA,GAAA,GAAA,SAAAA,EAAA,IAAA,QAAAA,EAAA,KACAA,EAAA,KAAAA,EAAA,GAAAA,EAAA,IAAA,QAAAA,EAAA,KAGAA,EAAA,IACA+jB,EAAArD,MAAA1gB,EAAA,IAGAA,GAGAsrB,OAAA,SAAAtrB,GACA,GAAAyuB,GACAC,GAAA1uB,EAAA,IAAAA,EAAA,EAEA,OAAAirB,IAAA,MAAAxsB,KAAAuB,EAAA,IACA,MAIAA,EAAA,GACAA,EAAA,GAAAA,EAAA,IAAAA,EAAA,IAAA,GAGA0uB,GAAA3D,GAAAtsB,KAAAiwB,KAEAD,EAAAlnB,EAAAmnB,GAAA,MAEAD,EAAAC,EAAAz1B,QAAA,IAAAy1B,EAAAzzB,OAAAwzB,GAAAC,EAAAzzB,UAGA+E,EAAA,GAAAA,EAAA,GAAA3J,MAAA,EAAAo4B,GACAzuB,EAAA,GAAA0uB,EAAAr4B,MAAA,EAAAo4B,IAIAzuB,EAAA3J,MAAA,EAAA,MAIAwb,QAEAuZ,IAAA,SAAAuD,GACA,GAAAjwB,GAAAiwB,EAAAxyB,QAAA0vB,GAAAC,IAAAlyB,aACA,OAAA,MAAA+0B,EACA,WAAA,OAAA,GACA,SAAAhd,GACA,MAAAA,GAAAjT,UAAAiT,EAAAjT,SAAA9E,gBAAA8E,IAIAysB,MAAA,SAAA91B,GACA,GAAAu5B,GAAA5E,EAAA30B,EAAA,IAEA,OAAAu5B,KACAA,EAAA,GAAAvuB,QAAA,MAAAiqB,GAAA,IAAAj1B,EAAA,IAAAi1B,GAAA,SACAN,EAAA30B,EAAA,SAAAsc,GACA,MAAAid,GAAAnwB,KAAA,gBAAAkT,GAAAtc,WAAAsc,EAAAtc,WAAA,mBAAAsc,GAAA3U,cAAA2U,EAAA3U,aAAA,UAAA,OAIAquB,KAAA,SAAAra,EAAA6d,EAAAC,GACA,MAAA,UAAAnd,GACA,GAAAkL,GAAAkH,EAAApqB,KAAAgY,EAAAX,EAEA,OAAA,OAAA6L,EACA,OAAAgS,GAEAA,IAIAhS,GAAA,GAEA,MAAAgS,EAAAhS,IAAAiS,EACA,OAAAD,EAAAhS,IAAAiS,EACA,OAAAD,EAAAC,GAAA,IAAAjS,EAAA5jB,QAAA61B,GACA,OAAAD,EAAAC,GAAAjS,EAAA5jB,QAAA61B,MACA,OAAAD,EAAAC,GAAAjS,EAAAxmB,OAAAy4B,EAAA7zB,UAAA6zB,EACA,OAAAD,GAAA,IAAAhS,EAAA1gB,QAAAwuB,GAAA,KAAA,KAAA1xB,QAAA61B,MACA,OAAAD,IAAAhS,IAAAiS,GAAAjS,EAAAxmB,MAAA,EAAAy4B,EAAA7zB,OAAA,KAAA6zB,EAAA,QAKAvD,MAAA,SAAAzpB,EAAAitB,EAAA1I,EAAA5D,EAAA5R,GACA,GAAAme,GAAA,QAAAltB,EAAAzL,MAAA,EAAA,GACA44B,EAAA,SAAAntB,EAAAzL,UACA64B,EAAA,YAAAH,CAEA,OAAA,KAAAtM,GAAA,IAAA5R,EAGA,SAAAc,GACA,QAAAA,EAAAnT,YAGA,SAAAmT,EAAAtF,EAAA0a,GACA,GAAA1b,GAAA4b,EAAAqF,EAAAxG,EAAAqJ,EAAA7S,EACArK,EAAA+c,IAAAC,EAAA,cAAA,kBACA30B,EAAAqX,EAAAnT,WACAwS,EAAAke,GAAAvd,EAAAjT,SAAA9E,cACAw1B,GAAArI,IAAAmI,CAEA,IAAA50B,EAAA,CAGA,GAAA00B,EAAA,CACA,KAAA/c,GAAA,CAEA,IADAqa,EAAA3a,EACA2a,EAAAA,EAAAra,IACA,GAAAid,EAAA5C,EAAA5tB,SAAA9E,gBAAAoX,EAAA,IAAAsb,EAAAlgB,SACA,OAAA,CAIAkQ,GAAArK,EAAA,SAAAnQ,IAAAwa,GAAA,cAEA,OAAA,EAMA,GAHAA,GAAA2S,EAAA30B,EAAA8C,WAAA9C,EAAA+0B,WAGAJ,GAAAG,GAQA,IANAnI,EAAA3sB,EAAAoZ,KAAApZ,EAAAoZ,OACArI,EAAA4b,EAAAnlB,OACAqtB,EAAA9jB,EAAA,KAAA8b,GAAA9b,EAAA,GACAya,EAAAza,EAAA,KAAA8b,GAAA9b,EAAA,GACAihB,EAAA6C,GAAA70B,EAAApE,WAAAi5B,GAEA7C,IAAA6C,GAAA7C,GAAAA,EAAAra,KAGA6T,EAAAqJ,EAAA,IAAA7S,EAAAjT,OAGA,GAAA,IAAAijB,EAAAlgB,YAAA0Z,GAAAwG,IAAA3a,EAAA,CACAsV,EAAAnlB,IAAAqlB,EAAAgI,EAAArJ,EACA,YAKA,IAAAsJ,IAAA/jB,GAAAsG,EAAA+B,KAAA/B,EAAA+B,QAAA5R,KAAAuJ,EAAA,KAAA8b,EACArB,EAAAza,EAAA,OAKA,OAAAihB,IAAA6C,GAAA7C,GAAAA,EAAAra,KACA6T,EAAAqJ,EAAA,IAAA7S,EAAAjT,UAEA6lB,EAAA5C,EAAA5tB,SAAA9E,gBAAAoX,EAAA,IAAAsb,EAAAlgB,cAAA0Z,IAEAsJ,KACA9C,EAAA5Y,KAAA4Y,EAAA5Y,QAAA5R,IAAAqlB,EAAArB,IAGAwG,IAAA3a,MASA,MADAmU,IAAAjV,EACAiV,IAAArD,GAAAqD,EAAArD,IAAA,GAAAqD,EAAArD,GAAA,KAKA6I,OAAA,SAAAgE,EAAAjJ,GAKA,GAAA7a,GACAP,EAAAqa,EAAAoF,QAAA4E,IAAAhK,EAAAiB,WAAA+I,EAAA11B,gBACAmqB,EAAArD,MAAA,uBAAA4O,EAKA,OAAArkB,GAAAyI,GACAzI,EAAAob,GAIApb,EAAAhQ,OAAA,GACAuQ,GAAA8jB,EAAAA,EAAA,GAAAjJ,GACAf,EAAAiB,WAAA9E,eAAA6N,EAAA11B,eACA4rB,EAAA,SAAAxB,EAAAlW,GAIA,IAHA,GAAAyhB,GACAC,EAAAvkB,EAAA+Y,EAAAqC,GACAllB,EAAAquB,EAAAv0B,OACAkG,KACAouB,EAAAt2B,GAAA+qB,EAAAwL,EAAAruB,IACA6iB,EAAAuL,KAAAzhB,EAAAyhB,GAAAC,EAAAruB,MAGA,SAAAwQ,GACA,MAAA1G,GAAA0G,EAAA,EAAAnG,KAIAP,IAIAyf,SAEAlZ,IAAAgU,EAAA,SAAA7D,GAIA,GAAA1b,MACAud,KACAkD,EAAAkD,EAAAjI,EAAAxlB,QAAAylB,GAAA,MAEA,OAAA8E,GAAAhT,GACA8R,EAAA,SAAAxB,EAAAlW,EAAAzB,EAAA0a,GAMA,IALA,GAAApV,GACA8V,EAAAf,EAAA1C,EAAA,KAAA+C,MACA5lB,EAAA6iB,EAAA/oB,OAGAkG,MACAwQ,EAAA8V,EAAAtmB,MACA6iB,EAAA7iB,KAAA2M,EAAA3M,GAAAwQ,MAIA,SAAAA,EAAAtF,EAAA0a,GAKA,MAJA9gB,GAAA,GAAA0L,EACA+U,EAAAzgB,EAAA,KAAA8gB,EAAAvD,GAEAvd,EAAA,GAAA,MACAud,EAAAna,SAIAomB,IAAAjK,EAAA,SAAA7D,GACA,MAAA,UAAAhQ,GACA,MAAAoS,GAAApC,EAAAhQ,GAAA1W,OAAA,KAIA0pB,SAAAa,EAAA,SAAAnrB,GAEA,MADAA,GAAAA,EAAA8B,QAAA0vB,GAAAC,IACA,SAAAna,GACA,OAAAA,EAAAsc,aAAAtc,EAAA+d,WAAAhG,EAAA/X,IAAA1Y,QAAAoB,SAWAs1B,KAAAnK,EAAA,SAAAmK,GAMA,MAJA3E,IAAAvsB,KAAAkxB,GAAA,KACA5L,EAAArD,MAAA,qBAAAiP,GAEAA,EAAAA,EAAAxzB,QAAA0vB,GAAAC,IAAAlyB,cACA,SAAA+X,GACA,GAAAie,EACA,GACA,IAAAA,EAAAnL,EACA9S,EAAAge,KACAhe,EAAA3U,aAAA,aAAA2U,EAAA3U,aAAA,QAGA,MADA4yB,GAAAA,EAAAh2B,cACAg2B,IAAAD,GAAA,IAAAC,EAAA32B,QAAA02B,EAAA,YAEAhe,EAAAA,EAAAnT,aAAA,IAAAmT,EAAAvF,SACA,QAAA,KAKA9U,OAAA,SAAAqa,GACA,GAAAke,GAAAl5B,EAAAsF,UAAAtF,EAAAsF,SAAA4zB,IACA,OAAAA,IAAAA,EAAAx5B,MAAA,KAAAsb,EAAAxT,IAGA/B,KAAA,SAAAuV,GACA,MAAAA,KAAA5O,GAGA+sB,MAAA,SAAAne,GACA,MAAAA,KAAA1c,EAAAyf,iBAAAzf,EAAA86B,UAAA96B,EAAA86B,gBAAApe,EAAA7P,MAAA6P,EAAA9D,OAAA8D,EAAAqe,WAIAC,QAAA,SAAAte,GACA,MAAAA,GAAAue,YAAA,GAGAA,SAAA,SAAAve,GACA,MAAAA,GAAAue,YAAA,GAGAza,QAAA,SAAA9D,GAGA,GAAAjT,GAAAiT,EAAAjT,SAAA9E,aACA,OAAA,UAAA8E,KAAAiT,EAAA8D,SAAA,WAAA/W,KAAAiT,EAAAwF,UAGAA,SAAA,SAAAxF,GAOA,MAJAA,GAAAnT,YACAmT,EAAAnT,WAAA2xB,cAGAxe,EAAAwF,YAAA,GAIAvb,MAAA,SAAA+V,GAKA,IAAAA,EAAAA,EAAAvU,WAAAuU,EAAAA,EAAAA,EAAAsU,YACA,GAAAtU,EAAAvF,SAAA,EACA,OAAA,CAGA,QAAA,GAGA9R,OAAA,SAAAqX,GACA,OAAA2T,EAAAoF,QAAA,MAAA/Y,IAIAye,OAAA,SAAAze,GACA,MAAAga,IAAAltB,KAAAkT,EAAAjT,WAGAuH,MAAA,SAAA0L,GACA,MAAA+Z,IAAAjtB,KAAAkT,EAAAjT,WAGA2xB,OAAA,SAAA1e,GACA,GAAAX,GAAAW,EAAAjT,SAAA9E,aACA,OAAA,UAAAoX,GAAA,WAAAW,EAAA7P,MAAA,WAAAkP,GAGA3W,KAAA,SAAAsX,GACA,GAAAhY,EACA,OAAA,UAAAgY,EAAAjT,SAAA9E,eACA,SAAA+X,EAAA7P,OAIA,OAAAnI,EAAAgY,EAAA3U,aAAA,UAAA,SAAArD,EAAAC,gBAIA6oB,MAAA2D,EAAA,WACA,OAAA,KAGAvV,KAAAuV,EAAA,SAAAE,EAAArrB,GACA,OAAAA,EAAA,KAGAynB,GAAA0D,EAAA,SAAAE,EAAArrB,EAAAorB,GACA,OAAAA,EAAA,EAAAA,EAAAprB,EAAAorB,KAGAiK,KAAAlK,EAAA,SAAAE,EAAArrB,GAEA,IADA,GAAAkG,GAAA,EACAA,EAAAlG,EAAAkG,GAAA,EACAmlB,EAAA9mB,KAAA2B,EAEA,OAAAmlB,KAGAiK,IAAAnK,EAAA,SAAAE,EAAArrB,GAEA,IADA,GAAAkG,GAAA,EACAA,EAAAlG,EAAAkG,GAAA,EACAmlB,EAAA9mB,KAAA2B,EAEA,OAAAmlB,KAGAkK,GAAApK,EAAA,SAAAE,EAAArrB,EAAAorB,GAEA,IADA,GAAAllB,GAAAklB,EAAA,EAAAA,EAAAprB,EAAAorB,IACAllB,GAAA,GACAmlB,EAAA9mB,KAAA2B,EAEA,OAAAmlB,KAGAmK,GAAArK,EAAA,SAAAE,EAAArrB,EAAAorB,GAEA,IADA,GAAAllB,GAAAklB,EAAA,EAAAA,EAAAprB,EAAAorB,IACAllB,EAAAlG,GACAqrB,EAAA9mB,KAAA2B,EAEA,OAAAmlB,OAKAhB,EAAAoF,QAAA,IAAApF,EAAAoF,QAAA,EAGA,KAAAvpB,KAAAuvB,OAAA,EAAAC,UAAA,EAAAC,MAAA,EAAAC,UAAA,EAAAz4B,OAAA,GACAktB,EAAAoF,QAAAvpB,GAAA+kB,EAAA/kB,EAEA,KAAAA,KAAA2vB,QAAA,EAAAC,OAAA,GACAzL,EAAAoF,QAAAvpB,GAAAglB,EAAAhlB,EA4lBA,OAvlBAolB,GAAAvM,UAAAsL,EAAA0L,QAAA1L,EAAAoF,QACApF,EAAAiB,WAAA,GAAAA,GAEAhf,EAAAwc,EAAAxc,SAAA,SAAAoa,EAAAsP,GACA,GAAAzB,GAAAxvB,EAAAwmB,EAAA1kB,EACAovB,EAAAhN,EAAAiN,EACA/hB,EAAA6a,EAAAtI,EAAA,IAEA,IAAAvS,EACA,MAAA6hB,GAAA,EAAA7hB,EAAA/Y,MAAA,EAOA,KAJA66B,EAAAvP,EACAuC,KACAiN,EAAA7L,EAAAuC,UAEAqJ,GAAA,CAGA1B,KAAAxvB,EAAA4qB,GAAAvkB,KAAA6qB,MACAlxB,IAEAkxB,EAAAA,EAAA76B,MAAA2J,EAAA,GAAA/E,SAAAi2B,GAEAhN,EAAA1kB,KAAAgnB,OAGAgJ,GAAA,GAGAxvB,EAAA6qB,GAAAxkB,KAAA6qB,MACA1B,EAAAxvB,EAAAd,QACAsnB,EAAAhnB,MACAsH,MAAA0oB,EAEA1tB,KAAA9B,EAAA,GAAA7D,QAAAylB,GAAA,OAEAsP,EAAAA,EAAA76B,MAAAm5B,EAAAv0B,QAIA,KAAA6G,IAAAwjB,GAAAzT,SACA7R,EAAAirB,GAAAnpB,GAAAuE,KAAA6qB,KAAAC,EAAArvB,MACA9B,EAAAmxB,EAAArvB,GAAA9B,MACAwvB,EAAAxvB,EAAAd,QACAsnB,EAAAhnB,MACAsH,MAAA0oB,EACA1tB,KAAAA,EACAgM,QAAA9N,IAEAkxB,EAAAA,EAAA76B,MAAAm5B,EAAAv0B,QAIA,KAAAu0B,EACA,MAOA,MAAAyB,GACAC,EAAAj2B,OACAi2B,EACAnN,EAAArD,MAAAiB,GAEAsI,EAAAtI,EAAAuC,GAAA7tB,MAAA,IAwWAuzB,EAAA7F,EAAA6F,QAAA,SAAAjI,EAAA3hB,GACA,GAAAmB,GACA6nB,KACAD,KACA3Z,EAAA8a,EAAAvI,EAAA,IAEA,KAAAvS,EAAA,CAMA,IAJApP,IACAA,EAAAuH,EAAAoa,IAEAxgB,EAAAnB,EAAA/E,OACAkG,KACAiO,EAAAkZ,EAAAtoB,EAAAmB,IACAiO,EAAAsE,GACAsV,EAAAxpB,KAAA4P,GAEA2Z,EAAAvpB,KAAA4P,EAKAA,GAAA8a,EAAAvI,EAAAmH,EAAAC,EAAAC,IAGA5Z,EAAAuS,SAAAA,EAEA,MAAAvS,IAYA+V,EAAApB,EAAAoB,OAAA,SAAAxD,EAAAtV,EAAAmX,EAAAQ,GACA,GAAA7iB,GAAAqlB,EAAA4K,EAAAtvB,EAAA1I,EACAi4B,EAAA,kBAAA1P,IAAAA,EACA3hB,GAAAgkB,GAAAzc,EAAAoa,EAAA0P,EAAA1P,UAAAA,EAKA,IAHA6B,EAAAA,MAGA,IAAAxjB,EAAA/E,OAAA,CAIA,GADAurB,EAAAxmB,EAAA,GAAAA,EAAA,GAAA3J,MAAA,GACAmwB,EAAAvrB,OAAA,GAAA,QAAAm2B,EAAA5K,EAAA,IAAA1kB,MACAuS,EAAAqY,SAAA,IAAArgB,EAAAD,UAAAqY,GACAa,EAAAmD,SAAAjC,EAAA,GAAA1kB,MAAA,CAGA,GADAuK,GAAAiZ,EAAAlsB,KAAA,GAAAg4B,EAAAtjB,QAAA,GAAA3R,QAAA0vB,GAAAC,IAAAzf,QAAA,IACAA,EACA,MAAAmX,EAGA6N,KACAhlB,EAAAA,EAAA7N,YAGAmjB,EAAAA,EAAAtrB,MAAAmwB,EAAAtnB,QAAA4H,MAAA7L,QAKA,IADAkG,EAAA8pB,GAAA,aAAAxsB,KAAAkjB,GAAA,EAAA6E,EAAAvrB,OACAkG,MACAiwB,EAAA5K,EAAArlB,IAGAmkB,EAAAmD,SAAA3mB,EAAAsvB,EAAAtvB,QAGA,IAAA1I,EAAAksB,EAAAlsB,KAAA0I,MAEAkiB,EAAA5qB,EACAg4B,EAAAtjB,QAAA,GAAA3R,QAAA0vB,GAAAC,IACA9G,GAAAvmB,KAAA+nB,EAAA,GAAA1kB,OAAAmjB,EAAA5Y,EAAA7N,aAAA6N,IACA,CAKA,GAFAma,EAAAxoB,OAAAmD,EAAA,GACAwgB,EAAAqC,EAAA/oB,QAAA8pB,EAAAyB,IACA7E,EAEA,MADAniB,GAAAwO,MAAAwV,EAAAQ,GACAR,CAGA,QAeA,OAPA6N,GAAAzH,EAAAjI,EAAA3hB,IACAgkB,EACA3X,GACAoY,EACAjB,EACAwB,GAAAvmB,KAAAkjB,IAAAsD,EAAA5Y,EAAA7N,aAAA6N,GAEAmX,GAMAnP,EAAA2Z,WAAAta,EAAA1U,MAAA,IAAAvE,KAAA0vB,GAAAhrB,KAAA,MAAAuU,EAIAW,EAAA0Z,mBAAAjE,EAGAtF,IAIAnQ,EAAAmZ,aAAA/H,EAAA,SAAA6L,GAEA,MAAA,GAAAA,EAAAlE,wBAAAn4B,EAAAG,cAAA,UAMAqwB,EAAA,SAAAlX,GAEA,MADAA,GAAAvY,UAAA,mBACA,MAAAuY,EAAAnR,WAAAJ,aAAA,WAEA0oB,EAAA,yBAAA,SAAA/T,EAAAX,EAAA2Y,GACA,IAAAA,EACA,MAAAhY,GAAA3U,aAAAgU,EAAA,SAAAA,EAAApX,cAAA,EAAA,KAOAya,EAAAoW,YAAAhF,EAAA,SAAAlX,GAGA,MAFAA,GAAAvY,UAAA,WACAuY,EAAAnR,WAAAH,aAAA,QAAA,IACA,KAAAsR,EAAAnR,WAAAJ,aAAA,YAEA0oB,EAAA,QAAA,SAAA/T,EAAAX,EAAA2Y,GACA,IAAAA,GAAA,UAAAhY,EAAAjT,SAAA9E,cACA,MAAA+X,GAAAyF,eAOAqO,EAAA,SAAAlX,GACA,MAAA,OAAAA,EAAAvR,aAAA,eAEA0oB,EAAA2E,GAAA,SAAA1Y,EAAAX,EAAA2Y,GACA,GAAA5vB,EACA,KAAA4vB,EACA,MAAAhY,GAAAX,MAAA,EAAAA,EAAApX,eACAG,EAAA4X,EAAAkb,iBAAA7b,KAAAjX,EAAA8zB,UACA9zB,EAAA+M,MACA,OAKAid,GAEAptB,EAIAf,IAAAwD,KAAA2qB,GACAnuB,GAAAg4B,KAAA7J,GAAAoK,UACAv4B,GAAAg4B,KAAA,KAAAh4B,GAAAg4B,KAAAlD,QACA90B,GAAA27B,OAAAxN,GAAA0F,WACA7zB,GAAAyE,KAAA0pB,GAAA2F,QACA9zB,GAAA47B,SAAAzN,GAAA4F,MACA/zB,GAAA+uB,SAAAZ,GAAAY,QAIA,IAAA8M,IAAA77B,GAAAg4B,KAAA5tB,MAAAyrB,aAEAiG,GAAA,6BAIA9f,GAAA,gBAgCAhc,IAAAic,OAAA,SAAA+b,EAAA1Y,EAAA1D,GACA,GAAAG,GAAAuD,EAAA,EAMA,OAJA1D,KACAoc,EAAA,QAAAA,EAAA,KAGA,IAAA1Y,EAAAja,QAAA,IAAA0W,EAAAvF,SACAxW,GAAAwD,KAAA0zB,gBAAAnb,EAAAic,IAAAjc,MACA/b,GAAAwD,KAAA0U,QAAA8f,EAAAh4B,GAAA8b,KAAAwD,EAAA,SAAAvD,GACA,MAAA,KAAAA,EAAAvF,aAIAxW,GAAAqV,GAAA8I,QACA3a,KAAA,SAAAuoB,GACA,GAAAxgB,GACAoS,KACAoe,EAAAz4B,KACA2M,EAAA8rB,EAAA12B,MAEA,IAAA,gBAAA0mB,GACA,MAAAzoB,MAAAopB,UAAA1sB,GAAA+rB,GAAA9P,OAAA,WACA,IAAA1Q,EAAA,EAAAA,EAAA0E,EAAA1E,IACA,GAAAvL,GAAA+uB,SAAAgN,EAAAxwB,GAAAjI,MACA,OAAA,IAMA,KAAAiI,EAAA,EAAAA,EAAA0E,EAAA1E,IACAvL,GAAAwD,KAAAuoB,EAAAgQ,EAAAxwB,GAAAoS,EAMA,OAFAA,GAAAra,KAAAopB,UAAAzc,EAAA,EAAAjQ,GAAA27B,OAAAhe,GAAAA,GACAA,EAAAoO,SAAAzoB,KAAAyoB,SAAAzoB,KAAAyoB,SAAA,IAAAA,EAAAA,EACApO,GAEA1B,OAAA,SAAA8P,GACA,MAAAzoB,MAAAopB,UAAAhR,EAAApY,KAAAyoB,OAAA,KAEAnQ,IAAA,SAAAmQ,GACA,MAAAzoB,MAAAopB,UAAAhR,EAAApY,KAAAyoB,OAAA,KAEAiQ,GAAA,SAAAjQ,GACA,QAAArQ,EACApY,KAIA,gBAAAyoB,IAAA8P,GAAAhzB,KAAAkjB,GACA/rB,GAAA+rB,GACAA,OACA,GACA1mB,SASA,IAAA42B,IAGA58B,GAAA0B,EAAA1B,SAKAyvB,GAAA,sCAEAjjB,GAAA7L,GAAAqV,GAAAxJ,KAAA,SAAAkgB,EAAAtV,GACA,GAAArM,GAAA2R,CAGA,KAAAgQ,EACA,MAAAzoB,KAIA,IAAA,gBAAAyoB,GAAA,CAUA,GAPA3hB,EAFA,MAAA2hB,EAAAha,OAAA,IAAA,MAAAga,EAAAha,OAAAga,EAAA1mB,OAAA,IAAA0mB,EAAA1mB,QAAA,GAEA,KAAA0mB,EAAA,MAGA+C,GAAAre,KAAAsb,IAIA3hB,IAAAA,EAAA,IAAAqM,EAsDA,OAAAA,GAAAA,EAAA6V,QACA7V,GAAAwlB,IAAAz4B,KAAAuoB,GAKAzoB,KAAAipB,YAAA9V,GAAAjT,KAAAuoB,EAzDA,IAAA3hB,EAAA,GAAA,CAYA,GAXAqM,EAAAA,YAAAzW,IAAAyW,EAAA,GAAAA,EAIAzW,GAAAyf,MAAAnc,KAAAtD,GAAAk8B,UACA9xB,EAAA,GACAqM,GAAAA,EAAAD,SAAAC,EAAAuJ,eAAAvJ,EAAApX,IACA,IAIAy8B,GAAAjzB,KAAAuB,EAAA,KAAApK,GAAAitB,cAAAxW,GACA,IAAArM,IAAAqM,GAEAzW,GAAA6b,WAAAvY,KAAA8G,IACA9G,KAAA8G,GAAAqM,EAAArM,IAIA9G,KAAAS,KAAAqG,EAAAqM,EAAArM,GAKA,OAAA9G,MAQA,GAJAyY,EAAA1c,GAAAC,eAAA8K,EAAA,IAIA2R,GAAAA,EAAAnT,WAAA,CAGA,GAAAmT,EAAAxT,KAAA6B,EAAA,GACA,MAAA6xB,IAAAz4B,KAAAuoB,EAIAzoB,MAAA+B,OAAA,EACA/B,KAAA,GAAAyY,EAKA,MAFAzY,MAAAmT,QAAApX,GACAiE,KAAAyoB,SAAAA,EACAzoB,KAcA,MAAAyoB,GAAAvV,UACAlT,KAAAmT,QAAAnT,KAAA,GAAAyoB,EACAzoB,KAAA+B,OAAA,EACA/B,MAIAtD,GAAA6b,WAAAkQ,GACA,mBAAAkQ,IAAAjf,MACAif,GAAAjf,MAAA+O,GAEAA,EAAA/rB,KAGAmD,SAAA4oB,EAAAA,WACAzoB,KAAAyoB,SAAAA,EAAAA,SACAzoB,KAAAmT,QAAAsV,EAAAtV,SAGAzW,GAAA0tB,UAAA3B,EAAAzoB,OAIAuI,IAAAuY,UAAApkB,GAAAqV,GAGA4mB,GAAAj8B,GAAAX,GAGA,IAAA88B,IAAA,iCAEAC,IACAC,UAAA,EACArS,UAAA,EACAsS,MAAA,EACA3R,MAAA,EAGA3qB,IAAAme,QACA9B,IAAA,SAAAN,EAAAM,EAAAkgB,GAIA,IAHA,GAAA3C,MACAxd,EAAAL,EAAAM,GAEAD,GAAA,IAAAA,EAAA5F,WAAArT,SAAAo5B,GAAA,IAAAngB,EAAA5F,WAAAxW,GAAAoc,GAAA4f,GAAAO,KACA,IAAAngB,EAAA5F,UACAojB,EAAAhwB,KAAAwS,GAEAA,EAAAA,EAAAC,EAEA,OAAAud,IAGAzd,QAAA,SAAAqgB,EAAAzgB,GAGA,IAFA,GAAA0gB,MAEAD,EAAAA,EAAAA,EAAAnM,YACA,IAAAmM,EAAAhmB,UAAAgmB,IAAAzgB,GACA0gB,EAAA7yB,KAAA4yB,EAIA,OAAAC,MAIAz8B,GAAAqV,GAAA8I,QACA0b,IAAA,SAAAn4B,GACA,GAAA6J,GACAmxB,EAAA18B,GAAA0B,EAAA4B,MACA2M,EAAAysB,EAAAr3B,MAEA,OAAA/B,MAAA2Y,OAAA,WACA,IAAA1Q,EAAA,EAAAA,EAAA0E,EAAA1E,IACA,GAAAvL,GAAA+uB,SAAAzrB,KAAAo5B,EAAAnxB,IACA,OAAA,KAMAoxB,QAAA,SAAApE,EAAA9hB,GASA,IARA,GAAA2F,GACA7Q,EAAA,EACAmV,EAAApd,KAAA+B,OACAu0B,KACAjpB,EAAAkrB,GAAAhzB,KAAA0vB,IAAA,gBAAAA,GACAv4B,GAAAu4B,EAAA9hB,GAAAnT,KAAAmT,SACA,EAEAlL,EAAAmV,EAAAnV,IACA,IAAA6Q,EAAA9Y,KAAAiI,GAAA6Q,GAAAA,IAAA3F,EAAA2F,EAAAA,EAAAxT,WAEA,GAAAwT,EAAA5F,SAAA,KAAA7F,EACAA,EAAA9M,MAAAuY,MAGA,IAAAA,EAAA5F,UACAxW,GAAAwD,KAAA0zB,gBAAA9a,EAAAmc,IAAA,CAEAqB,EAAAhwB,KAAAwS,EACA,OAKA,MAAA9Y,MAAAopB,UAAAkN,EAAAv0B,OAAA,EAAArF,GAAA27B,OAAA/B,GAAAA,IAKA/1B,MAAA,SAAAkY,GAGA,MAAAA,GAKA,gBAAAA,GACA/b,GAAAkc,QAAA5Y,KAAA,GAAAtD,GAAA+b,IAIA/b,GAAAkc,QAEAH,EAAAuQ,OAAAvQ,EAAA,GAAAA,EAAAzY,MAXAA,KAAA,IAAAA,KAAA,GAAAsF,WAAAtF,KAAAupB,QAAA+P,UAAAv3B,WAcA0b,IAAA,SAAAgL,EAAAtV,GACA,MAAAnT,MAAAopB,UACA1sB,GAAA27B,OACA37B,GAAAyf,MAAAnc,KAAA+e,MAAAriB,GAAA+rB,EAAAtV,OAKAomB,QAAA,SAAA9Q,GACA,MAAAzoB,MAAAyd,IAAA,MAAAgL,EACAzoB,KAAAqpB,WAAArpB,KAAAqpB,WAAA1Q,OAAA8P,OAaA/rB,GAAAkD,MACAwB,OAAA,SAAAqX,GACA,GAAArX,GAAAqX,EAAAnT,UACA,OAAAlE,IAAA,KAAAA,EAAA8R,SAAA9R,EAAA,MAEAo4B,QAAA,SAAA/gB,GACA,MAAA/b,IAAAqc,IAAAN,EAAA,eAEAghB,aAAA,SAAAhhB,EAAAxQ,EAAAgxB,GACA,MAAAv8B,IAAAqc,IAAAN,EAAA,aAAAwgB,IAEAD,KAAA,SAAAvgB,GACA,MAAAI,GAAAJ,EAAA,gBAEA4O,KAAA,SAAA5O,GACA,MAAAI,GAAAJ,EAAA,oBAEAihB,QAAA,SAAAjhB,GACA,MAAA/b,IAAAqc,IAAAN,EAAA,gBAEA6gB,QAAA,SAAA7gB,GACA,MAAA/b,IAAAqc,IAAAN,EAAA,oBAEAkhB,UAAA,SAAAlhB,EAAAxQ,EAAAgxB,GACA,MAAAv8B,IAAAqc,IAAAN,EAAA,cAAAwgB,IAEAW,UAAA,SAAAnhB,EAAAxQ,EAAAgxB,GACA,MAAAv8B,IAAAqc,IAAAN,EAAA,kBAAAwgB,IAEAY,SAAA,SAAAphB,GACA,MAAA/b,IAAAmc,SAAAJ,EAAAnT,gBAAApB,WAAAuU,IAEAsgB,SAAA,SAAAtgB,GACA,MAAA/b,IAAAmc,QAAAJ,EAAAvU,aAEAwiB,SAAA,SAAAjO,GACA,MAAA/b,IAAA8I,SAAAiT,EAAA,UACAA,EAAAgG,iBAAAhG,EAAA+F,cAAAziB,SACAW,GAAAyf,SAAA1D,EAAAzb,cAEA,SAAA8a,EAAA/F,GACArV,GAAAqV,GAAA+F,GAAA,SAAAmhB,EAAAxQ,GACA,GAAApO,GAAA3d,GAAAqI,IAAA/E,KAAA+R,EAAAknB,EAsBA,OApBA,UAAAnhB,EAAA3a,YACAsrB,EAAAwQ,GAGAxQ,GAAA,gBAAAA,KACApO,EAAA3d,GAAAic,OAAA8P,EAAApO,IAGAra,KAAA+B,OAAA,IAEA+2B,GAAAhhB,KACAuC,EAAA3d,GAAA27B,OAAAhe,IAIAwe,GAAAtzB,KAAAuS,KACAuC,EAAAA,EAAAyf,YAIA95B,KAAAopB,UAAA/O,KAGA,IAAAlB,IAAA,OAKAD,KAiCAxc,IAAAq9B,UAAA,SAAAr8B,GAIAA,EAAA,gBAAAA,GACAwb,GAAAxb,IAAAsb,EAAAtb,GACAhB,GAAAme,UAAAnd,EAEA,IACAs8B,GAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EAEA1e,KAEA2e,GAAA58B,EAAA68B,SAEA/X,EAAA,SAAAviB,GAOA,IANAg6B,EAAAv8B,EAAAu8B,QAAAh6B,EACAi6B,GAAA,EACAE,EAAAC,GAAA,EACAA,EAAA,EACAF,EAAAxe,EAAA5Z,OACAi4B,GAAA,EACAre,GAAAye,EAAAD,EAAAC,IACA,GAAAze,EAAAye,GAAAtlB,MAAA7U,EAAA,GAAAA,EAAA,OAAA,GAAAvC,EAAA88B,YAAA,CACAP,GAAA,CACA,OAGAD,GAAA,EACAre,IACA2e,EACAA,EAAAv4B,QACAygB,EAAA8X,EAAAt0B,SAEAi0B,EACAte,KAEA8c,EAAAgC,YAKAhC,GAEAhb,IAAA,WACA,GAAA9B,EAAA,CAEA,GAAAyH,GAAAzH,EAAA5Z,QACA,QAAA0b,GAAAnL,GACA5V,GAAAkD,KAAA0S,EAAA,SAAAuF,EAAA8S,GACA,GAAA/hB,GAAAlM,GAAAkM,KAAA+hB,EACA,cAAA/hB,EACAlL,EAAA26B,QAAAI,EAAAlC,IAAA5L,IACAhP,EAAArV,KAAAqkB,GAEAA,GAAAA,EAAA5oB,QAAA,WAAA6G,GAEA6U,EAAAkN,MAGApY,WAGAynB,EACAG,EAAAxe,EAAA5Z,OAGAk4B,IACAI,EAAAjX,EACAZ,EAAAyX,IAGA,MAAAj6B,OAGAvB,OAAA,WAkBA,MAjBAkd,IACAjf,GAAAkD,KAAA2S,UAAA,SAAAsF,EAAA8S,GAEA,IADA,GAAApqB,IACAA,EAAA7D,GAAAkc,QAAA+R,EAAAhP,EAAApb,QACAob,EAAA7W,OAAAvE,EAAA,GAEAy5B,IACAz5B,GAAA45B,GACAA,IAEA55B,GAAA65B,GACAA,OAMAp6B,MAIAu2B,IAAA,SAAAxkB,GACA,MAAAA,GAAArV,GAAAkc,QAAA7G,EAAA4J,SAAAA,IAAAA,EAAA5Z,SAGAW,MAAA,WAGA,MAFAiZ,MACAwe,EAAA,EACAn6B,MAGAy6B,QAAA,WAEA,MADA9e,GAAA2e,EAAAL,EAAAp6B,OACAG,MAGAg3B,SAAA,WACA,OAAArb,GAGA+e,KAAA,WAKA,MAJAJ,GAAAz6B,OACAo6B,GACAxB,EAAAgC,UAEAz6B,MAGA26B,OAAA,WACA,OAAAL,GAGAM,SAAA,SAAAznB,EAAAb,GAUA,OATAqJ,GAAAue,IAAAI,IACAhoB,EAAAA,MACAA,GAAAa,EAAAb,EAAAnV,MAAAmV,EAAAnV,QAAAmV,GACA0nB,EACAM,EAAAh0B,KAAAgM,GAEAkQ,EAAAlQ,IAGAtS,MAGAwiB,KAAA,WAEA,MADAiW,GAAAmC,SAAA56B,KAAAuS,WACAvS,MAGAk6B,MAAA,WACA,QAAAA,GAIA,OAAAzB,IAIA/7B,GAAAme,QAEAkJ,SAAA,SAAAzM,GACA,GAAAujB,KAEA,UAAA,OAAAn+B,GAAAq9B,UAAA,eAAA,aACA,SAAA,OAAAr9B,GAAAq9B,UAAA,eAAA,aACA,SAAA,WAAAr9B,GAAAq9B,UAAA,YAEAvrB,EAAA,UACAkW,GACAlW,MAAA,WACA,MAAAA,IAEAiU,OAAA,WAEA,MADAqB,GAAAb,KAAA1Q,WAAA2S,KAAA3S,WACAvS,MAEA86B,KAAA,WACA,GAAAC,GAAAxoB,SACA,OAAA7V,IAAAqnB,SAAA,SAAAiX,GACAt+B,GAAAkD,KAAAi7B,EAAA,SAAA5yB,EAAAgzB,GACA,GAAAlpB,GAAArV,GAAA6b,WAAAwiB,EAAA9yB,KAAA8yB,EAAA9yB,EAEA6b,GAAAmX,EAAA,IAAA,WACA,GAAAC,GAAAnpB,GAAAA,EAAA+C,MAAA9U,KAAAuS,UACA2oB,IAAAx+B,GAAA6b,WAAA2iB,EAAAxW,SACAwW,EAAAxW,UACAzB,KAAA+X,EAAAG,SACAjW,KAAA8V,EAAAI,QACAnW,SAAA+V,EAAAK,QAEAL,EAAAC,EAAA,GAAA,QAAAj7B,OAAA0kB,EAAAsW,EAAAtW,UAAA1kB,KAAA+R,GAAAmpB,GAAA3oB,eAIAwoB,EAAA,OACArW,WAIAA,QAAA,SAAA7S,GACA,MAAA,OAAAA,EAAAnV,GAAAme,OAAAhJ,EAAA6S,GAAAA,IAGAZ,IAwCA,OArCAY,GAAA4W,KAAA5W,EAAAoW,KAGAp+B,GAAAkD,KAAAi7B,EAAA,SAAA5yB,EAAAgzB,GACA,GAAAtf,GAAAsf,EAAA,GACAM,EAAAN,EAAA,EAGAvW,GAAAuW,EAAA,IAAAtf,EAAA8B,IAGA8d,GACA5f,EAAA8B,IAAA,WAEAjP,EAAA+sB,GAGAV,EAAA,EAAA5yB,GAAA,GAAAwyB,QAAAI,EAAA,GAAA,GAAAH,MAIA5W,EAAAmX,EAAA,IAAA,WAEA,MADAnX,GAAAmX,EAAA,GAAA,QAAAj7B,OAAA8jB,EAAAY,EAAA1kB,KAAAuS,WACAvS,MAEA8jB,EAAAmX,EAAA,GAAA,QAAAtf,EAAAif,WAIAlW,EAAAA,QAAAZ,GAGAxM,GACAA,EAAAla,KAAA0mB,EAAAA,GAIAA,GAIA0X,KAAA,SAAAC,GACA,GAwBAC,GAAAC,EAAAC,EAxBA3zB,EAAA,EACA4zB,EAAA1+B,EAAAC,KAAAmV,WACAxQ,EAAA85B,EAAA95B,OAGAmiB,EAAA,IAAAniB,GAAA05B,GAAA/+B,GAAA6b,WAAAkjB,EAAA/W,SAAA3iB,EAAA,EAGA+hB,EAAA,IAAAI,EAAAuX,EAAA/+B,GAAAqnB,WAGA+X,EAAA,SAAA7zB,EAAAomB,EAAA7O,GACA,MAAA,UAAA5R,GACAygB,EAAApmB,GAAAjI,KACAwf,EAAAvX,GAAAsK,UAAAxQ,OAAA,EAAA5E,EAAAC,KAAAmV,WAAA3E,EACA4R,IAAAkc,EACA5X,EAAAU,WAAA6J,EAAA7O,KAEA0E,GACAJ,EAAAW,YAAA4J,EAAA7O,IAQA,IAAAzd,EAAA,EAIA,IAHA25B,EAAA,GAAA3R,OAAAhoB,GACA45B,EAAA,GAAA5R,OAAAhoB,GACA65B,EAAA,GAAA7R,OAAAhoB,GACAkG,EAAAlG,EAAAkG,IACA4zB,EAAA5zB,IAAAvL,GAAA6b,WAAAsjB,EAAA5zB,GAAAyc,SACAmX,EAAA5zB,GAAAyc,UACAzB,KAAA6Y,EAAA7zB,EAAA2zB,EAAAC,IACA3W,KAAApB,EAAAsX,QACAnW,SAAA6W,EAAA7zB,EAAA0zB,EAAAD,MAEAxX,CAUA,OAJAA,IACAJ,EAAAW,YAAAmX,EAAAC,GAGA/X,EAAAY,YAMA,IAAAqX,GAEAr/B,IAAAqV,GAAA2H,MAAA,SAAA3H,GAIA,MAFArV,IAAAgd,MAAAgL,UAAAzB,KAAAlR,GAEA/R,MAGAtD,GAAAme,QAEAgP,SAAA,EAIAmS,UAAA,EAGAC,UAAA,SAAAC,GACAA,EACAx/B,GAAAs/B,YAEAt/B,GAAAgd,OAAA,IAKAA,MAAA,SAAAnC,GAGA,GAAAA,KAAA,KAAA7a,GAAAs/B,WAAAt/B,GAAAmtB,QAAA,CAKA,IAAA9tB,GAAAyD,KACA,MAAAuH,YAAArK,GAAAgd,MAIAhd,IAAAmtB,SAAA,EAGAtS,KAAA,KAAA7a,GAAAs/B,UAAA,IAKAD,GAAAtX,YAAA1oB,IAAAW,KAGAA,GAAAqV,GAAAoqB,iBACAz/B,GAAAX,IAAAogC,eAAA,SACAz/B,GAAAX,IAAAqgC,IAAA,eA8BA1/B,GAAAgd,MAAAgL,QAAA,SAAA7S,GACA,IAAAkqB,GAOA,GALAA,GAAAr/B,GAAAqnB,WAKA,aAAAhoB,GAAAuI,WAEAyC,WAAArK,GAAAgd,WAGA,IAAA3d,GAAAsL,iBAEAtL,GAAAsL,iBAAA,mBAAAkS,GAAA,GAGA9b,EAAA4J,iBAAA,OAAAkS,GAAA,OAGA,CAEAxd,GAAAkW,YAAA,qBAAAsH,GAGA9b,EAAAwU,YAAA,SAAAsH,EAIA,IAAA+Z,IAAA,CAEA,KACAA,EAAA,MAAA71B,EAAA4+B,cAAAtgC,GAAAwD,gBACA,MAAAF,IAEAi0B,GAAAA,EAAAgJ,WACA,QAAAC,KACA,IAAA7/B,GAAAmtB,QAAA,CAEA,IAGAyJ,EAAAgJ,SAAA,QACA,MAAAj9B,GACA,MAAA0H,YAAAw1B,EAAA,IAIAljB,IAGA3c,GAAAgd,YAMA,MAAAqiB,IAAArX,QAAA7S,GAIA,IAMA5J,IANAiU,GAAA,WAOA,KAAAjU,KAAAvL,IAAAye,IACA,KAEAA,IAAA8O,QAAA,MAAAhiB,GAIAkT,GAAA0H,wBAAA,EAGAnmB,GAAA,WAEA,GAAAmE,GAAAwU,EAAA7V,EAAAg9B,CAEAh9B,GAAAzD,GAAAiL,qBAAA,QAAA,GACAxH,GAAAA,EAAApD,QAMAiZ,EAAAtZ,GAAAG,cAAA,OACAsgC,EAAAzgC,GAAAG,cAAA,OACAsgC,EAAApgC,MAAAmZ,QAAA,iEACA/V,EAAAyE,YAAAu4B,GAAAv4B,YAAAoR,SAEAA,GAAAjZ,MAAA0mB,OAAA5G,KAKA7G,EAAAjZ,MAAAmZ,QAAA,gEAEA4F,GAAA0H,uBAAAhiB,EAAA,IAAAwU,EAAAtN,YACAlH,IAIArB,EAAApD,MAAA0mB,KAAA,IAIAtjB,EAAAoG,YAAA42B,MAMA,WACA,GAAAnnB,GAAAtZ,GAAAG,cAAA,MAGA,IAAA,MAAAif,GAAAC,cAAA,CAEAD,GAAAC,eAAA,CACA,WACA/F,GAAA9P,KACA,MAAAlG,GACA8b,GAAAC,eAAA,GAKA/F,EAAA,QAOA3Y,GAAA0d,WAAA,SAAA3B,GACA,GAAAgkB,GAAA//B,GAAA+/B,QAAAhkB,EAAAjT,SAAA,KAAA9E,eACAwS,GAAAuF,EAAAvF,UAAA,CAGA,QAAA,IAAAA,GAAA,IAAAA,MAIAupB,GAAAA,KAAA,GAAAhkB,EAAA3U,aAAA,aAAA24B,GAIA,IAAA3iB,IAAA,gCACAD,GAAA,UAqOAnd,IAAAme,QACA1I,SAIAsqB,QACAC,WAAA,EACAC,UAAA,EAEAC,UAAA,8CAGAzf,QAAA,SAAA1E,GAEA,MADAA,GAAAA,EAAAvF,SAAAxW,GAAAyV,MAAAsG,EAAA/b,GAAA8d,UAAA/B,EAAA/b,GAAA8d,WACA/B,IAAAuB,EAAAvB,IAGAxY,KAAA,SAAAwY,EAAAX,EAAA7X,GACA,MAAAia,GAAAzB,EAAAX,EAAA7X,IAGA48B,WAAA,SAAApkB,EAAAX,GACA,MAAAiD,GAAAtC,EAAAX,IAIAkF,MAAA,SAAAvE,EAAAX,EAAA7X,GACA,MAAAia,GAAAzB,EAAAX,EAAA7X,GAAA,IAGAkjB,YAAA,SAAA1K,EAAAX,GACA,MAAAiD,GAAAtC,EAAAX,GAAA,MAIApb,GAAAqV,GAAA8I,QACA5a,KAAA,SAAA2Z,EAAAhM,GACA,GAAA3F,GAAA6P,EAAA7X,EACAwY,EAAAzY,KAAA,GACAqhB,EAAA5I,GAAAA,EAAA8Y,UAMA,IAAA1xB,SAAA+Z,EAAA,CACA,GAAA5Z,KAAA+B,SACA9B,EAAAvD,GAAAuD,KAAAwY,GAEA,IAAAA,EAAAvF,WAAAxW,GAAAsgB,MAAAvE,EAAA,gBAAA,CAEA,IADAxQ,EAAAoZ,EAAAtf,OACAkG,KAIAoZ,EAAApZ,KACA6P,EAAAuJ,EAAApZ,GAAA6P,KACA,IAAAA,EAAA/X,QAAA,WACA+X,EAAApb,GAAAoe,UAAAhD,EAAA3a,MAAA,IACAwc,EAAAlB,EAAAX,EAAA7X,EAAA6X,KAIApb,IAAAsgB,MAAAvE,EAAA,eAAA,GAIA,MAAAxY,GAIA,MAAA,gBAAA2Z,GACA5Z,KAAAJ,KAAA,WACAlD,GAAAuD,KAAAD,KAAA4Z,KAIArH,UAAAxQ,OAAA,EAGA/B,KAAAJ,KAAA,WACAlD,GAAAuD,KAAAD,KAAA4Z,EAAAhM,KAKA6K,EAAAkB,EAAAlB,EAAAmB,EAAAld,GAAAuD,KAAAwY,EAAAmB,IAAA/Z,QAGAg9B,WAAA,SAAAjjB,GACA,MAAA5Z,MAAAJ,KAAA,WACAlD,GAAAmgC,WAAA78B,KAAA4Z,QAMAld,GAAAme,QACAwH,MAAA,SAAA5J,EAAA7P,EAAA3I,GACA,GAAAoiB,EAEA,IAAA5J,EAYA,MAXA7P,IAAAA,GAAA,MAAA,QACAyZ,EAAA3lB,GAAAsgB,MAAAvE,EAAA7P,GAGA3I,KACAoiB,GAAA3lB,GAAAse,QAAA/a,GACAoiB,EAAA3lB,GAAAsgB,MAAAvE,EAAA7P,EAAAlM,GAAA0tB,UAAAnqB,IAEAoiB,EAAA/b,KAAArG,IAGAoiB,OAIAya,QAAA,SAAArkB,EAAA7P,GACAA,EAAAA,GAAA,IAEA,IAAAyZ,GAAA3lB,GAAA2lB,MAAA5J,EAAA7P,GACAm0B,EAAA1a,EAAAtgB,OACAgQ,EAAAsQ,EAAArc,QACA+b,EAAArlB,GAAA4lB,YAAA7J,EAAA7P,GACAowB,EAAA,WACAt8B,GAAAogC,QAAArkB,EAAA7P,GAIA,gBAAAmJ,IACAA,EAAAsQ,EAAArc,QACA+2B,KAGAhrB,IAIA,OAAAnJ,GACAyZ,EAAAmD,QAAA,oBAIAzD,GAAA8C,KACA9S,EAAA3U,KAAAqb,EAAAugB,EAAAjX,KAGAgb,GAAAhb,GACAA,EAAArf,MAAA8f,QAKAF,YAAA,SAAA7J,EAAA7P,GACA,GAAAgR,GAAAhR,EAAA,YACA,OAAAlM,IAAAsgB,MAAAvE,EAAAmB,IAAAld,GAAAsgB,MAAAvE,EAAAmB,GACAlX,MAAAhG,GAAAq9B,UAAA,eAAAtc,IAAA,WACA/gB,GAAAymB,YAAA1K,EAAA7P,EAAA,SACAlM,GAAAymB,YAAA1K,EAAAmB,UAMAld,GAAAqV,GAAA8I,QACAwH,MAAA,SAAAzZ,EAAA3I,GACA,GAAA+8B,GAAA,CAQA,OANA,gBAAAp0B,KACA3I,EAAA2I,EACAA,EAAA,KACAo0B,KAGAzqB,UAAAxQ,OAAAi7B,EACAtgC,GAAA2lB,MAAAriB,KAAA,GAAA4I,GAGA/I,SAAAI,EACAD,KACAA,KAAAJ,KAAA,WACA,GAAAyiB,GAAA3lB,GAAA2lB,MAAAriB,KAAA4I,EAAA3I,EAGAvD,IAAA4lB,YAAAtiB,KAAA4I,GAEA,OAAAA,GAAA,eAAAyZ,EAAA,IACA3lB,GAAAogC,QAAA98B,KAAA4I,MAIAk0B,QAAA,SAAAl0B,GACA,MAAA5I,MAAAJ,KAAA,WACAlD,GAAAogC,QAAA98B,KAAA4I,MAGAq0B,WAAA,SAAAr0B,GACA,MAAA5I,MAAAqiB,MAAAzZ,GAAA,UAIA8b,QAAA,SAAA9b,EAAAiJ,GACA,GAAAuV,GACA8V,EAAA,EACAC,EAAAzgC,GAAAqnB,WACA/Q,EAAAhT,KACAiI,EAAAjI,KAAA+B,OACAo5B,EAAA,aACA+B,GACAC,EAAA1Y,YAAAzR,GAAAA,IAUA,KANA,gBAAApK,KACAiJ,EAAAjJ,EACAA,EAAA/I,QAEA+I,EAAAA,GAAA,KAEAX,KACAmf,EAAA1qB,GAAAsgB,MAAAhK,EAAA/K,GAAAW,EAAA,cACAwe,GAAAA,EAAA1kB,QACAw6B,IACA9V,EAAA1kB,MAAA+a,IAAA0d,GAIA,OADAA,KACAgC,EAAAzY,QAAA7S,KAGA,IAAAurB,IAAA,sCAAA31B,OAEAwY,IAAA,MAAA,QAAA,SAAA,QAEAR,GAAA,SAAAhH,EAAA4kB,GAIA,MADA5kB,GAAA4kB,GAAA5kB,EACA,SAAA/b,GAAA0F,IAAAqW,EAAA,aAAA/b,GAAA+uB,SAAAhT,EAAAiE,cAAAjE,IAOA6kB,GAAA5gC,GAAA4gC,OAAA,SAAAthB,EAAAjK,EAAA6H,EAAAhM,EAAA2vB,EAAAC,EAAAC,GACA,GAAAx1B,GAAA,EACAlG,EAAAia,EAAAja,OACA27B,EAAA,MAAA9jB,CAGA,IAAA,WAAAld,GAAAkM,KAAAgR,GAAA,CACA2jB,GAAA,CACA,KAAAt1B,IAAA2R,GACAld,GAAA4gC,OAAAthB,EAAAjK,EAAA9J,EAAA2R,EAAA3R,IAAA,EAAAu1B,EAAAC,OAIA,IAAA59B,SAAA+N,IACA2vB,GAAA,EAEA7gC,GAAA6b,WAAA3K,KACA6vB,GAAA,GAGAC,IAEAD,GACA1rB,EAAA3U,KAAA4e,EAAApO,GACAmE,EAAA,OAIA2rB,EAAA3rB,EACAA,EAAA,SAAA0G,EAAAmB,EAAAhM,GACA,MAAA8vB,GAAAtgC,KAAAV,GAAA+b,GAAA7K,MAKAmE,GACA,KAAA9J,EAAAlG,EAAAkG,IACA8J,EAAAiK,EAAA/T,GAAA2R,EAAA6jB,EAAA7vB,EAAAA,EAAAxQ,KAAA4e,EAAA/T,GAAAA,EAAA8J,EAAAiK,EAAA/T,GAAA2R,IAKA,OAAA2jB,GACAvhB,EAGA0hB,EACA3rB,EAAA3U,KAAA4e,GACAja,EAAAgQ,EAAAiK,EAAA,GAAApC,GAAA4jB,GAEAnhB,GAAA,yBAIA,WAEA,GAAAtP,GAAAhR,GAAAG,cAAA,SACAmZ,EAAAtZ,GAAAG,cAAA,OACAyH,EAAA5H,GAAA6H,wBAsDA,IAnDAyR,EAAAvY,UAAA,qEAGAqe,GAAAwiB,kBAAA,IAAAtoB,EAAAnR,WAAAgP,SAIAiI,GAAAyiB,OAAAvoB,EAAArO,qBAAA,SAAAjF,OAIAoZ,GAAA0iB,gBAAAxoB,EAAArO,qBAAA,QAAAjF,OAIAoZ,GAAA2C,WACA,kBAAA/hB,GAAAG,cAAA,OAAA8H,WAAA,GAAA6Z,UAIA9Q,EAAAnE,KAAA,WACAmE,EAAAwP,SAAA,EACA5Y,EAAAM,YAAA8I,GACAoO,GAAA2iB,cAAA/wB,EAAAwP,QAIAlH,EAAAvY,UAAA,yBACAqe,GAAA4iB,iBAAA1oB,EAAArR,WAAA,GAAAmyB,UAAAjY,aAGAva,EAAAM,YAAAoR,GACAA,EAAAvY,UAAA,mDAIAqe,GAAA6iB,WAAA3oB,EAAArR,WAAA,GAAAA,WAAA,GAAAmyB,UAAA5Z,QAKApB,GAAAwC,cAAA,EACAtI,EAAApD,cACAoD,EAAApD,YAAA,UAAA,WACAkJ,GAAAwC,cAAA,IAGAtI,EAAArR,WAAA,GAAAi6B,SAIA,MAAA9iB,GAAAC,cAAA,CAEAD,GAAAC,eAAA,CACA,WACA/F,GAAA9P,KACA,MAAAlG,GACA8b,GAAAC,eAAA,OAMA,WACA,GAAAnT,GAAAi2B,EACA7oB,EAAAtZ,GAAAG,cAAA;AAGA,IAAA+L,KAAA2vB,QAAA,EAAAuG,QAAA,EAAAC,SAAA,GACAF,EAAA,KAAAj2B,GAEAkT,GAAAlT,EAAA,WAAAi2B,IAAAzgC,MAEA4X,EAAAtR,aAAAm6B,EAAA,KACA/iB,GAAAlT,EAAA,WAAAoN,EAAAkc,WAAA2M,GAAA1jB,WAAA,EAKAnF,GAAA,OAIA,IAAAgpB,IAAA,+BACAC,GAAA,OACAC,GAAA,uCACAC,GAAA,kCACAC,GAAA,sBAoBA/hC,IAAA+c,OAEA1B,UAEA0F,IAAA,SAAAhF,EAAAzP,EAAAyjB,EAAAxsB,EAAAwoB,GACA,GAAArB,GAAA7J,EAAAmhB,EAAAC,EACAC,EAAAC,EAAAC,EACAC,EAAAn2B,EAAAo2B,EAAAC,EACAC,EAAAxiC,GAAAsgB,MAAAvE,EAGA,IAAAymB,EAAA,CAmCA,IA9BAzS,EAAAA,UACAkS,EAAAlS,EACAA,EAAAkS,EAAAlS,QACAhE,EAAAkW,EAAAlW,UAIAgE,EAAA9R,OACA8R,EAAA9R,KAAAje,GAAAie,SAIA4C,EAAA2hB,EAAA3hB,UACAA,EAAA2hB,EAAA3hB,YAEAshB,EAAAK,EAAA1hB,UACAqhB,EAAAK,EAAA1hB,OAAA,SAAAne,GAGA,aAAA3C,MAAAwf,IAAA7c,GAAA3C,GAAA+c,MAAA0lB,YAAA9/B,EAAAuJ,KAEA/I,OADAnD,GAAA+c,MAAA2lB,SAAAtqB,MAAA+pB,EAAApmB,KAAAlG,YAIAssB,EAAApmB,KAAAA,GAIAzP,GAAAA,GAAA,IAAAlC,MAAAqS,MAAA,IACAulB,EAAA11B,EAAAjH,OACA28B,KACAtX,EAAAqX,GAAAtxB,KAAAnE,EAAA01B,QACA91B,EAAAq2B,EAAA7X,EAAA,GACA4X,GAAA5X,EAAA,IAAA,IAAAthB,MAAA,KAAAvE,OAGAqH,IAKAg2B,EAAAliC,GAAA+c,MAAAmlB,QAAAh2B,OAGAA,GAAA6f,EAAAmW,EAAAS,aAAAT,EAAAU,WAAA12B,EAGAg2B,EAAAliC,GAAA+c,MAAAmlB,QAAAh2B,OAGAk2B,EAAApiC,GAAAme,QACAjS,KAAAA,EACAq2B,SAAAA,EACAh/B,KAAAA,EACAwsB,QAAAA,EACA9R,KAAA8R,EAAA9R,KACA8N,SAAAA,EACA8J,aAAA9J,GAAA/rB,GAAAg4B,KAAA5tB,MAAAyrB,aAAAhtB,KAAAkjB,GACA8W,UAAAP,EAAA/4B,KAAA,MACA04B,IAGAI,EAAAxhB,EAAA3U,MACAm2B,EAAAxhB,EAAA3U,MACAm2B,EAAAS,cAAA,EAGAZ,EAAAa,OAAAb,EAAAa,MAAAriC,KAAAqb,EAAAxY,EAAA++B,EAAAH,MAAA,IAEApmB,EAAApR,iBACAoR,EAAApR,iBAAAuB,EAAAi2B,GAAA,GAEApmB,EAAAxG,aACAwG,EAAAxG,YAAA,KAAArJ,EAAAi2B,KAKAD,EAAAnhB,MACAmhB,EAAAnhB,IAAArgB,KAAAqb,EAAAqmB,GAEAA,EAAArS,QAAA9R,OACAmkB,EAAArS,QAAA9R,KAAA8R,EAAA9R,OAKA8N,EACAsW,EAAAj6B,OAAAi6B,EAAAS,gBAAA,EAAAV,GAEAC,EAAAz4B,KAAAw4B,GAIApiC,GAAA+c,MAAA1B,OAAAnP,IAAA,EAIA6P,GAAA,OAIAha,OAAA,SAAAga,EAAAzP,EAAAyjB,EAAAhE,EAAAiX,GACA,GAAA9pB,GAAAkpB,EAAA1X,EACAuY,EAAAjB,EAAAnhB,EACAqhB,EAAAG,EAAAn2B,EACAo2B,EAAAC,EACAC,EAAAxiC,GAAAygB,QAAA1E,IAAA/b,GAAAsgB,MAAAvE,EAEA,IAAAymB,IAAA3hB,EAAA2hB,EAAA3hB,QAAA,CAOA,IAFAvU,GAAAA,GAAA,IAAAlC,MAAAqS,MAAA,IACAulB,EAAA11B,EAAAjH,OACA28B,KAMA,GALAtX,EAAAqX,GAAAtxB,KAAAnE,EAAA01B,QACA91B,EAAAq2B,EAAA7X,EAAA,GACA4X,GAAA5X,EAAA,IAAA,IAAAthB,MAAA,KAAAvE,OAGAqH,EAAA,CAcA,IAPAg2B,EAAAliC,GAAA+c,MAAAmlB,QAAAh2B,OACAA,GAAA6f,EAAAmW,EAAAS,aAAAT,EAAAU,WAAA12B,EACAm2B,EAAAxhB,EAAA3U,OACAwe,EAAAA,EAAA,IAAA,GAAAjgB,QAAA,UAAA63B,EAAA/4B,KAAA,iBAAA,WAGA05B,EAAA/pB,EAAAmpB,EAAAh9B,OACA6T,KACAkpB,EAAAC,EAAAnpB,IAEA8pB,GAAAT,IAAAH,EAAAG,UACAxS,GAAAA,EAAA9R,OAAAmkB,EAAAnkB,MACAyM,IAAAA,EAAA7hB,KAAAu5B,EAAAS,YACA9W,GAAAA,IAAAqW,EAAArW,WAAA,OAAAA,IAAAqW,EAAArW,YACAsW,EAAAj6B,OAAA8Q,EAAA,GAEAkpB,EAAArW,UACAsW,EAAAS,gBAEAZ,EAAAngC,QACAmgC,EAAAngC,OAAArB,KAAAqb,EAAAqmB,GAOAa,KAAAZ,EAAAh9B,SACA68B,EAAAgB,UAAAhB,EAAAgB,SAAAxiC,KAAAqb,EAAAumB,EAAAE,EAAA1hB,WAAA,GACA9gB,GAAAkhB,YAAAnF,EAAA7P,EAAAs2B,EAAA1hB,cAGAD,GAAA3U,QAtCA,KAAAA,IAAA2U,GACA7gB,GAAA+c,MAAAhb,OAAAga,EAAA7P,EAAAI,EAAA01B,GAAAjS,EAAAhE,GAAA,EA0CA/rB,IAAAud,cAAAsD,WACA2hB,GAAA1hB,OAIA9gB,GAAAymB,YAAA1K,EAAA,aAIAonB,QAAA,SAAApmB,EAAAxZ,EAAAwY,EAAAqnB,GACA,GAAAtiB,GAAAuiB,EAAAjnB,EACAknB,EAAApB,EAAAxX,EAAAnf,EACAg4B,GAAAxnB,GAAA1c,IACA6M,EAAA0f,GAAAlrB,KAAAqc,EAAA,QAAAA,EAAA7Q,KAAA6Q,EACAulB,EAAA1W,GAAAlrB,KAAAqc,EAAA,aAAAA,EAAA8lB,UAAAz5B,MAAA,OAKA,IAHAgT,EAAAsO,EAAA3O,EAAAA,GAAA1c,GAGA,IAAA0c,EAAAvF,UAAA,IAAAuF,EAAAvF,WAKAsrB,GAAAj5B,KAAAqD,EAAAlM,GAAA+c,MAAA0lB,aAIAv2B,EAAA7I,QAAA,MAAA,IAEAi/B,EAAAp2B,EAAA9C,MAAA,KACA8C,EAAAo2B,EAAAh5B,QACAg5B,EAAAz9B,QAEAw+B,EAAAn3B,EAAA7I,QAAA,KAAA,GAAA,KAAA6I,EAGA6Q,EAAAA,EAAA/c,GAAA8d,SACAf,EACA,GAAA/c,IAAAwjC,MAAAt3B,EAAA,gBAAA6Q,IAAAA,GAGAA,EAAA0mB,UAAAL,EAAA,EAAA,EACArmB,EAAA8lB,UAAAP,EAAA/4B,KAAA,KACAwT,EAAA2mB,aAAA3mB,EAAA8lB,UACA,GAAAp4B,QAAA,UAAA63B,EAAA/4B,KAAA,iBAAA,WACA,KAGAwT,EAAAkK,OAAA9jB,OACA4Z,EAAArb,SACAqb,EAAArb,OAAAqa,GAIAxY,EAAA,MAAAA,GACAwZ,GACA/c,GAAA0tB,UAAAnqB,GAAAwZ,IAGAmlB,EAAAliC,GAAA+c,MAAAmlB,QAAAh2B,OACAk3B,IAAAlB,EAAAiB,SAAAjB,EAAAiB,QAAA/qB,MAAA2D,EAAAxY,MAAA,GAAA,CAMA,IAAA6/B,IAAAlB,EAAAyB,WAAA3jC,GAAAyb,SAAAM,GAAA,CAMA,IAJAunB,EAAApB,EAAAS,cAAAz2B,EACA41B,GAAAj5B,KAAAy6B,EAAAp3B,KACAkQ,EAAAA,EAAAxT,YAEAwT,EAAAA,EAAAA,EAAAxT,WACA26B,EAAA35B,KAAAwS,GACAsO,EAAAtO,CAIAsO,MAAA3O,EAAAiE,eAAA3gB,KACAkkC,EAAA35B,KAAA8gB,EAAAc,aAAAd,EAAAe,cAAA1qB,GAMA,IADAwK,EAAA,GACA6Q,EAAAmnB,EAAAh4B,QAAAwR,EAAA6mB,wBAEA7mB,EAAA7Q,KAAAX,EAAA,EACA+3B,EACApB,EAAAU,UAAA12B,EAGA4U,GAAA9gB,GAAAsgB,MAAAlE,EAAA,eAAAW,EAAA7Q,OAAAlM,GAAAsgB,MAAAlE,EAAA,UACA0E,GACAA,EAAA1I,MAAAgE,EAAA7Y,GAIAud,EAAAuiB,GAAAjnB,EAAAinB,GACAviB,GAAAA,EAAA1I,OAAApY,GAAA0d,WAAAtB,KACAW,EAAAkK,OAAAnG,EAAA1I,MAAAgE,EAAA7Y,GACAwZ,EAAAkK,UAAA,GACAlK,EAAA8mB,iBAOA,IAHA9mB,EAAA7Q,KAAAA,GAGAk3B,IAAArmB,EAAA+mB,wBAEA5B,EAAA6B,UAAA7B,EAAA6B,SAAA3rB,MAAAmrB,EAAA9vB,MAAAlQ,MAAA,IACAvD,GAAA0d,WAAA3B,IAKAsnB,GAAAtnB,EAAA7P,KAAAlM,GAAAyb,SAAAM,GAAA,CAGA2O,EAAA3O,EAAAsnB,GAEA3Y,IACA3O,EAAAsnB,GAAA,MAIArjC,GAAA+c,MAAA0lB,UAAAv2B,CACA,KACA6P,EAAA7P,KACA,MAAAvJ,IAIA3C,GAAA+c,MAAA0lB,UAAAt/B,OAEAunB,IACA3O,EAAAsnB,GAAA3Y,GAMA,MAAA3N,GAAAkK,SAGAyb,SAAA,SAAA3lB,GAGAA,EAAA/c,GAAA+c,MAAAinB,IAAAjnB,EAEA,IAAAxR,GAAAoS,EAAAykB,EAAAxI,EAAA1gB,EACA+qB,KACAruB,EAAAnV,EAAAC,KAAAmV,WACAwsB,GAAAriC,GAAAsgB,MAAAhd,KAAA,eAAAyZ,EAAA7Q,UACAg2B,EAAAliC,GAAA+c,MAAAmlB,QAAAnlB,EAAA7Q,SAOA,IAJA0J,EAAA,GAAAmH,EACAA,EAAAmnB,eAAA5gC,MAGA4+B,EAAAiC,aAAAjC,EAAAiC,YAAAzjC,KAAA4C,KAAAyZ,MAAA,EAAA,CASA,IAJAknB,EAAAjkC,GAAA+c,MAAAslB,SAAA3hC,KAAA4C,KAAAyZ,EAAAslB,GAGA92B,EAAA,GACAquB,EAAAqK,EAAA14B,QAAAwR,EAAA6mB,wBAIA,IAHA7mB,EAAAqnB,cAAAxK,EAAA7d,KAEA7C,EAAA,GACAkpB,EAAAxI,EAAAyI,SAAAnpB,QAAA6D,EAAAsnB,iCAIAtnB,EAAA2mB,eAAA3mB,EAAA2mB,aAAA76B,KAAAu5B,EAAAS,aAEA9lB,EAAAqlB,UAAAA,EACArlB,EAAAxZ,KAAA6+B,EAAA7+B,KAEAoa,IAAA3d,GAAA+c,MAAAmlB,QAAAE,EAAAG,eAAAzhB,QAAAshB,EAAArS,SACA3X,MAAAwhB,EAAA7d,KAAAnG,GAEAzS,SAAAwa,IACAZ,EAAAkK,OAAAtJ,MAAA,IACAZ,EAAA8mB,iBACA9mB,EAAAunB,mBAYA,OAJApC,GAAAqC,cACArC,EAAAqC,aAAA7jC,KAAA4C,KAAAyZ,GAGAA,EAAAkK,SAGAob,SAAA,SAAAtlB,EAAAslB,GACA,GAAAxrB,GAAAurB,EAAAlqB,EAAA3M,EACA04B,KACAnB,EAAAT,EAAAS,cACA1mB,EAAAW,EAAArb,MAKA,IAAAohC,GAAA1mB,EAAA5F,YAAAuG,EAAA0d,QAAA,UAAA1d,EAAA7Q,MAGA,KAAAkQ,GAAA9Y,KAAA8Y,EAAAA,EAAAxT,YAAAtF,KAKA,GAAA,IAAA8Y,EAAA5F,WAAA4F,EAAAke,YAAA,GAAA,UAAAvd,EAAA7Q,MAAA,CAEA,IADAgM,KACA3M,EAAA,EAAAA,EAAAu3B,EAAAv3B,IACA62B,EAAAC,EAAA92B,GAGAsL,EAAAurB,EAAArW,SAAA,IAEA5oB,SAAA+U,EAAArB,KACAqB,EAAArB,GAAAurB,EAAAvM,aACA71B,GAAA6W,EAAAvT,MAAAO,MAAAuY,IAAA,EACApc,GAAAwD,KAAAqT,EAAAvT,KAAA,MAAA8Y,IAAA/W,QAEA6S,EAAArB,IACAqB,EAAAtO,KAAAw4B,EAGAlqB,GAAA7S,QACA4+B,EAAAr6B,MAAAmS,KAAAK,EAAAimB,SAAAnqB,IAWA,MAJA4qB,GAAAT,EAAAh9B,QACA4+B,EAAAr6B,MAAAmS,KAAAzY,KAAA++B,SAAAA,EAAA5hC,MAAAqiC,KAGAmB,GAGAD,IAAA,SAAAjnB,GACA,GAAAA,EAAA/c,GAAA8d,SACA,MAAAf,EAIA,IAAAxR,GAAA0Y,EAAA+I,EACA9gB,EAAA6Q,EAAA7Q,KACAs4B,EAAAznB,EACA0nB,EAAAnhC,KAAAohC,SAAAx4B,EAaA,KAXAu4B,IACAnhC,KAAAohC,SAAAx4B,GAAAu4B,EACA5C,GAAAh5B,KAAAqD,GAAA5I,KAAAqhC,WACA/C,GAAA/4B,KAAAqD,GAAA5I,KAAAshC,aAGA5X,EAAAyX,EAAAtf,MAAA7hB,KAAA6hB,MAAA5G,OAAAkmB,EAAAtf,OAAA7hB,KAAA6hB,MAEApI,EAAA,GAAA/c,IAAAwjC,MAAAgB,GAEAj5B,EAAAyhB,EAAA3nB,OACAkG,KACA0Y,EAAA+I,EAAAzhB,GACAwR,EAAAkH,GAAAugB,EAAAvgB,EAmBA,OAdAlH,GAAArb,SACAqb,EAAArb,OAAA8iC,EAAAK,YAAAxlC,IAKA,IAAA0d,EAAArb,OAAA8U,WACAuG,EAAArb,OAAAqb,EAAArb,OAAAkH,YAKAmU,EAAA+nB,UAAA/nB,EAAA+nB,QAEAL,EAAAxoB,OAAAwoB,EAAAxoB,OAAAc,EAAAynB,GAAAznB,GAIAoI,MAAA,wHAAA/b,MAAA,KAEAs7B,YAEAE,UACAzf,MAAA,4BAAA/b,MAAA,KACA6S,OAAA,SAAAc,EAAAgoB,GAOA,MAJA,OAAAhoB,EAAA2H,QACA3H,EAAA2H,MAAA,MAAAqgB,EAAAC,SAAAD,EAAAC,SAAAD,EAAAE,SAGAloB,IAIA4nB,YACAxf,MAAA,mGAAA/b,MAAA,KACA6S,OAAA,SAAAc,EAAAgoB,GACA,GAAAjiC,GAAAoiC,EAAAxjB,EACA+Y,EAAAsK,EAAAtK,OACA0K,EAAAJ,EAAAI,WAuBA,OApBA,OAAApoB,EAAAqoB,OAAA,MAAAL,EAAAM,UACAH,EAAAnoB,EAAArb,OAAAse,eAAA3gB,GACAqiB,EAAAwjB,EAAAriC,gBACAC,EAAAoiC,EAAApiC,KAEAia,EAAAqoB,MAAAL,EAAAM,SAAA3jB,GAAAA,EAAA4jB,YAAAxiC,GAAAA,EAAAwiC,YAAA,IAAA5jB,GAAAA,EAAA6jB,YAAAziC,GAAAA,EAAAyiC,YAAA,GACAxoB,EAAAyoB,MAAAT,EAAAU,SAAA/jB,GAAAA,EAAAgkB,WAAA5iC,GAAAA,EAAA4iC,WAAA,IAAAhkB,GAAAA,EAAAikB,WAAA7iC,GAAAA,EAAA6iC,WAAA,KAIA5oB,EAAA6oB,eAAAT,IACApoB,EAAA6oB,cAAAT,IAAApoB,EAAArb,OAAAqjC,EAAAc,UAAAV,GAKApoB,EAAA2H,OAAAvhB,SAAAs3B,IACA1d,EAAA2H,MAAA,EAAA+V,EAAA,EAAA,EAAAA,EAAA,EAAA,EAAAA,EAAA,EAAA,GAGA1d,IAIAmlB,SACA4D,MAEAnC,UAAA,GAEAzJ,OAEAiJ,QAAA,WACA,GAAA7/B,OAAAub,KAAAvb,KAAA42B,MACA,IAEA,MADA52B,MAAA42B,SACA,EACA,MAAAv3B,MAOAggC,aAAA,WAEAoD,MACA5C,QAAA,WACA,GAAA7/B,OAAAub,KAAAvb,KAAAyiC,KAEA,MADAziC,MAAAyiC,QACA,GAGApD,aAAA,YAEApB,OAEA4B,QAAA,WACA,GAAAnjC,GAAA8I,SAAAxF,KAAA,UAAA,aAAAA,KAAA4I,MAAA5I,KAAAi+B,MAEA,MADAj+B,MAAAi+B,SACA,GAKAwC,SAAA,SAAAhnB,GACA,MAAA/c,IAAA8I,SAAAiU,EAAArb,OAAA,OAIAskC,cACAzB,aAAA,SAAAxnB,GAIA5Z,SAAA4Z,EAAAkK,QAAAlK,EAAAynB,gBACAznB,EAAAynB,cAAAyB,YAAAlpB,EAAAkK,WAMAif,SAAA,SAAAh6B,EAAA6P,EAAAgB,EAAAopB,GAIA,GAAAxjC,GAAA3C,GAAAme,OACA,GAAAne,IAAAwjC,MACAzmB,GAEA7Q,KAAAA,EACAk6B,aAAA,EACA5B,kBAGA2B,GACAnmC,GAAA+c,MAAAomB,QAAAxgC,EAAA,KAAAoZ,GAEA/b,GAAA+c,MAAA2lB,SAAAhiC,KAAAqb,EAAApZ,GAEAA,EAAAmhC,sBACA/mB,EAAA8mB,mBAKA7jC,GAAAkhB,YAAA7hB,GAAAud,oBACA,SAAAb,EAAA7P,EAAA4U,GACA/E,EAAAa,qBACAb,EAAAa,oBAAA1Q,EAAA4U,GAAA,IAGA,SAAA/E,EAAA7P,EAAA4U,GACA,GAAA1F,GAAA,KAAAlP,CAEA6P,GAAAe,oBAIAf,GAAAX,KAAAoE,KACAzD,EAAAX,GAAA,MAGAW,EAAAe,YAAA1B,EAAA0F,KAIA9gB,GAAAwjC,MAAA,SAAArhC,EAAAgjB,GAEA,MAAA7hB,gBAAAtD,IAAAwjC,OAKArhC,GAAAA,EAAA+J,MACA5I,KAAAkhC,cAAAriC,EACAmB,KAAA4I,KAAA/J,EAAA+J,KAIA5I,KAAAwgC,mBAAA3hC,EAAAkkC,kBACAljC,SAAAhB,EAAAkkC,kBAEAlkC,EAAA8jC,eAAA,EACAtnB,EACAC,GAIAtb,KAAA4I,KAAA/J,EAIAgjB,GACAnlB,GAAAme,OAAA7a,KAAA6hB,GAIA7hB,KAAAgjC,UAAAnkC,GAAAA,EAAAmkC,WAAAtmC,GAAAukB,WAGAjhB,KAAAtD,GAAA8d,UAAA,IA/BA,GAAA9d,IAAAwjC,MAAArhC,EAAAgjB,IAoCAnlB,GAAAwjC,MAAApf,WACA0f,mBAAAllB,EACAglB,qBAAAhlB,EACAylB,8BAAAzlB,EAEAilB,eAAA,WACA,GAAAlhC,GAAAW,KAAAkhC,aAEAlhC,MAAAwgC,mBAAAnlB,EACAhc,IAKAA,EAAAkhC,eACAlhC,EAAAkhC,iBAKAlhC,EAAAsjC,aAAA,IAGA3B,gBAAA,WACA,GAAA3hC,GAAAW,KAAAkhC,aAEAlhC,MAAAsgC,qBAAAjlB,EACAhc,IAIAA,EAAA2hC,iBACA3hC,EAAA2hC,kBAKA3hC,EAAA4jC,cAAA,IAEAC,yBAAA,WACA,GAAA7jC,GAAAW,KAAAkhC,aAEAlhC,MAAA+gC,8BAAA1lB,EAEAhc,GAAAA,EAAA6jC,0BACA7jC,EAAA6jC,2BAGAljC,KAAAghC,oBAKAtkC,GAAAkD,MACAujC,WAAA,YACAC,WAAA,WACAC,aAAA,cACAC,aAAA,cACA,SAAAnhB,EAAAue,GACAhkC,GAAA+c,MAAAmlB,QAAAzc,IACAkd,aAAAqB,EACApB,SAAAoB,EAEAljB,OAAA,SAAA/D,GACA,GAAAY,GACAjc,EAAA4B,KACAujC,EAAA9pB,EAAA6oB,cACAxD,EAAArlB,EAAAqlB,SASA,OALAyE,KAAAA,IAAAnlC,GAAA1B,GAAA+uB,SAAArtB,EAAAmlC,MACA9pB,EAAA7Q,KAAAk2B,EAAAG,SACA5kB,EAAAykB,EAAArS,QAAA3X,MAAA9U,KAAAuS,WACAkH,EAAA7Q,KAAA83B,GAEArmB,MAMAc,GAAAqoB,gBAEA9mC,GAAA+c,MAAAmlB,QAAAhH,QACA6H,MAAA,WAEA,OAAA/iC,GAAA8I,SAAAxF,KAAA,aAKAtD,IAAA+c,MAAAgE,IAAAzd,KAAA,iCAAA,SAAAX,GAEA,GAAAoZ,GAAApZ,EAAAjB,OACAqlC,EAAA/mC,GAAA8I,SAAAiT,EAAA,UAAA/b,GAAA8I,SAAAiT,EAAA,UAAAA,EAAAgrB,KAAA5jC,MACA4jC,KAAA/mC,GAAAsgB,MAAAymB,EAAA,mBACA/mC,GAAA+c,MAAAgE,IAAAgmB,EAAA,iBAAA,SAAAhqB,GACAA,EAAAiqB,gBAAA,IAEAhnC,GAAAsgB,MAAAymB,EAAA,iBAAA,OAMAxC,aAAA,SAAAxnB,GAEAA,EAAAiqB,uBACAjqB,GAAAiqB,eACA1jC,KAAAsF,aAAAmU,EAAA0mB,WACAzjC,GAAA+c,MAAAmpB,SAAA,SAAA5iC,KAAAsF,WAAAmU,GAAA,KAKAmmB,SAAA,WAEA,OAAAljC,GAAA8I,SAAAxF,KAAA,aAKAtD,IAAA+c,MAAAhb,OAAAuB,KAAA,eAMAmb,GAAAwoB,gBAEAjnC,GAAA+c,MAAAmlB,QAAAT,QAEAsB,MAAA,WAEA,MAAApB,IAAA94B,KAAAvF,KAAAwF,WAIA,aAAAxF,KAAA4I,MAAA,UAAA5I,KAAA4I,OACAlM,GAAA+c,MAAAgE,IAAAzd,KAAA,yBAAA,SAAAyZ,GACA,YAAAA,EAAAynB,cAAA0C,eACA5jC,KAAA6jC,eAAA,KAGAnnC,GAAA+c,MAAAgE,IAAAzd,KAAA,gBAAA,SAAAyZ,GACAzZ,KAAA6jC,gBAAApqB,EAAA0mB,YACAngC,KAAA6jC,eAAA,GAGAnnC,GAAA+c,MAAAmpB,SAAA,SAAA5iC,KAAAyZ,GAAA,OAGA,OAGA/c,IAAA+c,MAAAgE,IAAAzd,KAAA,yBAAA,SAAAX,GACA,GAAAoZ,GAAApZ,EAAAjB,MAEAigC,IAAA94B,KAAAkT,EAAAjT,YAAA9I,GAAAsgB,MAAAvE,EAAA,mBACA/b,GAAA+c,MAAAgE,IAAAhF,EAAA,iBAAA,SAAAgB,IACAzZ,KAAAsF,YAAAmU,EAAAqpB,aAAArpB,EAAA0mB,WACAzjC,GAAA+c,MAAAmpB,SAAA,SAAA5iC,KAAAsF,WAAAmU,GAAA,KAGA/c,GAAAsgB,MAAAvE,EAAA,iBAAA,OAKA+E,OAAA,SAAA/D,GACA,GAAAhB,GAAAgB,EAAArb,MAGA,IAAA4B,OAAAyY,GAAAgB,EAAAqpB,aAAArpB,EAAA0mB,WAAA,UAAA1nB,EAAA7P,MAAA,aAAA6P,EAAA7P,KACA,MAAA6Q,GAAAqlB,UAAArS,QAAA3X,MAAA9U,KAAAuS,YAIAqtB,SAAA,WAGA,MAFAljC,IAAA+c,MAAAhb,OAAAuB,KAAA,aAEAq+B,GAAA94B,KAAAvF,KAAAwF,aAMA2V,GAAA2oB,gBACApnC,GAAAkD,MAAAg3B,MAAA,UAAA6L,KAAA,YAAA,SAAAtgB,EAAAue,GAGA,GAAAjU,GAAA,SAAAhT,GACA/c,GAAA+c,MAAAmpB,SAAAlC,EAAAjnB,EAAArb,OAAA1B,GAAA+c,MAAAinB,IAAAjnB,IAAA,GAGA/c,IAAA+c,MAAAmlB,QAAA8B,IACAjB,MAAA,WACA,GAAArhB,GAAApe,KAAA0c,eAAA1c,KACA+jC,EAAArnC,GAAAsgB,MAAAoB,EAAAsiB,EAEAqD,IACA3lB,EAAA/W,iBAAA8a,EAAAsK,GAAA,GAEA/vB,GAAAsgB,MAAAoB,EAAAsiB,GAAAqD,GAAA,GAAA,IAEAnE,SAAA,WACA,GAAAxhB,GAAApe,KAAA0c,eAAA1c,KACA+jC,EAAArnC,GAAAsgB,MAAAoB,EAAAsiB,GAAA,CAEAqD,GAIArnC,GAAAsgB,MAAAoB,EAAAsiB,EAAAqD,IAHA3lB,EAAA9E,oBAAA6I,EAAAsK,GAAA,GACA/vB,GAAAymB,YAAA/E,EAAAsiB,QASAhkC,GAAAqV,GAAA8I,QAEAjJ,GAAA,SAAA5I,EAAAyf,EAAAxoB,EAAA8R,EAAAiyB,GACA,GAAAp7B,GAAAq7B,CAGA,IAAA,gBAAAj7B,GAAA,CAEA,gBAAAyf,KAEAxoB,EAAAA,GAAAwoB,EACAA,EAAA5oB,OAEA,KAAA+I,IAAAI,GACAhJ,KAAA4R,GAAAhJ,EAAA6f,EAAAxoB,EAAA+I,EAAAJ,GAAAo7B,EAEA,OAAAhkC,MAmBA,GAhBA,MAAAC,GAAA,MAAA8R,GAEAA,EAAA0W,EACAxoB,EAAAwoB,EAAA5oB,QACA,MAAAkS,IACA,gBAAA0W,IAEA1W,EAAA9R,EACAA,EAAAJ,SAGAkS,EAAA9R,EACAA,EAAAwoB,EACAA,EAAA5oB,SAGAkS,KAAA,EACAA,EAAAuJ,MACA,KAAAvJ,EACA,MAAA/R,KAaA,OAVA,KAAAgkC,IACAC,EAAAlyB,EACAA,EAAA,SAAA0H,GAGA,MADA/c,MAAA0/B,IAAA3iB,GACAwqB,EAAAnvB,MAAA9U,KAAAuS,YAGAR,EAAA4I,KAAAspB,EAAAtpB,OAAAspB,EAAAtpB,KAAAje,GAAAie,SAEA3a,KAAAJ,KAAA,WACAlD,GAAA+c,MAAAgE,IAAAzd,KAAAgJ,EAAA+I,EAAA9R,EAAAwoB,MAGAub,IAAA,SAAAh7B,EAAAyf,EAAAxoB,EAAA8R,GACA,MAAA/R,MAAA4R,GAAA5I,EAAAyf,EAAAxoB,EAAA8R,EAAA,IAEAqqB,IAAA,SAAApzB,EAAAyf,EAAA1W,GACA,GAAA+sB,GAAAl2B,CACA,IAAAI,GAAAA,EAAAu3B,gBAAAv3B,EAAA81B,UAQA,MANAA,GAAA91B,EAAA81B,UACApiC,GAAAsM,EAAA43B,gBAAAxE,IACA0C,EAAAS,UAAAT,EAAAG,SAAA,IAAAH,EAAAS,UAAAT,EAAAG,SACAH,EAAArW,SACAqW,EAAArS,SAEAzsB,IAEA,IAAA,gBAAAgJ,GAAA,CAEA,IAAAJ,IAAAI,GACAhJ,KAAAo8B,IAAAxzB,EAAA6f,EAAAzf,EAAAJ,GAEA,OAAA5I,MAUA,MARAyoB,MAAA,GAAA,kBAAAA,KAEA1W,EAAA0W,EACAA,EAAA5oB,QAEAkS,KAAA,IACAA,EAAAuJ,GAEAtb,KAAAJ,KAAA,WACAlD,GAAA+c,MAAAhb,OAAAuB,KAAAgJ,EAAA+I,EAAA0W,MAIAoX,QAAA,SAAAj3B,EAAA3I,GACA,MAAAD,MAAAJ,KAAA,WACAlD,GAAA+c,MAAAomB,QAAAj3B,EAAA3I,EAAAD,SAGAm8B,eAAA,SAAAvzB,EAAA3I,GACA,GAAAwY,GAAAzY,KAAA,EACA,IAAAyY,EACA,MAAA/b,IAAA+c,MAAAomB,QAAAj3B,EAAA3I,EAAAwY,GAAA,KAoBA,IAAAmD,IAAA,6JAEAsoB,GAAA,6BACAC,GAAA,GAAAh9B,QAAA,OAAAyU,GAAA,WAAA,KACAwoB,GAAA,OACAC,GAAA,0EACAC,GAAA,YACAC,GAAA,UACAC,GAAA,YACAC,GAAA,0BAEAC,GAAA,oCACAC,GAAA,4BACA9nB,GAAA,cACA+nB,GAAA,2CAGAC,IACAC,QAAA,EAAA,+BAAA,aACAC,QAAA,EAAA,aAAA,eACAC,MAAA,EAAA,QAAA,UACAC,OAAA,EAAA,WAAA,aACAC,OAAA,EAAA,UAAA,YACAC,IAAA,EAAA,iBAAA,oBACAC,KAAA,EAAA,mCAAA,uBACAC,IAAA,EAAA,qBAAA,yBAIA5E,SAAAtlB,GAAA0iB,eAAA,EAAA,GAAA,KAAA,EAAA,SAAA,WAEAyH,GAAA5pB,EAAA3f,IACAwpC,GAAAD,GAAArhC,YAAAlI,GAAAG,cAAA,OAEA2oC,IAAAW,SAAAX,GAAAC,OACAD,GAAAjH,MAAAiH,GAAAY,MAAAZ,GAAAa,SAAAb,GAAAc,QAAAd,GAAAK,MACAL,GAAAe,GAAAf,GAAAQ,GAiKA3oC,GAAAme,QACA1Y,MAAA,SAAAsW,EAAAotB,EAAAC,GACA,GAAAC,GAAA3S,EAAAjxB,EAAA8F,EAAA+9B,EACAC,EAAAvpC,GAAA+uB,SAAAhT,EAAAiE,cAAAjE,EAWA,IATA0C,GAAA2C,YAAAphB,GAAA47B,SAAA7f,KAAA0rB,GAAA5+B,KAAA,IAAAkT,EAAAjT,SAAA,KACArD,EAAAsW,EAAAzU,WAAA,IAIAuhC,GAAAzoC,UAAA2b,EAAAoF,UACA0nB,GAAA3/B,YAAAzD,EAAAojC,GAAArhC,eAGAiX,GAAAwC,cAAAxC,GAAA4iB,gBACA,IAAAtlB,EAAAvF,UAAA,KAAAuF,EAAAvF,UAAAxW,GAAA47B,SAAA7f,IAOA,IAJAstB,EAAAjqB,EAAA3Z,GACA6jC,EAAAlqB,EAAArD,GAGAxQ,EAAA,EAAA,OAAAmrB,EAAA4S,EAAA/9B,MAAAA,EAEA89B,EAAA99B,IACAyV,EAAA0V,EAAA2S,EAAA99B,GAMA,IAAA49B,EACA,GAAAC,EAIA,IAHAE,EAAAA,GAAAlqB,EAAArD,GACAstB,EAAAA,GAAAjqB,EAAA3Z,GAEA8F,EAAA,EAAA,OAAAmrB,EAAA4S,EAAA/9B,IAAAA,IACAgV,EAAAmW,EAAA2S,EAAA99B,QAGAgV,GAAAxE,EAAAtW,EAaA,OARA4jC,GAAAjqB,EAAA3Z,EAAA,UACA4jC,EAAAhkC,OAAA,GACA+a,EAAAipB,GAAAE,GAAAnqB,EAAArD,EAAA,WAGAstB,EAAAC,EAAA5S,EAAA,KAGAjxB,GAGA+jC,cAAA,SAAAlqB,EAAA7I,EAAAgzB,EAAAC,GAWA,IAVA,GAAAxwB,GAAA6C,EAAAgT,EACArE,EAAArL,EAAA6hB,EAAAyI,EACAjpB,EAAApB,EAAAja,OAGAukC,EAAA5qB,EAAAvI,GAEAozB,KACAt+B,EAAA,EAEAA,EAAAmV,EAAAnV,IAGA,GAFAwQ,EAAAuD,EAAA/T,GAEAwQ,GAAA,IAAAA,EAGA,GAAA,WAAA/b,GAAAkM,KAAA6P,GACA/b,GAAAyf,MAAAoqB,EAAA9tB,EAAAvF,UAAAuF,GAAAA,OAGA,IAAA+rB,GAAAj/B,KAAAkT,GAIA,CAWA,IAVA2O,EAAAA,GAAAkf,EAAAriC,YAAAkP,EAAAjX,cAAA,QAGA6f,GAAAuoB,GAAAn3B,KAAAsL,KAAA,GAAA,KAAA,GAAA/X,cACA2lC,EAAAxB,GAAA9oB,IAAA8oB,GAAApE,SAEArZ,EAAAtqB,UAAAupC,EAAA,GAAA5tB,EAAAxV,QAAAohC,GAAA,aAAAgC,EAAA,GAGAzwB,EAAAywB,EAAA,GACAzwB,KACAwR,EAAAA,EAAA+O,SASA,KALAhb,GAAAwiB,mBAAAyG,GAAA7+B,KAAAkT,IACA8tB,EAAAjgC,KAAA6M,EAAAqzB,eAAApC,GAAAj3B,KAAAsL,GAAA,MAIA0C,GAAAyiB,MAYA,IATAnlB,EAAA,UAAAsD,GAAAwoB,GAAAh/B,KAAAkT,GAIA,YAAA4tB,EAAA,IAAA9B,GAAAh/B,KAAAkT,GAEA,EADA2O,EAJAA,EAAAljB,WAOA0R,EAAA6C,GAAAA,EAAAzb,WAAA+E,OACA6T,KACAlZ,GAAA8I,SAAAo4B,EAAAnlB,EAAAzb,WAAA4Y,GAAA,WAAAgoB,EAAA5gC,WAAA+E,QACA0W,EAAA7S,YAAAg4B,EAWA,KANAlhC,GAAAyf,MAAAoqB,EAAAnf,EAAApqB,YAGAoqB,EAAA2N,YAAA,GAGA3N,EAAAljB,YACAkjB,EAAAxhB,YAAAwhB,EAAAljB,WAIAkjB,GAAAkf,EAAAnQ,cAtDAoQ,GAAAjgC,KAAA6M,EAAAqzB,eAAA/tB,GAuEA,KAXA2O,GACAkf,EAAA1gC,YAAAwhB,GAKAjM,GAAA2iB,eACAphC,GAAA8b,KAAAsD,EAAAyqB,EAAA,SAAAnqB,GAGAnU,EAAA,EACAwQ,EAAA8tB,EAAAt+B,MAIA,KAAAm+B,GAAA1pC,GAAAkc,QAAAH,EAAA2tB,WAIA3a,EAAA/uB,GAAA+uB,SAAAhT,EAAAiE,cAAAjE,GAGA2O,EAAAtL,EAAAwqB,EAAAriC,YAAAwU,GAAA,UAGAgT,GACA3O,EAAAsK,GAIA+e,GAEA,IADAvwB,EAAA,EACA6C,EAAA2O,EAAAxR,MACA+uB,GAAAp/B,KAAAkT,EAAA7P,MAAA,KACAu9B,EAAA7/B,KAAAmS,EAQA,OAFA2O,GAAA,KAEAkf,GAGAprB,UAAA,SAAAc,EAAA5B,GAQA,IAPA,GAAA3B,GAAA7P,EAAA3D,EAAAhF,EACAgI,EAAA,EACAsS,EAAA7d,GAAA8d,QACArI,EAAAzV,GAAAyV,MACAiJ,EAAAD,GAAAC,cACAwjB,EAAAliC,GAAA+c,MAAAmlB,QAEA,OAAAnmB,EAAAuD,EAAA/T,IAAAA,IACA,IAAAmS,GAAA1d,GAAA0d,WAAA3B,MAEAxT,EAAAwT,EAAA8B,GACAta,EAAAgF,GAAAkN,EAAAlN,IAEA,CACA,GAAAhF,EAAAsd,OACA,IAAA3U,IAAA3I,GAAAsd,OACAqhB,EAAAh2B,GACAlM,GAAA+c,MAAAhb,OAAAga,EAAA7P,GAIAlM,GAAAkhB,YAAAnF,EAAA7P,EAAA3I,EAAAud,OAMArL,GAAAlN,WAEAkN,GAAAlN,GAKAmW,QACA3C,GAAA8B,SAEA9B,GAAA5H,kBAAAqL,GACAzD,EAAA5H,gBAAA0J,GAGA9B,EAAA8B,GAAA,KAGAG,EAAApU,KAAArB,QAQAvI,GAAAqV,GAAA8I,QACA1Z,KAAA,SAAAyM,GACA,MAAA0vB,IAAAt9B,KAAA,SAAA4N,GACA,MAAA/N,UAAA+N,EACAlR,GAAAyE,KAAAnB,MACAA,KAAA0C,QAAAF,QAAAxC,KAAA,IAAAA,KAAA,GAAA0c,eAAA3gB,IAAAyqC,eAAA54B,KACA,KAAAA,EAAA2E,UAAAxQ,SAGAS,OAAA,WACA,MAAAxC,MAAAymC,SAAAl0B,UAAA,SAAAkG,GACA,GAAA,IAAAzY,KAAAkT,UAAA,KAAAlT,KAAAkT,UAAA,IAAAlT,KAAAkT,SAAA,CACA,GAAA9U,GAAAoe,EAAAxc,KAAAyY,EACAra,GAAA6F,YAAAwU,OAKAiuB,QAAA,WACA,MAAA1mC,MAAAymC,SAAAl0B,UAAA,SAAAkG,GACA,GAAA,IAAAzY,KAAAkT,UAAA,KAAAlT,KAAAkT,UAAA,IAAAlT,KAAAkT,SAAA,CACA,GAAA9U,GAAAoe,EAAAxc,KAAAyY,EACAra,GAAArB,aAAA0b,EAAAra,EAAA8F,gBAKAyiC,OAAA,WACA,MAAA3mC,MAAAymC,SAAAl0B,UAAA,SAAAkG,GACAzY,KAAAsF,YACAtF,KAAAsF,WAAAvI,aAAA0b,EAAAzY,SAKAyB,MAAA,WACA,MAAAzB,MAAAymC,SAAAl0B,UAAA,SAAAkG,GACAzY,KAAAsF,YACAtF,KAAAsF,WAAAvI,aAAA0b,EAAAzY,KAAA+sB,gBAKAtuB,OAAA,SAAAgqB,EAAAme,GAKA,IAJA,GAAAnuB,GACAuD,EAAAyM,EAAA/rB,GAAAic,OAAA8P,EAAAzoB,MAAAA,KACAiI,EAAA,EAEA,OAAAwQ,EAAAuD,EAAA/T,IAAAA,IAEA2+B,GAAA,IAAAnuB,EAAAvF,UACAxW,GAAAwe,UAAAY,EAAArD,IAGAA,EAAAnT,aACAshC,GAAAlqC,GAAA+uB,SAAAhT,EAAAiE,cAAAjE,IACAqE,EAAAhB,EAAArD,EAAA,WAEAA,EAAAnT,WAAAM,YAAA6S,GAIA,OAAAzY,OAGA0C,MAAA,WAIA,IAHA,GAAA+V,GACAxQ,EAAA,EAEA,OAAAwQ,EAAAzY,KAAAiI,IAAAA,IAAA,CAOA,IALA,IAAAwQ,EAAAvF,UACAxW,GAAAwe,UAAAY,EAAArD,GAAA,IAIAA,EAAAvU,YACAuU,EAAA7S,YAAA6S,EAAAvU,WAKAuU,GAAA/a,SAAAhB,GAAA8I,SAAAiT,EAAA,YACAA,EAAA/a,QAAAqE,OAAA,GAIA,MAAA/B,OAGAmC,MAAA,SAAA0jC,EAAAC,GAIA,MAHAD,GAAA,MAAAA,GAAAA,EACAC,EAAA,MAAAA,EAAAD,EAAAC,EAEA9lC,KAAA+E,IAAA,WACA,MAAArI,IAAAyF,MAAAnC,KAAA6lC,EAAAC,MAIA9mC,KAAA,SAAA4O,GACA,MAAA0vB,IAAAt9B,KAAA,SAAA4N,GACA,GAAA6K,GAAAzY,KAAA,OACAiI,EAAA,EACAmV,EAAApd,KAAA+B,MAEA,IAAAlC,SAAA+N,EACA,MAAA,KAAA6K,EAAAvF,SACAuF,EAAA3b,UAAAmG,QAAAihC,GAAA,IACArkC,MAIA,IAAA,gBAAA+N,KAAA62B,GAAAl/B,KAAAqI,KACAuN,GAAA0iB,gBAAAsG,GAAA5+B,KAAAqI,MACAuN,GAAAwiB,oBAAAyG,GAAA7+B,KAAAqI,MACAi3B,IAAAP,GAAAn3B,KAAAS,KAAA,GAAA,KAAA,GAAAlN,eAAA,CAEAkN,EAAAA,EAAA3K,QAAAohC,GAAA,YAEA,KACA,KAAAp8B,EAAAmV,EAAAnV,IAEAwQ,EAAAzY,KAAAiI,OACA,IAAAwQ,EAAAvF,WACAxW,GAAAwe,UAAAY,EAAArD,GAAA,IACAA,EAAA3b,UAAA8Q,EAIA6K,GAAA,EAGA,MAAApZ,KAGAoZ,GACAzY,KAAA0C,QAAAF,OAAAoL,IAEA,KAAAA,EAAA2E,UAAAxQ,SAGA8kC,YAAA,WACA,GAAAlc,GAAApY,UAAA,EAcA,OAXAvS,MAAAymC,SAAAl0B,UAAA,SAAAkG,GACAkS,EAAA3qB,KAAAsF,WAEA5I,GAAAwe,UAAAY,EAAA9b,OAEA2qB,GACAA,EAAAmc,aAAAruB,EAAAzY,QAKA2qB,IAAAA,EAAA5oB,QAAA4oB,EAAAzX,UAAAlT,KAAAA,KAAAvB,UAGA4a,OAAA,SAAAoP,GACA,MAAAzoB,MAAAvB,OAAAgqB,GAAA,IAGAge,SAAA,SAAAn0B,EAAAgX,GAGAhX,EAAA2I,EAAAnG,SAAAxC,EAEA,IAAAiX,GAAA6J,EAAA2T,EACAZ,EAAA/nB,EAAAza,EACAsE,EAAA,EACAmV,EAAApd,KAAA+B,OACAiK,EAAAhM,KACAgnC,EAAA5pB,EAAA,EACAxP,EAAA0E,EAAA,GACAiG,EAAA7b,GAAA6b,WAAA3K,EAGA,IAAA2K,GACA6E,EAAA,GAAA,gBAAAxP,KACAuN,GAAA6iB,YAAA0G,GAAAn/B,KAAAqI,GACA,MAAA5N,MAAAJ,KAAA,SAAAW,GACA,GAAAk4B,GAAAzsB,EAAAwd,GAAAjpB,EACAgY,KACAjG,EAAA,GAAA1E,EAAAxQ,KAAA4C,KAAAO,EAAAk4B,EAAAz5B,SAEAy5B,EAAAgO,SAAAn0B,EAAAgX,IAIA,IAAAlM,IACAzZ,EAAAjH,GAAAwpC,cAAA5zB,EAAAtS,KAAA,GAAA0c,eAAA,EAAA1c,MACAupB,EAAA5lB,EAAAO,WAEA,IAAAP,EAAA3G,WAAA+E,SACA4B,EAAA4lB,GAGAA,GAAA,CAMA,IALA4c,EAAAzpC,GAAAqI,IAAA+W,EAAAnY,EAAA,UAAAgZ,GACAoqB,EAAAZ,EAAApkC,OAIAkG,EAAAmV,EAAAnV,IACAmrB,EAAAzvB,EAEAsE,IAAA++B,IACA5T,EAAA12B,GAAAyF,MAAAixB,GAAA,GAAA,GAGA2T,GACArqC,GAAAyf,MAAAgqB,EAAArqB,EAAAsX,EAAA,YAIA9J,EAAAlsB,KAAA4C,KAAAiI,GAAAmrB,EAAAnrB,EAGA,IAAA8+B,EAOA,IANA3oB,EAAA+nB,EAAAA,EAAApkC,OAAA,GAAA2a,cAGAhgB,GAAAqI,IAAAohC,EAAAvpB,GAGA3U,EAAA,EAAAA,EAAA8+B,EAAA9+B,IACAmrB,EAAA+S,EAAAl+B,GACA08B,GAAAp/B,KAAA6tB,EAAAxqB,MAAA,MACAlM,GAAAsgB,MAAAoW,EAAA,eAAA12B,GAAA+uB,SAAArN,EAAAgV,KAEAA,EAAAv0B,IAEAnC,GAAAuqC,UACAvqC,GAAAuqC,SAAA7T,EAAAv0B,KAGAnC,GAAAwtB,YAAAkJ,EAAAjyB,MAAAiyB,EAAA2B,aAAA3B,EAAAt2B,WAAA,IAAAmG,QAAA2hC,GAAA,KAOAjhC,GAAA4lB,EAAA,KAIA,MAAAvpB,SAIAtD,GAAAkD,MACA+C,SAAA,SACAukC,UAAA,UACAnqC,aAAA,SACAoqC,YAAA,QACAC,WAAA,eACA,SAAAtvB,EAAA2pB,GACA/kC,GAAAqV,GAAA+F,GAAA,SAAA2Q,GAOA,IANA,GAAAzM,GACA/T,EAAA,EACAoS,KACAgtB,EAAA3qC,GAAA+rB,GACA9Q,EAAA0vB,EAAAtlC,OAAA,EAEAkG,GAAA0P,EAAA1P,IACA+T,EAAA/T,IAAA0P,EAAA3X,KAAAA,KAAAmC,OAAA,GACAzF,GAAA2qC,EAAAp/B,IAAAw5B,GAAAzlB,GAGA1V,EAAAwO,MAAAuF,EAAA2B,EAAA+C,MAGA,OAAA/e,MAAAopB,UAAA/O,KAKA,IAAAtb,IACAwf,OA8DA,WACA,GAAA+oB,EAEAnsB,IAAA4H,iBAAA,WACA,GAAA,MAAAukB,EACA,MAAAA,EAIAA,IAAA,CAGA,IAAAjyB,GAAA7V,EAAAg9B,CAGA,OADAh9B,GAAAzD,GAAAiL,qBAAA,QAAA,GACAxH,GAAAA,EAAApD,OAMAiZ,EAAAtZ,GAAAG,cAAA,OACAsgC,EAAAzgC,GAAAG,cAAA,OACAsgC,EAAApgC,MAAAmZ,QAAA,iEACA/V,EAAAyE,YAAAu4B,GAAAv4B,YAAAoR,SAIAA,GAAAjZ,MAAA0mB,OAAA5G,KAEA7G,EAAAjZ,MAAAmZ,QAGA,iJAGAF,EAAApR,YAAAlI,GAAAG,cAAA,QAAAE,MAAAqD,MAAA,MACA6nC,EAAA,IAAAjyB,EAAAtN,aAGAvI,EAAAoG,YAAA42B,GAEA8K,GA3BA,UA+BA,IAMAjnB,IAAAE,GANAgnB,GAAA,UAEA/mB,GAAA,GAAArZ,QAAA,KAAAi2B,GAAA,kBAAA,KAKAoK,GAAA,2BAEA/pC,GAAAgqC,kBACApnB,GAAA,SAAA5H,GAIA,MAAAA,GAAAiE,cAAAwL,YAAAwf,OACAjvB,EAAAiE,cAAAwL,YAAAuf,iBAAAhvB,EAAA,MAGAhb,EAAAgqC,iBAAAhvB,EAAA,OAGA8H,GAAA,SAAA9H,EAAAX,EAAA6vB,GACA,GAAAloC,GAAAmoC,EAAAC,EAAAxtB,EACAje,EAAAqc,EAAArc,KAqCA,OAnCAurC,GAAAA,GAAAtnB,GAAA5H,GAGA4B,EAAAstB,EAAAA,EAAAG,iBAAAhwB,IAAA6vB,EAAA7vB,GAAAjY,OAEA8nC,IAEA,KAAAttB,GAAA3d,GAAA+uB,SAAAhT,EAAAiE,cAAAjE,KACA4B,EAAA3d,GAAAN,MAAAqc,EAAAX,IAOA0I,GAAAjb,KAAA8U,IAAAktB,GAAAhiC,KAAAuS,KAGArY,EAAArD,EAAAqD,MACAmoC,EAAAxrC,EAAAwrC,SACAC,EAAAzrC,EAAAyrC,SAGAzrC,EAAAwrC,SAAAxrC,EAAAyrC,SAAAzrC,EAAAqD,MAAA4a,EACAA,EAAAstB,EAAAloC,MAGArD,EAAAqD,MAAAA,EACArD,EAAAwrC,SAAAA,EACAxrC,EAAAyrC,SAAAA,IAMAhoC,SAAAwa,EACAA,EACAA,EAAA,KAEAte,GAAAwD,gBAAAwoC,eACA1nB,GAAA,SAAA5H,GACA,MAAAA,GAAAsvB,cAGAxnB,GAAA,SAAA9H,EAAAX,EAAA6vB,GACA,GAAAK,GAAAC,EAAAC,EAAA7tB,EACAje,EAAAqc,EAAArc,KAyCA,OAvCAurC,GAAAA,GAAAtnB,GAAA5H,GACA4B,EAAAstB,EAAAA,EAAA7vB,GAAAjY,OAIA,MAAAwa,GAAAje,GAAAA,EAAA0b,KACAuC,EAAAje,EAAA0b,IAUA0I,GAAAjb,KAAA8U,KAAAmtB,GAAAjiC,KAAAuS,KAGAkwB,EAAA5rC,EAAA4rC,KACAC,EAAAxvB,EAAA0vB,aACAD,EAAAD,GAAAA,EAAAD,KAGAE,IACAD,EAAAD,KAAAvvB,EAAAsvB,aAAAC,MAEA5rC,EAAA4rC,KAAA,aAAAlwB,EAAA,MAAAuC,EACAA,EAAAje,EAAAgsC,UAAA,KAGAhsC,EAAA4rC,KAAAA,EACAE,IACAD,EAAAD,KAAAE,IAMAroC,SAAAwa,EACAA,EACAA,EAAA,IAAA,SAmCA,WAkEA,QAAAguB,KAEA,GAAAhzB,GAAA7V,EAAAg9B,EAAA9V,CAEAlnB,GAAAzD,GAAAiL,qBAAA,QAAA,GACAxH,GAAAA,EAAApD,QAMAiZ,EAAAtZ,GAAAG,cAAA,OACAsgC,EAAAzgC,GAAAG,cAAA,OACAsgC,EAAApgC,MAAAmZ,QAAA,iEACA/V,EAAAyE,YAAAu4B,GAAAv4B,YAAAoR,GAEAA,EAAAjZ,MAAAmZ,QAGA,uKAMA+yB,EAAAC,GAAA,EACAC,GAAA,EAGA/qC,EAAAgqC,mBACAa,EAAA,QAAA7qC,EAAAgqC,iBAAApyB,EAAA,WAAAie,IACAiV,EACA,SAAA9qC,EAAAgqC,iBAAApyB,EAAA,QAAA5V,MAAA,QAAAA,MAMAinB,EAAArR,EAAApR,YAAAlI,GAAAG,cAAA,QAGAwqB,EAAAtqB,MAAAmZ,QAAAF,EAAAjZ,MAAAmZ,QAGA,8HAEAmR,EAAAtqB,MAAAqsC,YAAA/hB,EAAAtqB,MAAAqD,MAAA,IACA4V,EAAAjZ,MAAAqD,MAAA,MAEA+oC,GACAv6B,YAAAxQ,EAAAgqC,iBAAA/gB,EAAA,WAAA+hB,aAEApzB,EAAAzP,YAAA8gB,IAUArR,EAAAvY,UAAA,8CACA4pB,EAAArR,EAAArO,qBAAA,MACA0f,EAAA,GAAAtqB,MAAAmZ,QAAA,2CACAmzB,EAAA,IAAAhiB,EAAA,GAAAtG,aACAsoB,IACAhiB,EAAA,GAAAtqB,MAAAkG,QAAA,GACAokB,EAAA,GAAAtqB,MAAAkG,QAAA,OACAomC,EAAA,IAAAhiB,EAAA,GAAAtG,cAGA5gB,EAAAoG,YAAA42B,IAxIA,GAAAnnB,GAAAjZ,EAAAkD,EAAAgpC,EAAAC,EACAG,EAAAF,CAGAnzB,GAAAtZ,GAAAG,cAAA,OACAmZ,EAAAvY,UAAA,qEACAwC,EAAA+V,EAAArO,qBAAA,KAAA,GACA5K,EAAAkD,GAAAA,EAAAlD,MAGAA,IAIAA,EAAAmZ,QAAA,wBAIA4F,GAAAmG,QAAA,QAAAllB,EAAAklB,QAIAnG,GAAAwtB,WAAAvsC,EAAAusC,SAEAtzB,EAAAjZ,MAAAwsC,eAAA,cACAvzB,EAAArR,WAAA,GAAA5H,MAAAwsC,eAAA,GACAztB,GAAA0tB,gBAAA,gBAAAxzB,EAAAjZ,MAAAwsC,eAIAztB,GAAAmF,UAAA,KAAAlkB,EAAAkkB,WAAA,KAAAlkB,EAAA0sC,cACA,KAAA1sC,EAAA2sC,gBAEArsC,GAAAme,OAAAM,IACA6tB,sBAAA,WAIA,MAHA,OAAAN,GACAL,IAEAK,GAGAjoB,kBAAA,WAIA,MAHA,OAAA8nB,GACAF,IAEAE,GAGAU,cAAA,WAIA,MAHA,OAAAX,GACAD,IAEAC,GAIAY,oBAAA,WAIA,MAHA,OAAAV,GACAH,IAEAG,SAmFA9rC,GAAAysC,KAAA,SAAA1wB,EAAA/a,EAAA4rB,EAAAhX,GACA,GAAA+H,GAAAvC,EACAmT,IAGA,KAAAnT,IAAApa,GACAutB,EAAAnT,GAAAW,EAAArc,MAAA0b,GACAW,EAAArc,MAAA0b,GAAApa,EAAAoa,EAGAuC,GAAAiP,EAAAxU,MAAA2D,EAAAnG,MAGA,KAAAwF,IAAApa,GACA+a,EAAArc,MAAA0b,GAAAmT,EAAAnT,EAGA,OAAAuC,GAIA,IACA+uB,IAAA,kBACAC,GAAA,wBAIAC,GAAA,4BACA1pB,GAAA,GAAAzY,QAAA,KAAAi2B,GAAA,SAAA,KACAmM,GAAA,GAAApiC,QAAA,YAAAi2B,GAAA,IAAA,KAEAoM,IAAAjnC,SAAA,WAAAF,WAAA,SAAAC,QAAA,SACAmnC,IACAC,cAAA,IACAC,WAAA,OAGAvqB,IAAA,SAAA,IAAA,MAAA,KAuKA1iB,IAAAme,QAGA0I,UACAjC,SACAvC,IAAA,SAAAtG,EAAAkvB,GACA,GAAAA,EAAA,CAEA,GAAAttB,GAAAkG,GAAA9H,EAAA,UACA,OAAA,KAAA4B,EAAA,IAAAA,MAOAuvB,WACAC,aAAA,EACAC,aAAA,EACAC,UAAA,EACAC,YAAA,EACAL,YAAA,EACAM,YAAA,EACA3oB,SAAA,EACA4oB,OAAA,EACAC,SAAA,EACAC,QAAA,EACAC,QAAA,EACAvnB,MAAA,GAKAwnB,UAEAC,QAAApvB,GAAAwtB,SAAA,WAAA,cAIAvsC,MAAA,SAAAqc,EAAAX,EAAAlK,EAAAkS,GAEA,GAAArH,GAAA,IAAAA,EAAAvF,UAAA,IAAAuF,EAAAvF,UAAAuF,EAAArc,MAAA,CAKA,GAAAie,GAAAzR,EAAAmZ,EACA5C,EAAAziB,GAAAoe,UAAAhD,GACA1b,EAAAqc,EAAArc,KASA,IAPA0b,EAAApb,GAAA4tC,SAAAnrB,KAAAziB,GAAA4tC,SAAAnrB,GAAAF,EAAA7iB,EAAA+iB,IAIA4C,EAAArlB,GAAA6mB,SAAAzL,IAAApb,GAAA6mB,SAAApE,GAGAtf,SAAA+N,EAsCA,MAAAmU,IAAA,OAAAA,IAAAliB,UAAAwa,EAAA0H,EAAAhD,IAAAtG,GAAA,EAAAqH,IACAzF,EAIAje,EAAA0b,EAhCA,IAVAlP,QAAAgF,GAGA,WAAAhF,IAAAyR,EAAAkvB,GAAAp8B,KAAAS,MACAA,GAAAyM,EAAA,GAAA,GAAAA,EAAA,GAAApM,WAAAvR,GAAA0F,IAAAqW,EAAAX,IAEAlP,EAAA,UAIA,MAAAgF,GAAAA,IAAAA,IAKA,WAAAhF,GAAAlM,GAAAktC,UAAAzqB,KACAvR,GAAA,MAKAuN,GAAA0tB,iBAAA,KAAAj7B,GAAA,IAAAkK,EAAA/X,QAAA,gBACA3D,EAAA0b,GAAA,aAIAiK,GAAA,OAAAA,IAAAliB,UAAA+N,EAAAmU,EAAA/V,IAAAyM,EAAA7K,EAAAkS,MAIA,IACA1jB,EAAA0b,GAAAlK,EACA,MAAAvO,OAcA+C,IAAA,SAAAqW,EAAAX,EAAAgI,EAAAE,GACA,GAAAmJ,GAAAtoB,EAAAkhB,EACA5C,EAAAziB,GAAAoe,UAAAhD,EAyBA,OAtBAA,GAAApb,GAAA4tC,SAAAnrB,KAAAziB,GAAA4tC,SAAAnrB,GAAAF,EAAAxG,EAAArc,MAAA+iB,IAIA4C,EAAArlB,GAAA6mB,SAAAzL,IAAApb,GAAA6mB,SAAApE,GAGA4C,GAAA,OAAAA,KACAlhB,EAAAkhB,EAAAhD,IAAAtG,GAAA,EAAAqH,IAIAjgB,SAAAgB,IACAA,EAAA0f,GAAA9H,EAAAX,EAAAkI,IAIA,WAAAnf,GAAAiX,IAAA2xB,MACA5oC,EAAA4oC,GAAA3xB,IAIA,KAAAgI,GAAAA,GACAqJ,EAAAlb,WAAApN,GACAif,KAAA,GAAApjB,GAAAstB,UAAAb,GAAAA,GAAA,EAAAtoB,GAEAA,KAIAnE,GAAAkD,MAAA,SAAA,SAAA,SAAAqI,EAAA6P,GACApb,GAAA6mB,SAAAzL,IACAiH,IAAA,SAAAtG,EAAAkvB,EAAA7nB,GACA,GAAA6nB,EAGA,MAAA2B,IAAA/jC,KAAA7I,GAAA0F,IAAAqW,EAAA,aAAA,IAAAA,EAAA1Q,YACArL,GAAAysC,KAAA1wB,EAAA+wB,GAAA,WACA,MAAAtpB,GAAAzH,EAAAX,EAAAgI,KAEAI,EAAAzH,EAAAX,EAAAgI,IAIA9T,IAAA,SAAAyM,EAAA7K,EAAAkS,GACA,GAAAE,GAAAF,GAAAO,GAAA5H,EACA,OAAAiH,GAAAjH,EAAA7K,EAAAkS,EACAD,EACApH,EACAX,EACAgI,EACA3E,GAAAmF,WAAA,eAAA5jB,GAAA0F,IAAAqW,EAAA,aAAA,EAAAuH,GACAA,GACA,OAMA7E,GAAAmG,UACA5kB,GAAA6mB,SAAAjC,SACAvC,IAAA,SAAAtG,EAAAkvB,GAEA,MAAA0B,IAAA9jC,MAAAoiC,GAAAlvB,EAAAsvB,aAAAtvB,EAAAsvB,aAAApvB,OAAAF,EAAArc,MAAAuc,SAAA,IACA,IAAA1K,WAAA9G,OAAAC,IAAA,GACAugC,EAAA,IAAA,IAGA37B,IAAA,SAAAyM,EAAA7K,GACA,GAAAxR,GAAAqc,EAAArc,MACA2rC,EAAAtvB,EAAAsvB,aACAzmB,EAAA5kB,GAAAstB,UAAApc,GAAA,iBAAA,IAAAA,EAAA,IAAA,GACA+K,EAAAovB,GAAAA,EAAApvB,QAAAvc,EAAAuc,QAAA,EAIAvc,GAAA0mB,KAAA,GAIAlV,GAAA,GAAA,KAAAA,IACA,KAAAlR,GAAAqhB,KAAApF,EAAA1V,QAAAmmC,GAAA,MACAhtC,EAAAyU,kBAKAzU,EAAAyU,gBAAA,UAGA,KAAAjD,GAAAm6B,IAAAA,EAAApvB,UAMAvc,EAAAuc,OAAAywB,GAAA7jC,KAAAoT,GACAA,EAAA1V,QAAAmmC,GAAA9nB,GACA3I,EAAA,IAAA2I,MAKA5kB,GAAA6mB,SAAAklB,YAAA7pB,EAAAzD,GAAA+tB,oBACA,SAAAzwB,EAAAkvB,GACA,GAAAA,EAGA,MAAAjrC,IAAAysC,KAAA1wB,GAAAnW,QAAA,gBACAie,IAAA9H,EAAA,kBAMA/b,GAAAkD,MACApD,OAAA,GACAD,QAAA,GACAiuC,OAAA,SACA,SAAA9iB,EAAA+iB,GACA/tC,GAAA6mB,SAAAmE,EAAA+iB,IACAjnB,OAAA,SAAA5V,GAOA,IANA,GAAA3F,GAAA,EACAyiC,KAGAC,EAAA,gBAAA/8B,GAAAA,EAAA9H,MAAA,MAAA8H,GAEA3F,EAAA,EAAAA,IACAyiC,EAAAhjB,EAAAzH,GAAAhY,GAAAwiC,GACAE,EAAA1iC,IAAA0iC,EAAA1iC,EAAA,IAAA0iC,EAAA,EAGA,OAAAD,KAIAnD,GAAAhiC,KAAAmiB,KACAhrB,GAAA6mB,SAAAmE,EAAA+iB,GAAAz+B,IAAA0T,KAIAhjB,GAAAqV,GAAA8I,QACAzY,IAAA,SAAA0V,EAAAlK,GACA,MAAA0vB,IAAAt9B,KAAA,SAAAyY,EAAAX,EAAAlK,GACA,GAAAoS,GAAArT,EACA5H,KACAkD,EAAA,CAEA,IAAAvL,GAAAse,QAAAlD,GAAA,CAIA,IAHAkI,EAAAK,GAAA5H,GACA9L,EAAAmL,EAAA/V,OAEAkG,EAAA0E,EAAA1E,IACAlD,EAAA+S,EAAA7P,IAAAvL,GAAA0F,IAAAqW,EAAAX,EAAA7P,IAAA,EAAA+X,EAGA,OAAAjb,GAGA,MAAAlF,UAAA+N,EACAlR,GAAAN,MAAAqc,EAAAX,EAAAlK,GACAlR,GAAA0F,IAAAqW,EAAAX,IACAA,EAAAlK,EAAA2E,UAAAxQ,OAAA,IAEAud,KAAA,WACA,MAAAD,GAAArf,MAAA,IAEAkjB,KAAA,WACA,MAAA7D,GAAArf,OAEA8hB,OAAA,SAAAtT,GACA,MAAA,iBAAAA,GACAA,EAAAxO,KAAAsf,OAAAtf,KAAAkjB,OAGAljB,KAAAJ,KAAA,WACA6f,GAAAzf,MACAtD,GAAAsD,MAAAsf,OAEA5iB,GAAAsD,MAAAkjB,YAUAxmB,GAAAgkB,MAAAA,EAEAA,EAAAI,WACAmI,YAAAvI,EACAnY,KAAA,SAAAkQ,EAAA/a,EAAAijB,EAAAC,EAAAC,EAAA+pB,GACA5qC,KAAAyY,KAAAA,EACAzY,KAAA2gB,KAAAA,EACA3gB,KAAA6gB,OAAAA,GAAA,QACA7gB,KAAAtC,QAAAA,EACAsC,KAAAojB,MAAApjB,KAAAihB,IAAAjhB,KAAA8Y,MACA9Y,KAAA4gB,IAAAA,EACA5gB,KAAA4qC,KAAAA,IAAAluC,GAAAktC,UAAAjpB,GAAA,GAAA,OAEA7H,IAAA,WACA,GAAAiJ,GAAArB,EAAAmqB,UAAA7qC,KAAA2gB,KAEA,OAAAoB,IAAAA,EAAAhD,IACAgD,EAAAhD,IAAA/e,MACA0gB,EAAAmqB,UAAApK,SAAA1hB,IAAA/e,OAEAkX,IAAA,SAAAoN,GACA,GAAAwmB,GACA/oB,EAAArB,EAAAmqB,UAAA7qC,KAAA2gB,KAoBA,OAlBA3gB,MAAAtC,QAAA0mB,SACApkB,KAAAqN,IAAAy9B,EAAApuC,GAAAmkB,OAAA7gB,KAAA6gB,QACAyD,EAAAtkB,KAAAtC,QAAA0mB,SAAAE,EAAA,EAAA,EAAAtkB,KAAAtC,QAAA0mB,UAGApkB,KAAAqN,IAAAy9B,EAAAxmB,EAEAtkB,KAAAihB,KAAAjhB,KAAA4gB,IAAA5gB,KAAAojB,OAAA0nB,EAAA9qC,KAAAojB,MAEApjB,KAAAtC,QAAAqtC,MACA/qC,KAAAtC,QAAAqtC,KAAA3tC,KAAA4C,KAAAyY,KAAAzY,KAAAihB,IAAAjhB,MAGA+hB,GAAAA,EAAA/V,IACA+V,EAAA/V,IAAAhM,MAEA0gB,EAAAmqB,UAAApK,SAAAz0B,IAAAhM,MAEAA,OAIA0gB,EAAAI,UAAAvY,KAAAuY,UAAAJ,EAAAI,UAEAJ,EAAAmqB,WACApK,UACA1hB,IAAA,SAAA0C,GACA,GAAAkC,EAEA,OAAA,OAAAlC,EAAAhJ,KAAAgJ,EAAAd,OACAc,EAAAhJ,KAAArc,OAAA,MAAAqlB,EAAAhJ,KAAArc,MAAAqlB,EAAAd,OAQAgD,EAAAjnB,GAAA0F,IAAAqf,EAAAhJ,KAAAgJ,EAAAd,KAAA,IAEAgD,GAAA,SAAAA,EAAAA,EAAA,GATAlC,EAAAhJ,KAAAgJ,EAAAd,OAWA3U,IAAA,SAAAyV,GAGA/kB,GAAAsoB,GAAA+lB,KAAAtpB,EAAAd,MACAjkB,GAAAsoB,GAAA+lB,KAAAtpB,EAAAd,MAAAc,GACAA,EAAAhJ,KAAArc,QAAA,MAAAqlB,EAAAhJ,KAAArc,MAAAM,GAAA4tC,SAAA7oB,EAAAd,QAAAjkB,GAAA6mB,SAAA9B,EAAAd,OACAjkB,GAAAN,MAAAqlB,EAAAhJ,KAAAgJ,EAAAd,KAAAc,EAAAR,IAAAQ,EAAAmpB,MAEAnpB,EAAAhJ,KAAAgJ,EAAAd,MAAAc,EAAAR,OASAP,EAAAmqB,UAAAzI,UAAA1hB,EAAAmqB,UAAA7I,YACAh2B,IAAA,SAAAyV,GACAA,EAAAhJ,KAAAvF,UAAAuO,EAAAhJ,KAAAnT,aACAmc,EAAAhJ,KAAAgJ,EAAAd,MAAAc,EAAAR,OAKAvkB,GAAAmkB,QACAmqB,OAAA,SAAAC,GACA,MAAAA,IAEAC,MAAA,SAAAD,GACA,MAAA,GAAAnqC,KAAAqqC,IAAAF,EAAAnqC,KAAAsqC,IAAA,IAIA1uC,GAAAsoB,GAAAtE,EAAAI,UAAAvY,KAGA7L,GAAAsoB,GAAA+lB,OAKA,IACA/pB,IAAA7J,GACA6L,GAAA,yBACAqoB,GAAA,GAAAlkC,QAAA,iBAAAi2B,GAAA,cAAA,KACAkO,GAAA,cACAznB,IAAAjC,GACAD,IACA4pB,KAAA,SAAA5qB,EAAA/S,GACA,GAAA6T,GAAAzhB,KAAAuhB,YAAAZ,EAAA/S,GACAxP,EAAAqjB,EAAA3I,MACA6xB,EAAAU,GAAAl+B,KAAAS,GACAg9B,EAAAD,GAAAA,EAAA,KAAAjuC,GAAAktC,UAAAjpB,GAAA,GAAA,MAGAyC,GAAA1mB,GAAAktC,UAAAjpB,IAAA,OAAAiqB,IAAAxsC,IACAitC,GAAAl+B,KAAAzQ,GAAA0F,IAAAqf,EAAAhJ,KAAAkI,IACA6qB,EAAA,EACAC,EAAA,EAEA,IAAAroB,GAAAA,EAAA,KAAAwnB,EAAA,CAEAA,EAAAA,GAAAxnB,EAAA,GAGAunB,EAAAA,MAGAvnB,GAAAhlB,GAAA,CAEA,GAGAotC,GAAAA,GAAA,KAGApoB,GAAAooB,EACA9uC,GAAAN,MAAAqlB,EAAAhJ,KAAAkI,EAAAyC,EAAAwnB,SAIAY,KAAAA,EAAA/pB,EAAA3I,MAAA1a,IAAA,IAAAotC,KAAAC,GAaA,MATAd,KACAvnB,EAAA3B,EAAA2B,OAAAA,IAAAhlB,GAAA,EACAqjB,EAAAmpB,KAAAA,EAEAnpB,EAAAb,IAAA+pB,EAAA,GACAvnB,GAAAunB,EAAA,GAAA,GAAAA,EAAA,IACAA,EAAA,IAGAlpB,IA0UA/kB,IAAA+mB,UAAA/mB,GAAAme,OAAA4I,GACAioB,QAAA,SAAA7pB,EAAAyH,GACA5sB,GAAA6b,WAAAsJ,IACAyH,EAAAzH,EACAA,GAAA,MAEAA,EAAAA,EAAA/b,MAAA,IAOA,KAJA,GAAA6a,GACApgB,EAAA,EACAwB,EAAA8f,EAAA9f,OAEAxB,EAAAwB,EAAAxB,IACAogB,EAAAkB,EAAAthB,GACAohB,GAAAhB,GAAAgB,GAAAhB,OACAgB,GAAAhB,GAAA6E,QAAA8D,IAIAqiB,UAAA,SAAAriB,EAAAod,GACAA,EACA7iB,GAAA2B,QAAA8D,GAEAzF,GAAAvd,KAAAgjB,MAKA5sB,GAAAkvC,MAAA,SAAAA,EAAA/qB,EAAA9O,GACA,GAAAgB,GAAA64B,GAAA,gBAAAA,GAAAlvC,GAAAme,UAAA+wB,IACAt3B,SAAAvC,IAAAA,GAAA8O,GACAnkB,GAAA6b,WAAAqzB,IAAAA,EACAxnB,SAAAwnB,EACA/qB,OAAA9O,GAAA8O,GAAAA,IAAAnkB,GAAA6b,WAAAsI,IAAAA,EAwBA,OArBA9N,GAAAqR,SAAA1nB,GAAAsoB,GAAAoX,IAAA,EAAA,gBAAArpB,GAAAqR,SAAArR,EAAAqR,SACArR,EAAAqR,WAAA1nB,IAAAsoB,GAAA6mB,OAAAnvC,GAAAsoB,GAAA6mB,OAAA94B,EAAAqR,UAAA1nB,GAAAsoB,GAAA6mB,OAAApL,SAGA,MAAA1tB,EAAAsP,OAAAtP,EAAAsP,SAAA,IACAtP,EAAAsP,MAAA,MAIAtP,EAAAkY,IAAAlY,EAAAuB,SAEAvB,EAAAuB,SAAA,WACA5X,GAAA6b,WAAAxF,EAAAkY,MACAlY,EAAAkY,IAAA7tB,KAAA4C,MAGA+S,EAAAsP,OACA3lB,GAAAogC,QAAA98B,KAAA+S,EAAAsP,QAIAtP,GAGArW,GAAAqV,GAAA8I,QACAixB,OAAA,SAAAF,EAAAG,EAAAlrB,EAAAyI,GAGA,MAAAtpB,MAAA2Y,OAAA8G,IAAArd,IAAA,UAAA,GAAAkd,OAGAsB,MAAAorB,SAAA1qB,QAAAyqB,GAAAH,EAAA/qB,EAAAyI,IAEA0iB,QAAA,SAAArrB,EAAAirB,EAAA/qB,EAAAyI,GACA,GAAA5mB,GAAAhG,GAAAud,cAAA0G,GACAsrB,EAAAvvC,GAAAkvC,MAAAA,EAAA/qB,EAAAyI,GACA4iB,EAAA,WAEA,GAAAhqB,GAAAuB,EAAAzjB,KAAAtD,GAAAme,UAAA8F,GAAAsrB,IAGAvpC,GAAAhG,GAAAsgB,MAAAhd,KAAA,YACAkiB,EAAA2C,MAAA,GAKA,OAFAqnB,GAAAC,OAAAD,EAEAxpC,GAAAupC,EAAA5pB,SAAA,EACAriB,KAAAJ,KAAAssC,GACAlsC,KAAAqiB,MAAA4pB,EAAA5pB,MAAA6pB,IAEArnB,KAAA,SAAAjc,EAAAq0B,EAAAnY,GACA,GAAAsnB,GAAA,SAAArqB,GACA,GAAA8C,GAAA9C,EAAA8C,WACA9C,GAAA8C,KACAA,EAAAC,GAYA,OATA,gBAAAlc,KACAkc,EAAAmY,EACAA,EAAAr0B,EACAA,EAAA/I,QAEAo9B,GAAAr0B,KAAA,GACA5I,KAAAqiB,MAAAzZ,GAAA,SAGA5I,KAAAJ,KAAA,WACA,GAAAk9B,IAAA,EACAv8B,EAAA,MAAAqI,GAAAA,EAAA,aACAyjC,EAAA3vC,GAAA2vC,OACApsC,EAAAvD,GAAAsgB,MAAAhd,KAEA,IAAAO,EACAN,EAAAM,IAAAN,EAAAM,GAAAskB,MACAunB,EAAAnsC,EAAAM,QAGA,KAAAA,IAAAN,GACAA,EAAAM,IAAAN,EAAAM,GAAAskB,MAAAymB,GAAA/lC,KAAAhF,IACA6rC,EAAAnsC,EAAAM,GAKA,KAAAA,EAAA8rC,EAAAtqC,OAAAxB,KACA8rC,EAAA9rC,GAAAkY,OAAAzY,MAAA,MAAA4I,GAAAyjC,EAAA9rC,GAAA8hB,QAAAzZ,IACAyjC,EAAA9rC,GAAA2hB,KAAA2C,KAAAC,GACAgY,GAAA,EACAuP,EAAAvnC,OAAAvE,EAAA,KAOAu8B,GAAAhY,GACApoB,GAAAogC,QAAA98B,KAAA4I,MAIAujC,OAAA,SAAAvjC,GAIA,MAHAA,MAAA,IACAA,EAAAA,GAAA,MAEA5I,KAAAJ,KAAA,WACA,GAAAW,GACAN,EAAAvD,GAAAsgB,MAAAhd,MACAqiB,EAAApiB,EAAA2I,EAAA,SACAmZ,EAAA9hB,EAAA2I,EAAA,cACAyjC,EAAA3vC,GAAA2vC,OACAtqC,EAAAsgB,EAAAA,EAAAtgB,OAAA,CAaA,KAVA9B,EAAAksC,QAAA,EAGAzvC,GAAA2lB,MAAAriB,KAAA4I,MAEAmZ,GAAAA,EAAA8C,MACA9C,EAAA8C,KAAAznB,KAAA4C,MAAA,GAIAO,EAAA8rC,EAAAtqC,OAAAxB,KACA8rC,EAAA9rC,GAAAkY,OAAAzY,MAAAqsC,EAAA9rC,GAAA8hB,QAAAzZ,IACAyjC,EAAA9rC,GAAA2hB,KAAA2C,MAAA,GACAwnB,EAAAvnC,OAAAvE,EAAA,GAKA,KAAAA,EAAA,EAAAA,EAAAwB,EAAAxB,IACA8hB,EAAA9hB,IAAA8hB,EAAA9hB,GAAA4rC,QACA9pB,EAAA9hB,GAAA4rC,OAAA/uC,KAAA4C,YAKAC,GAAAksC,YAKAzvC,GAAAkD,MAAA,SAAA,OAAA,QAAA,SAAAqI,EAAA6P,GACA,GAAAw0B,GAAA5vC,GAAAqV,GAAA+F,EACApb,IAAAqV,GAAA+F,GAAA,SAAA8zB,EAAA/qB,EAAAyI,GACA,MAAA,OAAAsiB,GAAA,iBAAAA,GACAU,EAAAx3B,MAAA9U,KAAAuS,WACAvS,KAAAgsC,QAAA9qB,EAAApJ,GAAA,GAAA8zB,EAAA/qB,EAAAyI,MAKA5sB,GAAAkD,MACA2sC,UAAArrB,EAAA,QACAsrB,QAAAtrB,EAAA,QACAurB,YAAAvrB,EAAA,UACAwrB,QAAAprB,QAAA,QACAqrB,SAAArrB,QAAA,QACAsrB,YAAAtrB,QAAA,WACA,SAAAxJ,EAAA+J,GACAnlB,GAAAqV,GAAA+F,GAAA,SAAA8zB,EAAA/qB,EAAAyI,GACA,MAAAtpB,MAAAgsC,QAAAnqB,EAAA+pB,EAAA/qB,EAAAyI,MAIA5sB,GAAA2vC,UACA3vC,GAAAsoB,GAAAhB,KAAA,WACA,GAAA1c,GACA+kC,EAAA3vC,GAAA2vC,OACApkC,EAAA,CAIA,KAFA+Y,GAAAtkB,GAAAukB,MAEAhZ,EAAAokC,EAAAtqC,OAAAkG,IACAX,EAAA+kC,EAAApkC,GAEAX,KAAA+kC,EAAApkC,KAAAX,GACA+kC,EAAAvnC,OAAAmD,IAAA,EAIAokC,GAAAtqC,QACArF,GAAAsoB,GAAAH,OAEA7D,GAAAnhB,QAGAnD,GAAAsoB,GAAA1d,MAAA,SAAAA,GACA5K,GAAA2vC,OAAA/lC,KAAAgB,GACAA,IACA5K,GAAAsoB,GAAA5B,QAEA1mB,GAAA2vC,OAAAl8B,OAIAzT,GAAAsoB,GAAA6nB,SAAA,GAEAnwC,GAAAsoB,GAAA5B,MAAA,WACAjM,KACAA,GAAA21B,YAAApwC,GAAAsoB,GAAAhB,KAAAtnB,GAAAsoB,GAAA6nB,YAIAnwC,GAAAsoB,GAAAH,KAAA,WACAkoB,cAAA51B,IACAA,GAAA,MAGAza,GAAAsoB,GAAA6mB,QACAmB,KAAA,IACAC,KAAA,IAEAxM,SAAA,KAMA/jC,GAAAqV,GAAAm7B,MAAA,SAAAC,EAAAvkC,GAIA,MAHAukC,GAAAzwC,GAAAsoB,GAAAtoB,GAAAsoB,GAAA6mB,OAAAsB,IAAAA,EAAAA,EACAvkC,EAAAA,GAAA,KAEA5I,KAAAqiB,MAAAzZ,EAAA,SAAAowB,EAAAjX,GACA,GAAAvK,GAAAzQ,WAAAiyB,EAAAmU,EACAprB,GAAA8C,KAAA,WACAzc,aAAAoP,OAMA,WAEA,GAAAzK,GAAAsI,EAAA4W,EAAA3sB,EAAAyT,CAGAsC,GAAAtZ,GAAAG,cAAA,OACAmZ,EAAAtR,aAAA,YAAA,KACAsR,EAAAvY,UAAA,qEACAwC,EAAA+V,EAAArO,qBAAA,KAAA,GAGAilB,EAAAlwB,GAAAG,cAAA,UACA6W,EAAAkZ,EAAAhoB,YAAAlI,GAAAG,cAAA,WACA6Q,EAAAsI,EAAArO,qBAAA,SAAA,GAEA1H,EAAAlD,MAAAmZ,QAAA,UAGA4F,GAAAiyB,gBAAA,MAAA/3B,EAAAlZ,UAIAgf,GAAA/e,MAAA,MAAAmJ,KAAAjG,EAAAwE,aAAA,UAIAqX,GAAAkyB,eAAA,OAAA/tC,EAAAwE,aAAA,QAGAqX,GAAAmyB,UAAAvgC,EAAAa,MAIAuN,GAAAoyB,YAAAx6B,EAAAkL,SAGA9C,GAAAqyB,UAAAzxC,GAAAG,cAAA,QAAAsxC,QAIAvhB,EAAA+K,UAAA,EACA7b,GAAAsyB,aAAA16B,EAAAikB,SAIAjqB,EAAAhR,GAAAG,cAAA,SACA6Q,EAAAhJ,aAAA,QAAA,IACAoX,GAAApO,MAAA,KAAAA,EAAAjJ,aAAA,SAGAiJ,EAAAa,MAAA,IACAb,EAAAhJ,aAAA,OAAA,SACAoX,GAAAuyB,WAAA,MAAA3gC,EAAAa,QAIA,IAAA+/B,IAAA,KAEAjxC,IAAAqV,GAAA8I,QACAha,IAAA,SAAA+M,GACA,GAAAmU,GAAA1H,EAAA9B,EACAE,EAAAzY,KAAA,EAEA,EAAA,GAAAuS,UAAAxQ,OAsBA,MAFAwW,GAAA7b,GAAA6b,WAAA3K,GAEA5N,KAAAJ,KAAA,SAAAqI,GACA,GAAApH,EAEA,KAAAb,KAAAkT,WAKArS,EADA0X,EACA3K,EAAAxQ,KAAA4C,KAAAiI,EAAAvL,GAAAsD,MAAAa,OAEA+M,EAIA,MAAA/M,EACAA,EAAA,GACA,gBAAAA,GACAA,GAAA,GACAnE,GAAAse,QAAAna,KACAA,EAAAnE,GAAAqI,IAAAlE,EAAA,SAAA+M,GACA,MAAA,OAAAA,EAAA,GAAAA,EAAA,MAIAmU,EAAArlB,GAAAkxC,SAAA5tC,KAAA4I,OAAAlM,GAAAkxC,SAAA5tC,KAAAwF,SAAA9E,eAGAqhB,GAAA,OAAAA,IAAAliB,SAAAkiB,EAAA/V,IAAAhM,KAAAa,EAAA,WACAb,KAAA4N,MAAA/M,KAjDA,IAAA4X,EAGA,MAFAsJ,GAAArlB,GAAAkxC,SAAAn1B,EAAA7P,OAAAlM,GAAAkxC,SAAAn1B,EAAAjT,SAAA9E,eAEAqhB,GAAA,OAAAA,IAAAliB,UAAAwa,EAAA0H,EAAAhD,IAAAtG,EAAA,UACA4B,GAGAA,EAAA5B,EAAA7K,MAEA,gBAAAyM,GAEAA,EAAApX,QAAA0qC,GAAA,IAEA,MAAAtzB,EAAA,GAAAA,OA0CA3d,GAAAme,QACA+yB,UACA9I,QACA/lB,IAAA,SAAAtG,GACA,GAAA5X,GAAAnE,GAAAwD,KAAAO,KAAAgY,EAAA,QACA,OAAA,OAAA5X,EACAA,EAGAnE,GAAAqhB,KAAArhB,GAAAyE,KAAAsX,MAGAwT,QACAlN,IAAA,SAAAtG,GAYA,IAXA,GAAA7K,GAAAk3B,EACApnC,EAAA+a,EAAA/a,QACA6C,EAAAkY,EAAAwe,cACA+M,EAAA,eAAAvrB,EAAA7P,MAAArI,EAAA,EACAif,EAAAwkB,EAAA,QACAr6B,EAAAq6B,EAAAzjC,EAAA,EAAA7C,EAAAqE,OACAkG,EAAA1H,EAAA,EACAoJ,EACAq6B,EAAAzjC,EAAA,EAGA0H,EAAA0B,EAAA1B,IAIA,GAHA68B,EAAApnC,EAAAuK,IAGA68B,EAAA7mB,UAAAhW,IAAA1H,KAEA4a,GAAAsyB,aAAA3I,EAAA9N,SAAA,OAAA8N,EAAAhhC,aAAA,gBACAghC,EAAAx/B,WAAA0xB,WAAAt6B,GAAA8I,SAAAs/B,EAAAx/B,WAAA,aAAA,CAMA,GAHAsI,EAAAlR,GAAAooC,GAAAjkC,MAGAmjC,EACA,MAAAp2B,EAIA4R,GAAAlZ,KAAAsH,GAIA,MAAA4R,IAGAxT,IAAA,SAAAyM,EAAA7K,GAMA,IALA,GAAAigC,GAAA/I,EACApnC,EAAA+a,EAAA/a,QACA8hB,EAAA9iB,GAAA0tB,UAAAxc,GACA3F,EAAAvK,EAAAqE,OAEAkG,KAGA,GAFA68B,EAAApnC,EAAAuK,GAEAvL,GAAAkc,QAAAlc,GAAAkxC,SAAA9I,OAAA/lB,IAAA+lB,GAAAtlB,IAAA,EAMA,IACAslB,EAAA7mB,SAAA4vB,GAAA,EAEA,MAAAh2B,GAGAitB,EAAAgJ,iBAIAhJ,GAAA7mB,UAAA,CASA,OAJA4vB,KACAp1B,EAAAwe,kBAGAv5B,OAOAhB,GAAAkD,MAAA,QAAA,YAAA,WACAlD,GAAAkxC,SAAA5tC,OACAgM,IAAA,SAAAyM,EAAA7K,GACA,GAAAlR,GAAAse,QAAApN,GACA,MAAA6K,GAAA8D,QAAA7f,GAAAkc,QAAAlc,GAAA+b,GAAA5X,MAAA+M,IAAA,IAIAuN,GAAAmyB,UACA5wC,GAAAkxC,SAAA5tC,MAAA+e,IAAA,SAAAtG,GAGA,MAAA,QAAAA,EAAA3U,aAAA,SAAA,KAAA2U,EAAA7K,SAQA,IAAAmgC,IAAAC,GACAthB,GAAAhwB,GAAAg4B,KAAAhI,WACAuhB,GAAA,0BACAb,GAAAjyB,GAAAiyB,gBACAc,GAAA/yB,GAAApO,KAEArQ,IAAAqV,GAAA8I,QACApa,KAAA,SAAAqX,EAAAlK,GACA,MAAA0vB,IAAAt9B,KAAAtD,GAAA+D,KAAAqX,EAAAlK,EAAA2E,UAAAxQ,OAAA,IAGAosC,WAAA,SAAAr2B,GACA,MAAA9X,MAAAJ,KAAA,WACAlD,GAAAyxC,WAAAnuC,KAAA8X,QAKApb,GAAAme,QACApa,KAAA,SAAAgY,EAAAX,EAAAlK,GACA,GAAAmU,GAAA1H,EACA+zB,EAAA31B,EAAAvF,QAGA,IAAAuF,GAAA,IAAA21B,GAAA,IAAAA,GAAA,IAAAA,EAKA,aAAA31B,GAAA3U,eAAAoY,GACAxf,GAAAikB,KAAAlI,EAAAX,EAAAlK,IAKA,IAAAwgC,GAAA1xC,GAAA47B,SAAA7f,KACAX,EAAAA,EAAApX,cACAqhB,EAAArlB,GAAA2xC,UAAAv2B,KACApb,GAAAg4B,KAAA5tB,MAAAwrB,KAAA/sB,KAAAuS,GAAAk2B,GAAAD,KAGAluC,SAAA+N,EAaAmU,GAAA,OAAAA,IAAA,QAAA1H,EAAA0H,EAAAhD,IAAAtG,EAAAX,IACAuC,GAGAA,EAAA3d,GAAAwD,KAAAO,KAAAgY,EAAAX,GAGA,MAAAuC,EACAxa,OACAwa,GApBA,OAAAzM,EAGAmU,GAAA,OAAAA,IAAAliB,UAAAwa,EAAA0H,EAAA/V,IAAAyM,EAAA7K,EAAAkK,IACAuC,GAGA5B,EAAA1U,aAAA+T,EAAAlK,EAAA,IACAA,OAPAlR,IAAAyxC,WAAA11B,EAAAX,KAuBAq2B,WAAA,SAAA11B,EAAA7K,GACA,GAAAkK,GAAAw2B,EACArmC,EAAA,EACAsmC,EAAA3gC,GAAAA,EAAA9G,MAAAqS,GAEA,IAAAo1B,GAAA,IAAA91B,EAAAvF,SACA,KAAA4E,EAAAy2B,EAAAtmC,MACAqmC,EAAA5xC,GAAA8xC,QAAA12B,IAAAA,EAGApb,GAAAg4B,KAAA5tB,MAAAwrB,KAAA/sB,KAAAuS,GAEAo2B,IAAAd,KAAAa,GAAA1oC,KAAAuS,GACAW,EAAA61B,IAAA,EAIA71B,EAAA/b,GAAAoe,UAAA,WAAAhD,IACAW,EAAA61B,IAAA,EAKA5xC,GAAA+D,KAAAgY,EAAAX,EAAA,IAGAW,EAAA5H,gBAAAu8B,GAAAt1B,EAAAw2B,IAKAD,WACAzlC,MACAoD,IAAA,SAAAyM,EAAA7K,GACA,IAAAuN,GAAAuyB,YAAA,UAAA9/B,GAAAlR,GAAA8I,SAAAiT,EAAA,SAAA,CAGA,GAAA5X,GAAA4X,EAAA7K,KAKA,OAJA6K,GAAA1U,aAAA,OAAA6J,GACA/M,IACA4X,EAAA7K,MAAA/M,GAEA+M,QAQAogC,IACAhiC,IAAA,SAAAyM,EAAA7K,EAAAkK,GAaA,MAZAlK,MAAA,EAEAlR,GAAAyxC,WAAA11B,EAAAX,GACAo2B,IAAAd,KAAAa,GAAA1oC,KAAAuS,GAEAW,EAAA1U,cAAAqpC,IAAA1wC,GAAA8xC,QAAA12B,IAAAA,EAAAA,GAIAW,EAAA/b,GAAAoe,UAAA,WAAAhD,IAAAW,EAAAX,IAAA,EAGAA,IAKApb,GAAAkD,KAAAlD,GAAAg4B,KAAA5tB,MAAAwrB,KAAA7qB,OAAAX,MAAA,QAAA,SAAAmB,EAAA6P;AAEA,GAAA22B,GAAA/hB,GAAA5U,IAAApb,GAAAwD,KAAAO,IAEAisB,IAAA5U,GAAAo2B,IAAAd,KAAAa,GAAA1oC,KAAAuS,GACA,SAAAW,EAAAX,EAAA2Y,GACA,GAAApW,GAAAmD,CAUA,OATAiT,KAEAjT,EAAAkP,GAAA5U,GACA4U,GAAA5U,GAAAuC,EACAA,EAAA,MAAAo0B,EAAAh2B,EAAAX,EAAA2Y,GACA3Y,EAAApX,cACA,KACAgsB,GAAA5U,GAAA0F,GAEAnD,GAEA,SAAA5B,EAAAX,EAAA2Y,GACA,IAAAA,EACA,MAAAhY,GAAA/b,GAAAoe,UAAA,WAAAhD,IACAA,EAAApX,cACA,QAMAwtC,IAAAd,KACA1wC,GAAA2xC,UAAAzgC,OACA5B,IAAA,SAAAyM,EAAA7K,EAAAkK,GACA,MAAApb,IAAA8I,SAAAiT,EAAA,cAEAA,EAAAyF,aAAAtQ,GAGAmgC,IAAAA,GAAA/hC,IAAAyM,EAAA7K,EAAAkK,MAOAs1B,KAIAW,IACA/hC,IAAA,SAAAyM,EAAA7K,EAAAkK,GAEA,GAAAuC,GAAA5B,EAAAkb,iBAAA7b,EAUA,IATAuC,GACA5B,EAAAi2B,iBACAr0B,EAAA5B,EAAAiE,cAAAiyB,gBAAA72B,IAIAuC,EAAAzM,MAAAA,GAAA,GAGA,UAAAkK,GAAAlK,IAAA6K,EAAA3U,aAAAgU,GACA,MAAAlK,KAMA8e,GAAAznB,GAAAynB,GAAA5U,KAAA4U,GAAAkiB,OACA,SAAAn2B,EAAAX,EAAA2Y,GACA,GAAApW,EACA,KAAAoW,EACA,OAAApW,EAAA5B,EAAAkb,iBAAA7b,KAAA,KAAAuC,EAAAzM,MACAyM,EAAAzM,MACA,MAKAlR,GAAAkxC,SAAAzW,QACApY,IAAA,SAAAtG,EAAAX,GACA,GAAAuC,GAAA5B,EAAAkb,iBAAA7b,EACA,IAAAuC,GAAAA,EAAAsa,UACA,MAAAta,GAAAzM,OAGA5B,IAAA+hC,GAAA/hC,KAKAtP,GAAA2xC,UAAAQ,iBACA7iC,IAAA,SAAAyM,EAAA7K,EAAAkK,GACAi2B,GAAA/hC,IAAAyM,EAAA,KAAA7K,GAAAA,EAAAkK,KAMApb,GAAAkD,MAAA,QAAA,UAAA,SAAAqI,EAAA6P,GACApb,GAAA2xC,UAAAv2B,IACA9L,IAAA,SAAAyM,EAAA7K,GACA,GAAA,KAAAA,EAEA,MADA6K,GAAA1U,aAAA+T,EAAA,QACAlK,OAOAuN,GAAA/e,QACAM,GAAA2xC,UAAAjyC,OACA2iB,IAAA,SAAAtG,GAIA,MAAAA,GAAArc,MAAAmZ,SAAA1V,QAEAmM,IAAA,SAAAyM,EAAA7K,GACA,MAAA6K,GAAArc,MAAAmZ,QAAA3H,EAAA,KAQA,IAAAkhC,IAAA,6CACAC,GAAA,eAEAryC,IAAAqV,GAAA8I,QACA8F,KAAA,SAAA7I,EAAAlK,GACA,MAAA0vB,IAAAt9B,KAAAtD,GAAAikB,KAAA7I,EAAAlK,EAAA2E,UAAAxQ,OAAA,IAGAitC,WAAA,SAAAl3B,GAEA,MADAA,GAAApb,GAAA8xC,QAAA12B,IAAAA,EACA9X,KAAAJ,KAAA,WAEA,IACAI,KAAA8X,GAAAjY,aACAG,MAAA8X,GACA,MAAAzY,UAKA3C,GAAAme,QACA2zB,SACAS,MAAA,UACAC,QAAA,aAGAvuB,KAAA,SAAAlI,EAAAX,EAAAlK,GACA,GAAAyM,GAAA0H,EAAAotB,EACAf,EAAA31B,EAAAvF,QAGA,IAAAuF,GAAA,IAAA21B,GAAA,IAAAA,GAAA,IAAAA,EAYA,MARAe,GAAA,IAAAf,IAAA1xC,GAAA47B,SAAA7f,GAEA02B,IAEAr3B,EAAApb,GAAA8xC,QAAA12B,IAAAA,EACAiK,EAAArlB,GAAAmuC,UAAA/yB,IAGAjY,SAAA+N,EACAmU,GAAA,OAAAA,IAAAliB,UAAAwa,EAAA0H,EAAA/V,IAAAyM,EAAA7K,EAAAkK,IACAuC,EACA5B,EAAAX,GAAAlK,EAGAmU,GAAA,OAAAA,IAAA,QAAA1H,EAAA0H,EAAAhD,IAAAtG,EAAAX,IACAuC,EACA5B,EAAAX,IAIA+yB,WACA/T,UACA/X,IAAA,SAAAtG,GAIA,GAAA22B,GAAA1yC,GAAAwD,KAAAO,KAAAgY,EAAA,WAEA,OAAA22B,GACAnuC,SAAAmuC,EAAA,IACAN,GAAAvpC,KAAAkT,EAAAjT,WAAAupC,GAAAxpC,KAAAkT,EAAAjT,WAAAiT,EAAA9D,KACA,UASAwG,GAAAkyB,gBAEA3wC,GAAAkD,MAAA,OAAA,OAAA,SAAAqI,EAAA6P,GACApb,GAAAmuC,UAAA/yB,IACAiH,IAAA,SAAAtG,GACA,MAAAA,GAAA3U,aAAAgU,EAAA,OASAqD,GAAAoyB,cACA7wC,GAAAmuC,UAAA5sB,UACAc,IAAA,SAAAtG,GACA,GAAArX,GAAAqX,EAAAnT,UAUA,OARAlE,KACAA,EAAA61B,cAGA71B,EAAAkE,YACAlE,EAAAkE,WAAA2xB,eAGA,QAKAv6B,GAAAkD,MACA,WACA,WACA,YACA,cACA,cACA,UACA,UACA,SACA,cACA,mBACA,WACAlD,GAAA8xC,QAAAxuC,KAAAU,eAAAV,OAIAmb,GAAAqyB,UACA9wC,GAAA8xC,QAAAhB,QAAA,WAMA,IAAA6B,IAAA,aAEA3yC,IAAAqV,GAAA8I,QACAza,SAAA,SAAAwN,GACA,GAAA0hC,GAAA72B,EAAAK,EAAAy2B,EAAA35B,EAAA45B,EACAvnC,EAAA,EACA0E,EAAA3M,KAAA+B,OACA0tC,EAAA,gBAAA7hC,IAAAA,CAEA,IAAAlR,GAAA6b,WAAA3K,GACA,MAAA5N,MAAAJ,KAAA,SAAAgW,GACAlZ,GAAAsD,MAAAI,SAAAwN,EAAAxQ,KAAA4C,KAAA4V,EAAA5V,KAAA7D,aAIA,IAAAszC,EAIA,IAFAH,GAAA1hC,GAAA,IAAA9G,MAAAqS,QAEAlR,EAAA0E,EAAA1E,IAOA,GANAwQ,EAAAzY,KAAAiI,GACA6Q,EAAA,IAAAL,EAAAvF,WAAAuF,EAAAtc,WACA,IAAAsc,EAAAtc,UAAA,KAAA8G,QAAAosC,GAAA,KACA,KAGA,CAEA,IADAz5B,EAAA,EACA25B,EAAAD,EAAA15B,MACAkD,EAAA/Y,QAAA,IAAAwvC,EAAA,KAAA,IACAz2B,GAAAy2B,EAAA,IAKAC,GAAA9yC,GAAAqhB,KAAAjF,GACAL,EAAAtc,YAAAqzC,IACA/2B,EAAAtc,UAAAqzC,GAMA,MAAAxvC,OAGAG,YAAA,SAAAyN,GACA,GAAA0hC,GAAA72B,EAAAK,EAAAy2B,EAAA35B,EAAA45B,EACAvnC,EAAA,EACA0E,EAAA3M,KAAA+B,OACA0tC,EAAA,IAAAl9B,UAAAxQ,QAAA,gBAAA6L,IAAAA,CAEA,IAAAlR,GAAA6b,WAAA3K,GACA,MAAA5N,MAAAJ,KAAA,SAAAgW,GACAlZ,GAAAsD,MAAAG,YAAAyN,EAAAxQ,KAAA4C,KAAA4V,EAAA5V,KAAA7D,aAGA,IAAAszC,EAGA,IAFAH,GAAA1hC,GAAA,IAAA9G,MAAAqS,QAEAlR,EAAA0E,EAAA1E,IAQA,GAPAwQ,EAAAzY,KAAAiI,GAEA6Q,EAAA,IAAAL,EAAAvF,WAAAuF,EAAAtc,WACA,IAAAsc,EAAAtc,UAAA,KAAA8G,QAAAosC,GAAA,KACA,IAGA,CAEA,IADAz5B,EAAA,EACA25B,EAAAD,EAAA15B,MAEA,KAAAkD,EAAA/Y,QAAA,IAAAwvC,EAAA,MAAA,GACAz2B,EAAAA,EAAA7V,QAAA,IAAAssC,EAAA,IAAA,IAKAC,GAAA5hC,EAAAlR,GAAAqhB,KAAAjF,GAAA,GACAL,EAAAtc,YAAAqzC,IACA/2B,EAAAtc,UAAAqzC,GAMA,MAAAxvC,OAGA0vC,YAAA,SAAA9hC,EAAA+hC,GACA,GAAA/mC,SAAAgF,EAEA,OAAA,iBAAA+hC,IAAA,WAAA/mC,EACA+mC,EAAA3vC,KAAAI,SAAAwN,GAAA5N,KAAAG,YAAAyN,GAGAlR,GAAA6b,WAAA3K,GACA5N,KAAAJ,KAAA,SAAAqI,GACAvL,GAAAsD,MAAA0vC,YAAA9hC,EAAAxQ,KAAA4C,KAAAiI,EAAAjI,KAAA7D,UAAAwzC,GAAAA,KAIA3vC,KAAAJ,KAAA,WACA,GAAA,WAAAgJ,EAOA,IALA,GAAAzM,GACA8L,EAAA,EACAwwB,EAAA/7B,GAAAsD,MACA4vC,EAAAhiC,EAAA9G,MAAAqS,QAEAhd,EAAAyzC,EAAA3nC,MAEAwwB,EAAAoX,SAAA1zC,GACAs8B,EAAAt4B,YAAAhE,GAEAs8B,EAAAr4B,SAAAjE,OAKAyM,KAAAsT,IAAA,YAAAtT,IACA5I,KAAA7D,WAEAO,GAAAsgB,MAAAhd,KAAA,gBAAAA,KAAA7D,WAOA6D,KAAA7D,UAAA6D,KAAA7D,WAAAyR,KAAA,EAAA,GAAAlR,GAAAsgB,MAAAhd,KAAA,kBAAA,OAKA6vC,SAAA,SAAApnB,GAIA,IAHA,GAAAtsB,GAAA,IAAAssB,EAAA,IACAxgB,EAAA,EACAmV,EAAApd,KAAA+B,OACAkG,EAAAmV,EAAAnV,IACA,GAAA,IAAAjI,KAAAiI,GAAAiL,WAAA,IAAAlT,KAAAiI,GAAA9L,UAAA,KAAA8G,QAAAosC,GAAA,KAAAtvC,QAAA5D,IAAA,EACA,OAAA,CAIA,QAAA,KAUAO,GAAAkD,KAAA,0MAEAkG,MAAA,KAAA,SAAAmC,EAAA6P,GAGApb,GAAAqV,GAAA+F,GAAA,SAAA7X,EAAA8R,GACA,MAAAQ,WAAAxQ,OAAA,EACA/B,KAAA4R,GAAAkG,EAAA,KAAA7X,EAAA8R,GACA/R,KAAA6/B,QAAA/nB,MAIApb,GAAAqV,GAAA8I,QACAi1B,MAAA,SAAAC,EAAAC,GACA,MAAAhwC,MAAAmjC,WAAA4M,GAAA3M,WAAA4M,GAAAD,IAGAE,KAAA,SAAAjnC,EAAA/I,EAAA8R,GACA,MAAA/R,MAAA4R,GAAA5I,EAAA,KAAA/I,EAAA8R,IAEAm+B,OAAA,SAAAlnC,EAAA+I,GACA,MAAA/R,MAAAo8B,IAAApzB,EAAA,KAAA+I,IAGAo+B,SAAA,SAAA1nB,EAAAzf,EAAA/I,EAAA8R,GACA,MAAA/R,MAAA4R,GAAA5I,EAAAyf,EAAAxoB,EAAA8R,IAEAq+B,WAAA,SAAA3nB,EAAAzf,EAAA+I,GAEA,MAAA,KAAAQ,UAAAxQ,OAAA/B,KAAAo8B,IAAA3T,EAAA,MAAAzoB,KAAAo8B,IAAApzB,EAAAyf,GAAA,KAAA1W,KAKA,IAAAs+B,IAAA3zC,GAAAukB,MAEAqvB,GAAA,KAIAC,GAAA,kIAEA7zC,IAAAqd,UAAA,SAAA9Z,GAEA,GAAAxC,EAAA+yC,MAAA/yC,EAAA+yC,KAAAC,MAGA,MAAAhzC,GAAA+yC,KAAAC,MAAAxwC,EAAA,GAGA,IAAAywC,GACAC,EAAA,KACA1hC,EAAAvS,GAAAqhB,KAAA9d,EAAA,GAIA,OAAAgP,KAAAvS,GAAAqhB,KAAA9O,EAAAhM,QAAAstC,GAAA,SAAArY,EAAA0Y,EAAAxqC,EAAAuY,GAQA,MALA+xB,IAAAE,IACAD,EAAA,GAIA,IAAAA,EACAzY,GAIAwY,EAAAtqC,GAAAwqC,EAMAD,IAAAhyB,GAAAvY,EAGA,OAEAuM,SAAA,UAAA1D,KACAvS,GAAA8qB,MAAA,iBAAAvnB,IAKAvD,GAAAm0C,SAAA,SAAA5wC,GACA,GAAA4tB,GAAAzG,CACA,KAAAnnB,GAAA,gBAAAA,GACA,MAAA,KAEA,KACAxC,EAAAqzC,WACA1pB,EAAA,GAAA0pB,WACAjjB,EAAAzG,EAAA2pB,gBAAA9wC,EAAA,cAEA4tB,EAAA,GAAA7F,eAAA,oBACA6F,EAAAmjB,MAAA,QACAnjB,EAAAojB,QAAAhxC,IAEA,MAAAZ,GACAwuB,EAAAhuB,OAKA,MAHAguB,IAAAA,EAAAtuB,kBAAAsuB,EAAA7mB,qBAAA,eAAAjF,QACArF,GAAA8qB,MAAA,gBAAAvnB,GAEA4tB,EAIA,IAEAqjB,IACAC,GAEAC,GAAA,OACAC,GAAA,gBACAC,GAAA,gCAEAC,GAAA,4DACAC,GAAA,iBACAC,GAAA,QACAC,GAAA,4DAWAC,MAOA3rB,MAGA4rB,GAAA,KAAA32B,OAAA,IAIA,KACAk2B,GAAApuC,SAAA4R,KACA,MAAAtV,IAGA8xC,GAAAp1C,GAAAG,cAAA,KACAi1C,GAAAx8B,KAAA,GACAw8B,GAAAA,GAAAx8B,KAIAu8B,GAAAQ,GAAAvkC,KAAAgkC,GAAAzwC,mBAoOAhE,GAAAme,QAGAg3B,OAAA,EAGAC,gBACAC,QAEA3rB,cACArgB,IAAAorC,GACAvoC,KAAA,MACAopC,QAAAT,GAAAhsC,KAAA2rC,GAAA,IACAn5B,QAAA,EACAk6B,aAAA,EACAjB,OAAA,EACAkB,YAAA,mDAaAC,SACA5G,IAAAqG,GACAzwC,KAAA,aACAnC,KAAA,YACA6uB,IAAA,4BACAukB,KAAA,qCAGA1rB,UACAmH,IAAA,MACA7uB,KAAA,OACAozC,KAAA,QAGA9qB,gBACAuG,IAAA,cACA1sB,KAAA,eACAixC,KAAA,gBAKAvrB,YAGAwrB,SAAArf,OAGAsf,aAAA,EAGAC,YAAA71C,GAAAqd,UAGAy4B,WAAA91C,GAAAm0C,UAOA1qB,aACApgB,KAAA,EACAoN,SAAA,IAOAs/B,UAAA,SAAAr0C,EAAAs0C,GACA,MAAAA,GAGAzsB,EAAAA,EAAA7nB,EAAA1B,GAAA0pB,cAAAssB,GAGAzsB,EAAAvpB,GAAA0pB,aAAAhoB,IAGAu0C,cAAAxtB,EAAAwsB,IACAiB,cAAAztB,EAAAa,IAGA6sB,KAAA,SAAA9sC,EAAArI,GAoRA,QAAAulB,GAAA6vB,EAAAC,EAAAzsB,EAAA0sB,GACA,GAAAhsB,GAAAisB,EAAAzrB,EAAAT,EAAAmsB,EACAC,EAAAJ,CAGA,KAAAvkC,IAKAA,EAAA,EAGA4kC,GACAhrC,aAAAgrC,GAKAC,EAAAxzC,OAGAyzC,EAAAN,GAAA,GAGAttB,EAAAphB,WAAAwuC,EAAA,EAAA,EAAA,EAGA9rB,EAAA8rB,GAAA,KAAAA,EAAA,KAAA,MAAAA,EAGAxsB,IACAS,EAAAV,EAAA1W,EAAA+V,EAAAY,IAIAS,EAAAD,EAAAnX,EAAAoX,EAAArB,EAAAsB,GAGAA,GAGArX,EAAA4jC,aACAL,EAAAxtB,EAAAkB,kBAAA,iBACAssB,IACAx2C,GAAAo1C,aAAA0B,GAAAN,GAEAA,EAAAxtB,EAAAkB,kBAAA,QACAssB,IACAx2C,GAAAq1C,KAAAyB,GAAAN,IAKA,MAAAJ,GAAA,SAAAnjC,EAAA/G,KACAuqC,EAAA,YAGA,MAAAL,EACAK,EAAA,eAIAA,EAAApsB,EAAAvY,MACAykC,EAAAlsB,EAAA9mB,KACAunB,EAAAT,EAAAS,MACAR,GAAAQ,KAKAA,EAAA2rB,GACAL,GAAAK,IACAA,EAAA,QACAL,EAAA,IACAA,EAAA,KAMAptB,EAAAotB,OAAAA,EACAptB,EAAAytB,YAAAJ,GAAAI,GAAA,GAGAnsB,EACAlD,EAAAW,YAAAgvB,GAAAR,EAAAE,EAAAztB,IAEA5B,EAAAiB,WAAA0uB,GAAA/tB,EAAAytB,EAAA3rB,IAIA9B,EAAAguB,WAAAA,GACAA,EAAA7zC,OAEA8zC,GACAC,EAAA/T,QAAA7Y,EAAA,cAAA,aACAtB,EAAA/V,EAAAqX,EAAAisB,EAAAzrB,IAIAqsB,EAAAjZ,SAAA6Y,GAAA/tB,EAAAytB,IAEAQ,IACAC,EAAA/T,QAAA,gBAAAna,EAAA/V,MAEAjT,GAAAm1C,QACAn1C,GAAA+c,MAAAomB,QAAA,cA5XA,gBAAA95B,KACArI,EAAAqI,EACAA,EAAAlG,QAIAnC,EAAAA,KAEA,IACAitC,GAEA1iC,EAEAurC,EAEAF,EAEAF,EAGAO,EAEAN,EAEAS,EAEAnkC,EAAAjT,GAAA+1C,aAAA/0C,GAEA+1C,EAAA9jC,EAAAwD,SAAAxD,EAEAikC,EAAAjkC,EAAAwD,UAAAsgC,EAAAvgC,UAAAugC,EAAAzqB,QACAtsB,GAAA+2C,GACA/2C,GAAA+c,MAEAqK,EAAApnB,GAAAqnB,WACA8vB,EAAAn3C,GAAAq9B,UAAA,eAEA2Z,EAAA/jC,EAAA+jC,eAEAK,KACAC,KAEAxlC,EAAA,EAEAylC,EAAA,WAEAvuB,GACAphB,WAAA,EAGAsiB,kBAAA,SAAAhN,GACA,GAAA9S,EACA,IAAA,IAAA0H,EAAA,CACA,IAAAslC,EAEA,IADAA,KACAhtC,EAAAwqC,GAAAnkC,KAAAmmC,IACAQ,EAAAhtC,EAAA,GAAApG,eAAAoG,EAAA,EAGAA,GAAAgtC,EAAAl6B,EAAAlZ,eAEA,MAAA,OAAAoG,EAAA,KAAAA,GAIAotC,sBAAA,WACA,MAAA,KAAA1lC,EAAA8kC,EAAA,MAIAa,iBAAA,SAAAr8B,EAAAlK,GACA,GAAAwmC,GAAAt8B,EAAApX,aAKA,OAJA8N,KACAsJ,EAAAk8B,EAAAI,GAAAJ,EAAAI,IAAAt8B,EACAi8B,EAAAj8B,GAAAlK,GAEA5N,MAIAq0C,iBAAA,SAAAzrC,GAIA,MAHA4F,KACAmB,EAAAgX,SAAA/d,GAEA5I,MAIA0zC,WAAA,SAAA3uC,GACA,GAAAuvC,EACA,IAAAvvC,EACA,GAAAyJ,EAAA,EACA,IAAA8lC,IAAAvvC,GAEA2uC,EAAAY,IAAAZ,EAAAY,GAAAvvC,EAAAuvC,QAIA5uB,GAAAjD,OAAA1d,EAAA2gB,EAAAotB,QAGA,OAAA9yC,OAIAu0C,MAAA,SAAApB,GACA,GAAAqB,GAAArB,GAAAc,CAKA,OAJAZ,IACAA,EAAAkB,MAAAC,GAEAvxB,EAAA,EAAAuxB,GACAx0C,MAwCA,IAnCA8jB,EAAAY,QAAAgB,GAAApR,SAAAu/B,EAAAp2B,IACAiI,EAAAutB,QAAAvtB,EAAAzC,KACAyC,EAAA8B,MAAA9B,EAAAR,KAMAvV,EAAA5J,MAAAA,GAAA4J,EAAA5J,KAAAorC,IAAA,IAAAluC,QAAAmuC,GAAA,IAAAnuC,QAAAwuC,GAAAP,GAAA,GAAA,MAGAvhC,EAAA/G,KAAAlL,EAAA+2C,QAAA/2C,EAAAkL,MAAA+G,EAAA8kC,QAAA9kC,EAAA/G,KAGA+G,EAAA4V,UAAA7oB,GAAAqhB,KAAApO,EAAA2V,UAAA,KAAA5kB,cAAAoG,MAAAqS,MAAA,IAGA,MAAAxJ,EAAA+kC,cACA/J,EAAA+G,GAAAvkC,KAAAwC,EAAA5J,IAAArF,eACAiP,EAAA+kC,eAAA/J,GACAA,EAAA,KAAAuG,GAAA,IAAAvG,EAAA,KAAAuG,GAAA,KACAvG,EAAA,KAAA,UAAAA,EAAA,GAAA,KAAA,WACAuG,GAAA,KAAA,UAAAA,GAAA,GAAA,KAAA,UAKAvhC,EAAA1P,MAAA0P,EAAAsiC,aAAA,gBAAAtiC,GAAA1P,OACA0P,EAAA1P,KAAAvD,GAAAuoC,MAAAt1B,EAAA1P,KAAA0P,EAAAgY,cAIAlC,EAAAksB,GAAAhiC,EAAAjS,EAAAgoB,GAGA,IAAAlX,EACA,MAAAkX,EAKAiuB,GAAAj3C,GAAA+c,OAAA9J,EAAAoI,OAGA47B,GAAA,IAAAj3C,GAAAm1C,UACAn1C,GAAA+c,MAAAomB,QAAA,aAIAlwB,EAAA/G,KAAA+G,EAAA/G,KAAAhB,cAGA+H,EAAAglC,YAAAnD,GAAAjsC,KAAAoK,EAAA/G,MAIA4qC,EAAA7jC,EAAA5J,IAGA4J,EAAAglC,aAGAhlC,EAAA1P,OACAuzC,EAAA7jC,EAAA5J,MAAAuqC,GAAA/qC,KAAAiuC,GAAA,IAAA,KAAA7jC,EAAA1P,WAEA0P,GAAA1P,MAIA0P,EAAAwC,SAAA,IACAxC,EAAA5J,IAAAsrC,GAAA9rC,KAAAiuC,GAGAA,EAAAvwC,QAAAouC,GAAA,OAAAhB,MAGAmD,GAAAlD,GAAA/qC,KAAAiuC,GAAA,IAAA,KAAA,KAAAnD,OAKA1gC,EAAA4jC,aACA72C,GAAAo1C,aAAA0B,IACA9tB,EAAAyuB,iBAAA,oBAAAz3C,GAAAo1C,aAAA0B,IAEA92C,GAAAq1C,KAAAyB,IACA9tB,EAAAyuB,iBAAA,gBAAAz3C,GAAAq1C,KAAAyB,MAKA7jC,EAAA1P,MAAA0P,EAAAglC,YAAAhlC,EAAAuiC,eAAA,GAAAx0C,EAAAw0C,cACAxsB,EAAAyuB,iBAAA,eAAAxkC,EAAAuiC,aAIAxsB,EAAAyuB,iBACA,SACAxkC,EAAA4V,UAAA,IAAA5V,EAAAwiC,QAAAxiC,EAAA4V,UAAA,IACA5V,EAAAwiC,QAAAxiC,EAAA4V,UAAA,KAAA,MAAA5V,EAAA4V,UAAA,GAAA,KAAAqsB,GAAA,WAAA,IACAjiC,EAAAwiC,QAAA,KAIA,KAAAlqC,IAAA0H,GAAAqjC,QACAttB,EAAAyuB,iBAAAlsC,EAAA0H,EAAAqjC,QAAA/qC,GAIA,IAAA0H,EAAAilC,aAAAjlC,EAAAilC,WAAAx3C,KAAAq2C,EAAA/tB,EAAA/V,MAAA,GAAA,IAAAnB,GAEA,MAAAkX,GAAA6uB,OAIAN,GAAA,OAGA,KAAAhsC,KAAAgrC,QAAA,EAAAzrB,MAAA,EAAAlT,SAAA,GACAoR,EAAAzd,GAAA0H,EAAA1H,GAOA,IAHAorC,EAAA5tB,EAAAO,GAAArW,EAAAjS,EAAAgoB,GAKA,CACAA,EAAAphB,WAAA,EAGAqvC,GACAC,EAAA/T,QAAA,YAAAna,EAAA/V,IAGAA,EAAAqhC,OAAArhC,EAAA6H,QAAA,IACA47B,EAAArsC,WAAA,WACA2e,EAAA6uB,MAAA,YACA5kC,EAAA6H,SAGA,KACAhJ,EAAA,EACA6kC,EAAAhtC,KAAA0tC,EAAA9wB,GACA,MAAA5jB,GAEA,KAAAmP,EAAA,GAIA,KAAAnP,EAHA4jB,MAAA5jB,QArBA4jB,MAAA,eA8IA,OAAAyC,IAGAmvB,QAAA,SAAA9uC,EAAA9F,EAAAqpB,GACA,MAAA5sB,IAAAqiB,IAAAhZ,EAAA9F,EAAAqpB,EAAA,SAGAwrB,UAAA,SAAA/uC,EAAAujB,GACA,MAAA5sB,IAAAqiB,IAAAhZ,EAAAlG,OAAAypB,EAAA,aAIA5sB,GAAAkD,MAAA,MAAA,QAAA,SAAAqI,EAAAwsC,GACA/3C,GAAA+3C,GAAA,SAAA1uC,EAAA9F,EAAAqpB,EAAA1gB,GAQA,MANAlM,IAAA6b,WAAAtY,KACA2I,EAAAA,GAAA0gB,EACAA,EAAArpB,EACAA,EAAAJ,QAGAnD,GAAAm2C,MACA9sC,IAAAA,EACA6C,KAAA6rC,EACAnvB,SAAA1c,EACA3I,KAAAA,EACAgzC,QAAA3pB,OAMA5sB,GAAAuqC,SAAA,SAAAlhC,GACA,MAAArJ,IAAAm2C,MACA9sC,IAAAA,EACA6C,KAAA,MACA0c,SAAA,SACA0rB,OAAA,EACAj5B,QAAA,EACAg9B,UAAA,KAKAr4C,GAAAqV,GAAA8I,QACAm6B,QAAA,SAAAh2C,GACA,GAAAtC,GAAA6b,WAAAvZ,GACA,MAAAgB,MAAAJ,KAAA,SAAAqI,GACAvL,GAAAsD,MAAAg1C,QAAAh2C,EAAA5B,KAAA4C,KAAAiI,KAIA,IAAAjI,KAAA,GAAA,CAEA,GAAAqmC,GAAA3pC,GAAAsC,EAAAgB,KAAA,GAAA0c,eAAA8M,GAAA,GAAArnB,OAAA,EAEAnC,MAAA,GAAAsF,YACA+gC,EAAAtpC,aAAAiD,KAAA,IAGAqmC,EAAAthC,IAAA,WAGA,IAFA,GAAA0T,GAAAzY,KAEAyY,EAAAvU,YAAA,IAAAuU,EAAAvU,WAAAgP,UACAuF,EAAAA,EAAAvU,UAGA,OAAAuU,KACAjW,OAAAxC,MAGA,MAAAA,OAGAi1C,UAAA,SAAAj2C,GACA,MAAAtC,IAAA6b,WAAAvZ,GACAgB,KAAAJ,KAAA,SAAAqI,GACAvL,GAAAsD,MAAAi1C,UAAAj2C,EAAA5B,KAAA4C,KAAAiI,MAIAjI,KAAAJ,KAAA,WACA,GAAA64B,GAAA/7B,GAAAsD,MACA0mB,EAAA+R,EAAA/R,UAEAA,GAAA3kB,OACA2kB,EAAAsuB,QAAAh2C,GAGAy5B,EAAAj2B,OAAAxD,MAKAqnC,KAAA,SAAArnC,GACA,GAAAuZ,GAAA7b,GAAA6b,WAAAvZ,EAEA,OAAAgB,MAAAJ,KAAA,SAAAqI,GACAvL,GAAAsD,MAAAg1C,QAAAz8B,EAAAvZ,EAAA5B,KAAA4C,KAAAiI,GAAAjJ,MAIAk2C,OAAA,WACA,MAAAl1C,MAAAoB,SAAAxB,KAAA,WACAlD,GAAA8I,SAAAxF,KAAA,SACAtD,GAAAsD,MAAA6mC,YAAA7mC,KAAAhD,cAEA4jB,SAKAlkB,GAAAg4B,KAAAoD,QAAAvY,OAAA,SAAA9G,GAGA,MAAAA,GAAA1Q,aAAA,GAAA0Q,EAAA2H,cAAA,IACAjF,GAAA6tB,yBACA,UAAAvwB,EAAArc,OAAAqc,EAAArc,MAAAkG,SAAA5F,GAAA0F,IAAAqW,EAAA,aAGA/b,GAAAg4B,KAAAoD,QAAAqd,QAAA,SAAA18B,GACA,OAAA/b,GAAAg4B,KAAAoD,QAAAvY,OAAA9G,GAMA,IAAA28B,IAAA,OACAvtB,GAAA,QACAwtB,GAAA,SACAC,GAAA,wCACAC,GAAA,oCAgCA74C,IAAAuoC,MAAA,SAAA3lC,EAAAqoB,GACA,GAAAD,GACA/X,KACA8N,EAAA,SAAA7D,EAAAhM,GAEAA,EAAAlR,GAAA6b,WAAA3K,GAAAA,IAAA,MAAAA,EAAA,GAAAA,EACA+B,EAAAA,EAAA5N,QAAAyzC,mBAAA57B,GAAA,IAAA47B,mBAAA5nC,GASA,IALA/N,SAAA8nB,IACAA,EAAAjrB,GAAA0pB,cAAA1pB,GAAA0pB,aAAAuB,aAIAjrB,GAAAse,QAAA1b,IAAAA,EAAA0pB,SAAAtsB,GAAAitB,cAAArqB,GAEA5C,GAAAkD,KAAAN,EAAA,WACAme,EAAAzd,KAAA8X,KAAA9X,KAAA4N,aAMA,KAAA8Z,IAAApoB,GACAmoB,EAAAC,EAAApoB,EAAAooB,GAAAC,EAAAlK,EAKA,OAAA9N,GAAA1J,KAAA,KAAAhD,QAAAmyC,GAAA,MAGA14C,GAAAqV,GAAA8I,QACA46B,UAAA,WACA,MAAA/4C,IAAAuoC,MAAAjlC,KAAA01C,mBAEAA,eAAA,WACA,MAAA11C,MAAA+E,IAAA,WAEA,GAAAiO,GAAAtW,GAAAikB,KAAA3gB,KAAA,WACA,OAAAgT,GAAAtW,GAAA0tB,UAAApX,GAAAhT,OAEA2Y,OAAA,WACA,GAAA/P,GAAA5I,KAAA4I,IAEA,OAAA5I,MAAA8X,OAAApb,GAAAsD,MAAA04B,GAAA,cACA6c,GAAAhwC,KAAAvF,KAAAwF,YAAA8vC,GAAA/vC,KAAAqD,KACA5I,KAAAuc,UAAAF,GAAA9W,KAAAqD,MAEA7D,IAAA,SAAAkD,EAAAwQ,GACA,GAAA5X,GAAAnE,GAAAsD,MAAAa,KAEA,OAAA,OAAAA,EACA,KACAnE,GAAAse,QAAAna,GACAnE,GAAAqI,IAAAlE,EAAA,SAAAA,GACA,OAAAiX,KAAAW,EAAAX,KAAAlK,MAAA/M,EAAAoC,QAAAoyC,GAAA,YAEAv9B,KAAAW,EAAAX,KAAAlK,MAAA/M,EAAAoC,QAAAoyC,GAAA,WACAt2B,SAOAriB,GAAA0pB,aAAAhiB,IAAAvE,SAAApC,EAAAuqB,cAEA,WAGA,OAAAhoB,KAAAgyC,SAQA,wCAAAzsC,KAAAvF,KAAA4I,OAEAkf,KAAAC,KAGAD,CAEA,IAAA6tB,IAAA,EACAC,MACAC,GAAAn5C,GAAA0pB,aAAAhiB,KAKA3G,GAAAwU,aACAxU,EAAAwU,YAAA,WAAA,WACA,IAAA,GAAA2H,KAAAg8B,IACAA,GAAAh8B,GAAA/Z,QAAA,KAMAsb,GAAA26B,OAAAD,IAAA,mBAAAA,IACAA,GAAA16B,GAAA03B,OAAAgD,GAGAA,IAEAn5C,GAAAk2C,cAAA,SAAAl1C,GAEA,IAAAA,EAAAg3C,aAAAv5B,GAAA26B,KAAA,CAEA,GAAAxsB,EAEA,QACAjjB,KAAA,SAAA2sC,EAAA1+B,GACA,GAAArM,GACA7D,EAAA1G,EAAA0G,MACAa,IAAA0wC,EAMA,IAHAvxC,EAAAgC,KAAA1I,EAAAkL,KAAAlL,EAAAqI,IAAArI,EAAAszC,MAAAtzC,EAAAq4C,SAAAr4C,EAAAi6B,UAGAj6B,EAAAs4C,UACA,IAAA/tC,IAAAvK,GAAAs4C,UACA5xC,EAAA6D,GAAAvK,EAAAs4C,UAAA/tC,EAKAvK,GAAAipB,UAAAviB,EAAAiwC,kBACAjwC,EAAAiwC,iBAAA32C,EAAAipB,UAQAjpB,EAAAg3C,aAAA1B,EAAA,sBACAA,EAAA,oBAAA,iBAIA,KAAA/qC,IAAA+qC,GAOAnzC,SAAAmzC,EAAA/qC,IACA7D,EAAA+vC,iBAAAlsC,EAAA+qC,EAAA/qC,GAAA,GAOA7D,GAAAiC,KAAA3I,EAAAi3C,YAAAj3C,EAAAuC,MAAA,MAGAqpB,EAAA,SAAAzR,EAAAo+B,GACA,GAAAnD,GAAAK,EAAA7sB,CAGA,IAAAgD,IAAA2sB,GAAA,IAAA7xC,EAAAE,YAOA,SALAsxC,IAAA3wC,GACAqkB,EAAAzpB,OACAuE,EAAAC,mBAAA3H,GAAA+T,KAGAwlC,EACA,IAAA7xC,EAAAE,YACAF,EAAAmwC,YAEA,CACAjuB,KACAwsB,EAAA1uC,EAAA0uC,OAKA,gBAAA1uC,GAAAO,eACA2hB,EAAAnlB,KAAAiD,EAAAO,aAKA,KACAwuC,EAAA/uC,EAAA+uC,WACA,MAAA9zC,GAEA8zC,EAAA,GAQAL,IAAAp1C,EAAAs0C,SAAAt0C,EAAAg3C,YAGA,OAAA5B,IACAA,EAAA,KAHAA,EAAAxsB,EAAAnlB,KAAA,IAAA,IASAmlB,GACAhS,EAAAw+B,EAAAK,EAAA7sB,EAAAliB,EAAA8vC,0BAIAx2C,EAAAszC,MAGA,IAAA5sC,EAAAE,WAGAyC,WAAAuiB,GAGAllB,EAAAC,mBAAAuxC,GAAA3wC,GAAAqkB,EAPAA,KAWAirB,MAAA,WACAjrB,GACAA,EAAAzpB,QAAA,QAyBAnD,GAAA+1C,WACAN,SACA+D,OAAA,6FAEAxvB,UACAwvB,OAAA,uBAEArvB,YACAsvB,cAAA,SAAAh1C,GAEA,MADAzE,IAAAwtB,WAAA/oB,GACAA,MAMAzE,GAAAi2C,cAAA,SAAA,SAAAhjC,GACA9P,SAAA8P,EAAAwC,QACAxC,EAAAwC,OAAA,GAEAxC,EAAA+kC,cACA/kC,EAAA/G,KAAA,MACA+G,EAAAoI,QAAA,KAKArb,GAAAk2C,cAAA,SAAA,SAAAjjC,GAGA,GAAAA,EAAA+kC,YAAA,CAEA,GAAAwB,GACAE,EAAAr6C,GAAAq6C,MAAA15C,GAAA,QAAA,IAAAX,GAAAwD,eAEA,QAEA8G,KAAA,SAAAwR,EAAAyR,GAEA4sB,EAAAn6C,GAAAG,cAAA,UAEAg6C,EAAAlF,OAAA,EAEArhC,EAAA0mC,gBACAH,EAAAI,QAAA3mC,EAAA0mC,eAGAH,EAAAr3C,IAAA8Q,EAAA5J,IAGAmwC,EAAAhtC,OAAAgtC,EAAA7xC,mBAAA,SAAAwT,EAAAo+B,IAEAA,IAAAC,EAAA5xC,YAAA,kBAAAiB,KAAA2wC,EAAA5xC,eAGA4xC,EAAAhtC,OAAAgtC,EAAA7xC,mBAAA,KAGA6xC,EAAA5wC,YACA4wC,EAAA5wC,WAAAM,YAAAswC,GAIAA,EAAA,KAGAD,GACA3sB,EAAA,IAAA,aAOA8sB,EAAAr5C,aAAAm5C,EAAAE,EAAAlyC,aAGAqwC,MAAA,WACA2B,GACAA,EAAAhtC,OAAArJ,QAAA,OAUA,IAAA02C,OACAC,GAAA,mBAGA95C,IAAA+1C,WACAgE,MAAA,WACAC,cAAA,WACA,GAAAptB,GAAAitB,GAAApmC,OAAAzT,GAAA8d,QAAA,IAAA61B,IAEA,OADArwC,MAAAspB,IAAA,EACAA,KAKA5sB,GAAAi2C,cAAA,aAAA,SAAAhjC,EAAAgnC,EAAAjxB,GAEA,GAAAkxB,GAAAC,EAAAC,EACAC,EAAApnC,EAAA8mC,SAAA,IAAAD,GAAAjxC,KAAAoK,EAAA5J,KACA,MACA,gBAAA4J,GAAA1P,QAAA0P,EAAAuiC,aAAA,IAAAnyC,QAAA,sCAAAy2C,GAAAjxC,KAAAoK,EAAA1P,OAAA,OAIA,IAAA82C,GAAA,UAAApnC,EAAA4V,UAAA,GAsDA,MAnDAqxB,GAAAjnC,EAAA+mC,cAAAh6C,GAAA6b,WAAA5I,EAAA+mC,eACA/mC,EAAA+mC,gBACA/mC,EAAA+mC,cAGAK,EACApnC,EAAAonC,GAAApnC,EAAAonC,GAAA9zC,QAAAuzC,GAAA,KAAAI,GACAjnC,EAAA8mC,SAAA,IACA9mC,EAAA5J,MAAAuqC,GAAA/qC,KAAAoK,EAAA5J,KAAA,IAAA,KAAA4J,EAAA8mC,MAAA,IAAAG,GAIAjnC,EAAAkX,WAAA,eAAA,WAIA,MAHAiwB,IACAp6C,GAAA8qB,MAAAovB,EAAA,mBAEAE,EAAA,IAIAnnC,EAAA4V,UAAA,GAAA,OAGAsxB,EAAAp5C,EAAAm5C,GACAn5C,EAAAm5C,GAAA,WACAE,EAAAvkC,WAIAmT,EAAAjD,OAAA,WAEAhlB,EAAAm5C,GAAAC,EAGAlnC,EAAAinC,KAEAjnC,EAAA+mC,cAAAC,EAAAD,cAGAH,GAAAjwC,KAAAswC,IAIAE,GAAAp6C,GAAA6b,WAAAs+B,IACAA,EAAAC,EAAA,IAGAA,EAAAD,EAAAh3C,SAIA,WAUAnD,GAAAk8B,UAAA,SAAA34B,EAAAkT,EAAA6jC,GACA,IAAA/2C,GAAA,gBAAAA,GACA,MAAA,KAEA,kBAAAkT,KACA6jC,EAAA7jC,EACAA,GAAA,GAEAA,EAAAA,GAAApX,EAEA,IAAA+a,GAAA0hB,GAAArrB,KAAAlN,GACAkmC,GAAA6Q,KAGA,OAAAlgC,IACA3D,EAAAjX,cAAA4a,EAAA,MAGAA,EAAApa,GAAAwpC,eAAAjmC,GAAAkT,EAAAgzB,GAEAA,GAAAA,EAAApkC,QACArF,GAAAypC,GAAA1nC,SAGA/B,GAAAyf,SAAArF,EAAA9Z,aAKA,IAAAi6C,IAAAv6C,GAAAqV,GAAAywB,IAKA9lC,IAAAqV,GAAAywB,KAAA,SAAAz8B,EAAAmxC,EAAA5tB,GACA,GAAA,gBAAAvjB,IAAAkxC,GACA,MAAAA,IAAAniC,MAAA9U,KAAAuS,UAGA,IAAAkW,GAAA1B,EAAAne,EACA6vB,EAAAz4B,KACAo8B,EAAAr2B,EAAAhG,QAAA,IA+CA,OA7CAq8B,IAAA,IACA3T,EAAA/rB,GAAAqhB,KAAAhY,EAAA5I,MAAAi/B,EAAAr2B,EAAAhE,SACAgE,EAAAA,EAAA5I,MAAA,EAAAi/B,IAIA1/B,GAAA6b,WAAA2+B,IAGA5tB,EAAA4tB,EACAA,EAAAr3C,QAGAq3C,GAAA,gBAAAA,KACAtuC,EAAA,QAIA6vB,EAAA12B,OAAA,GACArF,GAAAm2C,MACA9sC,IAAAA,EAGA6C,KAAAA,EACA0c,SAAA,OACArlB,KAAAi3C,IACAj0B,KAAA,SAAAte,GAGAoiB,EAAAxU,UAEAkmB,EAAAz5B,KAAAypB,EAIA/rB,GAAA,SAAA8F,OAAA9F,GAAAk8B,UAAAj0B,IAAAzE,KAAAuoB,GAGA9jB,KAEA2P,SAAAgV,GAAA,SAAA5D,EAAAotB,GACAra,EAAA74B,KAAA0pB,EAAAvC,IAAArB,EAAA/gB,aAAAmuC,EAAAptB,MAIA1lB,MAOAtD,GAAAkD,MAAA,YAAA,WAAA,eAAA,YAAA,cAAA,YAAA,SAAAqI,EAAAW,GACAlM,GAAAqV,GAAAnJ,GAAA,SAAAmJ,GACA,MAAA/R,MAAA4R,GAAAhJ,EAAAmJ,MAOArV,GAAAg4B,KAAAoD,QAAAqf,SAAA,SAAA1+B,GACA,MAAA/b,IAAA8b,KAAA9b,GAAA2vC,OAAA,SAAAt6B,GACA,MAAA0G,KAAA1G,EAAA0G,OACA1W,OAOA,IAAA8H,IAAApM,EAAA1B,SAAAwD,eAaA7C,IAAA06C,QACAC,UAAA,SAAA5+B,EAAA/a,EAAAuK,GACA,GAAAqvC,GAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EACAr1C,EAAA7F,GAAA0F,IAAAqW,EAAA,YACAo/B,EAAAn7C,GAAA+b,GACAoJ,IAGA,YAAAtf,IACAkW,EAAArc,MAAAmG,SAAA,YAGAm1C,EAAAG,EAAAT,SACAI,EAAA96C,GAAA0F,IAAAqW,EAAA,OACAk/B,EAAAj7C,GAAA0F,IAAAqW,EAAA,QACAm/B,GAAA,aAAAr1C,GAAA,UAAAA,IACA7F,GAAAkc,QAAA,QAAA4+B,EAAAG,OAGAC,GACAN,EAAAO,EAAAt1C,WACAk1C,EAAAH,EAAAhkB,IACAikB,EAAAD,EAAAtP,OAEAyP,EAAAxpC,WAAAupC,IAAA,EACAD,EAAAtpC,WAAA0pC,IAAA,GAGAj7C,GAAA6b,WAAA7a,KACAA,EAAAA,EAAAN,KAAAqb,EAAAxQ,EAAAyvC,IAGA,MAAAh6C,EAAA41B,MACAzR,EAAAyR,IAAA51B,EAAA41B,IAAAokB,EAAApkB,IAAAmkB,GAEA,MAAA/5C,EAAAsqC,OACAnmB,EAAAmmB,KAAAtqC,EAAAsqC,KAAA0P,EAAA1P,KAAAuP,GAGA,SAAA75C,GACAA,EAAAo6C,MAAA16C,KAAAqb,EAAAoJ,GAEAg2B,EAAAz1C,IAAAyf,KAKAnlB,GAAAqV,GAAA8I,QACAu8B,OAAA,SAAA15C,GACA,GAAA6U,UAAAxQ,OACA,MAAAlC,UAAAnC,EACAsC,KACAA,KAAAJ,KAAA,SAAAqI,GACAvL,GAAA06C,OAAAC,UAAAr3C,KAAAtC,EAAAuK,IAIA,IAAA4B,GAAAkuC,EACAC,GAAA1kB,IAAA,EAAA0U,KAAA,GACAvvB,EAAAzY,KAAA,GACAoe,EAAA3F,GAAAA,EAAAiE,aAEA,IAAA0B,EAOA,MAHAvU,GAAAuU,EAAA7e,gBAGA7C,GAAA+uB,SAAA5hB,EAAA4O,UAMAA,GAAAw/B,wBAAA/7B,KACA87B,EAAAv/B,EAAAw/B,yBAEAF,EAAA9vB,EAAA7J,IAEAkV,IAAA0kB,EAAA1kB,KAAAykB,EAAAG,aAAAruC,EAAAu4B,YAAAv4B,EAAAw4B,WAAA,GACA2F,KAAAgQ,EAAAhQ,MAAA+P,EAAAI,aAAAtuC,EAAAm4B,aAAAn4B,EAAAo4B,YAAA,KAXA+V,GAeAz1C,SAAA,WACA,GAAAvC,KAAA,GAAA,CAIA,GAAAo4C,GAAAhB,EACAiB,GAAA/kB,IAAA,EAAA0U,KAAA,GACAvvB,EAAAzY,KAAA,EAwBA,OArBA,UAAAtD,GAAA0F,IAAAqW,EAAA,YAEA2+B,EAAA3+B,EAAAw/B,yBAGAG,EAAAp4C,KAAAo4C,eAGAhB,EAAAp3C,KAAAo3C,SACA16C,GAAA8I,SAAA4yC,EAAA,GAAA,UACAC,EAAAD,EAAAhB,UAIAiB,EAAA/kB,KAAA52B,GAAA0F,IAAAg2C,EAAA,GAAA,kBAAA,GACAC,EAAArQ,MAAAtrC,GAAA0F,IAAAg2C,EAAA,GAAA,mBAAA,KAOA9kB,IAAA8jB,EAAA9jB,IAAA+kB,EAAA/kB,IAAA52B,GAAA0F,IAAAqW,EAAA,aAAA,GACAuvB,KAAAoP,EAAApP,KAAAqQ,EAAArQ,KAAAtrC,GAAA0F,IAAAqW,EAAA,cAAA,MAIA2/B,aAAA,WACA,MAAAp4C,MAAA+E,IAAA,WAGA,IAFA,GAAAqzC,GAAAp4C,KAAAo4C,cAAAvuC,GAEAuuC,IAAA17C,GAAA8I,SAAA4yC,EAAA,SAAA,WAAA17C,GAAA0F,IAAAg2C,EAAA,aACAA,EAAAA,EAAAA,YAEA,OAAAA,IAAAvuC,QAMAnN,GAAAkD,MAAAoiC,WAAA,cAAAI,UAAA,eAAA,SAAAqS,EAAA9zB,GACA,GAAA2S,GAAA,IAAA/tB,KAAAob,EAEAjkB,IAAAqV,GAAA0iC,GAAA,SAAA5zC,GACA,MAAAy8B,IAAAt9B,KAAA,SAAAyY,EAAAg8B,EAAA5zC,GACA,GAAAk3C,GAAA9vB,EAAAxP,EAEA,OAAA5Y,UAAAgB,EACAk3C,EAAAp3B,IAAAo3B,GAAAA,EAAAp3B,GACAo3B,EAAAh8C,SAAAwD,gBAAAk1C,GACAh8B,EAAAg8B,QAGAsD,EACAA,EAAAO,SACAhlB,EAAA52B,GAAAq7C,GAAA/V,aAAAnhC,EACAyyB,EAAAzyB,EAAAnE,GAAAq7C,GAAA3V,aAIA3pB,EAAAg8B,GAAA5zC,IAEA4zC,EAAA5zC,EAAA0R,UAAAxQ,OAAA,SAQArF,GAAAkD,MAAA,MAAA,QAAA,SAAAqI,EAAA0Y,GACAjkB,GAAA6mB,SAAA5C,GAAA/B,EAAAzD,GAAA8tB,cACA,SAAAxwB,EAAAkvB,GACA,GAAAA,EAGA,MAFAA,GAAApnB,GAAA9H,EAAAkI,GAEAH,GAAAjb,KAAAoiC,GACAjrC,GAAA+b,GAAAlW,WAAAoe,GAAA,KACAgnB,MAQAjrC,GAAAkD,MAAA24C,OAAA,SAAAC,MAAA,SAAA,SAAA1gC,EAAAlP,GACAlM,GAAAkD,MAAArD,QAAA,QAAAub,EAAA2E,QAAA7T,EAAA6vC,GAAA,QAAA3gC,GAAA,SAAA4gC,EAAAC,GAEAj8C,GAAAqV,GAAA4mC,GAAA,SAAAn8C,EAAAoR,GACA,GAAA2vB,GAAAhrB,UAAAxQ,SAAA22C,GAAA,iBAAAl8C,IACAsjB,EAAA44B,IAAAl8C,KAAA,GAAAoR,KAAA,EAAA,SAAA,SAEA,OAAA0vB,IAAAt9B,KAAA,SAAAyY,EAAA7P,EAAAgF,GACA,GAAAwQ,EAEA,OAAA1hB,IAAAyb,SAAAM,GAIAA,EAAA1c,SAAAwD,gBAAA,SAAAuY,GAIA,IAAAW,EAAAvF,UACAkL,EAAA3F,EAAAlZ,gBAIAuB,KAAA6I,IACA8O,EAAAjZ,KAAA,SAAAsY,GAAAsG,EAAA,SAAAtG,GACAW,EAAAjZ,KAAA,SAAAsY,GAAAsG,EAAA,SAAAtG,GACAsG,EAAA,SAAAtG,KAIAjY,SAAA+N,EAEAlR,GAAA0F,IAAAqW,EAAA7P,EAAAkX,GAGApjB,GAAAN,MAAAqc,EAAA7P,EAAAgF,EAAAkS,IACAlX,EAAA20B,EAAA/gC,EAAAqD,OAAA09B,EAAA,WAOA7gC,GAAAqV,GAAA7B,KAAA,WACA,MAAAlQ,MAAA+B,QAGArF,GAAAqV,GAAA6mC,QAAAl8C,GAAAqV,GAAAwnB,QAkBA,kBAAAn2B,SAAAA,OAAAC,KACAD,OAAA,YAAA,WACA,MAAA1G,KAOA,IAEAm8C,IAAAp7C,EAAAf,OAGAo8C,GAAAr7C,EAAAd,CAwBA,OAtBAD,IAAAq8C,WAAA,SAAA7yB,GASA,MARAzoB,GAAAd,IAAAD,KACAe,EAAAd,EAAAm8C,IAGA5yB,GAAAzoB,EAAAf,SAAAA,KACAe,EAAAf,OAAAm8C,IAGAn8C,UAMAub,KAAAiE,KACAze,EAAAf,OAAAe,EAAAd,EAAAD,IAMAA,KCpmUA,SAAAyG,GACA,kBAAAC,SAAAA,OAAAC,IACAD,QAAA,UAAAD,GACA,gBAAAK,SAAAA,OAAAD,QACAC,OAAAD,QAAAJ,EAAA61C,QAAA,WAEA71C,EAAAzG,SAEA,SAAAC,GAEAA,EAAAke,OAAAle,EAAAoV,IAGApM,SAAA,SAAAjI,GAGA,IAAAsC,KAAA+B,OAIA,YAHArE,GAAAA,EAAAu7C,OAAAx7C,OAAAmW,SACAA,QAAAvD,KAAA,wDAMA,IAAAzT,GAAAD,EAAAsD,KAAAD,KAAA,GAAA,YACA,OAAApD,GACAA,GAIAoD,KAAAS,KAAA,aAAA,cAEA7D,EAAA,GAAAD,GAAAC,UAAAc,EAAAsC,KAAA,IACArD,EAAAsD,KAAAD,KAAA,GAAA,YAAApD,GAEAA,EAAA81C,SAAAwG,WAEAl5C,KAAA4R,GAAA,iBAAA,UAAA,SAAA6H,GAIA7c,EAAAu8C,aAAA1/B,EAAAqnB,cAGAnkC,EAAAqD,MAAA6vC,SAAA,YACAjzC,EAAAw8C,cAAA,GAIAv5C,SAAAlD,EAAAqD,MAAAS,KAAA,oBACA7D,EAAAw8C,cAAA,KAKAp5C,KAAA4R,GAAA,kBAAA,SAAA6H,GAMA,QAAA+D,KACA,GAAA+B,GAAAoE,CAcA,OAPA/mB,GAAAu8C,eAAAv8C,EAAA81C,SAAA2G,eAAAz8C,EAAA08C,iBACA/5B,EAAA5iB,EAAA,0BACA8D,KAAA,OAAA7D,EAAAu8C,aAAArhC,MACAjX,IAAAlE,EAAAC,EAAAu8C,cAAAt4C,OACA8B,SAAA/F,EAAA28C,eAGA38C,EAAA81C,SAAA2G,gBACA11B,EAAA/mB,EAAA81C,SAAA2G,cAAAj8C,KAAAR,EAAAA,EAAA28C,YAAA9/B,GACA8F,GAGAA,EAAA9gB,SAEAoB,SAAA8jB,GACAA,GAQA,MApCA/mB,GAAA81C,SAAAuG,OAGAx/B,EAAA8mB,iBAiCA3jC,EAAAw8C,cACAx8C,EAAAw8C,cAAA,EACA57B,KAEA5gB,EAAA6mC,OACA7mC,EAAA48C,gBACA58C,EAAA08C,eAAA,GACA,GAEA97B,KAEA5gB,EAAA68C,gBACA,MAKA78C,IAIA88C,MAAA,WACA,GAAAA,GAAA98C,EAAA+8C,CAgBA,OAdAh9C,GAAAqD,KAAA,IAAA04B,GAAA,QACAghB,EAAA15C,KAAA2F,WAAA89B,QAEAkW,KACAD,GAAA,EACA98C,EAAAD,EAAAqD,KAAA,GAAAyjC,MAAA99B,WACA3F,KAAAJ,KAAA,WACA85C,EAAA98C,EAAA0Z,QAAAtW,OAAA05C,EACAA,IACAC,EAAAA,EAAA1+B,OAAAre,EAAA+8C,cAGA/8C,EAAA+8C,UAAAA,GAEAD,GAIAE,MAAA,SAAAC,EAAA1sB,GACA,GACAulB,GAAAoH,EAAAC,EAAA95C,EAAAglC,EAAA+U,EADA1jC,EAAAtW,KAAA,EAIA,IAAA,MAAAsW,KAIAA,EAAAmtB,MAAAntB,EAAA2jC,aAAA,qBACA3jC,EAAAmtB,KAAAzjC,KAAAq5B,QAAA,QAAA,GACA/iB,EAAAwB,KAAA9X,KAAAS,KAAA,SAGA,MAAA6V,EAAAmtB,MAAA,CAIA,GAAAoW,EAIA,OAHAnH,EAAA/1C,EAAAsD,KAAAqW,EAAAmtB,KAAA,aAAAiP,SACAoH,EAAApH,EAAAkH,MACAG,EAAAp9C,EAAAC,UAAAk9C,YAAAxjC,GACAujC,GACA,IAAA,MACAl9C,EAAAke,OAAAk/B,EAAAp9C,EAAAC,UAAAs9C,cAAA/sB,UAGA4sB,GAAAI,SACAL,EAAAxjC,EAAAwB,MAAAiiC,EACA5sB,EAAAgtB,WACAzH,EAAAyH,SAAA7jC,EAAAwB,MAAAnb,EAAAke,OAAA63B,EAAAyH,SAAA7jC,EAAAwB,MAAAqV,EAAAgtB,UAEA,MACA,KAAA,SACA,MAAAhtB,IAIA6sB,KACAr9C,EAAAiD,KAAAutB,EAAArnB,MAAA,MAAA,SAAAvF,EAAAk0C,GACAuF,EAAAvF,GAAAsF,EAAAtF,SACAsF,GAAAtF,KAEAuF,UARAF,GAAAxjC,EAAAwB,MACAiiC,GAkCA,MAvBA95C,GAAAtD,EAAAC,UAAAw9C,eACAz9C,EAAAke,UAEAle,EAAAC,UAAAy9C,WAAA/jC,GACA3Z,EAAAC,UAAA09C,eAAAhkC,GACA3Z,EAAAC,UAAA29C,UAAAjkC,GACA3Z,EAAAC,UAAAk9C,YAAAxjC,IACAA,GAGArW,EAAAu6C,WACAvV,EAAAhlC,EAAAu6C,eACAv6C,GAAAu6C,SACAv6C,EAAAtD,EAAAke,QAAA2/B,SAAAvV,GAAAhlC,IAIAA,EAAAw6C,SACAxV,EAAAhlC,EAAAw6C,aACAx6C,GAAAw6C,OACAx6C,EAAAtD,EAAAke,OAAA5a,GAAAw6C,OAAAxV,KAGAhlC,MAKAtD,EAAAke,OAAAle,EAAA+3B,KAAAlD,SAAA70B,EAAA+3B,KAAA,MAGAgmB,MAAA,SAAAp7C,GACA,OAAA3C,EAAAohB,KAAA,GAAAphB,EAAA2C,GAAAuB,QAIA85C,OAAA,SAAAr7C,GACA,GAAAuB,GAAAlE,EAAA2C,GAAAuB,KACA,OAAA,QAAAA,KAAAlE,EAAAohB,KAAA,GAAAld,IAIA+5C,UAAA,SAAAt7C,GACA,OAAA3C,EAAA2C,GAAAqhB,KAAA,cAKAhkB,EAAAC,UAAA,SAAAc,EAAA+lC,GACAzjC,KAAA0yC,SAAA/1C,EAAAke,QAAA,KAAAle,EAAAC,UAAAi+C,SAAAn9C,GACAsC,KAAAu5C,YAAA9V,EACAzjC,KAAAuI,QAIA5L,EAAAC,UAAAk+C,OAAA,SAAArzC,EAAAyvC,GACA,MAAA,KAAA3kC,UAAAxQ,OACA,WACA,GAAAuQ,GAAA3V,EAAAytB,UAAA7X,UAEA,OADAD,GAAAkT,QAAA/d,GACA9K,EAAAC,UAAAk+C,OAAAhmC,MAAA9U,KAAAsS,IAGAzS,SAAAq3C,EACAzvC,GAEA8K,UAAAxQ,OAAA,GAAAm1C,EAAAjuB,cAAAc,QACAmtB,EAAAv6C,EAAAytB,UAAA7X,WAAApV,MAAA,IAEA+5C,EAAAjuB,cAAAc,QACAmtB,GAAAA,IAEAv6C,EAAAiD,KAAAs3C,EAAA,SAAAjvC,EAAAixB,GACAzxB,EAAAA,EAAAxE,QAAA,GAAAkE,QAAA,MAAAc,EAAA,MAAA,KAAA,WACA,MAAAixB,OAGAzxB,IAGA9K,EAAAke,OAAAle,EAAAC,WAEAi+C,UACAV,YACAnvB,UACA4uB,SACAmB,WAAA,QACAC,aAAA,UACAC,WAAA,QACAh/C,aAAA,QACAi/C,cAAA,EACAzB,cAAA,EACA0B,eAAAx+C,MACAy+C,oBAAAz+C,MACAu8C,UAAA,EACAmC,OAAA,UACAC,aAAA,EACAC,UAAA,SAAAjlC,GACAtW,KAAAw7C,WAAAllC,EAGAtW,KAAA0yC,SAAAwI,eACAl7C,KAAA0yC,SAAA+I,aACAz7C,KAAA0yC,SAAA+I,YAAAr+C,KAAA4C,KAAAsW,EAAAtW,KAAA0yC,SAAAqI,WAAA/6C,KAAA0yC,SAAAuI,YAEAj7C,KAAA07C,UAAA17C,KAAA27C,UAAArlC,MAGAslC,WAAA,SAAAtlC,GACAtW,KAAA67C,UAAAvlC,MAAAA,EAAAwB,OAAA9X,MAAA87C,YAAA97C,KAAA+7C,SAAAzlC,IACAtW,KAAAsW,QAAAA,IAGA0lC,QAAA,SAAA1lC,EAAAmD,GAgBA,GAAAwiC,IACA,GAAA,GAAA,GAAA,GAAA,GAAA,GAAA,GACA,GAAA,GAAA,GAAA,GAAA,IAAA,IAGA,KAAAxiC,EAAA2H,OAAA,KAAAphB,KAAAk8C,aAAA5lC,IAAA3Z,EAAAic,QAAAa,EAAAkoB,QAAAsa,UAEA3lC,EAAAwB,OAAA9X,MAAA87C,WAAAxlC,EAAAwB,OAAA9X,MAAAm8C,UACAn8C,KAAAsW,QAAAA,IAGA8lC,QAAA,SAAA9lC,GAGAA,EAAAwB,OAAA9X,MAAA87C,UACA97C,KAAAsW,QAAAA,GAGAA,EAAAhR,WAAAwS,OAAA9X,MAAA87C,WACA97C,KAAAsW,QAAAA,EAAAhR,aAGA+2C,UAAA,SAAA/lC,EAAAykC,EAAAE,GACA,UAAA3kC,EAAA1N,KACA5I,KAAAs8C,WAAAhmC,EAAAwB,MAAA1X,SAAA26C,GAAA56C,YAAA86C,GAEAt+C,EAAA2Z,GAAAlW,SAAA26C,GAAA56C,YAAA86C,IAGAQ,YAAA,SAAAnlC,EAAAykC,EAAAE,GACA,UAAA3kC,EAAA1N,KACA5I,KAAAs8C,WAAAhmC,EAAAwB,MAAA3X,YAAA46C,GAAA36C,SAAA66C,GAEAt+C,EAAA2Z,GAAAnW,YAAA46C,GAAA36C,SAAA66C,KAMAsB,YAAA,SAAA7J,GACA/1C,EAAAke,OAAAle,EAAAC,UAAAi+C,SAAAnI,IAGAyH,UACAK,SAAA,0BACAC,OAAA,yBACA+B,MAAA,sCACAz2C,IAAA,4BACA02C,KAAA,6BACAC,QAAA,mCACAC,OAAA,+BACAC,OAAA,4BACAC,QAAA,qCACAC,UAAAngD,EAAAC,UAAAk+C,OAAA,6CACAiC,UAAApgD,EAAAC,UAAAk+C,OAAA,yCACAkC,YAAArgD,EAAAC,UAAAk+C,OAAA,6DACAmC,MAAAtgD,EAAAC,UAAAk+C,OAAA,6CACAnxC,IAAAhN,EAAAC,UAAAk+C,OAAA,mDACAoC,IAAAvgD,EAAAC,UAAAk+C,OAAA,sDACA/P,KAAApuC,EAAAC,UAAAk+C,OAAA,oCAGAqC,kBAAA,EAEAr8B,WAEAvY,KAAA,WA0BA,QAAA4nC,GAAA12B,IAGAzZ,KAAAyjC,MAAAzjC,KAAAi6C,aAAA,qBACAj6C,KAAAyjC,KAAA9mC,EAAAqD,MAAAq5B,QAAA,QAAA,GACAr5B,KAAA8X,KAAAnb,EAAAqD,MAAAS,KAAA,QAGA,IAAA7D,GAAAD,EAAAsD,KAAAD,KAAAyjC,KAAA,aACA2Z,EAAA,KAAA3jC,EAAA7Q,KAAA3F,QAAA,YAAA,IACAyvC,EAAA91C,EAAA81C,QACAA,GAAA0K,KAAAzgD,EAAAqD,MAAA04B,GAAAga,EAAA2I,SACA3I,EAAA0K,GAAAhgD,KAAAR,EAAAoD,KAAAyZ,GArCAzZ,KAAAq9C,eAAA1gD,EAAAqD,KAAA0yC,SAAA0I,qBACAp7C,KAAAs9C,aAAAt9C,KAAAq9C,eAAAt7C,QAAA/B,KAAAq9C,gBAAA1gD,EAAAqD,KAAAu5C,aACAv5C,KAAAu9C,WAAA5gD,EAAAqD,KAAA0yC,SAAAyI,gBAAA19B,IAAAzd,KAAA0yC,SAAA0I,qBACAp7C,KAAA87C,aACA97C,KAAAw9C,cACAx9C,KAAAw5C,eAAA,EACAx5C,KAAAy9C,WACAz9C,KAAAm8C,WACAn8C,KAAA63B,OAEA,IACA+hB,GADA5uB,EAAAhrB,KAAAgrB,SAEAruB,GAAAiD,KAAAI,KAAA0yC,SAAA1nB,OAAA,SAAApR,EAAAhM,GACA,gBAAAA,KACAA,EAAAA,EAAA9H,MAAA,OAEAnJ,EAAAiD,KAAAgO,EAAA,SAAArN,EAAAuX,GACAkT,EAAAlT,GAAA8B,MAGAggC,EAAA55C,KAAA0yC,SAAAkH,MACAj9C,EAAAiD,KAAAg6C,EAAA,SAAAhgC,EAAAhM,GACAgsC,EAAAhgC,GAAAjd,EAAAC,UAAAs9C,cAAAtsC,KAmBAjR,EAAAqD,KAAAu5C,aACA3nC,GAAA,oDACA,0VAGAu+B,GAIAv+B,GAAA,iBAAA,oDAAAu+B,GAEAnwC,KAAA0yC,SAAAgL,gBACA/gD,EAAAqD,KAAAu5C,aAAA3nC,GAAA,wBAAA5R,KAAA0yC,SAAAgL,iBAKAja,KAAA,WAQA,MAPAzjC,MAAA29C,YACAhhD,EAAAke,OAAA7a,KAAA87C,UAAA97C,KAAA49C,UACA59C,KAAAm8C,QAAAx/C,EAAAke,UAAA7a,KAAA49C,UACA59C,KAAA05C,SACA/8C,EAAAqD,KAAAu5C,aAAApd,eAAA,gBAAAn8B,OAEAA,KAAA69C,aACA79C,KAAA05C,SAGAiE,UAAA,WACA39C,KAAA89C,aACA,KAAA,GAAA71C,GAAA,EAAA+K,EAAAhT,KAAA+9C,gBAAA/9C,KAAAgT,WAAAA,EAAA/K,GAAAA,IACAjI,KAAA41B,MAAA5iB,EAAA/K,GAEA,OAAAjI,MAAA05C,SAIApjC,QAAA,SAAAA,GACA,GAIA2xB,GAAA+V,EAJAC,EAAAj+C,KAAAk+C,MAAA5nC,GACA6nC,EAAAn+C,KAAAo+C,oBAAAH,GACAr2B,EAAA5nB,KACA2jB,GAAA,CA2CA,OAxCA9jB,UAAAs+C,QACAn+C,MAAAm8C,QAAA8B,EAAAnmC,OAEA9X,KAAAq+C,eAAAF,GACAn+C,KAAA+9C,gBAAAphD,EAAAwhD,GAIAH,EAAAh+C,KAAAgrB,OAAAmzB,EAAArmC,MACAkmC,GACArhD,EAAAiD,KAAAI,KAAAgrB,OAAA,SAAAlT,EAAAwmC,GACAA,IAAAN,GAAAlmC,IAAAqmC,EAAArmC,OACAmmC,EAAAr2B,EAAAw2B,oBAAAx2B,EAAAs2B,MAAAt2B,EAAA00B,WAAAxkC,KACAmmC,GAAAA,EAAAnmC,OAAA8P,GAAAu0B,UACAv0B,EAAAm2B,gBAAAz3C,KAAA23C,GACAt6B,EAAAiE,EAAAgO,MAAAqoB,IAAAt6B,MAMAskB,EAAAjoC,KAAA41B,MAAAuoB,MAAA,EACAx6B,EAAAA,GAAAskB,EACAA,EACAjoC,KAAAm8C,QAAAgC,EAAArmC,OAAA,EAEA9X,KAAAm8C,QAAAgC,EAAArmC,OAAA,EAGA9X,KAAAu+C,qBAGAv+C,KAAAw+C,OAAAx+C,KAAAw+C,OAAA/gC,IAAAzd,KAAAu9C,aAEAv9C,KAAA69C,aAGAlhD,EAAA2Z,GAAA7V,KAAA,gBAAAwnC,IAGAtkB,GAIAk6B,WAAA,SAAAY,GACA,GAAAA,EAAA,CACA,GAAA7hD,GAAAoD,IAGArD,GAAAke,OAAA7a,KAAA49C,SAAAa,GACAz+C,KAAA25C,UAAAh9C,EAAAoI,IAAA/E,KAAA49C,SAAA,SAAA/pC,EAAAiE,GACA,OACAjE,QAAAA,EACAyC,QAAA1Z,EAAA0/C,WAAAxkC,GAAA,MAKA9X,KAAA0+C,YAAA/hD,EAAA6b,KAAAxY,KAAA0+C,YAAA,SAAApoC,GACA,QAAAA,EAAAwB,OAAA2mC,MAGAz+C,KAAA0yC,SAAAmL,WACA79C,KAAA0yC,SAAAmL,WAAAzgD,KAAA4C,KAAAA,KAAA49C,SAAA59C,KAAA25C,WAEA35C,KAAA2+C,qBAKAC,UAAA,WACAjiD,EAAAoV,GAAA6sC,WACAjiD,EAAAqD,KAAAu5C,aAAAqF,YAEA5+C,KAAAm8C,WACAn8C,KAAA87C,aACA97C,KAAA89C,cACA99C,KAAA6+C,YACA,IAAA7rC,GAAAhT,KAAAgT,WACA6pB,WAAA,iBACAsR,WAAA,eAEAnuC,MAAA8+C,cAAA9rC,IAGA8rC,cAAA,SAAA9rC,GACA,GAAA/K,EAEA,IAAAjI,KAAA0yC,SAAA+I,YACA,IAAAxzC,EAAA,EAAA+K,EAAA/K,GAAAA,IACAjI,KAAA0yC,SAAA+I,YAAAr+C,KAAA4C,KAAAgT,EAAA/K,GACAjI,KAAA0yC,SAAAqI,WAAA,IACA/6C,KAAAs8C,WAAAtpC,EAAA/K,GAAA6P,MAAA3X,YAAAH,KAAA0yC,SAAAuI,gBAGAjoC,GACA7S,YAAAH,KAAA0yC,SAAAqI,YACA56C,YAAAH,KAAA0yC,SAAAuI,aAIAsD,iBAAA,WACA,MAAAv+C,MAAA++C,aAAA/+C,KAAAm8C,UAGA4C,aAAA,SAAAltC,GAEA,GACA5J,GADAi1B,EAAA,CAEA,KAAAj1B,IAAA4J,GAIAhS,SAAAgS,EAAA5J,IAAA,OAAA4J,EAAA5J,IAAA4J,EAAA5J,MAAA,GACAi1B,GAGA,OAAAA,IAGA2hB,WAAA,WACA7+C,KAAA07C,UAAA17C,KAAAw+C,SAGA9C,UAAA,SAAA+C,GACAA,EAAAnmC,IAAAtY,KAAAu9C,YAAAp8C,KAAA,IACAnB,KAAAg/C,WAAAP,GAAAv7B,QAGAw2B,MAAA,WACA,MAAA,KAAA15C,KAAAkQ,QAGAA,KAAA,WACA,MAAAlQ,MAAA25C,UAAA53C,QAGA03C,aAAA,WACA,GAAAz5C,KAAA0yC,SAAA+G,aACA,IACA98C,EAAAqD,KAAAi/C,kBAAAj/C,KAAA25C,UAAA53C,QAAA/B,KAAA25C,UAAA,GAAArjC,aACAqC,OAAA,YACAie,QAGAiJ,QAAA,WACA,MAAAxgC,MAOA4/C,eAAA,WACA,GAAAzD,GAAAx7C,KAAAw7C,UACA,OAAAA,IAEA,IAFA7+C,EAAA6b,KAAAxY,KAAA25C,UAAA,SAAAzgB,GACA,MAAAA,GAAA5iB,QAAAwB,OAAA0jC,EAAA1jC,OACA/V,QAAAy5C,GAGAxoC,SAAA,WACA,GAAApW,GAAAoD,KACAk/C,IAGA,OAAAviD,GAAAqD,KAAAu5C,aACAr5C,KAAA,8CACAoY,IAAA,sCACAA,IAAAtY,KAAA0yC,SAAA2I,QACA1iC,OAAA,WACA,GAAAb,GAAA9X,KAAA8X,MAAAnb,EAAAqD,MAAAS,KAAA,OAYA,QAXAqX,GAAAlb,EAAA81C,SAAAuG,OAAAx7C,OAAAmW,SACAA,QAAA4T,MAAA,0BAAAxnB,MAIAA,KAAAi6C,aAAA,qBACAj6C,KAAAyjC,KAAA9mC,EAAAqD,MAAAq5B,QAAA,QAAA,GACAr5B,KAAA8X,KAAAA,KAIAA,IAAAonC,KAAAtiD,EAAAmiD,aAAApiD,EAAAqD,MAAA45C,YAIAsF,EAAApnC,IAAA,GACA,MAIAomC,MAAA,SAAAz1B,GACA,MAAA9rB,GAAA8rB,GAAA,IAGAg2B,OAAA,WACA,GAAA1D,GAAA/6C,KAAA0yC,SAAAqI,WAAAj1C,MAAA,KAAAG,KAAA,IACA,OAAAtJ,GAAAqD,KAAA0yC,SAAAz2C,aAAA,IAAA8+C,EAAA/6C,KAAAs9C,eAGA6B,eAAA,WACAn/C,KAAA0+C,eACA1+C,KAAA25C,aACA35C,KAAA49C,YACA59C,KAAAo/C,OAAAziD,MACAqD,KAAAw+C,OAAA7hD,OAGAk7B,MAAA,WACA73B,KAAAm/C,iBACAn/C,KAAA+9C,gBAAAphD,OAGAmhD,YAAA,WACA99C,KAAA63B,QACA73B,KAAAw+C,OAAAx+C,KAAAy+C,SAAAhhC,IAAAzd,KAAAu9C,aAGAc,eAAA,SAAA/nC,GACAtW,KAAA63B,QACA73B,KAAAw+C,OAAAx+C,KAAA27C,UAAArlC,IAGA4lC,aAAA,SAAA5lC,GACA,GAEAzV,GAAAw1B,EAFAgpB,EAAA1iD,EAAA2Z,GACA1N,EAAA0N,EAAA1N,IAGA,OAAA,UAAAA,GAAA,aAAAA,EACA5I,KAAAs8C,WAAAhmC,EAAAwB,MAAAa,OAAA,YAAA9X,MACA,WAAA+H,GAAA,mBAAA0N,GAAAgpC,SACAhpC,EAAAgpC,SAAAC,SAAA,MAAAF,EAAAx+C,OAIAA,EADAyV,EAAA2jC,aAAA,mBACAoF,EAAAl+C,OAEAk+C,EAAAx+C,MAGA,SAAA+H,EAGA,mBAAA/H,EAAAoT,OAAA,EAAA,IACApT,EAAAoT,OAAA,KAKAoiB,EAAAx1B,EAAA2+C,YAAA,KACAnpB,GAAA,EACAx1B,EAAAoT,OAAAoiB,EAAA,IAIAA,EAAAx1B,EAAA2+C,YAAA,MACAnpB,GAAA,EACAx1B,EAAAoT,OAAAoiB,EAAA,GAIAx1B,IAGA,gBAAAA,GACAA,EAAAoC,QAAA,MAAA,IAEApC,IAGA+0B,MAAA,SAAAtf,GACAA,EAAAtW,KAAAo+C,oBAAAp+C,KAAAk+C,MAAA5nC,GAEA,IAMAqN,GAAA8wB,EAAAgL,EAAAC,EANA9F,EAAAj9C,EAAA2Z,GAAAsjC,QACA+F,EAAAhjD,EAAAoI,IAAA60C,EAAA,SAAA1gB,EAAAjxB,GACA,MAAAA,KACAlG,OACA69C,GAAA,EACA/+C,EAAAb,KAAAk8C,aAAA5lC,EAcA,IATA,kBAAAsjC,GAAA8F,WACAA,EAAA9F,EAAA8F,WACA,kBAAA1/C,MAAA0yC,SAAAgN,aACAA,EAAA1/C,KAAA0yC,SAAAgN,YAMAA,EAAA,CAGA,GAFA7+C,EAAA6+C,EAAAtiD,KAAAkZ,EAAAzV,GAEA,gBAAAA,GACA,KAAA,IAAAg/C,WAAA,sDAIAjG,GAAA8F,WAGA,IAAAjL,IAAAmF,GAAA,CACA6F,GAAAhL,OAAAA,EAAAqL,WAAAlG,EAAAnF,GACA,KAKA,GAJA9wB,EAAAhnB,EAAAC,UAAAmjD,QAAAtL,GAAAr3C,KAAA4C,KAAAa,EAAAyV,EAAAmpC,EAAAK,YAIA,wBAAAn8B,GAAA,IAAAg8B,EAAA,CACAC,GAAA,CACA,UAIA,GAFAA,GAAA,EAEA,YAAAj8B,EAEA,YADA3jB,KAAAw+C,OAAAx+C,KAAAw+C,OAAAlmC,IAAAtY,KAAA27C,UAAArlC,IAIA,KAAAqN,EAEA,MADA3jB,MAAAggD,aAAA1pC,EAAAmpC,IACA,EAEA,MAAApgD,GAQA,KAPAW,MAAA0yC,SAAAuG,OAAAx7C,OAAAmW,SACAA,QAAAqsC,IAAA,4CAAA3pC,EAAArR,GAAA,gBAAAw6C,EAAAhL,OAAA,YAAAp1C,GAEAA,YAAAwgD,aACAxgD,EAAAwU,SAAA,+CAAAyC,EAAArR,GAAA,gBAAAw6C,EAAAhL,OAAA,aAGAp1C,GAGA,IAAAugD,EAMA,MAHA5/C,MAAA++C,aAAAnF,IACA55C,KAAA0+C,YAAAp4C,KAAAgQ,IAEA,GAMA4pC,kBAAA,SAAA5pC,EAAAm+B,GACA,MAAA93C,GAAA2Z,GAAArW,KAAA,MAAAw0C,EAAAhmC,OAAA,GAAA7G,cACA6sC,EAAArnC,UAAA,GAAA1M,gBAAA/D,EAAA2Z,GAAArW,KAAA,QAIAkgD,cAAA,SAAAroC,EAAA28B,GACA,GAAA1pB,GAAA/qB,KAAA0yC,SAAAyH,SAAAriC,EACA,OAAAiT,KAAAA,EAAA9B,cAAA+J,OAAAjI,EAAAA,EAAA0pB,KAIA2L,YAAA,WACA,IAAA,GAAAn4C,GAAA,EAAAA,EAAAsK,UAAAxQ,OAAAkG,IACA,GAAApI,SAAA0S,UAAAtK,GACA,MAAAsK,WAAAtK,IAeAo4C,eAAA,SAAA/pC,EAAAmpC,GACA,gBAAAA,KACAA,GAAAhL,OAAAgL,GAGA,IAAA5rC,GAAA7T,KAAAogD,YACApgD,KAAAmgD,cAAA7pC,EAAAwB,KAAA2nC,EAAAhL,QACAz0C,KAAAkgD,kBAAA5pC,EAAAmpC,EAAAhL,SAGAz0C,KAAA0yC,SAAA4I,aAAAhlC,EAAAgqC,OAAAzgD,OACAlD,EAAAC,UAAAu9C,SAAAsF,EAAAhL,QACA,2CAAAn+B,EAAAwB,KAAA,aAEAyoC,EAAA,eAOA,OANA,kBAAA1sC,GACAA,EAAAA,EAAAzW,KAAA4C,KAAAy/C,EAAAK,WAAAxpC,GACAiqC,EAAAh7C,KAAAsO,KACAA,EAAAlX,EAAAC,UAAAk+C,OAAAjnC,EAAA5Q,QAAAs9C,EAAA,QAAAd,EAAAK,aAGAjsC,GAGAmsC,aAAA,SAAA1pC,EAAAmpC,GACA,GAAA5rC,GAAA7T,KAAAqgD,eAAA/pC,EAAAmpC,EAEAz/C,MAAA25C,UAAArzC,MACAuN,QAAAA,EACAyC,QAAAA,EACAm+B,OAAAgL,EAAAhL,SAGAz0C,KAAA49C,SAAAtnC,EAAAwB,MAAAjE,EACA7T,KAAA87C,UAAAxlC,EAAAwB,MAAAjE,GAGAmrC,WAAA,SAAAwB,GAIA,MAHAxgD,MAAA0yC,SAAA+N,UACAD,EAAAA,EAAA/iC,IAAA+iC,EAAAp/C,OAAApB,KAAA0yC,SAAA+N,WAEAD,GAGA7B,kBAAA,WACA,GAAA12C,GAAA+K,EAAAwU,CACA,KAAAvf,EAAA,EAAAjI,KAAA25C,UAAA1xC,GAAAA,IACAuf,EAAAxnB,KAAA25C,UAAA1xC,GACAjI,KAAA0yC,SAAA2J,WACAr8C,KAAA0yC,SAAA2J,UAAAj/C,KAAA4C,KAAAwnB,EAAAlR,QAAAtW,KAAA0yC,SAAAqI,WAAA/6C,KAAA0yC,SAAAuI,YAEAj7C,KAAA0gD,UAAAl5B,EAAAlR,QAAAkR,EAAA3T,QAKA,IAHA7T,KAAA25C,UAAA53C,SACA/B,KAAAo/C,OAAAp/C,KAAAo/C,OAAA3hC,IAAAzd,KAAAu9C,aAEAv9C,KAAA0yC,SAAAO,QACA,IAAAhrC,EAAA,EAAAjI,KAAA0+C,YAAAz2C,GAAAA,IACAjI,KAAA0gD,UAAA1gD,KAAA0+C,YAAAz2C,GAGA,IAAAjI,KAAA0yC,SAAA+I,YACA,IAAAxzC,EAAA,EAAA+K,EAAAhT,KAAA2gD,gBAAA3tC,EAAA/K,GAAAA,IACAjI,KAAA0yC,SAAA+I,YAAAr+C,KAAA4C,KAAAgT,EAAA/K,GAAAjI,KAAA0yC,SAAAqI,WAAA/6C,KAAA0yC,SAAAuI,WAGAj7C,MAAAw+C,OAAAx+C,KAAAw+C,OAAAlmC,IAAAtY,KAAAo/C,QACAp/C,KAAA6+C,aACA7+C,KAAAg/C,WAAAh/C,KAAAo/C,QAAA9/B,QAGAqhC,cAAA;AACA,MAAA3gD,MAAA+9C,gBAAAzlC,IAAAtY,KAAA4gD,oBAGAA,gBAAA,WACA,MAAAjkD,GAAAqD,KAAA25C,WAAA50C,IAAA,WACA,MAAA/E,MAAAsW,WAIAoqC,UAAA,SAAApqC,EAAAzC,GACA,GAAAgtC,GAAA7C,EAAA8C,EAAAl5B,EACAJ,EAAAxnB,KAAA27C,UAAArlC,GACAyqC,EAAA/gD,KAAAghD,SAAA1qC,GACA2qC,EAAAtkD,EAAA2Z,GAAA7V,KAAA,mBAEA+mB,GAAAzlB,QAGAylB,EAAArnB,YAAAH,KAAA0yC,SAAAuI,YAAA76C,SAAAJ,KAAA0yC,SAAAqI,YAGAvzB,EAAAxoB,KAAA6U,KAIA2T,EAAA7qB,EAAA,IAAAqD,KAAA0yC,SAAAz2C,aAAA,KACAwE,KAAA,KAAAsgD,EAAA,UACA3gD,SAAAJ,KAAA0yC,SAAAqI,YACA/7C,KAAA6U,GAAA,IAGAgtC,EAAAr5B,EACAxnB,KAAA0yC,SAAA+N,UAIAI,EAAAr5B,EAAAtE,OAAA5D,OAAA+mB,KAAA,IAAArmC,KAAA0yC,SAAA+N,QAAA,MAAAr/C,UAEApB,KAAAq9C,eAAAt7C,OACA/B,KAAAq9C,eAAA76C,OAAAq+C,GACA7gD,KAAA0yC,SAAAwO,eACAlhD,KAAA0yC,SAAAwO,eAAA9jD,KAAA4C,KAAA6gD,EAAAlkD,EAAA2Z,IAEAuqC,EAAA1Z,YAAA7wB,GAIAkR,EAAAkR,GAAA,SAGAlR,EAAA/mB,KAAA,MAAAsgD,GAIA,IAAAv5B,EAAAgS,QAAA,cAAAx5B,KAAAmhD,cAAAJ,GAAA,MAAAh/C,SACA++C,EAAAt5B,EAAA/mB,KAAA,MAGAwgD,EAEAA,EAAAn6C,MAAA,GAAAK,QAAA,MAAAnH,KAAAmhD,cAAAL,GAAA,UAGAG,GAAA,IAAAH,GAJAG,EAAAH,EAMAnkD,EAAA2Z,GAAA7V,KAAA,mBAAAwgD,GAGAjD,EAAAh+C,KAAAgrB,OAAA1U,EAAAwB,MACAkmC,IACAp2B,EAAA5nB,KACArD,EAAAiD,KAAAgoB,EAAAoD,OAAA,SAAAlT,EAAAwmC,GACAA,IAAAN,GACArhD,EAAA,UAAAirB,EAAAu5B,cAAArpC,GAAA,KAAA8P,EAAA2xB,aACA94C,KAAA,mBAAA+mB,EAAA/mB,KAAA,aAMAoT,GAAA7T,KAAA0yC,SAAAO,UACAzrB,EAAArmB,KAAA,IACA,gBAAAnB,MAAA0yC,SAAAO,QACAzrB,EAAApnB,SAAAJ,KAAA0yC,SAAAO,SAEAjzC,KAAA0yC,SAAAO,QAAAzrB,EAAAlR,IAGAtW,KAAAo/C,OAAAp/C,KAAAo/C,OAAA3hC,IAAA+J,IAGAm0B,UAAA,SAAArlC,GACA,GAAAwB,GAAA9X,KAAAmhD,cAAAnhD,KAAAghD,SAAA1qC,IACA8qC,EAAAzkD,EAAA2Z,GAAA7V,KAAA,oBACAgoB,EAAA,cAAA3Q,EAAA,kBAAAA,EAAA,MAQA,OALAspC,KACA34B,EAAAA,EAAA,MAAAzoB,KAAAmhD,cAAAC,GACAn+C,QAAA,OAAA,QAGAjD,KACAy+C,SACA9lC,OAAA8P,IAMA04B,cAAA,SAAA3uC,GACA,MAAAA,GAAAvP,QAAA,yCAAA,SAGA+9C,SAAA,SAAA1qC,GACA,MAAAtW,MAAAgrB,OAAA1U,EAAAwB,QAAA9X,KAAA67C,UAAAvlC,GAAAA,EAAAwB,KAAAxB,EAAArR,IAAAqR,EAAAwB,OAGAsmC,oBAAA,SAAA9nC,GAQA,MALAtW,MAAA67C,UAAAvlC,KACAA,EAAAtW,KAAAs8C,WAAAhmC,EAAAwB,OAIAnb,EAAA2Z,GAAAgC,IAAAtY,KAAA0yC,SAAA2I,QAAA,IAGAQ,UAAA,SAAAvlC,GACA,MAAA,kBAAA/Q,KAAA+Q,EAAA1N,OAGA0zC,WAAA,SAAAxkC,GACA,MAAAnb,GAAAqD,KAAAu5C,aAAAr5C,KAAA,UAAAF,KAAAmhD,cAAArpC,GAAA,OAGAupC,UAAA,SAAAzzC,EAAA0I,GACA,OAAAA,EAAA9Q,SAAA9E,eACA,IAAA,SACA,MAAA/D,GAAA,kBAAA2Z,GAAAvU,MACA,KAAA,QACA,GAAA/B,KAAA67C,UAAAvlC,GACA,MAAAtW,MAAAs8C,WAAAhmC,EAAAwB,MAAAa,OAAA,YAAA5W,OAGA,MAAA6L,GAAA7L,QAGAu/C,OAAA,SAAArc,EAAA3uB,GACA,OAAAtW,KAAAuhD,kBAAAtc,KAAAjlC,KAAAuhD,kBAAAtc,IAAAA,EAAA3uB,IAGAirC,aACAC,UAAA,SAAAvc,GACA,MAAAA,IAEAzyB,OAAA,SAAAyyB,EAAA3uB,GACA,QAAA3Z,EAAAsoC,EAAA3uB,EAAAmtB,MAAA1hC,QAEA0/C,WAAA,SAAAxc,EAAA3uB,GACA,MAAA2uB,GAAA3uB,KAIAylC,SAAA,SAAAzlC,GACA,GAAAzV,GAAAb,KAAAk8C,aAAA5lC,EACA,QAAA3Z,EAAAC,UAAAmjD,QAAAvF,SAAAp9C,KAAA4C,KAAAa,EAAAyV,IAAA,uBAGAorC,aAAA,SAAAprC,GACAtW,KAAAy9C,QAAAnnC,EAAAwB,QACA9X,KAAAw5C,iBACA78C,EAAA2Z,GAAAlW,SAAAJ,KAAA0yC,SAAAsI,cACAh7C,KAAAy9C,QAAAnnC,EAAAwB,OAAA,IAIA6pC,YAAA,SAAArrC,EAAAojC,GACA15C,KAAAw5C,iBAGAx5C,KAAAw5C,eAAA,IACAx5C,KAAAw5C,eAAA,SAEAx5C,MAAAy9C,QAAAnnC,EAAAwB,MACAnb,EAAA2Z,GAAAnW,YAAAH,KAAA0yC,SAAAsI,cACAtB,GAAA,IAAA15C,KAAAw5C,gBAAAx5C,KAAAs5C,eAAAt5C,KAAAyjC,QACA9mC,EAAAqD,KAAAu5C,aAAA3hB,SAMA53B,KAAAm5C,cACAx8C,EAAA,sBAAAqD,KAAAm5C,aAAArhC,KAAA,KAAA9X,KAAAu5C,aAAA96C,SAGAuB,KAAAs5C,eAAA,IACAI,GAAA,IAAA15C,KAAAw5C,gBAAAx5C,KAAAs5C,gBACA38C,EAAAqD,KAAAu5C,aAAApd,eAAA,gBAAAn8B,OACAA,KAAAs5C,eAAA,IAIAsI,cAAA,SAAAtrC,EAAAm+B,GAGA,MAFAA,GAAA,gBAAAA,IAAAA,GAAA,SAEA93C,EAAAsD,KAAAqW,EAAA,kBAAA3Z,EAAAsD,KAAAqW,EAAA,iBACA2U,IAAA,KACAyuB,OAAA,EACA7lC,QAAA7T,KAAAqgD,eAAA/pC,GAAAm+B,OAAAA,OAKAoN,QAAA,WACA7hD,KAAA4+C,YAEAjiD,EAAAqD,KAAAu5C,aACAnd,IAAA,aACAS,WAAA,aACA38B,KAAA,0BACAk8B,IAAA,qBACAj8B,YAAA,2BAKA2hD,mBACAtH,UAAAA,UAAA,GACAgC,OAAAA,OAAA,GACAz2C,KAAAA,KAAA,GACA02C,MAAAA,MAAA,GACAC,SAAAA,SAAA,GACAC,QAAAA,QAAA,GACAC,QAAAA,QAAA,GACAmF,YAAAA,YAAA,IAGAC,cAAA,SAAA7lD,EAAAy9C,GACAz9C,EAAA8sB,cAAA+J,OACAhzB,KAAA8hD,kBAAA3lD,GAAAy9C,EAEAj9C,EAAAke,OAAA7a,KAAA8hD,kBAAA3lD,IAIAk+C,WAAA,SAAA/jC,GACA,GAAAsjC,MACAtK,EAAA3yC,EAAA2Z,GAAA7V,KAAA,QASA,OAPA6uC,IACA3yC,EAAAiD,KAAA0vC,EAAAxpC,MAAA,KAAA,WACA9F,OAAArD,GAAAC,UAAAklD,mBACAnlD,EAAAke,OAAA++B,EAAAj9C,EAAAC,UAAAklD,kBAAA9hD,SAIA45C,GAGAqI,uBAAA,SAAArI,EAAAhxC,EAAA6rC,EAAA7mC,GAIA,eAAArI,KAAAkvC,KAAA,OAAA7rC,GAAA,oBAAArD,KAAAqD,MACAgF,EAAAs0C,OAAAt0C,GAGAu0C,MAAAv0C,KACAA,EAAA/N,SAIA+N,GAAA,IAAAA,EACAgsC,EAAAnF,GAAA7mC,EACAhF,IAAA6rC,GAAA,UAAA7rC,IAIAgxC,EAAAnF,IAAA,IAIA6F,eAAA,SAAAhkC,GACA,GAGAm+B,GAAA7mC,EAHAgsC,KACAyF,EAAA1iD,EAAA2Z,GACA1N,EAAA0N,EAAAxS,aAAA,OAGA,KAAA2wC,IAAA93C,GAAAC,UAAAmjD,QAGA,aAAAtL,GACA7mC,EAAA0I,EAAAxS,aAAA2wC,GAIA,KAAA7mC,IACAA,GAAA,GAIAA,IAAAA,GAEAA,EAAAyxC,EAAA5+C,KAAAg0C,GAGAz0C,KAAAiiD,uBAAArI,EAAAhxC,EAAA6rC,EAAA7mC,EAQA,OAJAgsC,GAAAkD,WAAA,uBAAAv3C,KAAAq0C,EAAAkD,kBACAlD,GAAAkD,UAGAlD,GAGAW,UAAA,SAAAjkC,GACA,GAGAm+B,GAAA7mC,EAHAgsC,KACAyF,EAAA1iD,EAAA2Z,GACA1N,EAAA0N,EAAAxS,aAAA,OAGA,KAAA2wC,IAAA93C,GAAAC,UAAAmjD,QACAnyC,EAAAyxC,EAAAp/C,KAAA,OAAAw0C,EAAAhmC,OAAA,GAAA7G,cAAA6sC,EAAArnC,UAAA,GAAA1M,eACAV,KAAAiiD,uBAAArI,EAAAhxC,EAAA6rC,EAAA7mC,EAEA,OAAAgsC,IAGAE,YAAA,SAAAxjC,GACA,GAAAsjC,MACAh9C,EAAAD,EAAAsD,KAAAqW,EAAAmtB,KAAA,YAKA,OAHA7mC,GAAA81C,SAAAkH,QACAA,EAAAj9C,EAAAC,UAAAs9C,cAAAt9C,EAAA81C,SAAAkH,MAAAtjC,EAAAwB,YAEA8hC,GAGAQ,eAAA,SAAAR,EAAAtjC,GAmEA,MAhEA3Z,GAAAiD,KAAAg6C,EAAA,SAAAj5B,EAAA9f,GAGA,GAAAA,KAAA,EAEA,kBADA+4C,GAAAj5B,EAGA,IAAA9f,EAAAokC,OAAApkC,EAAAuhD,QAAA,CACA,GAAAC,IAAA,CACA,cAAAxhD,GAAAuhD,SACA,IAAA,SACAC,IAAA1lD,EAAAkE,EAAAuhD,QAAA9rC,EAAAmtB,MAAA1hC,MACA,MACA,KAAA,WACAsgD,EAAAxhD,EAAAuhD,QAAAhlD,KAAAkZ,EAAAA,GAGA+rC,EACAzI,EAAAj5B,GAAA9gB,SAAAgB,EAAAokC,OAAApkC,EAAAokC,OAEAtoC,EAAAsD,KAAAqW,EAAAmtB,KAAA,aAAAqb,cAAAniD,EAAA2Z,UACAsjC,GAAAj5B,OAMAhkB,EAAAiD,KAAAg6C,EAAA,SAAA6F,EAAA6C,GACA1I,EAAA6F,GAAA9iD,EAAA4b,WAAA+pC,IAAA,eAAA7C,EAAA6C,EAAAhsC,GAAAgsC,IAIA3lD,EAAAiD,MAAA,YAAA,aAAA,WACAg6C,EAAA55C,QACA45C,EAAA55C,MAAAkiD,OAAAtI,EAAA55C,UAGArD,EAAAiD,MAAA,cAAA,SAAA,WACA,GAAA+qC,EACAiP,GAAA55C,QACArD,EAAAqe,QAAA4+B,EAAA55C,OACA45C,EAAA55C,OAAAkiD,OAAAtI,EAAA55C,MAAA,IAAAkiD,OAAAtI,EAAA55C,MAAA,KACA,gBAAA45C,GAAA55C,QACA2qC,EAAAiP,EAAA55C,MAAAiD,QAAA,UAAA,IAAA6C,MAAA,UACA8zC,EAAA55C,OAAAkiD,OAAAvX,EAAA,IAAAuX,OAAAvX,EAAA,SAKAhuC,EAAAC,UAAAugD,mBAGA,MAAAvD,EAAAsD,KAAA,MAAAtD,EAAAjwC,MACAiwC,EAAAqD,OAAArD,EAAAsD,IAAAtD,EAAAjwC,WACAiwC,GAAAsD,UACAtD,GAAAjwC,KAEA,MAAAiwC,EAAAmD,WAAA,MAAAnD,EAAAkD,YACAlD,EAAAoD,aAAApD,EAAAmD,UAAAnD,EAAAkD,iBACAlD,GAAAmD,gBACAnD,GAAAkD,YAIAlD,GAIAM,cAAA,SAAAj6C,GACA,GAAA,gBAAAA,GAAA,CACA,GAAAsiD,KACA5lD,GAAAiD,KAAAK,EAAA6F,MAAA,MAAA,WACAy8C,EAAAviD,OAAA,IAEAC,EAAAsiD,EAEA,MAAAtiD,IAIAuiD,UAAA,SAAA1qC,EAAA28B,EAAA5gC,GACAlX,EAAAC,UAAAmjD,QAAAjoC,GAAA28B,EACA93C,EAAAC,UAAAu9C,SAAAriC,GAAAjY,SAAAgU,EAAAA,EAAAlX,EAAAC,UAAAu9C,SAAAriC,GACA28B,EAAA1yC,OAAA,GACApF,EAAAC,UAAAolD,cAAAlqC,EAAAnb,EAAAC,UAAAs9C,cAAApiC,KAKAioC,SAGAvF,SAAA,SAAA5sC,EAAA0I,EAAA2uB,GAGA,IAAAjlC,KAAAshD,OAAArc,EAAA3uB,GACA,MAAA,qBAEA,IAAA,WAAAA,EAAA9Q,SAAA9E,cAAA,CAGA,GAAAG,GAAAlE,EAAA2Z,GAAAzV,KACA,OAAAA,IAAAA,EAAAkB,OAAA,EAEA,MAAA/B,MAAA67C,UAAAvlC,GACAtW,KAAAqhD,UAAAzzC,EAAA0I,GAAA,EAEA1I,EAAA7L,OAAA,GAIAy6C,MAAA,SAAA5uC,EAAA0I,GAMA,MAAAtW,MAAA+7C,SAAAzlC,IAAA,wIAAA/Q,KAAAqI,IAIA7H,IAAA,SAAA6H,EAAA0I,GAMA,MAAAtW,MAAA+7C,SAAAzlC,IAAA,2cAAA/Q,KAAAqI,IAIA6uC,KAAA,SAAA7uC,EAAA0I,GACA,MAAAtW,MAAA+7C,SAAAzlC,KAAA,cAAA/Q,KAAA,GAAAwO,MAAAnG,GAAAya,aAIAq0B,QAAA,SAAA9uC,EAAA0I,GACA,MAAAtW,MAAA+7C,SAAAzlC,IAAA,+DAAA/Q,KAAAqI,IAIA+uC,OAAA,SAAA/uC,EAAA0I,GACA,MAAAtW,MAAA+7C,SAAAzlC,IAAA,8CAAA/Q,KAAAqI,IAIAgvC,OAAA,SAAAhvC,EAAA0I,GACA,MAAAtW,MAAA+7C,SAAAzlC,IAAA,QAAA/Q,KAAAqI,IAIAmvC,UAAA,SAAAnvC,EAAA0I,EAAA2uB,GACA,GAAAljC,GAAApF,EAAAqe,QAAApN,GAAAA,EAAA7L,OAAA/B,KAAAqhD,UAAAzzC,EAAA0I,EACA,OAAAtW,MAAA+7C,SAAAzlC,IAAAvU,GAAAkjC,GAIA6X,UAAA,SAAAlvC,EAAA0I,EAAA2uB,GACA,GAAAljC,GAAApF,EAAAqe,QAAApN,GAAAA,EAAA7L,OAAA/B,KAAAqhD,UAAAzzC,EAAA0I,EACA,OAAAtW,MAAA+7C,SAAAzlC,IAAAvU,GAAAkjC,GAIA+X,YAAA,SAAApvC,EAAA0I,EAAA2uB,GACA,GAAAljC,GAAApF,EAAAqe,QAAApN,GAAAA,EAAA7L,OAAA/B,KAAAqhD,UAAAzzC,EAAA0I,EACA,OAAAtW,MAAA+7C,SAAAzlC,IAAAvU,GAAAkjC,EAAA,IAAAljC,GAAAkjC,EAAA,IAIAiY,IAAA,SAAAtvC,EAAA0I,EAAA2uB,GACA,MAAAjlC,MAAA+7C,SAAAzlC,IAAA1I,GAAAq3B,GAIAt7B,IAAA,SAAAiE,EAAA0I,EAAA2uB,GACA,MAAAjlC,MAAA+7C,SAAAzlC,IAAA1I,GAAAq3B,GAIAgY,MAAA,SAAArvC,EAAA0I,EAAA2uB,GACA,MAAAjlC,MAAA+7C,SAAAzlC,IAAA1I,GAAAq3B,EAAA,IAAAr3B,GAAAq3B,EAAA,IAIA8F,KAAA,SAAAn9B,EAAA0I,EAAA2uB,GACA,GAkBAwd,GAlBA75C,EAAAjM,EAAA2Z,GAAA7V,KAAA,QACAhE,EAAA,gCAAAmM,EAAA,qBACA85C,GAAA,OAAA,SAAA,SACAC,EAAA,GAAAx7C,QAAA,MAAAyB,EAAA,OACAg6C,EAAAh6C,IAAA+5C,EAAAp9C,KAAAm9C,EAAAz8C,QACA48C,EAAA,SAAA15B,GACA,GAAAriB,IAAA,GAAAqiB,GAAAriB,MAAA,gBACA,OAAAA,IAKAA,EAAA,GAAAA,EAAA,GAAA/E,OAJA,GAMA+gD,EAAA,SAAA35B,GACA,MAAAroB,MAAAI,MAAAioB,EAAAroB,KAAAoK,IAAA,GAAAu3C,KAEA/I,GAAA,CAKA,IAAAkJ,EACA,KAAA,IAAA5qC,OAAAvb,EAUA,OAPAgmD,GAAAI,EAAA5d,IAGA4d,EAAAj1C,GAAA60C,GAAAK,EAAAl1C,GAAAk1C,EAAA7d,KAAA,KACAyU,GAAA,GAGA15C,KAAA+7C,SAAAzlC,IAAAojC,GAIAmD,QAAA,SAAAjvC,EAAA0I,EAAA2uB,GAGA,GAAA7mC,GAAAzB,EAAAsoC,EAMA,OALAjlC,MAAA0yC,SAAAkJ,YAAAx9C,EAAAka,IAAA,0BAAAvW,QACA3D,EAAAgC,SAAA,yBAAAwR,GAAA,wBAAA,WACAjV,EAAA2Z,GAAAojC,UAGA9rC,IAAAxP,EAAAyC,OAIA45C,OAAA,SAAA7sC,EAAA0I,EAAA2uB,EAAAwP,GACA,GAAAz0C,KAAA+7C,SAAAzlC,GACA,MAAA,qBAGAm+B,GAAA,gBAAAA,IAAAA,GAAA,QAEA,IACA73C,GAAAqD,EAAA8iD,EADAC,EAAAhjD,KAAA4hD,cAAAtrC,EAAAm+B,EAWA,OARAz0C,MAAA0yC,SAAAyH,SAAA7jC,EAAAwB,QACA9X,KAAA0yC,SAAAyH,SAAA7jC,EAAAwB,UAEAkrC,EAAAC,gBAAAD,EAAAC,iBAAAjjD,KAAA0yC,SAAAyH,SAAA7jC,EAAAwB,MAAA28B,GACAz0C,KAAA0yC,SAAAyH,SAAA7jC,EAAAwB,MAAA28B,GAAAuO,EAAAnvC,QAEAoxB,EAAA,gBAAAA,KAAAl/B,IAAAk/B,IAAAA,EACA8d,EAAApmD,EAAAsoC,MAAAtoC,EAAAke,QAAA5a,KAAA2N,GAAAq3B,EAAAhlC,OACA+iD,EAAA/3B,MAAA83B,EACAC,EAAAtJ,OAGAsJ,EAAA/3B,IAAA83B,EACAnmD,EAAAoD,KACAA,KAAA0hD,aAAAprC,GACArW,KACAA,EAAAqW,EAAAwB,MAAAlK,EACAjR,EAAAk2C,KAAAl2C,EAAAke,QAAA,GACAqoC,KAAA,QACAC,KAAA,WAAA7sC,EAAAwB,KACAwN,SAAA,OACArlB,KAAAA,EACAkT,QAAAvW,EAAA28C,YACAtG,QAAA,SAAAlsB,GACA,GACA03B,GAAA5qC,EAAAioC,EADApC,EAAA3yB,KAAA,GAAA,SAAAA,CAGAnqB,GAAA81C,SAAAyH,SAAA7jC,EAAAwB,MAAA28B,GAAAuO,EAAAC,gBACAvJ,GACAoC,EAAAl/C,EAAA08C,cACA18C,EAAAuiD,iBACAviD,EAAA4hD,OAAA5hD,EAAA++C,UAAArlC,GACA1Z,EAAA08C,cAAAwC,EACAl/C,EAAA8hD,YAAAp4C,KAAAgQ,GACA1Z,EAAAu/C,QAAA7lC,EAAAwB,OAAA,EACAlb,EAAAihD,eAEAY,KACA5qC,EAAAkT,GAAAnqB,EAAAyjD,eAAA/pC,GAAAm+B,OAAAA,EAAAqL,WAAAlyC,IACA6wC,EAAAnoC,EAAAwB,MAAAkrC,EAAAnvC,QAAAA,EACAjX,EAAAu/C,QAAA7lC,EAAAwB,OAAA,EACAlb,EAAAihD,WAAAY,IAEAuE,EAAAtJ,MAAAA,EACA98C,EAAA+kD,YAAArrC,EAAAojC,KAEAzU,IACA,cAUA,IACA4N,GADAuQ,IA+BA,OA3BAzmD,GAAAg2C,cACAh2C,EAAAg2C,cAAA,SAAAD,EAAA76B,EAAAzT,GACA,GAAA++C,GAAAzQ,EAAAyQ,IACA,WAAAzQ,EAAAwQ,OACAE,EAAAD,IACAC,EAAAD,GAAA5O,QAEA6O,EAAAD,GAAA/+C,MAMAyuC,EAAAl2C,EAAAk2C,KACAl2C,EAAAk2C,KAAA,SAAAH,GACA,GAAAwQ,IAAA,QAAAxQ,GAAAA,EAAA/1C,EAAAypB,cAAA88B,KACAC,GAAA,QAAAzQ,GAAAA,EAAA/1C,EAAAypB,cAAA+8B,IACA,OAAA,UAAAD,GACAE,EAAAD,IACAC,EAAAD,GAAA5O,QAEA6O,EAAAD,GAAAtQ,EAAA/9B,MAAA9U,KAAAuS,WACA6wC,EAAAD,IAEAtQ,EAAA/9B,MAAA9U,KAAAuS,aAGA5V,ICvjDA,SAAAwG,GACA,kBAAAC,SAAAA,OAAAC,IAEAD,OAAA,+BAAA,qBAAAD,GACA,gBAAAK,SAAAA,OAAAD,QAEAC,OAAAD,QAAAJ,EAAA61C,QAAA,sBAGAt8C,OAAAE,UAAAC,YAAAsG,EAAAzG,SAEA,SAAAC,GAKA,QAAA0mD,GAAA3lD,EAAA4lD,EAAA11C,GACAlQ,EAAAk8C,MAAA0J,GAAA11C,EACAlQ,EAAAmW,UACAnW,EAAAy8C,SAAAmJ,GAAA5lD,EAAAmW,SAIA,QAAA0vC,GAAA31C,GACA,MAAAA,GAAA3K,QAAA,aAAA,IAAA6C,MAAA,YAGA,QAAA09C,GAAA51C,GAEA,MAAAA,GAAA3K,QAAA,yCAAA,QAGA,QAAAwgD,GAAAC,GACA,MAAAA,GAAAzvC,OAAA,EAAAyvC,EAAAlE,YAAA,KAAA,GAGA,QAAAmE,GAAA/1C,EAAA8Z,GAIA,MAHA,KAAA9Z,EAAA7N,QAAA,QACA6N,EAAAA,EAAA3K,QAAA,KAAAykB,IAEA9Z,EAGA,QAAAg2C,GAAAp8B,EAAAq8B,GACA,GAAArnB,GAAA7/B,EAAAqD,MAAAE,KAAA,qBAAAsjD,EAAAK,EAAA,GAAA/rC,MAAA,MACAgsC,EAAAtnB,EAAA/7B,KAAA,uBACAwC,EAAA6gD,EAAAnnD,EAAAod,UAAA+pC,MAAA,EAAA,IAEAtnB,GAAAr8B,YAAA,0BAAAC,SAAA,0BACAonB,EAAAvnB,KAAA,uBAAAu8B,GAEAv5B,GACAu5B,EAAA95B,QACA8kB,EAAArnB,YAAA,0BAAAwC,SAAA65B,IAGAhV,EAAAtE,OAIA,QAAA6gC,GAAAtqC,EAAA7c,GACA,GAAA4/B,GAAA7/B,EAAAqD,MAAAE,KAAA,8BACAyb,EAAA6gB,EAAAt8B,KAAA,KAEAyb,IAAAA,EAAA5Z,QAAAnF,EAAA+8C,UAAA53C,SACA4Z,EAAAjZ,QACA85B,EAAAp8B,SAAA,6BAAAD,YAAA,4BAEAxD,EAAAiD,KAAAhD,EAAA+8C,UAAA,WACAh9C,EAAA,UAAAqC,KAAAgB,KAAA6T,SAAAlR,SAAAgZ,MAKA,QAAAqoC,GAAAx8B,GACA,GAAAgV,GAAAhV,EAAAvnB,KAAA,uBAEA,IAAAu8B,EAAA,CACA,GAAAsnB,GAAAtnB,EAAA/7B,KAAA,uBACAwC,EAAA6gD,EAAAnnD,EAAAod,UAAA+pC,GAAA,IAEAtnB,GAAAp8B,SAAA,0BAAAD,YAAA,0BACAqnB,EAAAqV,WAAA,wBAEA55B,GACAu5B,EAAA95B,SAKA,QAAAuhD,GAAAxqC,GACA,GAAAyqC,GAAAvnD,EAAAqD,MACA4Z,EAAA,4CACA,KAAAsqC,EAAAjkD,KAAA2Z,GAAA,CAIAsqC,EAAAjkD,KAAA2Z,GAAA,EACA,KACAsqC,EAAAjkD,KAAA,aAAA2+C,YACA,QACAsF,EAAArnB,WAAAjjB,GAGAsqC,EAAAhkD,KAAA,8BACAE,SAAA,4BACAD,YAAA,6BACA+jD,EAAAhkD,KAAA,2BACAE,SAAA,0BACAD,YAAA,0BACA08B,WAAA,wBACA38B,KAAA,MACA28B,WAAA,yBAGA,QAAAsnB,GAAA1gB,GACA,GAAAygB,GAAAvnD,EAAA8mC,GACA9f,EAAAugC,EAAAjkD,KAAAmkD,GACAC,EAAA1nD,EAAAiuB,MAAAq5B,EAAAxgB,GACA6gB,EAAAC,EAAA1nD,YAAAa,YACA8mD,EAAA,SAAA1sC,EAAAxF,GACA,GAAAgF,GAAAgtC,EAAAxsC,EACAR,IAAA3a,EAAA4b,WAAAjB,IAAAA,EAAAxC,MAAA2uB,EAAAnxB,GAqCA,OAlCAqR,KACAA,GACAjmB,SACAq9C,WAAAuJ,EAAAvJ,YAAA,yBACA9+C,aAAAqoD,EAAAroD,cAAA,OACAilD,eAAA,WACA0C,EAAA9uC,MAAA2uB,EAAAlxB,WACAiyC,EAAA,iBAAAjyC,YAEAmrC,eAAA,WACAqG,EAAAjvC,MAAA2uB,EAAAlxB,WACAiyC,EAAA,iBAAAjyC,YAEA4nC,YACAP,SACA3G,QAAA,WACA+Q,EAAAlvC,MAAA2uB,EAAAlxB,WACAiyC,EAAA,UAAAjyC,aAGAkyC,iBAAA,WACAP,EACA9nB,IAAA,SAAAgoB,EAAAC,GACAzyC,GAAA,SAAAwyC,EAAAC,GACA1+C,SAAA3F,KAAAtC,UAEAiI,SAAA,WAEA,MADAu+C,GAAAv+C,WACAu+C,EAAAxK,UAGAwK,EAAAjkD,KAAAmkD,EAAAzgC,IAGAA,EAnJA,GACA+gC,GADAH,EAAA5nD,EAAAC,UAEAwnD,EAAA,uBAwZA,OApQAG,GAAA1nD,aACA6nD,YAEAC,aAAA,SAAAruC,EAAAsuC,GASA,GAEAC,GAAAjL,EAAAO,EAFAkF,EAAA1iD,EAAA2Z,GACAmtB,EAAA4b,EAAA7lB,QAAA,QAAA,EAGAiK,KAIAohB,EAAAV,EAAA1gB,GACAohB,EAAAnnD,QAAAk8C,MAAAtjC,EAAAwB,MAAA8hC,KACAiL,EAAAnnD,QAAAy8C,SAAA7jC,EAAAwB,MAAAqiC,KAEAx9C,EAAAiD,KAAAI,KAAA0kD,SAAA,WACA,GAAAh9B,GAAA,YAAA1nB,KAAA8X,KACAjE,EAAAwrC,EAAA5+C,KAAAinB,GACAo9B,IAEAjlD,UAAAgU,IACA6T,GAAA,IAEA/qB,EAAAiD,KAAAI,KAAAk3C,OAAA,WACA4N,EAAA9kD,MAAAq/C,EAAA5+C,KAAAinB,EAAA1nB,QAGAA,KAAA+kD,OACAzuC,QAAAA,EACAmtB,KAAAA,EACA5vB,QAAAA,EACAqjC,OAAA4N,EACAlL,MAAAA,EACAO,SAAAA,OAKAx9C,EAAAke,OAAA++B,GAAAoL,WAAA,IAEAJ,GACAC,EAAAJ,qBAIAhU,MAAA,SAAAhoB,GAUA,GAAAw8B,GAAAtoD,EAAA8rB,GACAy8B,EAAAD,EAAAzrB,UACAD,UACA5gB,OAAA,QACA8E,IAAAwnC,EAAA/kD,KAAA,SACAq2B,IAAA,kBAEA0uB,GAAA/kD,KAAA,mBAAAN,KAAA,WACA2kD,EAAA1nD,YAAA8nD,aAAA3kD,MAAA,KAGAklD,EAAAtlD,KAAA,WACA,GAAAulD,GAAAhB,EAAAnkD,KACAmlD,IACAA,EAAAV,uBAMAC,EAAAH,EAAA1nD,YAAA6nD,SAEAA,EAAAjnC,IAAA,SAAA2nC,EAAAlO,EAAAnlC,GAeA,MALAA,KACAA,EAAAmlC,EACAA,MAEAl3C,KAAAsG,MAAAwR,KAAAstC,EAAAlO,OAAAA,EAAA6N,MAAAhzC,IACA/R,MAGA0kD,EAAAW,QAAA,SAAAD,EAAA9B,GAQA,MAAAtjD,MAAAyd,IAAA2nC,EAAA,SAAA1nD,GACA2lD,EAAA3lD,EAAA4lD,GAAA8B,GAAA,MAIAV,EAAAY,UAAA,SAAAF,EAAAG,EAAAC,EAAAC,EAAAC,EAAAC,GAiBA,MAAA3lD,MAAAyd,IAAA2nC,GAAAM,GAAA,MAAAC,GAAA,OAAA,SAAAjoD,GACA,GAAAw/C,GAAAx/C,EAAAw5C,OAAAgG,IACAvzC,EAAAjM,EAAAw5C,OAAAvtC,GAEAuzC,IAAAvzC,EACA05C,EAAA3lD,EAAA+nD,GAAAvI,EAAAvzC,IAEAuzC,EACAmG,EAAA3lD,EAAA6nD,EAAArI,GAEAvzC,GACA05C,EAAA3lD,EAAA8nD,EAAA77C,MAKA+6C,EAAAkB,aAAA,SAAAR,EAAAS,EAAAvC,GAUA,MAAAtjD,MAAAyd,IAAA2nC,GAAAS,GAAA,OAAA,SAAAnoD,GACA2lD,EAAA3lD,EAAA4lD,GAAA8B,EAAA1nD,EAAAw5C,OAAA2O,OAIAtB,EAAA/B,UAAA,YAAA,SAAA50C,EAAA0I,EAAA4gC,GACA,OAAA,IAGAqN,EAAA/B,UAAA,QAAA,SAAA50C,EAAA0I,EAAA4gC,GACA,GAAApwC,EACA,SAAA9G,KAAA+7C,SAAAzlC,KAIAxP,EAAA,GAAAK,QAAA+vC,GAAA/pC,KAAAS,GACA9G,GAAA,IAAAA,EAAAvG,OAAAuG,EAAA,GAAA/E,SAAA6L,EAAA7L,UAGAwiD,EAAA/B,UAAA,cAAA,SAAA50C,EAAA0I,EAAAwvC,GACA,GAAAh/C,EAKA,OAJAg/C,KACAh/C,EAAA8G,EAAA9G,MAAA,OACAA,EAAAA,GAAAA,EAAA/E,QAAA+jD,GAEAh/C,IAGAy9C,EAAAxE,QAAAgG,WACArB,EAAAkB,aAAA,SAAA,WACAlB,EAAAkB,aAAA,YAAA,cAKAlB,EAAAkB,aAAA,YAAA,YAAA,UAGAlB,EAAAkB,aAAA,QAAA,WACAlB,EAAAW,QAAA,cAAAA,QAAA,QAAAA,QAAA,UAAAA,QAAA,SAAAA,QAAA,UAAAA,QAAA,OACAX,EAAAY,UAAA,SAAA,YAAA,YAAA,eAAAA,UAAA,QAAA,MAAA,MAAA,SACAZ,EAAAY,UAAA,YAAA,aAAAA,UAAA,YAAA,YAAA,aACAZ,EAAAjnC,IAAA,WAAA,SAAA,SAAA/f,GACA,GAAAgqB,GAAA+7B,EAAA/lD,EAAA4Y,QAAAwB,MACAkuC,EAAAtoD,EAAAw5C,OAAA8O,MACAC,EAAAtC,EAAAqC,EAAAt+B,GACApR,EAAA3Z,EAAAe,EAAA+lC,MAAAvjC,KAAA,UAAAyY,OAAA,UAAA6qC,EAAAyC,GAAA,MAAA,EAEA5C,GAAA3lD,EAAA,UAAA4Y,KAEAouC,EAAAjnC,IAAA,WAAA,SAAA/f,GAEA,UAAAA,EAAA4Y,QAAA4vC,QAAAt+C,eAAA,aAAAlK,EAAA4Y,QAAA1N,KAAAhB,eACAy7C,EAAA3lD,EAAA,YAAA,KAGAgnD,EAAAjnC,IAAA,UAAA,MAAA,OAAA,oBAAA,SAAA/f,GACA,GAAAkQ,IACA7H,IAAArI,EAAAw5C,OAAAnxC,IACA6C,KAAAlL,EAAAw5C,OAAAtuC,MAAA,MACA3I,SAEAynB,EAAA+7B,EAAA/lD,EAAA4Y,QAAAwB,KAEAnb,GAAAiD,KAAA2jD,EAAA7lD,EAAAw5C,OAAAiP,kBAAAzoD,EAAA4Y,QAAAwB,MAAA,SAAA7P,EAAAy7C,GACA,GAAA0C,GAAAzC,EAAAD,EAAAh8B,EACA9Z,GAAA3N,KAAAmmD,GAAA,WACA,GAAAC,GAAA1pD,EAAAe,EAAA+lC,MAAAvjC,KAAA,UAAAyY,OAAA,UAAA6qC,EAAA4C,GAAA,KAEA,OAAAC,GAAA3tB,GAAA,aACA2tB,EAAA1tC,OAAA,YAAA9X,OAAAwlD,EAAA1tC,OAAA,WAAA9X,OAAA,GAEAwlD,EAAA3tB,GAAA,UACA2tB,EAAA1tC,OAAA,YAAA9X,OAAA,GAEAwlD,EAAAxlD,SAIAwiD,EAAA3lD,EAAA,SAAAkQ,KAEA82C,EAAAjnC,IAAA,YAAA,MAAA,cAAA,SAAA,SAAA/f,GACAA,EAAAw5C,OAAAgG,KACAmG,EAAA3lD,EAAA,YAAAA,EAAAw5C,OAAAgG,KAEAx/C,EAAAw5C,OAAA4O,aACAzC,EAAA3lD,EAAA,cAAAA,EAAAw5C,OAAA4O,aAEApoD,EAAAw5C,OAAAoP,OACAjD,EAAA3lD,EAAA,QAAAA,EAAAw5C,OAAAoP,SAGA5B,EAAAjnC,IAAA,kBAAA,cAAA,SAAA/f,GACA2lD,EAAA3lD,EAAA,YAAAA,EAAAw5C,OAAAqP,cAGA5pD,EAAA,WACA4nD,EAAA1nD,YAAA4zC,MAAA10C,YAGAwoD,EAAA1nD,cC9aA,SAAAF,GAEAkD,QAAAlD,EAAAC,YAEAD,EAAAC,UAAA2/C,aACAlB,OAAA,YAGA1+C,EAAAC,UAAAC,YAAA6nD,SAAAW,QAAA,aAAA,YAEA1oD,EAAAC,UAAA4lD,UAAA,qBAAA,SAAA50C,EAAA0I,GAEA,GAAAgwC,GAAA3pD,EAAA2Z,GAAA7V,KAAA,cACAI,EAAAlE,EAAA2Z,GAAAzV,KACA,OAAA,IAAAA,EAAAkB,QAGAlB,EAAAiG,MAAAw/C,KAGA3pD,EAAAC,UAAAC,YAAA6nD,SAAAW,QAAA,QAAA,sBAEA1oD,EAAA,+BAAA2b,IAAA,WAAA2lB,MAAA,SAAAnsB,GACAA,EAAAyuB,gBACA,IAAA9H,GAAA97B,EAAAqD,MACAwmD,EAAA/tB,EAAAY,QAAA,OACAmtB,GAAA7gD,WACA6gD,EAAA9M,UACA8M,EAAA5uB,SACAa,EAAAh4B,KAAA,WAAA,iBAKA/D,OClCA,IAAA+pD,cAAAA,gBCMA,IDLA,SAAAC,GACA,GAAAC,GAAAD,EAAAC,eACAC,EAAAD,EAAAC,YACAC,GAAA,SAAAj5C,EAAAk5C,GACA,OAAAl5C,GAAA,MAAAk5C,GAEAC,MAAA,SAAAn5C,EAAAo5C,GACA,OAAAp5C,GAAA,MAAAo5C,GAEAC,YAAA,SAAAr5C,EAAAs5C,GACA,MAAAjmD,UAAA2M,GAAA3M,SAAAimD,IAEAC,SAAA,SAAAv5C,EAAAs5C,GACA,MAAAjmD,UAAA2M,GAAA3M,SAAAimD,IAEAE,WAAA,SAAAx5C,EAAAy5C,GACA,MAAAz5C,IAAA,IAAAA,EAAA7N,QAAAsnD,IAEAC,SAAA,SAAA15C,EAAAy5C,GACA,MAAAz5C,IAAAA,EAAA7N,QAAAsnD,KAAAz5C,EAAA7L,OAAAslD,EAAAtlD,QAEAwlD,SAAA,SAAA35C,EAAAy5C,GACA,MAAAz5C,IAAAA,EAAA7N,QAAAsnD,OAIAX,GAAAC,WAAAA,EACAD,EAAAC,WAAAC,UAAAA,EAEAD,EAAAnpC,OAAA,SAAA05B,GAQA,QAAAsQ,GAAA/H,GACA,GAAA7xC,GAAA4R,EAAAigC,EAAA4G,OACA/uC,EAAAsvC,EAAAnH,EAAA9pB,UACAhS,EAAA,OAAA/V,GAAA0J,EAAA1J,EAAA6xC,EAAA7xC,MAEA,OAAA+V,GAGA,QAAA8jC,GAAAhI,GACA,GAAAiI,IAAA,CAMA,OAJAC,GAAAlI,EAAA4G,SACAqB,EAAAE,EAAAnI,EAAA4G,MAAAsB,EAAAlI,EAAA4G,WAGAqB,GACAF,EAAA/H,GAMA,QAAAoI,GAAA5iD,EAAA+Z,GAGA,GAKAygC,GACAx3C,EANA6/C,EAAA,QAAA9oC,EAAA+oC,UACAj/B,EAAA,QAAA9J,EAAA+oC,UACAC,KACAC,GAAA,EACAhV,GAAA,CAIA,KAAAhrC,EAAA,EAAAA,EAAA+W,EAAA46B,MAAA73C,OAAAkG,IAAA,CAGA,GAFAw3C,EAAAzgC,EAAA46B,MAAA3xC,GAEAhD,IAAAw6C,EAAA4G,OAAAphD,IAAAw6C,EAAAyI,WACA,KAAA,IAAAlwC,OAAA,qBAAA/S,EAAA,8BAGApF,UAAAmoD,EAAAvI,EAAAyI,cAIAC,EAAA1I,EAAAyI,aACAF,EAAAvI,EAAAyI,YAAAN,EAAAnI,EAAAyI,WAAAC,EAAA1I,EAAAyI,aACAF,EAAAvI,EAAAyI,cACAD,GAAA,IAGAD,EAAAvI,EAAAyI,aAAA,GAIA,GAAAp/B,GAAAm/B,EACA,OAAA,CAGA,KAAAhgD,EAAA,EAAAA,EAAA+W,EAAA46B,MAAA73C,SACA09C,EAAAzgC,EAAA46B,MAAA3xC,GAGAgrC,IADA+U,EAAAvI,EAAAyI,aACAT,EAAAzoC,EAAA46B,MAAA3xC,KAKA6/C,IAAA7U,MAGAnqB,GAAAmqB,GAZAhrC,KAgBA,MAAAgrC,GAGA,QAAAmV,GAAAnjD,EAAA+Z,GACA,GAAAM,GAAA,SAAAN,EAAAqpC,WACAC,EAAAC,EAAAtjD,GACAguC,EAAApzC,SAAAyoD,EACAC,EAAAtjD,GAAA4iD,EAAA5iD,EAAA+Z,GACAspC,EACAnT,IAAAlC,EAAA3zB,EACA,OAAA61B,GAGA,QAAAyS,GAAA3iD,EAAA+Z,GACA,OAAAA,GACAopC,EAAAnjD,EAAA+Z,GAKA,QAAAwpC,GAAAlyC,EAAArR,EAAA+Z,EAAApW,GAEA,GAAA6/C,GAAAb,EAAA3iD,EAAA+Z,EACAypC,GAEAnyC,EAAAgJ,OAGAhJ,EAAA4M,OA7GA,GAAAwlC,GACAC,EACAR,EAAAjR,EAAAiR,iBACAR,EAAAzQ,EAAAyQ,oBACAnoC,EAAA03B,EAAA13B,WACA+oC,IA4GA,KAAAG,IAAAP,GACAK,EAAA7rD,EAAA,IAAA+rD,GAAAA,EAAAP,EAAAO,GAAA,WAGA,KAAAC,IAAAhB,GACAa,EAAA7rD,EAAA,IAAAgsD,GAAAtvB,QAAA,wBAAAsvB,EAAAhB,EAAAgB,GAAA,WAIAlC,cCnJA,mBAAA/pD,QACA,KAAA,IAAAsb,OAAA,yCV+EA,KU5EA,SAAArb,GACA,YACA,IAAA6rB,GAAA7rB,EAAAoV,GAAAiX,OAAAljB,MAAA,KAAA,GAAAA,MAAA,IACA,IAAA0iB,EAAA,GAAA,GAAAA,EAAA,GAAA,GAAA,GAAAA,EAAA,IAAA,GAAAA,EAAA,IAAAA,EAAA,GAAA,GAAAA,EAAA,GAAA,EACA,KAAA,IAAAxQ,OAAA,6FAEAtb,SAWA,SAAAC,GACA,YAKA,SAAAisD,KACA,GAAAvrB,GAAAthC,SAAAG,cAAA,aAEA2sD,GACAC,iBAAA,sBACAC,cAAA,gBACAC,YAAA,gCACAC,WAAA,gBAGA,KAAA,GAAAnxC,KAAA+wC,GACA,GAAAhpD,SAAAw9B,EAAAjhC,MAAA0b,GACA,OAAA8I,IAAAioC,EAAA/wC,GAIA,QAAA,EAIAnb,EAAAoV,GAAAm3C,qBAAA,SAAA9kC,GACA,GAAA+kC,IAAA,EACAC,EAAAppD,IACArD,GAAAqD,MAAAgkC,IAAA,kBAAA,WAAAmlB,GAAA,GACA,IAAA7/B,GAAA,WAAA6/B,GAAAxsD,EAAAysD,GAAAvpB,QAAAljC,EAAAwe,QAAA8tC,WAAAroC,KAEA,OADA7Z,YAAAuiB,EAAAlF,GACApkB,MAGArD,EAAA,WACAA,EAAAwe,QAAA8tC,WAAAL,IAEAjsD,EAAAwe,QAAA8tC,aAEAtsD,EAAA8c,MAAAmlB,QAAAyqB,iBACA/pB,SAAA3iC,EAAAwe,QAAA8tC,WAAAroC,IACAye,aAAA1iC,EAAAwe,QAAA8tC,WAAAroC,IACApD,OAAA,SAAAne,GACA,GAAA1C,EAAA0C,EAAAjB,QAAAs6B,GAAA14B,MAAA,MAAAX,GAAAy/B,UAAArS,QAAA3X,MAAA9U,KAAAuS,iBAKA7V,SAWA,SAAAC,GACA,YAqDA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,WAEAA,IAAAspD,EAAAtpD,KAAA,WAAAA,EAAA,GAAAupD,GAAAxpD,OACA,gBAAA8kC,IAAA7kC,EAAA6kC,GAAA1nC,KAAAmsD,KAtDA,GAAAE,GAAA,yBACAD,EAAA,SAAAnsB,GACA1gC,EAAA0gC,GAAAzrB,GAAA,QAAA63C,EAAAzpD,KAAA2e,OAGA6qC,GAAAE,QAAA,QAEAF,EAAAG,oBAAA,IAEAH,EAAA1oC,UAAAnC,MAAA,SAAAtf,GAuBA,QAAAuqD,KAEAC,EAAAxwC,SAAAwmB,QAAA,mBAAAphC,SAxBA,GAAA8qD,GAAA5sD,EAAAqD,MACAyoB,EAAA8gC,EAAA9oD,KAAA,cAEAgoB,KACAA,EAAA8gC,EAAA9oD,KAAA,QACAgoB,EAAAA,GAAAA,EAAAxlB,QAAA,iBAAA,IAGA,IAAA4mD,GAAAltD,EAAA,MAAA8rB,KAAAA,EAEAppB,IAAAA,EAAAkhC,iBAEAspB,EAAA9nD,SACA8nD,EAAAN,EAAAlwB,QAAA,WAGAwwB,EAAAhqB,QAAAxgC,EAAA1C,EAAAujC,MAAA,mBAEA7gC,EAAAmhC,uBAEAqpB,EAAA1pD,YAAA,MAOAxD,EAAAwe,QAAA8tC,YAAAY,EAAAha,SAAA,QACAga,EACA7lB,IAAA,kBAAA4lB,GACAV,qBAAAM,EAAAG,qBACAC,KAiBA,IAAA3+B,GAAAtuB,EAAAoV,GAAA+3C,KAEAntD,GAAAoV,GAAA+3C,MAAAR,EACA3sD,EAAAoV,GAAA+3C,MAAAC,YAAAP,EAMA7sD,EAAAoV,GAAA+3C,MAAA/Q,WAAA,WAEA,MADAp8C,GAAAoV,GAAA+3C,MAAA7+B,EACAjrB,MAOArD,EAAAZ,UAAA6V,GAAA,0BAAA63C,EAAAD,EAAA1oC,UAAAnC,QAEAjiB,SAWA,SAAAC,GACA,YAmEA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,aACAvC,EAAA,gBAAAonC,IAAAA,CAEA7kC,IAAAspD,EAAAtpD,KAAA,YAAAA,EAAA,GAAA+pD,GAAAhqD,KAAAtC,IAEA,UAAAonC,EAAA7kC,EAAA6hB,SACAgjB,GAAA7kC,EAAAgqD,SAAAnlB,KAvEA,GAAAklB,GAAA,SAAA1zC,EAAA5Y,GACAsC,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAAtC,QAAAf,EAAAke,UAAAmvC,EAAAE,SAAAxsD,GACAsC,KAAAmqD,WAAA,EAGAH,GAAAN,QAAA,QAEAM,EAAAE,UACAE,YAAA,cAGAJ,EAAAlpC,UAAAmpC,SAAA,SAAAz7C,GACA,GAAAhB,GAAA,WACA47C,EAAAppD,KAAAq/C,SACAx+C,EAAAuoD,EAAA1wB,GAAA,SAAA,MAAA,OACAz4B,EAAAmpD,EAAAnpD,MAEAuO,IAAA,OAEA,MAAAvO,EAAAoqD,WAAAjB,EAAAnpD,KAAA,YAAAmpD,EAAAvoD,MAGAkG,WAAApK,EAAAiuB,MAAA,WACAw+B,EAAAvoD,GAAA,MAAAZ,EAAAuO,GAAAxO,KAAAtC,QAAA8Q,GAAAvO,EAAAuO,IAEA,eAAAA,GACAxO,KAAAmqD,WAAA,EACAf,EAAAhpD,SAAAoN,GAAA/M,KAAA+M,EAAAA,GAAAmT,KAAAnT,GAAA,IACAxN,KAAAmqD,YACAnqD,KAAAmqD,WAAA,EACAf,EAAAjpD,YAAAqN,GAAA2gC,WAAA3gC,GAAAmT,KAAAnT,GAAA,KAEAxN,MAAA,IAGAgqD,EAAAlpC,UAAAgB,OAAA,WACA,GAAAwoC,IAAA,EACAT,EAAA7pD,KAAAq/C,SAAAhmB,QAAA,0BAEA,IAAAwwB,EAAA9nD,OAAA,CACA,GAAAwoD,GAAAvqD,KAAAq/C,SAAAn/C,KAAA,QACA,UAAAqqD,EAAA5pC,KAAA,SACA4pC,EAAA5pC,KAAA,aAAA2pC,GAAA,GACAT,EAAA3pD,KAAA,WAAAC,YAAA,UACAH,KAAAq/C,SAAAj/C,SAAA,WACA,YAAAmqD,EAAA5pC,KAAA,UACA4pC,EAAA5pC,KAAA,aAAA3gB,KAAAq/C,SAAAxP,SAAA,YAAAya,GAAA,GACAtqD,KAAAq/C,SAAA3P,YAAA,WAEA6a,EAAA5pC,KAAA,UAAA3gB,KAAAq/C,SAAAxP,SAAA,WACAya,GAAAC,EAAA1qB,QAAA,cAEA7/B,MAAAq/C,SAAA5+C,KAAA,gBAAAT,KAAAq/C,SAAAxP,SAAA,WACA7vC,KAAAq/C,SAAA3P,YAAA,UAqBA,IAAAzkB,GAAAtuB,EAAAoV,GAAAolB,MAEAx6B,GAAAoV,GAAAolB,OAAAmyB,EACA3sD,EAAAoV,GAAAolB,OAAA4yB,YAAAC,EAMArtD,EAAAoV,GAAAolB,OAAA4hB,WAAA,WAEA,MADAp8C,GAAAoV,GAAAolB,OAAAlM,EACAjrB,MAOArD,EAAAZ,UACA6V,GAAA,2BAAA,0BAAA,SAAAvS,GACA,GAAAmrD,GAAA7tD,EAAA0C,EAAAjB,QAAAi7B,QAAA,OACAiwB,GAAAlsD,KAAAotD,EAAA,UACA7tD,EAAA0C,EAAAjB,QAAAs6B,GAAA,iDAEAr5B,EAAAkhC,iBAEAiqB,EAAA9xB,GAAA,gBAAA8xB,EAAA3qB,QAAA,SACA2qB,EAAAtqD,KAAA,gCAAAqpB,QAAAsW,QAAA,YAGAjuB,GAAA,mDAAA,0BAAA,SAAAvS,GACA1C,EAAA0C,EAAAjB,QAAAi7B,QAAA,QAAAqW,YAAA,QAAA,eAAAnqC,KAAAlG,EAAAuJ,UAGAlM,SAWA,SAAAC,GACA,YAqKA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,eACAvC,EAAAf,EAAAke,UAAA4vC,EAAAP,SAAAX,EAAAtpD,OAAA,gBAAA6kC,IAAAA,GACA4lB,EAAA,gBAAA5lB,GAAAA,EAAApnC,EAAAitD,KAEA1qD,IAAAspD,EAAAtpD,KAAA,cAAAA,EAAA,GAAAwqD,GAAAzqD,KAAAtC,IACA,gBAAAonC,GAAA7kC,EAAA8rC,GAAAjH,GACA4lB,EAAAzqD,EAAAyqD,KACAhtD,EAAAmvC,UAAA5sC,EAAA2qD,QAAAC,UA1KA,GAAAJ,GAAA,SAAAn0C,EAAA5Y,GACAsC,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAA8qD,YAAA9qD,KAAAq/C,SAAAn/C,KAAA,wBACAF,KAAAtC,QAAAA,EACAsC,KAAA+qD,OAAA,KACA/qD,KAAAgrD,QAAA,KACAhrD,KAAA6sC,SAAA,KACA7sC,KAAAirD,QAAA,KACAjrD,KAAAkrD,OAAA,KAEAlrD,KAAAtC,QAAAytD,UAAAnrD,KAAAq/C,SAAAztC,GAAA,sBAAAjV,EAAAiuB,MAAA5qB,KAAAorD,QAAAprD,OAEA,SAAAA,KAAAtC,QAAAktD,SAAA,gBAAA7uD,UAAAwD,kBAAAS,KAAAq/C,SACAztC,GAAA,yBAAAjV,EAAAiuB,MAAA5qB,KAAA4qD,MAAA5qD,OACA4R,GAAA,yBAAAjV,EAAAiuB,MAAA5qB,KAAA6qD,MAAA7qD,OAGAyqD,GAAAf,QAAA,QAEAe,EAAAd,oBAAA,IAEAc,EAAAP,UACArd,SAAA,IACA+d,MAAA,QACAvkB,MAAA,EACA8kB,UAAA,GAGAV,EAAA3pC,UAAAsqC,QAAA,SAAA/rD,GACA,IAAA,kBAAAkG,KAAAlG,EAAAjB,OAAA8nD,SAAA,CACA,OAAA7mD,EAAA+hB,OACA,IAAA,IAAAphB,KAAAqnB,MAAA,MACA,KAAA,IAAArnB,KAAAg5B,MAAA,MACA,SAAA,OAGA35B,EAAAkhC,mBAGAkqB,EAAA3pC,UAAA+pC,MAAA,SAAAxrD,GASA,MARAA,KAAAW,KAAA+qD,QAAA,GAEA/qD,KAAA6sC,UAAAE,cAAA/sC,KAAA6sC,UAEA7sC,KAAAtC,QAAAmvC,WACA7sC,KAAA+qD,SACA/qD,KAAA6sC,SAAAC,YAAAnwC,EAAAiuB,MAAA5qB,KAAAg5B,KAAAh5B,MAAAA,KAAAtC,QAAAmvC,WAEA7sC,MAGAyqD,EAAA3pC,UAAAuqC,aAAA,SAAArmD,GAEA,MADAhF,MAAAkrD,OAAAlmD,EAAA5D,SAAA23B,SAAA,SACA/4B,KAAAkrD,OAAA3qD,MAAAyE,GAAAhF,KAAAirD,UAGAR,EAAA3pC,UAAAwqC,oBAAA,SAAAC,EAAA1Z,GACA,GAAA2Z,GAAAxrD,KAAAqrD,aAAAxZ,GACA4Z,EAAA,QAAAF,GAAA,IAAAC,GACA,QAAAD,GAAAC,GAAAxrD,KAAAkrD,OAAAnpD,OAAA,CACA,IAAA0pD,IAAAzrD,KAAAtC,QAAA2oC,KAAA,MAAAwL,EACA,IAAA6Z,GAAA,QAAAH,KAAA,EACAI,GAAAH,EAAAE,GAAA1rD,KAAAkrD,OAAAnpD,MACA,OAAA/B,MAAAkrD,OAAA1hC,GAAAmiC,IAGAlB,EAAA3pC,UAAAirB,GAAA,SAAA1+B,GACA,GAAAu+C,GAAA5rD,KACAwrD,EAAAxrD,KAAAqrD,aAAArrD,KAAAirD,QAAAjrD,KAAAq/C,SAAAn/C,KAAA,gBAEA,MAAAmN,EAAArN,KAAAkrD,OAAAnpD,OAAA,GAAAsL,EAAA,GAEA,MAAArN,MAAAgrD,QAAAhrD,KAAAq/C,SAAArb,IAAA,mBAAA,WAAA4nB,EAAA7f,GAAA1+B,KACAm+C,GAAAn+C,EAAArN,KAAA4qD,QAAAC,QAEA7qD,KAAA2qD,MAAAt9C,EAAAm+C,EAAA,OAAA,OAAAxrD,KAAAkrD,OAAA1hC,GAAAnc,KAGAo9C,EAAA3pC,UAAA8pC,MAAA,SAAAvrD,GAUA,MATAA,KAAAW,KAAA+qD,QAAA,GAEA/qD,KAAAq/C,SAAAn/C,KAAA,gBAAA6B,QAAApF,EAAAwe,QAAA8tC,aACAjpD,KAAAq/C,SAAAxf,QAAAljC,EAAAwe,QAAA8tC,WAAAroC,KACA5gB,KAAA6qD,OAAA,IAGA7qD,KAAA6sC,SAAAE,cAAA/sC,KAAA6sC,UAEA7sC,MAGAyqD,EAAA3pC,UAAAkY,KAAA,WACA,IAAAh5B,KAAAgrD,QACA,MAAAhrD,MAAA2qD,MAAA,SAGAF,EAAA3pC,UAAAuG,KAAA,WACA,IAAArnB,KAAAgrD,QACA,MAAAhrD,MAAA2qD,MAAA,SAGAF,EAAA3pC,UAAA6pC,MAAA,SAAA/hD,EAAAowB,GACA,GAAAiyB,GAAAjrD,KAAAq/C,SAAAn/C,KAAA,gBACA2rD,EAAA7yB,GAAAh5B,KAAAsrD,oBAAA1iD,EAAAqiD,GACAa,EAAA9rD,KAAA6sC,SACA0e,EAAA,QAAA3iD,EAAA,OAAA,QACAgjD,EAAA5rD,IAEA,IAAA6rD,EAAAhc,SAAA,UAAA,MAAA7vC,MAAAgrD,SAAA,CAEA,IAAA1oB,GAAAupB,EAAA,GACAE,EAAApvD,EAAAujC,MAAA,qBACAoC,cAAAA,EACAipB,UAAAA,GAGA,IADAvrD,KAAAq/C,SAAAxf,QAAAksB,IACAA,EAAAvrB,qBAAA,CAMA,GAJAxgC,KAAAgrD,SAAA,EAEAc,GAAA9rD,KAAA4qD,QAEA5qD,KAAA8qD,YAAA/oD,OAAA,CACA/B,KAAA8qD,YAAA5qD,KAAA,WAAAC,YAAA,SACA,IAAA6rD,GAAArvD,EAAAqD,KAAA8qD,YAAA/xB,WAAA/4B,KAAAqrD,aAAAQ,IACAG,IAAAA,EAAA5rD,SAAA,UAGA,GAAA6rD,GAAAtvD,EAAAujC,MAAA,oBAAAoC,cAAAA,EAAAipB,UAAAA,GAyBA,OAxBA5uD,GAAAwe,QAAA8tC,YAAAjpD,KAAAq/C,SAAAxP,SAAA,UACAgc,EAAAzrD,SAAAwI,GACAijD,EAAA,GAAA9jD,YACAkjD,EAAA7qD,SAAAmrD,GACAM,EAAAzrD,SAAAmrD,GACAN,EACAjnB,IAAA,kBAAA,WACA6nB,EAAA1rD,aAAAyI,EAAA2iD,GAAAtlD,KAAA,MAAA7F,SAAA,UACA6qD,EAAA9qD,aAAA,SAAAorD,GAAAtlD,KAAA,MACA2lD,EAAAZ,SAAA,EACAjkD,WAAA,WACA6kD,EAAAvM,SAAAxf,QAAAosB,IACA,KAEA/C,qBAAAuB,EAAAd,uBAEAsB,EAAA9qD,YAAA,UACA0rD,EAAAzrD,SAAA,UACAJ,KAAAgrD,SAAA,EACAhrD,KAAAq/C,SAAAxf,QAAAosB,IAGAH,GAAA9rD,KAAA6qD,QAEA7qD,MAqBA,IAAAirB,GAAAtuB,EAAAoV,GAAAm6C,QAEAvvD,GAAAoV,GAAAm6C,SAAA5C,EACA3sD,EAAAoV,GAAAm6C,SAAAnC,YAAAU,EAMA9tD,EAAAoV,GAAAm6C,SAAAnT,WAAA,WAEA,MADAp8C,GAAAoV,GAAAm6C,SAAAjhC,EACAjrB,KAOA,IAAAmsD,GAAA,SAAA9sD,GACA,GAAAsV,GACA40C,EAAA5sD,EAAAqD,MACAosD,EAAAzvD,EAAA4sD,EAAA9oD,KAAA,iBAAAkU,EAAA40C,EAAA9oD,KAAA,UAAAkU,EAAA1R,QAAA,iBAAA,IACA,IAAAmpD,EAAAvc,SAAA,YAAA,CACA,GAAAnyC,GAAAf,EAAAke,UAAAuxC,EAAAnsD,OAAAspD,EAAAtpD,QACAosD,EAAA9C,EAAA9oD,KAAA,gBACA4rD,KAAA3uD,EAAAmvC,UAAA,GAEAyc,EAAAlsD,KAAAgvD,EAAA1uD,GAEA2uD,GACAD,EAAAnsD,KAAA,eAAA8rC,GAAAsgB,GAGAhtD,EAAAkhC,kBAGA5jC,GAAAZ,UACA6V,GAAA,6BAAA,eAAAu6C,GACAv6C,GAAA,6BAAA,kBAAAu6C,GAEAxvD,EAAAc,QAAAmU,GAAA,OAAA,WACAjV,EAAA,0BAAAiD,KAAA,WACA,GAAA0sD,GAAA3vD,EAAAqD,KACAspD,GAAAlsD,KAAAkvD,EAAAA,EAAArsD,aAIAvD,SAYA,SAAAC,GACA,YAkJA,SAAA4vD,GAAAC,GACA,GAAA73C,GACAvW,EAAAouD,EAAA/rD,KAAA,iBACAkU,EAAA63C,EAAA/rD,KAAA,UAAAkU,EAAA1R,QAAA,iBAAA,GAEA,OAAAtG,GAAAyB,GAOA,QAAAkrD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,eACAvC,EAAAf,EAAAke,UAAA4xC,EAAAvC,SAAAX,EAAAtpD,OAAA,gBAAA6kC,IAAAA,IAEA7kC,GAAAvC,EAAAokB,QAAA,YAAAvc,KAAAu/B,KAAApnC,EAAAokB,QAAA,GACA7hB,GAAAspD,EAAAtpD,KAAA,cAAAA,EAAA,GAAAwsD,GAAAzsD,KAAAtC,IACA,gBAAAonC,IAAA7kC,EAAA6kC,OAjKA,GAAA2nB,GAAA,SAAAn2C,EAAA5Y,GACAsC,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAAtC,QAAAf,EAAAke,UAAA4xC,EAAAvC,SAAAxsD,GACAsC,KAAAwsD,SAAA7vD,EAAA,mCAAA2Z,EAAArR,GAAA,6CACAqR,EAAArR,GAAA,MACAjF,KAAA0sD,cAAA,KAEA1sD,KAAAtC,QAAA0D,OACApB,KAAA6pD,QAAA7pD,KAAA2sD,YAEA3sD,KAAA4sD,yBAAA5sD,KAAAq/C,SAAAr/C,KAAAwsD,UAGAxsD,KAAAtC,QAAAokB,QAAA9hB,KAAA8hB,SAGA2qC,GAAA/C,QAAA,QAEA+C,EAAA9C,oBAAA,IAEA8C,EAAAvC,UACApoC,QAAA,GAGA2qC,EAAA3rC,UAAA+rC,UAAA,WACA,GAAAC,GAAA9sD,KAAAq/C,SAAAxP,SAAA,QACA,OAAAid,GAAA,QAAA,UAGAL,EAAA3rC,UAAAxB,KAAA,WACA,IAAAtf,KAAA0sD,gBAAA1sD,KAAAq/C,SAAAxP,SAAA,MAAA,CAEA,GAAAkd,GACAC,EAAAhtD,KAAA6pD,SAAA7pD,KAAA6pD,QAAA9wB,SAAA,UAAAA,SAAA,mBAEA,MAAAi0B,GAAAA,EAAAjrD,SACAgrD,EAAAC,EAAA/sD,KAAA,eACA8sD,GAAAA,EAAAL,gBAFA,CAKA,GAAAO,GAAAtwD,EAAAujC,MAAA,mBAEA,IADAlgC,KAAAq/C,SAAAxf,QAAAotB,IACAA,EAAAzsB,qBAAA,CAEAwsB,GAAAA,EAAAjrD,SACAunD,EAAAlsD,KAAA4vD,EAAA,QACAD,GAAAC,EAAA/sD,KAAA,cAAA,MAGA,IAAA4sD,GAAA7sD,KAAA6sD,WAEA7sD,MAAAq/C,SACAl/C,YAAA,YACAC,SAAA,cAAAysD,GAAA,GACApsD,KAAA,iBAAA,GAEAT,KAAAwsD,SACArsD,YAAA,aACAM,KAAA,iBAAA,GAEAT,KAAA0sD,cAAA,CAEA,IAAAp4C,GAAA,WACAtU,KAAAq/C,SACAl/C,YAAA,cACAC,SAAA,eAAAysD,GAAA,IACA7sD,KAAA0sD,cAAA,EACA1sD,KAAAq/C,SACAxf,QAAA,qBAGA,KAAAljC,EAAAwe,QAAA8tC,WAAA,MAAA30C,GAAAlX,KAAA4C,KAEA,IAAAktD,GAAAvwD,EAAAme,WAAA,SAAA+xC,GAAA5mD,KAAA,KAEAjG,MAAAq/C,SACArb,IAAA,kBAAArnC,EAAAiuB,MAAAtW,EAAAtU,OACAkpD,qBAAAuD,EAAA9C,qBAAAkD,GAAA7sD,KAAAq/C,SAAA,GAAA6N,QAGAT,EAAA3rC,UAAAoC,KAAA,WACA,IAAAljB,KAAA0sD,eAAA1sD,KAAAq/C,SAAAxP,SAAA,MAAA,CAEA,GAAAod,GAAAtwD,EAAAujC,MAAA,mBAEA,IADAlgC,KAAAq/C,SAAAxf,QAAAotB,IACAA,EAAAzsB,qBAAA,CAEA,GAAAqsB,GAAA7sD,KAAA6sD,WAEA7sD,MAAAq/C,SAAAwN,GAAA7sD,KAAAq/C,SAAAwN,MAAA,GAAAzsC,aAEApgB,KAAAq/C,SACAj/C,SAAA,cACAD,YAAA,eACAM,KAAA,iBAAA,GAEAT,KAAAwsD,SACApsD,SAAA,aACAK,KAAA,iBAAA,GAEAT,KAAA0sD,cAAA,CAEA,IAAAp4C,GAAA,WACAtU,KAAA0sD,cAAA,EACA1sD,KAAAq/C,SACAl/C,YAAA,cACAC,SAAA,YACAy/B,QAAA,sBAGA,OAAAljC,GAAAwe,QAAA8tC,eAEAjpD,MAAAq/C,SACAwN,GAAA,GACA7oB,IAAA,kBAAArnC,EAAAiuB,MAAAtW,EAAAtU,OACAkpD,qBAAAuD,EAAA9C,qBALAr1C,EAAAlX,KAAA4C,SAQAysD,EAAA3rC,UAAAgB,OAAA,WACA9hB,KAAAA,KAAAq/C,SAAAxP,SAAA,MAAA,OAAA,WAGA4c,EAAA3rC,UAAA6rC,UAAA,WACA,MAAAhwD,GAAAqD,KAAAtC,QAAA0D,QACAlB,KAAA,yCAAAF,KAAAtC,QAAA0D,OAAA,MACAxB,KAAAjD,EAAAiuB,MAAA,SAAA3iB,EAAAqO,GACA,GAAA+oC,GAAA1iD,EAAA2Z,EACAtW,MAAA4sD,yBAAAL,EAAAlN,GAAAA,IACAr/C,OACA4gB,OAGA6rC,EAAA3rC,UAAA8rC,yBAAA,SAAAvN,EAAAmN,GACA,GAAAW,GAAA9N,EAAAxP,SAAA,KAEAwP,GAAA5+C,KAAA,gBAAA0sD,GACAX,EACA9c,YAAA,aAAAyd,GACA1sD,KAAA,gBAAA0sD,GA2BA,IAAAliC,GAAAtuB,EAAAoV,GAAAq7C,QAEAzwD,GAAAoV,GAAAq7C,SAAA9D,EACA3sD,EAAAoV,GAAAq7C,SAAArD,YAAA0C,EAMA9vD,EAAAoV,GAAAq7C,SAAArU,WAAA,WAEA,MADAp8C,GAAAoV,GAAAq7C,SAAAniC,EACAjrB,MAOArD,EAAAZ,UAAA6V,GAAA,6BAAA,2BAAA,SAAAvS,GACA,GAAAkqD,GAAA5sD,EAAAqD,KAEAupD,GAAA9oD,KAAA,gBAAApB,EAAAkhC,gBAEA,IAAA6rB,GAAAG,EAAAhD,GACAtpD,EAAAmsD,EAAAnsD,KAAA,eACA6kC,EAAA7kC,EAAA,SAAAspD,EAAAtpD,MAEAqpD,GAAAlsD,KAAAgvD,EAAAtnB,MAGApoC,SAWA,SAAAC,GACA,YAaA,SAAAgwD,GAAApD,GACA,GAAA9gC,GAAA8gC,EAAA9oD,KAAA,cAEAgoB,KACAA,EAAA8gC,EAAA9oD,KAAA,QACAgoB,EAAAA,GAAA,YAAAljB,KAAAkjB,IAAAA,EAAAxlB,QAAA,iBAAA,IAGA,IAAA4mD,GAAAphC,GAAA9rB,EAAA8rB,EAEA,OAAAohC,IAAAA,EAAA9nD,OAAA8nD,EAAAN,EAAAnoD,SAGA,QAAAisD,GAAAhuD,GACAA,GAAA,IAAAA,EAAA+hB,QACAzkB,EAAA2wD,GAAA7uD,SACA9B,EAAAmlB,GAAAliB,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACA6pD,EAAA8C,EAAApD,GACAjnB,GAAAA,cAAAtiC,KAEA6pD,GAAAha,SAAA,UAEAxwC,GAAA,SAAAA,EAAAuJ,MAAA,kBAAArD,KAAAlG,EAAAjB,OAAA8nD,UAAAvpD,EAAA8uB,SAAAo+B,EAAA,GAAAxqD,EAAAjB,UAEAyrD,EAAAhqB,QAAAxgC,EAAA1C,EAAAujC,MAAA,mBAAAoC,IAEAjjC,EAAAmhC,uBAEA+oB,EAAA9oD,KAAA,gBAAA,SACAopD,EAAA1pD,YAAA,QAAA0/B,QAAAljC,EAAAujC,MAAA,qBAAAoC,UA4EA,QAAAgnB,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,cAEAA,IAAAspD,EAAAtpD,KAAA,cAAAA,EAAA,GAAAstD,GAAAvtD,OACA,gBAAA8kC,IAAA7kC,EAAA6kC,GAAA1nC,KAAAmsD,KAxHA,GAAA+D,GAAA,qBACAxrC,EAAA,2BACAyrC,EAAA,SAAAj3C,GACA3Z,EAAA2Z,GAAA1E,GAAA,oBAAA5R,KAAA8hB,QAGAyrC,GAAA7D,QAAA,QAoCA6D,EAAAzsC,UAAAgB,OAAA,SAAAziB,GACA,GAAAkqD,GAAA5sD,EAAAqD,KAEA,KAAAupD,EAAA7wB,GAAA,wBAAA,CAEA,GAAAmxB,GAAA8C,EAAApD,GACAiE,EAAA3D,EAAAha,SAAA,OAIA,IAFAwd,KAEAG,EAAA,CACA,gBAAAzxD,UAAAwD,kBAAAsqD,EAAAxwB,QAAA,eAAAt3B,QAEApF,EAAAZ,SAAAG,cAAA,QACAkE,SAAA,qBACA+mC,YAAAxqC,EAAAqD,OACA4R,GAAA,QAAAy7C,EAGA,IAAA/qB,IAAAA,cAAAtiC,KAGA,IAFA6pD,EAAAhqB,QAAAxgC,EAAA1C,EAAAujC,MAAA,mBAAAoC,IAEAjjC,EAAAmhC,qBAAA,MAEA+oB,GACA1pB,QAAA,SACAp/B,KAAA,gBAAA,QAEAopD,EACAna,YAAA,QACA7P,QAAAljC,EAAAujC,MAAA,oBAAAoC,IAGA,OAAA,IAGAirB,EAAAzsC,UAAAsqC,QAAA,SAAA/rD,GACA,GAAA,gBAAAkG,KAAAlG,EAAA+hB,SAAA,kBAAA7b,KAAAlG,EAAAjB,OAAA8nD,SAAA,CAEA,GAAAqD,GAAA5sD,EAAAqD,KAKA,IAHAX,EAAAkhC,iBACAlhC,EAAA2hC,mBAEAuoB,EAAA7wB,GAAA,wBAAA,CAEA,GAAAmxB,GAAA8C,EAAApD,GACAiE,EAAA3D,EAAAha,SAAA,OAEA,KAAA2d,GAAA,IAAAnuD,EAAA+hB,OAAAosC,GAAA,IAAAnuD,EAAA+hB,MAEA,MADA,KAAA/hB,EAAA+hB,OAAAyoC,EAAA3pD,KAAA4hB,GAAA+d,QAAA,SACA0pB,EAAA1pB,QAAA,QAGA,IAAAnyB,GAAA,+BACAw9C,EAAArB,EAAA3pD,KAAA,iBAAAwN,EAEA,IAAAw9C,EAAAnpD,OAAA,CAEA,GAAAxB,GAAA2qD,EAAA3qD,MAAAlB,EAAAjB,OAEA,KAAAiB,EAAA+hB,OAAA7gB,EAAA,GAAAA,IACA,IAAAlB,EAAA+hB,OAAA7gB,EAAA2qD,EAAAnpD,OAAA,GAAAxB,KACAA,IAAAA,EAAA,GAEA2qD,EAAA1hC,GAAAjpB,GAAAs/B,QAAA,YAiBA,IAAA5U,GAAAtuB,EAAAoV,GAAA07C,QAEA9wD,GAAAoV,GAAA07C,SAAAnE,EACA3sD,EAAAoV,GAAA07C,SAAA1D,YAAAwD,EAMA5wD,EAAAoV,GAAA07C,SAAA1U,WAAA,WAEA,MADAp8C,GAAAoV,GAAA07C,SAAAxiC,EACAjrB,MAOArD,EAAAZ,UACA6V,GAAA,6BAAAy7C,GACAz7C,GAAA,6BAAA,iBAAA,SAAAvS,GAAAA,EAAA2hC,oBACApvB,GAAA,6BAAAkQ,EAAAyrC,EAAAzsC,UAAAgB,QACAlQ,GAAA,+BAAAkQ,EAAAyrC,EAAAzsC,UAAAsqC,SACAx5C,GAAA,+BAAA,iBAAA27C,EAAAzsC,UAAAsqC,UAEA1uD,SAWA,SAAAC,GACA,YAyRA,SAAA2sD,GAAAxkB,EAAA4oB,GACA,MAAA1tD,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,YACAvC,EAAAf,EAAAke,UAAA8yC,EAAAzD,SAAAX,EAAAtpD,OAAA,gBAAA6kC,IAAAA,EAEA7kC,IAAAspD,EAAAtpD,KAAA,WAAAA,EAAA,GAAA0tD,GAAA3tD,KAAAtC,IACA,gBAAAonC,GAAA7kC,EAAA6kC,GAAA4oB,GACAhwD,EAAA4hB,MAAArf,EAAAqf,KAAAouC,KA5RA,GAAAC,GAAA,SAAAr3C,EAAA5Y,GACAsC,KAAAtC,QAAAA,EACAsC,KAAA4tD,MAAAjxD,EAAAZ,SAAAyD,MACAQ,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAA6tD,QAAA7tD,KAAAq/C,SAAAn/C,KAAA,iBACAF,KAAA8tD,UAAA,KACA9tD,KAAA+tD,QAAA,KACA/tD,KAAAguD,gBAAA,KACAhuD,KAAAiuD,eAAA,EACAjuD,KAAAkuD,qBAAA,EAEAluD,KAAAtC,QAAA+8C,QACAz6C,KAAAq/C,SACAn/C,KAAA,kBACAsiC,KAAAxiC,KAAAtC,QAAA+8C,OAAA99C,EAAAiuB,MAAA,WACA5qB,KAAAq/C,SAAAxf,QAAA,oBACA7/B,OAIA2tD,GAAAjE,QAAA,QAEAiE,EAAAhE,oBAAA,IACAgE,EAAAQ,6BAAA,IAEAR,EAAAzD,UACAoD,UAAA;AACAnC,UAAA,EACA7rC,MAAA,GAGAquC,EAAA7sC,UAAAgB,OAAA,SAAA4rC,GACA,MAAA1tD,MAAA+tD,QAAA/tD,KAAAkjB,OAAAljB,KAAAsf,KAAAouC,IAGAC,EAAA7sC,UAAAxB,KAAA,SAAAouC,GACA,GAAA9B,GAAA5rD,KACAX,EAAA1C,EAAAujC,MAAA,iBAAAoC,cAAAorB,GAEA1tD,MAAAq/C,SAAAxf,QAAAxgC,GAEAW,KAAA+tD,SAAA1uD,EAAAmhC,uBAEAxgC,KAAA+tD,SAAA,EAEA/tD,KAAAouD,iBACApuD,KAAAquD,eACAruD,KAAA4tD,MAAAxtD,SAAA,cAEAJ,KAAAsuD,SACAtuD,KAAAuuD,SAEAvuD,KAAAq/C,SAAAztC,GAAA,yBAAA,yBAAAjV,EAAAiuB,MAAA5qB,KAAAkjB,KAAAljB,OAEAA,KAAA6tD,QAAAj8C,GAAA,6BAAA,WACAg6C,EAAAvM,SAAArb,IAAA,2BAAA,SAAA3kC,GACA1C,EAAA0C,EAAAjB,QAAAs6B,GAAAkzB,EAAAvM,YAAAuM,EAAAsC,qBAAA,OAIAluD,KAAAstD,SAAA,WACA,GAAArE,GAAAtsD,EAAAwe,QAAA8tC,YAAA2C,EAAAvM,SAAAxP,SAAA,OAEA+b,GAAAvM,SAAAj+C,SAAAW,QACA6pD,EAAAvM,SAAA18C,SAAAipD,EAAAgC,OAGAhC,EAAAvM,SACA//B,OACA8iB,UAAA,GAEAwpB,EAAA4C,eAEAvF,GACA2C,EAAAvM,SAAA,GAAAt3C,YAGA6jD,EAAAvM,SAAAj/C,SAAA,MAEAwrD,EAAA6C,cAEA,IAAApvD,GAAA1C,EAAAujC,MAAA,kBAAAoC,cAAAorB,GAEAzE,GACA2C,EAAAiC,QACA7pB,IAAA,kBAAA,WACA4nB,EAAAvM,SAAAxf,QAAA,SAAAA,QAAAxgC,KAEA6pD,qBAAAyE,EAAAhE,qBACAiC,EAAAvM,SAAAxf,QAAA,SAAAA,QAAAxgC,OAIAsuD,EAAA7sC,UAAAoC,KAAA,SAAA7jB,GACAA,GAAAA,EAAAkhC,iBAEAlhC,EAAA1C,EAAAujC,MAAA,iBAEAlgC,KAAAq/C,SAAAxf,QAAAxgC,GAEAW,KAAA+tD,UAAA1uD,EAAAmhC,uBAEAxgC,KAAA+tD,SAAA,EAEA/tD,KAAAsuD,SACAtuD,KAAAuuD,SAEA5xD,EAAAZ,UAAAqgC,IAAA,oBAEAp8B,KAAAq/C,SACAl/C,YAAA,MACAi8B,IAAA,0BACAA,IAAA,4BAEAp8B,KAAA6tD,QAAAzxB,IAAA,8BAEAz/B,EAAAwe,QAAA8tC,YAAAjpD,KAAAq/C,SAAAxP,SAAA,QACA7vC,KAAAq/C,SACArb,IAAA,kBAAArnC,EAAAiuB,MAAA5qB,KAAA0uD,UAAA1uD,OACAkpD,qBAAAyE,EAAAhE,qBACA3pD,KAAA0uD,cAGAf,EAAA7sC,UAAA2tC,aAAA,WACA9xD,EAAAZ,UACAqgC,IAAA,oBACAxqB,GAAA,mBAAAjV,EAAAiuB,MAAA,SAAAvrB,GACAtD,WAAAsD,EAAAjB,QACA4B,KAAAq/C,SAAA,KAAAhgD,EAAAjB,QACA4B,KAAAq/C,SAAA9oB,IAAAl3B,EAAAjB,QAAA2D,QACA/B,KAAAq/C,SAAAxf,QAAA,UAEA7/B,QAGA2tD,EAAA7sC,UAAAwtC,OAAA,WACAtuD,KAAA+tD,SAAA/tD,KAAAtC,QAAAytD,SACAnrD,KAAAq/C,SAAAztC,GAAA,2BAAAjV,EAAAiuB,MAAA,SAAAvrB,GACA,IAAAA,EAAA+hB,OAAAphB,KAAAkjB,QACAljB,OACAA,KAAA+tD,SACA/tD,KAAAq/C,SAAAjjB,IAAA,6BAIAuxB,EAAA7sC,UAAAytC,OAAA,WACAvuD,KAAA+tD,QACApxD,EAAAc,QAAAmU,GAAA,kBAAAjV,EAAAiuB,MAAA5qB,KAAA2uD,aAAA3uD,OAEArD,EAAAc,QAAA2+B,IAAA,oBAIAuxB,EAAA7sC,UAAA4tC,UAAA,WACA,GAAA9C,GAAA5rD,IACAA,MAAAq/C,SAAAn8B,OACAljB,KAAAstD,SAAA,WACA1B,EAAAgC,MAAAztD,YAAA,cACAyrD,EAAAgD,mBACAhD,EAAAiD,iBACAjD,EAAAvM,SAAAxf,QAAA,sBAIA8tB,EAAA7sC,UAAAguC,eAAA,WACA9uD,KAAA8tD,WAAA9tD,KAAA8tD,UAAArvD,SACAuB,KAAA8tD,UAAA,MAGAH,EAAA7sC,UAAAwsC,SAAA,SAAAhkC,GACA,GAAAsiC,GAAA5rD,KACAgsC,EAAAhsC,KAAAq/C,SAAAxP,SAAA,QAAA,OAAA,EAEA,IAAA7vC,KAAA+tD,SAAA/tD,KAAAtC,QAAA4vD,SAAA,CACA,GAAAyB,GAAApyD,EAAAwe,QAAA8tC,YAAAjd,CAqBA,IAnBAhsC,KAAA8tD,UAAAnxD,EAAAZ,SAAAG,cAAA,QACAkE,SAAA,kBAAA4rC,GACArpC,SAAA3C,KAAA4tD,OAEA5tD,KAAAq/C,SAAAztC,GAAA,yBAAAjV,EAAAiuB,MAAA,SAAAvrB,GACA,MAAAW,MAAAkuD,yBACAluD,KAAAkuD,qBAAA,QAGA7uD,EAAAjB,SAAAiB,EAAAyhC,gBACA,UAAA9gC,KAAAtC,QAAA4vD,SACAttD,KAAAq/C,SAAA,GAAAzoB,QACA52B,KAAAkjB,UACAljB,OAEA+uD,GAAA/uD,KAAA8tD,UAAA,GAAA/lD,YAEA/H,KAAA8tD,UAAA1tD,SAAA,OAEAkpB,EAAA,MAEAylC,GACA/uD,KAAA8tD,UACA9pB,IAAA,kBAAA1a,GACA4/B,qBAAAyE,EAAAQ,8BACA7kC,QAEA,KAAAtpB,KAAA+tD,SAAA/tD,KAAA8tD,UAAA,CACA9tD,KAAA8tD,UAAA3tD,YAAA,KAEA,IAAA6uD,GAAA,WACApD,EAAAkD,iBACAxlC,GAAAA,IAEA3sB,GAAAwe,QAAA8tC,YAAAjpD,KAAAq/C,SAAAxP,SAAA,QACA7vC,KAAA8tD,UACA9pB,IAAA,kBAAAgrB,GACA9F,qBAAAyE,EAAAQ,8BACAa,QAEA1lC,IACAA,KAMAqkC,EAAA7sC,UAAA6tC,aAAA,WACA3uD,KAAAwuD,gBAGAb,EAAA7sC,UAAA0tC,aAAA,WACA,GAAAS,GAAAjvD,KAAAq/C,SAAA,GAAAvR,aAAA/xC,SAAAwD,gBAAAyK,YAEAhK,MAAAq/C,SAAAj9C,KACA8sD,aAAAlvD,KAAAmvD,mBAAAF,EAAAjvD,KAAAiuD,eAAA,GACAmB,aAAApvD,KAAAmvD,oBAAAF,EAAAjvD,KAAAiuD,eAAA,MAIAN,EAAA7sC,UAAA8tC,iBAAA,WACA5uD,KAAAq/C,SAAAj9C,KACA8sD,YAAA,GACAE,aAAA,MAIAzB,EAAA7sC,UAAAstC,eAAA,WACA,GAAAiB,GAAA5xD,OAAAmM,UACA,KAAAylD,EAAA,CACA,GAAAC,GAAAvzD,SAAAwD,gBAAA04C,uBACAoX,GAAAC,EAAAC,MAAAzuD,KAAAC,IAAAuuD,EAAAtnB,MAEAhoC,KAAAmvD,kBAAApzD,SAAAyD,KAAAsK,YAAAulD,EACArvD,KAAAiuD,eAAAjuD,KAAAwvD,oBAGA7B,EAAA7sC,UAAAutC,aAAA,WACA,GAAAoB,GAAAxuD,SAAAjB,KAAA4tD,MAAAxrD,IAAA,kBAAA,EAAA,GACApC,MAAAguD,gBAAAjyD,SAAAyD,KAAApD,MAAAgzD,cAAA,GACApvD,KAAAmvD,mBAAAnvD,KAAA4tD,MAAAxrD,IAAA,gBAAAqtD,EAAAzvD,KAAAiuD,iBAGAN,EAAA7sC,UAAA+tC,eAAA,WACA7uD,KAAA4tD,MAAAxrD,IAAA,gBAAApC,KAAAguD,kBAGAL,EAAA7sC,UAAA0uC,iBAAA,WACA,GAAAE,GAAA3zD,SAAAG,cAAA,MACAwzD,GAAAvzD,UAAA,0BACA6D,KAAA4tD,MAAAprD,OAAAktD,EACA,IAAAzB,GAAAyB,EAAA3nD,YAAA2nD,EAAA5lD,WAEA,OADA9J,MAAA4tD,MAAA,GAAAhoD,YAAA8pD,GACAzB,EAmBA,IAAAhjC,GAAAtuB,EAAAoV,GAAA49C,KAEAhzD,GAAAoV,GAAA49C,MAAArG,EACA3sD,EAAAoV,GAAA49C,MAAA5F,YAAA4D,EAMAhxD,EAAAoV,GAAA49C,MAAA5W,WAAA,WAEA,MADAp8C,GAAAoV,GAAA49C,MAAA1kC,EACAjrB,MAOArD,EAAAZ,UAAA6V,GAAA,0BAAA,wBAAA,SAAAvS,GACA,GAAAkqD,GAAA5sD,EAAAqD,MACA2U,EAAA40C,EAAA9oD,KAAA,QACA2rD,EAAAzvD,EAAA4sD,EAAA9oD,KAAA,gBAAAkU,GAAAA,EAAA1R,QAAA,iBAAA,KACA6hC,EAAAsnB,EAAAnsD,KAAA,YAAA,SAAAtD,EAAAke,QAAA4/B,QAAA,IAAAl1C,KAAAoP,IAAAA,GAAAy3C,EAAAnsD,OAAAspD,EAAAtpD,OAEAspD,GAAA7wB,GAAA,MAAAr5B,EAAAkhC,iBAEA6rB,EAAApoB,IAAA,gBAAA,SAAA4rB,GACAA,EAAApvB,sBACA4rB,EAAApoB,IAAA,kBAAA,WACAulB,EAAA7wB,GAAA,aAAA6wB,EAAA1pB,QAAA,aAGAypB,EAAAlsD,KAAAgvD,EAAAtnB,EAAA9kC,SAGAtD,SAYA,SAAAC,GACA,YAkeA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,cACAvC,EAAA,gBAAAonC,IAAAA,GAEA7kC,GAAA,eAAAsF,KAAAu/B,KACA7kC,GAAAspD,EAAAtpD,KAAA,aAAAA,EAAA,GAAA4vD,GAAA7vD,KAAAtC,IACA,gBAAAonC,IAAA7kC,EAAA6kC,QAreA,GAAA+qB,GAAA,SAAAv5C,EAAA5Y,GACAsC,KAAA4I,KAAA,KACA5I,KAAAtC,QAAA,KACAsC,KAAA+2B,QAAA,KACA/2B,KAAAwX,QAAA,KACAxX,KAAA8vD,WAAA,KACA9vD,KAAAq/C,SAAA,KACAr/C,KAAA+vD,QAAA,KAEA/vD,KAAAuI,KAAA,UAAA+N,EAAA5Y,GAGAmyD,GAAAnG,QAAA,QAEAmG,EAAAlG,oBAAA,IAEAkG,EAAA3F,UACA1oC,WAAA,EACAwuC,UAAA,MACAvnC,UAAA,EACAwnC,SAAA,+GACApwB,QAAA,cACAygB,MAAA,GACApT,MAAA,EACAluC,MAAA,EACAw9B,WAAA,EACAp9B,UACAqpB,SAAA,OACAlsB,QAAA,IAIAszD,EAAA/uC,UAAAvY,KAAA,SAAAK,EAAA0N,EAAA5Y,GAQA,GAPAsC,KAAA+2B,SAAA,EACA/2B,KAAA4I,KAAAA,EACA5I,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAAtC,QAAAsC,KAAAkwD,WAAAxyD,GACAsC,KAAAmwD,UAAAnwD,KAAAtC,QAAA0B,UAAAzC,EAAAA,EAAA4b,WAAAvY,KAAAtC,QAAA0B,UAAAY,KAAAtC,QAAA0B,SAAAhC,KAAA4C,KAAAA,KAAAq/C,UAAAr/C,KAAAtC,QAAA0B,SAAAqpB,UAAAzoB,KAAAtC,QAAA0B,UACAY,KAAA+vD,SAAA9xB,OAAA,EAAA6R,OAAA,EAAAlZ,OAAA,GAEA52B,KAAAq/C,SAAA,YAAAtjD,UAAAktB,cAAAjpB,KAAAtC,QAAA+qB,SACA,KAAA,IAAAzQ,OAAA,yDAAAhY,KAAA4I,KAAA,kCAKA,KAAA,GAFAwnD,GAAApwD,KAAAtC,QAAAmiC,QAAA/5B,MAAA,KAEAmC,EAAAmoD,EAAAruD,OAAAkG,KAAA,CACA,GAAA43B,GAAAuwB,EAAAnoD,EAEA,IAAA,SAAA43B,EACA7/B,KAAAq/C,SAAAztC,GAAA,SAAA5R,KAAA4I,KAAA5I,KAAAtC,QAAA+qB,SAAA9rB,EAAAiuB,MAAA5qB,KAAA8hB,OAAA9hB,WACA,IAAA,UAAA6/B,EAAA,CACA,GAAAwwB,GAAA,SAAAxwB,EAAA,aAAA,UACAywB,EAAA,SAAAzwB,EAAA,aAAA,UAEA7/B,MAAAq/C,SAAAztC,GAAAy+C,EAAA,IAAArwD,KAAA4I,KAAA5I,KAAAtC,QAAA+qB,SAAA9rB,EAAAiuB,MAAA5qB,KAAAuwD,MAAAvwD,OACAA,KAAAq/C,SAAAztC,GAAA0+C,EAAA,IAAAtwD,KAAA4I,KAAA5I,KAAAtC,QAAA+qB,SAAA9rB,EAAAiuB,MAAA5qB,KAAAwwD,MAAAxwD,QAIAA,KAAAtC,QAAA+qB,SACAzoB,KAAAywD,SAAA9zD,EAAAke,UAAA7a,KAAAtC,SAAAmiC,QAAA,SAAApX,SAAA,KACAzoB,KAAA0wD,YAGAb,EAAA/uC,UAAA6vC,YAAA,WACA,MAAAd,GAAA3F,UAGA2F,EAAA/uC,UAAAovC,WAAA,SAAAxyD,GAUA,MATAA,GAAAf,EAAAke,UAAA7a,KAAA2wD,cAAA3wD,KAAAq/C,SAAAp/C,OAAAvC,GAEAA,EAAAwvC,OAAA,gBAAAxvC,GAAAwvC,QACAxvC,EAAAwvC,OACA5tB,KAAA5hB,EAAAwvC,MACAhqB,KAAAxlB,EAAAwvC,QAIAxvC,GAGAmyD,EAAA/uC,UAAA8vC,mBAAA,WACA,GAAAlzD,MACAm9C,EAAA76C,KAAA2wD,aAMA,OAJA3wD,MAAAywD,UAAA9zD,EAAAiD,KAAAI,KAAAywD,SAAA,SAAA72C,EAAAhM,GACAitC,EAAAjhC,IAAAhM,IAAAlQ,EAAAkc,GAAAhM,KAGAlQ,GAGAmyD,EAAA/uC,UAAAyvC,MAAA,SAAA1+C,GACA,GAAA4mB,GAAA5mB,YAAA7R,MAAAipB,YACApX,EAAAlV,EAAAkV,EAAAivB,eAAA7gC,KAAA,MAAAD,KAAA4I,KAWA,OATA6vB,KACAA,EAAA,GAAAz4B,MAAAipB,YAAApX,EAAAivB,cAAA9gC,KAAA4wD,sBACAj0D,EAAAkV,EAAAivB,eAAA7gC,KAAA,MAAAD,KAAA4I,KAAA6vB,IAGA5mB,YAAAlV,GAAAujC,QACAzH,EAAAs3B,QAAA,WAAAl+C,EAAAjJ,KAAA,QAAA,UAAA,GAGA6vB,EAAAo4B,MAAAhhB,SAAA,OAAA,MAAApX,EAAAq3B,gBACAr3B,EAAAq3B,WAAA,OAIA1nD,aAAAqwB,EAAAjhB,SAEAihB,EAAAq3B,WAAA,KAEAr3B,EAAA/6B,QAAAwvC,OAAAzU,EAAA/6B,QAAAwvC,MAAA5tB,UAEAmZ,EAAAjhB,QAAAzQ,WAAA,WACA,MAAA0xB,EAAAq3B,YAAAr3B,EAAAnZ,QACAmZ,EAAA/6B,QAAAwvC,MAAA5tB,OAJAmZ,EAAAnZ,SAOAuwC,EAAA/uC,UAAAgwC,cAAA,WACA,IAAA,GAAAl3C,KAAA5Z,MAAA+vD,QACA,GAAA/vD,KAAA+vD,QAAAn2C,GAAA,OAAA,CAGA,QAAA,GAGAi2C,EAAA/uC,UAAA0vC,MAAA,SAAA3+C,GACA,GAAA4mB,GAAA5mB,YAAA7R,MAAAipB,YACApX,EAAAlV,EAAAkV,EAAAivB,eAAA7gC,KAAA,MAAAD,KAAA4I,KAWA,IATA6vB,IACAA,EAAA,GAAAz4B,MAAAipB,YAAApX,EAAAivB,cAAA9gC,KAAA4wD,sBACAj0D,EAAAkV,EAAAivB,eAAA7gC,KAAA,MAAAD,KAAA4I,KAAA6vB,IAGA5mB,YAAAlV,GAAAujC,QACAzH,EAAAs3B,QAAA,YAAAl+C,EAAAjJ,KAAA,QAAA,UAAA,IAGA6vB,EAAAq4B,gBAMA,MAJA1oD,cAAAqwB,EAAAjhB,SAEAihB,EAAAq3B,WAAA,MAEAr3B,EAAA/6B,QAAAwvC,OAAAzU,EAAA/6B,QAAAwvC,MAAAhqB,UAEAuV,EAAAjhB,QAAAzQ,WAAA,WACA,OAAA0xB,EAAAq3B,YAAAr3B,EAAAvV,QACAuV,EAAA/6B,QAAAwvC,MAAAhqB,OAJAuV,EAAAvV,QAOA2sC,EAAA/uC,UAAAxB,KAAA,WACA,GAAAjgB,GAAA1C,EAAAujC,MAAA,WAAAlgC,KAAA4I,KAEA,IAAA5I,KAAA20C,cAAA30C,KAAA+2B,QAAA,CACA/2B,KAAAq/C,SAAAxf,QAAAxgC,EAEA,IAAA0xD,GAAAp0D,EAAA8uB,SAAAzrB,KAAAq/C,SAAA,GAAA3iC,cAAAnd,gBAAAS,KAAAq/C,SAAA,GACA,IAAAhgD,EAAAmhC,uBAAAuwB,EAAA,MACA,IAAAnF,GAAA5rD,KAEAgxD,EAAAhxD,KAAA6wD,MAEAI,EAAAjxD,KAAAkxD,OAAAlxD,KAAA4I,KAEA5I,MAAAmxD,aACAH,EAAAvwD,KAAA,KAAAwwD,GACAjxD,KAAAq/C,SAAA5+C,KAAA,mBAAAwwD,GAEAjxD,KAAAtC,QAAA8jB,WAAAwvC,EAAA5wD,SAAA,OAEA,IAAA4vD,GAAA,kBAAAhwD,MAAAtC,QAAAsyD,UACAhwD,KAAAtC,QAAAsyD,UAAA5yD,KAAA4C,KAAAgxD,EAAA,GAAAhxD,KAAAq/C,SAAA,IACAr/C,KAAAtC,QAAAsyD,UAEAoB,EAAA,eACAC,EAAAD,EAAA7rD,KAAAyqD,EACAqB,KAAArB,EAAAA,EAAA/sD,QAAAmuD,EAAA,KAAA,OAEAJ,EACA33C,SACAjX,KAAAkxB,IAAA,EAAA0U,KAAA,EAAA1lC,QAAA,UACAlC,SAAA4vD,GACA/vD,KAAA,MAAAD,KAAA4I,KAAA5I,MAEAA,KAAAtC,QAAA8+B,UAAAw0B,EAAAruD,SAAA3C,KAAAtC,QAAA8+B,WAAAw0B,EAAA7pB,YAAAnnC,KAAAq/C,UACAr/C,KAAAq/C,SAAAxf,QAAA,eAAA7/B,KAAA4I,KAEA,IAAAyE,GAAArN,KAAAsxD,cACAC,EAAAP,EAAA,GAAAjpD,YACAypD,EAAAR,EAAA,GAAA5wC,YAEA,IAAAixC,EAAA,CACA,GAAAI,GAAAzB,EACA0B,EAAA1xD,KAAAsxD,YAAAtxD,KAAAmwD,UAEAH,GAAA,UAAAA,GAAA3iD,EAAAskD,OAAAH,EAAAE,EAAAC,OAAA,MACA,OAAA3B,GAAA3iD,EAAAimB,IAAAk+B,EAAAE,EAAAp+B,IAAA,SACA,SAAA08B,GAAA3iD,EAAAkiD,MAAAgC,EAAAG,EAAAjyD,MAAA,OACA,QAAAuwD,GAAA3iD,EAAA26B,KAAAupB,EAAAG,EAAA1pB,KAAA,QACAgoB,EAEAgB,EACA7wD,YAAAsxD,GACArxD,SAAA4vD,GAGA,GAAA4B,GAAA5xD,KAAA6xD,oBAAA7B,EAAA3iD,EAAAkkD,EAAAC,EAEAxxD,MAAA8xD,eAAAF,EAAA5B,EAEA,IAAA17C,GAAA,WACA,GAAAy9C,GAAAnG,EAAAkE,UACAlE,GAAAvM,SAAAxf,QAAA,YAAA+rB,EAAAhjD,MACAgjD,EAAAkE,WAAA,KAEA,OAAAiC,GAAAnG,EAAA4E,MAAA5E,GAGAjvD,GAAAwe,QAAA8tC,YAAAjpD,KAAAgxD,KAAAnhB,SAAA,QACAmhB,EACAhtB,IAAA,kBAAA1vB,GACA40C,qBAAA2G,EAAAlG,qBACAr1C,MAIAu7C,EAAA/uC,UAAAgxC,eAAA,SAAA1a,EAAA4Y,GACA,GAAAgB,GAAAhxD,KAAA6wD,MACApxD,EAAAuxD,EAAA,GAAAjpD,YACArI,EAAAsxD,EAAA,GAAA5wC,aAGA4xC,EAAA/wD,SAAA+vD,EAAA5uD,IAAA,cAAA,IACA6vD,EAAAhxD,SAAA+vD,EAAA5uD,IAAA,eAAA,GAGA+/C,OAAA6P,KAAAA,EAAA,GACA7P,MAAA8P,KAAAA,EAAA,GAEA7a,EAAA9jB,KAAA0+B,EACA5a,EAAApP,MAAAiqB,EAIAt1D,EAAAy6C,OAAAC,UAAA2Z,EAAA,GAAAr0D,EAAAke,QACAi9B,MAAA,SAAAj2B,GACAmvC,EAAA5uD,KACAkxB,IAAAxyB,KAAAI,MAAA2gB,EAAAyR,KACA0U,KAAAlnC,KAAAI,MAAA2gB,EAAAmmB,UAGAoP,GAAA,GAEA4Z,EAAA5wD,SAAA,KAGA,IAAAmxD,GAAAP,EAAA,GAAAjpD,YACAypD,EAAAR,EAAA,GAAA5wC,YAEA,QAAA4vC,GAAAwB,GAAA9xD,IACA03C,EAAA9jB,IAAA8jB,EAAA9jB,IAAA5zB,EAAA8xD,EAGA,IAAA9F,GAAA1rD,KAAAkyD,yBAAAlC,EAAA5Y,EAAAma,EAAAC,EAEA9F,GAAA1jB,KAAAoP,EAAApP,MAAA0jB,EAAA1jB,KACAoP,EAAA9jB,KAAAo4B,EAAAp4B,GAEA,IAAA6+B,GAAA,aAAA5sD,KAAAyqD,GACAoC,EAAAD,EAAA,EAAAzG,EAAA1jB,KAAAvoC,EAAA8xD,EAAA,EAAA7F,EAAAp4B,IAAA5zB,EAAA8xD,EACAa,EAAAF,EAAA,cAAA,cAEAnB,GAAA5Z,OAAAA,GACAp3C,KAAAsyD,aAAAF,EAAApB,EAAA,GAAAqB,GAAAF,IAGAtC,EAAA/uC,UAAAwxC,aAAA,SAAA5G,EAAAmB,EAAAsF,GACAnyD,KAAAuyD,QACAnwD,IAAA+vD,EAAA,OAAA,MAAA,IAAA,EAAAzG,EAAAmB,GAAA,KACAzqD,IAAA+vD,EAAA,MAAA,OAAA,KAGAtC,EAAA/uC,UAAAqwC,WAAA,WACA,GAAAH,GAAAhxD,KAAA6wD,MACAvQ,EAAAtgD,KAAAwyD,UAEAxB,GAAA9wD,KAAA,kBAAAF,KAAAtC,QAAAsB,KAAA,OAAA,QAAAshD,GACA0Q,EAAA7wD,YAAA,kCAGA0vD,EAAA/uC,UAAAoC,KAAA,SAAAoG,GAKA,QAAAhV,KACA,MAAAs3C,EAAAkE,YAAAkB,EAAA33C,SACAuyC,EAAAvM,UACAuM,EAAAvM,SACAlR,WAAA,oBACAtO,QAAA,aAAA+rB,EAAAhjD,MAEA0gB,GAAAA,IAXA,GAAAsiC,GAAA5rD,KACAgxD,EAAAr0D,EAAAqD,KAAAgxD,MACA3xD,EAAA1C,EAAAujC,MAAA,WAAAlgC,KAAA4I,KAcA,IAFA5I,KAAAq/C,SAAAxf,QAAAxgC,IAEAA,EAAAmhC,qBAYA,MAVAwwB,GAAA7wD,YAAA,MAEAxD,EAAAwe,QAAA8tC,YAAA+H,EAAAnhB,SAAA,QACAmhB,EACAhtB,IAAA,kBAAA1vB,GACA40C,qBAAA2G,EAAAlG,qBACAr1C,IAEAtU,KAAA8vD,WAAA,KAEA9vD,MAGA6vD,EAAA/uC,UAAA4vC,SAAA,WACA,GAAA+B,GAAAzyD,KAAAq/C,UACAoT,EAAAhyD,KAAA,UAAA,gBAAAgyD,GAAAhyD,KAAA,yBACAgyD,EAAAhyD,KAAA,sBAAAgyD,EAAAhyD,KAAA,UAAA,IAAAA,KAAA,QAAA,KAIAovD,EAAA/uC,UAAA6zB,WAAA,WACA,MAAA30C,MAAAwyD,YAGA3C,EAAA/uC,UAAAwwC,YAAA,SAAAjS,GACAA,EAAAA,GAAAr/C,KAAAq/C,QAEA,IAAAhiB,GAAAgiB,EAAA,GACAqT,EAAA,QAAAr1B,EAAA6oB,QAEAyM,EAAAt1B,EAAA4a,uBACA,OAAA0a,EAAAlzD,QAEAkzD,EAAAh2D,EAAAke,UAAA83C,GAAAlzD,MAAAkzD,EAAApD,MAAAoD,EAAA3qB,KAAAtoC,OAAAizD,EAAAhB,OAAAgB,EAAAr/B,MAEA,IAAAs/B,GAAAn1D,OAAAo1D,YAAAx1B,YAAA5/B,QAAAo1D,WAGAC,EAAAJ,GAAAp/B,IAAA,EAAA0U,KAAA,GAAA4qB,EAAA,KAAAvT,EAAAjI,SACA2b,GAAAA,OAAAL,EAAA32D,SAAAwD,gBAAA6iC,WAAArmC,SAAAyD,KAAA4iC,UAAAid,EAAAjd,aACA4wB,EAAAN,GAAAjzD,MAAA9C,EAAAc,QAAAgC,QAAAC,OAAA/C,EAAAc,QAAAiC,UAAA,IAEA,OAAA/C,GAAAke,UAAA83C,EAAAI,EAAAC,EAAAF,IAGAjD,EAAA/uC,UAAA+wC,oBAAA,SAAA7B,EAAA3iD,EAAAkkD,EAAAC,GACA,MAAA,UAAAxB,GAAA18B,IAAAjmB,EAAAimB,IAAAjmB,EAAA3N,OAAAsoC,KAAA36B,EAAA26B,KAAA36B,EAAA5N,MAAA,EAAA8xD,EAAA,GACA,OAAAvB,GAAA18B,IAAAjmB,EAAAimB,IAAAk+B,EAAAxpB,KAAA36B,EAAA26B,KAAA36B,EAAA5N,MAAA,EAAA8xD,EAAA,GACA,QAAAvB,GAAA18B,IAAAjmB,EAAAimB,IAAAjmB,EAAA3N,OAAA,EAAA8xD,EAAA,EAAAxpB,KAAA36B,EAAA26B,KAAAupB,IACAj+B,IAAAjmB,EAAAimB,IAAAjmB,EAAA3N,OAAA,EAAA8xD,EAAA,EAAAxpB,KAAA36B,EAAA26B,KAAA36B,EAAA5N,QAIAowD,EAAA/uC,UAAAoxC,yBAAA,SAAAlC,EAAA3iD,EAAAkkD,EAAAC,GACA,GAAA9F,IAAAp4B,IAAA,EAAA0U,KAAA,EACA,KAAAhoC,KAAAmwD,UAAA,MAAAzE,EAEA,IAAAuH,GAAAjzD,KAAAtC,QAAA0B,UAAAY,KAAAtC,QAAA0B,SAAA7C,SAAA,EACA22D,EAAAlzD,KAAAsxD,YAAAtxD,KAAAmwD,UAEA,IAAA,aAAA5qD,KAAAyqD,GAAA,CACA,GAAAmD,GAAA9lD,EAAAimB,IAAA2/B,EAAAC,EAAAH,OACAK,EAAA/lD,EAAAimB,IAAA2/B,EAAAC,EAAAH,OAAAvB,CACA2B,GAAAD,EAAA5/B,IACAo4B,EAAAp4B,IAAA4/B,EAAA5/B,IAAA6/B,EACAC,EAAAF,EAAA5/B,IAAA4/B,EAAAxzD,SACAgsD,EAAAp4B,IAAA4/B,EAAA5/B,IAAA4/B,EAAAxzD,OAAA0zD,OAEA,CACA,GAAAC,GAAAhmD,EAAA26B,KAAAirB,EACAK,EAAAjmD,EAAA26B,KAAAirB,EAAA1B,CACA8B,GAAAH,EAAAlrB,KACA0jB,EAAA1jB,KAAAkrB,EAAAlrB,KAAAqrB,EACAC,EAAAJ,EAAA3D,QACA7D,EAAA1jB,KAAAkrB,EAAAlrB,KAAAkrB,EAAAzzD,MAAA6zD,GAIA,MAAA5H,IAGAmE,EAAA/uC,UAAA0xC,SAAA,WACA,GAAAlS,GACAmS,EAAAzyD,KAAAq/C,SACAkU,EAAAvzD,KAAAtC,OAKA,OAHA4iD,GAAAmS,EAAAhyD,KAAA,yBACA,kBAAA8yD,GAAAjT,MAAAiT,EAAAjT,MAAAljD,KAAAq1D,EAAA,IAAAc,EAAAjT,QAKAuP,EAAA/uC,UAAAowC,OAAA,SAAAxpC,GACA,EAAAA,OAAA,IAAA5mB,KAAA8oB,gBACA7tB,SAAAC,eAAA0rB,GACA,OAAAA,IAGAmoC,EAAA/uC,UAAA+vC,IAAA,WACA,IAAA7wD,KAAAgxD,OACAhxD,KAAAgxD,KAAAr0D,EAAAqD,KAAAtC,QAAAuyD,UACA,GAAAjwD,KAAAgxD,KAAAjvD,QACA,KAAA,IAAAiW,OAAAhY,KAAA4I,KAAA,kEAGA,OAAA5I,MAAAgxD,MAGAnB,EAAA/uC,UAAAyxC,MAAA,WACA,MAAAvyD,MAAAwzD,OAAAxzD,KAAAwzD,QAAAxzD,KAAA6wD,MAAA3wD,KAAA,mBAGA2vD,EAAA/uC,UAAA2yC,OAAA,WACAzzD,KAAA+2B,SAAA,GAGA84B,EAAA/uC,UAAA2Z,QAAA,WACAz6B,KAAA+2B,SAAA,GAGA84B,EAAA/uC,UAAA4yC,cAAA,WACA1zD,KAAA+2B,SAAA/2B,KAAA+2B,SAGA84B,EAAA/uC,UAAAgB,OAAA,SAAAziB,GACA,GAAAo5B,GAAAz4B,IACAX,KACAo5B,EAAA97B,EAAA0C,EAAAyhC,eAAA7gC,KAAA,MAAAD,KAAA4I,MACA6vB,IACAA,EAAA,GAAAz4B,MAAAipB,YAAA5pB,EAAAyhC,cAAA9gC,KAAA4wD,sBACAj0D,EAAA0C,EAAAyhC,eAAA7gC,KAAA,MAAAD,KAAA4I,KAAA6vB,KAIAp5B,GACAo5B,EAAAs3B,QAAA9xB,OAAAxF,EAAAs3B,QAAA9xB,MACAxF,EAAAq4B,gBAAAr4B,EAAA83B,MAAA93B,GACAA,EAAA+3B,MAAA/3B,IAEAA,EAAAo4B,MAAAhhB,SAAA,MAAApX,EAAA+3B,MAAA/3B,GAAAA,EAAA83B,MAAA93B,IAIAo3B,EAAA/uC,UAAA+gC,QAAA,WACA,GAAA+J,GAAA5rD,IACAoI,cAAApI,KAAAwX,SACAxX,KAAAkjB,KAAA,WACA0oC,EAAAvM,SAAAjjB,IAAA,IAAAwvB,EAAAhjD,MAAAi0B,WAAA,MAAA+uB,EAAAhjD,MACAgjD,EAAAoF,MACApF,EAAAoF,KAAA33C,SAEAuyC,EAAAoF,KAAA,KACApF,EAAA4H,OAAA,KACA5H,EAAAuE,UAAA,KACAvE,EAAAvM,SAAA,OAoBA,IAAAp0B,GAAAtuB,EAAAoV,GAAA4hD,OAEAh3D,GAAAoV,GAAA4hD,QAAArK,EACA3sD,EAAAoV,GAAA4hD,QAAA5J,YAAA8F,EAMAlzD,EAAAoV,GAAA4hD,QAAA5a,WAAA,WAEA,MADAp8C,GAAAoV,GAAA4hD,QAAA1oC,EACAjrB,OAGAtD,SAWA,SAAAC,GACA,YAuEA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,cACAvC,EAAA,gBAAAonC,IAAAA,GAEA7kC,GAAA,eAAAsF,KAAAu/B,KACA7kC,GAAAspD,EAAAtpD,KAAA,aAAAA,EAAA,GAAA2zD,GAAA5zD,KAAAtC,IACA,gBAAAonC,IAAA7kC,EAAA6kC,QA1EA,GAAA8uB,GAAA,SAAAt9C,EAAA5Y,GACAsC,KAAAuI,KAAA,UAAA+N,EAAA5Y,GAGA,KAAAf,EAAAoV,GAAA4hD,QAAA,KAAA,IAAA37C,OAAA,8BAEA47C,GAAAlK,QAAA,QAEAkK,EAAA1J,SAAAvtD,EAAAke,UAAAle,EAAAoV,GAAA4hD,QAAA5J,YAAAG,UACA8F,UAAA,QACAnwB,QAAA,QACApjB,QAAA,GACAwzC,SAAA,0IAOA2D,EAAA9yC,UAAAnkB,EAAAke,UAAAle,EAAAoV,GAAA4hD,QAAA5J,YAAAjpC,WAEA8yC,EAAA9yC,UAAAmI,YAAA2qC,EAEAA,EAAA9yC,UAAA6vC,YAAA,WACA,MAAAiD,GAAA1J,UAGA0J,EAAA9yC,UAAAqwC,WAAA,WACA,GAAAH,GAAAhxD,KAAA6wD,MACAvQ,EAAAtgD,KAAAwyD,WACA/1C,EAAAzc,KAAA6zD,YAEA7C,GAAA9wD,KAAA,kBAAAF,KAAAtC,QAAAsB,KAAA,OAAA,QAAAshD,GACA0Q,EAAA9wD,KAAA,oBAAA64B,WAAA1f,SAAAuH,MACA5gB,KAAAtC,QAAAsB,KAAA,gBAAAyd,GAAA,OAAA,SAAA,QACAA,GAEAu0C,EAAA7wD,YAAA,iCAIA6wD,EAAA9wD,KAAA,kBAAAlB,QAAAgyD,EAAA9wD,KAAA,kBAAAgjB,QAGA0wC,EAAA9yC,UAAA6zB,WAAA,WACA,MAAA30C,MAAAwyD,YAAAxyD,KAAA6zD,cAGAD,EAAA9yC,UAAA+yC,WAAA,WACA,GAAApB,GAAAzyD,KAAAq/C,SACAkU,EAAAvzD,KAAAtC,OAEA,OAAA+0D,GAAAhyD,KAAA,kBACA,kBAAA8yD,GAAA92C,QACA82C,EAAA92C,QAAArf,KAAAq1D,EAAA,IACAc,EAAA92C,UAGAm3C,EAAA9yC,UAAAyxC,MAAA,WACA,MAAAvyD,MAAAwzD,OAAAxzD,KAAAwzD,QAAAxzD,KAAA6wD,MAAA3wD,KAAA,UAmBA,IAAA+qB,GAAAtuB,EAAAoV,GAAA+hD,OAEAn3D,GAAAoV,GAAA+hD,QAAAxK,EACA3sD,EAAAoV,GAAA+hD,QAAA/J,YAAA6J,EAMAj3D,EAAAoV,GAAA+hD,QAAA/a,WAAA,WAEA,MADAp8C,GAAAoV,GAAA+hD,QAAA7oC,EACAjrB,OAGAtD,SAWA,SAAAC,GACA,YAKA,SAAAo3D,GAAAz9C,EAAA5Y,GACAsC,KAAA4tD,MAAAjxD,EAAAZ,SAAAyD,MACAQ,KAAAg0D,eAAAr3D,EAAAA,EAAA2Z,GAAAoiB,GAAA38B,SAAAyD,MAAA/B,OAAA6Y,GACAtW,KAAAtC,QAAAf,EAAAke,UAAAk5C,EAAA7J,SAAAxsD,GACAsC,KAAAyoB,UAAAzoB,KAAAtC,QAAAU,QAAA,IAAA,eACA4B,KAAAi0D,WACAj0D,KAAAo5B,WACAp5B,KAAAk0D,aAAA,KACAl0D,KAAA8tC,aAAA,EAEA9tC,KAAAg0D,eAAApiD,GAAA,sBAAAjV,EAAAiuB,MAAA5qB,KAAAm0D,QAAAn0D,OACAA,KAAAo0D,UACAp0D,KAAAm0D,UA4GA,QAAA7K,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,gBACAvC,EAAA,gBAAAonC,IAAAA,CAEA7kC,IAAAspD,EAAAtpD,KAAA,eAAAA,EAAA,GAAA8zD,GAAA/zD,KAAAtC,IACA,gBAAAonC,IAAA7kC,EAAA6kC,OAhHAivB,EAAArK,QAAA,QAEAqK,EAAA7J,UACA9S,OAAA,IAGA2c,EAAAjzC,UAAAuzC,gBAAA,WACA,MAAAr0D,MAAAg0D,eAAA,GAAAlmB,cAAAhtC,KAAA6I,IAAA3J,KAAA4tD,MAAA,GAAA9f,aAAA/xC,SAAAwD,gBAAAuuC,eAGAimB,EAAAjzC,UAAAszC,QAAA,WACA,GAAAxI,GAAA5rD,KACAs0D,EAAA,SACAC,EAAA,CAEAv0D,MAAAi0D,WACAj0D,KAAAo5B,WACAp5B,KAAA8tC,aAAA9tC,KAAAq0D,kBAEA13D,EAAAwb,SAAAnY,KAAAg0D,eAAA,MACAM,EAAA,WACAC,EAAAv0D,KAAAg0D,eAAA5xB,aAGApiC,KAAA4tD,MACA1tD,KAAAF,KAAAyoB,UACA1jB,IAAA,WACA,GAAAqkD,GAAAzsD,EAAAqD,MACA2U,EAAAy0C,EAAAnpD,KAAA,WAAAmpD,EAAA3oD,KAAA,QACA+zD,EAAA,MAAAjvD,KAAAoP,IAAAhY,EAAAgY,EAEA,OAAA6/C,IACAA,EAAAzyD,QACAyyD,EAAA97B,GAAA,eACA87B,EAAAF,KAAAhhC,IAAAihC,EAAA5/C,KAAA,OAEApT,KAAA,SAAAjC,EAAAkC,GAAA,MAAAlC,GAAA,GAAAkC,EAAA,KACA5B,KAAA,WACAgsD,EAAAqI,QAAA3tD,KAAAtG,KAAA,IACA4rD,EAAAxyB,QAAA9yB,KAAAtG,KAAA,OAIA+zD,EAAAjzC,UAAAqzC,QAAA,WACA,GAMAlsD,GANAm6B,EAAApiC,KAAAg0D,eAAA5xB,YAAApiC,KAAAtC,QAAA05C,OACAtJ,EAAA9tC,KAAAq0D,kBACAI,EAAAz0D,KAAAtC,QAAA05C,OAAAtJ,EAAA9tC,KAAAg0D,eAAAt0D,SACAu0D,EAAAj0D,KAAAi0D,QACA76B,EAAAp5B,KAAAo5B,QACA86B,EAAAl0D,KAAAk0D,YAOA,IAJAl0D,KAAA8tC,cAAAA,GACA9tC,KAAAo0D,UAGAhyB,GAAAqyB,EACA,MAAAP,KAAAjsD,EAAAmxB,EAAAA,EAAAr3B,OAAA,KAAA/B,KAAA00D,SAAAzsD,EAGA,IAAAisD,GAAA9xB,EAAA6xB,EAAA,GAEA,MADAj0D,MAAAk0D,aAAA,KACAl0D,KAAA20D,OAGA,KAAA1sD,EAAAgsD,EAAAlyD,OAAAkG,KACAisD,GAAA96B,EAAAnxB,IACAm6B,GAAA6xB,EAAAhsD,KACApI,SAAAo0D,EAAAhsD,EAAA,IAAAm6B,EAAA6xB,EAAAhsD,EAAA,KACAjI,KAAA00D,SAAAt7B,EAAAnxB,KAIA8rD,EAAAjzC,UAAA4zC,SAAA,SAAAt2D,GACA4B,KAAAk0D,aAAA91D,EAEA4B,KAAA20D,OAEA,IAAAlsC,GAAAzoB,KAAAyoB,SACA,iBAAArqB,EAAA,MACA4B,KAAAyoB,SAAA,UAAArqB,EAAA,KAEAyzC,EAAAl1C,EAAA8rB,GACA+Q,QAAA,MACAp5B,SAAA,SAEAyxC,GAAAzwC,OAAA,kBAAAW,SACA8vC,EAAAA,EACAxY,QAAA,eACAj5B,SAAA,WAGAyxC,EAAAhS,QAAA,0BAGAk0B,EAAAjzC,UAAA6zC,MAAA,WACAh4D,EAAAqD,KAAAyoB,UACAgR,aAAAz5B,KAAAtC,QAAAU,OAAA,WACA+B,YAAA,UAkBA,IAAA8qB,GAAAtuB,EAAAoV,GAAA6iD,SAEAj4D,GAAAoV,GAAA6iD,UAAAtL,EACA3sD,EAAAoV,GAAA6iD,UAAA7K,YAAAgK,EAMAp3D,EAAAoV,GAAA6iD,UAAA7b,WAAA,WAEA,MADAp8C,GAAAoV,GAAA6iD,UAAA3pC,EACAjrB,MAOArD,EAAAc,QAAAmU,GAAA,6BAAA,WACAjV,EAAA,uBAAAiD,KAAA,WACA,GAAAi1D,GAAAl4D,EAAAqD,KACAspD,GAAAlsD,KAAAy3D,EAAAA,EAAA50D,aAIAvD,SAWA,SAAAC,GACA,YA2GA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,SAEAA,IAAAspD,EAAAtpD,KAAA,SAAAA,EAAA,GAAA60D,GAAA90D,OACA,gBAAA8kC,IAAA7kC,EAAA6kC,OA5GA,GAAAgwB,GAAA,SAAAx+C,GAEAtW,KAAAsW,QAAA3Z,EAAA2Z,GAIAw+C,GAAApL,QAAA,QAEAoL,EAAAnL,oBAAA,IAEAmL,EAAAh0C,UAAAxB,KAAA,WACA,GAAAiqC,GAAAvpD,KAAAsW,QACAy+C,EAAAxL,EAAAlwB,QAAA,0BACA5Q,EAAA8gC,EAAAtpD,KAAA,SAOA,IALAwoB,IACAA,EAAA8gC,EAAA9oD,KAAA,QACAgoB,EAAAA,GAAAA,EAAAxlB,QAAA,iBAAA,MAGAsmD,EAAAnoD,OAAA,MAAAyuC,SAAA,UAAA,CAEA,GAAAmlB,GAAAD,EAAA70D,KAAA,kBACA+0D,EAAAt4D,EAAAujC,MAAA,eACAoC,cAAAinB,EAAA,KAEAqG,EAAAjzD,EAAAujC,MAAA,eACAoC,cAAA0yB,EAAA,IAMA,IAHAA,EAAAn1B,QAAAo1B,GACA1L,EAAA1pB,QAAA+vB,IAEAA,EAAApvB,uBAAAy0B,EAAAz0B,qBAAA,CAEA,GAAA4rB,GAAAzvD,EAAA8rB,EAEAzoB,MAAA00D,SAAAnL,EAAAlwB,QAAA,MAAA07B,GACA/0D,KAAA00D,SAAAtI,EAAAA,EAAAhrD,SAAA,WACA4zD,EAAAn1B,SACAj3B,KAAA,gBACA05B,cAAAinB,EAAA,KAEAA,EAAA1pB,SACAj3B,KAAA,eACA05B,cAAA0yB,EAAA,UAKAF,EAAAh0C,UAAA4zC,SAAA,SAAAp+C,EAAAkmB,EAAAlT,GAMA,QAAA0P,KACAiyB,EACA9qD,YAAA,UACAD,KAAA,8BACAC,YAAA,UACAygB,MACA1gB,KAAA,uBACAO,KAAA,iBAAA,GAEA6V,EACAlW,SAAA,UACAF,KAAA,uBACAO,KAAA,iBAAA,GAEAwoD,GACA3yC,EAAA,GAAAvO,YACAuO,EAAAlW,SAAA,OAEAkW,EAAAnW,YAAA,QAGAmW,EAAAlV,OAAA,kBAAAW,QACAuU,EACA+iB,QAAA,eACAj5B,SAAA,UACAwgB,MACA1gB,KAAA,uBACAO,KAAA,iBAAA,GAGA6oB,GAAAA,IAnCA,GAAA2hC,GAAAzuB,EAAAt8B,KAAA,aACA+oD,EAAA3/B,GACA3sB,EAAAwe,QAAA8tC,aACAgC,EAAAlpD,QAAAkpD,EAAApb,SAAA,WAAArT,EAAAt8B,KAAA,WAAA6B,OAmCAkpD,GAAAlpD,QAAAknD,EACAgC,EACAjnB,IAAA,kBAAAhL,GACAkwB,qBAAA4L,EAAAnL,qBACA3wB,IAEAiyB,EAAA9qD,YAAA,MAiBA,IAAA8qB,GAAAtuB,EAAAoV,GAAAmjD,GAEAv4D,GAAAoV,GAAAmjD,IAAA5L,EACA3sD,EAAAoV,GAAAmjD,IAAAnL,YAAA+K,EAMAn4D,EAAAoV,GAAAmjD,IAAAnc,WAAA,WAEA,MADAp8C,GAAAoV,GAAAmjD,IAAAjqC,EACAjrB,KAOA,IAAAmsD,GAAA,SAAA9sD,GACAA,EAAAkhC,iBACA+oB,EAAAlsD,KAAAT,EAAAqD,MAAA,QAGArD,GAAAZ,UACA6V,GAAA,wBAAA,sBAAAu6C,GACAv6C,GAAA,wBAAA,uBAAAu6C,IAEAzvD,SAWA,SAAAC,GACA,YA4GA,SAAA2sD,GAAAxkB,GACA,MAAA9kC,MAAAJ,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MACAC,EAAAspD,EAAAtpD,KAAA,YACAvC,EAAA,gBAAAonC,IAAAA,CAEA7kC,IAAAspD,EAAAtpD,KAAA,WAAAA,EAAA,GAAAk1D,GAAAn1D,KAAAtC,IACA,gBAAAonC,IAAA7kC,EAAA6kC,OA9GA,GAAAqwB,GAAA,SAAA7+C,EAAA5Y,GACAsC,KAAAtC,QAAAf,EAAAke,UAAAs6C,EAAAjL,SAAAxsD,GAEAsC,KAAAosD,QAAAzvD,EAAAqD,KAAAtC,QAAAU,QACAwT,GAAA,2BAAAjV,EAAAiuB,MAAA5qB,KAAAo1D,cAAAp1D,OACA4R,GAAA,0BAAAjV,EAAAiuB,MAAA5qB,KAAAq1D,2BAAAr1D,OAEAA,KAAAq/C,SAAA1iD,EAAA2Z,GACAtW,KAAAs1D,QAAA,KACAt1D,KAAAu1D,MAAA,KACAv1D,KAAAw1D,aAAA,KAEAx1D,KAAAo1D,gBAGAD,GAAAzL,QAAA,QAEAyL,EAAAM,MAAA,+BAEAN,EAAAjL,UACA9S,OAAA,EACAh5C,OAAAX,QAGA03D,EAAAr0C,UAAA40C,SAAA,SAAA5nB,EAAApuC,EAAAi2D,EAAAC,GACA,GAAAxzB,GAAApiC,KAAAosD,QAAAhqB,YACA7/B,EAAAvC,KAAAq/C,SAAAjI,SACAye,EAAA71D,KAAAosD,QAAA1sD,QAEA,IAAA,MAAAi2D,GAAA,OAAA31D,KAAAs1D,QAAA,MAAAlzB,GAAAuzB,GAAA,KAEA,IAAA,UAAA31D,KAAAs1D,QACA,MAAA,OAAAK,IAAAvzB,EAAApiC,KAAAu1D,OAAAhzD,EAAA+wB,MAAA,WACA8O,EAAAyzB,GAAA/nB,EAAA8nB,IAAA,QAGA,IAAAE,GAAA,MAAA91D,KAAAs1D,QACAS,EAAAD,EAAA1zB,EAAA7/B,EAAA+wB,IACA0iC,EAAAF,EAAAD,EAAAn2D,CAEA,OAAA,OAAAi2D,GAAAvzB,GAAAuzB,EAAA,MACA,MAAAC,GAAAG,EAAAC,GAAAloB,EAAA8nB,GAAA,UAKAT,EAAAr0C,UAAAm1C,gBAAA,WACA,GAAAj2D,KAAAw1D,aAAA,MAAAx1D,MAAAw1D,YACAx1D,MAAAq/C,SAAAl/C,YAAAg1D,EAAAM,OAAAr1D,SAAA,QACA,IAAAgiC,GAAApiC,KAAAosD,QAAAhqB,YACA7/B,EAAAvC,KAAAq/C,SAAAjI,QACA,OAAAp3C,MAAAw1D,aAAAjzD,EAAA+wB,IAAA8O,GAGA+yB,EAAAr0C,UAAAu0C,2BAAA,WACAtuD,WAAApK,EAAAiuB,MAAA5qB,KAAAo1D,cAAAp1D,MAAA,IAGAm1D,EAAAr0C,UAAAs0C,cAAA,WACA,GAAAp1D,KAAAq/C,SAAA3mB,GAAA,YAAA,CAEA,GAAAh5B,GAAAM,KAAAq/C,SAAA3/C,SACA03C,EAAAp3C,KAAAtC,QAAA05C,OACAue,EAAAve,EAAA9jB,IACAsiC,EAAAxe,EAAAua,OACA7jB,EAAAhtC,KAAA6I,IAAAhN,EAAAZ,UAAA2D,SAAA/C,EAAAZ,SAAAyD,MAAAE,SAEA,iBAAA03C,KAAAwe,EAAAD,EAAAve,GACA,kBAAAue,KAAAA,EAAAve,EAAA9jB,IAAAtzB,KAAAq/C,WACA,kBAAAuW,KAAAA,EAAAxe,EAAAua,OAAA3xD,KAAAq/C,UAEA,IAAA6W,GAAAl2D,KAAA01D,SAAA5nB,EAAApuC,EAAAi2D,EAAAC,EAEA,IAAA51D,KAAAs1D,SAAAY,EAAA,CACA,MAAAl2D,KAAAu1D,OAAAv1D,KAAAq/C,SAAAj9C,IAAA,MAAA,GAEA,IAAA+zD,GAAA,SAAAD,EAAA,IAAAA,EAAA,IACA72D,EAAA1C,EAAAujC,MAAAi2B,EAAA,YAIA,IAFAn2D,KAAAq/C,SAAAxf,QAAAxgC,GAEAA,EAAAmhC,qBAAA,MAEAxgC,MAAAs1D,QAAAY,EACAl2D,KAAAu1D,MAAA,UAAAW,EAAAl2D,KAAAi2D,kBAAA,KAEAj2D,KAAAq/C,SACAl/C,YAAAg1D,EAAAM,OACAr1D,SAAA+1D,GACAt2B,QAAAs2B,EAAAlzD,QAAA,QAAA,WAAA,aAGA,UAAAizD,GACAl2D,KAAAq/C,SAAAjI,QACA9jB,IAAAwa,EAAApuC,EAAAk2D,KAoBA,IAAA3qC,GAAAtuB,EAAAoV,GAAAmkD,KAEAv5D,GAAAoV,GAAAmkD,MAAA5M,EACA3sD,EAAAoV,GAAAmkD,MAAAnM,YAAAoL,EAMAx4D,EAAAoV,GAAAmkD,MAAAnd,WAAA,WAEA,MADAp8C,GAAAoV,GAAAmkD,MAAAjrC,EACAjrB,MAOArD,EAAAc,QAAAmU,GAAA,OAAA,WACAjV,EAAA,sBAAAiD,KAAA,WACA,GAAAi1D,GAAAl4D,EAAAqD,MACAC,EAAA40D,EAAA50D,MAEAA,GAAAm3C,OAAAn3C,EAAAm3C,WAEA,MAAAn3C,EAAA21D,eAAA31D,EAAAm3C,OAAAua,OAAA1xD,EAAA21D,cACA,MAAA31D,EAAA01D,YAAA11D,EAAAm3C,OAAA9jB,IAAArzB,EAAA01D,WAEArM,EAAAlsD,KAAAy3D,EAAA50D,QAIAvD,QC9zEA,SAAAyG,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,UAAAD,GAIAA,EAAAzG,SAEA,SAAAC,GAmEA,QAAAy5D,GAAA9/C,EAAA+/C,GACA,GAAAtxD,GAAAuxD,EAAA13D,EACA4G,EAAA8Q,EAAA9Q,SAAA9E,aACA,OAAA,SAAA8E,GACAT,EAAAuR,EAAAhR,WACAgxD,EAAAvxD,EAAA+S,QACAxB,EAAA3B,OAAA2hD,GAAA,QAAAvxD,EAAAS,SAAA9E,iBAGA9B,EAAAjC,EAAA,gBAAA25D,EAAA,MAAA,KACA13D,GAAAu2C,EAAAv2C,MAEA,0CAAA2G,KAAAC,IACA8Q,EAAA0gB,SACA,MAAAxxB,EACA8Q,EAAA3B,MAAA0hD,EACAA,IAEAlhB,EAAA7+B,GAGA,QAAA6+B,GAAA7+B,GACA,MAAA3Z,GAAA+3B,KAAAoD,QAAAqd,QAAA7+B,KACA3Z,EAAA2Z,GAAAkjB,UAAAD,UAAA5gB,OAAA,WACA,MAAA,WAAAhc,EAAAyF,IAAApC,KAAA,gBACA+B,OAzFApF,EAAA45D,GAAA55D,EAAA45D,OAEA55D,EAAAke,OAAAle,EAAA45D,IACA/tC,QAAA,SAEAmZ,SACA60B,UAAA,EACAC,MAAA,IACAC,OAAA,GACAC,KAAA,GACAC,IAAA,GACAC,MAAA,GACAC,OAAA,GACAC,KAAA,GACAC,KAAA,GACAC,UAAA,GACAC,QAAA,GACAC,OAAA,IACAC,MAAA,GACAC,MAAA,GACAC,IAAA,EACAC,GAAA,MAKA56D,EAAAoV,GAAA8I,QACA28C,aAAA,SAAAC,GACA,GAAAl1D,GAAAvC,KAAAoC,IAAA,YACAs1D,EAAA,aAAAn1D,EACAo1D,EAAAF,EAAA,uBAAA,gBACAD,EAAAx3D,KAAAw5B,UAAA7gB,OAAA,WACA,GAAAvX,GAAAzE,EAAAqD,KACA,SAAA03D,GAAA,WAAAt2D,EAAAgB,IAAA,cAGAu1D,EAAApyD,KAAAnE,EAAAgB,IAAA,YAAAhB,EAAAgB,IAAA,cAAAhB,EAAAgB,IAAA,iBACAonB,GAAA,EAEA,OAAA,UAAAjnB,GAAAi1D,EAAAz1D,OAAAy1D,EAAA76D,EAAAqD,KAAA,GAAA0c,eAAA3gB,WAGA67D,SAAA,WACA,GAAAC,GAAA,CAEA,OAAA,YACA,MAAA73D,MAAAJ,KAAA,WACAI,KAAAiF,KACAjF,KAAAiF,GAAA,YAAA4yD,SAMAC,eAAA,WACA,MAAA93D,MAAAJ,KAAA,WACA,cAAA2F,KAAAvF,KAAAiF,KACAtI,EAAAqD,MAAAmuC,WAAA,WAmCAxxC,EAAAke,OAAAle,EAAA+3B,KAAA,MACAz0B,KAAAtD,EAAA+3B,KAAAQ,aACAv4B,EAAA+3B,KAAAQ,aAAA,SAAA6iC,GACA,MAAA,UAAAt/C,GACA,QAAA9b,EAAAsD,KAAAwY,EAAAs/C,MAIA,SAAAt/C,EAAAxQ,EAAAnB,GACA,QAAAnK,EAAAsD,KAAAwY,EAAA3R,EAAA,KAGAsvD,UAAA,SAAA9/C,GACA,MAAA8/C,GAAA9/C,GAAA6rC,MAAAxlD,EAAA8D,KAAA6V,EAAA,eAGA0hD,SAAA,SAAA1hD,GACA,GAAAwgB,GAAAn6B,EAAA8D,KAAA6V,EAAA,YACA2hD,EAAA9V,MAAArrB,EACA,QAAAmhC,GAAAnhC,GAAA,IAAAs/B,EAAA9/C,GAAA2hD,MAKAt7D,EAAA,OAAAu7D,WAAA,GAAAlvC,QACArsB,EAAAiD,MAAA,QAAA,UAAA,SAAAqI,EAAA6P,GAUA,QAAAqgD,GAAA1/C,EAAAvI,EAAAs6B,EAAAhuC,GAUA,MATAG,GAAAiD,KAAAw4D,EAAA,WACAloD,GAAAjC,WAAAtR,EAAAyF,IAAAqW,EAAA,UAAAzY,QAAA,EACAwqC,IACAt6B,GAAAjC,WAAAtR,EAAAyF,IAAAqW,EAAA,SAAAzY,KAAA,WAAA,GAEAxD,IACA0T,GAAAjC,WAAAtR,EAAAyF,IAAAqW,EAAA,SAAAzY,QAAA,KAGAkQ,EAnBA,GAAAkoD,GAAA,UAAAtgD,GAAA,OAAA,UAAA,MAAA,UACAlP,EAAAkP,EAAApX,cACAyhB,GACAvY,WAAAjN,EAAAoV,GAAAnI,WACAG,YAAApN,EAAAoV,GAAAhI,YACAmuD,WAAAv7D,EAAAoV,GAAAmmD,WACAG,YAAA17D,EAAAoV,GAAAsmD,YAgBA17D,GAAAoV,GAAA,QAAA+F,GAAA,SAAA5H,GACA,MAAArQ,UAAAqQ,EACAiS,EAAA,QAAArK,GAAA1a,KAAA4C,MAGAA,KAAAJ,KAAA,WACAjD,EAAAqD,MAAAoC,IAAAwG,EAAAuvD,EAAAn4D,KAAAkQ,GAAA,SAIAvT,EAAAoV,GAAA,QAAA+F,GAAA,SAAA5H,EAAA1T,GACA,MAAA,gBAAA0T,GACAiS,EAAA,QAAArK,GAAA1a,KAAA4C,KAAAkQ,GAGAlQ,KAAAJ,KAAA,WACAjD,EAAAqD,MAAAoC,IAAAwG,EAAAuvD,EAAAn4D,KAAAkQ,GAAA,EAAA1T,GAAA,WAOAG,EAAAoV,GAAAwnB,UACA58B,EAAAoV,GAAAwnB,QAAA,SAAA9Q,GACA,MAAAzoB,MAAAyd,IAAA,MAAAgL,EACAzoB,KAAAqpB,WAAArpB,KAAAqpB,WAAA1Q,OAAA8P,MAMA9rB,EAAA,OAAAsD,KAAA,MAAA,KAAA48B,WAAA,OAAA58B,KAAA,SACAtD,EAAAoV,GAAA8qB,WAAA,SAAAA,GACA,MAAA,UAAAjjB,GACA,MAAArH,WAAAxQ,OACA86B,EAAAz/B,KAAA4C,KAAArD,EAAAme,UAAAlB,IAEAijB,EAAAz/B,KAAA4C,QAGArD,EAAAoV,GAAA8qB,aAIAlgC,EAAA45D,GAAA+B,KAAA,cAAAnrD,KAAAvG,UAAAC,UAAAnG,eAEA/D,EAAAoV,GAAA8I,QACA+b,MAAA,SAAAzU,GACA,MAAA,UAAA+qB,EAAAn7B,GACA,MAAA,gBAAAm7B,GACAltC,KAAAJ,KAAA,WACA,GAAA6Y,GAAAzY,IACA+G,YAAA,WACApK,EAAA8b,GAAAme,QACA7kB,GACAA,EAAA3U,KAAAqb,IAEAy0B,KAEA/qB,EAAArN,MAAA9U,KAAAuS,aAEA5V,EAAAoV,GAAA6kB,OAEA2hC,iBAAA,WACA,GAAAnb,GAAA,iBAAArhD,UAAAG,cAAA,OACA,cACA,WAEA,OAAA,YACA,MAAA8D,MAAAiwC,KAAAmN,EAAA,uBAAA,SAAA3jC,GACAA,EAAA8mB,uBAKAi4B,gBAAA,WACA,MAAAx4D,MAAAkwC,OAAA,yBAGA7F,OAAA,SAAAA,GACA,GAAAxqC,SAAAwqC,EACA,MAAArqC,MAAAoC,IAAA,SAAAioC,EAGA,IAAArqC,KAAA+B,OAEA,IADA,GAAAQ,GAAAqL,EAAA6K,EAAA9b,EAAAqD,KAAA,IACAyY,EAAA1W,QAAA0W,EAAA,KAAA1c,UAAA,CAKA,GADAwG,EAAAkW,EAAArW,IAAA,aACA,aAAAG,GAAA,aAAAA,GAAA,UAAAA,KAKAqL,EAAA3M,SAAAwX,EAAArW,IAAA,UAAA,KACA+/C,MAAAv0C,IAAA,IAAAA,GACA,MAAAA,EAGA6K,GAAAA,EAAArX,SAIA,MAAA,MAKAzE,EAAA45D,GAAAkC,QACAh7C,IAAA,SAAAja,EAAAshC,EAAA94B,GACA,GAAA/D,GACAywD,EAAA/7D,EAAA45D,GAAA/yD,GAAAsd,SACA,KAAA7Y,IAAA+D,GACA0sD,EAAAC,QAAA1wD,GAAAywD,EAAAC,QAAA1wD,OACAywD,EAAAC,QAAA1wD,GAAA3B,MAAAw+B,EAAA94B,EAAA/D,MAGA7K,KAAA,SAAAw7D,EAAA9gD,EAAAxF,EAAAumD,GACA,GAAA5wD,GACA+D,EAAA4sD,EAAAD,QAAA7gD,EAEA,IAAA9L,IAIA6sD,GAAAD,EAAAtiD,QAAA,GAAAhR,YAAA,KAAAszD,EAAAtiD,QAAA,GAAAhR,WAAA4N,UAIA,IAAAjL,EAAA,EAAAA,EAAA+D,EAAAjK,OAAAkG,IACA2wD,EAAAl7D,QAAAsO,EAAA/D,GAAA,KACA+D,EAAA/D,GAAA,GAAA6M,MAAA8jD,EAAAtiD,QAAAhE,OC/RA,SAAAnP,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QACA,SACA,UACAD,GAIAA,EAAAzG,SAEA,SAAAC,GAMA,QAAAm8D,GAAArgD,GAEA,IADA,GAAAlW,GAAAqL,EACA6K,EAAA1W,QAAA0W,EAAA,KAAA1c,UAAA,CAKA,GADAwG,EAAAkW,EAAArW,IAAA,aACA,aAAAG,GAAA,aAAAA,GAAA,UAAAA,KAKAqL,EAAA3M,SAAAwX,EAAArW,IAAA,UAAA,KACA+/C,MAAAv0C,IAAA,IAAAA,GACA,MAAAA,EAGA6K,GAAAA,EAAArX,SAGA,MAAA,GAOA,QAAA23D,KACA/4D,KAAAg5D,SAAA,KACAh5D,KAAAi5D,WAAA,EACAj5D,KAAAk5D,mBACAl5D,KAAAm5D,oBAAA,EACAn5D,KAAAo5D,WAAA,EACAp5D,KAAAq5D,WAAA,oBACAr5D,KAAAs5D,aAAA,uBACAt5D,KAAAu5D,aAAA,uBACAv5D,KAAAw5D,cAAA,wBACAx5D,KAAAy5D,aAAA,uBACAz5D,KAAA05D,cAAA,yBACA15D,KAAA25D,mBAAA,6BACA35D,KAAA45D,cAAA,4BACA55D,KAAA65D,cAAA,+BACA75D,KAAA85D,YACA95D,KAAA85D,SAAA,KACAC,UAAA,OACAC,SAAA,OACAC,SAAA,OACAC,YAAA,QACAC,YAAA,UAAA,WAAA,QAAA,QAAA,MAAA,OACA,OAAA,SAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,UAAA,SAAA,SAAA,UAAA,YAAA,WAAA,SAAA,YACAC,eAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,KACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IAEA76D,KAAA86D,WACAC,OAAA,QAEAC,SAAA,SACAC,eACAC,YAAA,KAEAC,WAAA,GACAC,WAAA,MACAC,YAAA,GACAC,iBAAA,EACAC,kBAAA,EAEAC,wBAAA,EACAC,aAAA,EACAC,aAAA,EACAC,YAAA,EACAC,UAAA,YAGAC,iBAAA,EACAC,mBAAA,EACAC,UAAA,EACAC,cAAAh8D,KAAAi8D,YAEAC,gBAAA,MAGAC,QAAA,KACAC,QAAA,KACAh4C,SAAA,OACAi4C,cAAA,KAGAC,WAAA,KAEAC,SAAA,KACAC,kBAAA,KACAC,QAAA,KACAC,eAAA,EACAC,iBAAA,EACAC,WAAA,EACAC,cAAA,GACAC,SAAA,GACAC,UAAA,GACAC,gBAAA,EACAC,iBAAA,EACAC,UAAA,EACAlmC,UAAA,GAEAr6B,EAAAke,OAAA7a,KAAA86D,UAAA96D,KAAA85D,SAAA,KACA95D,KAAA85D,SAAAqD,GAAAxgE,EAAAke,QAAA,KAAA7a,KAAA85D,SAAA,KACA95D,KAAA85D,SAAA,SAAAn9D,EAAAke,QAAA,KAAA7a,KAAA85D,SAAAqD,IACAn9D,KAAAo9D,MAAAC,EAAA1gE,EAAA,YAAAqD,KAAAq5D,WAAA,gGAg0DA,QAAAgE,GAAAD,GACA,GAAA30C,GAAA,gFACA,OAAA20C,GAAAjtB,SAAA1nB,EAAA,WAAA,WACA9rB,EAAAqD,MAAAG,YAAA,kBACAH,KAAA7D,UAAA4D,QAAA,4BACApD,EAAAqD,MAAAG,YAAA,4BAEAH,KAAA7D,UAAA4D,QAAA,4BACApD,EAAAqD,MAAAG,YAAA,8BAGAgwC,SAAA1nB,EAAA,YAAA60C,GAGA,QAAAA,KACA3gE,EAAA4gE,WAAAC,sBAAAC,EAAAC,OAAAD,EAAAL,MAAAh8D,SAAA,GAAAq8D,EAAA1wD,MAAA,MACApQ,EAAAqD,MAAAw5B,QAAA,2BAAAt5B,KAAA,KAAAC,YAAA,kBACAxD,EAAAqD,MAAAI,SAAA,kBACAJ,KAAA7D,UAAA4D,QAAA,4BACApD,EAAAqD,MAAAI,SAAA,4BAEAJ,KAAA7D,UAAA4D,QAAA,4BACApD,EAAAqD,MAAAI,SAAA,6BAMA,QAAAu9D,GAAAv/D,EAAAyjB,GACAllB,EAAAke,OAAAzc,EAAAyjB,EACA,KAAA,GAAA/J,KAAA+J,GACA,MAAAA,EAAA/J,KACA1Z,EAAA0Z,GAAA+J,EAAA/J,GAGA,OAAA1Z,GAz9DAzB,EAAAke,OAAAle,EAAA45D,IAAAgH,YAAA/0C,QAAA,WAEA,IAAAi1C,EAsgEA,OA/4DA9gE,GAAAke,OAAAk+C,EAAAj4C,WAEA88C,gBAAA,gBAGAC,QAAA,EAGAC,kBAAA,WACA,MAAA99D,MAAAo9D,OAOA7gB,YAAA,SAAA7J,GAEA,MADAirB,GAAA39D,KAAA86D,UAAApoB,OACA1yC,MAOA+9D,kBAAA,SAAA3/D,EAAAs0C,GACA,GAAAltC,GAAAk4D,EAAAM,CACAx4D,GAAApH,EAAAoH,SAAA9E,cACAg9D,EAAA,QAAAl4D,GAAA,SAAAA,EACApH,EAAA6G,KACAjF,KAAA63D,MAAA,EACAz5D,EAAA6G,GAAA,KAAAjF,KAAA63D,MAEAmG,EAAAh+D,KAAAi+D,SAAAthE,EAAAyB,GAAAs/D,GACAM,EAAAtrB,SAAA/1C,EAAAke,UAAA63B,OACA,UAAAltC,EACAxF,KAAAk+D,mBAAA9/D,EAAA4/D,GACAN,GACA19D,KAAAm+D,kBAAA//D,EAAA4/D,IAKAC,SAAA,SAAA7/D,EAAAs/D,GACA,GAAAz4D,GAAA7G,EAAA,GAAA6G,GAAAhC,QAAA,qBAAA,SACA,QAAAgC,GAAAA,EAAA8H,MAAA3O,EACAggE,YAAA,EAAAC,cAAA,EAAAC,aAAA,EACAC,UAAA,EAAAC,SAAA,EACAd,OAAAA,EACAN,MAAAM,EACAL,EAAA1gE,EAAA,eAAAqD,KAAAs5D,aAAA,wFADAt5D,KAAAo9D,QAKAc,mBAAA,SAAA9/D,EAAA4/D,GACA,GAAAjxD,GAAApQ,EAAAyB,EACA4/D,GAAAx7D,OAAA7F,MACAqhE,EAAAn+B,QAAAljC,MACAoQ,EAAA8iC,SAAA7vC,KAAA49D,mBAGA59D,KAAAy+D,aAAA1xD,EAAAixD,GACAjxD,EAAA3M,SAAAJ,KAAA49D,iBAAAxS,QAAAprD,KAAA0+D,YACAC,SAAA3+D,KAAA4+D,aAAAC,MAAA7+D,KAAA8+D,UACA9+D,KAAA++D,UAAAf,GACArhE,EAAAsD,KAAA7B,EAAA,aAAA4/D,GAEAA,EAAAtrB,SAAA1b,UACAh3B,KAAAg/D,mBAAA5gE,KAKAqgE,aAAA,SAAA1xD,EAAAixD,GACA,GAAAjD,GAAAK,EAAAC,EACAF,EAAAn7D,KAAAi/D,KAAAjB,EAAA,cACArD,EAAA36D,KAAAi/D,KAAAjB,EAAA,QAEAA,GAAAx7D,QACAw7D,EAAAx7D,OAAA/D,SAEA08D,IACA6C,EAAAx7D,OAAA7F,EAAA,gBAAAqD,KAAAu5D,aAAA,KAAA4B,EAAA,WACApuD,EAAA4tD,EAAA,SAAA,SAAAqD,EAAAx7D,SAGAuK,EAAAmjC,OAAA,QAAAlwC,KAAAk/D,iBAEAlB,EAAAn+B,SACAm+B,EAAAn+B,QAAAphC,SAGAs8D,EAAA/6D,KAAAi/D,KAAAjB,EAAA,UACA,UAAAjD,GAAA,SAAAA,GACAhuD,EAAA6pB,MAAA52B,KAAAk/D,iBAEA,WAAAnE,GAAA,SAAAA,IACAK,EAAAp7D,KAAAi/D,KAAAjB,EAAA,cACA3C,EAAAr7D,KAAAi/D,KAAAjB,EAAA,eACAA,EAAAn+B,QAAAljC,EAAAqD,KAAAi/D,KAAAjB,EAAA,mBACArhE,EAAA,UAAAyD,SAAAJ,KAAAw5D,eACA/4D,MAAA5B,IAAAw8D,EAAA8D,IAAA/D,EAAA9a,MAAA8a,IACAz+D,EAAA,mCAAAyD,SAAAJ,KAAAw5D,eACAx6D,KAAAq8D,EAAA1+D,EAAA,UAAA8D,MACA5B,IAAAw8D,EAAA8D,IAAA/D,EAAA9a,MAAA8a,IADAA,IAEAruD,EAAA4tD,EAAA,SAAA,SAAAqD,EAAAn+B,SACAm+B,EAAAn+B,QAAA5B,MAAA,WASA,MARAthC,GAAA4gE,WAAApE,oBAAAx8D,EAAA4gE,WAAA6B,aAAAryD,EAAA,GACApQ,EAAA4gE,WAAA8B,kBACA1iE,EAAA4gE,WAAApE,oBAAAx8D,EAAA4gE,WAAA6B,aAAAryD,EAAA,IACApQ,EAAA4gE,WAAA8B,kBACA1iE,EAAA4gE,WAAA2B,gBAAAnyD,EAAA,KAEApQ,EAAA4gE,WAAA2B,gBAAAnyD,EAAA,KAEA,MAMAgyD,UAAA,SAAAf,GACA,GAAAh+D,KAAAi/D,KAAAjB,EAAA,cAAAA,EAAAN,OAAA,CACA,GAAA4B,GAAA31D,EAAA41D,EAAAt3D,EACAw0C,EAAA,GAAA1oC,MAAA,KAAA,GAAA,IACA0mD,EAAAz6D,KAAAi/D,KAAAjB,EAAA,aAEAvD,GAAA3zD,MAAA,UACAw4D,EAAA,SAAAE,GAGA,IAFA71D,EAAA,EACA41D,EAAA,EACAt3D,EAAA,EAAAA,EAAAu3D,EAAAz9D,OAAAkG,IACAu3D,EAAAv3D,GAAAlG,OAAA4H,IACAA,EAAA61D,EAAAv3D,GAAAlG,OACAw9D,EAAAt3D,EAGA,OAAAs3D,IAEA9iB,EAAAgjB,SAAAH,EAAAt/D,KAAAi/D,KAAAjB,EAAAvD,EAAA3zD,MAAA,MACA,aAAA,qBACA21C,EAAAijB,QAAAJ,EAAAt/D,KAAAi/D,KAAAjB,EAAAvD,EAAA3zD,MAAA,MACA,WAAA,kBAAA,GAAA21C,EAAAkjB,WAEA3B,EAAAjxD,MAAAtM,KAAA,OAAAT,KAAA4/D,YAAA5B,EAAAvhB,GAAA16C;GAKAo8D,kBAAA,SAAA//D,EAAA4/D,GACA,GAAA6B,GAAAljE,EAAAyB,EACAyhE,GAAAhwB,SAAA7vC,KAAA49D,mBAGAiC,EAAAz/D,SAAAJ,KAAA49D,iBAAAp7D,OAAAw7D,EAAAZ,OACAzgE,EAAAsD,KAAA7B,EAAA,aAAA4/D,GACAh+D,KAAA8/D,SAAA9B,EAAAh+D,KAAA+/D,gBAAA/B,IAAA,GACAh+D,KAAAggE,kBAAAhC,GACAh+D,KAAAigE,iBAAAjC,GAEAA,EAAAtrB,SAAA1b,UACAh3B,KAAAg/D,mBAAA5gE,GAIA4/D,EAAAZ,MAAAh7D,IAAA,UAAA,WAaA89D,kBAAA,SAAAnzD,EAAA0vC,EAAA8f,EAAA7pB,EAAArlC,GACA,GAAApI,GAAAk7D,EAAAC,EAAAC,EAAAC,EACAtC,EAAAh+D,KAAAugE,WAqCA,OAnCAvC,KACAh+D,KAAA63D,MAAA,EACA5yD,EAAA,KAAAjF,KAAA63D,KACA73D,KAAAwgE,aAAA7jE,EAAA,0BAAAsI,EACA,4DACAjF,KAAAwgE,aAAApV,QAAAprD,KAAA0+D,YACA/hE,EAAA,QAAA6F,OAAAxC,KAAAwgE,cACAxC,EAAAh+D,KAAAugE,YAAAvgE,KAAAi+D,SAAAj+D,KAAAwgE,cAAA,GACAxC,EAAAtrB,YACA/1C,EAAAsD,KAAAD,KAAAwgE,aAAA,GAAA,aAAAxC,IAEAL,EAAAK,EAAAtrB,SAAAA,OACA+J,EAAAA,GAAAA,EAAAxzB,cAAAlV,KAAA/T,KAAA4/D,YAAA5B,EAAAvhB,GAAAA,EACAz8C,KAAAwgE,aAAA3/D,IAAA47C,GAEAz8C,KAAAygE,KAAApzD,EAAAA,EAAAtL,OAAAsL,GAAAA,EAAAy0B,MAAAz0B,EAAA60B,OAAA,KACAliC,KAAAygE,OACAN,EAAApkE,SAAAwD,gBAAAuK,YACAs2D,EAAArkE,SAAAwD,gBAAAyK,aACAq2D,EAAAtkE,SAAAwD,gBAAAyiC,YAAAjmC,SAAAyD,KAAAwiC,WACAs+B,EAAAvkE,SAAAwD,gBAAA6iC,WAAArmC,SAAAyD,KAAA4iC,UACApiC,KAAAygE,MACAN,EAAA,EAAA,IAAAE,EAAAD,EAAA,EAAA,IAAAE,IAIAtgE,KAAAwgE,aAAAp+D,IAAA,OAAApC,KAAAygE,KAAA,GAAA,GAAA,MAAAr+D,IAAA,MAAApC,KAAAygE,KAAA,GAAA,MACAzC,EAAAtrB,SAAA6pB,SAAAA,EACAv8D,KAAAo5D,WAAA,EACAp5D,KAAAo9D,MAAAh9D,SAAAJ,KAAAy5D,cACAz5D,KAAAk/D,gBAAAl/D,KAAAwgE,aAAA,IACA7jE,EAAA+jE,SACA/jE,EAAA+jE,QAAA1gE,KAAAo9D,OAEAzgE,EAAAsD,KAAAD,KAAAwgE,aAAA,GAAA,aAAAxC,GACAh+D,MAMA2gE,mBAAA,SAAAviE,GACA,GAAAoH,GACA4mD,EAAAzvD,EAAAyB,GACA4/D,EAAArhE,EAAAsD,KAAA7B,EAAA,aAEAguD,GAAAvc,SAAA7vC,KAAA49D,mBAIAp4D,EAAApH,EAAAoH,SAAA9E,cACA/D,EAAAkgC,WAAAz+B,EAAA,cACA,UAAAoH,GACAw4D,EAAAx7D,OAAA/D,SACAu/D,EAAAn+B,QAAAphC,SACA2tD,EAAAjsD,YAAAH,KAAA49D,iBACA1tB,OAAA,QAAAlwC,KAAAk/D,iBACAhvB,OAAA,UAAAlwC,KAAA0+D,YACAxuB,OAAA,WAAAlwC,KAAA4+D,aACA1uB,OAAA,QAAAlwC,KAAA8+D,WACA,QAAAt5D,GAAA,SAAAA,GACA4mD,EAAAjsD,YAAAH,KAAA49D,iBAAAl7D,QAGA+6D,IAAAO,IACAP,EAAA,QAOAmD,kBAAA,SAAAxiE,GACA,GAAAoH,GAAAk4D,EACAtR,EAAAzvD,EAAAyB,GACA4/D,EAAArhE,EAAAsD,KAAA7B,EAAA,aAEAguD,GAAAvc,SAAA7vC,KAAA49D,mBAIAp4D,EAAApH,EAAAoH,SAAA9E,cACA,UAAA8E,GACApH,EAAA44B,UAAA,EACAgnC,EAAAn+B,QAAAlnB,OAAA,UACA/Y,KAAA,WAAAI,KAAAg3B,UAAA,IAAApW,MACAjI,OAAA,OAAAvW,KAAAkf,QAAA,MAAAu/C,OAAA,MACA,QAAAr7D,GAAA,SAAAA,IACAk4D,EAAAtR,EAAArzB,SAAA,IAAA/4B,KAAAs5D,cACAoE,EAAA3kC,WAAA54B,YAAA,qBACAu9D,EAAAx9D,KAAA,yDACAygB,KAAA,YAAA,IAEA3gB,KAAAk5D,gBAAAv8D,EAAAoI,IAAA/E,KAAAk5D,gBACA,SAAAtrD,GAAA,MAAAA,KAAAxP,EAAA,KAAAwP,MAMAoxD,mBAAA,SAAA5gE,GACA,GAAAoH,GAAAk4D,EACAtR,EAAAzvD,EAAAyB,GACA4/D,EAAArhE,EAAAsD,KAAA7B,EAAA,aAEAguD,GAAAvc,SAAA7vC,KAAA49D,mBAIAp4D,EAAApH,EAAAoH,SAAA9E,cACA,UAAA8E,GACApH,EAAA44B,UAAA,EACAgnC,EAAAn+B,QAAAlnB,OAAA,UACA/Y,KAAA,WAAAI,KAAAg3B,UAAA,IAAApW,MACAjI,OAAA,OAAAvW,KAAAkf,QAAA,MAAAu/C,OAAA,aACA,QAAAr7D,GAAA,SAAAA,IACAk4D,EAAAtR,EAAArzB,SAAA,IAAA/4B,KAAAs5D,cACAoE,EAAA3kC,WAAA34B,SAAA,qBACAs9D,EAAAx9D,KAAA,yDACAygB,KAAA,YAAA,IAEA3gB,KAAAk5D,gBAAAv8D,EAAAoI,IAAA/E,KAAAk5D,gBACA,SAAAtrD,GAAA,MAAAA,KAAAxP,EAAA,KAAAwP,IACA5N,KAAAk5D,gBAAAl5D,KAAAk5D,gBAAAn3D,QAAA3D,IAOAo/D,sBAAA,SAAAp/D,GACA,IAAAA,EACA,OAAA,CAEA,KAAA,GAAA6J,GAAA,EAAAA,EAAAjI,KAAAk5D,gBAAAn3D,OAAAkG,IACA,GAAAjI,KAAAk5D,gBAAAjxD,KAAA7J,EACA,OAAA,CAGA,QAAA,GAQA0iE,SAAA,SAAA1iE,GACA,IACA,MAAAzB,GAAAsD,KAAA7B,EAAA,cAEA,MAAAqd,GACA,KAAA,8CAaAslD,kBAAA,SAAA3iE,EAAA0Z,EAAAlK,GACA,GAAA8kC,GAAA+J,EAAA0f,EAAAC,EACA4B,EAAAh+D,KAAA8gE,SAAA1iE,EAEA,OAAA,KAAAmU,UAAAxQ,QAAA,gBAAA+V,GACA,aAAAA,EAAAnb,EAAAke,UAAAle,EAAA4gE,WAAAzC,WACAkD,EAAA,QAAAlmD,EAAAnb,EAAAke,UAAAmjD,EAAAtrB,UACA1yC,KAAAi/D,KAAAjB,EAAAlmD,GAAA,MAGA46B,EAAA56B,MACA,gBAAAA,KACA46B,KACAA,EAAA56B,GAAAlK,QAGAowD,IACAh+D,KAAAg5D,WAAAgF,GACAh+D,KAAAq/D,kBAGA5iB,EAAAz8C,KAAAghE,mBAAA5iE,GAAA,GACA+9D,EAAAn8D,KAAAihE,eAAAjD,EAAA,OACA5B,EAAAp8D,KAAAihE,eAAAjD,EAAA,OACAL,EAAAK,EAAAtrB,SAAAA,GAEA,OAAAypB,GAAAt8D,SAAA6yC,EAAA+nB,YAAA56D,SAAA6yC,EAAAypB,UACA6B,EAAAtrB,SAAAypB,QAAAn8D,KAAA4/D,YAAA5B,EAAA7B,IAEA,OAAAC,GAAAv8D,SAAA6yC,EAAA+nB,YAAA56D,SAAA6yC,EAAA0pB,UACA4B,EAAAtrB,SAAA0pB,QAAAp8D,KAAA4/D,YAAA5B,EAAA5B,IAEA,YAAA1pB,KACAA,EAAA1b,SACAh3B,KAAAg/D,mBAAA5gE,GAEA4B,KAAA4gE,kBAAAxiE,IAGA4B,KAAAy+D,aAAA9hE,EAAAyB,GAAA4/D,GACAh+D,KAAA++D,UAAAf,GACAh+D,KAAA8/D,SAAA9B,EAAAvhB,GACAz8C,KAAAigE,iBAAAjC,GACAh+D,KAAAggE,kBAAAhC,OAKAkD,kBAAA,SAAA9iE,EAAA0Z,EAAAlK,GACA5N,KAAA+gE,kBAAA3iE,EAAA0Z,EAAAlK,IAMAuzD,mBAAA,SAAA/iE,GACA,GAAA4/D,GAAAh+D,KAAA8gE,SAAA1iE,EACA4/D,IACAh+D,KAAAggE,kBAAAhC,IAQAoD,mBAAA,SAAAhjE,EAAAq+C,GACA,GAAAuhB,GAAAh+D,KAAA8gE,SAAA1iE,EACA4/D,KACAh+D,KAAA8/D,SAAA9B,EAAAvhB,GACAz8C,KAAAggE,kBAAAhC,GACAh+D,KAAAigE,iBAAAjC,KASAgD,mBAAA,SAAA5iE,EAAAijE,GACA,GAAArD,GAAAh+D,KAAA8gE,SAAA1iE,EAIA,OAHA4/D,KAAAA,EAAAN,QACA19D,KAAAshE,kBAAAtD,EAAAqD,GAEArD,EAAAh+D,KAAAuhE,SAAAvD,GAAA,MAIAU,WAAA,SAAAjlD,GACA,GAAA8iD,GAAAiF,EAAAjuD,EACAyqD,EAAArhE,EAAA4gE,WAAAuD,SAAArnD,EAAArb,QACAqjE,GAAA,EACA9G,EAAAqD,EAAAZ,MAAA1kC,GAAA,qBAGA,IADAslC,EAAA/E,WAAA,EACAt8D,EAAA4gE,WAAApE,mBACA,OAAA1/C,EAAAkoB,SACA,IAAA,GAAAhlC,EAAA4gE,WAAA8B,kBACAoC,GAAA,CACA,MACA,KAAA,IAgBA,MAhBAluD,GAAA5W,EAAA,MAAAA,EAAA4gE,WAAA1D,cAAA,SACAl9D,EAAA4gE,WAAA3D,cAAA,IAAAoE,EAAAZ,OACA7pD,EAAA,IACA5W,EAAA4gE,WAAAmE,WAAAjoD,EAAArb,OAAA4/D,EAAAK,cAAAL,EAAAM,aAAA/qD,EAAA,IAGAgpD,EAAA5/D,EAAA4gE,WAAA0B,KAAAjB,EAAA,YACAzB,GACAiF,EAAA7kE,EAAA4gE,WAAAqC,YAAA5B,GAGAzB,EAAAznD,MAAAkpD,EAAAjxD,MAAAixD,EAAAjxD,MAAA,GAAA,MAAAy0D,EAAAxD,KAEArhE,EAAA4gE,WAAA8B,mBAGA,CACA,KAAA,IAAA1iE,EAAA4gE,WAAA8B,iBACA,MACA,KAAA,IAAA1iE,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAqb,EAAAmoD,SACAjlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,kBACArhE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cAAA,IACA,MACA,KAAA,IAAArhE,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAqb,EAAAmoD,SACAjlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,kBACArhE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cAAA,IACA,MACA,KAAA,KAAAvkD,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAsE,WAAApoD,EAAArb,QAEAqjE,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,OACA,MACA,KAAA,KAAA/nB,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAuE,WAAAroD,EAAArb,QAEAqjE,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,OACA,MACA,KAAA,KAAA/nB,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAu8D,EAAA,KAAA,KAEA8G,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,QAEA/nB,EAAAynB,cAAA6gC,QACAplE,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAqb,EAAAmoD,SACAjlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,kBACArhE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cAAA,IAGA,MACA,KAAA,KAAAvkD,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAoE,YAAAloD,EAAArb,UAAA,KAEAqjE,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,OACA,MACA,KAAA,KAAA/nB,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAu8D,KAAA,EAAA,KAEA8G,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,QAEA/nB,EAAAynB,cAAA6gC,QACAplE,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAAqb,EAAAmoD,SACAjlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,kBACArhE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cAAA,IAGA,MACA,KAAA,KAAAvkD,EAAAmoD,SAAAnoD,EAAA+nB,UACA7kC,EAAA4gE,WAAAoE,YAAAloD,EAAArb,OAAA,EAAA,KAEAqjE,EAAAhoD,EAAAmoD,SAAAnoD,EAAA+nB,OACA,MACA,SAAAigC,GAAA,MAEA,MAAAhoD,EAAAkoB,SAAAloB,EAAAmoD,QACAjlE,EAAA4gE,WAAA2B,gBAAAl/D,MAEAyhE,GAAA,CAGAA,KACAhoD,EAAA8mB,iBACA9mB,EAAAunB,oBAKA49B,YAAA,SAAAnlD,GACA,GAAAvM,GAAA80D,EACAhE,EAAArhE,EAAA4gE,WAAAuD,SAAArnD,EAAArb,OAEA,IAAAzB,EAAA4gE,WAAA0B,KAAAjB,EAAA,kBAGA,MAFA9wD,GAAAvQ,EAAA4gE,WAAA0E,eAAAtlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,eACAgE,EAAAhvC,OAAAC,aAAA,MAAAxZ,EAAAioB,SAAAjoB,EAAAkoB,QAAAloB,EAAAioB,UACAjoB,EAAAmoD,SAAAnoD,EAAA+nB,SAAAwgC,EAAA,MAAA90D,GAAAA,EAAAnN,QAAAiiE,OAKAlD,SAAA,SAAArlD,GACA,GAAAgjC,GACAuhB,EAAArhE,EAAA4gE,WAAAuD,SAAArnD,EAAArb,OAEA,IAAA4/D,EAAAjxD,MAAAlM,QAAAm9D,EAAAkE,QACA,IACAzlB,EAAA9/C,EAAA4gE,WAAA4E,UAAAxlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cACAA,EAAAjxD,MAAAixD,EAAAjxD,MAAAlM,MAAA,KACAlE,EAAA4gE,WAAA6E,iBAAApE,IAEAvhB,IACA9/C,EAAA4gE,WAAA+D,kBAAAtD,GACArhE,EAAA4gE,WAAA0C,iBAAAjC,GACArhE,EAAA4gE,WAAAyC,kBAAAhC,IAGA,MAAAviD,IAGA,OAAA,GAQAyjD,gBAAA,SAAAnyD,GAMA,GALAA,EAAAA,EAAA3O,QAAA2O,EACA,UAAAA,EAAAvH,SAAA9E,gBACAqM,EAAApQ,EAAA,QAAAoQ,EAAAzH,YAAA,KAGA3I,EAAA4gE,WAAAC,sBAAAzwD,IAAApQ,EAAA4gE,WAAA6B,aAAAryD,EAAA,CAIA,GAAAixD,GAAA1B,EAAA+F,EAAAC,EACAlrB,EAAA4jB,EAAA52C,CAEA45C,GAAArhE,EAAA4gE,WAAAuD,SAAA/zD,GACApQ,EAAA4gE,WAAAvE,UAAAr8D,EAAA4gE,WAAAvE,WAAAgF,IACArhE,EAAA4gE,WAAAvE,SAAAoE,MAAAv4C,MAAA,GAAA,GACAm5C,GAAArhE,EAAA4gE,WAAApE,oBACAx8D,EAAA4gE,WAAA8B,gBAAA1iE,EAAA4gE,WAAAvE,SAAAjsD,MAAA,KAIAuvD,EAAA3/D,EAAA4gE,WAAA0B,KAAAjB,EAAA,cACAqE,EAAA/F,EAAAA,EAAAxnD,MAAA/H,GAAAA,EAAAixD,OACAqE,KAAA,IAGA1E,EAAAK,EAAAtrB,SAAA2vB,GAEArE,EAAAkE,QAAA,KACAvlE,EAAA4gE,WAAA6B,WAAAryD,EACApQ,EAAA4gE,WAAA+D,kBAAAtD,GAEArhE,EAAA4gE,WAAAnE,YACArsD,EAAAa,MAAA,IAEAjR,EAAA4gE,WAAAkD,OACA9jE,EAAA4gE,WAAAkD,KAAA9jE,EAAA4gE,WAAAgF,SAAAx1D,GACApQ,EAAA4gE,WAAAkD,KAAA,IAAA1zD,EAAAqT,cAGAkiD,GAAA,EACA3lE,EAAAoQ,GAAAysB,UAAA55B,KAAA,WAEA,MADA0iE,IAAA,UAAA3lE,EAAAqD,MAAAoC,IAAA,aACAkgE,IAGAlrB,GAAApP,KAAArrC,EAAA4gE,WAAAkD,KAAA,GAAAntC,IAAA32B,EAAA4gE,WAAAkD,KAAA,IACA9jE,EAAA4gE,WAAAkD,KAAA,KAEAzC,EAAAZ,MAAA16D,QAEAs7D,EAAAZ,MAAAh7D,KAAAG,SAAA,WAAAD,QAAA,QAAAgxB,IAAA,YACA32B,EAAA4gE,WAAAyC,kBAAAhC,GAGA5mB,EAAAz6C,EAAA4gE,WAAAiF,aAAAxE,EAAA5mB,EAAAkrB,GACAtE,EAAAZ,MAAAh7D,KAAAG,SAAA5F,EAAA4gE,WAAAnE,WAAAz8D,EAAA+jE,QACA,SAAA4B,EAAA,QAAA,WAAAhgE,QAAA,OACA0lC,KAAAoP,EAAApP,KAAA,KAAA1U,IAAA8jB,EAAA9jB,IAAA,OAEA0qC,EAAAN,SACA1C,EAAAr+D,EAAA4gE,WAAA0B,KAAAjB,EAAA,YACA55C,EAAAznB,EAAA4gE,WAAA0B,KAAAjB,EAAA,YACAA,EAAAZ,MAAAh7D,IAAA,UAAA02D,EAAAn8D,EAAAoQ,IAAA,GACApQ,EAAA4gE,WAAApE,oBAAA,EAEAx8D,EAAA8lE,SAAA9lE,EAAA8lE,QAAAC,OAAA1H,GACAgD,EAAAZ,MAAA99C,KAAA07C,EAAAr+D,EAAA4gE,WAAA0B,KAAAjB,EAAA,eAAA55C,GAEA45C,EAAAZ,MAAApC,GAAA,QAAAA,EAAA52C,EAAA,MAGAznB,EAAA4gE,WAAAoF,kBAAA3E,IACAA,EAAAjxD,MAAA6pB,QAGAj6B,EAAA4gE,WAAAvE,SAAAgF,MAKAgC,kBAAA,SAAAhC,GACAh+D,KAAA69D,QAAA,EACAJ,EAAAO,EACAA,EAAAZ,MAAA16D,QAAAF,OAAAxC,KAAA4iE,cAAA5E,IACAh+D,KAAA6iE,gBAAA7E,EAEA,IAAA8E,GACAC,EAAA/iE,KAAAgjE,mBAAAhF,GACAiF,EAAAF,EAAA,GACAtjE,EAAA,GACAyjE,EAAAlF,EAAAZ,MAAAl9D,KAAA,IAAAF,KAAA65D,cAAA,KAEAqJ,GAAAnhE,OAAA,GACAu7D,EAAAxoD,MAAAouD,EAAAnkD,IAAA,IAGAi/C,EAAAZ,MAAAj9D,YAAA,qEAAAV,MAAA,IACAwjE,EAAA,GACAjF,EAAAZ,MAAAh9D,SAAA,uBAAA6iE,GAAA7gE,IAAA,QAAA3C,EAAAwjE,EAAA,MAEAjF,EAAAZ,OAAA,IAAA2F,EAAA,IAAA,IAAAA,EAAA,GAAA,MAAA,UACA,SAAA,uBACA/E,EAAAZ,OAAAp9D,KAAAi/D,KAAAjB,EAAA,SAAA,MAAA,UACA,SAAA,qBAEAA,IAAArhE,EAAA4gE,WAAAvE,UAAAr8D,EAAA4gE,WAAApE,oBAAAx8D,EAAA4gE,WAAAoF,kBAAA3E,IACAA,EAAAjxD,MAAA6pB,QAIAonC,EAAAmF,YACAL,EAAA9E,EAAAmF,UACAp8D,WAAA,WAEA+7D,IAAA9E,EAAAmF,WAAAnF,EAAAmF,WACAnF,EAAAZ,MAAAl9D,KAAA,mCAAA2mC,YAAAm3B,EAAAmF,WAEAL,EAAA9E,EAAAmF,UAAA,MACA,KAOAR,kBAAA,SAAA3E,GACA,MAAAA,GAAAjxD,OAAAixD,EAAAjxD,MAAA2rB,GAAA,cAAAslC,EAAAjxD,MAAA2rB,GAAA,eAAAslC,EAAAjxD,MAAA2rB,GAAA,WAIA8pC,aAAA,SAAAxE,EAAA5mB,EAAAkrB,GACA,GAAAc,GAAApF,EAAAZ,MAAAlF,aACAmL,EAAArF,EAAAZ,MAAA/E,cACAiL,EAAAtF,EAAAjxD,MAAAixD,EAAAjxD,MAAAmrD,aAAA,EACAqL,EAAAvF,EAAAjxD,MAAAixD,EAAAjxD,MAAAsrD,cAAA,EACAmL,EAAAznE,SAAAwD,gBAAAuK,aAAAw4D,EAAA,EAAA3lE,EAAAZ,UAAAimC,cACAyhC,EAAA1nE,SAAAwD,gBAAAyK,cAAAs4D,EAAA,EAAA3lE,EAAAZ,UAAAqmC,YAYA,OAVAgV,GAAApP,MAAAhoC,KAAAi/D,KAAAjB,EAAA,SAAAoF,EAAAE,EAAA,EACAlsB,EAAApP,MAAAs6B,GAAAlrB,EAAApP,OAAAg2B,EAAAjxD,MAAAqqC,SAAApP,KAAArrC,EAAAZ,UAAAimC,aAAA,EACAoV,EAAA9jB,KAAAgvC,GAAAlrB,EAAA9jB,MAAA0qC,EAAAjxD,MAAAqqC,SAAA9jB,IAAAiwC,EAAA5mE,EAAAZ,UAAAqmC,YAAA,EAGAgV,EAAApP,MAAAlnC,KAAAo8C,IAAA9F,EAAApP,KAAAoP,EAAApP,KAAAo7B,EAAAI,GAAAA,EAAAJ,EACAtiE,KAAAC,IAAAq2C,EAAApP,KAAAo7B,EAAAI,GAAA,GACApsB,EAAA9jB,KAAAxyB,KAAAo8C,IAAA9F,EAAA9jB,IAAA8jB,EAAA9jB,IAAA+vC,EAAAI,GAAAA,EAAAJ,EACAviE,KAAAC,IAAAsiE,EAAAE,GAAA,GAEAnsB,GAIAmrB,SAAA,SAAA1wD,GAKA,IAJA,GAAAtP,GACAy7D,EAAAh+D,KAAA8gE,SAAAjvD,GACA8oD,EAAA36D,KAAAi/D,KAAAjB,EAAA,SAEAnsD,IAAA,WAAAA,EAAAjJ,MAAA,IAAAiJ,EAAAqB,UAAAvW,EAAA+3B,KAAAoD,QAAAvY,OAAA1N,KACAA,EAAAA,EAAA8oD,EAAA,kBAAA,cAIA,OADAp4D,GAAA5F,EAAAkV,GAAAulC,UACA70C,EAAAylC,KAAAzlC,EAAA+wB,MAMA+rC,gBAAA,SAAAtyD,GACA,GAAAiuD,GAAA52C,EAAAs/C,EAAAjH,EACAuB,EAAAh+D,KAAAg5D,UAEAgF,GAAAjxD,GAAAixD,IAAArhE,EAAAsD,KAAA8M,EAAA,eAIA/M,KAAAm5D,qBACA6B,EAAAh7D,KAAAi/D,KAAAjB,EAAA,YACA55C,EAAApkB,KAAAi/D,KAAAjB,EAAA,YACA0F,EAAA,WACA/mE,EAAA4gE,WAAAoG,YAAA3F,IAIArhE,EAAA8lE,UAAA9lE,EAAA8lE,QAAAC,OAAA1H,IAAAr+D,EAAA8lE,QAAAzH,IACAgD,EAAAZ,MAAAl6C,KAAA83C,EAAAr+D,EAAA4gE,WAAA0B,KAAAjB,EAAA,eAAA55C,EAAAs/C,GAEA1F,EAAAZ,MAAA,cAAApC,EAAA,UACA,WAAAA,EAAA,UAAA,QAAAA,EAAA52C,EAAA,KAAAs/C,GAGA1I,GACA0I,IAEA1jE,KAAAm5D,oBAAA,EAEAsD,EAAAz8D,KAAAi/D,KAAAjB,EAAA,WACAvB,GACAA,EAAA3nD,MAAAkpD,EAAAjxD,MAAAixD,EAAAjxD,MAAA,GAAA,MAAAixD,EAAAjxD,MAAAixD,EAAAjxD,MAAAlM,MAAA,GAAAm9D,IAGAh+D,KAAAo/D,WAAA,KACAp/D,KAAAo5D,YACAp5D,KAAAwgE,aAAAp+D,KAAAG,SAAA,WAAAylC,KAAA,IAAA1U,IAAA,WACA32B,EAAA+jE,UACA/jE,EAAAinE,YACAjnE,EAAA,QAAA6F,OAAAxC,KAAAo9D,SAGAp9D,KAAAo5D,WAAA,IAKAuK,YAAA,SAAA3F,GACAA,EAAAZ,MAAAj9D,YAAAH,KAAAy5D,cAAAvpB,OAAA,4BAIA2zB,oBAAA,SAAApqD,GACA,GAAA9c,EAAA4gE,WAAAvE,SAAA,CAIA,GAAA5M,GAAAzvD,EAAA8c,EAAArb,QACA4/D,EAAArhE,EAAA4gE,WAAAuD,SAAA1U,EAAA,KAEAA,EAAA,GAAAnnD,KAAAtI,EAAA4gE,WAAAlE,YACA,IAAAjN,EAAA5yB,QAAA,IAAA78B,EAAA4gE,WAAAlE,YAAAt3D,QACAqqD,EAAAvc,SAAAlzC,EAAA4gE,WAAAK,kBACAxR,EAAA/yB,QAAA,IAAA18B,EAAA4gE,WAAA/D,eAAAz3D,SACApF,EAAA4gE,WAAApE,oBAAAx8D,EAAA4gE,WAAAnE,WAAAz8D,EAAA+jE,YACAtU,EAAAvc,SAAAlzC,EAAA4gE,WAAAK,kBAAAjhE,EAAA4gE,WAAAvE,WAAAgF,IACArhE,EAAA4gE,WAAA8B,oBAKAsC,YAAA,SAAA18D,EAAAmyC,EAAA0sB,GACA,GAAA1lE,GAAAzB,EAAAsI,GACA+4D,EAAAh+D,KAAA8gE,SAAA1iE,EAAA,GAEA4B,MAAAw9D,sBAAAp/D,EAAA,MAGA4B,KAAA+jE,gBAAA/F,EAAA5mB,GACA,MAAA0sB,EAAA9jE,KAAAi/D,KAAAjB,EAAA,oBAAA,GACA8F,GACA9jE,KAAAggE,kBAAAhC,KAIA8D,WAAA,SAAA78D,GACA,GAAAw3C,GACAr+C,EAAAzB,EAAAsI,GACA+4D,EAAAh+D,KAAA8gE,SAAA1iE,EAAA,GAEA4B,MAAAi/D,KAAAjB,EAAA,gBAAAA,EAAAgG,YACAhG,EAAAI,YAAAJ,EAAAgG,WACAhG,EAAAO,UAAAP,EAAAK,cAAAL,EAAAiG,aACAjG,EAAAQ,SAAAR,EAAAM,aAAAN,EAAAkG,cAEAznB,EAAA,GAAA1oC,MACAiqD,EAAAI,YAAA3hB,EAAA0nB,UACAnG,EAAAO,UAAAP,EAAAK,cAAA5hB,EAAA2nB,WACApG,EAAAQ,SAAAR,EAAAM,aAAA7hB,EAAA4nB,eAEArkE,KAAAskE,cAAAtG,GACAh+D,KAAA2hE,YAAAvjE,IAIAmmE,iBAAA,SAAAt/D,EAAAgnB,EAAA63C,GACA,GAAA1lE,GAAAzB,EAAAsI,GACA+4D,EAAAh+D,KAAA8gE,SAAA1iE,EAAA,GAEA4/D,GAAA,YAAA,MAAA8F,EAAA,QAAA,SACA9F,EAAA,QAAA,MAAA8F,EAAA,QAAA,SACA7iE,SAAAgrB,EAAAvuB,QAAAuuB,EAAAgL,eAAArpB,MAAA,IAEA5N,KAAAskE,cAAAtG,GACAh+D,KAAA2hE,YAAAvjE,IAIAsjE,WAAA,SAAAz8D,EAAAu/D,EAAAC,EAAAp/B,GACA,GAAA24B,GACA5/D,EAAAzB,EAAAsI,EAEAtI,GAAA0oC,GAAAwK,SAAA7vC,KAAA25D,qBAAA35D,KAAAw9D,sBAAAp/D,EAAA,MAIA4/D,EAAAh+D,KAAA8gE,SAAA1iE,EAAA,IACA4/D,EAAAI,YAAAJ,EAAAgG,WAAArnE,EAAA,IAAA0oC,GAAArmC,OACAg/D,EAAAK,cAAAL,EAAAiG,aAAAO,EACAxG,EAAAM,aAAAN,EAAAkG,YAAAO,EACAzkE,KAAA0kE,YAAAz/D,EAAAjF,KAAA4/D,YAAA5B,EACAA,EAAAgG,WAAAhG,EAAAiG,aAAAjG,EAAAkG,gBAIArC,WAAA,SAAA58D,GACA,GAAA7G,GAAAzB,EAAAsI,EACAjF,MAAA0kE,YAAAtmE,EAAA,KAIAsmE,YAAA,SAAAz/D,EAAAu8D,GACA,GAAAjF,GACAn+D,EAAAzB,EAAAsI,GACA+4D,EAAAh+D,KAAA8gE,SAAA1iE,EAAA,GAEAojE,GAAA,MAAAA,EAAAA,EAAAxhE,KAAA4/D,YAAA5B,GACAA,EAAAjxD,OACAixD,EAAAjxD,MAAAlM,IAAA2gE,GAEAxhE,KAAAigE,iBAAAjC,GAEAzB,EAAAv8D,KAAAi/D,KAAAjB,EAAA,YACAzB,EACAA,EAAAznD,MAAAkpD,EAAAjxD,MAAAixD,EAAAjxD,MAAA,GAAA,MAAAy0D,EAAAxD,IACAA,EAAAjxD,OACAixD,EAAAjxD,MAAA8yB,QAAA,UAGAm+B,EAAAN,OACA19D,KAAAggE,kBAAAhC,IAEAh+D,KAAAq/D,kBACAr/D,KAAAo/D,WAAApB,EAAAjxD,MAAA,GACA,gBAAAixD,GAAAjxD,MAAA,IACAixD,EAAAjxD,MAAA6pB,QAEA52B,KAAAo/D,WAAA,OAKAa,iBAAA,SAAAjC,GACA,GAAAjB,GAAAtgB,EAAA+kB,EACA1E,EAAA98D,KAAAi/D,KAAAjB,EAAA,WAEAlB,KACAC,EAAA/8D,KAAAi/D,KAAAjB,EAAA,cAAAh+D,KAAAi/D,KAAAjB,EAAA,cACAvhB,EAAAz8C,KAAAuhE,SAAAvD,GACAwD,EAAAxhE,KAAA2kE,WAAA5H,EAAAtgB,EAAAz8C,KAAAoiE,iBAAApE,IACArhE,EAAAmgE,GAAAl9D,KAAA,WAAAjD,EAAAqD,MAAAa,IAAA2gE,OAQAoD,WAAA,SAAAnoB,GACA,GAAAooB,GAAApoB,EAAAkjB,QACA,QAAAkF,EAAA,GAAAA,EAAA,EAAA,KAOA5I,YAAA,SAAAxf,GACA,GAAAtP,GACA23B,EAAA,GAAA/wD,MAAA0oC,EAAAzoC,UAQA,OALA8wD,GAAApF,QAAAoF,EAAAX,UAAA,GAAAW,EAAAnF,UAAA,IAEAxyB,EAAA23B,EAAA9wD,UACA8wD,EAAArF,SAAA,GACAqF,EAAApF,QAAA,GACA5+D,KAAAikE,MAAAjkE,KAAAI,OAAAisC,EAAA23B,GAAA,OAAA,GAAA,GAgBA3C,UAAA,SAAArnB,EAAAltC,EAAA8kC,GACA,GAAA,MAAAoI,GAAA,MAAAltC,EACA,KAAA,mBAIA,IADAA,EAAA,gBAAAA,GAAAA,EAAAya,WAAAza,EAAA,GACA,KAAAA,EACA,MAAA,KAGA,IAAAo3D,GAAAC,EAAAnlD,EAcA28B,EAbAyoB,EAAA,EACAC,GAAAzyB,EAAAA,EAAAwpB,gBAAA,OAAAl8D,KAAA86D,UAAAoB,gBACAA,EAAA,gBAAAiJ,GAAAA,GACA,GAAApxD,OAAAswD,cAAA,IAAApjE,SAAAkkE,EAAA,IACA7K,GAAA5nB,EAAAA,EAAA4nB,cAAA,OAAAt6D,KAAA86D,UAAAR,cACAD,GAAA3nB,EAAAA,EAAA2nB,SAAA,OAAAr6D,KAAA86D,UAAAT,SACAD,GAAA1nB,EAAAA,EAAA0nB,gBAAA,OAAAp6D,KAAA86D,UAAAV,gBACAD,GAAAznB,EAAAA,EAAAynB,WAAA,OAAAn6D,KAAA86D,UAAAX,WACAsK,KACAD,KACAK,KACAO,KACAC,GAAA,EAGAC,EAAA,SAAAx+D,GACA,GAAA8N,GAAAowD,EAAA,EAAAlqB,EAAA/4C,QAAA+4C,EAAArsC,OAAAu2D,EAAA,KAAAl+D,CAIA,OAHA8N,IACAowD,IAEApwD,GAGA2wD,EAAA,SAAAz+D,GACA,GAAA0+D,GAAAF,EAAAx+D,GACAoJ,EAAA,MAAApJ,EAAA,GAAA,MAAAA,EAAA,GACA,MAAAA,GAAA0+D,EAAA,EAAA,MAAA1+D,EAAA,EAAA,EACA2+D,EAAA,MAAA3+D,EAAAoJ,EAAA,EACA0sC,EAAA,GAAAz1C,QAAA,QAAAs+D,EAAA,IAAAv1D,EAAA,KACAiZ,EAAAvb,EAAAR,UAAA83D,GAAAp+D,MAAA81C,EACA,KAAAzzB,EACA,KAAA,8BAAA+7C,CAGA,OADAA,IAAA/7C,EAAA,GAAApnB,OACAd,SAAAkoB,EAAA,GAAA,KAGAu8C,EAAA,SAAA5+D,EAAA6+D,EAAAC,GACA,GAAArlE,MACAi/D,EAAA7iE,EAAAoI,IAAAugE,EAAAx+D,GAAA8+D,EAAAD,EAAA,SAAA/9C,EAAAi+C,GACA,QAAAA,EAAAj+C,MACArmB,KAAA,SAAAjC,EAAAkC,GACA,QAAAlC,EAAA,GAAAyC,OAAAP,EAAA,GAAAO,SAWA,IARApF,EAAAiD,KAAA4/D,EAAA,SAAAv3D,EAAA69D,GACA,GAAAhuD,GAAAguD,EAAA,EACA,IAAAl4D,EAAAqG,OAAAixD,EAAAptD,EAAA/V,QAAArB,gBAAAoX,EAAApX,cAGA,MAFAH,GAAAulE,EAAA,GACAZ,GAAAptD,EAAA/V,QACA,IAGAxB,OACA,MAAAA,GAAA,CAEA,MAAA,4BAAA2kE,GAIAa,EAAA,WACA,GAAAn4D,EAAAa,OAAAy2D,KAAApqB,EAAArsC,OAAAu2D,GACA,KAAA,kCAAAE,CAEAA,KAGA,KAAAF,EAAA,EAAAA,EAAAlqB,EAAA/4C,OAAAijE,IACA,GAAAK,EACA,MAAAvqB,EAAArsC,OAAAu2D,IAAAM,EAAA,KAGAS,IAFAV,GAAA,MAKA,QAAAvqB,EAAArsC,OAAAu2D,IACA,IAAA,IACAH,EAAAU,EAAA,IACA,MACA,KAAA,IACAG,EAAA,IAAApL,EAAAD,EACA,MACA,KAAA,IACA+K,EAAAG,EAAA,IACA,MACA,KAAA,IACAf,EAAAe,EAAA,IACA,MACA,KAAA,IACAf,EAAAkB,EAAA,IAAAtL,EAAAD,EACA,MACA,KAAA,IACAsK,EAAAc,EAAA,IACA,MACA,KAAA,IACA9oB,EAAA,GAAA1oC,MAAAwxD,EAAA,MACAd,EAAAhoB,EAAA4nB,cACAG,EAAA/nB,EAAA2nB,WAAA,EACAS,EAAApoB,EAAA0nB,SACA,MACA,KAAA,IACA1nB,EAAA,GAAA1oC,OAAAwxD,EAAA,KAAAvlE,KAAAgmE,cAAA,KACAvB,EAAAhoB,EAAA4nB,cACAG,EAAA/nB,EAAA2nB,WAAA,EACAS,EAAApoB,EAAA0nB,SACA,MACA,KAAA,IACAmB,EAAA,KACAS,IAEAV,GAAA,CAEA,MACA,SACAU,IAKA,GAAAb,EAAAt3D,EAAA7L,SACA+d,EAAAlS,EAAAqG,OAAAixD,IACA,OAAA3/D,KAAAua,IACA,KAAA,4CAAAA,CAWA,IAPA2kD,OACAA,GAAA,GAAA1wD,OAAAswD,cACAI,EAAA,MACAA,IAAA,GAAA1wD,OAAAswD,eAAA,GAAAtwD,OAAAswD,cAAA,KACAI,GAAAvI,EAAA,SAGAkJ,KAGA,IAFAZ,EAAA,EACAK,EAAAO,IACA,CAEA,GADAH,EAAAjlE,KAAAimE,gBAAAxB,EAAAD,EAAA,GACAK,GAAAI,EACA,KAEAT,KACAK,GAAAI,EAKA,GADAxoB,EAAAz8C,KAAAkmE,sBAAA,GAAAnyD,MAAA0wD,EAAAD,EAAA,EAAAK,IACApoB,EAAA4nB,gBAAAI,GAAAhoB,EAAA2nB,WAAA,IAAAI,GAAA/nB,EAAA0nB,YAAAU,EACA,KAAA,cAEA,OAAApoB,IAIA0pB,KAAA,WACAC,OAAA,aACAC,SAAA,WACAC,QAAA,WACAC,QAAA,aACAC,SAAA,WACAC,SAAA,YACAC,SAAA,YACAC,IAAA,WACAC,MAAA,IACAC,UAAA,IACAC,IAAA,WAEAd,aACA,IADA,OAAAllE,KAAAikE,MAAA,OAAAjkE,KAAAikE,MAAA,MACAjkE,KAAAikE,MAAA,QAAA,GAAA,GAAA,IA8BAJ,WAAA,SAAA7pB,EAAA2B,EAAA/J,GACA,IAAA+J,EACA,MAAA,EAGA,IAAAuoB,GACA1K,GAAA5nB,EAAAA,EAAA4nB,cAAA,OAAAt6D,KAAA86D,UAAAR,cACAD,GAAA3nB,EAAAA,EAAA2nB,SAAA,OAAAr6D,KAAA86D,UAAAT,SACAD,GAAA1nB,EAAAA,EAAA0nB,gBAAA,OAAAp6D,KAAA86D,UAAAV,gBACAD,GAAAznB,EAAAA,EAAAynB,WAAA,OAAAn6D,KAAA86D,UAAAX,WAEAmL,EAAA,SAAAx+D,GACA,GAAA8N,GAAAowD,EAAA,EAAAlqB,EAAA/4C,QAAA+4C,EAAArsC,OAAAu2D,EAAA,KAAAl+D,CAIA,OAHA8N,IACAowD,IAEApwD,GAGAmyD,EAAA,SAAAjgE,EAAA8G,EAAAjB,GACA,GAAAwc,GAAA,GAAAvb,CACA,IAAA03D,EAAAx+D,GACA,KAAAqiB,EAAApnB,OAAA4K,GACAwc,EAAA,IAAAA,CAGA,OAAAA,IAGA69C,EAAA,SAAAlgE,EAAA8G,EAAA+3D,EAAAC,GACA,MAAAN,GAAAx+D,GAAA8+D,EAAAh4D,GAAA+3D,EAAA/3D,IAEAq5D,EAAA,GACA5B,GAAA,CAEA,IAAA5oB,EACA,IAAAuoB,EAAA,EAAAA,EAAAlqB,EAAA/4C,OAAAijE,IACA,GAAAK,EACA,MAAAvqB,EAAArsC,OAAAu2D,IAAAM,EAAA,KAGA2B,GAAAnsB,EAAArsC,OAAAu2D,GAFAK,GAAA,MAKA,QAAAvqB,EAAArsC,OAAAu2D,IACA,IAAA,IACAiC,GAAAF,EAAA,IAAAtqB,EAAA0nB,UAAA,EACA,MACA,KAAA,IACA8C,GAAAD,EAAA,IAAAvqB,EAAAkjB,SAAArF,EAAAD,EACA,MACA,KAAA,IACA4M,GAAAF,EAAA,IACAjmE,KAAAI,OAAA,GAAA6S,MAAA0oC,EAAA4nB,cAAA5nB,EAAA2nB,WAAA3nB,EAAA0nB,WAAAnwD,UAAA,GAAAD,MAAA0oC,EAAA4nB,cAAA,EAAA,GAAArwD,WAAA,OAAA,EACA,MACA,KAAA,IACAizD,GAAAF,EAAA,IAAAtqB,EAAA2nB,WAAA,EAAA,EACA,MACA,KAAA,IACA6C,GAAAD,EAAA,IAAAvqB,EAAA2nB,WAAAhK,EAAAD,EACA,MACA,KAAA,IACA8M,GAAA3B,EAAA,KAAA7oB,EAAA4nB,eACA5nB,EAAAyqB,UAAA,IAAA,GAAA,IAAA,IAAAzqB,EAAAyqB,UAAA,GACA,MACA,KAAA,IACAD,GAAAxqB,EAAAzoC,SACA,MACA,KAAA,IACAizD,GAAA,IAAAxqB,EAAAzoC,UAAAhU,KAAAgmE,YACA,MACA,KAAA,IACAV,EAAA,KACA2B,GAAA,IAEA5B,GAAA,CAEA,MACA,SACA4B,GAAAnsB,EAAArsC,OAAAu2D,GAKA,MAAAiC,IAIAhF,eAAA,SAAAnnB,GACA,GAAAkqB,GACA93D,EAAA,GACAm4D,GAAA,EAEAC,EAAA,SAAAx+D,GACA,GAAA8N,GAAAowD,EAAA,EAAAlqB,EAAA/4C,QAAA+4C,EAAArsC,OAAAu2D,EAAA,KAAAl+D,CAIA,OAHA8N,IACAowD,IAEApwD,EAGA,KAAAowD,EAAA,EAAAA,EAAAlqB,EAAA/4C,OAAAijE,IACA,GAAAK,EACA,MAAAvqB,EAAArsC,OAAAu2D,IAAAM,EAAA,KAGAp4D,GAAA4tC,EAAArsC,OAAAu2D,GAFAK,GAAA,MAKA,QAAAvqB,EAAArsC,OAAAu2D,IACA,IAAA,IAAA,IAAA,IAAA,IAAA,IAAA,IAAA,IACA93D,GAAA,YACA,MACA,KAAA,IAAA,IAAA,IACA,MAAA,KACA,KAAA,IACAo4D,EAAA,KACAp4D,GAAA,IAEAm4D,GAAA,CAEA,MACA,SACAn4D,GAAA4tC,EAAArsC,OAAAu2D,GAIA,MAAA93D,IAIA+xD,KAAA,SAAAjB,EAAAlmD,GACA,MAAAjY,UAAAm+D,EAAAtrB,SAAA56B,GACAkmD,EAAAtrB,SAAA56B,GAAA9X,KAAA86D,UAAAhjD,IAIAwpD,kBAAA,SAAAtD,EAAAqD,GACA,GAAArD,EAAAjxD,MAAAlM,QAAAm9D,EAAAkE,QAAA,CAIA,GAAAzH,GAAAz6D,KAAAi/D,KAAAjB,EAAA,cACAmJ,EAAAnJ,EAAAkE,QAAAlE,EAAAjxD,MAAAixD,EAAAjxD,MAAAlM,MAAA,KACAq6D,EAAAl7D,KAAA+/D,gBAAA/B,GACAvhB,EAAAye,EACAxoB,EAAA1yC,KAAAoiE,iBAAApE,EAEA,KACAvhB,EAAAz8C,KAAAmiE,UAAA1H,EAAA0M,EAAAz0B,IAAAwoB,EACA,MAAAzhD,GACA0tD,EAAA9F,EAAA,GAAA8F,EAEAnJ,EAAAI,YAAA3hB,EAAA0nB,UACAnG,EAAAO,UAAAP,EAAAK,cAAA5hB,EAAA2nB,WACApG,EAAAQ,SAAAR,EAAAM,aAAA7hB,EAAA4nB,cACArG,EAAAgG,WAAAmD,EAAA1qB,EAAA0nB,UAAA,EACAnG,EAAAiG,aAAAkD,EAAA1qB,EAAA2nB,WAAA,EACApG,EAAAkG,YAAAiD,EAAA1qB,EAAA4nB,cAAA,EACArkE,KAAA+jE,gBAAA/F,KAIA+B,gBAAA,SAAA/B,GACA,MAAAh+D,MAAAonE,gBAAApJ,EACAh+D,KAAAqnE,eAAArJ,EAAAh+D,KAAAi/D,KAAAjB,EAAA,eAAA,GAAAjqD,SAIAszD,eAAA,SAAArJ,EAAAvhB,EAAAye,GACA,GAAAoM,GAAA,SAAAlwB,GACA,GAAAqF,GAAA,GAAA1oC,KAEA,OADA0oC,GAAAijB,QAAAjjB,EAAA0nB,UAAA/sB,GACAqF,GAEA8qB,EAAA,SAAAnwB,GACA,IACA,MAAAz6C,GAAA4gE,WAAA4E,UAAAxlE,EAAA4gE,WAAA0B,KAAAjB,EAAA,cACA5mB,EAAAz6C,EAAA4gE,WAAA6E,iBAAApE,IAEA,MAAA3+D,IAYA,IARA,GAAAo9C,IAAArF,EAAA12C,cAAAoG,MAAA,MACAnK,EAAA4gE,WAAAgE,SAAAvD,GAAA,OAAA,GAAAjqD,MACA0wD,EAAAhoB,EAAA4nB,cACAG,EAAA/nB,EAAA2nB,WACAS,EAAApoB,EAAA0nB,UACAzuC,EAAA,uCACA9gB,EAAA8gB,EAAAvoB,KAAAiqC,GAEAxiC,GAAA,CACA,OAAAA,EAAA,IAAA,KACA,IAAA,IAAA,IAAA,IACAiwD,GAAA5jE,SAAA2T,EAAA,GAAA,GAAA,MACA,KAAA,IAAA,IAAA,IACAiwD,GAAA,EAAA5jE,SAAA2T,EAAA,GAAA,GAAA,MACA,KAAA,IAAA,IAAA,IACA4vD,GAAAvjE,SAAA2T,EAAA,GAAA,IACAiwD,EAAA/jE,KAAAo8C,IAAA2nB,EAAAloE,EAAA4gE,WAAA0I,gBAAAxB,EAAAD,GACA,MACA,KAAA,IAAA,IAAA,IACAC,GAAAxjE,SAAA2T,EAAA,GAAA,IACAiwD,EAAA/jE,KAAAo8C,IAAA2nB,EAAAloE,EAAA4gE,WAAA0I,gBAAAxB,EAAAD,IAGA5vD,EAAA8gB,EAAAvoB,KAAAiqC,GAEA,MAAA,IAAArjC,MAAA0wD,EAAAD,EAAAK,IAEA2C,EAAA,MAAA/qB,GAAA,KAAAA,EAAAye,EAAA,gBAAAze,GAAA8qB,EAAA9qB,GACA,gBAAAA,GAAA0F,MAAA1F,GAAAye,EAAAoM,EAAA7qB,GAAA,GAAA1oC,MAAA0oC,EAAAzoC,UASA,OAPAwzD,GAAAA,GAAA,iBAAAA,EAAAn/C,WAAA6yC,EAAAsM,EACAA,IACAA,EAAAC,SAAA,GACAD,EAAAE,WAAA,GACAF,EAAAG,WAAA,GACAH,EAAAI,gBAAA,IAEA5nE,KAAAkmE,sBAAAsB,IAUAtB,sBAAA,SAAAzpB,GACA,MAAAA,IAGAA,EAAAgrB,SAAAhrB,EAAAorB,WAAA,GAAAprB,EAAAorB,WAAA,EAAA,GACAprB,GAHA,MAOAqjB,SAAA,SAAA9B,EAAAvhB,EAAAqrB,GACA,GAAAnT,IAAAlY,EACAsrB,EAAA/J,EAAAK,cACA2J,EAAAhK,EAAAM,aACAkJ,EAAAxnE,KAAAonE,gBAAApJ,EAAAh+D,KAAAqnE,eAAArJ,EAAAvhB,EAAA,GAAA1oC,OAEAiqD,GAAAI,YAAAJ,EAAAgG,WAAAwD,EAAArD,UACAnG,EAAAO,UAAAP,EAAAK,cAAAL,EAAAiG,aAAAuD,EAAApD,WACApG,EAAAQ,SAAAR,EAAAM,aAAAN,EAAAkG,YAAAsD,EAAAnD,cACA0D,IAAA/J,EAAAK,eAAA2J,IAAAhK,EAAAM,cAAAwJ,GACA9nE,KAAAskE,cAAAtG,GAEAh+D,KAAA+jE,gBAAA/F,GACAA,EAAAjxD,OACAixD,EAAAjxD,MAAAlM,IAAA8zD,EAAA,GAAA30D,KAAA4/D,YAAA5B,KAKAuD,SAAA,SAAAvD,GACA,GAAAiK,IAAAjK,EAAAkG,aAAAlG,EAAAjxD,OAAA,KAAAixD,EAAAjxD,MAAAlM,MAAA,KACAb,KAAAkmE,sBAAA,GAAAnyD,MACAiqD,EAAAkG,YAAAlG,EAAAiG,aAAAjG,EAAAgG,YACA,OAAAiE,IAMApF,gBAAA,SAAA7E,GACA,GAAApB,GAAA58D,KAAAi/D,KAAAjB,EAAA,cACA/4D,EAAA,IAAA+4D,EAAA/4D,GAAAhC,QAAA,QAAA,KACA+6D,GAAAZ,MAAAl9D,KAAA,kBAAA6E,IAAA,WACA,GAAA0nB,IACApF,KAAA,WACA1qB,EAAA4gE,WAAAoE,YAAA18D,GAAA23D,EAAA,MAEA5jC,KAAA,WACAr8B,EAAA4gE,WAAAoE,YAAA18D,GAAA23D,EAAA,MAEA15C,KAAA,WACAvmB,EAAA4gE,WAAA8B,mBAEA6I,MAAA,WACAvrE,EAAA4gE,WAAAuE,WAAA78D,IAEAkjE,UAAA,WAEA,MADAxrE,GAAA4gE,WAAAmE,WAAAz8D,GAAAjF,KAAA8D,aAAA,eAAA9D,KAAA8D,aAAA,aAAA9D,OACA,GAEAooE,YAAA,WAEA,MADAzrE,GAAA4gE,WAAAgH,iBAAAt/D,EAAAjF,KAAA,MACA,GAEAqoE,WAAA,WAEA,MADA1rE,GAAA4gE,WAAAgH,iBAAAt/D,EAAAjF,KAAA,MACA,GAGArD,GAAAqD,MAAAiwC,KAAAjwC,KAAA8D,aAAA,cAAA2oB,EAAAzsB,KAAA8D,aAAA,qBAKA8+D,cAAA,SAAA5E,GACA,GAAAsK,GAAAtO,EAAA3yC,EAAA4yC,EAAAjhC,EAAAkhC,EAAAqO,EACAC,EAAAC,EAAA/N,EAAAqB,EAAA1B,EAAAE,EACAJ,EAAAC,EAAAiC,EAAAR,EACAC,EAAAZ,EAAAl8D,EAAA0pE,EAAAC,EAAA3qB,EAAA5Y,EAAAwjC,EACAC,EAAAC,EAAA5jC,EAAA2/B,EAAAkE,EAAAC,EAAAC,EAAAC,EACAC,EAAAC,EAAAxrC,EAAAyrC,EAAAC,EAAAC,EACAC,EAAA,GAAAz1D,MACAm0D,EAAAloE,KAAAkmE,sBACA,GAAAnyD,MAAAy1D,EAAAnF,cAAAmF,EAAApF,WAAAoF,EAAArF,YACAxJ,EAAA36D,KAAAi/D,KAAAjB,EAAA,SACAf,EAAAj9D,KAAAi/D,KAAAjB,EAAA,mBACAzC,EAAAv7D,KAAAi/D,KAAAjB,EAAA,oBACAxC,EAAAx7D,KAAAi/D,KAAAjB,EAAA,0BACA+E,EAAA/iE,KAAAgjE,mBAAAhF,GACArB,EAAA38D,KAAAi/D,KAAAjB,EAAA,oBACApB,EAAA58D,KAAAi/D,KAAAjB,EAAA,cACAyL,EAAA,IAAA1G,EAAA,IAAA,IAAAA,EAAA,GACA2G,EAAA1pE,KAAAkmE,sBAAAlI,EAAAgG,WACA,GAAAjwD,MAAAiqD,EAAAkG,YAAAlG,EAAAiG,aAAAjG,EAAAgG,YADA,GAAAjwD,MAAA,KAAA,EAAA,IAEAooD,EAAAn8D,KAAAihE,eAAAjD,EAAA,OACA5B,EAAAp8D,KAAAihE,eAAAjD,EAAA,OACAO,EAAAP,EAAAO,UAAA5B,EACA6B,GAAAR,EAAAQ,QAMA,IAJAD,EAAA,IACAA,GAAA,GACAC,MAEApC,EAIA,IAHAkM,EAAAtoE,KAAAkmE,sBAAA,GAAAnyD,MAAAqoD,EAAAiI,cACAjI,EAAAgI,WAAArB,EAAA,GAAAA,EAAA,GAAA,EAAA3G,EAAA+H,YACAmE,EAAAnM,GAAAmM,EAAAnM,EAAAA,EAAAmM,EACAtoE,KAAAkmE,sBAAA,GAAAnyD,MAAAyqD,GAAAD,EAAA,IAAA+J,GACA/J,IACAA,EAAA,IACAA,EAAA,GACAC,KAqDA,KAjDAR,EAAAO,UAAAA,EACAP,EAAAQ,SAAAA,GAEAxE,EAAAh6D,KAAAi/D,KAAAjB,EAAA,YACAhE,EAAAwB,EAAAx7D,KAAA2kE,WAAA3K,EACAh6D,KAAAkmE,sBAAA,GAAAnyD,MAAAyqD,GAAAD,EAAA3B,EAAA,IACA58D,KAAAoiE,iBAAApE,IAFAhE,EAIA3yC,EAAArnB,KAAA2pE,gBAAA3L,KAAAQ,GAAAD,GACA,6FACAvE,EAAA,mDAAAW,EAAA,IAAA,KAAA,KAAAX,EAAA,cACAuB,EAAA,GAAA,wEAAAvB,EAAA,mDAAAW,EAAA,IAAA,KAAA,KAAAX,EAAA,cAEAC,EAAAj6D,KAAAi/D,KAAAjB,EAAA,YACA/D,EAAAuB,EAAAx7D,KAAA2kE,WAAA1K,EACAj6D,KAAAkmE,sBAAA,GAAAnyD,MAAAyqD,GAAAD,EAAA3B,EAAA,IACA58D,KAAAoiE,iBAAApE,IAFA/D,EAIAjhC,EAAAh5B,KAAA2pE,gBAAA3L,EAAA,EAAAQ,GAAAD,GACA,6FACAtE,EAAA,mDAAAU,EAAA,IAAA,KAAA,KAAAV,EAAA,cACAsB,EAAA,GAAA,wEAAAtB,EAAA,mDAAAU,EAAA,IAAA,KAAA,KAAAV,EAAA,cAEAC,EAAAl6D,KAAAi/D,KAAAjB,EAAA,eACAuK,EAAAvoE,KAAAi/D,KAAAjB,EAAA,gBAAAA,EAAAgG,WAAA0F,EAAAxB,EACAhO,EAAAsB,EACAx7D,KAAA2kE,WAAAzK,EAAAqO,EAAAvoE,KAAAoiE,iBAAApE,IADA9D,EAGAsO,EAAAxK,EAAAN,OACA,GADA,+IACA19D,KAAAi/D,KAAAjB,EAAA,aAAA,YAEAyK,EAAA,EAAA,4DAAA9N,EAAA6N,EAAA,KACAxoE,KAAA4pE,WAAA5L,EAAAuK,GAAA,oJACArO,EAAA,YAAA,KAAAS,EAAA,GAAA6N,GAAA,SAAA,GAEA9N,EAAAz5D,SAAAjB,KAAAi/D,KAAAjB,EAAA,YAAA,IACAtD,EAAAvY,MAAAuY,GAAA,EAAAA,EAEAqB,EAAA/7D,KAAAi/D,KAAAjB,EAAA,YACA3D,EAAAr6D,KAAAi/D,KAAAjB,EAAA,YACAzD,EAAAv6D,KAAAi/D,KAAAjB,EAAA,eACA7D,EAAAn6D,KAAAi/D,KAAAjB,EAAA,cACA5D,EAAAp6D,KAAAi/D,KAAAjB,EAAA,mBACA3B,EAAAr8D,KAAAi/D,KAAAjB,EAAA,iBACAnC,EAAA77D,KAAAi/D,KAAAjB,EAAA,mBACAlC,EAAA97D,KAAAi/D,KAAAjB,EAAA,qBACA9C,EAAAl7D,KAAA+/D,gBAAA/B,GACAh/D,EAAA,GAEA2pE,EAAA,EAAAA,EAAA5F,EAAA,GAAA4F,IAAA,CAGA,IAFA3qB,EAAA,GACAh+C,KAAA69D,QAAA,EACAz4B,EAAA,EAAAA,EAAA29B,EAAA,GAAA39B,IAAA,CAIA,GAHAwjC,EAAA5oE,KAAAkmE,sBAAA,GAAAnyD,MAAAyqD,GAAAD,EAAAP,EAAAI,cACAyK,EAAA,iBACAC,EAAA,GACAW,EAAA,CAEA,GADAX,GAAA,kCACA/F,EAAA,GAAA,EACA,OAAA39B,GACA,IAAA,GAAA0jC,GAAA,6BACAD,EAAA,eAAAlO,EAAA,QAAA,OAAA,MACA,KAAAoI,GAAA,GAAA,EAAA+F,GAAA,4BACAD,EAAA,eAAAlO,EAAA,OAAA,QAAA,MACA,SAAAmO,GAAA,8BAAAD,EAAA,GAGAC,GAAA,KAUA,IARAA,GAAA,uEAAAD,EAAA,MACA,WAAAtjE,KAAAsjE,IAAA,IAAAF,EAAAhO,EAAA3hC,EAAA3R,EAAA,KACA,YAAA9hB,KAAAsjE,IAAA,IAAAF,EAAAhO,EAAAtzC,EAAA2R,EAAA,IACAh5B,KAAA6pE,yBAAA7L,EAAAO,EAAAC,GAAArC,EAAAC,EACAuM,EAAA,GAAAvjC,EAAA,EAAA+0B,EAAAC,GACA,0DAEAl1B,EAAA62B,EAAA,sCAAA/7D,KAAAi/D,KAAAjB,EAAA,cAAA,QAAA,GACA0K,EAAA,EAAAA,EAAA,EAAAA,IACA7D,GAAA6D,EAAAhO,GAAA,EACAx1B,GAAA,oBAAAwjC,EAAAhO,EAAA,GAAA,GAAA,EAAA,kCAAA,IAAA,iBACAL,EAAAwK,GAAA,KAAAtK,EAAAsK,GAAA,cAYA,KAVAiE,GAAA5jC,EAAA,uBACA6jC,EAAA/oE,KAAAimE,gBAAAzH,GAAAD,GACAC,KAAAR,EAAAM,cAAAC,IAAAP,EAAAK,gBACAL,EAAAI,YAAAt9D,KAAAo8C,IAAA8gB,EAAAI,YAAA2K,IAEAC,GAAAhpE,KAAA8pE,oBAAAtL,GAAAD,GAAA7D,EAAA,GAAA,EACAuO,EAAAnoE,KAAAipE,MAAAf,EAAAD,GAAA,GACAG,EAAAO,GAAAzpE,KAAA69D,QAAAoL,EAAAjpE,KAAA69D,QAAAoL,EACAjpE,KAAA69D,QAAAqL,EACAC,EAAAnpE,KAAAkmE,sBAAA,GAAAnyD,MAAAyqD,GAAAD,EAAA,EAAAyK,IACAI,EAAA,EAAAA,EAAAF,EAAAE,IAAA,CAIA,IAHAN,GAAA,OACAlrC,EAAAm+B,EAAA,sCACA/7D,KAAAi/D,KAAAjB,EAAA,iBAAAmL,GAAA,QADA,GAEAT,EAAA,EAAAA,EAAA,EAAAA,IACAW,EAAAhN,EACAA,EAAAvnD,MAAAkpD,EAAAjxD,MAAAixD,EAAAjxD,MAAA,GAAA,MAAAo8D,MAAA,EAAA,IACAG,EAAAH,EAAA/E,aAAA7F,EACAgL,EAAAD,IAAAxN,IAAAuN,EAAA,IACAlN,GAAAgN,EAAAhN,GAAAC,GAAA+M,EAAA/M,EACAx+B,GAAA,gBACA8qC,EAAAhO,EAAA,GAAA,GAAA,EAAA,0BAAA,KACA4O,EAAA,6BAAA,KACAH,EAAAn1D,YAAA40D,EAAA50D,WAAAuqD,IAAAP,EAAAK,eAAAL,EAAA/E,WACAiC,EAAAlnD,YAAAm1D,EAAAn1D,WAAAknD,EAAAlnD,YAAA40D,EAAA50D,UAEA,IAAAhU,KAAA65D,cAAA,KACA0P,EAAA,IAAAvpE,KAAA25D,mBAAA,qBAAA,KACA2P,IAAAzN,EAAA,GAAA,IAAAwN,EAAA,IACAF,EAAAn1D,YAAA01D,EAAA11D,UAAA,IAAAhU,KAAA45D,cAAA,KACAuP,EAAAn1D,YAAAk0D,EAAAl0D,UAAA,uBAAA,KAAA,KACAs1D,IAAAzN,IAAAwN,EAAA,GAAA,GAAA,WAAAA,EAAA,GAAApmE,QAAA,KAAA,SAAA,MACAsmE,EAAA,GAAA,4DAAAJ,EAAA/E,WAAA,gBAAA+E,EAAA9E,cAAA,KAAA,KACAiF,IAAAzN,EAAA,SACA0N,EAAA,kCAAAJ,EAAAhF,UAAA,UAAA,8BACAgF,EAAAn1D,YAAAk0D,EAAAl0D,UAAA,sBAAA,KACAm1D,EAAAn1D,YAAA01D,EAAA11D,UAAA,mBAAA,KACAs1D,EAAA,yBAAA,IACA,cAAAH,EAAAhF,UAAA,QAAA,QACAgF,EAAAzJ,QAAAyJ,EAAAhF,UAAA,GACAgF,EAAAnpE,KAAAkmE,sBAAAiD,EAEAL,IAAAlrC,EAAA,QAEA2gC,IACAA,EAAA,KACAA,EAAA,EACAC,MAEAsK,GAAA,oBAAAW,EAAA,UACA1G,EAAA,GAAA,GAAA39B,IAAA29B,EAAA,GAAA,EAAA,8CAAA,IAAA,IACA/kB,GAAA8qB,EAEA9pE,GAAAg/C,EAIA,MAFAh/C,IAAAypE,EACAzK,EAAA/E,WAAA,EACAj6D,GAIA6qE,yBAAA,SAAA7L,EAAAO,EAAAC,EAAArC,EAAAC,EACA4N,EAAA7P,EAAAC,GAEA,GAAA6P,GAAAC,EAAA1F,EAAA2F,EAAAC,EAAAC,EAAA5F,EAAA6F,EACA5O,EAAA17D,KAAAi/D,KAAAjB,EAAA,eACArC,EAAA37D,KAAAi/D,KAAAjB,EAAA,cACApD,EAAA56D,KAAAi/D,KAAAjB,EAAA,sBACAh/D,EAAA,oCACAurE,EAAA,EAGA,IAAAP,IAAAtO,EACA6O,GAAA,qCAAApQ,EAAAoE,GAAA,cACA,CAIA,IAHA0L,EAAA9N,GAAAA,EAAAkI,gBAAA7F,EACA0L,EAAA9N,GAAAA,EAAAiI,gBAAA7F,EACA+L,GAAA,sFACA/F,EAAA,EAAAA,EAAA,GAAAA,MACAyF,GAAAzF,GAAArI,EAAAiI,eAAA8F,GAAA1F,GAAApI,EAAAgI,cACAmG,GAAA,kBAAA/F,EAAA,KACAA,IAAAjG,EAAA,uBAAA,IACA,IAAAnE,EAAAoK,GAAA,YAGA+F,IAAA,YAQA,GALA3P,IACA57D,GAAAurE,IAAAP,GAAAtO,GAAAC,EAAA,GAAA,YAIAqC,EAAAmF,UAEA,GADAnF,EAAAmF,UAAA,GACA6G,IAAArO,EACA38D,GAAA,oCAAAw/D,EAAA,cACA,CAeA,IAbA2L,EAAAnqE,KAAAi/D,KAAAjB,EAAA,aAAAl4D,MAAA,KACAskE,GAAA,GAAAr2D,OAAAswD,cACAgG,EAAA,SAAAz8D,GACA,GAAA62D,GAAA72D,EAAA9G,MAAA,YAAA03D,EAAAv9D,SAAA2M,EAAAR,UAAA,GAAA,IACAQ,EAAA9G,MAAA,WAAAsjE,EAAAnpE,SAAA2M,EAAA,IACA3M,SAAA2M,EAAA,GACA,OAAAu0C,OAAAsiB,GAAA2F,EAAA3F,GAEAA,EAAA4F,EAAAF,EAAA,IACAG,EAAAxpE,KAAA6I,IAAA86D,EAAA4F,EAAAF,EAAA,IAAA,KACA1F,EAAAtI,EAAAr7D,KAAA6I,IAAA86D,EAAAtI,EAAAkI,eAAAI,EACA6F,EAAAlO,EAAAt7D,KAAAo8C,IAAAotB,EAAAlO,EAAAiI,eAAAiG,EACAtM,EAAAmF,WAAA,oFACAsB,GAAA6F,EAAA7F,IACAzG,EAAAmF,WAAA,kBAAAsB,EAAA,KACAA,IAAAjG,EAAA,uBAAA,IACA,IAAAiG,EAAA,WAEAzG,GAAAmF,WAAA,YAEAnkE,GAAAg/D,EAAAmF,UACAnF,EAAAmF,UAAA,KASA,MALAnkE,IAAAgB,KAAAi/D,KAAAjB,EAAA,cACApD,IACA57D,KAAAgrE,GAAAtO,GAAAC,EAAA,GAAA,UAAA4O,GAEAvrE,GAAA,UAKA+kE,gBAAA,SAAA/F,EAAA5mB,EAAA0sB,GACA,GAAAW,GAAAzG,EAAAQ,UAAA,MAAAsF,EAAA1sB,EAAA,GACAotB,EAAAxG,EAAAO,WAAA,MAAAuF,EAAA1sB,EAAA,GACAytB,EAAA/jE,KAAAo8C,IAAA8gB,EAAAI,YAAAp+D,KAAAimE,gBAAAxB,EAAAD,KAAA,MAAAV,EAAA1sB,EAAA,GACAqF,EAAAz8C,KAAAonE,gBAAApJ,EAAAh+D,KAAAkmE,sBAAA,GAAAnyD,MAAA0wD,EAAAD,EAAAK,IAEA7G,GAAAI,YAAA3hB,EAAA0nB,UACAnG,EAAAO,UAAAP,EAAAK,cAAA5hB,EAAA2nB,WACApG,EAAAQ,SAAAR,EAAAM,aAAA7hB,EAAA4nB,cACA,MAAAP,GAAA,MAAAA,GACA9jE,KAAAskE,cAAAtG,IAKAoJ,gBAAA,SAAApJ,EAAAvhB,GACA,GAAA0f,GAAAn8D,KAAAihE,eAAAjD,EAAA,OACA5B,EAAAp8D,KAAAihE,eAAAjD,EAAA,OACAwJ,EAAArL,GAAA1f,EAAA0f,EAAAA,EAAA1f,CACA,OAAA2f,IAAAoL,EAAApL,EAAAA,EAAAoL,GAIAlD,cAAA,SAAAtG,GACA,GAAAwM,GAAAxqE,KAAAi/D,KAAAjB,EAAA,oBACAwM,IACAA,EAAA11D,MAAAkpD,EAAAjxD,MAAAixD,EAAAjxD,MAAA,GAAA,MACAixD,EAAAM,aAAAN,EAAAK,cAAA,EAAAL,KAKAgF,mBAAA,SAAAhF,GACA,GAAA+E,GAAA/iE,KAAAi/D,KAAAjB,EAAA,iBACA,OAAA,OAAA+E,GAAA,EAAA,GAAA,gBAAAA,IAAA,EAAAA,GAAAA,GAIA9B,eAAA,SAAAjD,EAAAyM,GACA,MAAAzqE,MAAAqnE,eAAArJ,EAAAh+D,KAAAi/D,KAAAjB,EAAAyM,EAAA,QAAA,OAIAxE,gBAAA,SAAAxB,EAAAD,GACA,MAAA,IAAAxkE,KAAAkmE,sBAAA,GAAAnyD,MAAA0wD,EAAAD,EAAA,KAAAL,WAIA2F,oBAAA,SAAArF,EAAAD,GACA,MAAA,IAAAzwD,MAAA0wD,EAAAD,EAAA,GAAA7E,UAIAgK,gBAAA,SAAA3L,EAAA5mB,EAAAszB,EAAAC,GACA,GAAA5H,GAAA/iE,KAAAgjE,mBAAAhF,GACAvhB,EAAAz8C,KAAAkmE,sBAAA,GAAAnyD,MAAA22D,EACAC,GAAAvzB,EAAA,EAAAA,EAAA2rB,EAAA,GAAAA,EAAA,IAAA,GAKA,OAHA3rB,GAAA,GACAqF,EAAAijB,QAAA1/D,KAAAimE,gBAAAxpB,EAAA4nB,cAAA5nB,EAAA2nB,aAEApkE,KAAA4pE,WAAA5L,EAAAvhB,IAIAmtB,WAAA,SAAA5L,EAAAvhB,GACA,GAAAmuB,GAAA1G,EACA/H,EAAAn8D,KAAAihE,eAAAjD,EAAA,OACA5B,EAAAp8D,KAAAihE,eAAAjD,EAAA,OACA6M,EAAA,KACAC,EAAA,KACAX,EAAAnqE,KAAAi/D,KAAAjB,EAAA,YAcA,OAbAmM,KACAS,EAAAT,EAAArkE,MAAA,KACAo+D,GAAA,GAAAnwD,OAAAswD,cACAwG,EAAA5pE,SAAA2pE,EAAA,GAAA,IACAE,EAAA7pE,SAAA2pE,EAAA,GAAA,IACAA,EAAA,GAAA9jE,MAAA,aACA+jE,GAAA3G,GAEA0G,EAAA,GAAA9jE,MAAA,aACAgkE,GAAA5G,MAIA/H,GAAA1f,EAAAzoC,WAAAmoD,EAAAnoD,cACAooD,GAAA3f,EAAAzoC,WAAAooD,EAAApoD,cACA62D,GAAApuB,EAAA4nB,eAAAwG,MACAC,GAAAruB,EAAA4nB,eAAAyG,IAIA1I,iBAAA,SAAApE,GACA,GAAA9B,GAAAl8D,KAAAi/D,KAAAjB,EAAA,kBAGA,OAFA9B,GAAA,gBAAAA,GAAAA,GACA,GAAAnoD,OAAAswD,cAAA,IAAApjE,SAAAi7D,EAAA,KACAA,gBAAAA,EACA5B,cAAAt6D,KAAAi/D,KAAAjB,EAAA,iBAAA3D,SAAAr6D,KAAAi/D,KAAAjB,EAAA,YACA5D,gBAAAp6D,KAAAi/D,KAAAjB,EAAA,mBAAA7D,WAAAn6D,KAAAi/D,KAAAjB,EAAA,gBAIA4B,YAAA,SAAA5B,EAAA6G,EAAAL,EAAAC,GACAI,IACA7G,EAAAgG,WAAAhG,EAAAI,YACAJ,EAAAiG,aAAAjG,EAAAK,cACAL,EAAAkG,YAAAlG,EAAAM,aAEA,IAAA7hB,GAAAooB,EAAA,gBAAAA,GAAAA,EACA7kE,KAAAkmE,sBAAA,GAAAnyD,MAAA0wD,EAAAD,EAAAK,IACA7kE,KAAAkmE,sBAAA,GAAAnyD,MAAAiqD,EAAAkG,YAAAlG,EAAAiG,aAAAjG,EAAAgG,YACA,OAAAhkE,MAAA2kE,WAAA3kE,KAAAi/D,KAAAjB,EAAA,cAAAvhB,EAAAz8C,KAAAoiE,iBAAApE,OAmDArhE,EAAAoV,GAAAwrD,WAAA,SAAA7/D,GAGA,IAAAsC,KAAA+B,OACA,MAAA/B,KAIArD,GAAA4gE,WAAAwN,cACApuE,EAAAZ,UAAAivE,UAAAruE,EAAA4gE,WAAAsG,qBACAlnE,EAAA4gE,WAAAwN,aAAA,GAIA,IAAApuE,EAAA,IAAAA,EAAA4gE,WAAAlE,YAAAt3D,QACApF,EAAA,QAAA6F,OAAA7F,EAAA4gE,WAAAH,MAGA,IAAA6N,GAAAlhD,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EACA,OAAA,gBAAA7U,IAAA,eAAAA,GAAA,YAAAA,GAAA,WAAAA,EAIA,WAAAA,GAAA,IAAA6U,UAAAxQ,QAAA,gBAAAwQ,WAAA,GACA5V,EAAA4gE,WAAA,IAAA7/D,EAAA,cACAoX,MAAAnY,EAAA4gE,YAAAv9D,KAAA,IAAAib,OAAAgwD,IAEAjrE,KAAAJ,KAAA,WACA,gBAAAlC,GACAf,EAAA4gE,WAAA,IAAA7/D,EAAA,cACAoX,MAAAnY,EAAA4gE,YAAAv9D,MAAAib,OAAAgwD,IACAtuE,EAAA4gE,WAAAQ,kBAAA/9D,KAAAtC,KAXAf,EAAA4gE,WAAA,IAAA7/D,EAAA,cACAoX,MAAAnY,EAAA4gE,YAAAv9D,KAAA,IAAAib,OAAAgwD,KAcAtuE,EAAA4gE,WAAA,GAAAxE,GACAp8D,EAAA4gE,WAAAwN,aAAA,EACApuE,EAAA4gE,WAAA1F,MAAA,GAAA9jD,OAAAC,UACArX,EAAA4gE,WAAA/0C,QAAA,SAEA7rB,EAAA4gE,aC/hEA,SAAAp6D,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,iBAAAD,GAIAA,EAAAzG,OAAA6gE,aAEA,SAAAA,GAsBA,MApBAA,GAAAzD,SAAA,IACAC,UAAA,QACAC,SAAA,cACAC,SAAA,cACAC,YAAA,OACAC,YAAA,UAAA,WAAA,OAAA,QAAA,MAAA,OACA,OAAA,UAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MACA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAE,eAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAD,UAAA,SAAA,SAAA,SAAA,SAAA,UAAA,SAAA,UACAE,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,KACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IACA0C,EAAAhhB,YAAAghB,EAAAzD,SAAA,IAEAyD,EAAAzD,SAAA,KC/BA,SAAA32D,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,iBAAAD,GAIAA,EAAAzG,OAAA6gE,aAEA,SAAAA,GAqBA,MAnBAA,GAAAzD,SAAA,IACAC,UAAA,OACAC,SAAA,gBACAC,SAAA,cACAC,YAAA,QACAC,YAAA,SAAA,UAAA,OAAA,QAAA,MAAA,OAAA,OAAA,SAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAE,eAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAD,UAAA,SAAA,SAAA,UAAA,SAAA,UAAA,SAAA,UACAE,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,MACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IAEA0C,EAAAhhB,YAAAghB,EAAAzD,SAAA,IAEAyD,EAAAzD,SAAA,KChCA,SAAA32D,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,iBAAAD,GAIAA,EAAAzG,OAAA6gE;EAEA,SAAAA,GAsBA,MApBAA,GAAAzD,SAAA,UACAC,UAAA,OACAC,SAAA,OACAC,SAAA,OACAC,YAAA,QACAC,YAAA,UAAA,WAAA,QAAA,QAAA,MAAA,OACA,OAAA,SAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MACA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,UAAA,SAAA,SAAA,UAAA,YAAA,WAAA,SAAA,YACAC,eAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,KACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IACA0C,EAAAhhB,YAAAghB,EAAAzD,SAAA,UAEAyD,EAAAzD,SAAA,WChCA,SAAA32D,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,iBAAAD,GAIAA,EAAAzG,OAAA6gE,aAEA,SAAAA,GAsBA,MApBAA,GAAAzD,SAAA,IACAC,UAAA,YACAC,SAAA,eACAC,SAAA,YACAC,YAAA,QACAC,YAAA,SAAA,UAAA,OAAA,QAAA,MAAA,OACA,OAAA,SAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MACA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,UAAA,UAAA,SAAA,WAAA,WAAA,aAAA,UAAA,WACAC,eAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,KACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IACA0C,EAAAhhB,YAAAghB,EAAAzD,SAAA,IAEAyD,EAAAzD,SAAA,KChCA,SAAA32D,GACA,kBAAAC,SAAAA,OAAAC,IAGAD,QAAA,iBAAAD,GAIAA,EAAAzG,OAAA6gE,aAEA,SAAAA,GAsBA,MApBAA,GAAAzD,SAAA,IACAC,UAAA,MACAC,SAAA,gBACAC,SAAA,cACAC,YAAA,OACAC,YAAA,SAAA,UAAA,QAAA,QAAA,MAAA,OACA,OAAA,SAAA,YAAA,UAAA,WAAA,YACAC,iBAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MACA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,UAAA,SAAA,SAAA,UAAA,SAAA,UAAA,SAAA,UACAC,eAAA,MAAA,MAAA,MAAA,MAAA,MAAA,MAAA,OACAC,aAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MACAC,WAAA,MACAC,WAAA,WACAC,SAAA,EACAC,OAAA,EACAC,oBAAA,EACAC,WAAA,IACA0C,EAAAhhB,YAAAghB,EAAAzD,SAAA,IAEAyD,EAAAzD,SAAA,KC3BA,SAAA32D,GACA,kBAAAC,SAAAA,OAAAC,IAEAD,QAAA,UAAAD,GAGAA,EAFA,gBAAAI,SAEAy1C,QAAA,UAGAt8C,SAEA,SAAAC,GAIA,QAAAuuE,GAAAv7D,GACA,MAAAw7D,GAAA1tC,IAAA9tB,EAAA6lC,mBAAA7lC,GAGA,QAAAy7D,GAAAz7D,GACA,MAAAw7D,GAAA1tC,IAAA9tB,EAAA07D,mBAAA17D,GAGA,QAAA27D,GAAA19D,GACA,MAAAs9D,GAAAC,EAAA/4B,KAAA5B,KAAA+6B,UAAA39D,GAAAolB,OAAAplB,IAGA,QAAA49D,GAAA77D,GACA,IAAAA,EAAA5P,QAAA,OAEA4P,EAAAA,EAAAxS,MAAA,MAAA8F,QAAA,OAAA,KAAAA,QAAA,QAAA,MAGA,KAKA,MADA0M,GAAA07D,mBAAA17D,EAAA1M,QAAAwoE,EAAA,MACAN,EAAA/4B,KAAA5B,KAAAC,MAAA9gC,GAAAA,EACA,MAAAtQ,KAGA,QAAAqsE,GAAA/7D,EAAAg8D,GACA,GAAA/9D,GAAAu9D,EAAA1tC,IAAA9tB,EAAA67D,EAAA77D,EACA,OAAAhT,GAAA4b,WAAAozD,GAAAA,EAAA/9D,GAAAA,EA/BA,GAAA69D,GAAA,MAkCAN,EAAAxuE,EAAAmD,OAAA,SAAA8Z,EAAAhM,EAAAlQ,GAIA,GAAAmC,SAAA+N,IAAAjR,EAAA4b,WAAA3K,GAAA,CAGA,GAFAlQ,EAAAf,EAAAke,UAAAswD,EAAAtwB,SAAAn9C,GAEA,gBAAAA,GAAAkuE,QAAA,CACA,GAAAC,GAAAnuE,EAAAkuE,QAAAltC,EAAAhhC,EAAAkuE,QAAA,GAAA73D,KACA2qB,GAAAotC,SAAAptC,EAAA,MAAAmtC,GAGA,MAAA9vE,UAAA+D,QACAorE,EAAAtxD,GAAA,IAAA0xD,EAAA19D,GACAlQ,EAAAkuE,QAAA,aAAAluE,EAAAkuE,QAAAG,cAAA,GACAruE,EAAAsuE,KAAA,UAAAtuE,EAAAsuE,KAAA,GACAtuE,EAAAuuE,OAAA,YAAAvuE,EAAAuuE,OAAA,GACAvuE,EAAAwuE,OAAA,WAAA,IACAjmE,KAAA,IAYA,IAAA,GAPA0d,GAAA/J,EAAA/Z,UAKAssE,EAAApwE,SAAA+D,OAAA/D,SAAA+D,OAAAgG,MAAA,SAEAmC,EAAA,EAAAmV,EAAA+uD,EAAApqE,OAAAkG,EAAAmV,EAAAnV,IAAA,CACA,GAAA0iC,GAAAwhC,EAAAlkE,GAAAnC,MAAA,KACAgS,EAAAszD,EAAAzgC,EAAA3kC,SACAlG,EAAA6qC,EAAA1kC,KAAA,IAEA,IAAA2T,GAAAA,IAAA9B,EAAA,CAEA6L,EAAA+nD,EAAA5rE,EAAA8N,EACA,OAIAgM,GAAA/Z,UAAAC,EAAA4rE,EAAA5rE,MACA6jB,EAAA7L,GAAAhY,GAIA,MAAA6jB,GAGAwnD,GAAAtwB,YAEAl+C,EAAAyvE,aAAA,SAAAxyD,EAAAlc,GACA,MAAAmC,UAAAlD,EAAAmD,OAAA8Z,KAKAjd,EAAAmD,OAAA8Z,EAAA,GAAAjd,EAAAke,UAAAnd,GAAAkuE,eACAjvE,EAAAmD,OAAA8Z,OCxGA,SAAA7B,EAAA5U,GAEA,kBAAAC,SAAAA,OAAAC,IACAD,QAAA,UAAA,SAAA1G,GACA,MAAAyG,GAAA4U,EAAArb,KAGA,gBAAA6G,SACAJ,EAAA4U,EAAAihC,QAAA,WAGA71C,EAAA4U,EAAAA,EAAArb,SAEA,mBAAAe,QAAAA,OAAAuC,KAAA,SAAAvC,EAAAd,GACA,YAuFA,SAAA0vE,GAAA9iD,EAAAgB,GAEA,IADA,GAAAtiB,GAAAshB,EAAAxnB,SACAkG,GACA,IAAAshB,EAAAthB,MAAAsiB,EAAAtiB,GACA,OAAA,CAGA,QAAA,EAQA,QAAAqkE,GAAA5mE,GACA,GAAAhI,IAAAu/C,OAAA,EAAAjR,SAAA,EAMA,OALA,iBAAAtmC,GACAhI,EAAAsuC,QAAAtmC,EAEA/I,EAAAke,OAAAnd,EAAAgI,GAEAhI,EAQA,QAAA6uE,GAAAjtE,EAAAkC,EAAAkH,EAAA8E,EAAAnO,EAAAmtE,EAAAC,EAAAh/D,EAAAxF,GACA,UAAAtL,EAAAiM,KAAAtJ,GACAU,KAAAgT,WACA1T,EAAA,IAAAA,EAAA,IAAAA,EAAA,IACAA,EAAA,IAAAA,EAAA,IAAAA,EAAA,GACA,EAAA,EAAA,GAGAU,KAAAgT,UACA1T,EAAAkC,EAAAkH,EACA8E,EAAAnO,EAAAmtE,EACAC,GAAA,EAAAh/D,GAAA,EAAAxF,GAAA,GA4EA,QAAAykE,GAAAC,EAAAC,EAAAC,GACA7sE,KAAAgT,UAAA25D,EAAAC,EAAAC,GAwBA,QAAAC,GAAAr0D,EAAA/a,GAGA,KAAAsC,eAAA8sE,IACA,MAAA,IAAAA,GAAAr0D,EAAA/a,EAIA,KAAA+a,EAAAvF,UACAvW,EAAA6qB,MAAA,sCAEA7qB,EAAA8uB,SAAA1vB,EAAA0c,IACA9b,EAAA6qB,MAAA,mDAIA,IAAAha,GAAA7Q,EAAAsD,KAAAwY,EAAAs0D,EACA,IAAAv/D,EACA,MAAAA,EAKAxN,MAAAtC,QAAAA,EAAAf,EAAAke,UAAAiyD,EAAAjyB,SAAAn9C,GACAsC,KAAAyY,KAAAA,CACA,IAAAu0D,GAAAhtE,KAAAgtE,MAAArwE,EAAA8b,EACAzY,MAAAitE,KAAAvvE,EAAAuvE,MAAAvvE,EAAAuvE,KAAAlrE,OAAArE,EAAAuvE,KAAAD,EACAhtE,KAAAktE,KAAAvwE,EAAA8b,EAAAiE,eAAA3gB,GACAiE,KAAA6pD,QAAAmjB,EAAA5rE,SAIApB,KAAAmtE,MAAAC,EAAA7nE,KAAAkT,EAAA40D,eAAA,QAAA50D,EAAAjT,SAAA9E,cAEAV,KAAAstE,SAAA,EAKAttE,KAAAutE,kBAIAvtE,KAAAwtE,YAAAxtE,KAAAmtE,OAAAxwE,EAAA2tC,SAAAmjC,UAAAxqE,QAAAyqE,EAAA,OAAAhtE,cAGAV,KAAA2tE,mBAGA3tE,KAAA4tE,iBAGA,IAAAC,GAAAlxE,IACA87B,EAAAz4B,IACArD,GAAAiD,MAAA,UAAA,WAAA,aAAA,UAAA,SAAAqI,EAAA6P,GACA2gB,EAAA3gB,GAAApa,EAAAoa,IAAA+1D,IAGA7tE,KAAAyzD,SAGA92D,EAAAsD,KAAAwY,EAAAs0D,EAAA/sE,MA/RA,GAAA2b,GAAA,2CAAA7V,MAAA,KACAgoE,EAAAnxE,EAAAke,UAAAle,EAAA8c,MAAA4nB,YACA9jB,IAGA,IAAA9f,EAAAswE,aACApxE,EAAAiD,KAAA+b,EAAA,SAAA1T,EAAA6P,GAEAnb,EAAA8c,MAAA2nB,SACA7jB,EAAAzF,GAAA,UAAAA,GACAg2D,QAEA,CACA,GAAAE,GAAAF,EAAAjsD,KAEAisD,GAAAjsD,MAAAmsD,EAAA/yD,QAAA,UAAA,iBAAA,gBAAA,SAAA,UAAA,UAAA,aAOA6yD,EAAAn1D,OAAA,SAAAc,EAAAynB,GACA,GAAA+sC,GACAhmE,EAAA+lE,EAAAjsE,MACA,KAAAm/B,EAAAY,OAAAZ,EAAAgtC,UAAAD,EAAA/sC,EAAAgtC,QAAA,IAEA,KAAAjmE,KACAwR,EAAAu0D,EAAA/lE,IAAAgmE,EAAAD,EAAA/lE,GAGA,OAAAwR,IAGA9c,EAAAiD,KAAA+b,EAAA,SAAA1T,EAAA6P,GAEA,GAAA7P,EAAA,EACAsV,EAAAzF,GAAA,QAAAA,MACA,CACA,GAAAm2D,GAAA,SACA,SAAAn2D,EAAA,QAAA,OAAAA,EAAA,MAAAA,EAEAnb,GAAA8c,MAAA2nB,SAAA6sC,GAAAH,EAEAvwD,EAAAzF,GAAAm2D,EAAA,SAAAn2D,KAKAnb,EAAAwxE,aAAA5wD,CAEA,IAAAxhB,GAAA0B,EAAA1B,SACAgxE,EAAA,SACA5vE,EAAA4sB,MAAAjJ,UAAA3jB,MACAixE,IAAA3wE,EAAAswE,aACAM,EAAA,WACA,GAAAthE,GAAAhR,EAAAG,cAAA,QAEA,OADA6Q,GAAAhJ,aAAA,UAAA,UACA,kBAAAgJ,GAAAuhE,WAIAZ,EAAA,WACAN,EAAA,sBACAmB,EAAA,UAEAC,EAAA,mBACAC,EAAA,WACAC,EAAA,GAAAvnE,QACA,aACAqnE,EAAAC,EACAD,EAAAC,EACAD,EAAAC,EACAD,EAAAC,EACAD,EAAAC,EACAD,EAAA,OAmnCA,OA5jCAjC,GAAAzrD,WAMA6rD,EAAA,SAAAgC,GACA,GAAAC,GAAAD,YAAAjC,GAEAptE,EAAAU,KAAAgT,SACAxR,EAAAmtE,EAAA37D,QAEA,OAAA47D,IAAA,IAAAptE,EAAAO,OAEA,GAAA2qE,GACAptE,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,IAEAA,EAAAO,SAAAzC,EAAAyC,QAEA,GAAAwqE,GACAjtE,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAEAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAEAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GACAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,GAAAlC,EAAA,GAAAkC,EAAA,KASAqtE,QAAA,WACA,GAAArhE,GAAA,EAAAxN,KAAA8uE,cACAxvE,EAAAU,KAAAgT,QACA,OAAA,IAAAu5D,GACA/+D,GAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,IAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,GAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IAEAkO,IAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,GAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,IAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IAEAkO,GAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,IAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IACAkO,GAAAlO,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,MAOAwvE,YAAA,WACA,GAAAxvE,GAAAU,KAAAgT,QACA,OAAA1T,GAAA,IAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IAAAA,EAAA,IAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,IAAAA,EAAA,IAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,GAAAA,EAAA,MAeAotE,EAAA5rD,UAAAzhB,EAAAktE,EAAAzrD,UAAAzhB,EAAA,SAAA4I,GACA,MAAAjI,MAAAgT,SAAA/K,IAiFA6kE,EAAA4B,QAAAA,EAGA5B,EAAAvvD,OAAA5gB,EAAAwxE,aAEArB,EAAAjyB,UAKAk0B,eAAA,WAGA9lB,YAAA,EAGA4X,OAAA,OAGAmO,YAAA,EACAC,aAAA,EAIAC,UAAA,GAEAC,SAAA,GACAC,SAAA,EAIAC,UAAA,IAGAjrD,SAAA,IAEAvD,OAAA,cAMAyuD,SAAA,GAGAxC,EAAAhsD,WACAmI,YAAA6jD,EAKAlU,SAAA,WACA,MAAA54D,OAMAyzD,OAAA,WAEAzzD,KAAAuvE,aACAvvE,KAAAwvE,QACAxvE,KAAAg3B,UAAA,GAMAyD,QAAA,WACAz6B,KAAAg3B,UAAA,EACAh3B,KAAAyvE,cACAzvE,KAAA0vE,WAMAC,WAAA,WACA,MAAA3vE,MAAAg3B,UAMA6qB,QAAA,WACA7hD,KAAAy6B,UACA99B,EAAAkgC,WAAA78B,KAAAyY,KAAAs0D,IAQAa,gBAAA,WAEA,GAAA/jB,GAAA7pD,KAAA6pD,OACA7pD,MAAAw8B,WACA/8B,MAAAoqD,EAAAjgD,aACAlK,OAAAmqD,EAAA9/C,cAEA,IAGA6lE,GAHAC,EAAAhmB,EAAAzS,SACA3+B,EAAAzY,KAAAyY,KACAu0D,EAAAhtE,KAAAgtE,KAEAhtE,MAAAmtE,OACAyC,EAAAn3D,EAAAw/B,wBACA23B,GACA5nC,KAAA4nC,EAAA5nC,KAAA6nC,EAAA7nC,KACA1U,IAAAs8C,EAAAt8C,IAAAu8C,EAAAv8C,IACA7zB,MAAAmwE,EAAAnwE,MACAC,OAAAkwE,EAAAlwE,OACAlD,QAAAwrC,KAAA,EAAA1U,IAAA,KAGAs8C,GACA5nC,KAAArrC,EAAAyF,IAAAqW,EAAA,QAAA,IAAA,EACA6a,IAAA32B,EAAAyF,IAAAqW,EAAA,OAAA,IAAA,EACAhZ,MAAAutE,EAAApjE,aACAlK,OAAAstE,EAAAjjE,cACAvN,QACA82B,IAAA32B,EAAAyF,IAAAqW,EAAA,aAAA,IAAA,EACAuvB,KAAArrC,EAAAyF,IAAAqW,EAAA,cAAA,IAAA,IAIAm3D,EAAAE,YAAAnzE,EAAAyF,IAAAqW,EAAA,mBAAA,GAAA9b,EAAAyF,IAAAqW,EAAA,oBAAA,IAAA,EACAm3D,EAAAG,aAAApzE,EAAAyF,IAAAqW,EAAA,kBAAA,GAAA9b,EAAAyF,IAAAqW,EAAA,qBAAA,IAAA,EACAzY,KAAAgwE,WAAAJ,GAQA/3C,MAAA,SAAAn6B,GACAA,EAAA4uE,EAAA5uE,EAEA,IAAAixE,GAAA3uE,KAAAiwE,UAAAjwE,KAAAkwE,eAAAxyE,EACAA,GAAAyyE,QACAnwE,KAAAowE,SAAA,QAAAzB,IAQA0B,UAAA,SAAA3yE,GACAA,EAAA4uE,EAAA5uE,EACA,IAAA4yE,GAAAtwE,KAAAuwE,UAAAvwE,KAAAkwE,eACAxyE,GAAA8yE,OAAAF,EAAA,GACAtwE,KAAA8iB,KAAAwtD,EAAA,GAAA5yE,IAOA+yE,SAAA,SAAA/yE,GACA,GAAA4yE,GAAAtwE,KAAAuwE,UAAAvwE,KAAAkwE,eACAlwE,MAAA0wE,IAAAJ,EAAA,GAAAA,EAAA,GAAAhE,EAAA5uE,KAOAizE,aAAA,SAAAlD,GAIA,IAHA,GAAAh5B,GAAAz0C,KAAAmtE,MAAA,OAAA,QACAF,EAAAjtE,KAAAitE,KACAhlE,EAAAglE,EAAAlrE,OACAkG,KACAtL,EAAA83C,GAAAw4B,EAAAhlE,GAAA,YAAAwlE,IAYAmD,aAAA,SAAAnD,GACA,GAAAR,GAAAjtE,KAAAitE,KACA4D,EAAA5D,EAAA,EAeA,OAdAQ,GACAztE,KAAA2wE,aAAAlD,GAGAA,EAAA9wE,EAAAqD,KAAAmtE,MAAA,OAAA,SAAA0D,EAAA,aAKA,SAAApD,GAAAiB,EAAAnpE,KAAAkoE,IAEAztE,KAAA2wE,aAAAlD,EAAA9wE,EAAAyF,IAAAyuE,EAAA,cAGApD,GAAA,QAQA8C,UAAA,SAAA9C,GACA,GAAAkB,GAAAD,EAAAvhE,KAAAsgE,GAAAztE,KAAA4wE,eAIA,OAHAjC,IACAA,EAAA3oE,QAEA2oE,IAAA,EAAA,EAAA,EAAA,EAAA,EAAA,IAcAsB,UAAA,SAAAtB,EAAAjxE,GACA,IAAAsC,KAAAg3B,SAAA,CACAt5B,IAAAA,MAEA,gBAAAixE,KACAA,EAAA3uE,KAAAuwE,UAAA5B,GAEA,IAAAiB,GAAApzC,EAAAs0C,EAAAC,EAAAC,EAAAC,EAAAjpC,EAAA1U,EAAA7zB,EAAAC,EACA8rC,GAAAmjC,EAAA,GACA9kB,EAAA7pD,KAAA6pD,QACAylB,EAAA,mBAAA5xE,GAAA4xE,QAAA5xE,EAAA4xE,QAAAtvE,KAAAtC,QAAA4xE,OAyDA,OAtDAA,KACAM,EAAA5vE,KAAAkxE,aACA10C,EAAAx8B,KAAAw8B,UACA/8B,EAAAmwE,EAAAnwE,MAAAmwE,EAAAE,YACApwE,EAAAkwE,EAAAlwE,OAAAkwE,EAAAG,aAEAe,EAAArxE,EAAAqB,KAAAC,IAAAyqC,GAAAhP,EAAA/8B,OAAAA,EAAAqB,KAAAC,IAAAyqC,GAAAhP,EAAA/8B,OAAA,EAAA,EACAsxE,EAAArxE,EAAAoB,KAAAC,IAAAyqC,GAAAhP,EAAA98B,QAAAA,EAAAoB,KAAAC,IAAAyqC,GAAAhP,EAAA98B,QAAA,EAAA,EACAsoC,EAAA4nC,EAAA5nC,KAAA4nC,EAAApzE,OAAAwrC,KACA1U,EAAAs8C,EAAAt8C,IAAAs8C,EAAApzE,OAAA82B,IACA,WAAAg8C,GACA0B,EAAAvxE,EAAA+8B,EAAA/8B,MAAAA,EAAA+8B,EAAA/8B,MAAA,EACAwxE,EAAAvxE,EAAA88B,EAAA98B,OAAAA,EAAA88B,EAAA98B,OAAA,EACAoxE,IAAAt0C,EAAA/8B,MAAAA,GAAA,EACAsxE,IAAAv0C,EAAA98B,OAAAA,GAAA,EACAivE,EAAA,GAAA7tE,KAAA6I,IAAA7I,KAAAo8C,IAAAyxB,EAAA,GAAAmC,EAAA9oC,IAAA8oC,EAAA9oC,EAAAgpC,GACArC,EAAA,GAAA7tE,KAAA6I,IAAA7I,KAAAo8C,IAAAyxB,EAAA,GAAAoC,EAAAz9C,IAAAy9C,EAAAz9C,EAAA29C,EAAArB,EAAAG,gBAGAgB,GAAAnB,EAAAG,aAAA,EACAiB,EAAAx0C,EAAA/8B,MAAAA,EAAA+8B,EAAA/8B,MAAAA,EAAA,EACAwxE,EAAAz0C,EAAA98B,OAAAA,EAAA88B,EAAA98B,OAAAA,EAAA,EAEA,WAAAmqD,EAAAznD,IAAA,cAAAmsE,EAAAhpE,KAAA5I,EAAAyF,IAAApC,KAAAyY,KAAA,YAGAu4D,EAAA,EAFAF,EAAAC,EAAA,EAIApC,EAAA,GAAA7tE,KAAAo8C,IACAp8C,KAAA6I,IAAAglE,EAAA,GAAAmC,EAAA9oC,IACA8oC,EAAA9oC,EAAAgpC,GAEArC,EAAA,GAAA7tE,KAAAo8C,IACAp8C,KAAA6I,IAAAglE,EAAA,GAAAoC,EAAAz9C,IACAy9C,EAAAz9C,EAAA29C,KAIA,SAAAvzE,EAAAsuC,SAEAhsC,KAAAipD,YAAAvrD,EAAAsuC,SAGAtuC,EAAAu/C,OACAj9C,KAAAmxE,WAAAtwE,IAAA2qC,GAIAxrC,KAAA2wE,aAAA,UAAAhC,EAAA1oE,KAAA,KAAA,KAEAvI,EAAAyyE,QACAnwE,KAAAowE,SAAA,SAAAzB,GAGAA,IAMAyC,UAAA,WACA,MAAApxE,MAAAstE,SAOArkB,WAAA,SAAA7sB,GACA,GAAAp8B,KAAAqxE,YAIA,IAHA,GAAApoB,GAAA7sB,IAAAp8B,KAAAtC,QAAAurD,WAAA,OAAAjpD,KAAAqxE,YACApE,EAAAjtE,KAAAitE,KACAhlE,EAAAglE,EAAAlrE,OACAkG,KAEAtL,EAAAP,MAAA6wE,EAAAhlE,GAAA,gBAAAghD,GACAtsD,EAAAP,MAAA6wE,EAAAhlE,GAAA,aAAAghD,IAeAynB,IAAA,SAAA/D,EAAAC,EAAAlvE,GACA,IAAAsC,KAAAtC,QAAAsxE,WAAA,CACAtxE,IAAAA,KACA,IAAAixE,GAAAjxE,EAAAixE,MACAA,KACAA,EAAA3uE,KAAAuwE,aAGA7yE,EAAA6xB,WACAo9C,IAAAgC,EAAA,GACA/B,IAAA+B,EAAA,IAEAA,EAAA,GAAAhC,EACAgC,EAAA,GAAA/B,EACA5sE,KAAAiwE,UAAAtB,EAAAjxE,GACAA,EAAAyyE,QACAnwE,KAAAowE,SAAA,MAAAzB,EAAA,GAAAA,EAAA,MAqBA7rD,KAAA,SAAA0oB,EAAA9lC,GAEA,gBAAA8lC,IACA9lC,EAAA8lC,EACAA,EAAA,MACA9lC,IACAA,KAEA,IAAAhI,GAAAf,EAAAke,UAAA7a,KAAAtC,QAAAgI,EAEA,KAAAhI,EAAAuxE,YAAA,CACA,GAAAjjC,IAAA,EACA2iC,EAAAjxE,EAAAixE,QAAA3uE,KAAAuwE,WAGA,iBAAA/kC,KACAA,GAAAmjC,EAAA,GAAAjxE,EAAAwxE,WAAA1jC,KAAA,GACAQ,GAAA,GAIAR,EAAA9tC,EAAA0xE,SACA5jC,EAAA9tC,EAAA0xE,SACA5jC,EAAA9tC,EAAAyxE,WACA3jC,EAAA9tC,EAAAyxE,SAIA,IAAAmC,GAAA5zE,EAAA4zE,KACA,IAAAA,IAAA5zE,EAAAsxE,WAAA,CAGA,GAAAY,GAAA5vE,KAAAkxE,aACAnvC,EAAAuvC,EAAAvvC,QACAI,EAAAmvC,EAAAnvC,OAEAniC,MAAAmtE,QACAprC,IAAA6tC,EAAAnwE,MAAAmwE,EAAAE,aAAA,EACA3tC,IAAAytC,EAAAlwE,OAAAkwE,EAAAG,cAAA,EAEA,IAAAwB,GAAA,GAAA7E,GAAA3qC,EAAAI,EAAA,GACAqvC,EAAA,GAAAjF,GAAAoC,GAEApb,EAAAvzD,KAAAq4C,cAAAr4C,KAAA6pD,QAAAzS,SACAq6B,EAAA,GAAAlF,GAAA,EAAA,EAAAhZ,EAAAvrB,KAAAhoC,KAAAktE,KAAAlrC,aAAA,EAAA,EAAAuxB,EAAAjgC,IAAAtzB,KAAAktE,KAAA9qC,aACAsvC,EAAAF,EAAA3C,UAAAlC,EAAA8E,EAAA5C,UAAAlC,EAAA4E,IACAI,EAAAnmC,EAAAmjC,EAAA,EACA6C,GAAAA,EAAA7E,EAAA,GAAAJ,IAAAoF,EAAA,EAAA,EAAAA,EAAA,EAAA,KACAJ,EAAAE,EAAA9E,EAAA6E,EAAA7E,EAAA+E,IACA/C,EAAA,IAAAA,EAAA,IAAA5sC,EAAAwvC,EAAAlyE,EAAA,IACAsvE,EAAA,IAAAA,EAAA,IAAAxsC,EAAAovC,EAAAlyE,EAAA,IAIAsvE,EAAA,GAAAnjC,EACAmjC,EAAA,GAAA,gBAAAjxE,GAAA8yE,OAAA9yE,EAAA8yE,OAAAhlC,EAGAxrC,KAAAiwE,UAAAtB,GACA3iC,QAAA,iBAAAtuC,GAAAsuC,QAAAtuC,EAAAsuC,QAAAA,EAEAiR,OAAAv/C,EAAAk0E,aAIAl0E,EAAAyyE,QACAnwE,KAAAowE,SAAA,OAAAzB,EAAA,GAAAjxE,KASAonC,OAAA,SAAAlrB,EAAAhM,GACA,GAAAlQ,EACA,KAAAkc,EAEA,MAAAjd,GAAAke,UAAA7a,KAAAtC,QAGA,IAAA,gBAAAkc,GAAA,CACA,GAAA,IAAArH,UAAAxQ,OACA,MAAAlC,UAAAG,KAAAtC,QAAAkc,GACA5Z,KAAAtC,QAAAkc,GACA,IAEAlc,MACAA,EAAAkc,GAAAhM,MAEAlQ,GAAAkc,CAGA5Z,MAAA6xE,YAAAn0E,IAOAm0E,YAAA,SAAAn0E,GACAf,EAAAiD,KAAAlC,EAAAf,EAAAiuB,MAAA,SAAAhR,EAAAhM,GACA,OAAAgM,GACA,IAAA,aACA5Z,KAAAyvE,aAEA,KAAA,UACA,IAAA,WACA,IAAA,aACA,IAAA,SACA,IAAA,cACA,IAAA,UACA,IAAA,WACA,IAAA,SACA,IAAA,QACA,IAAA,QACA,IAAA,UACA,IAAA,iBACAzvE,KAAA0vE,UAGA,OADA1vE,KAAAtC,QAAAkc,GAAAhM,EACAgM,GACA,IAAA,aACA5Z,KAAAuvE,YAEA,KAAA,UACA,IAAA,WACA,IAAA,aACA,IAAA,SAEAvvE,KAAA4Z,GAAAhM,CAEA,KAAA,cACA,IAAA,UACA,IAAA,WACA,IAAA,SACA,IAAA,QACA,IAAA,QACA,IAAA,UACA,IAAA,iBACA5N,KAAAwvE,OACA,MACA,KAAA,SACA7yE,EAAAP,MAAA4D,KAAAyY,KAAA,SAAA7K,EACA,MACA,KAAA,WACA5N,KAAAmxE,WAAA1wE,KAAA,MAAAmN,EACA,MACA,KAAA,WACA5N,KAAAmxE,WAAA1wE,KAAA,MAAAmN,EACA,MACA,KAAA,YACA5N,KAAAmxE,WAAA1wE,KAAA,OAAAmN,EACA,MACA,KAAA,iBACA5N,KAAAutE,iBACA,MACA,KAAA,WACA,IAAA,SACAvtE,KAAA2tE,kBAEA,KAAA,aACA3tE,KAAAipD,YACA,MACA,KAAA,OACAr7C,YAAAjR,IAAAiR,EAAA7L,SACA/B,KAAAitE,KAAAr/D,EAEA5N,KAAAuvE,aACAvvE,KAAAutE,qBAGAvtE,QAMAuvE,WAAA,WACA,GAAAvvD,IAEA8xD,sBAAA,SAEAC,mBAAA/xE,KAAAmtE,MAAA,MAAA,UAGAntE,MAAAtC,QAAAsxE,aACAhvD,EAAA6gD,OAAA7gE,KAAAtC,QAAAmjE,QAEA7gE,KAAAitE,KAAA7qE,IAAA4d,EAGA,IAAA6pC,GAAA7pD,KAAA6pD,OAEAA,GAAA9nD,SAAApF,EAAA6I,SAAAqkD,EAAA,GAAA,UACA7pC,GACA0C,SAAA,UAEA,WAAAmnC,EAAAznD,IAAA,cACA4d,EAAAzd,SAAA,YAEAsnD,EAAAznD,IAAA4d,KAOAyvD,YAAA,WACAzvE,KAAAgtE,MAAA5qE,KACAy+D,OAAA,GACA5X,WAAA,KAEAjpD,KAAA6pD,QAAAznD,KACAsgB,SAAA,GACAngB,SAAA,MAOAitE,MAAA,WACA,GAAA/2C,GAAAz4B,KACAtC,EAAAsC,KAAAtC,QACAiO,EAAAjO,EAAAqxE,eACAiD,EAAA5D,EAAA,cAAAziE,EAAA,aAAAA,EAAA,aAAAA,EACAsmE,EAAA7D,EAAA,YAAAziE,EAAA,WAAAA,EAAA,SAAAA,EACA4R,KACA20D,EAAAlyE,KAAAkyE,OACAf,EAAAnxE,KAAAmxE,UAsDA,IAnDAx0E,EAAAiD,MAAA,QAAA,SAAA,OAAA,MAAA,MAAA,SAAA,WACA,GAAAmrB,GAAArtB,EAAA,KAAAsC,KACArD,GAAA4b,WAAAwS,KACAxN,EAAA,UAAAvd,KAAAU,cAAAiL,GAAAof,KAMArtB,EAAAsxE,YAAAtxE,EAAAuxE,cACA1xD,EAAAy0D,GAAA,SAAA3yE,GACA,GAAA6uE,IACA,eAAA7uE,EAAAuJ,OAEAslE,EAAA7uE,EAAA6uE,WACA,IAAAA,EAAAnsE,QAAArE,EAAAsxE,aAAA,IAAAd,EAAAnsE,OAEArE,EAAAsxE,YAAA,IAAA3vE,EAAA+hB,SAEA/hB,EAAAkhC,iBACAlhC,EAAA2hC,kBACAvI,EAAA05C,WAAA9yE,EAAA6uE,MAIAluE,KAAAgtE,MAAAp7D,GAAA2L,GAGA20D,EAAAnwE,QACAmwE,EAAAtgE,GAAAqgE,EAAA,SAAA5yE,GACAA,EAAAkhC,iBACA9H,EAAAZ,UAKAs5C,EAAApvE,QACAovE,EAAA1wE,MAGAsqC,KAAArtC,EAAA2xE,YAAAvC,EAAAjyB,SAAAw0B,WACA8B,EAAA1wE,KAAA,SACA/C,EAAA2xE,UACAnyB,IAAAx/C,EAAAyxE,SACAxlE,IAAAjM,EAAA0xE,WACAzuD,MACA/S,MAAA5N,KAAAuwE,YAAA,MAKA7yE,EAAAuxE,YAAA,CAIA,GAAAmD,GAAApyE,KAAAoyE,QACAC,EAAAryE,KAAAqyE,QAIAD,GAAArwE,QAAAswE,EAAAtwE,SAEAqwE,EAAAxgE,GAAAqgE,EAAA,SAAA5yE,GACAA,EAAAkhC,iBACA9H,EAAA3V,SAEAuvD,EAAAzgE,GAAAqgE,EAAA,SAAA5yE,GACAA,EAAAkhC,iBACA9H,EAAA3V,MAAA,MAIAquD,EAAApvE,SACAwb,KAEAA,GAAA6wD,EAAA,cAAA,aAAAziE,GAAA,WACA8sB,EAAAwwB,YAAA,IAIA1rC,GAAA8wD,EAAA,QAAA,UAAA1iE,GAAA,WACA8sB,EAAA3V,MAAA9iB,KAAA4N,OAAAgkE,YAAA,KAEAT,EAAAv/D,GAAA2L,MAOAmyD,QAAA,WACA1vE,KAAAgtE,MACAvvD,IAAAzd,KAAAoyE,SACA30D,IAAAzd,KAAAqyE,UACA50D,IAAAzd,KAAAkyE,QACA91C,IAAAp8B,KAAAtC,QAAAqxE,iBAMAxB,gBAAA,WAIA,MAAAvtE,MAAAkwE,eAAAlwE,KAAA4wE,aAAA5wE,KAAAtC,QAAA40E,iBAOA3E,iBAAA,WACA,GAAA3tE,KAAAwtE,WAAA,CACA,GAAA9vE,GAAAsC,KAAAtC,OACAsC,MAAAqxE,YAAArxE,KAAAwtE,WAAA,IAAA9vE,EAAA0mB,SAAA,MAAA1mB,EAAAmjB,SAOAqwD,WAAA,WACA,GAAAtB,GAAA5vE,KAAAgwE,UAKA,OAHAJ,GAAAnwE,OAAAmwE,EAAAlwE,QACAM,KAAA4tE,kBAEA5tE,KAAAgwE,YASAuC,aAAA,SAAArE,GACA,GAAAsE,GAAAtE,EAAA,GACAuE,EAAAvE,EAAA,EACA,OAAAptE,MAAAqK,KAAArK,KAAAoK,IAAApK,KAAAC,IAAA0xE,EAAA1wC,QAAAywC,EAAAzwC,SAAA,GAAAjhC,KAAAoK,IAAApK,KAAAC,IAAA0xE,EAAAtwC,QAAAqwC,EAAArwC,SAAA,KAOAuwC,WAAA,SAAAxE,GACA,GAAAsE,GAAAtE,EAAA,GACAuE,EAAAvE,EAAA,EACA,QACAnsC,SAAA0wC,EAAA1wC,QAAAywC,EAAAzwC,SAAA,EAAAywC,EAAAzwC,QACAI,SAAAswC,EAAAtwC,QAAAqwC,EAAArwC,SAAA,EAAAqwC,EAAArwC,UAUAiuC,SAAA,SAAA32D,GACA,gBAAAA,KACAA,EAAA,UAAAA,GAEAzZ,KAAAgtE,MAAA7wC,eAAA1iB,GAAAzZ,MAAAib,OAAA9d,EAAAC,KAAAmV,UAAA,MASA4/D,WAAA,SAAA14D,EAAAy0D,GACA,GAAAyE,GAAAC,EAAAC,EACAC,EAAAC,EAAAC,EACAC,EAAAC,EACAz6C,EAAAz4B,KACAtC,EAAAsC,KAAAtC,QACAiO,EAAAjO,EAAAqxE,eACAJ,EAAA3uE,KAAAuwE,YACA9uC,EAAAktC,EAAAxxE,MAAA,GACAg2E,GAAA1xC,EAAA,GACA2xC,GAAA3xC,EAAA,GACA4xC,GAAA1E,OAAAA,EAAA3iC,QAAA,OAGAoiC,IACAwE,EAAA,cACAC,EAAA,aACA,eAAAp5D,EAAA7Q,MACAgqE,EAAA,YACAC,EAAA,aAEAD,EAAA,YACAC,EAAA,WAIAD,GAAAjnE,EACAknE,GAAAlnE,EAGA3L,KAAAipD,YAAA,GAGAjpD,KAAAstE,SAAA,EAGAttE,KAAAowE,SAAA,QAAA32D,EAAAy0D,GAEAA,GAAA,IAAAA,EAAAnsE,QACA+wE,EAAA9yE,KAAAuyE,aAAArE,GACA6E,GAAApE,EAAA,GACAqE,EAAAhzE,KAAA0yE,WAAAxE,GACAyE,EAAA,SAAAtzE,GACAA,EAAAkhC,gBAGA,IAAA+yC,GAAA76C,EAAAi6C,WAAAxE,EAAA7uE,EAAA6uE,SACAthD,EAAA6L,EAAA85C,aAAArE,GAAA4E,CAGAr6C,GAAA3V,KAAA8J,GAAAlvB,EAAAwxE,UAAA,KAAA6D,GACAzB,MAAAgC,EACA3E,OAAAA,EACA3iC,SAAA,IAIAvT,EAAAi4C,KACA/B,EAAA,GAAA2E,EAAAvxC,QAAAixC,EAAAjxC,SACA4sC,EAAA,GAAA2E,EAAAnxC,QAAA6wC,EAAA7wC,QACAkxC,GAEAL,EAAAM,KAGAL,EAAAx5D,EAAAqoB,MACAoxC,EAAAz5D,EAAAyoB,MAMAywC,EAAA,SAAAtzE,GACAA,EAAAkhC,iBACA9H,EAAAi4C,IACAyC,EAAA9zE,EAAAyiC,MAAAmxC,EACAG,EAAA/zE,EAAA6iC,MAAAgxC,EACAG,KAMA12E,EAAAZ,GACAqgC,IAAAzwB,GACAiG,GAAAghE,EAAAD,GACA/gE,GAAAihE,EAAA,SAAAxzE,GACAA,EAAAkhC,iBAEA5jC,EAAAqD,MAAAo8B,IAAAzwB,GACA8sB,EAAA60C,SAAA,EAIAjuE,EAAAuJ,KAAA,aACA6vB,EAAA23C,SAAA/wE,EAAAsvE,GAAAtC,EAAAsC,EAAAltC,QAMA9kC,EAAAmwE,QAAAA,EAQAnwE,EAAAoV,GAAAwhE,QAAA,SAAA71E,GACA,GAAAk7D,GAAAtmD,EAAAyY,EAAA1Q,CAGA,OAAA,gBAAA3c,IACA2c,KACA/H,EAAAnV,EAAAC,KAAAmV,UAAA,GACAvS,KAAAJ,KAAA,WACAg5D,EAAAj8D,EAAAsD,KAAAD,KAAA+sE,GAEAnU,EAIA,MAAAl7D,EAAA+Q,OAAA,IACA,mBAAAsc,EAAA6tC,EAAAl7D,KAEAmC,UAAAkrB,EAAAA,EAAAjW,MAAA8jD,EAAAtmD,KAEA+H,EAAA/T,KAAAykB,GARA1Q,EAAA/T,KAAAzG,UAeAwa,EAAAtY,OACA,IAAAsY,EAAAtY,OAAAsY,EAAA,GAAAA,EACAra,MAGAA,KAAAJ,KAAA,WAAA,GAAAktE,GAAA9sE,KAAAtC,MAGAovE,ICvtCA,SAAAztE,EAAAq/B,EAAAxF,GAAA,kBAAA91B,SAAAA,OAAAC,IAAAD,QAAA,UAAA,SAAA+1B,GAAA,MAAAD,GAAAC,EAAA95B,EAAAq/B,GAAAvF,EAAAq6C,SAAAt6C,EAAA75B,EAAA3C,OAAA2C,EAAAq/B,IAAA1+B,KAAAjE,SAAA,SAAAsD,EAAAq/B,EAAAxF,EAAAC,IAAA,SAAA95B,EAAAq/B,EAAAxF,EAAAC,GAAA,QAAAwzC,GAAAttE,GAAA,KAAAA,GAAA,mBAAAA,GAAA6hC,eAAA7hC,EAAAA,EAAA6hC,aAAA,OAAA7hC,GAAA,QAAAo0E,GAAA/0C,EAAAxF,GAAA,GAAAvpB,GAAA4jD,EAAAj0D,EAAA8d,EAAA1U,EAAA+E,EAAAw9B,EAAAz9B,EAAAoa,EAAA3f,EAAAy2B,EAAA91B,IAAA,IAAA81B,EAAAr/B,EAAA6gC,MAAAxB,GAAAA,EAAA91B,KAAAswB,EAAAvpB,EAAA+uB,EAAAwC,cAAAqyB,EAAAl0D,EAAAoa,MAAAoI,MAAA5Z,EAAAyrE,OAAA,uBAAAngB,EAAAiZ,GAAA78D,EAAA,IAAAs7B,EAAAsoB,EAAAxxD,OAAAqb,EAAA6tB,GAAA7tB,EAAAm2C,IAAAtoB,GAAAvM,EAAAthB,GAAAzN,EAAAyN,EAAA,IAAAnV,EAAAyrE,OAAA,6BAAAh1C,EAAAtd,QAAAsd,EAAAtd,MAAA,GAAAnZ,EAAAyrE,OAAA,iBAAAp0E,EAAAqtE,EAAAh9D,GAAA1H,EAAA3I,EAAA4uE,QAAAxlE,EAAApJ,EAAAq0E,eAAAlmE,EAAAxF,GAAAA,EAAAlG,OAAAkG,EAAA,GAAAS,GAAAA,EAAA3G,OAAA2G,EAAA,GAAAywB,EAAA1rB,GAAA,IAAAD,EAAA,EAAAoa,EAAAnT,EAAA1S,OAAAyL,EAAAoa,EAAApa,IAAA4P,EAAA3I,EAAAjH,GAAAkxB,EAAAthB,GAAA3P,EAAA2P,EAAA,OAAAshB,GAAA,QAAAk1C,GAAAl1C,GAAA,IAAA,GAAAvF,GAAAxpB,EAAAupB,KAAAwF,GAAA,CAAAvF,EAAA95B,EAAAY,KAAAy+B,EAAAz2B,EAAA,KAAA0H,IAAAwpB,GAAAA,EAAAxpB,KAAAupB,EAAAvpB,GAAAupB,EAAA26C,mBAAA,EAAAn1C,GAAAA,EAAAp5B,WAAA,MAAA4zB,GAAA,QAAA46C,GAAAp1C,EAAAxF,GAAA,IAAA,GAAAC,GAAAuF,GAAA,CAAA,GAAAvF,EAAA95B,EAAAY,KAAAy+B,EAAAz2B,GAAAkxB,KAAAD,GAAAC,EAAAD,IAAA,MAAAwF,EAAAA,GAAAA,EAAAp5B,WAAA,MAAA,MAAA,QAAAugE,KAAA4G,GAAA,EAAA,QAAAsH,KAAAtH,GAAA,EAAA,QAAAuH,KAAAC,EAAA,EAAArsD,EAAA7lB,OAAA,EAAAgpB,GAAA,EAAAgpD,IAAA,QAAAG,KAAArO,IAAA,QAAAsO,KAAAt8D,IAAAnP,EAAA3B,WAAA,WAAA2B,EAAA,EAAAsrE,KAAA30E,EAAA+0E,OAAAC,oBAAA,QAAAx8D,KAAAnP,IAAAN,aAAAM,GAAAA,EAAA,GAAA,QAAA4rE,GAAA51C,EAAAxF,EAAAC,GAAA,GAAAlxB,EAAA,QAAAkxB,GAAAA,EAAAuF,KAAAvF,GAAA26C,EAAA56C,EAAA96B,OAAAsgC,MAAAz2B,EAAAwrE,EAAAv6C,EAAAwF,GAAAr/B,EAAA65B,EAAA96B,QAAAyhC,QAAA53B,IAAAA,EAAA,QAAAssE,GAAA71C,GAAA,GAAAxF,GAAA75B,EAAAY,KAAAy+B,EAAAtgC,OAAAuR,EAAA,MAAAob,GAAAkpD,GAAAA,IAAA/6C,GAAA,CAAA,GAAAC,GAAAm7C,EAAA,IAAA51C,EAAA91B,KAAA81B,EAAAvF,KAAAA,EAAAqH,sBAAA9B,EAAA6B,iBAAApH,EAAAmH,wBAAA5B,EAAAsC,kBAAA7H,EAAA4H,iCAAArC,EAAAwE,6BAAA,QAAAsxC,GAAA91C,GAAA,GAAAvF,GAAAlxB,EAAAixB,EAAAyzC,EAAAjuC,GAAAwvC,OAAA,IAAAh1C,GAAA,IAAAA,EAAAn3B,SAAAo3B,EAAAuF,EAAAtgC,OAAA6J,EAAA2rE,EAAAz6C,GAAAlxB,EAAA4rE,mBAAA,CAAAI,EAAA1mE,IAAAlO,EAAAY,KAAAk5B,EAAAxpB,EAAAskE,GAAAp8D,IAAAq8D,IAAA1mE,GAAA,CAAA,IAAA+lD,GAAAoZ,EAAAjuC,GAAAwvC,QAAA,EAAAzgE,GAAA8lD,EAAAzxB,MAAAmJ,EAAAsoB,EAAArxB,MAAAoyC,EAAA,aAAA51C,EAAAz2B,GAAAqsE,EAAA,aAAA51C,EAAAz2B,IAAA,QAAAwsE,GAAAp1E,GAAAotE,IAAAj/D,GAAA8mE,EAAA,eAAAj1E,EAAAu0E,EAAAv0E,EAAAjB,SAAAoP,GAAA,EAAA2mE,KAAA,QAAAv+D,GAAA8oB,GAAA,IAAA+tC,EAAA,CAAA,GAAAvzC,GAAAyzC,EAAAjuC,GAAAwvC,QAAA,GAAA/0C,EAAA3rB,EAAAvF,EAAA5I,EAAA+0E,OAAAM,sBAAA/kE,EAAAikE,EAAAl1C,EAAAtgC,OAAAoP,GAAAA,GAAA1M,KAAAC,IAAAm4B,EAAA4I,MAAAr0B,GAAAxF,GAAAnH,KAAAC,IAAAm4B,EAAAgJ,MAAA+I,GAAAhjC,EAAAuF,IAAA2rB,GAAAm7C,EAAA,eAAA51C,EAAA/uB,GAAA2kE,EAAA,aAAA51C,EAAA/uB,GAAAwkE,KAAA,QAAAQ,GAAAt1E,GAAA,IAAAotE,EAAA,CAAAsH,GAAA,IAAA76C,GAAAwF,EAAAk1C,EAAAv0E,EAAAjB,OAAA,IAAAk2E,EAAA,WAAAj1E,EAAAq/B,IAAAlxB,EAAA,CAAA,GAAA2rB,GAAAm7C,EAAA,SAAAj1E,EAAAq/B,EAAAvF,IAAAA,EAAAqH,uBAAAtH,EAAAyzC,EAAAttE,GAAAs0E,eAAA,GAAA/rD,EAAAthB,MAAAsuE,QAAAX,EAAAtH,EAAAzzC,EAAA6I,QAAA6qC,EAAA1zC,EAAAiJ,UAAApX,GAAA,GAAAupD,EAAA,YAAAj1E,EAAAq/B,GAAAlxB,GAAA,EAAA2mE,KAAA,QAAAU,GAAAn2C,GAAA,GAAAvF,GAAAD,EAAA75B,EAAAY,KAAAy+B,EAAAz2B,EAAA,IAAAixB,EAAA,IAAAC,IAAAD,GAAA,GAAAA,EAAAC,GAAA,OAAA,CAAA,QAAA,EAAA,QAAA27C,MAAA,QAAAC,GAAAr2C,GAAA,GAAAxF,GAAAwF,EAAAzqB,OAAA,EAAA,QAAAwrB,MAAA,SAAAtG,EAAAxpB,GAAAklE,EAAA70E,OAAAX,EAAAY,KAAAD,KAAAiI,KAAA,IAAAsrD,GAAAl0D,EAAAY,KAAAD,KAAAiI,EAAAsrD,GAAA70B,IAAA,EAAAthB,EAAAshB,IAAAthB,EAAAshB,IAAA,GAAA,EAAA,IAAAthB,EAAAshB,IAAAl9B,EAAAyuC,KAAA/W,EAAAq7C,GAAAl1E,EAAAW,MAAAiwC,KAAA/W,EAAA47C,GAAAlI,IAAAxvD,EAAA43D,YAAA53D,EAAA43D,YAAA,GAAA,EAAA,IAAA53D,EAAA43D,YAAAxzE,EAAAyuC,KAAA,aAAAukC,GAAAvkC,KAAA,WAAA0kC,GAAA1kC,KAAA,YAAAr6B,GAAAq6B,KAAA,SAAAwkC,KAAA70C,SAAA,SAAAzG,EAAAxpB,KAAAyN,EAAAshB,GAAAthB,EAAAshB,IAAAl9B,EAAA0uC,OAAAhX,EAAAq7C,GAAA3H,MAAAxvD,EAAA43D,WAAA53D,EAAA43D,YAAAxzE,EAAA0uC,OAAA,aAAAskC,GAAAtkC,OAAA,YAAAt6B,GAAAs6B,OAAA,WAAAykC,GAAAzkC,OAAA,SAAAukC,GAAA,IAAAlhB,GAAAl0D,EAAAW,MAAAyU,EAAApV,EAAAY,KAAAD,KAAAiI,EAAAwM,KAAAA,EAAAiqB,IAAA,GAAA60B,EAAArjB,OAAAhX,EAAA47C,GAAAD,EAAA70E,OAAAuzD,EAAA12B,WAAA50B,KAAA,GAAAgtE,GAAAhtE,EAAA,uBAAA0H,EAAA,iBAAA4jD,EAAA,0EAAAztD,MAAA,KAAA2O,EAAA,8CAAA3O,MAAA,KAAAxG,EAAAD,EAAAoa,MAAA4nB,WAAAhiC,EAAAoa,MAAA4nB,WAAAxf,SAAA2qD,EAAAntE,EAAAoa,MAAAoI,MAAA5G,OAAA3b,GAAA8d,KAAA1U,EAAA,EAAA+E,EAAA,EAAAw9B,EAAA,EAAAz9B,GAAA,EAAAoa,KAAAmD,GAAA,EAAA0hD,GAAA,EAAAG,EAAA,oBAAA1zC,GAAA13B,EAAAnC,EAAA65B,GAAA3rB,EAAA,EAAA0mE,EAAA,CAAA50E,GAAA+0E,QAAAM,sBAAA,GAAAQ,uBAAA,GAAAb,mBAAA,KAAA,KAAA,GAAAc,GAAA,EAAAA,EAAA5hB,EAAAxxD,OAAAozE,IAAA91E,EAAAoa,MAAAmlB,QAAA20B,EAAA4hB,IAAAJ,EAAAxhB,EAAA4hB,GAAAvI,IAAA1zC,EAAA7xB,iBAAA,QAAA,SAAAq3B,GAAA,GAAAz2B,GAAAsrD,EAAA9+C,EAAAnV,EAAAktE,EAAApvD,EAAA8b,EAAAtR,EAAA7lB,OAAAo3B,EAAAuF,EAAAtgC,MAAA,IAAA86B,EAAA,IAAAjxB,EAAAy2B,EAAAqD,QAAAwxB,EAAA70B,EAAAyD,QAAA8yC,EAAA51E,EAAA+0E,OAAAc,uBAAAzgE,EAAA0kB,EAAA1kB,GAAA,CAAA,IAAAnV,EAAA,EAAAA,EAAA45B,EAAA55B,IAAA,GAAAktE,EAAA5kD,EAAAtoB,GAAA8d,EAAA,EAAA3I,IAAA0kB,GAAAr4B,KAAAC,IAAAyrE,EAAAG,EAAA1kE,GAAAgtE,GAAAn0E,KAAAC,IAAAyrE,EAAAI,EAAArZ,GAAA0hB,GAAA51E,EAAAY,KAAAwU,EAAA9E,KAAA68D,EAAAoI,QAAA,MAAAl2C,GAAA6B,qBAAA7B,GAAAsC,iBAAAvsB,GAAAA,EAAAnP,cAAA,IAAAjG,EAAAq/B,EAAAxF,GAAA,SAAA75B,GAAAA,EAAAm0E,WAAAn0E,GAAA,SAAAA,EAAAq/B,GAAA,GAAAvF,IAAA80C,MAAA,cAAA/0C,GAAA75B,GAAAm0E,OAAAr4D,QAAA9b,EAAAm0E,OAAAr4D,YAAA9b,EAAAwb,OAAAxb,EAAA8b,QAAAge,GAAA95B,EAAAwb,OAAAxb,EAAAm0E,OAAAr4D,QAAAge,IAAA95B,GAAA,SAAAA,EAAAq/B,EAAAvF,GAAA,QAAA/b,GAAAshB,EAAAxF,EAAAC,GAAA,GAAAlxB,GAAAkxB,EAAAvwB,IAAAuwB,GAAAvwB,KAAAswB,EAAA75B,EAAAoa,MAAA2lB,SAAAhiC,KAAAshC,EAAAvF,GAAAA,EAAAvwB,KAAAX,EAAA,GAAAA,GAAA5I,EAAA65B,EAAA75B,GAAAO,KAAA,8FAAAkG,MAAA,KAAA,SAAA44B,EAAAxF,GAAA75B,EAAA0S,GAAAmnB,GAAA,SAAA75B,GAAA,MAAAA,GAAAW,KAAAiwC,KAAA/W,EAAA75B,GAAAW,KAAA6/B,QAAA3G,IAAA75B,EAAA+1E,SAAA/1E,EAAA+1E,OAAAl8C,IAAA,IAAA,IAAAvpB,GAAAtQ,EAAAm0E,OAAAr4D,QAAA8yD,MAAA1a,EAAA,mBAAA9+C,EAAA9E,EAAA,aAAA,YAAArQ,EAAAqQ,EAAA,WAAA,UAAA68D,EAAA78D,EAAA,YAAA,WAAAtQ,GAAAoa,MAAAmlB,QAAAy2C,aAAAt+C,SAAA,EAAA0I,MAAA,WAAA,QAAA9vB,GAAAtQ,EAAA65B,GAAAC,EAAAD,EAAA9b,EAAAshB,EAAAvF,EAAA,cAAA,aAAA95B,GAAA,GAAA85B,GAAAlxB,EAAAy2B,EAAA1+B,KAAAk5B,EAAA75B,EAAAq/B,EAAAxF,GAAA+W,KAAAsjB,EAAA,SAAA70B,GAAAr/B,EAAAoa,MAAAmlB,QAAAy2C,YAAAt+C,UAAAoC,GAAAxpB,EAAA+uB,GAAA,GAAAt2B,aAAAH,GAAAA,EAAAlB,WAAA,WAAA4I,EAAA+uB,GAAA,IAAA,SAAAr/B,EAAAoa,MAAAmlB,QAAA02C,KAAAC,iBAAA,IAAA91C,MAAA,WAAA,GAAAf,GAAA1+B,KAAAk5B,EAAA75B,EAAAq/B,EAAAxF,GAAA+W,KAAA,aAAA,SAAA9W,GAAA,QAAA75B,KAAA8I,aAAAqM,GAAA,QAAA+3D,KAAAltE,IAAA45B,EAAAgX,OAAA,SAAAxnC,GAAAwnC,OAAA,WAAA5wC,GAAA2I,EAAAioC,OAAA,eAAAs8B,GAAA,QAAA9jE,GAAArJ,GAAAmtE,IAAA78D,IAAAtQ,EAAAjB,QAAAgf,EAAAshB,EAAA,MAAAr/B,GAAA,GAAA85B,EAAA/X,OAAA,IAAA+X,EAAA/X,MAAA,OAAA,CAAA,IAAA3M,GAAA9E,EAAAwpB,EAAA/6B,MAAA+6B,GAAA+H,aAAAhI,GAAA+W,KAAA,WAAA3wC,GAAA2wC,KAAA,SAAAvnC,GAAAT,EAAAgoC,KAAA,eAAAu8B,GAAA/3D,EAAA1N,WAAA,WAAAqW,EAAAshB,EAAA,UAAAr/B,EAAA6gC,MAAA,WAAA9hC,OAAAuR,MAAAtQ,EAAAoa,MAAAmlB,QAAA02C,IAAAC,sBAAAl2E,EAAAoa,MAAAmlB,QAAA42C,OAAAC,0BAAA,GAAAC,kBAAA,IAAAC,4BAAA,GAAAC,0BAAA,GAAAxyD,MAAA,SAAAsb,GAAA,GAAAxF,GAAAwF,EAAAwC,cAAAgtC,QAAAxvC,EAAAwC,cAAAgtC,QAAA,GAAAxvC,CAAA,QAAAyO,MAAA,GAAAp5B,OAAAC,UAAA46B,QAAA1V,EAAA4I,MAAA5I,EAAAgJ,OAAA2zC,OAAAx2E,EAAAq/B,EAAAtgC,UAAAymB,KAAA,SAAAxlB,GAAA,GAAAq/B,GAAAr/B,EAAA6hC,cAAAgtC,QAAA7uE,EAAA6hC,cAAAgtC,QAAA,GAAA7uE,CAAA,QAAA8tC,MAAA,GAAAp5B,OAAAC,UAAA46B,QAAAlQ,EAAAoD,MAAApD,EAAAwD,SAAA4zC,YAAA,SAAAp3C,EAAAxF,GAAAA,EAAAiU,KAAAzO,EAAAyO,KAAA9tC,EAAAoa,MAAAmlB,QAAA42C,MAAAE,mBAAA50E,KAAAC,IAAA29B,EAAAkQ,OAAA,GAAA1V,EAAA0V,OAAA,IAAAvvC,EAAAoa,MAAAmlB,QAAA42C,MAAAG,6BAAA70E,KAAAC,IAAA29B,EAAAkQ,OAAA,GAAA1V,EAAA0V,OAAA,IAAAvvC,EAAAoa,MAAAmlB,QAAA42C,MAAAI,2BAAAl3C,EAAAm3C,OAAAh2C,QAAA,SAAAA,QAAAnB,EAAAkQ,OAAA,GAAA1V,EAAA0V,OAAA,GAAA,YAAA,eAAAnP,MAAA,WAAA,GAAAf,GAAA1+B,KAAAk5B,EAAA75B,EAAAq/B,EAAAxF,GAAA+W,KAAAx7B,EAAA,SAAAiqB,GAAA,QAAA60B,GAAA70B,GAAAz2B,IAAA0H,EAAAtQ,EAAAoa,MAAAmlB,QAAA42C,MAAA3wD,KAAA6Z,GAAA59B,KAAAC,IAAAkH,EAAA2mC,OAAA,GAAAj/B,EAAAi/B,OAAA,IAAAvvC,EAAAoa,MAAAmlB,QAAA42C,MAAAC,2BAAA/2C,EAAA6B,kBAAA,GAAA5wB,GAAA1H,EAAA5I,EAAAoa,MAAAmlB,QAAA42C,MAAApyD,MAAAsb,EAAAxF,GAAA+W,KAAAu8B,EAAAjZ,GAAAvvB,IAAA1kC,EAAA,WAAA45B,EAAAgX,OAAAs8B,EAAAjZ,GAAAtrD,GAAA0H,GAAAtQ,EAAAoa,MAAAmlB,QAAA42C,MAAAM,YAAA7tE,EAAA0H,GAAA1H,EAAA0H,EAAAwpB,QAAA95B,EAAAO,MAAAm2E,WAAA,cAAAC,QAAA,MAAAC,UAAA,QAAAC,WAAA,SAAA,SAAAx3C,EAAAxF,GAAA75B,EAAAoa,MAAAmlB,QAAAF,IAAAe,MAAA,WAAApgC,EAAAW,MAAAiwC,KAAA/W,EAAA75B,EAAAoR,WAAApR,EAAAW,QpBDA,YAAAjE,SAAAuI,WACArH,eAEAlB,SAAAsL,iBAAA,mBAAA,WACApK,iBAkFAlB,SAAAo6E,cAAA,yBAAA,CACA,GAAAC,aAAA,GAAAC,kBAAA,WACAp5E,gBAGAm5E,aAAAn3E,QAAAlD,SAAAo6E,cAAA,0BAAAG,WAAA,EAAAC,SAAA,KqBjFA,SAAA73C,EAAAr/B,EAAA65B,EAAAq6B,GAAA,YAAA,SAAAtrD,GAAAy2B,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,EAAA3I,EAAAqQ,KAAAwpB,EAAA,CAAAuF,IAAAA,EAAA8B,uBAAA9B,EAAA6B,iBAAAlhC,EAAAA,MAAAq/B,GAAAA,EAAAz+B,OAAAZ,EAAAoO,EAAAixB,EAAAz+B,KAAAvC,QAAA2B,IAAAk0D,EAAAl0D,EAAA+sD,SAAAlzB,EAAAwF,EAAAoC,eAAAjB,QAAA,SAAAvgC,EAAA45B,EAAAs9C,SAAAC,gBAAAn3E,EAAAktD,UAAAltD,EAAAktD,SAAA9zB,GAAA66B,KAAAl0D,EAAAopB,SAAA9Y,EAAAupB,EAAA75B,EAAAopB,WAAAxgB,EAAAsrD,EAAA9yD,KAAA,kBAAA,GAAAwH,GAAA0H,EAAA+uB,EAAAz+B,KAAAy+B,EAAAz+B,KAAAy2E,SAAA/mE,EAAAA,EAAA5N,OAAA4N,EAAAgJ,OAAA,mBAAA1Q,EAAA,MAAAixB,EAAA,mBAAAjxB,EAAA,OAAA0H,GAAA4jD,IAAAp6B,EAAAD,EAAAvpB,GAAApP,MAAAgzD,GAAAp6B,EAAA,IAAAA,EAAA,GAAA75B,EAAA45B,EAAAs9C,SAAApwE,KAAAuJ,EAAAtQ,EAAA85B,GAAA75B,EAAAktD,SAAA+G,IAAA,GAAA70B,EAAA9qB,QAAA8qB,EAAA9qB,UAAAuxC,KAAA,SAAAzmB,MAAAxF,EAAA,CAAA,GAAAA,EAAAnnB,GAAAykE,SAAA,WAAA5iE,SAAAuxC,KAAA,+BAAA,IAAA7lD,IAAAq3E,eAAA,EAAAC,MAAA,EAAAC,OAAA,GAAA1rB,UAAA,EAAA2rB,uBAAA,EAAAC,QAAA,EAAAC,SAAA,EAAAC,SAAA,OAAAC,QAAA,OAAAC,SAAA,OAAA,YAAA,SAAA,SAAAC,SAAA,EAAAC,SAAA,EAAA1nB,OAAA,EAAAzwD,OAAAo4E,SAAA,GAAAzkC,MAAAH,UAAAzyC,MAAAu2E,UAAA,KAAAz3E,QAAAw4E,IAAA,sKAAAD,SAAA,EAAAl1E,OAAA3B,MAAA+2E,UAAA,SAAAC,OAAAF,IAAA,yQAAAz8B,OAAA,GAAA48B,WAAA,GAAAC,YAAA,QAAAC,gBAAA,OAAAC,kBAAA,IAAAC,YAAA,OAAAC,iBAAA,OAAAC,mBAAA,IAAAC,WAAA,GAAAC,UAAA,GAAAC,QAAA,ycAAAC,WAAA,uCAAAC,SAAA,qDAAAC,QAAAC,SAAA,kTAAAz1D,KAAA,mYAAAnE,MAAA,gSAAA65D,UAAA,2QAAAC,WAAA,mRAAAxB,SAAA,mQAAAyB,SAAA,OAAAC,eAAA,EAAAC,WAAA,EAAAC,WAAA,EAAAC,WAAA,EAAAC,YAAArB,WAAA,GAAAzJ,OAAA+K,UAAA,EAAAC,UAAA,GAAAtiD,KAAA,KAAA9pB,SAAAqsE,WAAAxB,WAAA,EAAA9rC,MAAA,KAAAutC,QAAAzB,WAAA,EAAA0B,aAAA,EAAAV,SAAA,sBAAAW,KAAA,KAAAC,MAAA,OAAAC,OAAArgD,EAAAzoB,KAAA+oE,WAAAtgD,EAAAzoB,KAAAgpE,UAAAvgD,EAAAzoB,KAAA6rD,WAAApjC,EAAAzoB,KAAAipE,UAAAxgD,EAAAzoB,KAAAkpE,YAAAzgD,EAAAzoB,KAAAmpE,WAAA1gD,EAAAzoB,KAAAopE,WAAA3gD,EAAAzoB,KAAAqpE,aAAA5gD,EAAAzoB,KAAAspE,aAAA,SAAAr7C,EAAAr/B,GAAA,MAAA,UAAAq/B,EAAA91B,MAAA,QAAAoxE,WAAA,QAAAC,aAAA,QAAAC,iBAAA,EAAAC,eAAA,EAAAC,iBAAA,EAAA5G,QAAAsD,uBAAA,EAAAM,UAAA,EAAA2C,aAAA,SAAAr7C,EAAAr/B,GAAA,MAAA,UAAAq/B,EAAA91B,MAAA,kBAAAoxE,WAAA,SAAAt7C,EAAAr/B,GAAA,MAAA,UAAAq/B,EAAA91B,KAAA,iBAAA,SAAAsxE,gBAAA,SAAAx7C,EAAAr/B,GAAA,MAAA,UAAAq/B,EAAA91B,MAAA,QAAAuxE,cAAA,SAAAz7C,EAAAr/B,GAAA,MAAA,UAAAq/B,EAAA91B,MAAA,SAAA6tB,KAAA,KAAA4jD,MAAAld,IAAAmd,MAAA,QAAAC,KAAA,OAAAC,KAAA,WAAAC,MAAA,wEAAAC,WAAA,kBAAAC,UAAA,kBAAAC,YAAA,cAAAC,OAAA,aAAAC,SAAA,WAAAC,MAAA,QAAAC,KAAA,QAAAC,IAAAX,MAAA,kBAAAC,KAAA,SAAAC,KAAA,cAAAC,MAAA,0GAAAC,WAAA,mBAAAC,UAAA,mBAAAC,YAAA,WAAAC,OAAA,iBAAAC,SAAA,gBAAAC,MAAA,SAAAC,KAAA,2BAAArrE,EAAAupB,EAAAwF,GAAAvF,EAAAD,EAAA75B,GAAAqJ,EAAA,EAAA0U,EAAA,SAAAshB,GAAA,MAAAA,IAAAA,EAAAnW,gBAAAmW,YAAAxF,IAAA1rB,EAAA,WAAA,MAAAkxB,GAAAn4B,uBAAAm4B,EAAAw8C,6BAAAx8C,EAAAy8C,0BAAAz8C,EAAA08C,wBAAA,SAAA/7E,GAAA,MAAAq/B,GAAA33B,WAAA1H,EAAA,IAAA,QAAAoV,EAAA,WAAA,MAAAiqB,GAAA28C,sBAAA38C,EAAA48C,4BAAA58C,EAAA68C,yBAAA78C,EAAA88C,uBAAA,SAAAn8E,GAAAq/B,EAAAt2B,aAAA/I,OAAAmtE,EAAA,WAAA,GAAA9tC,GAAAxF,EAAA75B,EAAAnD,cAAA,eAAAq3D,GAAAtK,WAAA,gBAAAD,YAAA,iBAAAD,cAAA,gBAAAD,iBAAA,sBAAA,KAAApqB,IAAA60B,GAAA,GAAA,SAAAr6B,EAAA98B,MAAAsiC,GAAA,MAAA60B,GAAA70B,EAAA,OAAA,mBAAAuM,EAAA,SAAAvM,GAAA,MAAAA,IAAAA,EAAA38B,QAAA28B,EAAA,GAAAte,cAAA3S,EAAA,SAAAixB,EAAAr/B,GAAA,GAAAk0D,GAAAr6B,EAAAre,QAAA,KAAA6jB,EAAAr/B,EAAA,OAAA65B,GAAAt5B,KAAAP,EAAA,SAAAq/B,EAAAr/B,GAAA65B,EAAAle,QAAA3b,KAAAk0D,EAAA70B,GAAAr/B,KAAAk0D,GAAAkZ,EAAA,SAAA/tC,GAAA,GAAA60B,GAAAtrD,CAAA,UAAAy2B,GAAAA,EAAAhiB,gBAAArd,KAAA65B,EAAA,uBAAA92B,IAAA,iBAAA,QAAAmxD,GAAAoZ,EAAAjuC,EAAAuZ,wBAAAjQ,KAAAtJ,EAAA32B,YAAA,EAAA6kE,EAAAluC,EAAAuZ,wBAAA3kB,IAAAoL,EAAAte,aAAA,GAAAnY,EAAA5I,EAAAo8E,iBAAAloB,EAAAoZ,EAAApZ,EAAAqZ,KAAAluC,EAAAxF,EAAA,uBAAA92B,IAAA,iBAAA,IAAA6F,IAAAzG,EAAA,SAAAk9B,EAAAr/B,EAAAk0D,GAAA,GAAAtrD,GAAAjI,IAAAiI,GAAAvC,KAAA+H,GAAAlN,MAAAgzD,GAAAr6B,EAAAs9C,SAAA37B,UAAA3hB,EAAAvP,cAAAtqB,KAAA4I,EAAAvC,KAAA+H,EAAAxF,EAAAvC,KAAArG,IAAA65B,EAAAs9C,SAAAkF,WAAAzzE,EAAAvC,KAAA+H,EAAAxF,EAAAvC,KAAAuC,EAAAvC,KAAA8tE,SAAAvrE,EAAAhD,GAAAgD,EAAAvC,KAAAT,MAAAyD,EAAAT,EAAA0zE,UAAA16E,SAAAgH,EAAAvC,KAAAnF,MAAA,KAAA,EAAA0H,EAAA2zE,UAAA,KAAA3zE,EAAA4zE,QAAA,KAAA5zE,EAAA6zE,QAAA,EAAA7zE,EAAA8zE,UAAA,EAAA9zE,EAAA+1C,SAAA/1C,EAAA+zE,UAAA/zE,EAAAg0E,WAAAv9C,GAAAz2B,EAAA+1C,MAAAj8C,QAAAkG,EAAAM,OAAA2wB,GAAAre,OAAArZ,EAAAsf,WAAAvY,KAAA,WAAA,GAAAgrD,GAAAtrD,EAAA3I,EAAAU,KAAA2P,EAAArQ,EAAA0+C,MAAA1+C,EAAAq8E,WAAAxiD,EAAAxpB,EAAAjK,IAAAyzB,GAAAw9C,eAAAz9C,EAAAs9C,SAAA73D,OAAA,GAAAua,EAAA,QAAA94B,SAAA,oBAAA84B,EAAAs9C,SAAAC,gBAAA,IAAAt9C,EAAAw/C,gBAAAz/C,EAAAs9C,SAAAkF,UAAAr8E,EAAAG,KAAAsuC,aAAApP,EAAA30B,cAAAmvB,EAAA,QAAA12B,OAAA,+FAAAk8B,EAAA90B,WAAAvK,EAAAE,gBAAAuK,aAAA,gBAAAovB,EAAA,QAAA94B,SAAA,6BAAA6H,EAAA,GAAAixB,EAAAt5B,KAAAu5B,EAAAg+C,QAAA,SAAAz4C,EAAAr/B,GAAA4I,GAAAkxB,EAAAm/C,OAAAj5E,IAAA,KAAAk0D,EAAAr6B,EAAA55B,EAAA48E,UAAA58E,EAAA65B,EAAAg/C,QAAAl1E,QAAA,cAAAgF,GAAAhF,QAAA,aAAAk2B,EAAAm/C,OAAAE,UAAAr/C,EAAAm/C,OAAAG,cAAAh4E,KAAA,KAAA,sBAAAnB,EAAA2F,IAAA7E,SAAA+4B,EAAA++C,WAAAj4E,KAAA,WAAAX,GAAAqD,SAAAw2B,EAAAu/C,UAAAp5E,EAAA68E,OAAA3/C,UAAA+2B,IAAA,KAAA,QAAA,UAAA,UAAA,QAAA,UAAA,cAAAv1D,QAAA,SAAA0gC,GAAAp/B,EAAA68E,MAAAz9C,GAAA60B,EAAArzD,KAAA,aAAAw+B,KAAAp/B,EAAAugC,QAAA,UAAAvgC,EAAAo1D,WAAAp1D,EAAA88E,OAAA98E,EAAAq8E,YAAAO,UAAA,SAAAx9C,EAAAr/B,GAAA,GAAA65B,GAAAwF,EAAAh5B,KAAA20E,KAAA37C,EAAAh5B,KAAA+wB,OAAAiI,EAAAh5B,KAAA20E,KAAAld,EAAA,OAAA99D,GAAA4D,QAAA,iBAAA,SAAAy7B,EAAAr/B,GAAA,MAAA,UAAA65B,EAAA75B,GAAAq/B,EAAAxF,EAAA75B,MAAA48E,WAAA,SAAAv9C,GAAA,GAAAr/B,GAAAk0D,EAAAvzD,KAAAiI,EAAAixB,EAAA9O,UAAAsU,EAAAxF,GAAAt5B,KAAAqI,EAAA,SAAAy2B,EAAAr/B,GAAA,GAAA4I,GAAA3I,EAAAqQ,EAAAwpB,EAAAzwB,EAAA0U,KAAA5P,IAAA0rB,GAAAvP,cAAAtqB,IAAA+d,EAAA/d,EAAAmO,EAAAnO,EAAAqG,MAAArG,GAAA,WAAA65B,EAAAtwB,KAAAvJ,IAAA65B,EAAA75B,GAAA0C,QAAAkG,EAAAixB,EAAA75B,GAAAmO,EAAAvF,EAAAhI,WAAAuN,EAAA0rB,EAAAre,QAAA,KAAArN,EAAAA,EAAA9P,SAAA8P,EAAA6uE,MAAAp0E,EAAAmV,EAAAve,IAAA00D,EAAA7tD,KAAA7G,KAAA2O,EAAA3O,KAAAoJ,EAAAxH,KAAA,QAAA2c,EAAAxU,MAAAwU,EAAAve,MAAAue,EAAAxU,KAAA,SAAAwU,EAAAve,IAAAQ,IAAA+d,GAAAxU,KAAA,OAAA/J,IAAAQ,EAAA,IAAA+d,EAAA1X,KAAAwzB,EAAAre,QAAA,KAAA04C,EAAA7tD,KAAA8H,GAAA0rB,EAAAle,QAAAxN,EAAA2pE,WAAA/5D,EAAA1X,KAAAyxE,QAAA3pE,EAAA2pE,SAAAj+C,EAAAs9C,SAAAkF,UAAAt+D,EAAA1X,KAAA8tE,SAAAp2D,EAAA1X,KAAA+H,EAAA2P,EAAA1X,KAAA0X,EAAA1X,KAAA8tE,SAAAl0E,EAAA8d,EAAAxU,MAAAwU,EAAA1X,KAAAkD,KAAAuwB,EAAA/b,EAAAve,KAAA,IAAAS,GAAA65B,KAAAxpB,EAAAwpB,EAAAryB,MAAA,uCAAAxH,EAAA,QAAA8d,EAAA1X,KAAA+xE,MAAA38B,SAAA19B,EAAA1X,KAAA+xE,MAAA38B,OAAA,UAAA,QAAAnrC,EAAA,GAAA,MAAAA,EAAA,MAAAwpB,EAAAryB,MAAA,wFAAAxH,EAAA,QAAA65B,EAAAryB,MAAA,yBAAAxH,EAAA,SAAA8d,EAAA8b,EAAAre,QAAA,EAAAuC,GAAA80B,YAAA,MAAAxsC,MAAA3G,QAAAu4E,SAAA,OAAA,MAAAn+C,EAAA1qB,OAAA,KAAAnP,EAAA,WAAAA,EAAA8d,EAAAxU,KAAAtJ,EAAAi0D,EAAA1zB,QAAA,kBAAAziB,GAAAA,EAAA80B,cAAA90B,EAAA80B,YAAAhZ,EAAAtgB,QAAAwE,EAAAxU,MAAA,OAAA,SAAA,YAAA,OAAAwU,EAAAxU,MAAAwU,EAAA7c,MAAAgzD,EAAAvV,MAAAj8C,OAAA,QAAAqb,EAAA1X,KAAAuxE,WAAA75D,EAAA1X,KAAAuxE,SAAA/9C,EAAAtgB,QAAAwE,EAAAxU,MAAA,OAAA,SAAA,aAAA,SAAAwU,EAAA1X,KAAAwxE,UAAA95D,EAAA1X,KAAAwxE,SAAA95D,EAAA1X,KAAAuxE,UAAA75D,EAAAk/D,OAAAl/D,EAAA1X,KAAA42E,QAAA,KAAAl/D,EAAA1X,KAAA8mD,UAAApvC,EAAA7c,QAAAgzD,EAAA7tD,KAAAnF,QAAA6c,EAAAk/D,OAAAl/D,EAAA1X,KAAA8mD,SAAAtsD,KAAA,aAAAkd,EAAAk/D,OAAAv6E,SAAAqb,EAAA1X,KAAA22E,MAAAj/D,EAAA1X,KAAA8mD,WAAApvC,EAAAk/D,QAAAl/D,EAAAk/D,OAAAv6E,SAAAqb,EAAA1X,KAAA22E,QAAAj/D,EAAAk/D,OAAAl/D,EAAA1X,KAAA22E,MAAAn8E,KAAA,cAAAkd,EAAAk/D,SAAAl/D,EAAAk/D,OAAAv6E,SAAAqb,EAAAk/D,OAAA,MAAAl/D,EAAAm/D,MAAAn/D,EAAA1X,KAAA62E,QAAAn/D,EAAAk/D,OAAAl/D,EAAAk/D,OAAA,GAAAz9E,IAAA;AAAA,aAAAq6B,EAAAtwB,KAAAwU,EAAA1X,KAAAigC,WAAAvoB,EAAA1X,KAAAigC,QAAAvoB,EAAA1X,KAAAigC,QAAA7wB,MAAAzV,GAAAk0D,EAAAn2C,KAAA,aAAA8b,EAAAtwB,KAAA2qD,EAAA7tD,KAAAigC,WAAAvoB,EAAA1X,KAAAigC,QAAA4tB,EAAA7tD,KAAAigC,QAAA7wB,MAAAzV,GAAAk0D,EAAAn2C,KAAAA,EAAA1X,KAAAigC,kBAAAzM,KAAA9b,EAAA1X,KAAAigC,QAAA,SAAAvoB,EAAA1X,KAAAigC,QAAA,GAAAvoB,EAAA1X,KAAAigC,QAAA,IAAA,SAAAvoB,EAAAxU,OAAAF,EAAAywB,EAAArzB,MAAA,MAAA,GAAA4C,EAAA3G,OAAA,IAAAqb,EAAAve,IAAA6J,EAAA1C,QAAAoX,EAAA1X,KAAAiT,OAAAjQ,EAAA1C,UAAAoX,EAAA1X,KAAAiqD,QAAAvyC,EAAA1X,KAAAwzB,EAAAre,QAAA,EAAAuC,EAAA1X,MAAAozE,WAAA,EAAA9B,QAAA,EAAAE,QAAA,EAAAD,SAAA,EAAA9rB,SAAA,EAAA+tB,UAAA,EAAAH,WAAA,EAAAI,OAAA,EAAAlL,MAAA,EAAA8L,cAAA,EAAAC,YAAA,EAAAC,cAAA,EAAAC,iBAAA,EAAAC,eAAA,EAAAC,iBAAA,KAAA7mB,EAAAvV,MAAA13C,KAAA8W,KAAA5W,OAAA2lB,KAAAonC,EAAAyoB,QAAAj6E,SAAAwxD,EAAAipB,kBAAAn9E,EAAAk0D,EAAAkpB,SAAAp9E,EAAAmuD,WAAAnuD,EAAAq9E,SAAAr9E,EAAAu3B,WAAA+lD,UAAA,WAAA,GAAAt9E,GAAAW,IAAAX,GAAAu9E,eAAAv9E,EAAA88E,MAAA3/C,UAAA5qB,GAAA,iBAAA,wBAAA,SAAA8sB,GAAAA,EAAAsC,kBAAAtC,EAAA6B,iBAAAlhC,EAAAsf,MAAA+f,KAAA9sB,GAAA,mCAAA,uBAAA,SAAA8sB,GAAAA,EAAAsC,kBAAAtC,EAAA6B,iBAAAlhC,EAAA2jD,aAAApxC,GAAA,mCAAA,uBAAA,SAAA8sB,GAAAA,EAAAsC,kBAAAtC,EAAA6B,iBAAAlhC,EAAA25B,SAAApnB,GAAA,WAAA,uBAAA,SAAA8sB,GAAAr/B,EAAAA,EAAAw9E,eAAA,gBAAA,kBAAAltE,EAAAiC,GAAA,iCAAA,SAAA8sB,GAAAA,GAAAA,EAAAwC,eAAA,WAAAxC,EAAAwC,cAAAt4B,MAAAvJ,EAAAy9E,WAAAroE,EAAApV,EAAAy9E,WAAAz9E,EAAAy9E,UAAAtvE,EAAA,WAAAnO,EAAA09E,OAAAr+C,OAAAr/B,EAAA6nB,SAAA,WAAA7nB,EAAA6nB,QAAAte,MAAAvJ,EAAA88E,MAAAa,MAAA95D,OAAAnc,WAAA,WAAA1H,EAAA88E,MAAAa,MAAA19D,OAAAjgB,EAAA09E,OAAAr+C,IAAAxF,EAAAs9C,SAAAkF,SAAA,IAAA,QAAAviD,EAAAvnB,GAAA,aAAA,SAAA8sB,GAAA,GAAA60B,GAAAr6B,EAAAs9C,SAAAt9C,EAAAs9C,SAAAC,cAAA,KAAAxuE,EAAAsrD,EAAArsC,QAAA5nB,EAAAo/B,EAAAiD,SAAAjD,EAAAtd,KAAA,OAAA,IAAA9hB,OAAA2I,EAAAvC,KAAAozE,WAAAz5E,EAAAu3B,MAAA8H,KAAAz2B,EAAAvC,KAAAylD,UAAAzsB,EAAAkjC,SAAAljC,EAAAqjC,QAAArjC,EAAAu+C,UAAA/jD,EAAAwF,EAAAtgC,QAAAs6B,GAAA,qCAAA,OAAA,IAAAp5B,GAAA,KAAAA,GAAAo/B,EAAA6B,qBAAAlhC,GAAAsf,MAAA+f,IAAA,KAAAp/B,GAAA,KAAAA,GAAAo/B,EAAA6B,qBAAAlhC,GAAA2jD,YAAA,KAAA1jD,GAAA,KAAAA,GAAAo/B,EAAA6B,qBAAAlhC,GAAA25B,YAAA35B,GAAAwgC,QAAA,eAAAnB,EAAAp/B,KAAAD,EAAA2+C,MAAA3+C,EAAAs8E,WAAAj2E,KAAA0xE,WAAA/3E,EAAA69E,mBAAA,EAAA/jD,EAAAvnB,GAAA,6HAAA,SAAA8sB,GAAAr/B,EAAA69E,mBAAA,EAAA79E,EAAA89E,QAAA99E,EAAA+9E,eAAA/9E,EAAA89E,QAAA,IAAA99E,EAAAg+E,aAAA3+C,EAAAoO,YAAA,aAAAztC,EAAA69E,oBAAA79E,EAAA2+C,MAAA3+C,EAAAs8E,WAAAj2E,KAAA0xE,WAAA/3E,EAAAi+E,aAAAj+E,EAAA89E,QAAA,EAAA99E,EAAA69E,mBAAA,EAAA79E,EAAAk+E,iBAAA,OAAAX,aAAA,WAAA,GAAAv9E,GAAAW,IAAA2P,GAAAysB,IAAA,kCAAAjD,EAAAiD,IAAA,uBAAAp8B,KAAAm8E,MAAA3/C,UAAAJ,IAAA,+BAAA/8B,EAAAg+E,eAAA3+C,EAAAqO,cAAA1tC,EAAAg+E,cAAAh+E,EAAAg+E,aAAA,OAAAr6B,SAAA,SAAAtkB,GAAA,MAAA1+B,MAAAo8E,OAAAp8E,KAAA87E,QAAA,EAAAp9C,IAAA1F,KAAA,SAAA0F,GAAA,MAAA1+B,MAAAo8E,OAAAp8E,KAAA87E,QAAA,EAAAp9C,IAAA09C,OAAA,SAAA19C,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,EAAA3I,EAAAqQ,EAAAwpB,EAAAzwB,EAAA0U,EAAA5P,EAAAiH,EAAA+3D,EAAAxsE,KAAAyN,EAAA++D,EAAAxuB,MAAAj8C,MAAA,MAAAyqE,EAAA8Q,YAAA9Q,EAAAgR,WAAAhR,EAAAiR,aAAAjR,EAAAuP,UAAA,CAAA,GAAAr9C,EAAAz9B,SAAAy9B,EAAA,MAAAp/B,EAAAktE,EAAAtlD,QAAAslD,EAAAtlD,QAAAxhB,KAAAkxE,KAAApK,EAAA9mE,KAAAkxE,QAAAl4C,EAAA,GAAAA,GAAAjxB,GAAA,OAAA,CAAA,IAAA8lD,EAAAiZ,EAAAuP,UAAAv1E,OAAA2lB,KAAAqgD,EAAAwP,QAAAj6E,OAAAo3B,EAAAqzC,EAAAtlD,QAAAslD,EAAAoP,UAAApP,EAAAmP,UAAAnP,EAAAqP,QAAArP,EAAAsP,QAAAnsE,EAAA68D,EAAAkR,YAAAh/C,GAAAjxB,EAAA,KAAAnO,GAAAqQ,EAAApP,MAAAkN,EAAA,IAAA++D,EAAAkR,YAAAh/C,EAAA,IAAAp/B,GAAAqQ,EAAApP,MAAA,IAAAisE,EAAAkR,YAAAh/C,EAAA,IAAA8tC,EAAAtlD,QAAAvX,EAAA68D,EAAAmP,UAAAhsE,EAAApP,MAAAisE,EAAAsP,QAAAnsE,EAAAtC,IAAAm/D,EAAA3sC,QAAA,aAAA0zB,GAAAiZ,EAAAgQ,iBAAA7sE,EAAAguE,eAAA,OAAAzkD,EAAAlP,UAAA3qB,GAAAsQ,EAAAguE,eAAAt+E,EAAAA,EAAAsQ,EAAAjK,KAAA6tD,EAAA,oBAAA,sBAAAl0D,EAAA4B,SAAA5B,EAAA,IAAA4I,EAAAukE,EAAAoR,QAAAjuE,GAAAA,EAAAkuE,OAAAz9E,SAAA,2BAAAmzD,EAAA,MAAA5jD,GAAAjK,KAAAkyE,iBAAAv4E,GAAAmtE,EAAA2P,MAAA3/C,UAAAp6B,IAAA,sBAAA/C,EAAA,MAAAmtE,EAAA2P,MAAA3/C,UAAAp8B,SAAA,oBAAAy/B,QAAA,SAAA2sC,EAAAsR,UAAAnuE,OAAA68D,GAAA8K,QAAA,QAAA5uE,GAAAwwB,EAAAs9C,SAAAuH,aAAA5kD,EAAA0kD,QAAAzgE,EAAA8b,EAAAs9C,SAAAuH,aAAAvR,EAAA2P,MAAAa,OAAA9jD,EAAAt5B,KAAA4sE,EAAAwP,OAAA,SAAAt9C,EAAAr/B,GAAA65B,EAAAs9C,SAAA3xD,KAAAxlB,EAAAw+E,QAAA,KAAA1kD,EAAA9rB,MAAAsC,EAAAtC,MAAA8rB,EAAA6kD,YAAA,GAAA7kD,EAAA0kD,OAAA19E,YAAA,oDAAA8H,GAAAwM,EAAA/L,EAAAs/B,MAAA7O,EAAA9rB,IAAA3E,EAAAjJ,MAAA05B,EAAA9rB,IAAA8rB,EAAAzzB,KAAAmxE,QAAA39C,EAAAt5B,KAAA4sE,EAAAwP,OAAA,SAAAt9C,EAAA60B,GAAAA,EAAAsqB,OAAA19E,YAAA,qBAAAA,YAAA,SAAAu+B,EAAAr/B,GAAA,OAAAA,EAAAyH,MAAA,+BAAAb,KAAA,MAAA,IAAAgC,GAAAsrD,EAAAlmD,IAAA3E,EAAAjJ,MAAA8zD,EAAAlmD,IAAAkmD,EAAA7tD,KAAAmxE,MAAA39C,GAAAs9C,SAAAyH,aAAA1qB,EAAAsqB,QAAAvqD,IAAA,EAAA0U,KAAA//B,EAAAmV,EAAA4qB,KAAAvzB,IAAA8+C,EAAAlmD,MAAAsC,EAAAtC,KAAAkmD,EAAAsqB,OAAAz9E,SAAA,oBAAAmzD,EAAAlmD,IAAAsC,EAAAtC,IAAA,OAAA,aAAA49B,EAAAsoB,EAAAsqB,QAAA3kD,EAAAs9C,SAAAxqC,QAAAunB,EAAAsqB,QAAAvqD,IAAA,EAAA0U,MAAAurB,EAAAlmD,IAAAsC,EAAAtC,KAAA3E,EAAAjJ,OAAA8zD,EAAAlmD,IAAAsC,EAAAtC,KAAAkmD,EAAA7tD,KAAAmxE,QAAAx3E,EAAA,WAAAk0D,EAAAsqB,OAAAz7E,KAAAqrE,UAAA,GAAAnsD,QAAA,KAAAnhB,YAAA,iDAAAozD,EAAAlmD,MAAAm/D,EAAAsP,SAAAtP,EAAAl4D,gBAAAjV,GAAAsQ,EAAAjK,KAAAqyE,mBAAAvqE,EAAA,iCAAAmC,EAAAjK,KAAAqyE,iBAAA5+C,EAAA0kD,OAAAz9E,SAAA,oBAAA+4B,EAAA9rB,IAAAsC,EAAAtC,IAAA,OAAA,aAAA6rB,EAAAs9C,SAAAxqC,QAAA7S,EAAA0kD,OAAArwE,EAAAnO,EAAA,WAAA85B,EAAA0kD,OAAA19E,YAAAqN,GAAArN,YAAA,mDAAA,IAAAwP,EAAAuuE,SAAA1R,EAAA2R,cAAAxuE,GAAA68D,EAAAsR,UAAAnuE,GAAA68D,EAAA8K,QAAA,WAAAoG,YAAA,SAAAh/C,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAAjI,IAAA,OAAAuzD,GAAA70B,EAAAz2B,EAAA+1C,MAAAj8C,OAAAwxD,EAAAA,EAAA,EAAAtrD,EAAA+1C,MAAAj8C,OAAAwxD,EAAAA,GAAAtrD,EAAA+zE,OAAAt9C,IAAAz2B,EAAA+1C,MAAAuV,KAAAl0D,EAAA65B,EAAA,sCAAAv2B,SAAAsF,EAAAk0E,MAAAa,OAAA/0E,EAAA+zE,OAAAt9C,GAAAxF,EAAAre,QAAA,KAAA5S,EAAA+1C,MAAAuV,IAAAlmD,IAAAqxB,EAAAm/C,OAAAx+E,EAAA6+E,UAAA,IAAAj2E,EAAAm2E,YAAAn2E,EAAA+zE,OAAAt9C,KAAAz2B,EAAA+zE,OAAAt9C,IAAA2/C,cAAA,SAAA3/C,EAAAr/B,EAAAk0D,GAAA,GAAAtrD,GAAA3I,EAAAqQ,EAAAwpB,EAAAzwB,EAAA0U,EAAApd,KAAAwN,EAAA4P,EAAA8J,QAAAzS,EAAAjH,EAAA8wE,SAAA9R,EAAAtzC,EAAAs9C,SAAAuH,aAAAvwE,EAAAqwE,QAAAp+E,MAAAwrC,EAAA/R,EAAAs9C,SAAAuH,aAAAvwE,EAAAqwE,QAAAn+E,OAAA+N,EAAAD,EAAA/N,MAAAgtE,EAAAj/D,EAAA9N,MAAA0d,GAAAqgE,aAAArgE,EAAAwgE,YAAAnpE,GAAA,SAAAjH,EAAA5E,OAAA4E,EAAA0wE,UAAA1wE,EAAA+wE,WAAAnhE,EAAAqgE,aAAA,EAAAvkD,EAAAs9C,SAAA3xD,KAAApQ,GAAAiqB,EAAA,SAAAA,EAAA,GAAA8tC,EAAA9tC,EAAAr/B,EAAA,SAAAA,EAAA,GAAA4rC,EAAA5rC,EAAA4I,EAAAixB,EAAAs9C,SAAAuH,aAAAtpE,GAAAxM,EAAAqrB,KAAA4F,EAAAs9C,SAAAuH,aAAAvwE,EAAAqwE,QAAAvqD,IAAArrB,EAAA+/B,MAAA9O,EAAAs9C,SAAAuH,aAAAvwE,EAAAqwE,QAAA71C,KAAA7O,EAAA1rB,EAAAxF,EAAAxI,MAAAiJ,EAAA+jE,EAAAxkE,EAAAvI,OAAAJ,EAAA,GAAAktE,EAAA,GAAA/+D,EAAAkC,EAAA,GAAAs7B,EAAA,GAAAwhC,EAAAh/D,EAAA++D,IAAAltE,EAAA2I,EAAA+/B,KAAA7O,GAAAuF,EAAAvF,EAAAuF,GAAAp/B,EAAA,IAAAA,EAAA,GAAAA,EAAAktE,EAAA/+D,IAAAnO,EAAAktE,EAAA/+D,IAAAg/D,EAAAxhC,IAAAt7B,EAAA1H,EAAAqrB,IAAA5qB,GAAArJ,EAAAqJ,EAAArJ,GAAAsQ,EAAA,IAAAA,EAAA,GAAAA,EAAAs7B,EAAAwhC,IAAA98D,EAAAs7B,EAAAwhC,IAAArvD,EAAAohE,aAAA/wE,EAAAg/D,GAAAvzC,EAAAs9C,SAAAxqC,QAAAv3B,GAAA6e,IAAA3jB,EAAAq4B,KAAA1oC,EAAAm/E,OAAAtlD,EAAAulD,OAAAh2E,GAAA6qD,GAAA,IAAA,WAAAn2C,EAAAqgE,aAAA,IAAArgE,EAAAuhE,WAAAvhE,EAAAuhE,UAAAnxB,UAAApwC,EAAAuhE,UAAA95D,SAAA+5D,WAAA,SAAAlgD,GAAA,GAAAr/B,GAAAk0D,EAAAvzD,KAAAiI,EAAAsrD,EAAArsC,QAAA5nB,EAAA2I,EAAAq2E,QAAA/qB,GAAAkqB,aAAAlqB,EAAAqqB,YAAAt+E,GAAA,SAAA2I,EAAAW,OAAAX,EAAAi2E,UAAAj2E,EAAAs2E,WAAAhrB,EAAAkqB,aAAA,EAAAvkD,EAAAs9C,SAAA3xD,KAAAvlB,GAAAD,EAAAk0D,EAAAsrB,UAAA52E,GAAAsrD,EAAAirB,aAAAn/E,EAAAI,MAAAJ,EAAAK,QAAAw5B,EAAAs9C,SAAAxqC,QAAA1sC,GAAAg0B,IAAAj0B,EAAAi0B,IAAA0U,KAAA3oC,EAAA2oC,KAAAy2C,OAAAp/E,EAAAI,MAAAH,EAAAG,QAAAi/E,OAAAr/E,EAAAK,OAAAJ,EAAAI,UAAAg/B,GAAA,IAAA,WAAA60B,EAAAkqB,aAAA,MAAAoB,UAAA,SAAAngD,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAA3I,EAAAqQ,EAAA3P,KAAAm5B,EAAAuF,EAAA4/C,SAAA51E,EAAAg2B,EAAAm/C,OAAAzgE,EAAAshB,EAAAj/B,OAAAi/B,EAAAh5B,KAAAjG,MAAA+N,EAAAkxB,EAAAh/B,QAAAg/B,EAAAh5B,KAAAhG,OAAA+U,IAAA,UAAAiqB,EAAAw/C,UAAA/kD,GAAAA,EAAAp3B,UAAA1C,EAAA65B,EAAAs9C,SAAAuH,aAAApuE,EAAAwsE,MAAAa,OAAAv9E,MAAA8zD,EAAAr6B,EAAAs9C,SAAAuH,aAAApuE,EAAAwsE,MAAAa,OAAAt9E,OAAAL,GAAA4O,WAAAvF,EAAAtG,IAAA,gBAAA6L,WAAAvF,EAAAtG,IAAA,iBAAA6L,WAAAkrB,EAAA/2B,IAAA,eAAA6L,WAAAkrB,EAAA/2B,IAAA,gBAAAmxD,GAAAtlD,WAAAvF,EAAAtG,IAAA,eAAA6L,WAAAvF,EAAAtG,IAAA,kBAAA6L,WAAAkrB,EAAA/2B,IAAA,cAAA6L,WAAAkrB,EAAA/2B,IAAA,iBAAAgb,GAAA5P,IAAA4P,EAAA/d,EAAAmO,EAAA+lD,GAAAtrD,EAAAnH,KAAAo8C,IAAA,EAAA79C,EAAA+d,EAAAm2C,EAAA/lD,GAAA4P,GAAAnV,EAAAuF,GAAAvF,EAAAmV,EAAA/d,EAAA,KAAA+d,EAAA/d,GAAAmO,EAAA+lD,EAAA,KAAA/lD,EAAA+lD,GAAA,UAAA70B,EAAA91B,MAAA6L,EAAA6e,IAAAxyB,KAAAikE,MAAA,IAAAxR,EAAA/lD,IAAAS,WAAAvF,EAAAtG,IAAA,eAAAqS,EAAAuzB,KAAAlnC,KAAAikE,MAAA,IAAA1lE,EAAA+d,IAAAnP,WAAAvF,EAAAtG,IAAA,iBAAA,UAAAs8B,EAAAwT,cAAA5yC,EAAAo/B,EAAAh5B,KAAAjG,OAAAi/B,EAAAh5B,KAAAhG,OAAA0d,EAAA5P,EAAAkxB,EAAAh5B,KAAAo5E,OAAA,GAAA,EAAAtxE,EAAA4P,EAAA9d,EAAAkO,EAAA4P,EAAA9d,EAAA8d,EAAA5P,EAAAlO,IAAA8d,EAAA5P,EAAAlO,IAAAmV,EAAAhV,MAAA2d,EAAA3I,EAAA/U,OAAA8N,EAAAiH,IAAAsoE,OAAA,SAAAr+C,GAAA,GAAAr/B,GAAAW,IAAAk5B,GAAAt5B,KAAAP,EAAA28E,OAAA,SAAA9iD,EAAAq6B,GAAAl0D,EAAA++E,YAAA7qB,EAAA70B,MAAA0/C,YAAA,SAAA1/C,EAAAr/B,GAAA,GAAAk0D,GAAAvzD,KAAAiI,EAAAy2B,GAAAA,EAAA4/C,SAAAh/E,EAAAo/B,EAAAj/B,OAAAi/B,EAAAh5B,KAAAjG,MAAAkQ,EAAA+uB,EAAAh/B,QAAAg/B,EAAAh5B,KAAAhG,OAAAy5B,EAAAuF,EAAAm/C,MAAAtqB,GAAAwrB,cAAArgD,GAAAz2B,IAAA3I,GAAAqQ,GAAA,UAAA+uB,EAAAwT,eAAAxT,EAAA6/C,WAAArlD,EAAAs9C,SAAA3xD,KAAA5c,GAAAixB,EAAAs9C,SAAAyH,aAAAh2E,EAAAsrD,EAAAsrB,UAAAngD,IAAAA,EAAArxB,MAAAkmD,EAAAuoB,UAAAvoB,EAAAkqB,aAAA,EAAAlqB,EAAAirB,iBAAAjrB,EAAAyrB,aAAAtgD,GAAAvF,EAAAp3B,SAAAo3B,EAAA0G,QAAA,WAAAnB,EAAArxB,MAAAkmD,EAAAuoB,SAAAvoB,EAAA4oB,MAAAjF,QAAAz5D,IAAA81C,EAAA4oB,MAAA8C,WAAA/+E,KAAA,kCAAAwvC,YAAA,2BAAAvW,EAAApa,IAAA,GAAA+uB,aAAA3U,EAAApa,IAAA,GAAA/U,eAAAupD,EAAA1zB,QAAA,WAAAnB,EAAAr/B,IAAA6/E,YAAA,SAAAxgD,GAAA,GAAAr/B,GAAAW,KAAAuzD,EAAAl0D,EAAA6nB,QAAAjf,EAAAsrD,EAAAsqB,QAAAx+E,EAAAm+E,WAAAjqB,IAAAtrD,EAAA4xB,WAAAz3B,KAAAqrE,UAAA,GAAAnsD,QAAA,KAAArZ,EAAA7G,SAAA23B,WAAA54B,YAAA,iDAAA+4B,EAAAs9C,SAAAxqC,QAAA/jC,GAAAqrB,IAAA,EAAA0U,KAAA,EAAA1mB,QAAA,GAAA,SAAAod,EAAA,EAAAA,EAAA,WAAAz2B,EAAA7F,KAAAqrE,UAAA,GAAAnsD,QAAA,KAAAiyC,EAAAyqB,YAAA3+E,EAAAiV,aAAA,KAAAspE,QAAA,SAAAl/C,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAAy2B,GAAA1+B,KAAAknB,OAAA,SAAAjf,IAAAsrD,EAAAr6B,EAAAs9C,SAAAuH,aAAA/9E,KAAAm8E,MAAAa,OAAA39E,EAAA65B,EAAAs9C,SAAAuH,aAAA91E,EAAA41E,SAAA51E,EAAA41E,OAAAhuC,SAAA,uBAAA/uC,KAAAC,IAAA1B,EAAAi0B,IAAAigC,EAAAjgC,KAAA,IAAAxyB,KAAAC,IAAA1B,EAAA2oC,KAAAurB,EAAAvrB,MAAA,MAAAw2C,aAAA,SAAA9/C,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,EAAA3I,EAAAU,KAAA2P,EAAArQ,EAAA4nB,QAAAiS,EAAA75B,EAAA68E,MAAA3/C,SAAA7sB,KAAArQ,EAAAk+E,WAAAl+E,EAAA6/E,YAAAhmD,EAAAh5B,YAAA,qGAAAozD,EAAAj0D,EAAA8/E,OAAA1gD,EAAAr/B,GAAA4I,IAAAsrD,GAAAj0D,EAAA+/E,aAAAlmD,EAAAuW,YAAA,uBAAAznC,GAAAixB,EAAA,wBAAAvY,KAAA,YAAA1Y,GAAAsrD,EAAAp6B,EAAA/4B,SAAA,oBAAA6H,IAAA,SAAA0H,EAAAjK,KAAAq0E,cAAA7gD,EAAA3gB,WAAA5I,EAAAjK,KAAAq0E,eAAA,QAAApqE,EAAAjK,KAAAq0E,aAAApqE,IAAAwpB,EAAA/4B,SAAA,uBAAAuP,EAAAjK,KAAAuoE,QAAAt+D,EAAAjK,KAAAuoE,MAAA+K,UAAA15E,EAAA0+C,MAAAj8C,OAAA,IAAA,UAAA4N,EAAAuiC,aAAA/Y,EAAA/4B,SAAA,wBAAAi/E,WAAA,WAAA,GAAA3gD,GAAAr/B,EAAAW,KAAAk5B,EAAA75B,EAAA6nB,OAAA,IAAAgS,IAAA75B,EAAAm+E,WAAA,UAAAtkD,EAAAtwB,OAAAswB,EAAAqlD,SAAA,CAAA,IAAArlD,EAAAglD,SAAA,OAAA,CAAA,KAAAx/C,EAAAr/B,EAAAw/E,UAAA3lD,MAAAA,EAAAz5B,MAAAi/B,EAAAj/B,OAAAy5B,EAAAx5B,OAAAg/B,EAAAh/B,QAAA,OAAA,EAAA,OAAA,GAAAm9E,aAAA,SAAAn+C,EAAAr/B,GAAA,GAAAk0D,GAAAvzD,KAAAiI,GAAA,EAAA3I,EAAAi0D,EAAArsC,QAAAvX,EAAArQ,EAAAg/E,QAAA,OAAA,UAAA5/C,GAAA,SAAAr/B,EAAA4I,EAAAy2B,EAAAp/B,EAAAG,OAAAJ,EAAAC,EAAAI,OAAAiQ,IAAA1H,EAAAixB,EAAAs9C,SAAAuH,aAAApuE,GAAA1H,EAAAA,EAAAxI,MAAAH,EAAAG,OAAAwI,EAAAvI,OAAAJ,EAAAI,QAAAuI,GAAAm3E,OAAA,SAAA1gD,EAAAr/B,GAAA,GAAAk0D,GAAAvzD,KAAAiI,EAAAsrD,EAAArsC,QAAA5nB,EAAA,KAAAqQ,GAAA,CAAA,OAAA,UAAA1H,EAAAW,OAAAX,EAAA+1E,YAAAt/C,GAAAr/B,KAAA4I,EAAAs2E,WAAA5uE,EAAA4jD,EAAAsrB,UAAA52E,GAAA,SAAAy2B,GAAA,SAAAr/B,EAAAC,GAAAG,MAAAi/B,EAAAh/B,OAAAL,GAAA4I,EAAA+1E,aAAA1+E,EAAA45B,EAAAs9C,SAAAuH,aAAA91E,EAAAq2E,WAAAh/E,GAAAqQ,IAAAA,EAAA7O,KAAAC,IAAAzB,EAAAG,MAAAkQ,EAAAlQ,OAAA,KAAAqB,KAAAC,IAAAzB,EAAAI,OAAAiQ,EAAAjQ,QAAA,MAAAiQ,GAAAmuE,UAAA,SAAAp/C,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAA3I,EAAAU,IAAA,KAAA0+B,EAAAyrB,YAAAzrB,EAAAw/C,SAAA,CAAA,GAAAx/C,EAAAyrB,WAAA,GAAA,IAAA7qD,EAAAugC,QAAA,aAAAnB,GAAA,MAAAA,GAAAyrB,WAAA,GAAA,CAAA,QAAA9qD,EAAAq/B,EAAA91B,KAAA2qD,EAAA70B,EAAAm/C,OAAAtqB,EAAAn3B,IAAA,WAAAyD,QAAA,WAAAz/B,SAAAs+B,EAAAh5B,KAAAuyE,YAAA54E,GAAA,IAAA,QAAAC,EAAAggF,SAAA5gD,EAAA,MAAA,KAAA,SAAAp/B,EAAAigF,UAAA7gD,EAAA,MAAA,KAAA,OAAAp/B,EAAA6xD,WAAAzyB,EAAAA,EAAA7/B,KAAA6/B,EAAAjiB,QAAA,MAAA,KAAA,QAAAnd,EAAA6xD,WAAAzyB,EAAAA,EAAAh5B,KAAA+xE,MAAAF,IAAAt0E,QAAA,gBAAAy7B,EAAA7/B,KAAAoE,QAAA,aAAAy7B,EAAAh5B,KAAA85E,aAAA9gD,EAAAh5B,KAAA+xE,MAAA38B,QAAA,IAAA73C,QAAA,aAAAy7B,EAAA69C,OAAA,IAAA,MAAA,KAAA,SAAArjD,EAAAwF,EAAA7/B,KAAAkD,OAAAzC,EAAA6xD,WAAAzyB,EAAAxF,EAAAwF,EAAA7/B,MAAAS,EAAAmgF,SAAA/gD,EAAA,MAAA,KAAA,OAAAp/B,EAAAogF,YAAAhhD,GAAAz2B,EAAAixB,EAAA2Z,KAAA3Z,EAAAre,UAAA6jB,EAAAh5B,KAAAmtC,KAAAH,UAAA3sC,IAAA24B,EAAA7/B,IAAAo0C,QAAA,SAAA5zC,EAAA65B,GAAA,YAAAA,GAAA55B,EAAA6xD,WAAAzyB,EAAAr/B,IAAAmoB,MAAA,SAAAnoB,EAAA65B,GAAA75B,GAAA,UAAA65B,GAAA55B,EAAAmgF,SAAA/gD,OAAA60B,EAAAvvB,IAAA,UAAA,WAAA/7B,EAAAssC,SAAA,MAAA,SAAAj1C,EAAAmgF,SAAA/gD,GAAA,OAAA,IAAA4gD,SAAA,SAAA5gD,GAAA,GAAA60B,GAAAtrD,EAAAjI,IAAA+G,YAAA,WAAA,GAAA1H,GAAAq/B,EAAAihD,MAAA13E,GAAAu1E,YAAA9+C,EAAAyrB,WAAA9qD,GAAAA,EAAA0C,QAAA1C,EAAA,GAAAiV,UAAAoqB,EAAA6/C,UAAAt2E,EAAAy3E,YAAAhhD,IAAA,IAAAz2B,EAAA23E,YAAAlhD,GAAAA,EAAA4/C,SAAAplD,EAAA,wCAAA94B,SAAA,sBAAAuC,SAAA+7B,EAAAm/C,OAAAz9E,SAAA,2BAAA,IAAAs+B,EAAAh5B,KAAA4xE,SAAA54C,EAAAh5B,KAAAjG,OAAAi/B,EAAAh5B,KAAAhG,QAAAg/B,EAAA69C,QAAA79C,EAAAj/B,MAAAi/B,EAAAh5B,KAAAjG,MAAAi/B,EAAAh/B,OAAAg/B,EAAAh5B,KAAAhG,OAAA6zD,EAAAl0D,EAAAnD,cAAA,OAAAq3D,EAAAxqD,QAAA,WAAAmwB,EAAAl5B,MAAAvB,SAAAigC,EAAAmhD,OAAA,MAAAtsB,EAAArqD,OAAA,WAAAjB,EAAAwxE,UAAA/6C,IAAAA,EAAAmhD,OAAA3mD,EAAAq6B,GAAAnzD,SAAA,kBAAAuC,SAAA+7B,EAAA4/C,UAAA79E,KAAA,MAAAi+B,EAAA69C,QAAAt0E,EAAA63E,YAAAphD,IAAAkhD,YAAA,SAAAvgF,GAAA,GAAA65B,GAAAq6B,EAAAtrD,EAAA3I,EAAAqQ,EAAAtQ,EAAAqG,KAAArH,QAAAgB,EAAAqG,KAAAxG,MAAAb,MAAA,IAAAsR,EAAA,CAAA1H,EAAAy2B,EAAAp1B,kBAAA,EAAAhK,EAAAo/B,EAAA90B,WAAA3B,EAAAsrD,EAAA5jD,EAAA7J,MAAA,KAAAf,IAAA,SAAA25B,GAAA,GAAAr/B,KAAA,OAAAq/B,GAAA3gB,OAAAjY,MAAA,OAAA9H,QAAA,SAAA0gC,EAAAxF,GAAA,GAAAq6B,GAAAtyD,SAAAy9B,EAAAtxB,UAAA,EAAAsxB,EAAA38B,OAAA,GAAA,GAAA,OAAA,KAAAm3B,EAAA75B,EAAA0G,IAAA24B,OAAA60B,IAAAl0D,EAAAuO,MAAA2lD,EAAAl0D,EAAA0gF,QAAArhD,EAAAA,EAAA38B,OAAA,OAAA1C,IAAAk0D,EAAAhyD,KAAA,SAAAm9B,EAAAr/B,GAAA,MAAAq/B,GAAA9wB,MAAAvO,EAAAuO,OAAA,KAAA,GAAAurB,GAAA,EAAAA,EAAAo6B,EAAAxxD,OAAAo3B,IAAA,CAAA,GAAAzwB,GAAA6qD,EAAAp6B,EAAA,IAAA,MAAAzwB,EAAAq3E,SAAAr3E,EAAAkF,OAAAtO,GAAA,MAAAoJ,EAAAq3E,SAAAr3E,EAAAkF,OAAA3F,EAAA,CAAAixB,EAAAxwB,CAAA,SAAAwwB,GAAAq6B,EAAAxxD,SAAAm3B,EAAAq6B,EAAAA,EAAAxxD,OAAA,IAAAm3B,IAAA75B,EAAAR,IAAAq6B,EAAAnzB,IAAA1G,EAAAI,OAAAJ,EAAAK,QAAA,KAAAw5B,EAAA6mD,UAAA1gF,EAAAK,OAAAL,EAAAI,MAAAJ,EAAAK,OAAAw5B,EAAAtrB,MAAAvO,EAAAI,MAAAy5B,EAAAtrB,OAAAvO,EAAAqG,KAAArH,OAAAsR,KAAAmwE,YAAA,SAAAphD,GAAA,GAAA60B,GAAAvzD,KAAAiI,EAAA5I,EAAAnD,cAAA,OAAAoD,EAAA45B,EAAAjxB,EAAAy2B,GAAAihD,OAAArgF,EAAA0kC,IAAA,QAAA,WAAAuvB,EAAAksB,SAAA/gD,KAAAsF,IAAA,OAAA,WAAA,GAAA3kC,EAAAq/B,GAAAmhD,SAAAtsB,EAAAysB,sBAAAthD,EAAA1+B,KAAAigF,aAAAjgF,KAAAkgF,eAAA3sB,EAAAkmB,UAAA/6C,IAAA60B,EAAAiqB,YAAA9+C,EAAAh5B,KAAArH,SAAAgB,EAAAq/B,EAAAh5B,KAAAgC,MAAArI,GAAA,SAAAA,IAAAA,GAAAq/B,EAAAj/B,MAAAi/B,EAAAh/B,OAAA,GAAAiQ,EAAAlQ,QAAAkQ,EAAAjQ,SAAA,EAAA,MAAAoB,KAAAI,MAAAw9B,EAAAj/B,MAAAi/B,EAAAh/B,OAAA,MAAA,MAAAJ,EAAAmB,KAAA,QAAApB,GAAAoB,KAAA,SAAAi+B,EAAAh5B,KAAArH,SAAAqgC,EAAAmhD,QAAA94E,WAAA,WAAA23B,EAAAmhD,SAAAtsB,EAAAiqB,WAAA9+C,EAAAmhD,OAAA38D,QAAApiB,KAAAo8C,IAAA,IAAAp8C,KAAA6I,IAAA,IAAA+0B,EAAAh/B,OAAA,QAAA6zD,EAAA4sB,YAAAzhD,MAAAt+B,SAAA,kBAAAK,KAAA,MAAAi+B,EAAA7/B,KAAA8D,SAAA+7B,EAAA4/C,WAAAr2E,EAAAqM,UAAA,YAAArM,EAAA3D,aAAAhF,EAAA2gF,cAAA3gF,EAAA4gF,cAAA5gF,EAAAugC,QAAA,QAAA53B,EAAAuf,OAAAloB,EAAAugC,QAAA,UAAAmgD,sBAAA,SAAAthD,EAAAr/B,EAAA65B,GAAA,GAAAq6B,GAAAtyD,SAAAy9B,EAAAh5B,KAAAjG,MAAA,IAAAwI,EAAAhH,SAAAy9B,EAAAh5B,KAAAhG,OAAA,GAAAg/B,GAAAj/B,MAAAJ,EAAAq/B,EAAAh/B,OAAAw5B,EAAAq6B,EAAA,IAAA70B,EAAAj/B,MAAA8zD,EAAA70B,EAAAh/B,OAAAoB,KAAAikE,MAAAxR,EAAAr6B,EAAA75B,IAAA4I,EAAA,IAAAy2B,EAAAj/B,MAAAqB,KAAAikE,MAAA98D,EAAA5I,EAAA65B,GAAAwF,EAAAh/B,OAAAuI,IAAAs3E,UAAA,SAAA7gD,GAAA,GAAAr/B,GAAAk0D,EAAAvzD,KAAAiI,EAAAy2B,EAAAh5B,KAAA3G,OAAAO,EAAAo/B,EAAAm/C,MAAAn/C,GAAA4/C,SAAAplD,EAAA,gCAAAjxB,EAAAqvE,QAAA,sBAAA,IAAA,YAAAl1E,IAAA6F,EAAA7F,KAAAO,SAAArD,GAAAA,EAAAc,SAAA,mBAAAs+B,EAAAwT,aAAAxT,EAAA0hD,QAAA/gF,EAAA65B,EAAAjxB,EAAAsvE,IAAAt0E,QAAA,YAAA,GAAA8Q,OAAAC,YAAAvT,KAAAwH,EAAAxH,MAAAkC,SAAA+7B,EAAA4/C,UAAAr2E,EAAAqvE,SAAA/jB,EAAAmsB,YAAAhhD,GAAAr/B,EAAAuS,GAAA,mBAAA,SAAAvS,GAAAW,KAAA6pB,QAAA,EAAA6U,EAAAm/C,OAAAh+C,QAAA,WAAA0zB,EAAAkmB,UAAA/6C,KAAAp/B,EAAAsS,GAAA,aAAA,WAAA,GAAAsnB,GAAAq6B,EAAA5jD,EAAA+uB,EAAA4/C,SAAAnlD,EAAAlxB,EAAA7F,IAAA3C,MAAAiJ,EAAAT,EAAA7F,IAAA1C,MAAA,IAAA,IAAAL,EAAA,GAAAwqB,QAAA,CAAA,IAAAqP,EAAA75B,EAAAqnB,WAAA6sC,EAAAr6B,EAAAh5B,KAAA,QAAA,MAAAw+B,IAAA60B,GAAAA,EAAAxxD,QAAAwxD,EAAAx6B,WAAAh3B,SAAAzC,EAAA8C,IAAA,WAAA,WAAAuN,EAAAvN,KAAA3C,MAAA,OAAA4gF,YAAA,OAAA3gF,OAAA,WAAA,SAAAy5B,IAAAA,EAAAr4B,KAAAipE,KAAAjpE,KAAA6I,IAAA4pD,EAAA,GAAAzpD,YAAAypD,EAAA2E,YAAA,MAAAvoD,EAAAvN,IAAA,QAAA+2B,GAAA,IAAA/2B,IAAA,YAAA,IAAA,SAAAsG,IAAAA,EAAA5H,KAAAipE,KAAAjpE,KAAA6I,IAAA4pD,EAAA,GAAAvpD,aAAAupD,EAAA8E,aAAA,MAAA1oD,EAAAvN,IAAA,SAAAsG,GAAA,IAAApJ,EAAA8C,IAAA,WAAA,SAAAuN,EAAAxP,YAAA,0BAAAozD,EAAAkmB,UAAA/6C,GAAAr/B,EAAAoB,KAAA,MAAAi+B,EAAA7/B,KAAAS,EAAA0kC,IAAA,UAAA,WAAA,IAAA9K,EAAAl5B,MAAAE,KAAA,UAAAgjB,OAAAgtB,SAAAzvC,KAAA,MAAA,iBAAA,MAAAi+B,IAAAxF,EAAAl5B,MAAAo8B,IAAA,cAAA15B,QAAAg8B,EAAAw/C,UAAA,EAAAx/C,EAAA4hD,YAAA,KAAAnvB,WAAA,SAAAzyB,EAAAr/B,GAAA,GAAAk0D,GAAAvzD,IAAAuzD,GAAAiqB,YAAAjqB,EAAA4sB,YAAAzhD,GAAAA,EAAA4/C,UAAAplD,EAAAs9C,SAAA3xD,KAAA6Z,EAAA4/C,UAAA5/C,EAAAm/C,OAAAn7E,QAAA0a,EAAA/d,IAAAA,EAAA+B,SAAAW,SAAA1C,EAAAwwC,SAAA,qBAAAxwC,EAAA+B,SAAAyuC,SAAA,sBAAAxwC,EAAAm6B,QAAA,mBAAAqG,QAAA,WAAAnB,EAAA6hD,aAAArnD,EAAA,SAAAhW,OAAAikB,YAAA9nC,GAAAA,EAAA+C,IAAA,UAAA,iBAAAs8B,EAAA6/C,WAAA,WAAArlD,EAAAtwB,KAAAvJ,KAAAA,EAAA65B,EAAA,SAAA12B,OAAA02B,EAAAnb,KAAA1e,IAAAqnB,YAAAgY,EAAAh5B,KAAAiT,SAAAtZ,EAAA65B,EAAA,SAAAl6B,KAAAK,GAAAa,KAAAw+B,EAAAh5B,KAAAiT,UAAA+lB,EAAAm/C,OAAA75C,IAAA,UAAA,WAAA9K,EAAAl5B,MAAAE,KAAA,eAAA2/B,QAAA,SAAAnB,EAAA6hD,eAAA7hD,EAAA6hD,aAAA9+E,MAAApC,EAAAc,YAAA,oBAAA+iB,QAAAzkB,SAAAigC,EAAA6hD,aAAA,MAAA7hD,EAAA8hD,YAAA9hD,EAAA8hD,UAAA/hF,SAAAigC,EAAA8hD,UAAA,MAAA9hD,EAAA6/C,WAAArlD,EAAAl5B,MAAA0C,QAAAg8B,EAAAw/C,UAAA,EAAAx/C,EAAA4hD,YAAA,KAAApnD,EAAA75B,GAAAsD,SAAA+7B,EAAAm/C,QAAA3kD,EAAA75B,GAAAq5B,GAAA,iBAAAQ,EAAA75B,GAAAe,SAAA,kBAAA84B,EAAA75B,GAAAgnC,KAAA,eAAA3H,EAAAwT,YAAA,QAAAxT,EAAAh5B,KAAAjG,MAAAi/B,EAAAh5B,KAAAjG,OAAAy5B,EAAA75B,GAAAoB,KAAA,SAAAi+B,EAAAh5B,KAAAhG,OAAAg/B,EAAAh5B,KAAAhG,QAAAw5B,EAAA75B,GAAAoB,KAAA,WAAAi+B,EAAA4/C,SAAA5/C,EAAAm/C,OAAA9kD,WAAApgB,OAAA,uDAAA4Q,QAAAmV,EAAA4/C,SAAAzkD,WAAA3W,OAAAwb,EAAA4/C,SAAAv8E,SAAA28B,EAAA4/C,SAAA5/C,EAAAm/C,OAAA5oC,UAAA,eAAAlc,WAAAxP,SAAAmV,EAAA4/C,SAAAl+E,SAAA,oBAAAs+B,EAAAm/C,OAAAz9E,SAAA,mBAAAs+B,EAAAwT,aAAAqhB,EAAAkmB,UAAA/6C,KAAA+gD,SAAA,SAAA/gD,GAAAA,EAAA6/C,UAAA,EAAA7/C,EAAAm/C,OAAAh+C,QAAA,WAAA1/B,YAAA,mBAAAu+B,EAAAwT,aAAA9xC,SAAA,yBAAAs+B,EAAAwT,YAAA,OAAAlyC,KAAAmxD,WAAAzyB,EAAA1+B,KAAAk8E,UAAAx9C,EAAAA,EAAAh5B,KAAA2yE,WAAA35C,EAAArxB,MAAArN,KAAA87E,UAAA97E,KAAAy9E,aAAA,IAAAiC,YAAA,SAAAhhD,GAAA,GAAAr/B,GAAAW,MAAA0+B,EAAAA,GAAAr/B,EAAA6nB,WAAAwX,EAAA+hD,WAAA/hD,EAAA+hD,SAAAvnD,EAAA75B,EAAA68E,UAAA78E,EAAAA,EAAAqG,KAAA0yE,aAAAz1E,SAAA+7B,EAAAm/C,QAAA36D,OAAAwpB,OAAA,UAAAyzC,YAAA,SAAAzhD,GAAA,GAAAr/B,GAAAW,MAAA0+B,EAAAA,GAAAr/B,EAAA6nB,UAAAwX,EAAA+hD,WAAA/hD,EAAA+hD,SAAA57D,OAAApmB,eAAAigC,GAAA+hD,WAAAhH,UAAA,SAAA/6C,GAAA,GAAAr/B,GAAAW,IAAAX,GAAAm+E,YAAA9+C,EAAAyrB,WAAA,EAAAzrB,EAAAw/C,UAAA,EAAA7+E,EAAAwgC,QAAA,YAAAnB,GAAAr/B,EAAA8gF,YAAAzhD,IAAAA,EAAAh5B,KAAAuxE,UAAAv4C,EAAA8hD,WAAA9hD,EAAA8hD,UAAAz+E,SAAA28B,EAAA8hD,UAAAtnD,EAAA75B,EAAA68E,UAAAx9C,EAAAA,EAAAh5B,KAAA4yE,OAAArB,WAAAt0E,SAAA+7B,EAAA4/C,WAAA5/C,EAAAh5B,KAAA2xE,SAAA34C,EAAA4/C,WAAA5/C,EAAA6/C,WAAA7/C,EAAA4/C,SAAA1sE,GAAA,iBAAA,SAAA8sB,GAAA,MAAA,IAAAA,EAAAvH,QAAAuH,EAAA6B,kBAAA,IAAA,UAAA7B,EAAA91B,MAAAswB,EAAA,0CAAAv2B,SAAA+7B,EAAA4/C,WAAAj/E,EAAA0/E,cAAArgD,GAAAr/B,EAAA2/E,aAAAtgD,GAAAA,EAAArxB,MAAAhO,EAAAy8E,SAAAz8E,EAAAm/E,eAAAn/E,EAAA8+E,cAAAz/C,KAAAqgD,cAAA,SAAArgD,GAAA,GAAAr/B,GAAA65B,EAAAl5B,KAAAuzD,EAAA70B,GAAAxF,EAAAhS,QAAAjf,EAAAsrD,EAAA7tD,KAAAigC,QAAArmC,EAAAi0D,EAAA7tD,KAAAoxE,sBAAAnnE,EAAAupB,EAAAijD,MAAAx2C,QAAAxM,GAAA,CAAAxpB,GAAA+/B,YAAA,6BAAApwC,GAAAA,GAAA2I,GAAAA,EAAAlG,SAAAwxD,EAAAlmD,MAAA6rB,EAAA4iD,SAAAz8E,EAAAsQ,EAAAxN,QAAAQ,SAAAgN,EAAAvO,UAAA/B,EAAA05B,WAAAvP,GAAA,GAAA9mB,QAAA1D,KAAAiJ,GAAAkxB,EAAA95B,EAAAg5D,aAAA,GAAAh5D,EAAAqD,QAAAjE,UAAAy6B,EAAAwnD,WAAAvnD,EAAAD,EAAAwnD,SAAAroB,aAAA,IAAA9E,EAAAsqB,OAAAz7E,IAAA,iBAAA+2B,GAAA,MAAA6lD,aAAA,SAAAtgD,GAAA,GAAAr/B,GAAA65B,EAAAq6B,EAAAtrD,EAAA3I,EAAAU,KAAA2P,EAAA+uB,GAAAp/B,EAAA4nB,OAAAvX,GAAAuuE,WAAA,IAAAvuE,EAAAjK,KAAAi7E,mBAAAhxE,EAAA2uE,SAAAl8E,IAAA,gBAAA,IAAAuN,EAAA2uE,SAAAjmB,cAAA1oD,EAAAkuE,OAAAn+E,SAAA,KAAA6zD,EAAA5jD,EAAAkuE,OAAA,GAAAzhF,MAAA,kBAAA6L,EAAA0H,EAAAkuE,OAAAz7E,IAAA,kBAAA6L,WAAAhG,GAAA,IAAA5I,EAAAsQ,EAAAkuE,OAAA,GAAA/vC,aAAAn+B,EAAAkuE,OAAAz7E,IAAA,iBAAA,GAAAtB,KAAAC,IAAA1B,EAAAsQ,EAAAkuE,OAAA,GAAA/vC,cAAA,IAAA5U,EAAAjxB,GAAA0H,EAAAkuE,OAAAz7E,IAAA,iBAAAmxD,KAAA5jD,EAAA2uE,SAAAl8E,IAAA,gBAAA82B,KAAAilD,cAAA,SAAAz/C,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAA3I,EAAAqQ,EAAA3P,KAAAm5B,EAAAuF,EAAAm/C,OAAAn1E,GAAA,EAAA0U,GAAA,EAAA5P,EAAAmC,EAAAiuE,QAAAl/C,GAAAjqB,EAAAiqB,EAAA4hD,UAAA,OAAA5hD,GAAA4hD,YAAA,EAAAjhF,EAAAq/B,EAAAh5B,KAAAiK,EAAAosE,SAAA,kBAAA,oBAAA9zE,EAAAy2B,EAAAh5B,KAAAiK,EAAAosE,SAAA,oBAAA,sBAAA9zE,EAAAhH,SAAA,SAAAy9B,EAAAi/C,eAAA11E,EAAAy2B,EAAAi/C,eAAA,KAAAnwE,GAAAkxB,EAAArxB,MAAAsC,EAAAmsE,SAAA7zE,IAAA5I,GAAA,GAAA,SAAAA,IAAAq/B,EAAArxB,MAAAsC,EAAAmsE,SAAA7zE,GAAA,UAAAy2B,EAAA91B,OAAA81B,EAAA6/C,WAAAnhE,EAAAzN,EAAAixE,YAAAliD,IAAAh2B,EAAAiH,EAAAkvE,UAAAngD,GAAAr/B,EAAA,QAAA,SAAAA,GAAAsQ,EAAA8tE,aAAA,EAAA/0E,EAAA+1E,OAAA/1E,EAAAjJ,MAAA2d,EAAA3d,MAAAiJ,EAAAg2E,OAAAh2E,EAAAhJ,OAAA0d,EAAA1d,OAAAJ,EAAAo/B,EAAAh5B,KAAAoyE,YAAA,QAAAx4E,IAAAA,EAAAwB,KAAAC,IAAA29B,EAAAj/B,MAAAi/B,EAAAh/B,OAAA0d,EAAA3d,MAAA2d,EAAA1d,QAAA,IAAAJ,IAAA8d,EAAAkE,QAAA,GAAA5Y,EAAA4Y,QAAA,GAAA4X,EAAAs9C,SAAAyH,aAAAv/C,EAAA4/C,SAAAn+E,YAAA,sBAAAid,GAAA6tB,EAAAvM,EAAA4/C,cAAAplD,GAAAs9C,SAAAxqC,QAAAtN,EAAA4/C,SAAA51E,EAAAT,EAAA,WAAA0H,EAAA8tE,aAAA,EAAA9tE,EAAA2E,eAAA3E,EAAAyuE,YAAA1/C,GAAAr/B,GAAA65B,EAAAs9C,SAAA3xD,KAAAsU,GAAAo6B,EAAA,oBAAA70B,EAAArxB,KAAAsC,EAAAksE,QAAA,OAAA,YAAA,kCAAAx8E,EAAA85B,EAAA/4B,SAAAmzD,GAAApzD,YAAA,2BAAAu+B,EAAA4/C,SAAAn+E,YAAA,sBAAA8qC,EAAA9R,GAAA,UAAAuF,EAAA91B,MAAA81B,EAAA4/C,SAAAp7D,OAAA5D,KAAA,OAAA4Z,GAAAs9C,SAAAxqC,QAAA7S,EAAA,0BAAAlxB,EAAA,WAAAkxB,EAAAh5B,YAAAozD,GAAAnxD,KAAAqrE,UAAA,GAAAnsD,QAAA,KAAAod,EAAArxB,MAAAsC,EAAAmsE,SAAAnsE,EAAA2E,aAAA,KAAAoqB,EAAA4/C,SAAAn+E,YAAA,sBAAAsU,IAAAjH,GAAA,UAAAkxB,EAAA91B,MAAA81B,EAAA6/C,UAAA7/C,EAAA4/C,SAAAp7D,OAAAwpB,OAAA,aAAAhO,EAAArxB,MAAAsC,EAAAmsE,SAAAnsE,EAAA2E,eAAAssE,YAAA,SAAAliD,GAAA,GAAAr/B,GAAAk0D,EAAAtrD,EAAA3I,EAAAqQ,EAAAwpB,GAAA,EAAAzwB,EAAAg2B,EAAA49C,MAAA,UAAA5zE,IAAA+jE,EAAA/jE,EAAA,OAAArJ,EAAA65B,EAAAs9C,SAAAuH,aAAAr1E,GAAA6qD,EAAAtlD,WAAAvF,EAAAtG,IAAA,qBAAA,GAAA6F,EAAAgG,WAAAvF,EAAAtG,IAAA,uBAAA,GAAA9C,EAAA2O,WAAAvF,EAAAtG,IAAA,wBAAA,GAAAuN,EAAA1B,WAAAvF,EAAAtG,IAAA,sBAAA,GAAA+2B,GAAA7F,IAAAj0B,EAAAi0B,IAAAigC,EAAAvrB,KAAA3oC,EAAA2oC,KAAAr4B,EAAAlQ,MAAAJ,EAAAI,MAAAwI,EAAA0H,EAAAjQ,OAAAL,EAAAK,OAAA6zD,EAAAj0D,EAAAm/E,OAAA,EAAAC,OAAA,GAAAr/E,EAAAI,MAAA,GAAAJ,EAAAK,OAAA,GAAAy5B,IAAA7kB,SAAA,WAAA,GAAAoqB,GAAAr/B,EAAAW,KAAAuzD,EAAAl0D,EAAA6nB,QAAAjf,MAAA5I,EAAAu+E,WAAArqB,EAAA2qB,WAAA3qB,EAAAyqB,aAAAzqB,EAAAyqB,YAAA,EAAAzqB,EAAAsqB,OAAAhkD,WAAAgG,QAAA,WAAAxgC,EAAAi4E,QAAA,UAAArsC,EAAAsoB,EAAAsqB,QAAAtqB,EAAAsqB,OAAAz9E,SAAA,4BAAA84B,EAAAt5B,KAAAP,EAAA28E,OAAA,SAAAt9C,EAAA60B,GAAAA,EAAAlmD,KAAAhO,EAAAy8E,QAAA,GAAAvoB,EAAAlmD,KAAAhO,EAAAy8E,QAAA,EAAA7zE,EAAAsrD,EAAAlmD,KAAAkmD,EAAAA,IAAAr6B,EAAAs9C,SAAA3xD,KAAA0uC,EAAAsqB,QAAAtqB,EAAAsqB,OAAAzhD,MAAA39B,YAAAY,EAAA28E,OAAA/zE,GAAA5I,EAAAo+E,aAAA,EAAAp+E,EAAAm/E,eAAAn/E,EAAAwgC,QAAA,aAAA0zB,EAAA7tD,KAAA+xE,MAAAC,WAAAnkB,EAAAsqB,OAAA39E,KAAA,eAAAyY,OAAA,kBAAAknB,QAAA,QAAAmE,IAAA,QAAA,WAAA68C,SAAAC,eAAAD,SAAAC,iBAAA9gF,KAAA+gF,sBAAA/gF,KAAA+gF,uBAAA1hF,EAAA25B,SAAAu6B,EAAA7tD,KAAAkzE,WAAA,SAAArlB,EAAArhB,cAAAxT,EAAA60B,EAAA+qB,SAAAp+E,KAAA,0CAAAw+B,EAAA38B,OAAA28B,EAAAmB,QAAA,SAAAxgC,EAAAu3B,MAAA,MAAA,IAAA28B,EAAAsqB,OAAAz7C,UAAA,GAAAJ,WAAA,KAAAs1C,QAAA,SAAA54C,GAAA,GAAAr/B,GAAA65B,EAAAq6B,EAAAvzD,IAAAuzD,GAAAvV,MAAAj8C,OAAA,IAAAm3B,EAAAq6B,EAAAyoB,OAAAzoB,EAAAuoB,QAAA,GAAAz8E,EAAAk0D,EAAAyoB,OAAAzoB,EAAAuoB,QAAA,GAAAz8E,GAAAA,EAAAuJ,OAAA81B,GAAA60B,EAAAuqB,UAAAz+E,GAAA65B,GAAAA,EAAAtwB,OAAA81B,GAAA60B,EAAAuqB,UAAA5kD,KAAAtC,MAAA,SAAA8H,EAAA60B,GAAA,GAAAtrD,GAAA3I,EAAAqQ,EAAA3P,KAAAm5B,GAAA,UAAA,aAAA,gEAAA,4CAAA,8CAAA,4CAAA,SAAA,SAAA,QAAA,QAAA,QAAA,oBAAA,mCAAAlzB,KAAA,IAAA0J,GAAA6tE,YAAAv1E,GAAAy2B,GAAA/uB,EAAAuX,SAAAvX,EAAAuX,QAAA82D,WAAAruE,EAAAuX,QAAA22D,OAAA39E,KAAA,aAAAqzD,EAAA,8BAAA,KAAA5jD,EAAAwsE,MAAA3/C,UAAAt8B,KAAA,aAAA+H,EAAAA,EAAA0Q,OAAAwgB,GAAAxgB,OAAA,WAAA,MAAA,WAAAugB,EAAAl5B,MAAAoC,IAAA,gBAAA82B,EAAAl5B,MAAA6vC,SAAA,cAAA5nC,EAAAlG,QAAAzC,EAAA2I,EAAA1H,MAAAlB,EAAAmc,eAAAkjB,GAAAA,EAAAu+C,UAAA39E,EAAA,GAAA,GAAAA,KAAAo/B,EAAA6B,iBAAAt4B,EAAAuhB,GAAAvhB,EAAAlG,OAAA,GAAA89B,QAAA,WAAAvgC,EAAA,GAAAA,GAAA2I,EAAAlG,OAAA,KAAA28B,GAAAA,EAAA6B,iBAAAt4B,EAAAuhB,GAAA,GAAAqW,QAAA,WAAAlwB,EAAAwsE,MAAA3/C,UAAAqD,QAAA,WAAA60B,SAAA,WAAA,GAAAh2B,GAAA1+B,IAAAk5B,GAAA,uBAAAt5B,KAAA,WAAA,GAAAP,GAAA65B,EAAAl5B,MAAAC,KAAA,WAAAZ,IAAAA,EAAA4F,KAAAy5B,EAAAz5B,KAAA5F,EAAAm+E,YAAAn+E,EAAAwgC,QAAA,gBAAAxgC,EAAAu9E,eAAAv9E,EAAAuoD,WAAA,KAAAlpB,EAAAkpB,WAAA,GAAAlpB,EAAAxX,SAAAwX,EAAAy+C,UAAAz+C,EAAAq+C,SAAAr+C,EAAA89C,kBAAA99C,EAAAmB,QAAA,cAAAnB,EAAAi+C,aAAAh+D,MAAA,SAAA+f,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,EAAA3I,EAAAqQ,EAAAwpB,EAAAzwB,EAAA0U,EAAA3I,EAAAzU,KAAAwsE,EAAA/3D,EAAAyS,QAAAzZ,EAAA,WAAAgH,EAAAusE,QAAAtiD,GAAA,SAAAjqB,EAAA+oE,YAAA/oE,EAAA+oE,WAAA,GAAA,IAAA/oE,EAAAorB,QAAA,cAAAnB,IAAAjqB,EAAA+oE,WAAA,EAAAhwE,EAAA,WAAAiH,EAAAsoE,WAAA,IAAAtoE,EAAAmoE,eAAAt9E,EAAAktE,EAAA8R,SAAA/qB,EAAAiZ,EAAA9mE,KAAAkyE,gBAAA3vE,EAAAixB,EAAAlP,UAAA3qB,GAAAA,EAAAk0D,EAAAiZ,EAAA9mE,KAAAmyE,kBAAA,EAAArL,EAAAqR,OAAA19E,YAAA,6FAAA,IAAAu+B,EAAAxF,EAAAs9C,SAAA3xD,KAAA2nD,EAAAqR,QAAAtqB,GAAA,EAAAiZ,EAAAqR,OAAAhkD,WAAAgG,QAAA,WAAAphC,SAAAwJ,GAAAwM,EAAA0nE,MAAA3/C,UAAAr8B,YAAA,oBAAAC,SAAA,uBAAAgC,IAAA,sBAAA6F,EAAA,MAAAwM,EAAA0rE,YAAA3T,GAAA/3D,EAAA8oE,cAAA,GAAA9oE,EAAA+pE,eAAA,SAAAjrB,GAAAj0D,GAAA2I,GAAA,UAAAukE,EAAA5jE,OAAA6L,EAAAmpE,YAAApR,EAAA+R,WAAAnhE,EAAA3I,EAAAmsE,YAAApU,MAAAjZ,EAAA,QAAA,SAAAA,GAAAr6B,EAAAs9C,SAAA3xD,KAAAvlB,GAAAqQ,EAAAupB,EAAAs9C,SAAAuH,aAAAz+E,GAAAoJ,GAAA4qB,IAAA3jB,EAAA2jB,IAAA0U,KAAAr4B,EAAAq4B,KAAAy2C,OAAA9uE,EAAAlQ,MAAA2d,EAAA3d,MAAAi/E,OAAA/uE,EAAAjQ,OAAA0d,EAAA1d,OAAAD,MAAA2d,EAAA3d,MAAAC,OAAA0d,EAAA1d,QAAAy5B,EAAAqzC,EAAA9mE,KAAAoyE,YACA,QAAA3+C,IAAAA,EAAAr4B,KAAAC,IAAAyrE,EAAA/sE,MAAA+sE,EAAA9sE,OAAA0d,EAAA3d,MAAA2d,EAAA1d,QAAA,IAAAy5B,IAAA/b,EAAAkE,QAAA,GAAA4X,EAAAs9C,SAAAyH,aAAA3+E,EAAAoJ,GAAAuiC,EAAA3rC,GAAA45B,EAAAs9C,SAAAxqC,QAAA1sC,EAAA8d,EAAAnV,EAAAwF,GAAA,IAAA8lD,GAAAtrD,EAAAixB,EAAAs9C,SAAAxqC,QAAAwgC,EAAAqR,OAAAz9E,SAAA,4BAAAD,YAAA,2BAAA,iCAAAozD,EAAAtrD,EAAAwF,IAAA,IAAAixB,EAAA33B,WAAA0G,EAAAxF,GAAAwF,IAAA,OAAAuzE,QAAA,SAAA3hF,GAAA,GAAAk0D,GAAAtrD,EAAA3I,EAAAqQ,EAAA3P,KAAAm5B,EAAAxpB,EAAAuX,QAAAxhB,KAAA22E,KAAA1sE,GAAAuX,QAAA22D,OAAAh+C,QAAA,WAAAlwB,EAAAwsE,MAAA3/C,UAAA95B,QAAAjE,SAAAkR,EAAAkwB,QAAA,aAAAxgC,GAAAsQ,EAAAuX,QAAAxhB,KAAAmzE,YAAA1/C,GAAAA,EAAAp3B,QAAAo3B,EAAAT,GAAA,cAAAS,EAAAxpB,EAAA68C,UAAArzB,GAAAA,EAAAp3B,SAAAkG,EAAAy2B,EAAA2hC,QAAA/gE,EAAAo/B,EAAA4hC,QAAAnnC,EAAA0G,QAAA,SAAA3G,EAAA,cAAAkJ,UAAA9iC,GAAA0iC,WAAA/5B,KAAA0H,EAAAuX,QAAA,KAAAqsC,EAAAr6B,EAAAs9C,SAAAC,cAAAljB,EAAAA,EAAAmB,YAAAx7B,EAAA,QAAA/4B,YAAA,4CAAA+4B,EAAA,4BAAAz6B,WAAAohC,QAAA,SAAAnB,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,EAAA8hB,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,GAAAjT,EAAAU,KAAA2P,EAAAtQ,GAAAA,EAAAqG,KAAArG,EAAAC,EAAA4nB,OAAA,OAAAvX,GAAA1H,EAAAud,QAAA7V,GAAAA,EAAArQ,EAAA2I,EAAAud,QAAAlmB,GAAA45B,EAAA3gB,WAAA5I,EAAAjK,KAAAg5B,MAAA60B,EAAA5jD,EAAAjK,KAAAg5B,GAAA5pB,MAAAnF,EAAA1H,KAAA,IAAAsrD,EAAAA,OAAA,eAAA70B,GAAAp/B,EAAA68E,MAAA78E,EAAA68E,MAAA3/C,UAAAqD,QAAAnB,EAAA,MAAAz2B,GAAAkxB,EAAA0G,QAAAnB,EAAA,MAAAz2B,KAAAu0E,eAAA,WAAA,GAAA99C,GAAA1+B,KAAAuzD,EAAA70B,EAAAxX,QAAAjf,EAAAsrD,EAAAhzD,MAAAjB,EAAAo/B,EAAAy9C,MAAA3/C,UAAA7sB,EAAA+uB,EAAAy9C,MAAAx2C,QAAAxM,EAAAo6B,EAAA7tD,KAAAigC,OAAA4tB,GAAAsqB,OAAAh+C,QAAA,WAAA1G,GAAAA,EAAAp3B,QAAA28B,EAAAgiD,SAAA/wE,EAAAA,EAAAopB,WAAAvP,GAAA,GAAAxqB,KAAAm6B,IAAAuF,EAAAgiD,SAAA,KAAAhiD,EAAAuiD,mBAAAviD,EAAAy+C,QAAAz+C,EAAA0+C,eAAA99E,EAAAY,KAAA,yBAAAlB,KAAA0/B,EAAAsf,MAAAj8C,QAAAzC,EAAAY,KAAA,yBAAAlB,KAAAiJ,EAAA,GAAA3I,EAAAY,KAAA,wBAAAygB,KAAA,YAAA4yC,EAAA7tD,KAAAkxE,MAAA3uE,GAAA,GAAA3I,EAAAY,KAAA,wBAAAygB,KAAA,YAAA4yC,EAAA7tD,KAAAkxE,MAAA3uE,GAAAy2B,EAAAsf,MAAAj8C,OAAA,GAAA,UAAAwxD,EAAA3qD,KAAAtJ,EAAAY,KAAA,wBAAAof,OAAAsB,MAAA1gB,KAAA,4BAAAO,KAAA,OAAA8yD,EAAA7tD,KAAAxG,MAAAL,KAAA00D,EAAA10D,KAAAygB,OAAAi0C,EAAA7tD,KAAAwxE,SAAA53E,EAAAY,KAAA,iDAAAgjB,OAAAgW,EAAA75B,EAAAmc,eAAAkd,GAAA,uBAAAgG,EAAAy9C,MAAA3/C,UAAAqD,QAAA,UAAA09C,aAAA,SAAA7+C,GAAA,GAAAr/B,GAAAW,KAAAk5B,GAAA,UAAA,UAAA,QAAAwF,GAAAr/B,EAAA6nB,QAAAxhB,KAAAoxE,uBAAA59C,EAAA5yB,KAAA,WAAAtG,KAAAm8E,MAAA3/C,UAAAr8B,YAAA+4B,EAAAn0B,IAAA,SAAA25B,GAAA,MAAA,iBAAAA,IAAAz4B,KAAA,MAAAjG,KAAAihF,mBAAA,GAAA7D,aAAA,WAAA,GAAA1+C,GAAA1+B,KAAAX,EAAAq/B,EAAAxX,QAAAwX,EAAAxX,QAAAxhB,KAAAg5B,EAAAh5B,KAAAwzB,EAAAwF,EAAAy9C,MAAA3/C,SAAAkC,GAAAuiD,mBAAA,EAAAviD,EAAAw+C,mBAAA,EAAAhkD,EAAAwW,YAAA,2BAAArwC,EAAA63E,UAAA73E,EAAA83E,UAAAznC,YAAA,2BAAArwC,EAAA23E,SAAAt4C,EAAAsf,MAAAj8C,OAAA,IAAA2tC,YAAA,0BAAAhR,EAAAgiD,UAAAhxC,YAAA,uBAAArwC,EAAA03E,QAAAr4C,EAAAsf,MAAAj8C,OAAA,IAAA2tC,YAAA,sBAAArwC,EAAAswD,QAAAuxB,eAAA,WAAAlhF,KAAAihF,kBAAAjhF,KAAAo9E,eAAAp9E,KAAAu9E,kBAAArkD,EAAAs9C,UAAAhuD,QAAA,QAAAqyB,SAAAv7C,EAAAm3E,YAAA,SAAA/3C,GAAA,GAAAr/B,GAAA65B,EAAA,wDAAAj5B,KAAA,YAAAszD,EAAAxpC,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EAAA,OAAAlT,aAAAmC,KAAA,WAAA03B,EAAAtwB,KAAA81B,GAAAr/B,EAAAq/B,GAAA5pB,MAAAzV,EAAAk0D,GAAA,aAAAr6B,EAAAtwB,KAAA81B,IAAAA,EAAA5pB,MAAAzV,EAAAk0D,GAAAl0D,IAAA+G,KAAA,SAAAs4B,EAAAr/B,EAAA65B,GAAA,MAAA,IAAA13B,GAAAk9B,EAAAr/B,EAAA65B,IAAAva,MAAA,SAAA+f,GAAA,GAAAr/B,GAAAW,KAAAy2E,aAAAp3E,KAAAA,EAAAsf,SAAA,IAAA+f,GAAA1+B,KAAA2e,MAAA+f,KAAAmjB,QAAA,WAAA7hD,KAAA2e,OAAA,GAAAwa,EAAA1b,IAAA,QAAA2e,IAAA,iBAAA,OAAAs/C,SAAA,iEAAAn2E,KAAAqB,UAAAC,WAAAs6E,MAAA,WAAA,GAAAjoD,GAAA75B,EAAAnD,cAAA,MAAA,OAAAwiC,GAAA+I,kBAAA/I,EAAA+I,iBAAAvO,IAAAwF,EAAA+I,iBAAAvO,GAAA4O,iBAAA,gBAAAzoC,EAAA+hF,cAAA/hF,EAAA+hF,aAAA,OAAArD,aAAA,SAAAr/C,GAAA,GAAAr/B,EAAA,UAAAq/B,IAAAA,EAAA38B,UAAA1C,EAAAq/B,EAAA,GAAAuZ,yBAAA3kB,IAAAj0B,EAAAi0B,KAAA,EAAA0U,KAAA3oC,EAAA2oC,MAAA,EAAAvoC,MAAAJ,EAAAI,MAAAC,OAAAL,EAAAK,OAAA4hB,QAAArT,WAAAywB,EAAAt8B,IAAA,eAAA67E,aAAA,SAAAv/C,EAAAr/B,GAAA,GAAA65B,GAAA,GAAAq6B,IAAA,IAAA70B,GAAAr/B,EAAA,MAAA,UAAAA,EAAA2oC,MAAA,SAAA3oC,EAAAi0B,MAAA4F,GAAA,SAAA75B,EAAA2oC,KAAAtJ,EAAAn8B,WAAAylC,KAAA3oC,EAAA2oC,MAAA,QAAA,SAAA3oC,EAAAi0B,IAAAoL,EAAAn8B,WAAA+wB,IAAAj0B,EAAAi0B,KAAA,KAAA4F,EAAAl5B,KAAAmhF,MAAA,eAAAjoD,EAAA,SAAA,aAAAA,EAAA,KAAA,SAAA75B,EAAAo/E,QAAA,SAAAp/E,EAAAq/E,OAAAxlD,GAAA,UAAA75B,EAAAo/E,OAAA,KAAAp/E,EAAAq/E,OAAA,IAAA,SAAAr/E,EAAAo/E,SAAAvlD,GAAA,WAAA75B,EAAAo/E,OAAA,KAAAvlD,EAAAn3B,SAAAwxD,EAAAka,UAAAv0C,GAAA,SAAA75B,EAAAiiB,UAAAiyC,EAAAjyC,QAAAjiB,EAAAiiB,SAAA,SAAAjiB,EAAAI,QAAA8zD,EAAA9zD,MAAAJ,EAAAI,OAAA,SAAAJ,EAAAK,SAAA6zD,EAAA7zD,OAAAL,EAAAK,QAAAg/B,EAAAt8B,IAAAmxD,IAAAvnB,QAAA,SAAAtN,EAAAr/B,EAAAk0D,EAAAtrD,EAAA3I,GAAA,GAAAqQ,GAAAwpB,EAAAn5B,IAAAk5B,GAAA3gB,WAAAg7C,KAAAtrD,EAAAsrD,EAAAA,EAAA,MAAAp6B,EAAAtU,KAAA6Z,GAAA/uB,EAAAwpB,EAAA4kD,aAAAr/C,GAAAA,EAAA9sB,GAAA46D,EAAA,SAAA9jE,KAAAA,IAAAA,EAAAw4B,eAAAxC,EAAAhG,GAAAhwB,EAAAw4B,cAAA9iC,SAAA,WAAAsK,EAAAw4B,cAAA0C,gBAAAzK,EAAAtU,KAAA6Z,GAAAxF,EAAAlP,UAAAupC,IAAA70B,EAAAt8B,IAAA,sBAAA,IAAA82B,EAAAvP,cAAAtqB,GAAA,SAAAA,EAAAo/E,QAAA,SAAAp/E,EAAAq/E,QAAAvlD,EAAA8kD,aAAAv/C,GAAApL,IAAAj0B,EAAAi0B,IAAA0U,KAAA3oC,EAAA2oC,KAAAvoC,MAAAkQ,EAAAlQ,MAAAJ,EAAAo/E,OAAA/+E,OAAAiQ,EAAAjQ,OAAAL,EAAAq/E,OAAAD,OAAA,EAAAC,OAAA,KAAA,IAAAp/E,GAAAo/B,EAAAv+B,YAAAd,GAAA65B,EAAA3gB,WAAAtQ,IAAAA,EAAAS,MAAAwwB,EAAAlP,UAAAupC,IAAA70B,EAAAt8B,IAAA,sBAAAmxD,EAAA,MAAAr6B,EAAAvP,cAAAtqB,IAAA,SAAAA,EAAAo/E,QAAA,SAAAp/E,EAAAq/E,eAAAr/E,GAAAI,YAAAJ,GAAAK,OAAAg/B,EAAAt9B,SAAAyuC,SAAA,0BAAAnR,EAAAt9B,SAAAhB,SAAA,wBAAA84B,EAAAs9C,SAAAyH,aAAAv/C,EAAAr/B,IAAAq/B,EAAAt+B,SAAAf,GAAAq/B,EAAAz+B,KAAA,QAAA8G,WAAA,WAAA23B,EAAAmB,QAAA2sC,IAAAjZ,EAAA,MAAA1uC,KAAA,SAAA6Z,EAAAr/B,GAAAq/B,GAAAA,EAAA38B,SAAAqG,aAAAs2B,EAAAz+B,KAAA,UAAAZ,GAAAq/B,EAAAmB,QAAA2sC,GAAA9tC,EAAAtC,IAAAowC,GAAApqE,IAAA,sBAAA,IAAAs8B,EAAAt9B,SAAAjB,YAAA,0BAAA+4B,EAAAnnB,GAAAykE,SAAA,SAAA93C,GAAA,GAAAr/B,EAAA,OAAAq/B,GAAAA,MAAAr/B,EAAAq/B,EAAAjW,WAAA,EAAAppB,EAAA65B,EAAA,QAAAkD,IAAA,iBAAA/8B,GAAAuS,GAAA,iBAAAvS,GAAA3B,QAAAghC,GAAAz2B,GAAAjI,KAAAo8B,IAAA,kBAAAxqB,GAAA,kBAAA8kE,MAAA12E,KAAAtC,QAAAghC,GAAAz2B,GAAAjI,MAAAm5B,EAAAvnB,GAAA,iBAAA,kBAAA3J,GAAAkxB,EAAAvnB,GAAA,iBAAA,0BAAA,SAAA8sB,GAAAxF,EAAA,mBAAAA,EAAAl5B,MAAAS,KAAA,yBAAA,MAAA+oB,GAAA0P,EAAAl5B,MAAAS,KAAA,wBAAA,GAAAo/B,QAAA,kBAAA2sB,SAAAtzB,EAAAl5B,UAAA,WAAA,GAAA0+B,GAAA,IAAAvF,GAAAvnB,GAAA,+BAAA,mBAAA,SAAAvS,GAAA,OAAAA,EAAAuJ,MAAA,IAAA,YAAA81B,EAAAxF,EAAAl5B,KAAA,MAAA,KAAA,UAAA0+B,EAAA,IAAA,MAAA,KAAA,UAAAxF,EAAA,oBAAA/4B,YAAA,kBAAA+4B,EAAAl5B,MAAA04B,GAAAgG,IAAAxF,EAAAl5B,MAAA04B,GAAA,eAAAQ,EAAAl5B,MAAAI,SAAA,iBAAA,MAAA,KAAA,WAAA84B,EAAA,oBAAA/4B,YAAA,0BAAA1C,OAAA1B,SAAAW,QAAA,SAAAgiC,GAAA,YAAA,IAAAr/B,IAAAgiF,SAAA7zD,QAAA,wJAAA0pB,QAAAoqC,SAAA,EAAAC,SAAA,EAAAC,GAAA,EAAAC,IAAA,EAAAC,GAAA,EAAAC,MAAA,cAAAC,YAAA,EAAAC,MAAA,GAAAC,WAAA,EAAAl5E,KAAA,SAAA7C,IAAA,4CAAAw2E,MAAA,+CAAAwF,OAAAv0D,QAAA,oCAAA0pB,QAAAoqC,SAAA,EAAAI,GAAA,EAAAM,WAAA,EAAAC,YAAA,EAAAC,cAAA,EAAAC,WAAA,GAAAL,WAAA,EAAAl5E,KAAA,SAAA7C,IAAA,+BAAAq8E,WAAA50D,QAAA,yDAAA5kB,KAAA,QAAA7C,IAAA,2BAAAs8E,YAAA70D,QAAA,4GAAA5kB,KAAA,SAAA7C,IAAA,SAAA24B,GAAA,MAAA,iBAAAA,EAAA,GAAA,SAAAA,EAAA,GAAAA,EAAA,GAAA,MAAA59B,KAAAikE,MAAArmC,EAAA,MAAAA,EAAA,IAAAA,EAAA,IAAAz7B,QAAA,MAAA,KAAA,IAAAy7B,EAAA,IAAA,IAAAz7B,QAAA,KAAA,KAAA,YAAAy7B,EAAA,KAAAA,EAAA,IAAA3+B,QAAA,WAAA,EAAA,UAAA,WAAAuiF,aAAA90D,QAAA,oEAAA5kB,KAAA,SAAA7C,IAAA,SAAA24B,GAAA,MAAA,iBAAAA,EAAA,GAAA,WAAAA,EAAA,GAAAz7B,QAAA,SAAA,MAAAA,QAAA,QAAA,IAAA,mBAAAi2B,EAAA,SAAA75B,EAAA65B,EAAAq6B,GAAA,GAAAl0D,EAAA,MAAAk0D,GAAAA,GAAA,GAAA,WAAA70B,EAAA91B,KAAA2qD,KAAAA,EAAA70B,EAAAuG,MAAAsuB,GAAA,IAAA70B,EAAA9+B,KAAAs5B,EAAA,SAAAwF,EAAAxF,GAAA75B,EAAAA,EAAA4D,QAAA,IAAAy7B,EAAAxF,GAAA,MAAAq6B,EAAAxxD,SAAA1C,IAAAA,EAAAU,QAAA,KAAA,EAAA,IAAA,KAAAwzD,GAAAl0D,EAAAq/B,GAAA3iC,UAAA6V,GAAA,qBAAA,SAAA2hD,EAAAtrD,EAAA3I,GAAA,GAAAqQ,GAAAwpB,EAAAzwB,EAAA0U,EAAA5P,EAAAiH,EAAA+3D,EAAAvhC,EAAA3rC,EAAAT,KAAA,GAAA4O,GAAA,CAAAkC,GAAA+uB,EAAA7jB,QAAA,KAAAxb,EAAAC,EAAAoG,KAAAmH,OAAA6xB,EAAA9+B,KAAA+P,EAAA,SAAAtQ,EAAAk0D,GAAA,GAAA7qD,EAAAuiC,EAAAnkC,MAAAysD,EAAA/lC,SAAA,CAAA,GAAA/f,EAAA8lD,EAAA3qD,KAAA4jE,EAAAntE,EAAAoV,KAAA8+C,EAAAuuB,YAAAp5E,EAAA6qD,EAAAuuB,YAAA,CAAAt0E,EAAA9E,EAAA6qD,EAAAuuB,YAAA,KAAAt0E,EAAA,KAAAA,EAAAA,EAAAJ,UAAA,IAAAI,EAAAA,EAAA1H,MAAA,IAAA,KAAA,GAAAmC,GAAA,EAAAA,EAAAuF,EAAAzL,SAAAkG,EAAA,CAAA,GAAA0H,GAAAnC,EAAAvF,GAAAnC,MAAA,IAAA,EAAA,IAAA6J,EAAA5N,SAAA0S,EAAA9E,EAAA,IAAA07D,mBAAA17D,EAAA,GAAA1M,QAAA,MAAA,QAAA,MAAAma,GAAAshB,EAAA7jB,QAAA,KAAA04C,EAAArc,OAAA53C,EAAAoG,KAAArG,GAAAoV,GAAAw2B,EAAA,aAAAvM,EAAA91B,KAAA2qD,EAAAxtD,KAAAwtD,EAAAxtD,IAAA3I,KAAA4C,KAAA0I,EAAA0U,EAAA9d,GAAA45B,EAAAq6B,EAAAxtD,IAAA2C,EAAA0U,GAAA+b,EAAA,aAAAuF,EAAA91B,KAAA2qD,EAAAgpB,OAAAhpB,EAAAgpB,MAAAn/E,KAAA4C,KAAA0I,EAAA0U,EAAA9d,GAAA45B,EAAAq6B,EAAAgpB,MAAA7zE,GAAA,YAAArJ,EAAA4rC,EAAAA,EAAAhoC,QAAA,qBAAA,SAAAy7B,EAAAr/B,EAAA65B,EAAAq6B,GAAA,MAAA,YAAAr6B,EAAA,GAAAj4B,SAAAi4B,EAAA,IAAA,GAAAj4B,SAAAsyD,EAAA,OAAA,UAAAl0D,IAAA4rC,EAAAA,EAAAhoC,QAAA,OAAA,OAAA,KAAAwK,GAAAnO,EAAAoG,KAAA62E,OAAAj9E,EAAAoG,KAAA42E,QAAAh9E,EAAAoG,KAAA42E,OAAAv6E,SAAAzC,EAAAoG,KAAA62E,MAAApjD,GAAA,WAAA1rB,IAAAnO,EAAAoG,KAAAg5B,EAAA7jB,QAAA,EAAAvb,EAAAoG,MAAA3G,QAAAu4E,SAAA,EAAA72E,MAAA+2E,UAAA,UAAA94C,EAAA7jB,OAAAvb,GAAAsJ,KAAA6E,EAAA5O,IAAAosC,EAAAs3C,QAAAjjF,EAAAT,IAAA2jF,cAAAhW,EAAAt6B,YAAA,UAAAzkC,EAAA,QAAA,cAAA++D,GAAA,eAAAA,EAAA,MAAA,WAAAvhC,IAAA3rC,EAAAsJ,KAAAtJ,EAAAoG,KAAAiyE,cAAA,IAAApkB,IAAA8tB,SAAAxiF,IAAA,qCAAAqwC,QAAA,KAAAuzC,SAAA,EAAAC,QAAA,GAAAX,OAAAljF,IAAA,yCAAAqwC,QAAA,QAAAuzC,SAAA,EAAAC,QAAA,GAAAlgD,KAAA,SAAA9D,GAAA,GAAAr/B,GAAA65B,EAAAl5B,IAAA,OAAAA,MAAA0+B,GAAAgkD,WAAA37E,YAAA,WAAAmyB,EAAAjW,KAAAyb,UAAA1+B,KAAA0+B,GAAA+jD,UAAAziF,KAAA0+B,GAAA+jD,SAAA,EAAApjF,EAAAtD,SAAAG,cAAA,UAAAmD,EAAAuJ,KAAA,kBAAAvJ,EAAAR,IAAAmB,KAAA0+B,GAAA7/B,IAAA,YAAA6/B,EAAAjhC,OAAAklF,wBAAA,WAAAzpD,EAAAwF,GAAAgkD,QAAA,EAAAxpD,EAAAjW,KAAAyb,IAAAr/B,EAAA6J,OAAA,WAAAgwB,EAAAwF,GAAAgkD,QAAA,EAAAxpD,EAAAjW,KAAAyb,IAAA3iC,SAAAyD,KAAAyE,YAAA5E,MAAA4jB,KAAA,SAAA5jB,GAAA,GAAA65B,GAAAq6B,EAAAtrD,CAAA,aAAA5I,SAAA5B,QAAAklF,yBAAAzpD,EAAAwF,EAAA83C,SAAAC,iBAAAljB,EAAAr6B,EAAAhS,QAAAo3D,SAAAp+E,KAAA,UAAA,YAAAb,GAAA,SAAAujF,IAAAA,GAAA36E,EAAA,GAAA26E,IAAAC,OAAAtvB,EAAA9yD,KAAA,OAAA8c,QAAAulE,cAAA,SAAApkD,GAAA,GAAAA,EAAAz+B,MAAAi5B,EAAAF,WAAA,UAAA35B,GAAA,SAAA0jF,OAAAA,QAAA96E,EAAA,GAAA86E,OAAAF,OAAAtvB,GAAAtrD,EAAA2J,GAAA,QAAA,WAAAsnB,EAAAF,YAAA0F,GAAA3iC,UAAA6V,IAAAoxE,eAAA,SAAAtkD,EAAAr/B,EAAA65B,GAAA75B,EAAA2+C,MAAAj8C,OAAA,IAAA,YAAAm3B,EAAAspD,eAAA,UAAAtpD,EAAAspD,gBAAAjvB,EAAA/wB,KAAAtJ,EAAAspD,mBAAA9lF,QAAA,SAAAgiC,EAAAr/B,EAAA65B,GAAA;AAAA,GAAAq6B,GAAA,WAAA,MAAA70B,GAAAn4B,uBAAAm4B,EAAAw8C,6BAAAx8C,EAAAy8C,0BAAAz8C,EAAA08C,wBAAA,SAAA/7E,GAAA,MAAAq/B,GAAA33B,WAAA1H,EAAA,IAAA,QAAA4I,EAAA,WAAA,MAAAy2B,GAAA28C,sBAAA38C,EAAA48C,4BAAA58C,EAAA68C,yBAAA78C,EAAA88C,uBAAA,SAAAn8E,GAAAq/B,EAAAt2B,aAAA/I,OAAAC,EAAA,SAAAD,GAAA,GAAA65B,KAAA75B,GAAAA,EAAA6hC,eAAA7hC,GAAAq/B,EAAAr/B,EAAAA,EAAAA,EAAA6uE,SAAA7uE,EAAA6uE,QAAAnsE,OAAA1C,EAAA6uE,QAAA7uE,EAAAs0E,gBAAAt0E,EAAAs0E,eAAA5xE,OAAA1C,EAAAs0E,gBAAAt0E,EAAA,KAAA,GAAAk0D,KAAAl0D,GAAAA,EAAAk0D,GAAAzxB,MAAA5I,EAAA5yB,MAAAqmE,EAAAttE,EAAAk0D,GAAAzxB,MAAA8qC,EAAAvtE,EAAAk0D,GAAArxB,QAAA7iC,EAAAk0D,GAAAxxB,SAAA7I,EAAA5yB,MAAAqmE,EAAAttE,EAAAk0D,GAAAxxB,QAAA6qC,EAAAvtE,EAAAk0D,GAAApxB,SAAA,OAAAjJ,IAAAvpB,EAAA,SAAA+uB,EAAAr/B,EAAA65B,GAAA,MAAA75B,IAAAq/B,EAAA,MAAAxF,EAAAwF,EAAAiuC,EAAAttE,EAAAstE,EAAA,MAAAzzC,EAAAwF,EAAAkuC,EAAAvtE,EAAAutE,EAAA9rE,KAAAqK,KAAArK,KAAAoK,IAAAwzB,EAAAiuC,EAAAttE,EAAAstE,EAAA,GAAA7rE,KAAAoK,IAAAwzB,EAAAkuC,EAAAvtE,EAAAutE,EAAA,IAAA,GAAAzzC,EAAA,SAAAuF,GAAA,GAAAA,EAAAhG,GAAA,yFAAAQ,EAAA3gB,WAAAmmB,EAAA3f,IAAA,GAAAq9B,UAAA1d,EAAAz+B,KAAA,cAAA,OAAA,CAAA,KAAA,GAAAZ,GAAA,EAAAk0D,EAAA70B,EAAA,GAAAnN,WAAAtpB,EAAAsrD,EAAAxxD,OAAA1C,EAAA4I,EAAA5I,IAAA,GAAA,mBAAAk0D,EAAAl0D,GAAAmG,SAAAyO,OAAA,EAAA,IAAA,OAAA,CAAA,QAAA,GAAAvL,EAAA,SAAArJ,GAAA,GAAA65B,GAAAwF,EAAA+I,iBAAApoC,GAAA,cAAAk0D,EAAA70B,EAAA+I,iBAAApoC,GAAA,cAAA4I,GAAA,WAAAixB,GAAA,SAAAA,IAAA75B,EAAAyuC,aAAAzuC,EAAA2K,aAAA1K,GAAA,WAAAi0D,GAAA,SAAAA,IAAAl0D,EAAA4jF,YAAA5jF,EAAAyK,WAAA,OAAA7B,IAAA3I,GAAA8d,EAAA,SAAAshB,GAAA,IAAA,GAAAr/B,IAAA,IAAAA,EAAAqJ,EAAAg2B,EAAA3f,IAAA,OAAA2f,EAAAA,EAAAt9B,SAAAs9B,EAAA38B,SAAA28B,EAAAmR,SAAA,oBAAAnR,EAAAhG,GAAA,WAAA,MAAAr5B,IAAAmO,EAAA,SAAAkxB,GAAA,GAAAr/B,GAAAW,IAAAX,GAAAu5D,SAAAl6B,EAAAr/B,EAAA6jF,IAAAxkD,EAAAy9C,MAAAgH,GAAA9jF,EAAA+jF,OAAA1kD,EAAAy9C,MAAAa,MAAA39E,EAAAgkF,WAAA3kD,EAAAy9C,MAAA3/C,UAAAn9B,EAAAwiD,UAAAxiD,EAAAgkF,WAAAzxE,GAAA,yCAAAsnB,EAAAtO,MAAAvrB,EAAA,iBAAAmO,GAAAsT,UAAA+gC,QAAA,WAAA,GAAAnjB,GAAA1+B,IAAA0+B,GAAA2kD,WAAAjnD,IAAA,aAAAlD,EAAA75B,GAAA+8B,IAAA,aAAAsC,EAAAo+C,YAAA70E,EAAAy2B,EAAAo+C,WAAAp+C,EAAAo+C,UAAA,MAAAp+C,EAAA4kD,SAAAl7E,aAAAs2B,EAAA4kD,QAAA5kD,EAAA4kD,OAAA,OAAA91E,EAAAsT,UAAAyiE,aAAA,SAAAhwB,GAAA,GAAAtrD,GAAAjI,KAAA0I,EAAAwwB,EAAAq6B,EAAAn1D,QAAAoP,EAAAvF,EAAA2wD,SAAAnkD,EAAAjH,EAAA0Z,QAAAslD,EAAA/3D,EAAAopE,OAAA5yC,EAAAx2B,EAAA6pE,SAAA7wE,EAAA,cAAA8lD,EAAA3qD,IAAA,IAAA6E,GAAAxF,EAAAo7E,WAAAjnD,IAAA,wBAAAm3B,EAAAryB,eAAA,GAAAqyB,EAAAryB,cAAA/J,SAAAq1C,EAAAzqE,QAAA2G,EAAA3G,SAAAo3B,EAAAzwB,KAAAywB,EAAAzwB,EAAAtH,YAAAsH,EAAAgwB,GAAA,UAAA66B,EAAAryB,cAAAa,QAAAr5B,EAAA,GAAAoB,YAAApB,EAAA0uC,SAAApP,OAAA,CAAA,IAAAvzB,GAAAjH,EAAAiwE,aAAAhpE,EAAAopE,OAAAhuC,SAAA,qBAAA,MAAA0jB,GAAAvyB,sBAAAuyB,GAAAhzB,gBAAAt4B,GAAAu7E,WAAAv7E,EAAAw7E,YAAAnkF,EAAAi0D,GAAAtrD,EAAAw7E,YAAA1hF,SAAA0S,EAAAw5D,OAAA1a,EAAAvyB,kBAAA/4B,EAAAglD,WAAAsG,EAAAtrD,EAAAy7E,QAAA,EAAAz7E,EAAAmkD,QAAA1jD,EAAAT,EAAAq2E,SAAArzC,EAAAhjC,EAAAvC,KAAA+O,EAAA/O,KAAAuoE,MAAAhmE,EAAAmpE,WAAA,EAAAnpE,EAAA07E,WAAA,EAAA17E,EAAA27E,WAAA,EAAA37E,EAAA47E,aAAA,EAAA57E,EAAAm3E,OAAA5xE,EAAA4xE,SAAAn3E,EAAAkc,WAAA,GAAApQ,OAAAC,UAAA/L,EAAA67E,UAAA77E,EAAA87E,UAAA97E,EAAA+7E,SAAA,EAAA/7E,EAAAg8E,YAAAnjF,KAAAI,MAAAsrE,EAAA,GAAA1iE,aAAA7B,EAAAi8E,aAAApjF,KAAAI,MAAAsrE,EAAA,GAAAxiE,cAAA/B,EAAAk8E,eAAA,KAAAl8E,EAAAm8E,gBAAAlrD,EAAAs9C,SAAAuH,aAAA91E,EAAAq2E,YAAAhrD,IAAA,EAAA0U,KAAA,GAAA//B,EAAAo8E,eAAAnrD,EAAAs9C,SAAAuH,aAAAvR,GAAAvkE,EAAAq8E,SAAAprD,EAAAs9C,SAAAuH,aAAAvwE,EAAA2uE,MAAAa,OAAA/0E,EAAAo8E,eAAA/wD,KAAArrB,EAAAq8E,SAAAhxD,IAAArrB,EAAAo8E,eAAAr8C,MAAA//B,EAAAq8E,SAAAt8C,KAAA//B,EAAAm8E,gBAAA9wD,KAAArrB,EAAAq8E,SAAAhxD,IAAArrB,EAAAm8E,gBAAAp8C,MAAA//B,EAAAq8E,SAAAt8C,KAAA9O,EAAA75B,GAAA+8B,IAAA,aAAAxqB,GAAAnE,EAAA,yCAAA,uCAAAyrB,EAAAtO,MAAA3iB,EAAA,eAAA2J,GAAAnE,EAAA,qBAAA,qBAAAyrB,EAAAtO,MAAA3iB,EAAA,gBAAAixB,EAAAs9C,SAAAkF,UAAAr8E,EAAAgI,iBAAA,SAAAY,EAAAs8E,UAAA,KAAAt8E,EAAAvC,MAAAuC,EAAAm3E,UAAA12E,EAAAgwB,GAAAzwB,EAAAm7E,SAAAn7E,EAAAm7E,OAAAljF,KAAAwI,GAAA3G,UAAA2G,EAAAgwB,GAAA,oBAAA66B,EAAAhzB,iBAAArH,EAAAs9C,SAAAkF,UAAAhzE,EAAA8wB,QAAA,qBAAAz3B,WAAAkG,EAAAu8E,aAAApnE,EAAA1U,IAAA0U,EAAA1U,EAAAtH,UAAA83B,EAAAs9C,SAAAkF,UAAAzzE,EAAAu8E,cAAAjxB,EAAAhzB,kBAAA,IAAAt4B,EAAAw7E,YAAA1hF,QAAA0S,EAAA8pE,YAAAt2E,EAAAm3E,QAAAlmD,EAAAs9C,SAAA3xD,KAAA5c,EAAAq2E,UAAAr2E,EAAAmpE,WAAA,GAAAnpE,EAAA07E,WAAA,EAAA17E,EAAAo7E,WAAAjjF,SAAA,yBAAA,IAAA6H,EAAAw7E,YAAA1hF,QAAA,UAAA0S,EAAA7L,OAAA6L,EAAAypE,UAAAzpE,EAAAorE,UAAA53E,EAAAy7E,QAAA,EAAAz7E,EAAA07E,WAAA,EAAA17E,EAAAmpE,WAAA,EAAAnpE,EAAA27E,WAAA,EAAA1qD,EAAAs9C,SAAA3xD,KAAA5c,EAAAq2E,UAAAr2E,EAAAw8E,kBAAA,IAAAx8E,EAAAw7E,YAAA,GAAA9W,EAAA1kE,EAAAw7E,YAAA,GAAA9W,GAAAzzC,EAAAwF,GAAAsD,aAAA/5B,EAAAy8E,kBAAA,IAAAz8E,EAAAw7E,YAAA,GAAA7W,EAAA3kE,EAAAw7E,YAAA,GAAA7W,GAAA1zC,EAAAwF,GAAA0D,YAAAn6B,EAAA08E,gCAAA18E,EAAAw8E,kBAAAx8E,EAAAm8E,gBAAAp8C,MAAA//B,EAAAm8E,gBAAA3kF,MAAAwI,EAAA28E,gCAAA38E,EAAAy8E,kBAAAz8E,EAAAm8E,gBAAA9wD,KAAArrB,EAAAm8E,gBAAA1kF,OAAAuI,EAAA48E,4BAAAl1E,EAAA1H,EAAAw7E,YAAA,GAAAx7E,EAAAw7E,YAAA,SAAAj2E,EAAAsT,UAAAyjE,SAAA,SAAA7lD,GAAA,GAAAxF,GAAAl5B,IAAAk5B,GAAA2qD,aAAA,EAAAxkF,EAAAia,oBAAA,SAAA4f,EAAAqrD,UAAA,IAAA/2E,EAAAsT,UAAAgkE,YAAA,SAAApmD,GAAA,GAAAr/B,GAAAW,IAAA,OAAA,UAAA0+B,EAAAwC,cAAAi2C,SAAA,IAAAz4C,EAAAwC,cAAAi2C,YAAA93E,GAAA0lF,WAAArmD,GAAAr/B,EAAAwkF,iBAAAxkF,EAAAqkF,QAAA,IAAArkF,EAAA2lF,UAAA1lF,EAAAo/B,SAAAr/B,EAAAqG,MAAArG,EAAA+/E,SAAA//E,EAAA2lF,UAAAjjF,QAAA1C,EAAA2lF,UAAAjjF,SAAA1C,EAAAskF,YAAA,IAAAtkF,EAAAskF,WAAAjlD,EAAA6B,iBAAAlhC,EAAAykF,UAAAn0E,EAAAtQ,EAAA2lF,UAAA,GAAA3lF,EAAAokF,YAAA,GAAA,KAAApkF,EAAA0kF,UAAAp0E,EAAAtQ,EAAA2lF,UAAA,GAAA3lF,EAAAokF,YAAA,GAAA,KAAApkF,EAAA2kF,SAAAr0E,EAAAtQ,EAAA2lF,UAAA,GAAA3lF,EAAAokF,YAAA,IAAApkF,EAAA2kF,SAAA,IAAA3kF,EAAAskF,UAAAtkF,EAAA4lF,QAAAvmD,GAAAr/B,EAAA+xE,UAAA/xE,EAAA6lF,QAAA7lF,EAAAukF,WAAAvkF,EAAA8lF,cAAA33E,EAAAsT,UAAAmkE,QAAA,SAAA5lF,GAAA,GAAAC,GAAAqQ,EAAA3P,KAAAm5B,EAAAxpB,EAAAipD,SAAAlwD,EAAAiH,EAAAg0E,UAAAvmE,EAAAzN,EAAA00E,eAAAr8C,MAAA,CAAA,KAAA,IAAAt/B,EAAA,KAAAA,IAAAiH,EAAAm0E,UAAA,IAAAn0E,EAAAipD,SAAA5a,MAAAj8C,OAAA,GAAA,IAAA4N,EAAAipD,SAAA1xC,QAAA3mB,QAAAoP,EAAAipD,SAAA1xC,QAAAxhB,KAAAkxE,MAAAx5D,GAAAtc,KAAAoK,IAAAyE,EAAAm0E,UAAA,IAAAn0E,EAAAm0E,UAAA,IAAAn0E,EAAAipD,SAAA5a,MAAAj8C,OAAA,GAAA4N,EAAAipD,SAAA1xC,QAAA3mB,QAAAoP,EAAAipD,SAAA5a,MAAAj8C,OAAA,IAAA4N,EAAAipD,SAAA1xC,QAAAxhB,KAAAkxE,MAAAx5D,GAAAtc,KAAAoK,KAAAyE,EAAAm0E,UAAA,IAAA1mE,GAAAzN,EAAAm0E,WAAAn0E,EAAAy1E,eAAA9xD,IAAA,KAAA5qB,EAAA,EAAAiH,EAAA00E,eAAA/wD,IAAA3jB,EAAAo0E,UAAA/7C,KAAA5qB,GAAAzN,EAAAmtE,YAAA70E,EAAA0H,EAAAmtE,WAAAntE,EAAAmtE,UAAA,MAAAntE,EAAAmtE,UAAAvpB,EAAA,WAAA5jD,EAAAy1E,gBAAAlsD,EAAAt5B,KAAA+P,EAAAipD,SAAAojB,OAAA,SAAAt9C,EAAAr/B,GAAA,GAAAk0D,GAAAl0D,EAAAgO,IAAAsC,EAAAipD,SAAAkjB,OAAA5iD,GAAAs9C,SAAAyH,aAAA5+E,EAAAw+E,QAAAvqD,IAAA3jB,EAAAy1E,cAAA9xD,IAAA0U,KAAAr4B,EAAAy1E,cAAAp9C,KAAAurB,EAAA5jD,EAAAs0E,YAAA1wB,EAAAl0D,EAAAqG,KAAAmxE,WAAAlnE,EAAA0zE,WAAAjjF,SAAA,8BAAA,IAAAU,KAAAC,IAAA4O,EAAAq0E,UAAA,GAAA,CAAA,GAAAr0E,EAAA+zE,QAAA,EAAAvqD,EAAA6kB,MAAAj8C,OAAA,GAAA4N,EAAAjK,KAAAszE,SAAArpE,EAAAg0E,UAAA,IAAAxqD,EAAAmkD,aAAA,IAAA3tE,EAAAjK,KAAAszE,UAAA,SAAArpE,EAAAjK,KAAAszE,UAAA9/C,EAAAwF,GAAAj/B,QAAA,IAAAkQ,EAAAg0E,UAAA,KAAArkF,EAAAwB,KAAAC,IAAA,IAAAD,KAAAukF,MAAA11E,EAAAo0E,UAAAp0E,EAAAm0E,WAAAhjF,KAAAsqC,IAAAz7B,EAAAg0E,UAAArkF,EAAA,IAAAA,EAAA,IAAA,IAAA,KAAA,MAAAqQ,EAAAg0E,WAAAzqD,EAAAs9C,SAAAkF,UAAA/rE,EAAA60E,aAAA,YAAA70E,EAAAk0E,aAAA,EAAA1qD,GAAAmkD,WAAA3tE,EAAAg0E,UAAAh0E,EAAA8zE,YAAA9zE,EAAAq1E,UAAA9rD,EAAAt5B,KAAAu5B,EAAA6iD,OAAA,SAAAt9C,EAAAr/B,GAAA,GAAAk0D,GAAAtrD,CAAAixB,GAAAs9C,SAAA3xD,KAAAxlB,EAAAw+E,QAAAtqB,EAAAr6B,EAAAs9C,SAAAuH,aAAA1+E,EAAAw+E,QAAA51E,EAAAixB,EAAAs9C,SAAAuH,aAAA5kD,EAAAgjD,MAAAa,OAAA39E,EAAAw+E,OAAAz7E,KAAAqrE,UAAA,GAAAnsD,QAAA,GAAAgkE,sBAAA,KAAAnlF,YAAA,qBAAAA,YAAA,SAAAu+B,EAAAr/B,GAAA,OAAAA,EAAAyH,MAAA,+BAAAb,KAAA,OAAA5G,EAAAgO,MAAA8rB,EAAAjS,QAAA7Z,MAAAsC,EAAA00E,eAAA/wD,IAAAigC,EAAAjgC,IAAArrB,EAAAqrB,IAAA3jB,EAAA00E,eAAAr8C,KAAAurB,EAAAvrB,KAAA//B,EAAA+/B,MAAA9O,EAAAs9C,SAAAyH,aAAA5+E,EAAAw+E,QAAAvqD,IAAAigC,EAAAjgC,IAAArrB,EAAAqrB,IAAA0U,KAAAurB,EAAAvrB,KAAA//B,EAAA+/B,SAAA7O,EAAAwlD,WAAAxlD,EAAAwlD,UAAAnxB,UAAAr0B,EAAAwlD,UAAA95D,SAAArX,EAAAsT,UAAAokE,MAAA,WAAA,GAAAxmD,GAAA1+B,IAAA,OAAA2P,GAAA+uB,EAAAsmD,UAAA,GAAAtmD,EAAA8kD,WAAA,KAAAtqD,EAAAs9C,SAAAkF,SAAA,GAAA,QAAAh9C,EAAA+kD,YAAA/kD,EAAAsmD,YAAAtmD,EAAAglD,QAAA,EAAAhlD,EAAAylD,eAAAzlD,EAAA6mD,gBAAA7mD,EAAAo+C,WAAA70E,EAAAy2B,EAAAo+C,WAAAp+C,EAAAo+C,UAAAvpB,EAAA,WAAAr6B,EAAAs9C,SAAAyH,aAAAv/C,EAAA4/C,SAAA5/C,EAAAylD,kBAAAzlD,SAAAlxB,EAAAsT,UAAAykE,cAAA,WAAA,GAAA7mD,GAAAr/B,EAAA65B,EAAAq6B,EAAAtrD,EAAA3I,EAAAqQ,EAAA3P,KAAAm5B,EAAAxpB,EAAAs0E,YAAAv7E,EAAAiH,EAAAu0E,aAAA9mE,EAAAzN,EAAAm0E,UAAAt2E,EAAAmC,EAAAo0E,UAAAtvE,EAAA9E,EAAAy0E,gBAAA5X,EAAA/3D,EAAAuzB,KAAAiD,EAAAx2B,EAAA6e,IAAA7lB,EAAAgH,EAAAhV,MAAAgtE,EAAAh4D,EAAA/U,MAAA,OAAAuI,GAAAwF,EAAA0rB,EAAAqzC,EAAApvD,EAAAovD,EAAAltE,EAAA2rC,EAAAz9B,EAAAkxB,EAAA59B,KAAA6I,IAAA,EAAA,GAAAwvB,EAAA,GAAA1rB,GAAApO,EAAAyB,KAAA6I,IAAA,EAAA,GAAAjB,EAAA,GAAA+jE,GAAAvzC,EAAAp4B,KAAAo8C,IAAA/jB,EAAA1rB,EAAA,GAAA0rB,EAAA,GAAA1rB,GAAA8lD,EAAAzyD,KAAAo8C,IAAAx0C,EAAA+jE,EAAA,GAAA/jE,EAAA,GAAA+jE,GAAArvD,EAAA,GAAAnV,EAAAy2B,IAAAz2B,EAAAy2B,EAAA,EAAA59B,KAAAoK,KAAAwzB,EAAA8tC,EAAApvD,EAAA,KAAA,GAAAA,EAAA,GAAAnV,EAAAixB,IAAAjxB,EAAAixB,EAAA,EAAAp4B,KAAAoK,IAAAguB,EAAAszC,EAAApvD,EAAA,KAAA,GAAA5P,EAAA,GAAAlO,EAAAD,IAAAC,EAAAD,EAAA,EAAAyB,KAAAoK,KAAA7L,EAAA4rC,EAAAz9B,EAAA,KAAA,GAAAA,EAAA,GAAAlO,EAAAi0D,IAAAj0D,EAAAi0D,EAAA,EAAAzyD,KAAAoK,IAAAqoD,EAAAtoB,EAAAz9B,EAAA,KAAA,IAAA8lB,IAAAh0B,EAAA0oC,KAAA//B,IAAAuF,EAAAsT,UAAA0kE,cAAA,SAAA9mD,EAAAr/B,EAAA65B,EAAAq6B,GAAA,GAAAtrD,GAAAjI,KAAAV,EAAA2I,EAAAg8E,YAAAt0E,EAAA1H,EAAAi8E,YAAA,OAAAhrD,GAAA55B,GAAAo/B,EAAAA,EAAA,EAAA,EAAAA,EAAAA,EAAAA,EAAAp/B,EAAA45B,EAAA55B,EAAA45B,EAAAwF,GAAAA,EAAA59B,KAAA6I,IAAA,EAAArK,EAAA,EAAA45B,EAAA,GAAAq6B,EAAA5jD,GAAAtQ,EAAAA,EAAA,EAAA,EAAAA,EAAAA,EAAAA,EAAAsQ,EAAA4jD,EAAA5jD,EAAA4jD,EAAAl0D,GAAAA,EAAAyB,KAAA6I,IAAA,EAAAgG,EAAA,EAAA4jD,EAAA,IAAAjgC,IAAAj0B,EAAA2oC,KAAAtJ,IAAAlxB,EAAAsT,UAAAqkE,OAAA,WAAA,GAAA9lF,GAAAW,KAAAV,EAAAD,EAAA+kF,gBAAAjrD,EAAA75B,EAAAG,MAAAiJ,EAAApJ,EAAAI,OAAA0d,EAAA9d,EAAA0oC,KAAAx6B,EAAAlO,EAAAg0B,IAAA7e,EAAA9E,EAAAtQ,EAAA2lF,UAAA,GAAA3lF,EAAA2lF,UAAA,IAAAxY,EAAA/3D,EAAApV,EAAAwlF,4BAAA55C,EAAAnqC,KAAAikE,MAAA5rC,EAAAqzC,GAAA/+D,EAAA3M,KAAAikE,MAAAr8D,EAAA8jE,GAAAC,GAAAtzC,EAAA8R,GAAA5rC,EAAAslF,+BAAAnjF,GAAAkH,EAAA+E,GAAApO,EAAAulF,+BAAA75D,GAAA1rB,EAAA2lF,UAAA,GAAArY,EAAAttE,EAAA2lF,UAAA,GAAArY,GAAA,EAAAzzC,EAAAwF,GAAAsD,aAAApa,GAAAvoB,EAAA2lF,UAAA,GAAApY,EAAAvtE,EAAA2lF,UAAA,GAAApY,GAAA,EAAA1zC,EAAAwF,GAAA0D,YAAAwqC,EAAA7hD,EAAA1rB,EAAAolF,kBAAA9X,EAAA/kD,EAAAvoB,EAAAqlF,kBAAAn3E,EAAA6P,GAAAqvD,EAAAG,GAAAjwE,EAAA6Q,GAAAhM,EAAAmrE,GAAAsI,GAAA3hD,IAAA32B,EAAAqrC,KAAAz6B,EAAAkxE,OAAAjS,EAAAkS,OAAAlS,EAAAntE,GAAAqkF,QAAA,EAAArkF,EAAAomF,SAAAx6C,EAAA5rC,EAAAqmF,UAAAj4E,EAAApO,EAAA8kF,eAAAlP,EAAA51E,EAAAy9E,WAAA70E,EAAA5I,EAAAy9E,WAAAz9E,EAAAy9E,UAAAvpB,EAAA,WAAAr6B,EAAAs9C,SAAAyH,aAAA5+E,EAAAi/E,SAAAj/E,EAAA8kF,mBAAA32E,EAAAsT,UAAAikE,WAAA,SAAArmD,GAAA,GAAA60B,GAAAvzD,KAAA2P,EAAA4jD,EAAAowB,UAAAxqD,EAAAo6B,EAAA6d,UAAA1oE,EAAA6qD,EAAAqwB,UAAAxmE,EAAAm2C,EAAAswB,WAAA,OAAAtwB,GAAAoyB,UAAArmF,EAAAo/B,GAAA60B,EAAAqyB,IAAA9kF,KAAA6I,KAAA,GAAAoK,OAAAC,UAAAu/C,EAAApvC,UAAA,GAAAovC,EAAA8vB,WAAAljF,YAAA,wBAAA+4B,EAAA75B,GAAA+8B,IAAA,aAAA/8B,EAAAia,oBAAA,SAAAi6C,EAAAgxB,UAAA,GAAAhxB,EAAAupB,YAAA70E,EAAAsrD,EAAAupB,WAAAvpB,EAAAupB,UAAA,MAAAvpB,EAAAowB,WAAA,EAAApwB,EAAA6d,WAAA,EAAA7d,EAAAqwB,WAAA,EAAArwB,EAAAswB,aAAA,EAAAtwB,EAAAqF,SAAA0kB,YAAA,EAAA/pB,EAAAmwB,OAAAnwB,EAAAsyB,MAAAnnD,IAAA60B,EAAA3nB,MAAA,IAAA2nB,EAAAuyB,UAAAvyB,EAAAuwB,UAAAvwB,EAAAqyB,IAAA,GAAAryB,EAAAwyB,UAAAxyB,EAAAwwB,UAAAxwB,EAAAqyB,IAAA,GAAAzsD,EAAAo6B,EAAAyyB,aAAAt9E,EAAA6qD,EAAA0yB,aAAA1yB,EAAA2yB,WAAAv2E,EAAAyN,GAAAm2C,SAAA/lD,EAAAsT,UAAAolE,WAAA,SAAAxnD,EAAAr/B,GAAA,GAAAk0D,GAAAvzD,KAAAiI,GAAA,EAAA3I,EAAAi0D,EAAAqF,SAAA5a,MAAAj8C,OAAA4N,EAAA7O,KAAAC,IAAAwyD,EAAAuwB,WAAA3qD,EAAA,KAAAuF,GAAAp/B,EAAA,IAAAi0D,EAAAqyB,IAAA,KAAAj2E,EAAA,IAAAA,EAAA,GAAA4jD,GAAA6xB,cAAA,KAAA,KAAA1mD,IAAAr/B,GAAAyB,KAAAC,IAAAwyD,EAAAwwB,WAAA,IAAA7qD,EAAAs9C,SAAAxqC,QAAAunB,EAAAqF,SAAA1xC,QAAA22D,QAAAvqD,IAAAigC,EAAA8wB,eAAA/wD,IAAAigC,EAAAwwB,UAAA,IAAAxwB,EAAAwyB,UAAAzkE,QAAA,GAAA,KAAArZ,EAAAsrD,EAAAqF,SAAAj6C,OAAA,EAAA,MAAAwa,GAAAo6B,EAAAuwB,UAAA,EAAA77E,EAAAsrD,EAAAqF,SAAA5V,SAAA,KAAA7pB,GAAAo6B,EAAAuwB,UAAA,IAAA77E,EAAAsrD,EAAAqF,SAAA5/B,KAAA,OAAA,IAAA/wB,GAAA,KAAAy2B,GAAA,KAAAA,GAAA60B,EAAAqF,SAAAsmB,YAAA,KAAA3rB,EAAA8vB,WAAAljF,YAAA,wBAAAqN,EAAAsT,UAAAklE,WAAA,WAAA,GAAAtnD,GAAAr/B,EAAAk0D,EAAAtrD,EAAAjI,IAAAiI,GAAAk8E,kBAAA,IAAAl8E,EAAAvC,KAAAuzE,UAAAhxE,EAAA29E,IAAA,KAAAlnD,EAAAz2B,EAAAk8E,eAAAn8C,KAAA3oC,EAAA4I,EAAAk8E,eAAA7wD,MAAAoL,EAAAz2B,EAAAk8E,eAAAn8C,KAAA,IAAA//B,EAAA69E,UAAAzmF,EAAA4I,EAAAk8E,eAAA7wD,IAAA,IAAArrB,EAAA89E,WAAAxyB,EAAAtrD,EAAAu9E,cAAA9mD,EAAAr/B,EAAA4I,EAAAm8E,gBAAA3kF,MAAAwI,EAAAm8E,gBAAA1kF,QAAA6zD,EAAA9zD,MAAAwI,EAAAm8E,gBAAA3kF,MAAA8zD,EAAA7zD,OAAAuI,EAAAm8E,gBAAA1kF,OAAAw5B,EAAAs9C,SAAAxqC,QAAA/jC,EAAAq2E,SAAA/qB,EAAA,OAAA/lD,EAAAsT,UAAAmlE,WAAA,WAAA,GAAAvnD,GAAAr/B,EAAAk0D,EAAAtrD,EAAA3I,EAAAU,KAAA2P,EAAArQ,EAAAs5D,SAAA1xC,QAAAiS,EAAA75B,EAAAmmF,SAAA/8E,EAAApJ,EAAAomF,SAAApmF,GAAA6kF,iBAAAzlD,EAAAp/B,EAAA6kF,eAAAn8C,KAAA3oC,EAAAC,EAAA6kF,eAAA7wD,IAAArrB,GAAAqrB,IAAAj0B,EAAA2oC,KAAAtJ,EAAAj/B,MAAA05B,EAAAz5B,OAAAgJ,EAAA+1E,OAAA,EAAAC,OAAA,GAAAxlD,EAAAs9C,SAAAyH,aAAA3+E,EAAAg/E,SAAAr2E,GAAAkxB,EAAA75B,EAAA2kF,aAAAv7E,EAAApJ,EAAA4kF,aAAA5kF,EAAAs5D,SAAAgmB,WAAA,KAAAzlD,EAAAxpB,EAAAlQ,OAAAiJ,EAAAiH,EAAAjQ,OAAAJ,EAAAs5D,SAAAylB,cAAA/+E,EAAAmlF,kBAAAnlF,EAAAolF,kBAAA,MAAAnxB,EAAAj0D,EAAAkmF,cAAA9mD,EAAAr/B,EAAA85B,EAAAzwB,GAAAwwB,EAAAs9C,SAAAxqC,QAAA1sC,EAAAg/E,SAAA/qB,EAAA,QAAA/lD,EAAAsT,UAAA+kE,MAAA,SAAAxmF,GAAA,GAAAk0D,GAAAtrD,EAAAjI,KAAA2P,EAAAupB,EAAA75B,EAAAjB,QAAA+6B,EAAAlxB,EAAA2wD,SAAAlwD,EAAAywB,EAAAjS,QAAA9J,EAAA/d,GAAAC,EAAAD,IAAA4I,EAAAw7E,YAAAj2E,EAAA4P,EAAA,GAAAA,EAAA,GAAAuvD,EAAAzzC,EAAAwF,GAAAsD,aAAA/5B,EAAAq8E,SAAAt8C,KAAA,EAAAvzB,EAAA2I,EAAA,GAAAA,EAAA,GAAAwvD,EAAA1zC,EAAAwF,GAAA0D,YAAAn6B,EAAAq8E,SAAAhxD,IAAA,EAAAk5C,EAAA,SAAA9tC,GAAA,GAAA60B,GAAA7qD,EAAAhD,KAAAg5B,EAAA,IAAAxF,EAAA3gB,WAAAg7C,KAAAA,EAAAA,EAAAz+C,MAAAqkB,GAAAzwB,EAAArJ,KAAAk0D,EAAA,OAAAA,GAAA,IAAA,QAAAp6B,EAAAxa,MAAA1W,EAAAglD,WAAA,MAAA,KAAA,iBAAA9zB,EAAA+nD,gBAAA,MAAA,KAAA,OAAA/nD,EAAAH,MAAA,MAAA,KAAA,cAAAG,EAAA6kB,MAAAj8C,OAAA,EAAAo3B,EAAAH,OAAAG,EAAAxa,MAAA1W,EAAAglD,WAAA,MAAA,KAAA,OAAA,SAAAvkD,EAAAE,OAAAF,EAAAw1E,UAAAx1E,EAAAm3E,UAAA1mD,EAAAimD,SAAAjmD,EAAAylD,aAAAzlD,EAAA0jD,eAAA1jD,EAAAklD,cAAA7wE,EAAAiH,GAAA0kB,EAAA6kB,MAAAj8C,OAAA,GAAAo3B,EAAAxa,MAAA1W,EAAAglD,cAAA,MAAA5tD,EAAA6hC,eAAA,GAAA7hC,EAAA6hC,cAAA/J,UAAAxnB,EAAA+oB,GAAA,UAAAlrB,EAAAmC,EAAA,GAAA7F,YAAA6F,EAAAynC,SAAApP,OAAA,CAAA,GAAAr4B,EAAA+oB,GAAA,oEAAA66B,EAAA,cAAA,IAAA5jD,EAAA+oB,GAAA,mBAAA66B,EAAA,YAAA,CAAA,IAAAp6B,EAAAjS,QAAAo3D,WAAAnlD,EAAAjS,QAAAo3D,SAAAp+E,KAAAyP,GAAA4pB,UAAA5gB,OAAAhJ,GAAA5N,OAAA,MAAAwxD,GAAA,UAAA,GAAAtrD,EAAAq7E,OAAA,CAAA,GAAAl7E,aAAAH,EAAAq7E,QAAAr7E,EAAAq7E,OAAA,KAAAxiF,KAAAC,IAAAyM,EAAAvF,EAAAk+E,MAAA,IAAArlF,KAAAC,IAAA0T,EAAAxM,EAAAm+E,MAAA,GAAA,MAAApmF,KAAAwsE,GAAA,WAAAjZ,OAAAtrD,GAAAk+E,KAAA34E,EAAAvF,EAAAm+E,KAAA3xE,EAAA/L,EAAAhD,KAAA,WAAA6tD,IAAA7qD,EAAAhD,KAAA,WAAA6tD,KAAA7qD,EAAAhD,KAAA,QAAA6tD,GAAAtrD,EAAAq7E,OAAAv8E,WAAA,WAAAkB,EAAAq7E,OAAA,KAAAnqD,EAAAskD,aAAAjR,EAAA,QAAAjZ,IAAA,KAAAiZ,EAAA,QAAAjZ,EAAA,OAAAvzD,QAAAk5B,EAAA75B,GAAAuS,GAAA,gBAAA,SAAA8sB,EAAAr/B,GAAAA,IAAAA,EAAA8/E,YAAA9/E,EAAA8/E,UAAA,GAAA3xE,GAAAnO,MAAAuS,GAAA,iBAAA,SAAA8sB,EAAAr/B,GAAAA,GAAAA,EAAA8/E,WAAA9/E,EAAA8/E,UAAAt9B,aAAApkD,OAAA1B,SAAAW,QAAA,SAAAgiC,EAAAr/B,GAAA,YAAAA,GAAAwb,QAAA,EAAAxb,EAAAm3E,SAAA37B,UAAAy9B,QAAAY,UAAA,uVAAAA,WAAAxB,WAAA,EAAA9rC,MAAA,IAAA3mB,UAAA,IAAA,IAAAiU,GAAA,SAAAwF,GAAA1+B,KAAA44D,SAAAl6B,EAAA1+B,KAAAuI,OAAAlJ,GAAAwb,OAAAqe,EAAApY,WAAAxZ,MAAA,KAAAkmD,UAAA,EAAA64B,QAAA,KAAA99E,KAAA,WAAA,GAAAm2B,GAAA1+B,KAAAk5B,EAAAwF,EAAAk6B,SAAArF,EAAAr6B,EAAA8kB,MAAA9kB,EAAAyiD,WAAAj2E,KAAAwzE,SAAAx6C,GAAA2nD,QAAAntD,EAAAijD,MAAAjF,QAAAh3E,KAAA,wBAAA0R,GAAA,QAAA,WAAA8sB,EAAA5c,WAAAoX,EAAA8kB,MAAAj8C,OAAA,IAAAwxD,EAAA70B,EAAA2nD,QAAAnjE,OAAAqwC,EAAAtuC,WAAAyZ,EAAA4nD,UAAAjnF,EAAA,yCAAAsD,SAAAu2B,EAAAijD,MAAAoK,SAAAv6E,IAAA,SAAA0yB,GAAA,GAAAxF,GAAAl5B,KAAAuzD,EAAAr6B,EAAA0/B,SAAA3wD,EAAAsrD,EAAArsC,OAAAjf,MAAA,IAAAy2B,GAAAz2B,EAAAvC,KAAAkxE,MAAArjB,EAAAooB,UAAApoB,EAAAvV,MAAAj8C,OAAA,GAAAm3B,EAAAs0B,UAAA,UAAAvlD,EAAAiqC,cAAAhZ,EAAAotD,WAAAjnF,EAAAm3E,SAAAxqC,QAAA9S,EAAAotD,UAAAhnE,QAAAm/D,OAAA,GAAAx2E,EAAAvC,KAAAwzE,UAAAttC,OAAA1S,EAAA5xB,MAAAP,WAAA,WAAAwsD,EAAArsC,QAAAxhB,KAAAkxE,MAAArjB,EAAArsC,QAAA3mB,OAAAgzD,EAAAvV,MAAAj8C,OAAA,EAAAwxD,EAAAv6B,OAAAu6B,EAAA6oB,OAAA,IAAAn0E,EAAAvC,KAAAwzE,UAAAttC,SAAA1S,EAAArU,OAAA0uC,EAAA2pB,mBAAA,EAAA3pB,EAAA6pB,iBAAAzoB,MAAA,WAAA,GAAAj2B,GAAA1+B,IAAAoI,cAAAs2B,EAAAp3B,OAAAo3B,EAAAp3B,MAAA,KAAAo3B,EAAA4nD,WAAA5nD,EAAA4nD,UAAAn4C,WAAA,SAAAjrB,QAAAE,MAAA,WAAA,GAAAsb,GAAA1+B,KAAAX,EAAAq/B,EAAAk6B,SAAA1xC,OAAA7nB,KAAAq/B,EAAA2nD,QAAA5lF,KAAA,SAAApB,EAAAqG,KAAA20E,KAAAh7E,EAAAqG,KAAA+wB,OAAAp3B,EAAAqG,KAAA20E,KAAAld,IAAAwd,WAAAx6E,YAAA,yBAAAC,SAAA,0BAAAs+B,EAAA8uB,UAAA,EAAAnuD,EAAA2+E,YAAAt/C,EAAA1yB,KAAA,GAAA0yB,EAAAk6B,SAAA/4B,QAAA,qBAAA,KAAAhb,KAAA,WAAA,GAAA6Z,GAAA1+B,KAAAX,EAAAq/B,EAAAk6B,SAAA1xC,OAAAwX,GAAAi2B,QAAAj2B,EAAA2nD,QAAA5lF,KAAA,SAAApB,EAAAqG,KAAA20E,KAAAh7E,EAAAqG,KAAA+wB,OAAAp3B,EAAAqG,KAAA20E,KAAAld,IAAAud,YAAAv6E,YAAA,0BAAAC,SAAA,yBAAAs+B,EAAA8uB,UAAA,EAAA9uB,EAAAk6B,SAAA/4B,QAAA,qBAAA,GAAAnB,EAAA4nD,WAAA5nD,EAAA4nD,UAAAn4C,WAAA,SAAAjrB,QAAApB,OAAA,WAAA,GAAA4c,GAAA1+B,IAAA0+B,GAAA8uB,SAAA9uB,EAAA7Z,OAAA6Z,EAAAtb,WAAA/jB,EAAAq/B,GAAA9sB,IAAA40E,YAAA,SAAA9nD,EAAAr/B,GAAAA,IAAAA,EAAAs/E,YAAAt/E,EAAAs/E,UAAA,GAAAzlD,GAAA75B,KAAAonF,gBAAA,SAAA/nD,EAAAr/B,EAAA65B,EAAAq6B,GAAA,GAAAtrD,GAAA5I,GAAAA,EAAAs/E,SAAAprB,GAAAtrD,GAAAixB,EAAAxzB,KAAAwzE,UAAAxB,WAAAzvE,EAAAmb,QAAAnb,GAAAA,EAAAulD,UAAAvlD,EAAA0sD,SAAAquB,eAAA,SAAAtkD,EAAAr/B,EAAA65B,GAAA,GAAAq6B,GAAAl0D,GAAAA,EAAAs/E,SAAAprB,IAAAA,EAAA/F,UAAA+F,EAAAvnD,OAAA06E,kBAAA,SAAAxtD,EAAAq6B,EAAAtrD,EAAA3I,EAAAqQ,GAAA,GAAAwpB,GAAAo6B,GAAAA,EAAAorB,WAAAxlD,IAAAlxB,EAAAvC,KAAAwzE,WAAA,KAAAvpE,GAAA,KAAAA,GAAAtQ,EAAAq/B,EAAAljB,eAAAkd,GAAA,oBAAAp5B,EAAAihC,iBAAApH,EAAArX,WAAA6kE,iCAAA,SAAAjoD,EAAAr/B,GAAA,GAAA65B,GAAA75B,GAAAA,EAAAs/E,SAAAzlD,IAAAA,EAAArU,UAAAxlB,EAAAq/B,GAAA9sB,GAAA,mBAAA,WAAA,GAAAsnB,GAAA75B,EAAAm3E,SAAAC,cAAAljB,EAAAr6B,GAAAA,EAAAylD,SAAAprB,IAAAA,EAAA/F,WAAA9uB,EAAAnf,OAAAg0C,EAAAoB,QAAApB,EAAAvnD,UAAAjQ,SAAAW,QAAA,SAAAgiC,EAAAr/B,GAAA,YAAA,IAAA65B,GAAA,WAAA,IAAA,GAAA75B,KAAA,oBAAA,iBAAA,oBAAA,oBAAA,mBAAA,oBAAA,0BAAA,uBAAA,0BAAA,0BAAA,yBAAA,0BAAA,0BAAA,yBAAA,iCAAA,yBAAA,yBAAA,0BAAA,uBAAA,sBAAA,uBAAA,uBAAA,sBAAA,uBAAA,sBAAA,mBAAA,sBAAA,sBAAA,qBAAA,sBAAA65B,KAAAq6B,EAAA,EAAAA,EAAAl0D,EAAA0C,OAAAwxD,IAAA,CAAA,GAAAtrD,GAAA5I,EAAAk0D,EAAA,IAAAtrD,GAAAA,EAAA,IAAAy2B,GAAA,CAAA,IAAA,GAAAp/B,GAAA,EAAAA,EAAA2I,EAAAlG,OAAAzC,IAAA45B,EAAA75B,EAAA,GAAAC,IAAA2I,EAAA3I,EAAA,OAAA45B,IAAA,OAAA,IAAA,IAAAA,EAAA,CAAA,GAAAq6B,IAAAqzB,QAAA,SAAAvnF,GAAAA,EAAAA,GAAAq/B,EAAAn/B,gBAAAF,EAAA65B,EAAA2tD,mBAAAxnF,EAAAynF,uBAAAC,KAAA,WAAAroD,EAAAxF,EAAA4nD,mBAAAh/D,OAAA,SAAAziB,GAAAA,EAAAA,GAAAq/B,EAAAn/B,gBAAAS,KAAAgnF,eAAAhnF,KAAA+mF,OAAA/mF,KAAA4mF,QAAAvnF,IAAA2nF,aAAA,WAAA,MAAAC,SAAAvoD,EAAAxF,EAAAguD,qBAAAnwD,QAAA,WAAA,MAAAkwD,SAAAvoD,EAAAxF,EAAAiuD,qBAAA9nF,GAAAwb,QAAA,EAAAxb,EAAAm3E,SAAA37B,UAAAy9B,QAAAS,WAAA,qaAAAA,YAAArB,WAAA,KAAAr4E,EAAAq/B,GAAA9sB,GAAAsnB,EAAAkuD,iBAAA,WAAA,GAAA1oD,GAAA60B,EAAAyzB,eAAA9tD,EAAA75B,EAAAm3E,SAAAC,aAAAv9C,KAAAA,EAAAhS,SAAA,UAAAgS,EAAAhS,QAAAte,MAAAswB,EAAAukD,cAAAvkD,EAAAukD,aAAA,EAAAvkD,EAAA6jD,QAAA,GAAA,EAAA,GAAA7jD,EAAA8kD,YAAA9kD,EAAA5kB,YAAA4kB,EAAA2G,QAAA,qBAAAnB,GAAAxF,EAAAijD,MAAA3/C,UAAAkT,YAAA,yBAAAhR,GAAAxF,EAAAijD,MAAAjF,QAAAh3E,KAAA,8BAAAwvC,YAAA,4BAAAhR,GAAAgR,YAAA,0BAAAhR,MAAAr/B,EAAAq/B,GAAA9sB,IAAA40E,YAAA,SAAA9nD,EAAAr/B,GAAA,GAAA4I,EAAA,OAAAixB,QAAA75B,GAAAA,EAAA2+C,MAAA3+C,EAAAs8E,WAAAj2E,KAAAqzE,YAAA9wE,EAAA5I,EAAA88E,MAAA3/C,UAAAv0B,EAAA2J,GAAA,sBAAA,6BAAA,SAAA8sB,GAAAA,EAAAsC,kBAAAtC,EAAA6B,iBAAAgzB,EAAAzxC,WAAAziB,EAAAqG,KAAAqzE,aAAA,IAAA15E,EAAAqG,KAAAqzE,WAAArB,WAAAnkB,EAAAqzB,UAAAvnF,EAAAgoF,WAAA9zB,GAAAl0D,GAAAA,EAAA88E,MAAAjF,QAAAh3E,KAAA,8BAAAgjB,YAAA7jB,GAAA88E,MAAAjF,QAAAh3E,KAAA,8BAAAzB,UAAAioF,kBAAA,SAAAhoD,EAAAr/B,EAAA65B,EAAAq6B,EAAAtrD,GAAA5I,GAAAA,EAAAgoF,YAAA,KAAAp/E,IAAAsrD,EAAAhzB,iBAAAlhC,EAAAgoF,WAAAvlE,WAAAwlE,iBAAA,SAAA5oD,EAAAr/B,GAAAA,GAAAA,EAAAgoF,YAAAhoF,EAAA88E,MAAA3/C,UAAAqT,SAAA,2BAAA0jB,EAAAwzB,WAAAhrF,SAAAW,QAAA,SAAAgiC,EAAAr/B,GAAA,YAAA,IAAA65B,GAAA,iBAAA75B,GAAAm3E,SAAA37B,SAAAx7C,EAAAwb,QAAA,GAAAy9D,QAAAa,OAAA,odAAAA,QAAAzB,WAAA,EAAA0B,aAAA,EAAAV,SAAA,sBAAAW,KAAA,MAAAh6E,EAAAm3E,SAAA37B,SAAA,IAAA0Y,GAAA,SAAA70B,GAAA1+B,KAAAuI,KAAAm2B,GAAAr/B,GAAAwb,OAAA04C,EAAAzyC,WAAAulE,QAAA,KAAAkB,MAAA,KAAAC,MAAA,KAAA5/B,WAAA,EAAA4F,UAAA,EAAAjlD,KAAA,SAAAm2B,GAAA,GAAAr/B,GAAAW,KAAAk5B,EAAAwF,EAAAsf,MAAAuV,EAAA,CAAAl0D,GAAAu5D,SAAAl6B,EAAAr/B,EAAAqG,KAAAwzB,EAAAwF,EAAAi9C,WAAAj2E,KAAAyzE,OAAAz6C,EAAA+9C,OAAAp9E,EAAAA,EAAAgnF,QAAA3nD,EAAAy9C,MAAAjF,QAAAh3E,KAAA,yBAAA,KAAA,GAAA+H,GAAA,EAAA3I,EAAA45B,EAAAn3B,OAAAkG,EAAA3I,IAAA45B,EAAAjxB,GAAAs0E,OAAAhpB,MAAAA,EAAA,IAAAtrD,KAAAsrD,EAAA,GAAAl0D,EAAAqG,MAAArG,EAAAgnF,QAAAl4C,WAAA,SAAAv8B,GAAA,QAAA,WAAAvS,EAAAyiB,WAAAziB,EAAAmuD,UAAA,GAAAnuD,EAAAgnF,QAAAnjE,QAAAw5D,OAAA,WAAA,GAAAh+C,GAAA60B,EAAAvzD,KAAAiI,EAAAsrD,EAAAqF,SAAAt5D,EAAAi0D,EAAA7tD,KAAAgzE,SAAA/oE,IAAA4jD,GAAAg0B,QAAAh0B,EAAAg0B,MAAAloF,EAAA,eAAA65B,EAAA,IAAAA,EAAA,IAAAq6B,EAAA7tD,KAAA2zE,KAAA,YAAA12E,SAAAsF,EAAAk0E,MAAA3/C,UAAAt8B,KAAAZ,GAAAi6B,UAAA5gB,OAAArZ,IAAAi0D,EAAAg0B,MAAA31E,GAAA,QAAA,IAAA,WAAA3J,EAAAm0E,OAAA/8E,EAAAW,MAAAS,KAAA,kBAAA8yD,EAAAi0B,QAAAj0B,EAAAi0B,MAAAnoF,EAAA,eAAA65B,EAAA,YAAAv2B,SAAA4wD,EAAAg0B,QAAAloF,EAAAO,KAAAqI,EAAA+1C,MAAA,SAAA3+C,EAAA65B,GAAAwF,EAAAxF,EAAAqjD,MAAA79C,GAAA,UAAAxF,EAAAtwB,OAAA81B,EAAAxF,EAAAr6B,KAAA8Q,EAAArJ,KAAA,mDAAAjH,EAAA,KAAAq/B,GAAAA,EAAA38B,OAAA,gCAAA28B,EAAA,KAAA,mCAAA,WAAA60B,EAAAi0B,MAAA,GAAA1qF,UAAA6S,EAAA1J,KAAA,IAAA,MAAAstD,EAAA7tD,KAAA2zE,MAAA9lB,EAAAi0B,MAAA/nF,MAAAwB,SAAAsyD,EAAAg0B,MAAAnlF,IAAA,iBAAA,IAAA6F,EAAA+1C,MAAAj8C,OAAAwxD,EAAAi0B,MAAAzuD,WAAAvP,GAAA,GAAA0uC,YAAA,KAAAthC,MAAA,SAAA8H,GAAA,GAAAr/B,GAAA65B,EAAAq6B,EAAAvzD,KAAAiI,EAAAsrD,EAAAi0B,MAAAloF,EAAAi0D,EAAAg0B,KAAAh0B,GAAAqF,SAAA1xC,UAAA7nB,EAAA4I,EAAA8wB,WAAA54B,YAAA,0BAAAwY,OAAA,gBAAA46C,EAAAqF,SAAA1xC,QAAA3mB,MAAA,MAAAH,SAAA,0BAAA84B,EAAA75B,EAAAkD,WAAA,MAAAgxD,EAAA7tD,KAAA2zE,OAAAngD,EAAA5F,IAAA,GAAA4F,EAAA5F,IAAArrB,EAAAvI,SAAAL,EAAAg5D,eAAApwD,EAAA4c,OAAAmnB,SAAA5J,UAAAn6B,EAAAm6B,YAAAlJ,EAAA5F,KAAAoL,GAAA,MAAA60B,EAAA7tD,KAAA2zE,OAAAngD,EAAA8O,KAAA1oC,EAAA0iC,cAAA9I,EAAA8O,KAAA1oC,EAAA0iC,cAAA1iC,EAAAG,QAAAJ,EAAA64D,gBAAAjwD,EAAA7G,SAAAyjB,OAAAmnB,SAAAhK,WAAA9I,EAAA8O,MAAAtJ,KAAAq+C,OAAA,WAAA,GAAAr+C,GAAA1+B,IAAA0+B,GAAAk6B,SAAAujB,MAAA3/C,UAAAkT,YAAA,uBAAA1vC,KAAA4nD,WAAAlpB,EAAAkpB,WAAAlpB,EAAA6oD,OAAA7oD,EAAAg+C,SAAAh+C,EAAAk6B,SAAA/4B,QAAA,gBAAAnB,EAAA9H,MAAA,IAAA8H,EAAA6oD,OAAA7oD,EAAAk6B,SAAA/4B,QAAA,gBAAAnB,EAAAk6B,SAAAmkB,UAAA75D,KAAA,WAAAljB,KAAA4nD,WAAA,EAAA5nD,KAAA+8E,UAAAz9D,KAAA,WAAAtf,KAAA4nD,WAAA,EAAA5nD,KAAA+8E,UAAAj7D,OAAA,WAAA9hB,KAAA4nD,WAAA5nD,KAAA4nD,UAAA5nD,KAAA+8E,YAAA19E,EAAAq/B,GAAA9sB,IAAA40E,YAAA,SAAA9nD,EAAAr/B,GAAA,GAAA65B,EAAA75B,KAAAA,EAAAo9E,SAAAvjD,EAAA,GAAAq6B,GAAAl0D,GAAA65B,EAAAs0B,WAAA,IAAAt0B,EAAAxzB,KAAAgyE,WAAAx+C,EAAA5Z,SAAAmnE,gBAAA,SAAA/nD,EAAAr/B,EAAA65B,EAAAq6B,GAAA,GAAAtrD,GAAA5I,GAAAA,EAAAo9E,MAAAx0E,IAAAA,EAAA2/C,WAAA3/C,EAAA2uB,MAAA28B,EAAA,EAAA,MAAAmzB,kBAAA,SAAAhoD,EAAAr/B,EAAA65B,EAAAq6B,EAAAtrD,GAAA,GAAA3I,GAAAD,GAAAA,EAAAo9E,MAAAn9E,IAAAA,EAAAkuD,UAAA,KAAAvlD,IAAAsrD,EAAAhzB,iBAAAjhC,EAAAwiB,WAAAwlE,iBAAA,SAAA5oD,EAAAr/B,GAAA,GAAA65B,GAAA75B,GAAAA,EAAAo9E,MAAAvjD,IAAAA,EAAA0uB,YAAA,IAAA1uB,EAAAxzB,KAAA0zE,aAAAlgD,EAAAquD,MAAArkE,WAAAnnB,SAAAW,QAAA,SAAAgiC,EAAAr/B,GAAA,YAAA,SAAA65B,GAAAwF,GAAA,GAAAr/B,IAAAooF,IAAA,QAAAC,IAAA,OAAAvyD,IAAA,OAAAwyD,IAAA,SAAAC,IAAA,QAAAC,IAAA,SAAAC,IAAA,SAAAC,IAAA,SAAA,OAAA/0D,QAAA0L,GAAAz7B,QAAA,eAAA,SAAAy7B,GAAA,MAAAr/B,GAAAq/B,KAAAr/B,EAAAwb,QAAA,EAAAxb,EAAAm3E,SAAA37B,UAAAy9B,QAAA0P,MAAA,oQAAAA,OAAAjiF,IAAA,SAAA24B,EAAAr/B,GAAA,OAAAq/B,EAAAupD,aAAA,WAAA5oF,EAAAuJ,MAAA,SAAAvJ,EAAAuJ,OAAAvJ,EAAAkjF,SAAAljF,EAAAR,MAAApB,OAAAsF,UACAw0E,IAAA,sjDAAAl4E,EAAAq/B,GAAA9sB,GAAA,QAAA,wBAAA,WAAA,GAAA8sB,GAAA60B,EAAAtrD,EAAA5I,EAAAm3E,SAAAC,cAAAn3E,EAAA2I,EAAAif,SAAA,IAAA5nB,KAAA,aAAAD,EAAAuJ,KAAAtJ,EAAAoG,KAAAsiF,MAAAjiF,OAAA24B,EAAAp/B,EAAAoG,KAAAsiF,MAAAjiF,IAAA+O,MAAAxV,GAAA2I,EAAA3I,KAAAi0D,EAAAj0D,EAAAoG,KAAAsiF,MAAAzQ,IAAAt0E,QAAA,iBAAA,UAAA3D,EAAAsJ,KAAA4sC,mBAAAl2C,EAAAT,KAAA,IAAAoE,QAAA,eAAAuyC,mBAAA9W,IAAAz7B,QAAA,mBAAAi2B,EAAAwF,IAAAz7B,QAAA,iBAAAgF,EAAAy4E,SAAAlrC,mBAAAvtC,EAAAy4E,SAAAv/E,QAAA,IAAA9B,EAAAm3E,SAAApwE,MAAAvH,IAAAoJ,EAAAi0E,UAAAj0E,EAAAsrD,GAAA3qD,KAAA,OAAAlD,MAAAuoE,OAAA,EAAA2J,iBAAA,EAAA6B,UAAA,SAAA/6C,EAAAr/B,GAAA4I,EAAAk0E,MAAA3/C,UAAAwH,IAAA,iBAAA,WAAAtF,EAAA/f,MAAA,KAAA,KAAAtf,EAAAi/E,SAAAp+E,KAAA,2BAAA+9B,MAAA,WAAA,MAAAxgC,QAAA2I,KAAApG,KAAA2U,KAAA,QAAA,0BAAA,KAAA6+D,QAAAoF,WAAA,UAAA78E,SAAAW,QAAA,SAAAgiC,EAAAr/B,EAAA65B,GAAA,YAAA,SAAAq6B,KAAA,GAAAl0D,GAAAq/B,EAAA37B,SAAA4zB,KAAA1iB,OAAA,GAAAilB,EAAA75B,EAAAyG,MAAA,KAAAytD,EAAAr6B,EAAAn3B,OAAA,GAAA,WAAAwD,KAAA2zB,EAAAA,EAAAn3B,OAAA,IAAAd,SAAAi4B,EAAA/oB,QAAA,KAAA,EAAA,EAAAlI,EAAAixB,EAAAjzB,KAAA,IAAA,QAAA0wB,KAAAt3B,EAAAkB,MAAAgzD,EAAA,EAAA,EAAAA,EAAA20B,QAAAjgF,GAAA,QAAAA,GAAAy2B,GAAA,KAAAA,EAAAwpD,SAAAhvD,EAAA,mBAAAA,EAAAivD,eAAAzpD,EAAAwpD,SAAA,MAAA1+D,GAAAkV,EAAAn+B,MAAA,GAAAq2B,QAAAiJ,QAAA,kBAAA,QAAAvgC,GAAAo/B,GAAA,GAAAr/B,GAAA65B,CAAA,SAAAwF,IAAAr/B,EAAAq/B,EAAAxX,QAAAwX,EAAAxX,QAAAxhB,KAAAg5B,EAAAh5B,KAAA,MAAAwzB,EAAA75B,EAAAs3B,OAAAt3B,EAAAg9E,MAAAh9E,EAAAg9E,MAAAp8E,KAAA,aAAAZ,EAAAg9E,MAAAp8E,KAAA,oBAAA,MAAAi5B,GAAAA,EAAAivD,iBAAAjvD,EAAAivD,eAAA,SAAAzpD,GAAA,OAAAA,EAAA,IAAAz7B,QAAA,+CAAA,SAAAy7B,EAAAr/B,GAAA,MAAAA,GAAA,OAAAq/B,EAAA,IAAAA,EAAAvhC,MAAA,MAAA,KAAAuhC,EAAA0pD,WAAA1pD,EAAA38B,OAAA,GAAAsmB,SAAA,IAAA,IAAA,KAAAqW,MAAAxF,EAAA,YAAA,IAAAA,EAAAs9C,SAAA37B,SAAAlkB,OAAAuC,EAAA75B,GAAAuS,IAAA40E,YAAA,SAAA9nD,EAAAr/B,GAAA,GAAA65B,GAAAjxB,GAAA,IAAA5I,EAAA2+C,MAAA3+C,EAAAs8E,WAAAj2E,KAAAixB,OAAAuC,EAAAq6B,KAAAtrD,EAAA3I,EAAAD,KAAA65B,EAAAgvD,SAAAjgF,GAAAixB,EAAAgvD,UAAA7oF,EAAAs8E,UAAAziD,EAAA34B,MAAA,KAAAkmF,gBAAA,SAAAvtD,EAAAq6B,EAAAtrD,EAAA0H,GAAA,GAAAwpB,EAAAlxB,KAAA,IAAAA,EAAAvC,KAAAixB,OAAAwC,EAAA75B,EAAAi0D,MAAAA,EAAA00B,YAAA9uD,GAAAo6B,EAAAvV,MAAAj8C,OAAA,EAAA,KAAAkG,EAAA1H,MAAA,GAAA,IAAAm+B,EAAA37B,SAAA4zB,OAAA,IAAA48B,EAAA00B,cAAAt4E,IAAA4jD,EAAA80B,WAAA90B,EAAA80B,SAAA3pD,EAAA37B,SAAA4zB,MAAA48B,EAAA+0B,WAAAlgF,aAAAmrD,EAAA+0B,WAAA/0B,EAAA+0B,UAAAvhF,WAAA,WAAA,gBAAA23B,GAAA6pD,SAAA7pD,EAAA6pD,QAAA54E,EAAA,YAAA,mBAAAtQ,EAAAihD,MAAA5hB,EAAA37B,SAAAylF,SAAA9pD,EAAA37B,SAAA2wE,OAAA,IAAAngB,EAAA00B,aAAAt4E,IAAA4jD,EAAAk1B,mBAAA,IAAA/pD,EAAA37B,SAAA4zB,KAAA48B,EAAA00B,YAAA10B,EAAA+0B,UAAA,MAAA,QAAAhB,iBAAA,SAAApuD,EAAAq6B,EAAAtrD,GAAAA,IAAA,IAAAA,EAAAvC,KAAAixB,OAAAvuB,aAAAmrD,EAAA+0B,WAAA/0B,EAAA00B,aAAA10B,EAAAk1B,kBAAA/pD,EAAA6pD,QAAAG,OAAAn1B,EAAA00B,cAAA,gBAAAvpD,GAAA6pD,QAAA7pD,EAAA6pD,QAAAI,gBAAAtpF,EAAAihD,MAAA5hB,EAAA37B,SAAAylF,SAAA9pD,EAAA37B,SAAA2wE,QAAAngB,EAAA80B,UAAA,KAAA3pD,EAAA37B,SAAA4zB,KAAA48B,EAAA80B,UAAA90B,EAAA00B,YAAA,SAAA/uD,EAAAwF,GAAA9sB,GAAA,gBAAA,WAAA,GAAA8sB,GAAA60B,IAAAl0D,EAAA,IAAA65B,GAAAt5B,KAAAs5B,EAAA,uBAAAna,MAAA+a,UAAA,SAAA4E,EAAA60B,GAAA,GAAAtrD,GAAAixB,EAAAq6B,GAAAtzD,KAAA,WAAA,IAAAgI,GAAAA,EAAAggF,YAAA,MAAA5oF,GAAA4I,GAAA,IAAA5I,EAAAA,EAAA4oF,cAAAvpD,EAAAwpD,QAAA,IAAAxpD,EAAAn+B,OAAA,IAAAm+B,EAAAn+B,OAAAlB,EAAA4oF,aAAAvpD,EAAAwpD,UAAA7oF,EAAA4oF,YAAA,KAAA5oF,EAAAsf,SAAA,KAAA+f,EAAAwpD,SAAAjgF,EAAAy2B,KAAA33B,WAAA,WAAAmyB,EAAAs9C,SAAAC,eAAAxuE,EAAAsrD,MAAA,QAAA91D,OAAA1B,SAAAW,QAAA,SAAAgiC,EAAAr/B,GAAA,YAAA,IAAA65B,IAAA,GAAAnlB,OAAAC,SAAA3U,GAAAq/B,GAAA9sB,IAAA40E,YAAA,SAAA9nD,EAAAr/B,EAAAk0D,GAAAl0D,EAAA88E,MAAAa,MAAAprE,GAAA,sDAAA,SAAA8sB,GAAA,GAAA60B,GAAAl0D,EAAA6nB,QAAAjf,GAAA,GAAA8L,OAAAC,SAAA3U,GAAA2+C,MAAAj8C,OAAA,IAAA,IAAAwxD,EAAA7tD,KAAA4zE,OAAA,SAAA/lB,EAAA7tD,KAAA4zE,OAAA,UAAA/lB,EAAA3qD,OAAA81B,EAAA6B,iBAAA7B,EAAAsC,kBAAAuyB,EAAAsqB,OAAAhuC,SAAA,uBAAAnR,EAAAA,EAAAwC,eAAAxC,EAAAz2B,EAAAixB,EAAA,MAAAA,EAAAjxB,EAAA5I,IAAAq/B,EAAAkqD,SAAAlqD,EAAAmqD,QAAAnqD,EAAAoqD,aAAApqD,EAAAqqD,QAAA,EAAA,OAAA,uBAAAhtF,SAAAW,SCFA,SAAA2C,EAAAq/B,GAAA,gBAAAn7B,UAAA,mBAAAC,QAAAA,OAAAD,QAAAm7B,IAAA,kBAAAt7B,SAAAA,OAAAC,IAAAD,OAAAs7B,GAAAr/B,EAAA2pF,OAAAtqD,KAAA1+B,KAAA,WAAA,YAAA,SAAAX,GAAAA,GAAA,MAAA4pF,GAAA7rF,KAAAiC,GAAAlC,MAAA,MAAAuD,cAAA,QAAAg+B,GAAAr/B,GAAA,MAAA,gBAAAA,GAAA,QAAA4I,GAAA5I,GAAA,MAAA,gBAAAA,KAAA8iD,MAAA9iD,GAAA,QAAA65B,GAAA75B,GAAA,MAAA,UAAAA,EAAA,QAAA85B,GAAA95B,GAAA,MAAA,YAAA,SAAAA,EAAA,YAAAo1E,EAAAp1E,KAAA,OAAAA,EAAA,QAAAC,GAAAD,GAAA,IAAA85B,EAAA95B,GAAA,OAAA,CAAA,KAAA,GAAAq/B,GAAAr/B,EAAA4pB,YAAAhhB,EAAAy2B,EAAA5d,SAAA,OAAA4d,IAAAz2B,GAAAihF,EAAA9rF,KAAA6K,EAAA,iBAAA,MAAA5I,GAAA,OAAA,GAAA,QAAAk0D,GAAA70B,GAAA,MAAA,aAAAr/B,EAAAq/B,GAAA,QAAAthB,GAAAshB,GAAA,MAAA3U,OAAA/O,QAAA+O,MAAA/O,QAAA0jB,GAAA,UAAAr/B,EAAAq/B,GAAA,QAAA/uB,GAAAtQ,EAAAq/B,GAAA,MAAAA,GAAAA,GAAA,EAAAA,EAAA,EAAA3U,MAAAo/D,KAAAp/D,MAAAo/D,KAAA9pF,GAAAlC,MAAAuhC,GAAA0qD,EAAAhsF,KAAAiC,EAAAq/B,GAAA,QAAAh2B,GAAArJ,EAAAq/B,GAAA,GAAAz2B,KAAA,OAAAy2B,GAAA3+B,QAAA2+B,EAAA3+B,QAAAV,IAAAq/B,EAAA1gC,QAAA,SAAA0gC,EAAAxF,GAAAwF,IAAAr/B,IAAA4I,EAAAixB,KAAAjxB,GAAA,QAAAwM,GAAApV,GAAA,MAAAq/B,GAAAr/B,KAAAA,EAAAA,EAAA0e,KAAA1e,EAAA0e,OAAA1e,EAAA4D,QAAAkyE,EAAA,MAAA91E,EAAA,QAAAmO,GAAAnO,EAAAq/B,GAAA,GAAAr/B,GAAAk0D,EAAA70B,GAAA,CAAA,GAAAxF,GAAA,MAAA,IAAA9b,EAAA/d,IAAA4I,EAAA5I,EAAA0C,QAAA,CAAA,GAAAzC,GAAAD,EAAA0C,MAAA,KAAAm3B,EAAA,EAAAA,EAAA55B,IAAA,IAAAo/B,EAAAthC,KAAAiC,EAAAA,EAAA65B,GAAAA,EAAA75B,GAAA65B,GAAA,QAAAC,GAAA95B,IAAAmH,OAAA2lB,KAAA9sB,GAAArB,QAAA,SAAAiK,GAAAy2B,EAAAthC,KAAAiC,EAAAA,EAAA4I,GAAAA,EAAA5I,KAAA,MAAAA,GAAA,QAAAuoB,GAAAvoB,GAAA,IAAA,GAAAq/B,GAAAnsB,UAAAxQ,OAAAkG,EAAA8hB,MAAA2U,EAAA,EAAAA,EAAA,EAAA,GAAAxF,EAAA,EAAAA,EAAAwF,EAAAxF,IAAAjxB,EAAAixB,EAAA,GAAA3mB,UAAA2mB,EAAA,IAAAC,EAAA95B,IAAA4I,EAAAlG,OAAA,EAAA,CAAA,GAAAyE,OAAA6iF,OAAA,MAAA7iF,QAAA6iF,OAAAv0E,MAAAtO,QAAAnH,GAAA4b,OAAAhT,GAAAA,GAAAjK,QAAA,SAAA0gC,GAAAvF,EAAAuF,IAAAl4B,OAAA2lB,KAAAuS,GAAA1gC,QAAA,SAAAiK,GAAA5I,EAAA4I,GAAAy2B,EAAAz2B,OAAA,MAAA5I,GAAA,QAAAmtE,GAAAntE,EAAAq/B,GAAA,IAAA,GAAAz2B,GAAAsK,UAAAxQ,OAAAm3B,EAAAnP,MAAA9hB,EAAA,EAAAA,EAAA,EAAA,GAAAkxB,EAAA,EAAAA,EAAAlxB,EAAAkxB,IAAAD,EAAAC,EAAA,GAAA5mB,UAAA4mB,EAAA,OAAA,YAAA,IAAA,GAAAlxB,GAAAsK,UAAAxQ,OAAAo3B,EAAApP,MAAA9hB,GAAA3I,EAAA,EAAAA,EAAA2I,EAAA3I,IAAA65B,EAAA75B,GAAAiT,UAAAjT,EAAA,OAAAD,GAAAyV,MAAA4pB,EAAAxF,EAAAje,OAAAke,KAAA,QAAApO,GAAA1rB,EAAAq/B,GAAA,GAAAxF,GAAA75B,EAAAjD,KAAAoR,GAAAkxB,EAAA,SAAAr/B,EAAAq/B,GAAA/hC,EAAA4I,KAAAm5B,IAAAz2B,EAAA5I,KAAAA,GAAA,MAAA65B,EAAAwF,GAAAr/B,IAAA,QAAAoO,GAAApO,GAAA,MAAA5B,QAAAgqC,iBAAAhqC,OAAAgqC,iBAAApoC,EAAA,MAAAA,EAAA0oC,aAAA,QAAAx6B,GAAAlO,EAAAq/B,GAAA,MAAAr/B,GAAAb,UAAAa,EAAAb,UAAAitB,SAAAiT,GAAAr/B,EAAAlD,UAAA4D,QAAA2+B,MAAA,QAAAuM,GAAA5rC,EAAAq/B,GAAA,GAAAA,EAAA,GAAAz2B,EAAA5I,EAAA0C,QAAAyL,EAAAnO,EAAA,SAAAA,GAAA4rC,EAAA5rC,EAAAq/B,SAAA,IAAAr/B,EAAAb,UAAAa,EAAAb,UAAAif,IAAAihB,OAAA,CAAA,GAAAxF,GAAAzkB,EAAApV,EAAAlD,UAAA+8B,GAAAA,EAAAn5B,QAAA2+B,GAAA,IAAAr/B,EAAAlD,UAAA+8B,EAAA,IAAAwF,GAAAr/B,EAAAlD,UAAAuiC,GAAA,QAAA+tC,GAAAptE,EAAAq/B,GAAAA,IAAAz2B,EAAA5I,EAAA0C,QAAAyL,EAAAnO,EAAA,SAAAA,GAAAotE,EAAAptE,EAAAq/B,KAAAr/B,EAAAb,UAAAa,EAAAb,UAAAC,OAAAigC,GAAAr/B,EAAAlD,UAAA4D,QAAA2+B,IAAA,IAAAr/B,EAAAlD,UAAAkD,EAAAlD,UAAA8G,QAAAy7B,EAAA,MAAA,QAAAl9B,GAAAnC,EAAAq/B,EAAAxF,GAAAwF,IAAAz2B,EAAA5I,EAAA0C,QAAAyL,EAAAnO,EAAA,SAAAA,GAAAmC,EAAAnC,EAAAq/B,EAAAxF,KAAAA,EAAA+R,EAAA5rC,EAAAq/B,GAAA+tC,EAAAptE,EAAAq/B,IAAA,QAAAkuC,GAAAvtE,GAAA,MAAAA,GAAA4D,QAAAqmF,EAAA,SAAA5oF,cAAA,QAAAisE,GAAAttE,EAAAq/B,GAAA,MAAAvF,GAAA95B,EAAAq/B,IAAAr/B,EAAAq/B,GAAAr/B,EAAAf,QAAAe,EAAAf,QAAAogC,GAAAr/B,EAAAyE,aAAA,QAAA8oE,EAAAluC,IAAA,QAAAmnC,GAAAxmE,EAAAq/B,EAAAz2B,GAAAkxB,EAAAlxB,GAAA5I,EAAAq/B,GAAAz2B,EAAA5I,EAAAf,QAAAe,EAAAf,QAAAogC,GAAAz2B,EAAA5I,EAAA0E,aAAA,QAAA6oE,EAAAluC,GAAAz2B,GAAA,QAAA4kE,GAAAxtE,EAAAq/B,GAAA,GAAAvF,EAAA95B,EAAAq/B,UAAAr/B,GAAAq/B,OAAA,IAAAr/B,EAAAf,QAAA,UAAAe,GAAAf,QAAAogC,GAAA,MAAAz2B,GAAA5I,EAAAf,QAAAogC,GAAA,SAAAr/B,GAAAwR,gBAAA,QAAA+7D,EAAAluC,IAAA,QAAA41C,GAAAj1E,EAAAq/B,EAAAz2B,GAAA,GAAAixB,GAAAzkB,EAAAiqB,GAAA54B,MAAAyjF,EAAArwD,GAAAn3B,OAAA,EAAAyL,EAAA0rB,EAAA,SAAAwF,GAAA41C,EAAAj1E,EAAAq/B,EAAAz2B,KAAA5I,EAAAia,oBAAAja,EAAAia,oBAAAolB,EAAAz2B,GAAA,GAAA5I,EAAAma,aAAAna,EAAAma,YAAA,KAAAklB,EAAAz2B,GAAA,QAAAgsE,GAAA50E,EAAAq/B,EAAAz2B,EAAAixB,GAAA,GAAAC,GAAA1kB,EAAAiqB,GAAA54B,MAAAyjF,GAAAjqF,EAAA2I,CAAAkxB,GAAAp3B,OAAA,EAAAyL,EAAA2rB,EAAA,SAAAuF,GAAAu1C,EAAA50E,EAAAq/B,EAAAz2B,MAAAixB,IAAAjxB,EAAA,WAAA,IAAA,GAAAixB,GAAA3mB,UAAAxQ,OAAAo3B,EAAApP,MAAAmP,GAAAq6B,EAAA,EAAAA,EAAAr6B,EAAAq6B,IAAAp6B,EAAAo6B,GAAAhhD,UAAAghD,EAAA,OAAA+gB,GAAAj1E,EAAAq/B,EAAAz2B,GAAA3I,EAAAwV,MAAAzV,EAAA85B,KAAA95B,EAAAgI,iBAAAhI,EAAAgI,iBAAAq3B,EAAAz2B,GAAA,GAAA5I,EAAA4S,aAAA5S,EAAA4S,YAAA,KAAAysB,EAAAz2B,IAAA,QAAA4sE,GAAAx1E,EAAAq/B,EAAAz2B,GAAA,GAAA5I,EAAAmqF,cAAA,CAAA,GAAArwD,GAAA,MAAA,OAAAo6B,GAAArzB,QAAAqzB,EAAAk2B,aAAAtwD,EAAAD,EAAAjxB,GAAA,GAAAi4B,OAAAxB,GAAAgrD,SAAA,EAAAC,YAAA,IAAA,GAAAF,aAAA/qD,GAAAqqD,OAAA9gF,EAAAyhF,SAAA,EAAAC,YAAA,IAAAzwD,EAAAjxB,IAAAkxB,EAAAp9B,SAAA6tF,YAAA,UAAAC,UAAAnrD,GAAA,GAAA,IAAAvF,EAAAp9B,SAAA6tF,YAAA,gBAAAE,gBAAAprD,GAAA,GAAA,EAAAz2B,GAAA5I,EAAAmqF,cAAArwD,GAAA,OAAA95B,EAAA0qF,WAAA1qF,EAAA0qF,UAAA,KAAArrD,GAAA,QAAA+0C,GAAAp0E,GAAA,GAAAq/B,GAAAr/B,GAAA5B,OAAAgc,KAAA,IAAAilB,EAAAtgC,SAAAsgC,EAAAtgC,OAAAsgC,EAAA6C,YAAAxlC,WAAAkM,EAAAy2B,EAAAoD,QAAA75B,EAAAy2B,EAAAqD,SAAA,CAAA,GAAA7I,GAAA75B,EAAAjB,OAAAse,eAAA3gB,SAAAo9B,EAAAD,EAAA35B,gBAAAD,EAAA45B,EAAA15B,IAAAk/B,GAAAoD,MAAApD,EAAAqD,UAAA5I,GAAAA,EAAA6I,YAAA1iC,GAAAA,EAAA0iC,YAAA,IAAA7I,GAAAA,EAAA8I,YAAA3iC,GAAAA,EAAA2iC,YAAA,IAAAvD,EAAAwD,MAAAxD,EAAAyD,UAAAhJ,GAAAA,EAAAiJ,WAAA9iC,GAAAA,EAAA8iC,WAAA,IAAAjJ,GAAAA,EAAAkJ,WAAA/iC,GAAAA,EAAA+iC,WAAA,IAAA,MAAA3D,GAAA,QAAAq1C,GAAA10E,GAAA,GAAAq/B,GAAA3iC,SAAAwD,gBAAA0I,EAAA5I,EAAA44C,uBAAA,QAAAjQ,KAAA//B,EAAA+/B,OAAAvqC,OAAA4iE,SAAA3hC,GAAAA,EAAAsD,YAAA,IAAAtD,GAAAA,EAAAuD,YAAA,IAAA3O,IAAArrB,EAAAqrB,MAAA71B,OAAA6iE,SAAA5hC,GAAAA,EAAA0D,WAAA,IAAA1D,GAAAA,EAAA2D,WAAA,KAAA,QAAAyxC,GAAAz0E,EAAAq/B,GAAA,MAAAr/B,GAAA2H,qBAAA03B,GAAA,QAAAsrD,GAAA3qF,EAAAq/B,GAAA,MAAAr/B,GAAAqsB,uBAAArsB,EAAAqsB,uBAAAgT,GAAAr/B,EAAAhC,iBAAA,IAAAqhC,GAAA,QAAAk1C,GAAAv0E,EAAAq/B,GAAAA,EAAA38B,OAAAyL,EAAAkxB,EAAA,SAAAA,GAAAk1C,EAAAv0E,EAAAq/B,KAAAr/B,EAAA4E,YAAAy6B,GAAA,QAAAurD,GAAA5qF,GAAAA,EAAAiG,YAAAjG,EAAAiG,WAAAM,YAAAvG,GAAA,QAAA80E,GAAA90E,GAAA,KAAAA,EAAA6E,YAAA7E,EAAAuG,YAAAvG,EAAA6E,YAAA,QAAA+wE,GAAA51E,EAAAq/B,GAAAxF,EAAA75B,EAAA01B,aAAA11B,EAAAm3B,UAAAkI,EAAAr/B,EAAA01B,YAAA2J,EAAA,QAAAs1C,GAAA30E,GAAA,MAAAA,GAAA0I,YAAA,QAAA4sE,GAAAt1E,GAAA,MAAAq/B,GAAAr/B,GAAAA,EAAA4D,QAAA,QAAA,IAAAA,QAAA,WAAA,IAAA,GAAA,QAAAixE,GAAA70E,EAAAq/B,GAAA,GAAAr/B,EAAA4gF,aAAAvhD,EAAAr/B,EAAA4gF,aAAA5gF,EAAA6gF,mBAAA,CAAA,GAAAj4E,GAAAlM,SAAAG,cAAA,MAAA+L,GAAAiB,OAAA,WAAAw1B,EAAA1+B,KAAAP,MAAAO,KAAAN,SAAAuI,EAAApJ,IAAAQ,EAAAR,KAAA,QAAAk2E,GAAA11E,GAAA,GAAAq/B,MAAAxF,EAAA75B,EAAA6qF,OAAA/wD,EAAA95B,EAAAo/E,OAAAn/E,EAAAD,EAAAq/E,MAAA,OAAAz2E,GAAAixB,IAAA,IAAAA,GAAAwF,EAAAp4B,KAAA,UAAA4yB,EAAA,QAAAjxB,EAAAkxB,IAAA,IAAAA,GAAAuF,EAAAp4B,KAAA,UAAA6yB,EAAA,KAAAlxB,EAAA3I,IAAA,IAAAA,GAAAo/B,EAAAp4B,KAAA,UAAAhH,EAAA,KAAAo/B,EAAA38B,OAAA28B,EAAAz4B,KAAA,KAAA,OAAA,QAAAkkF,GAAA9qF,GAAA,OAAAA,GAAA,IAAA,GAAA,MAAA,qBAAA,KAAA,GAAA,MAAA,qBAAA,KAAA,GAAA,MAAA,sBAAA,MAAA,GAAA,QAAAy1E,GAAAz1E,EAAAq/B,GAAA,GAAAz2B,IAAAmiF,KAAA/qF,EAAAyiC,MAAAuoD,KAAAhrF,EAAA6iC,MAAA,OAAAxD,GAAAz2B,EAAA2f,GAAA0iE,OAAAjrF,EAAAyiC,MAAAyoD,OAAAlrF,EAAA6iC,OAAAj6B,GAAA,QAAA2N,GAAAvW,GAAA,GAAAq/B,GAAA9W,KAAAvoB,GAAA4I,IAAA,OAAAuF,GAAAnO,EAAA,SAAAA,EAAA65B,SAAAwF,GAAAxF,GAAA1rB,EAAAkxB,EAAA,SAAAA,GAAA,GAAAxF,GAAAp4B,KAAAC,IAAA1B,EAAAirF,OAAA5rD,EAAA4rD,QAAAnxD,EAAAr4B,KAAAC,IAAA1B,EAAAkrF,OAAA7rD,EAAA6rD,QAAAjrF,EAAAwB,KAAAC,IAAA1B,EAAA+qF,KAAA1rD,EAAA0rD,MAAA72B,EAAAzyD,KAAAC,IAAA1B,EAAAgrF,KAAA3rD,EAAA2rD,MAAAjtE,EAAAtc,KAAAqK,KAAA+tB,EAAAA,EAAAC,EAAAA,GAAAxpB,GAAA7O,KAAAqK,KAAA7L,EAAAA,EAAAi0D,EAAAA,GAAAn2C,GAAAA,CAAAnV,GAAA3B,KAAAqJ,OAAA1H,EAAA1G,KAAA,SAAAlC,EAAAq/B,GAAA,MAAA59B,MAAAC,IAAA1B,GAAAyB,KAAAC,IAAA29B,KAAAz2B,EAAA,GAAA,QAAAusE,GAAAn1E,GAAA,GAAAq/B,GAAA,EAAAz2B,EAAA,EAAAixB,EAAA,CAAA,OAAA1rB,GAAAnO,EAAA,SAAAA,GAAAq/B,GAAAr/B,EAAAirF,OAAAriF,GAAA5I,EAAAkrF,OAAArxD,GAAA,IAAAwF,GAAAxF,EAAAjxB,GAAAixB,GAAA4I,MAAApD,EAAAwD,MAAAj6B,GAAA,QAAAssE,GAAAl1E,EAAAq/B,GAAA,KAAAr/B,YAAAq/B,IAAA,KAAA,IAAAmhB,WAAA,qCAAA,GAAA2qC,IAAA9sB,QAAA,EAAAvmC,QAAA;AAAAszD,QAAA,EAAAnqC,OAAA,EAAA42B,SAAA,EAAAvjB,SAAA,EAAA+2B,SAAA,EAAAC,UAAA,EAAAC,WAAA,EAAAC,UAAA,EAAA5hC,YAAA,EAAAk5B,YAAA,EAAAh3B,UAAA,EAAAte,SAAA,IAAAjF,SAAA,IAAAkjD,UAAA,IAAAC,UAAA,GAAAC,aAAA,IAAAC,aAAA,IAAA5gD,OAAA,KAAA6gD,aAAA,EAAAnlF,IAAA,MAAA2T,MAAA,KAAA4F,KAAA,KAAA6rE,MAAA,KAAAjoE,KAAA,KAAA3D,OAAA,KAAA6rE,KAAA,KAAAC,OAAA,MAAA5W,EAAA,kBAAA6W,SAAA,gBAAAA,QAAAC,SAAA,SAAAlsF,GAAA,aAAAA,IAAA,SAAAA,GAAA,MAAAA,IAAA,kBAAAisF,SAAAjsF,EAAA4pB,cAAAqiE,QAAAjsF,IAAAisF,OAAAxqE,UAAA,eAAAzhB,IAAAiqF,EAAA,oBAAAC,EAAA,MAAA5sF,EAAA,iDAAAw4E,EAAA,eAAAt9D,EAAArR,OAAAsa,UAAAmoE,EAAApxE,EAAAwQ,SAAA6gE,EAAArxE,EAAA0Q,eAAA6gE,EAAAr/D,MAAAjJ,UAAA3jB,MAAAquF,IAAAC,OAAA,WAAA,GAAApsF,GAAAW,IAAAX,GAAAqsF,gBAAArsF,EAAAssF,aAAAtsF,EAAAusF,WAAAvsF,EAAAwsF,gBAAAH,cAAA,WAAA1rF,KAAA8rF,eAAArsF,MAAAhC,OAAAmM,WAAAlK,OAAAjC,OAAAsM,cAAA4hF,WAAA,WAAA,GAAAtsF,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAA+B,OAAA83B,EAAA,MAAAwF,GAAAg/B,SAAAxkC,GAAAz5B,MAAAqB,KAAA6I,IAAA1B,EAAAF,YAAA22B,EAAAkJ,UAAAloC,OAAAoB,KAAA6I,IAAA1B,EAAAmY,aAAAse,EAAAosD,YAAAzrF,EAAA0sF,WAAA7yD,IAAA75B,EAAA2sF,QAAA9yD,IAAAA,EAAA75B,EAAAysF,eAAAzsF,EAAA4sF,WAAArkE,KAAAsR,IAAA2yD,aAAA,WAAA,GAAAxsF,GAAAW,IAAAX,GAAA3B,QAAAggE,SAAAr+D,EAAA2sF,QAAAjhE,EAAA1rB,EAAA6sF,OAAA7sF,EAAA4sF,aAAAL,SAAA,WAAA,GAAAvsF,GAAAW,KAAAiI,EAAA5I,EAAA3B,QAAAw7B,EAAA75B,EAAAiX,QAAA6iB,EAAA95B,EAAAsc,KAAArc,IAAAkO,GAAAnO,EAAA9B,OAAA,SAAA8B,EAAA65B,GAAA,GAAAC,GAAA95B,EAAAR,IAAAue,EAAA/d,EAAA8/D,KAAAwV,EAAAx7C,GAAAxpB,EAAA1H,EAAAlC,GAAAozB,KAAAuF,EAAA/uB,GAAAA,EAAAtQ,EAAAyE,aAAA6L,GAAA4jD,EAAA5jD,KAAAA,EAAAA,EAAAvS,KAAAiC,EAAAA,IAAAC,EAAAgH,KAAA,iBAAA6yB,EAAA,kDAAAD,EAAA,yBAAAvpB,GAAAwpB,GAAA,UAAA/b,EAAA,cAAA+b,EAAAr8B,UAAAwC,EAAA2G,KAAA,IAAAuH,EAAAsmE,EAAA36C,EAAA,OAAA,SAAAuF,GAAAmnC,EAAAnnC,EAAA,UAAA,GAAAu1C,EAAAv1C,EAAA,OAAA8tC,EAAAntE,EAAA8sF,UAAA9sF,IAAA,KAAAA,EAAAq3E,MAAA5C,EAAA36C,EAAA,MAAAlxB,EAAAghD,YAAAgrB,EAAA/6C,EAAA,SAAA,WAAA+R,EAAA9R,EAAA,uBAAA,IAAAizD,WAAA,SAAA/sF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAA5I,GAAAq/B,EAAAn+B,MAAA24B,EAAAwF,EAAAg4C,MAAAzuE,GAAAF,aAAA,GAAAoxB,EAAAD,EAAA,CAAAnO,GAAA2T,EAAA/iB,MAAAlc,MAAA05B,EAAAuF,EAAA38B,OAAAkwD,YAAAvzB,EAAAutD,WAAAxsF,MAAAy5B,GAAA,EAAAC,EAAAlxB,KAAAokF,UAAA,WAAA,GAAAhtF,GAAAW,IAAAm0E,GAAA90E,EAAAsc,MAAA8wD,EAAAptE,EAAAsc,KAAA,qBAAAoP,GAAAknC,WAAA,KAAAq6B,UAAA,SAAAjtF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAAhhC,QAAAw7B,EAAAwF,EAAAx/B,MAAAi6B,EAAAuF,EAAAutD,WAAA3sF,EAAAo/B,EAAA6tD,OAAAnsE,aAAAhD,EAAA+b,EAAA15B,MAAAkQ,EAAA7O,KAAA6I,IAAAwvB,EAAAz5B,OAAAJ,EAAAA,GAAAoJ,EAAAg2B,EAAA1oB,aAAAk+D,GAAAh7C,EAAA,SAAAA,EAAAC,GAAA,GAAA75B,GAAA45B,EAAAC,EAAA1kB,EAAA2I,EAAA5P,EAAAmC,CAAAA,GAAArQ,EAAA8d,EAAA5P,EAAA4P,EAAA9d,EAAAmV,EAAA9E,EAAArQ,CAAA,IAAAktE,IAAAyT,aAAA/mD,EAAAgnD,cAAA/mD,EAAAqzD,YAAAltF,EAAAw/E,OAAArqE,EAAA3T,KAAAo8C,IAAA,GAAAzoC,EAAAykB,IAAAA,EAAAz5B,MAAAgV,EAAA/U,OAAA8N,EAAA1M,KAAAo8C,IAAA,GAAA1vC,EAAA2rB,GAAA6O,MAAA5qB,EAAA3I,GAAA,EAAA6e,KAAA3jB,EAAAnC,GAAA,GAAAud,EAAAnD,KAAA4kD,EAAAvkE,GAAA2iF,YAAApe,EAAA0d,OAAAxhF,EAAAwhF,QAAA,EAAAn/D,EAAAm/D,OAAA,GAAAjiF,EAAA4iF,WAAAre,EAAAiS,OAAA/1E,EAAA+1E,QAAA,EAAAjS,EAAAkS,OAAAh2E,EAAAg2E,QAAA,EAAA3zD,EAAA0zD,OAAA,EAAA1zD,EAAA2zD,OAAA,GAAAhgD,EAAA1oB,UAAAw2D,EAAA9tC,EAAA+tD,iBAAA1hE,EAAAwoC,EAAAl0D,IAAAA,OAAAqtF,YAAA,SAAArtF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAAx/B,MAAAg6B,EAAAwF,EAAA1oB,UAAAmjB,EAAA47C,EAAA77C,EAAAnO,GAAA9iB,GAAAxI,MAAAy5B,EAAAz5B,MAAAC,OAAAw5B,EAAAx5B,OAAAuyD,WAAA/4B,EAAA8O,KAAAgqB,UAAA94B,EAAA5F,IAAAq5D,gBAAAxzD,EAAAyzD,YAAAzzD,EAAAs0C,UAAAt0C,IAAAo6B,EAAAl0D,KAAAq/B,EAAAguB,cAAAunB,EAAAhsE,EAAA,gBAAA5I,GAAA,GAAAA,MAAAwtF,WAAA,WAAA,GAAAxtF,GAAAW,IAAAX,GAAAH,QAAA+qF,EAAA5qF,EAAAH,OAAAG,EAAAH,MAAA,QAAA4tF,GAAA,mBAAArvF,QAAAA,OAAAswE,aAAA,KAAAzV,GAAAw0B,GAAA,cAAA,uBAAAC,GAAAD,GAAA,cAAA,sBAAAnqC,GAAAmqC,GAAA,0BAAA,+BAAAE,IAAA/8C,KAAA,WAAA,GAAA5wC,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,QAAA4iB,EAAA75B,EAAA6sF,MAAA34B,GAAA70B,EAAA0sD,OAAAnX,EAAAhsE,EAAA,OAAAy2B,EAAA0sD,MAAA73B,EAAA70B,EAAA2sD,SAAApX,EAAAhsE,EAAA,SAAAy2B,EAAA2sD,QAAApX,EAAA/6C,EAAA,QAAA75B,EAAA4tF,QAAAzgB,EAAAntE,EAAA4+B,MAAA5+B,IAAA40E,EAAA/6C,EAAA,kCAAA75B,EAAA6tF,QAAA1gB,EAAAntE,EAAAi6E,MAAAj6E,IAAA40E,EAAA/6C,EAAA,YAAA75B,EAAA8tF,YAAA3gB,EAAAntE,EAAA+tF,UAAA/tF,IAAA40E,EAAA50E,EAAAguF,OAAA/0B,GAAAj5D,EAAAiuF,cAAA9gB,EAAAntE,EAAAkuF,YAAAluF,IAAA40E,EAAAl4E,SAAAgxF,GAAA1tF,EAAAmuF,cAAAhhB,EAAAntE,EAAAouF,YAAApuF,IAAA40E,EAAAl4E,SAAA4mD,GAAAtjD,EAAAquF,YAAAlhB,EAAAntE,EAAAsuF,UAAAtuF,IAAA40E,EAAAl4E,SAAA,UAAAsD,EAAAuuF,UAAAphB,EAAAntE,EAAA+rD,QAAA/rD,IAAA40E,EAAAx2E,OAAA,SAAA4B,EAAA8I,SAAAqkE,EAAAntE,EAAAkvD,OAAAlvD,KAAA6wC,OAAA,WAAA,GAAA7wC,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,QAAA4iB,EAAA75B,EAAA6sF,MAAA34B,GAAA70B,EAAA0sD,OAAA9W,EAAArsE,EAAA,OAAAy2B,EAAA0sD,MAAA73B,EAAA70B,EAAA2sD,SAAA/W,EAAArsE,EAAA,SAAAy2B,EAAA2sD,QAAA/W,EAAAp7C,EAAA,QAAA75B,EAAA4tF,SAAA3Y,EAAAp7C,EAAA,kCAAA75B,EAAA6tF,SAAA5Y,EAAAp7C,EAAA,YAAA75B,EAAA8tF,aAAA7Y,EAAAj1E,EAAAguF,OAAA/0B,GAAAj5D,EAAAiuF,eAAAhZ,EAAAv4E,SAAAgxF,GAAA1tF,EAAAmuF,eAAAlZ,EAAAv4E,SAAA4mD,GAAAtjD,EAAAquF,aAAApZ,EAAAv4E,SAAA,UAAAsD,EAAAuuF,WAAAtZ,EAAA72E,OAAA,SAAA4B,EAAA8I,YAAA0lF,IAAAzqE,MAAA,SAAA/jB,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAwrE,EAAAp0E,GAAAjB,MAAA,SAAA6J,EAAAi+C,QAAAxlD,gBAAAg+B,EAAAtgC,OAAA6J,EAAAy2B,EAAApf,SAAA2e,MAAA,SAAA5+B,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAwrE,EAAAp0E,GAAAjB,OAAA86B,EAAAyzC,EAAA1kE,EAAA,UAAAkxB,EAAAuF,EAAA1oB,SAAA,QAAAkjB,GAAA,IAAA,MAAAwF,EAAAovD,OAAApvD,EAAA7Z,OAAA6Z,EAAAhhC,QAAAggE,OAAAh/B,EAAAstD,OAAAttD,EAAAqoD,OAAAroD,EAAAqvD,OAAArvD,EAAAxb,MAAA,MAAA,KAAA,OAAAwb,EAAA0sD,KAAAze,EAAA1kE,EAAA,SAAA,MAAA,KAAA,UAAAy2B,EAAA5b,KAAA,IAAA,EAAA,MAAA,KAAA,WAAA4b,EAAA5b,UAAA,EAAA,MAAA,KAAA,aAAA4b,EAAA5c,QAAA,MAAA,KAAA,QAAA4c,EAAA7G,OAAA,MAAA,KAAA,OAAA6G,EAAArX,MAAA,MAAA,KAAA,OAAAqX,EAAAsvD,MAAA,MAAA,KAAA,OAAAtvD,EAAA1F,MAAA,MAAA,KAAA,cAAA0F,EAAAwrD,WAAA,MAAA,KAAA,eAAAxrD,EAAAwrD,OAAA,GAAA,MAAA,KAAA,kBAAAxrD,EAAA+/C,QAAAtlD,EAAAslD,WAAA,MAAA,KAAA,gBAAA//C,EAAAggD,QAAAvlD,EAAAulD,WAAA,MAAA,SAAAhgD,EAAAovD,QAAApvD,EAAA7Z,SAAA2d,KAAA,WAAA,GAAAnjC,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAH,MAAAg6B,EAAA75B,EAAAkB,MAAA44B,EAAA95B,EAAA4sF,UAAA5sF,GAAAmY,UAAApP,aAAA/I,EAAAmY,SAAAnY,EAAAmY,SAAA,GAAAi1D,EAAAxkE,EAAA,oBAAAA,EAAA7L,MAAAmZ,QAAA,gCAAA4jB,EAAA15B,MAAA,EAAA,iBAAA05B,EAAAz5B,OAAA,EAAA,kDAAAL,EAAAitF,UAAA,WAAA9qF,EAAAyG,EAAA,oBAAAy2B,EAAAuqB,YAAAznD,EAAAyG,EAAA,cAAAy2B,EAAAgsD,SAAArrF,EAAAqtF,YAAA,WAAArtF,EAAAgsF,QAAA,EAAAxW,EAAAx1E,EAAAiX,QAAA,UAAA23E,cAAA5uF,EAAA9B,OAAA27B,GAAA34B,MAAA24B,EAAAh6B,MAAA+I,SAAAkkF,UAAA,SAAA9sF,GAAA,GAAAq/B,GAAA+0C,EAAAp0E,GAAAjB,OAAA6J,EAAAy2B,EAAAp5B,WAAA4zB,EAAAjxB,EAAAF,aAAA,GAAAoxB,EAAAlxB,EAAAmY,cAAA,GAAA9gB,IAAAqtE,EAAAjuC,EAAA,SAAAw1C,GAAAx1C,EAAA,SAAAr/B,EAAA4I,GAAA,GAAAsrD,GAAAl0D,EAAA4I,EAAAmV,EAAA8b,EAAAvpB,EAAAwpB,CAAAA,GAAAo6B,EAAAr6B,EAAA55B,EAAA8d,EAAA+b,EAAAo6B,EAAA5jD,EAAAupB,EAAAq6B,EAAAj0D,EAAAqQ,EAAAupB,EAAAq6B,EAAAn2C,EAAA+b,EAAAo6B,EAAAxoC,EAAA2T,GAAAj/B,MAAA2d,EAAA1d,OAAAiQ,EAAAsiD,YAAA/4B,EAAA9b,GAAA,EAAA40C,WAAA74B,EAAAxpB,GAAA,OAAA4+C,OAAA,WAAA,GAAAlvD,GAAAW,IAAAX,GAAAqsF,gBAAArsF,EAAAssF,aAAAtsF,EAAAwsF,eAAAxsF,EAAA+sF,aAAA/sF,EAAAgsF,QAAAhsF,EAAAitF,UAAA,WAAAjtF,EAAAqtF,gBAAArtF,EAAAyuF,QAAAtgF,EAAAsmE,EAAAz0E,EAAA6uF,OAAA,OAAA,SAAAxvD,GAAAu1C,EAAAv1C,EAAA,OAAA8tC,EAAAntE,EAAA8sF,UAAA9sF,IAAA,GAAAw1E,EAAAn2C,EAAA,WAAA46C,MAAA,SAAAj6E,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAwrE,EAAAp0E,EAAA,IAAAq/B,EAAA2sD,SAAApjF,EAAAs4B,kBAAA7B,EAAAyvD,UAAA,CAAAzvD,EAAAyvD,UAAA,EAAApnF,WAAA,WAAA23B,EAAAyvD,UAAA,GAAA,GAAA,IAAAj1D,GAAAgpB,OAAAxjB,EAAAhhC,QAAAqtF,YAAA,GAAA5xD,EAAA,CAAAlxB,GAAA2gF,OAAAzvD,EAAAlxB,EAAA2gF,OAAA,EAAA,KAAA3gF,EAAA6gF,WAAA3vD,GAAAlxB,EAAA6gF,WAAA,IAAA7gF,EAAA8gF,SAAA5vD,EAAAlxB,EAAA8gF,OAAA,EAAA,MAAArqD,EAAA5b,MAAAqW,EAAAD,GAAA,EAAAjxB,KAAAmjD,QAAA,SAAA/rD,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAwrE,EAAAp0E,GAAA65B,EAAAwF,EAAAhhC,QAAAy7B,EAAAlxB,EAAA05B,SAAA15B,EAAAmZ,OAAAnZ,EAAAy5B,QAAA,IAAAhD,EAAAstD,QAAA9yD,EAAAiyB,SAAA,OAAAhyB,GAAA,IAAA,IAAAuF,EAAAovD,OAAApvD,EAAA7Z,OAAAqU,EAAAwkC,OAAAh/B,EAAAstD,QAAAttD,EAAAqoD,OAAAroD,EAAAxb,MAAA,MAAA,KAAA,IAAAwb,EAAAovD,QAAApvD,EAAA7Z,MAAA,MAAA,KAAA,IAAA6Z,EAAArX,MAAA,MAAA,KAAA,IAAApf,EAAAs4B,iBAAA7B,EAAA5b,KAAAoW,EAAA6xD,WAAA,EAAA,MAAA,KAAA,IAAArsD,EAAA1F,MAAA,MAAA,KAAA,IAAA/wB,EAAAs4B,iBAAA7B,EAAA5b,MAAAoW,EAAA6xD,WAAA,EAAA,MAAA,KAAA,IAAA,IAAA,KAAA9iF,EAAA25D,SAAA35D,EAAAg1E,YAAAh1E,EAAAs4B,iBAAA7B,EAAA5c,YAAAsrE,UAAA,SAAA/tF,GAAA,QAAAA,EAAAjB,OAAA8nD,QAAAxlD,eAAArB,EAAAkhC,kBAAAgtD,YAAA,SAAAluF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAAhhC,QAAAw7B,EAAAwF,EAAA0vD,SAAAj1D,EAAAs6C,EAAAp0E,EAAA,IAAAq/B,EAAA2sD,SAAA3sD,EAAAguB,cAAA,CAAAvzB,EAAAw6C,eAAAnmE,EAAA2rB,EAAAw6C,eAAA,SAAAt0E,GAAA65B,EAAA75B,EAAAiyB,YAAAwjD,EAAAz1E,KAAA65B,EAAAC,EAAAk1D,WAAA,GAAAvZ,EAAA37C,EAAA,IAAA75B,KAAA2I,EAAAyiF,SAAA,MAAAlkF,QAAA2lB,KAAA+M,GAAAn3B,OAAA,EAAAzC,EAAA,OAAA,UAAA65B,EAAAm1D,aAAA,cAAAn1D,EAAAvwB,OAAA81B,EAAA6vD,iBAAAjvF,EAAA,UAAAo/B,EAAAgsB,OAAAprD,IAAAmuF,YAAA,SAAApuF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAAhhC,QAAAw7B,EAAAwF,EAAA0vD,SAAAj1D,EAAAs6C,EAAAp0E,GAAAC,EAAAo/B,EAAAgsB,OAAA6I,EAAA70B,EAAAx/B,KAAAw/B,GAAA2sD,QAAA/rF,IAAA65B,EAAAoH,iBAAApH,EAAAw6C,eAAAnmE,EAAA2rB,EAAAw6C,eAAA,SAAAt0E,GAAAuoB,EAAAsR,EAAA75B,EAAAiyB,YAAAwjD,EAAAz1E,GAAA,MAAAuoB,EAAAsR,EAAAC,EAAAk1D,WAAA,GAAAvZ,EAAA37C,GAAA,IAAA,SAAA75B,GAAA2I,EAAAghD,YAAA17C,EAAAgmD,EAAA,sBAAAkZ,EAAAlZ,EAAA,qBAAA70B,EAAAP,OAAAhF,KAAAw0D,UAAA,SAAAtuF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAA0vD,SAAAl1D,EAAAu6C,EAAAp0E,GAAA85B,EAAAuF,EAAAgsB,MAAAhsB,GAAA2sD,SAAAnyD,EAAAy6C,eAAAnmE,EAAA0rB,EAAAy6C,eAAA,SAAAt0E,SAAA4I,GAAA5I,EAAAiyB,oBAAArpB,GAAAixB,EAAAm1D,WAAA,GAAAl1D,IAAA,SAAAA,GAAAuF,EAAAhhC,QAAAurD,YAAAhe,EAAAvM,EAAAx/B,MAAA,qBAAAw/B,EAAAgsB,QAAA,MAAA8jC,IAAAlvE,KAAA,WAAA,GAAAjgB,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,OAAA,IAAAooB,EAAAg/B,QAAAr+D,EAAAqtD,cAAA,MAAArtD,EAAA,IAAAA,EAAAqa,OAAAra,EAAAovF,QAAAl7B,EAAA70B,EAAApf,OAAA20D,EAAAhsE,EAAA,OAAAy2B,EAAApf,MAAA,IAAA,IAAAu1D,EAAA5sE,EAAA,QAAA,MAAA5I,EAAAA,GAAA+G,MAAA,IAAA8yB,GAAA75B,EAAA6sF,MAAA,OAAAzf,GAAAvzC,EAAA,eAAA+6C,EAAAhsE,EAAA,QAAA,WAAA5I,EAAA+rF,KAAA/rF,EAAAjB,OAAAsK,EAAArJ,EAAAjB,OAAAuR,EAAAtQ,EAAA9B,SAAA8B,EAAAkB,OAAAlB,EAAAjB,QAAA,IAAA,GAAAsgC,EAAAuqB,YAAA5pD,EAAAqtD,eAAA,EAAAzhB,EAAA/R,EAAA,qBAAA86C,EAAA96C,GAAA+6C,EAAA/6C,EAAA,gBAAAszC,EAAAntE,EAAA8rF,MAAA9rF,IAAA,GAAA4rC,EAAA/R,EAAA,eAAA+R,EAAA/R,EAAA,aAAA75B,EAAA8rF,SAAA9rF,GAAA6jB,KAAA,WAAA,GAAA7jB,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,QAAA4iB,EAAA75B,EAAA6sF,MAAA,OAAAxtD,GAAAg/B,QAAAr+D,EAAAqtD,gBAAArtD,EAAA81C,QAAA91C,GAAAk0D,EAAA70B,EAAAxb,OAAA+wD,EAAAhsE,EAAA,OAAAy2B,EAAAxb,MAAA,IAAA,IAAA2xD,EAAA5sE,EAAA,QAAA5I,GAAAA,EAAAgsF,QAAA3sD,EAAAuqB,YAAA5pD,EAAAqtD,eAAA,EAAAunB,EAAA50E,EAAAH,MAAA,gBAAA,WAAA+0E,EAAA/6C,EAAA,gBAAAszC,EAAAntE,EAAAkgB,OAAAlgB,IAAA,GAAAotE,EAAAvzC,EAAA,eAAA,GAAA75B,EAAAqvF,OAAA,GAAA,GAAA,GAAA,KAAAjiB,EAAAvzC,EAAA,aAAA75B,EAAAkgB,UAAAlgB,KAAA+rF,KAAA,SAAA/rF,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAApoB,QAAA4iB,EAAAwF,EAAA4hB,MAAAnnB,EAAAuF,EAAA2uD,MAAA,IAAAhuF,EAAA6iD,OAAA7iD,IAAA,GAAAq/B,EAAAhlB,QAAAglB,EAAAyW,SAAAzW,EAAAovD,QAAAzuF,EAAA,GAAAA,GAAAq/B,EAAA38B,QAAA28B,EAAA2sD,QAAAhsF,IAAAq/B,EAAAn+B,MAAA,MAAAm+B,EAAA,IAAAp/B,GAAAo/B,EAAAg4C,MAAAr3E,GAAAk0D,EAAAugB,EAAAx0E,EAAA,OAAA,GAAA8d,EAAAuvD,EAAApZ,EAAA,eAAA5jD,EAAA4jD,EAAAzvD,aAAA,OAAA4E,EAAA3M,SAAAG,cAAA,MAAA,OAAAwM,GAAA7J,IAAAue,EAAA1U,EAAAy2D,IAAAxvD,GAAA,IAAAklE,EAAA5sE,EAAA,QAAAgmF,cAAAvvD,EAAAnhC,OAAA8B,GAAAkB,MAAAlB,EAAAH,MAAAwJ,IAAAg2B,GAAAA,EAAAx/B,MAAAwJ,EAAA+jE,EAAA/tC,EAAAg4C,MAAAh4C,EAAAn+B,OAAA,iBAAA0qC,EAAA3rC,EAAA,iBAAAo/B,EAAA2sD,QAAA,EAAA3sD,EAAAn+B,MAAAlB,EAAAq/B,EAAA1oB,UAAA,KAAAi1B,EAAAviC,EAAA,oBAAAyrE,EAAAh7C,GAAAy6C,EAAAz6C,EAAAzwB,GAAAg2B,EAAA0tD,aAAAjY,EAAAj7C,GAAA+6C,EAAAhsE,EAAA,SAAA,WAAA,GAAA5I,GAAAq/B,EAAA1oB,SAAAi/D,GAAA/7C,EAAAvpB,EAAA,KAAAtQ,EAAA4gF,aAAA,MAAA5gF,EAAA6gF,cAAA,OAAA,GAAAx3E,EAAA4L,SAAAoqB,EAAA8D,QAAAyxC,EAAAvrE,EAAA,OAAA8jE,EAAA9tC,EAAA8D,KAAA9D,IAAA,GAAAA,EAAAlnB,SAAApP,aAAAs2B,EAAAlnB,SAAAknB,EAAAlnB,QAAAzQ,WAAA,WAAA0lE,EAAA/jE,EAAA,oBAAAg2B,EAAAlnB,SAAA,GAAA,MAAAknB,IAAArX,KAAA,WAAA,GAAAhoB,GAAAW,IAAA,OAAAX,GAAA+rF,KAAAtqF,KAAA6I,IAAAtK,EAAAkB,MAAA,EAAA,IAAAlB,GAAA25B,KAAA,WAAA,GAAA35B,GAAAW,IAAA,OAAAX,GAAA+rF,KAAAtqF,KAAAo8C,IAAA79C,EAAAkB,MAAA,EAAAlB,EAAA0C,OAAA,IAAA1C,GAAAszE,KAAA,SAAAtzE,EAAAq/B,GAAA,GAAAz2B,GAAAjI,KAAAm5B,EAAAlxB,EAAA+N,SAAA,OAAA/N,GAAA0mF,OAAAz1D,EAAA75B,GAAAA,EAAA85B,EAAA6O,KAAAka,OAAA7iD,GAAA65B,EAAAwF,GAAAA,EAAAvF,EAAA7F,IAAA4uB,OAAAxjB,IAAAz2B,GAAA0mF,OAAA,SAAAtvF,EAAAq/B,GAAA,GAAAvF,GAAAn5B,KAAAV,EAAA65B,EAAAnjB,SAAA,IAAAkjB,EAAAwF,KAAAA,EAAAr/B,GAAAA,EAAA6iD,OAAA7iD,GAAAq/B,EAAAwjB,OAAAxjB,GAAAvF,EAAAkyD,SAAAlyD,EAAA20D,QAAA30D,EAAAz7B,QAAAgtF,QAAA,CAAA,GAAAn3B,IAAA,CAAAtrD,GAAA5I,KAAAC,EAAA0oC,KAAA3oC,EAAAk0D,GAAA,GAAAtrD,EAAAy2B,KAAAp/B,EAAAg0B,IAAAoL,EAAA60B,GAAA,GAAAA,GAAAp6B,EAAAuzD,cAAA,MAAAvzD,IAAArW,KAAA,SAAAzjB,EAAAq/B,EAAAz2B,GAAA,GAAAixB,GAAAl5B,KAAAm5B,EAAAD,EAAAljB,SAAA,OAAA3W,GAAA6iD,OAAA7iD,GAAAA,EAAAA,EAAA,EAAA,GAAA,EAAAA,GAAA,EAAAA,EAAA65B,EAAAw1D,OAAAv1D,EAAA15B,MAAAJ,EAAA85B,EAAA8mD,aAAAvhD,EAAAz2B,GAAAixB,GAAAw1D,OAAA,SAAArvF,EAAAq/B,EAAAxF,EAAAC,GAAA,GAAA75B,GAAAU,KAAAuzD,EAAAj0D,EAAA5B,QAAA0f,EAAA9d,EAAA8uF,SAAAz+E,EAAArQ,EAAA0W,SAAA,IAAA3W,EAAAyB,KAAA6I,IAAA,EAAAtK,GAAA4I,EAAA5I,IAAAC,EAAA+rF,SAAA/rF,EAAAwuF,SAAA30D,GAAAo6B,EAAAo3B,UAAA,CAAA,IAAAxxD,EAAA,CAAA,GAAAzwB,GAAA5H,KAAA6I,IAAA,IAAA4pD,EAAAy3B,cAAAv2E,EAAA3T,KAAAo8C,IAAA,IAAAqW,EAAA03B,aAAA5rF,GAAAyB,KAAAo8C,IAAAp8C,KAAA6I,IAAAtK,EAAAqJ,GAAA+L,GAAApV,EAAA,KAAAA,EAAA,OAAAA,EAAA,EAAA,IAAAmO,GAAAmC,EAAAswE,aAAA5gF,EAAAuoB,EAAAjY,EAAAuwE,cAAA7gF,CAAA,IAAA65B,EAAA,CAAA,GAAAszC,GAAAuH,EAAAz0E,EAAA4sF,QAAAnhE,EAAA3N,GAAA5W,OAAA2lB,KAAA/O,GAAArb,OAAAyyE,EAAAp3D,IAAA0kB,MAAA5I,EAAA4I,MAAAI,MAAAhJ,EAAAgJ,MAAAvyB,GAAAq4B,OAAAx6B,EAAAmC,EAAAlQ,SAAAsrB,EAAA+W,MAAA0qC,EAAAxkC,KAAAr4B,EAAAq4B,MAAAr4B,EAAAlQ,OAAAkQ,EAAA2jB,MAAA1L,EAAAjY,EAAAjQ,UAAAqrB,EAAAmX,MAAAsqC,EAAAl5C,IAAA3jB,EAAA2jB,KAAA3jB,EAAAjQ,YAAAiQ,GAAAq4B,OAAAx6B,EAAAmC,EAAAlQ,OAAA,EAAAkQ,EAAA2jB,MAAA1L,EAAAjY,EAAAjQ,QAAA,CAAAiQ,GAAAlQ,MAAA+N,EAAAmC,EAAAjQ,OAAAkoB,EAAAjY,EAAAmvE,MAAAz/E,EAAAC,EAAAotF,cAAAhuD,GAAAp/B,EAAAq0D,UAAA,MAAAr0D,IAAA4qF,OAAA,SAAA7qF,GAAA,GAAAq/B,GAAA1+B,IAAA,OAAA0+B,GAAAkwD,UAAAlwD,EAAA1oB,UAAAk0E,QAAA,GAAAhoC,OAAA7iD,IAAAq/B,GAAAkwD,SAAA,SAAAvvF,GAAA,GAAAq/B,GAAA1+B,KAAAk5B,EAAAwF,EAAA1oB,SAAA,OAAA3W,GAAA6iD,OAAA7iD,GAAA4I,EAAA5I,IAAAq/B,EAAA2sD,SAAA3sD,EAAAovD,QAAApvD,EAAAhhC,QAAAktF,YAAA1xD,EAAAgxD,OAAA7qF,EAAAq/B,EAAAguD,eAAAhuD,GAAA8M,MAAA,SAAAnsC,EAAAq/B,GAAA,GAAAvF,GAAAn5B,KAAAV,EAAA65B,EAAAnjB,SAAA,IAAAkjB,EAAAwF,KAAAA,EAAAr/B,GAAAA,EAAA6iD,OAAA7iD,GAAAq/B,EAAAwjB,OAAAxjB,GAAAvF,EAAAkyD,SAAAlyD,EAAA20D,QAAA30D,EAAAz7B,QAAAmtF,SAAA,CAAA,GAAAt3B,IAAA,CAAAtrD,GAAA5I,KAAAC,EAAAm/E,OAAAp/E,EAAAk0D,GAAA,GAAAtrD,EAAAy2B,KAAAp/B,EAAAo/E,OAAAhgD,EAAA60B,GAAA,GAAAA,GAAAp6B,EAAAuzD,cAAA,MAAAvzD,IAAAslD,OAAA,SAAAp/E,GAAA,GAAAq/B,GAAA1+B,IAAA,OAAA0+B,GAAA8M,MAAAnsC,EAAAq/B,EAAA1oB,UAAA0oE,QAAAhgD,GAAAggD,OAAA,SAAAr/E,GAAA,GAAAq/B,GAAA1+B,IAAA,OAAA0+B,GAAA8M,MAAA9M,EAAA1oB,UAAAyoE,OAAAp/E,GAAAq/B,GAAAsvD,KAAA,WAAA,GAAA3uF,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAw7B,EAAA75B,EAAA6uF,OAAA/0D,EAAAqzC,EAAAntE,EAAA8sF,UAAA9sF,GAAAC,KAAAi0D,EAAA,EAAAn2C,EAAA,CAAA,QAAA/d,EAAA81C,SAAA91C,EAAAyuF,OAAAzuF,GAAAq/B,EAAAyjD,YAAA9iF,EAAAwnF,oBAAAxnF,EAAAyuF,QAAA,EAAA7iD,EAAA/R,EAAA,eAAA1rB,EAAAnO,EAAAq3E,MAAA,SAAAr3E,EAAA4I,GAAA,GAAA0H,GAAAmkE,EAAAz0E,EAAA,OAAA,GAAAqJ,EAAA3M,SAAAG,cAAA,MAAAwM,GAAA7J,IAAA8tE,EAAAh9D,EAAA,eAAAjH,EAAAy2D,IAAAxvD,EAAA7L,aAAA,OAAAyvD,GAAA,EAAAtoB,EAAAviC,EAAA,eAAAlH,EAAAkH,EAAA,oBAAAg2B,EAAAuqB,YAAA17C,EAAAlO,EAAA,mBAAA4rC,EAAAviC,EAAA,aAAA0U,EAAAnV,GAAA3I,EAAAgH,KAAAoC,GAAAurE,EAAAvrE,EAAA,OAAAywB,GAAA,GAAAy6C,EAAA16C,EAAAxwB,KAAAT,EAAAy2B,EAAAmO,WAAAnO,EAAAmO,SAAA,GAAA0mB,EAAA,GAAA,QAAAtrD,KAAA5I,EAAAwvF,QAAA9nF,WAAA,WAAA0lE,EAAAntE,EAAA8d,GAAA,aAAA6tB,EAAA3rC,EAAA8d,GAAAA,GAAA,GAAAm2C,EAAAn2C,EAAA,GAAA,aAAAnV,KAAAy2B,EAAAmO,aAAAxtC,IAAAwlB,KAAA,WAAA,GAAAxlB,GAAAW,KAAA0+B,EAAAr/B,EAAA6uF,MAAA,OAAA7uF,GAAAyuF,QAAAzuF,EAAA3B,QAAAykF,YAAA9iF,EAAAyhF,iBAAAzhF,EAAAyuF,QAAA,EAAA1lF,aAAA/I,EAAAwvF,SAAApiB,EAAA/tC,EAAA,eAAAy1C,EAAAz1C,GAAAr/B,GAAAA,GAAA0uF,KAAA,WAAA,GAAA1uF,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAA6sF,OAAAhzD,EAAA75B,EAAAH,MAAAi6B,EAAA95B,EAAAsc,IAAA,QAAAtc,EAAA81C,SAAA91C,EAAAyuF,QAAAzuF,EAAA2sF,SAAAttD,EAAAg/B,OAAAr+D,GAAAA,EAAA2sF,QAAA,EAAA3sF,EAAA+G,OAAA6kC,EAAA5rC,EAAA83B,OAAA,0BAAAuH,EAAAuqB,aAAAwjB,EAAAvzC,EAAA,qBAAAuzC,EAAAtzC,EAAA,sBAAA8R,EAAAhjC,EAAA,gBAAAA,EAAAlE,aAAA,QAAA,IAAAgnB,EAAA9iB,GAAAoiC,OAAA3L,EAAA2L,SAAAhrC,EAAAqsF,gBAAArsF,EAAA4sF,WAAArkE,KAAAvoB,EAAAysF,eAAAzsF,EAAA+sF,aAAA/sF,EAAAitF,UAAA,WAAAjtF,EAAAqtF,YAAA,WAAAhuD,EAAAuqB,YAAAliD,WAAA,WAAAkkC,EAAA/R,EAAA,qBAAA+R,EAAA9R,EAAA,sBAAA,OAAA95B,IAAA0nF,KAAA,WAAA,GAAA1nF,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAA6sF,OAAAhzD,EAAA75B,EAAAH,MAAAi6B,EAAA95B,EAAAsc,IAAA,OAAAtc,GAAA2sF,QAAA3sF,EAAA2sF,QAAA,EAAA3sF,EAAAsf,QAAA8tD,EAAAptE,EAAA83B,OAAA,0BAAAuH,EAAAuqB,aAAAwjB,EAAAvzC,EAAA,qBAAAuzC,EAAAtzC,EAAA,sBAAAszC,EAAAxkE,EAAA,gBAAA8iB,EAAA9iB,GAAAoiC,OAAA3L,EAAAwsD,eAAA7rF,EAAA4sF,WAAArkE,KAAAvoB,EAAA0sF,YAAA1sF,EAAAwsF,eAAAxsF,EAAA+sF,aAAA/sF,EAAAitF,UAAA,WAAAjtF,EAAAqtF,YAAA,WAAAhuD,EAAAuqB,YAAAliD,WAAA,WAAAkkC,EAAA/R,EAAA,qBAAA+R,EAAA9R,EAAA,sBAAA,OAAA95B,GAAAA,GAAAs0D,QAAA,WAAA,GAAAt0D,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAyvF,WAAA51D,EAAA75B,EAAA2W,SAAA,OAAA3W,GAAAgsF,SAAAhsF,EAAAyuF,QAAApvD,EAAAi1B,SAAAshB,EAAAhtE,EAAAnH,KAAAI,MAAA,IAAAg4B,EAAA4lD,OAAA,KAAAz/E,EAAA0vF,WAAA3mF,aAAA/I,EAAA0vF,YAAArwD,EAAAuqB,YAAA5pD,EAAA2vF,QAAAna,EAAA5sE,EAAA,iBAAAgjC,EAAAhjC,EAAA,eAAAgjC,EAAAhjC,EAAA,eAAAgjC,EAAAhjC,EAAA,qBAAA+rE,EAAA/rE,GAAAgjC,EAAAhjC,EAAA,cAAAgjC,EAAAhjC,EAAA,eAAA5I,EAAA0vF,WAAAhoF,WAAA,WAAA23B,EAAAuqB,YAAAgrB,EAAAhsE,EAAA,gBAAA,WAAAwkE,EAAAxkE,EAAA,eAAAwkE,EAAAxkE,EAAA,eAAAwkE,EAAAxkE,EAAA,qBAAA5I,EAAA2vF,QAAA,IAAA,GAAAviB,EAAAxkE,EAAA,aAAA5I,EAAA2vF,QAAA,GAAAviB,EAAAxkE,EAAA,eAAA5I,EAAA0vF,YAAA,GAAA,KAAA1vF,GAAAA,GAAAyiB,OAAA,WAAA,GAAAziB,GAAAW,IAAA,OAAA,KAAAX,EAAA2W,UAAA8oE,MAAAz/E,EAAAqvF,OAAArvF,EAAAotF,iBAAA3N,OAAA,GAAAz/E,EAAAqvF,OAAA,GAAA,GAAArvF,GAAAw4B,MAAA,WAAA,GAAAx4B,GAAAW,IAAA,OAAAX,GAAAgsF,SAAAhsF,EAAAyuF,SAAAzuF,EAAA2W,UAAA4R,KAAAvoB,EAAAotF,kBAAAptF,EAAAqtF,eAAArtF,GAAA09E,OAAA,WAAA,GAAA19E,GAAAW,KAAA0+B,IAAA,IAAAr/B,EAAA4vF,QAAA5vF,EAAAiX,QAAAhR,WAAA,MAAAjG,GAAAwiD,SAAA,IAAAxiD,EAAA0C,OAAA1C,EAAA9B,OAAAwE,OAAA1C,EAAAqa,QAAAlM,EAAAnO,EAAAq3E,MAAA,SAAAzuE,EAAAixB,GAAA,GAAAC,GAAA26C,EAAA7rE,EAAA,OAAA,GAAA3I,EAAAD,EAAA9B,OAAA27B,EAAA55B,GAAAA,EAAAT,MAAAs6B,EAAAt6B,KAAA6/B,EAAAp4B,KAAA4yB,GAAAwF,EAAAp4B,KAAA4yB,KAAAnO,EAAA1rB,EAAAsc,MAAAlc,MAAA,SAAAJ,EAAAusF,WAAAvsF,EAAA81C,SAAA,GAAA91C,EAAA0C,QAAA,GAAA1C,EAAAgsF,OAAA,CAAA,GAAApjF,GAAAS,EAAArJ,EAAAkB,MAAAm+B,EAAAz2B,IAAA,GAAA5I,EAAAgsF,QAAA,EAAAhsF,EAAA+rF,KAAAtqF,KAAA6I,IAAAtK,EAAAkB,OAAA0H,EAAA,GAAA,KAAAgjC,EAAA5rC,EAAAq3E,MAAAr3E,EAAAkB,OAAA,sBAAAlB,GAAAH,MAAA,KAAAG,EAAAgsF,QAAA,EAAAhsF,EAAAkB,MAAA,EAAAlB,EAAA2W,UAAA,KAAAm+D,EAAA90E,EAAAguF,QAAAlZ,EAAA90E,EAAAihD,MAAA,OAAAjhD,IAAAwiD,QAAA,WAAA,GAAAxiD,GAAAW,KAAA0+B,EAAAr/B,EAAAiX,OAAA,OAAAjX,GAAA3B,QAAAggE,OAAAr+D,EAAA6wC,UAAA7wC,EAAA81C,SAAA91C,EAAA6wC,SAAAokC,EAAA51C,EAAA,QAAAr/B,EAAA6vF,UAAA7vF,EAAA8vF,UAAAtiB,EAAAnuC,EAAA,UAAAr/B,IAAA+vF,IAAAhpF,KAAA,WAAA,GAAA/G,GAAAW,KAAAR,IAAAyrC,GAAA5rC,EAAA,eAAAA,EAAAjD,MAAAgzD,aAAApvD,KAAAiuD,eAAA,MAAAtvC,MAAA,WAAA,GAAAtf,GAAAW,KAAAR,IAAAitE,GAAAptE,EAAA,eAAAA,EAAAjD,MAAAgzD,aAAA,GAAA+7B,MAAA,WAAA,GAAA9rF,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,OAAAjX,GAAAqtD,eAAA,EAAArtD,EAAA2sF,QAAA,EAAA3sF,EAAA81C,SAAA,EAAA91C,EAAAosF,SAAApsF,EAAA4wC,OAAAsjB,EAAA70B,EAAAysD,QAAAlX,EAAAhsE,EAAA,QAAAy2B,EAAAysD,OAAA,GAAAtW,EAAA5sE,EAAA,UAAAsX,OAAA,WAAA,GAAAlgB,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,OAAAjX,GAAAqtD,eAAA,EAAArtD,EAAAgsF,QAAA,EAAAhsF,EAAA2sF,QAAA,EAAA3sF,EAAA81C,SAAA,EAAA91C,EAAA6wC,SAAA7wC,EAAAsf,QAAAssB,EAAA5rC,EAAA6sF,OAAA,eAAA7sF,EAAAgtF,YAAAhtF,EAAAwtF,aAAAt5B,EAAA70B,EAAAnf,SAAA00D,EAAAhsE,EAAA,SAAAy2B,EAAAnf,QAAA,GAAAs1D,EAAA5sE,EAAA,WAAA4+E,kBAAA,WAAA,GAAAxnF,GAAAW,KAAA0+B,EAAA3iC,SAAAwD,iBAAAF,EAAA2sF,QAAAjwF,SAAAmrF,mBAAAnrF,SAAAszF,sBAAAtzF,SAAAuzF,yBAAAvzF,SAAAwzF,sBAAA7wD,EAAAmoD,kBAAAnoD,EAAAmoD,oBAAAnoD,EAAA8wD,oBAAA9wD,EAAA8wD,sBAAA9wD,EAAA+wD,qBAAA/wD,EAAA+wD,uBAAA/wD,EAAAgxD,yBAAAhxD,EAAAgxD,wBAAAC,QAAA7I,wBAAAhG,eAAA,WAAA9gF,KAAAgsF,SAAAjwF,SAAA+kF,eAAA/kF,SAAA+kF,iBAAA/kF,SAAA6zF,iBAAA7zF,SAAA6zF,mBAAA7zF,SAAA8zF,oBAAA9zF,SAAA8zF,sBAAA9zF,SAAAglF,sBAAAhlF,SAAAglF,yBAAA5iD,OAAA,SAAA9+B,GAAA,GAAAq/B,GAAA1+B,KAAAiI,EAAAy2B,EAAA0vD,SAAAl1D,EAAAjxB,EAAAzB,OAAA2lB,KAAAlkB,GAAA,IAAAkxB,EAAAD,EAAAkxD,KAAAlxD,EAAAoxD,OAAAhrF,EAAA45B,EAAAmxD,KAAAnxD,EAAAqxD,MAAA,QAAA7rD,EAAAgsB,QAAA,IAAA,OAAAhsB,EAAAi0C,KAAAx5C,EAAA75B,EAAA,MAAA,KAAA,OAAAo/B,EAAA5b,KAAAlN,EAAA3N,IAAA,EAAA5I,EAAA,MAAA,KAAA,SAAAq/B,EAAAgsB,OAAA,WAAA5pD,KAAAC,IAAAo4B,GAAAr4B,KAAAC,IAAAzB,KAAA65B,EAAA,EAAAuF,EAAArX,OAAA8R,MAAAuF,EAAA1F,QAAAxrB,EAAAvF,EAAA,SAAA5I,GAAAA,EAAAirF,OAAAjrF,EAAA+qF,KAAA/qF,EAAAkrF,OAAAlrF,EAAAgrF,QAAAkE,aAAA,WAAA,GAAAlvF,GAAAW,KAAA0+B,EAAAr/B,EAAA2W,UAAA/N,EAAA5I,EAAA4sF,UAAA,OAAA5sF,GAAA0C,OAAA,GAAA28B,EAAAsJ,MAAA,GAAAtJ,EAAApL,KAAA,GAAAoL,EAAAj/B,OAAAwI,EAAAxI,OAAAi/B,EAAAh/B,QAAAuI,EAAAvI,SAAAowF,GAAA,WAAA,QAAAzwF,GAAAA,EAAAq/B,GAAA,IAAA,GAAAz2B,GAAA,EAAAA,EAAAy2B,EAAA38B,OAAAkG,IAAA,CAAA,GAAAixB,GAAAwF,EAAAz2B,EAAAixB,GAAA62D,WAAA72D,EAAA62D,aAAA,EAAA72D,EAAA82D,cAAA,EAAA,SAAA92D,KAAAA,EAAA+2D,UAAA,GAAAzpF,OAAA0pF,eAAA7wF,EAAA65B,EAAAtf,IAAAsf,IAAA,MAAA,UAAAwF,EAAAz2B,EAAAixB,GAAA,MAAAjxB,IAAA5I,EAAAq/B,EAAA5d,UAAA7Y,GAAAixB,GAAA75B,EAAAq/B,EAAAxF,GAAAwF,MAAAyxD,GAAA,SAAAp0F,SAAAG,cAAA,UAAAE,MAAA6sD,WAAAgyB,GAAA,OAAAmV,GAAA,WAAA,QAAA/wF,GAAAq/B,EAAAz2B,GAAAssE,EAAAv0E,KAAAX,EAAA,IAAA65B,GAAAl5B,IAAAk5B,GAAA5iB,QAAAooB,EAAAxF,EAAAx7B,QAAAkqB,KAAA4iE,EAAAlrF,EAAA2I,IAAAA,GAAAixB,EAAA+1D,OAAA,EAAA/1D,EAAAxf,OAAA,EAAAwf,EAAAic,SAAA,EAAAjc,EAAAmyD,QAAA,EAAAnyD,EAAA8yD,QAAA,EAAA9yD,EAAA40D,QAAA,EAAA50D,EAAAi1D,UAAA,EAAAj1D,EAAA21D,SAAA,EAAA31D,EAAA81D,QAAA,EAAA91D,EAAA61D,YAAA,EAAA71D,EAAAwzB,eAAA,EAAAxzB,EAAAwxB,QAAA,EAAAxxB,EAAA96B,QAAA,EAAA86B,EAAA1hB,SAAA,EAAA0hB,EAAA34B,MAAA,EAAA24B,EAAAn3B,OAAA,EAAAm3B,EAAAk1D,YAAAl1D,EAAA3wB,OAAA,MAAAunF,IAAAzwF,IAAAua,IAAA,OAAAhM,MAAA,WAAA,GAAAvO,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,OAAA,KAAAq2D,EAAA1kE,EAAA,UAAA,CAAA49D,EAAA59D,EAAA,SAAA5I,EAAA,IAAA65B,GAAA,QAAAjxB,EAAAi+C,QAAAxlD,cAAAy4B,EAAAD,GAAAjxB,GAAA6rE,EAAA7rE,EAAA,OAAA3I,EAAA65B,EAAAp3B,MAAA,IAAAzC,EAAA,GAAAi0D,EAAA70B,EAAAhlB,QAAAu6D,EAAAhsE,EAAA,QAAAy2B,EAAAhlB,OAAA,GAAAy2E,KAAAzxD,EAAAuqB,YAAA,GAAA5pD,EAAA4vF,MAAA/1D,EAAA75B,EAAA0C,OAAAzC,EAAAD,EAAA69B,MAAA,EAAA79B,EAAA9B,OAAA47B,EAAA95B,EAAAG,KAAAzD,SAAAyD,KAAAH,EAAA4uD,eAAAxwD,OAAAmM,WAAA7N,SAAAyD,KAAAsK,YAAA40B,EAAAg/B,OAAA,CAAA,GAAAtgD,GAAAovD,EAAAntE,EAAA4lB,SAAA5lB,EAAA40E,GAAAhsE,EAAA,QAAA,WAAA5I,EAAA+rF,SAAA,GAAA59E,EAAA2rB,EAAA,SAAA95B,GAAAA,EAAAiV,SAAA8I,IAAA62D,EAAA50E,EAAA,OAAA+d,GAAA,SAAA62D,GAAAhsE,EAAA,QAAA5I,EAAA6vF,QAAA1iB,EAAAntE,EAAA+jB,MAAA/jB,QAAAua,IAAA,WAAAhM,MAAA,WAAA,GAAAvO,GAAAW,IAAAX,GAAA69B,OAAA,EAAA79B,EAAA69B,QAAA79B,EAAA0C,QAAA1C,EAAAovF,WAAA70E,IAAA,QAAAhM,MAAA,WAAA,GAAAvO,GAAAW,KAAA0+B,EAAAr/B,EAAA3B,QAAAuK,EAAA5I,EAAAiX,OAAA,KAAAjX,EAAAqa,MAAA,CAAA,GAAAwf,GAAAjxB,EAAA3C,WAAA6zB,EAAAp9B,SAAAG,cAAA,MAAAi9B,GAAAr8B,UAAA,snCAAA,IAAAwC,GAAA0qF,EAAA7wD,EAAA,oBAAA,GAAAo6B,EAAAy2B,EAAA1qF,EAAA,gBAAA,GAAA8d,EAAA4sE,EAAA1qF,EAAA,kBAAA,GAAAqQ,EAAAq6E,EAAA1qF,EAAA,iBAAA,GAAAoJ,EAAAshF,EAAA1qF,EAAA,iBAAA,EAAA,IAAAD,EAAA+B,OAAA83B,EAAA75B,EAAA6sF,OAAA5sF,EAAAD,EAAAihD,MAAAiT,EAAAl0D,EAAA63E,QAAA95D,EAAA/d,EAAAorF,OAAA96E,EAAAtQ,EAAA83B,OAAAzuB,EAAArJ,EAAAguF,OAAArD,EAAA1qF,EAAA,iBAAA,GAAAD,EAAAktF,OAAAvC,EAAA1qF,EAAA,iBAAA,GAAAD,EAAAyvF,WAAA9E,EAAA1qF,EAAA,kBAAA,GAAAD,EAAA6uF,OAAAlE,EAAA1qF,EAAA,iBAAA,GAAAD,EAAAsc,KAAAquE,EAAA1qF,EAAA,eAAA,GAAA2rC,EAAAsoB,EAAA70B,EAAA4hB,MAAA6pC,EAAAzrD,EAAA4hB,OAAA,eAAArV,EAAA7tB,EAAAshB,EAAAw4C,QAAAiT,EAAAzrD,EAAAw4C,SAAA,eAAAjsC,EAAAt7B,EAAA+uB,EAAA+rD,OAAAN,EAAAzrD,EAAA+rD,QAAA,eAAAjpF,EAAAkH,EAAA,eAAAg2B,EAAAvH,QAAA31B,EAAA4b,EAAA+4D,cAAA,sBAAA,oBAAAz3C,EAAAisD,UAAAnpF,EAAA4b,EAAA/f,iBAAA,qBAAA,oBAAAqhC,EAAAisD,UAAAnpF,EAAA4b,EAAA/f,iBAAA,qBAAA,oBAAAqhC,EAAAmsD,WAAAnsD,EAAAksD,UAAA,CAAA,GAAAn2E,GAAA2I,EAAA/f,iBAAA,sBAAA4tC,GAAAx2B,EAAA,oBAAAm/D,EAAAx2D,EAAA3I,GAAAiqB,EAAAg/B,QAAAzyB,EAAAviC,EAAA,qBAAAqiB,EAAAzrB,GAAA+qC,OAAA3L,EAAAwsD,eAAA,WAAAz9E,EAAAyrB,GAAA32B,UAAAwoB,EAAAmO,GAAA32B,SAAA,aAAA22B,EAAAn8B,aAAAuC,EAAA2I,EAAA8kB,eAAAke,EAAAviC,EAAA,gBAAAuiC,EAAA3rC,EAAA,gBAAA2rC,EAAA3rC,EAAA,eAAA2rC,EAAA3rC,EAAA,eAAAyrB,EAAAzrB,GAAA+qC,OAAA3L,EAAA2L,SAAAtuC,SAAAyD,KAAAyE,YAAA3E,IAAAo/B,EAAAg/B,SAAAr+D,EAAAosF,SAAApsF,EAAA4wC,OAAA5wC,EAAA81C,SAAA,GAAA91C,EAAAqa,OAAA,EAAAm7D,EAAA5sE,EAAA,aAAA2R,IAAA,UAAAhM,MAAA,WAAA,GAAAvO,GAAAW,IAAAX,GAAAqa,QAAAra,EAAAqa,OAAA,EAAAuwE,EAAA5qF,EAAA6sF,cAAAtyE,IAAA,aAAAhM,MAAA,WAAA,MAAAnQ,QAAAurF,OAAA/N,GAAA57E,KAAAua,IAAA,cAAAhM,MAAA,SAAAvO,GAAAuoB,EAAA4iE,EAAAlrF,EAAAD,IAAAA,OAAAA,IAAA,OAAAuoB,GAAAwoE,GAAAtvE,UAAA0qE,IAAA5jE,EAAAwoE,GAAAtvE,UAAAksE,IAAAplE,EAAAwoE,GAAAtvE,UAAA+sE,IAAAjmE,EAAAwoE,GAAAtvE,UAAA0tE,IAAA5mE,EAAAwoE,GAAAtvE,UAAAsuE,IAAA,mBAAA3xF,UAAAw9E,GAAAx9E,OAAAurF,OAAAvrF,OAAAurF,OAAAoH,IAAAA,KCPA,SAAAzzF,EAAAkD,GACA,YACA,IAAAg7C,IACA71C,KAAA,EACAqrF,WAAA,EACAC,UAAA,EACAC,YAAA,GACAnwF,SAAA,GACA8iD,KAAA,QACAstC,QAAA,EACAC,UAAA,OACA5vE,OAAA,SACA+qB,MAAA,IACA8kD,MAAA,EACAC,cAAA,EACA/Z,MAAA,EACAga,mBAAA,EACAhmC,MAAA,IACAimC,UAAA,EACAroB,UAAA,EACAsoB,SAAA,GACAC,SAAA,GACAC,KAAA,EACAC,gBAAA,EACAjY,UAAA,EACAkY,eAAA,IACAC,YAAA,IACAC,UAAA,GACAC,OAAA,EACAnJ,SAAA,EACAoJ,cAAA,EACAC,YAAA,EACAC,qBAAA,SACAC,aAAA,EACAC,YAAA,EACAC,UAAA,EACAC,eAAA,GACAC,cAEAC,cAAA,SAAA1oC,KACA2oC,aAAA,SAAA3oC,KACA4oC,cAAA,SAAA5oC,EAAA6oC,KACAC,aAAA,SAAA9oC,EAAA6oC,KACAE,kBAAA,SAAA/oC,EAAA6oC,KACAG,kBAAA,SAAAhpC,EAAA6oC,KAGAt1F,GAAAoV,GAAAsgF,YAAA,SAAA30F,GACA,GAAA,IAAAsC,KAAA+B,OACA,MAAA/B,KAGA,IAAAA,KAAA+B,OAAA,EAIA,MAHA/B,MAAAJ,KAAA,WACAjD,EAAAqD,MAAAqyF,YAAA30F,KAEAsC,IAGA,IAAAy4D,MACA/lB,EAAA/1C,EAAAke,QAAA,KAAAggC,EAAAn9C,GACA40F,KACAlpC,EAAAppD,IACAy4D,GAAArP,IAAAppD,KAEA,SAAA0yC,EAAAwQ,OACAxQ,EAAAsmC,UAAA,EAEA,IAAAuZ,GAAAnpC,EAAArwB,WACAy5D,EAAA71F,EAAAc,QAAAgC,QACAgzF,EAAA,KACAC,EAAA,KACA3wF,EAAA,EACAwL,EAAA,EACAqE,GAAA,EACA+gF,EAAA,EACA9U,EAAA,GACAoU,EAAA,EACAW,EAAAlgD,EAAAsmC,YAAA,EAAA,SAAA,QACAnC,EAAAnkC,EAAAsmC,YAAA,EAAA,gBAAA,eACA6Z,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAnmD,EAAA,KACAomD,EAAA,gBAAAl3F,UAAAwD,gBACA60D,IA2hCA,OAzhCAA,GAAA8+B,aAAA,WAEA,GADAV,EAAA71F,EAAAc,QAAAgC,QACAizC,EAAAm/C,WAAA9vF,OAAA,CACA,GAAAiD,EAIA,IAHA0tC,EAAA29C,aAAA,IACArrF,EAAA0tC,EAAA1tC,MAEAwtF,EAAA9/C,EAAAm/C,WAAA,GAAAY,WACA,IAAA,GAAAxqF,GAAA,EAAAA,EAAAyqC,EAAAm/C,WAAA9vF,OAAAkG,IACAuqF,EAAA9/C,EAAAm/C,WAAA5pF,GAAAwqF,aACAA,EAAA//C,EAAAm/C,WAAA5pF,GAAAwqF,WACAC,EAAAhgD,EAAAm/C,WAAA5pF,GAIA,IAAA,mBAAAyqF,IAAA,OAAAA,EACA,IAAA,GAAA98E,KAAA88E,GAAAhgD,SACAggD,EAAAhgD,SAAAnqB,eAAA3S,KACA,mBAAA08E,GAAA18E,IAAA,OAAA08E,EAAA18E,KACA08E,EAAA18E,GAAA88B,EAAA98B,IAEA88B,EAAA98B,GAAA88E,EAAAhgD,SAAA98B,GAIA,KAAAjZ,EAAAsd,cAAAq4E,IAAAE,EAAA9/C,EAAAm/C,WAAA,GAAAY,WACA,IAAA,GAAA5sB,KAAAysB,GACAA,EAAA/pE,eAAAs9C,KACAnzB,EAAAmzB,GAAAysB,EAAAzsB,GAIAnzB,GAAA29C,aAAA,GACAwC,EAAA,GAAAE,EAAA,GACA/tF,IAAA0tC,EAAA1tC,OACAitF,EAAAnxF,KAAAI,MAAA2xF,IAAAE,EAAArgD,EAAA69C,aAAA79C,EAAA49C,eAOAl8B,EAAA++B,MAAA,WACAzgD,EAAA29C,aAAA,IACA0C,GAAAJ,GAAAjgD,EAAA1tC,KAAA0tC,EAAA,YAAAA,EAAA69C,cAAA79C,EAAA1tC,OAIAovD,EAAAg/B,SAAA,SAAAC,GACA,GAAAC,GAAAD,KAAA,EAAAxV,EAAA39E,KAAA,WAAA6B,OAAAwwF,EAAAxwF,MACA,IAAA2wC,EAAA29C,aAAA,EACA9iF,EAAA+lF,GAAAP,EAAArgD,EAAA69C,iBACA,CACAhjF,EAAA,CACA,KAAA,GAAAtF,GAAA,EAAAA,EAAAqrF,EAAArrF,IACAsF,GAAAtM,SAAAsxF,EAAA/oE,GAAAvhB,GAAAxI,SAAAizC,EAAA69C,YAGA,MAAAhjF,IAEAkrD,GACA86B,MAAA,WACA,GAAAp4E,GAAA,WAGA,IAAA,GAFA8tC,IAAA,aAAA,gBAAA,mBAAA,cAAA,eAAA,mBACA/lD,EAAAnH,SAAAwD,gBACA0I,EAAA,EAAAA,EAAAghD,EAAAlnD,OAAAkG,IACA,GAAAghD,EAAAhhD,IAAA/E,GAAA9G,MACA,OAAA,EAIA,UAAAs2C,EAAA89C,SAAAr1E,MAKA01E,SAAA,WACAn+C,EAAAm+C,UACAl0F,EAAAZ,UAAA6V,GAAA,oBAAA,SAAAvS,GACA1C,EAAA,UAAA+7B,GAAA,qBACAr5B,EAAAkhC,eACAlhC,EAAAkhC,iBAEAlhC,EAAAsjC,aAAA,EAEA,KAAAtjC,EAAAsiC,QACAynB,EAAAoqC,gBACA,KAAAn0F,EAAAsiC,SACAynB,EAAAqqC,oBAMAjrB,SAAA,WACA91B,EAAA81B,WACApf,EAAA3nD,MAAA,2CAAAixC,EAAAo+C,SAAA,yBAAAp+C,EAAAq+C,SAAA,cACAr+C,EAAA29C,UAKAj8B,EAAAg/B,UAAA,GAAAT,GACA9U,EAAA39E,KAAA,aAAAgjB,OALAnhB,GAAA2wC,EAAA1tC,MACA64E,EAAA39E,KAAA,aAAAgjB,OAOA26D,EAAA39E,KAAA,eAAA0R,GAAA,QAAA,SAAAvS,GAWA,MAVAA,GAAAkhC,eACAlhC,EAAAkhC,iBAEAlhC,EAAAsjC,aAAA,EAEA,WAAAhmC,EAAAqD,MAAAS,KAAA,SACA2oD,EAAAoqC,gBAEApqC,EAAAqqC,iBAEA,MAIAC,aAAA,WACA,GAAAnqC,GAAAvpD,IACA,UAAA0yC,EAAAwQ,OACAxQ,EAAA29C,WAAA,EACA39C,EAAAk+C,mBAAA,GAEAl+C,EAAAg+C,OACAh+C,EAAAk+C,mBAAA,GAEAl+C,EAAA29C,YACA39C,EAAA49C,UAAA,EACA59C,EAAA1tC,KAAA,GAEA0tC,EAAAkkC,OACAlkC,EAAA49C,UAAA,EACA59C,EAAAi/C,UAAA,GAEAj/C,EAAAo/C,cAAA10F,KAAA4C,KAAAopD,GACAgL,EAAA8+B,eACA9pC,EAAAhpD,SAAA,eAAAimC,KAAA,4BAAAqM,EAAAtyC,SAAA,8CACAy9E,EAAAz0B,EAAAhoD,OAAA,mBACAsxC,EAAAs+C,OAAA,GACAnT,EAAAz8E,SAAAhB,SAAA,SAEAsyC,EAAAsmC,UACA6E,EAAAz8E,SAAAhB,SAAA,YACAuyF,EAAAjgD,EAAAw+C,eACArT,EAAAz7E,IAAA,SAAAuwF,EAAA,OAEAA,EAAAvpC,EAAA8O,aAEAq6B,EAAAnyF,SAAA,UACAsyC,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,OACAkR,EAAA++B,QACA/+B,EAAAjyD,MAAA,WACA,GAAAiyD,EAAAg/B,UAAA,GAAAT,EAAA,CAIA,IAAA,GAFAgB,GAAA,EACAC,EAAA,EACA/tB,EAAA,EAAAA,EAAA0sB,EAAAxwF,SACA4xF,GAAA1yF,SAAAmoD,EAAAlpD,KAAA,WAAAspB,GAAAq8C,GAAApmE,SAAAizC,EAAA69C,YACAqD,MACAD,GAAAhB,EAAAjgD,EAAA69C,cAHA1qB,KAOA,GAAAguB,GAAAnhD,EAAA29C,aAAA,EAAAuD,EAAAlhD,EAAA1tC,IAGA,IAAA6uF,EAAAzqC,EAAAlpD,KAAA,eAAA6B,OACA,IAAA,GAAAkG,GAAA,EAAAA,EAAAmhD,EAAAlpD,KAAA,eAAA6B,OAAA8xF,EAAA5rF,IACAsqF,EAAA/oE,GAAAvhB,GAAAxJ,QAGA,IAAAo1F,EAAAzqC,EAAAlpD,KAAA,gBAAA6B,OACA,IAAA,GAAA6T,GAAA28E,EAAAxwF,OAAA,EAAA6T,EAAA28E,EAAAxwF,OAAA,EAAAqnD,EAAAlpD,KAAA,gBAAA6B,OAAA6T,IACAq8E,IACAM,EAAA/oE,GAAA5T,GAAAnX,QAIA,KAAA,GAAAy6B,GAAAkwB,EAAAlpD,KAAA,gBAAA6B,OAAAm3B,EAAA26D,EAAA36D,IACAkwB,EAAAlpD,KAAA,WAAAspB,GAAA0P,GAAA/2B,QAAAhC,YAAA,UAAAC,SAAA,eAAAuC,SAAAymD,GACA6oC,GAEA,KAAA,GAAAlnE,GAAAq+B,EAAAlpD,KAAA,WAAA6B,OAAAqnD,EAAAlpD,KAAA,eAAA6B,OAAAgpB,EAAAq+B,EAAAlpD,KAAA,WAAA6B,OAAA8xF,EAAA9oE,IACAq+B,EAAAlpD,KAAA,WAAAspB,GAAAuB,EAAA,GAAA5oB,QAAAhC,YAAA,UAAAC,SAAA,cAAA8mC,UAAAkiB,EAEAmpC,GAAAnpC,EAAArwB,eAEAw5D,GAAA1iD,SAAA,WACAuZ,EAAAlpD,KAAA,UAAAzB,SACA8qD,EAAAopB,KAAAvpB,EAAA,KAIAgL,EAAAjyD,SAEAiyD,EAAA0/B,IAAA,WACA/xF,EAAAwwF,EAAAxwF,OACA2wC,EAAAs+C,OAAA,GAAAt+C,EAAAsmC,YAAA,IACAnC,EAAA,eAEAnkC,EAAA29C,aAAA,GACAkC,EAAAnwF,IAAAwwF,EAAAG,EAAA,MAEAR,EAAAnwF,IAAAy0E,EAAAnkC,EAAA69C,YAAA,MACAhjF,EAAA6mD,EAAAg/B,UAAA,GACAhqC,EAAAhnD,IAAAwwF,EAAArlF,EAAA,MACAmlC,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,MACAtxC,KAAA,IACAqgF,EAAA7oC,EAAAlpD,KAAA,eAAA6B,SAIAqyD,EAAA2/B,KAAA,WACAxB,EAAAnpC,EAAArwB,WACAh3B,EAAAwwF,EAAAxwF,QAEA/B,KAAAuzF,SACA1V,EAAAz9E,SAAA,YAEAg0D,EAAA2/B,OACA,UAAArhD,EAAAwQ,MACAkR,EAAA++B,QACA/+B,EAAA0/B,MACAphD,EAAAkkC,QAAA,IACAic,EAAAtpC,EAAAspC,aACA7yF,KAAA2yE,KAAAvpB,EAAAypC,IAEAngD,EAAAsmC,YAAA,GACAh5E,KAAAg0F,UAAA5qC,GAAA,KAIAppD,KAAAg0F,UAAA5qC,GAAA,GACAA,EAAAhpD,SAAA,UACAJ,KAAAuzF,UACAhB,EAAA5lD,QAAA,GACA4lD,EAAA/oE,GAAAyoE,GAAAvlD,OAAA,KAGAgG,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,KACAqvC,EAAA/oE,GAAAyoE,GAAA7xF,SAAA,UAEAmyF,EAAAhpE,QAAAnpB,SAAA,WAGAixF,MAAA,WACA,GAAA9nC,GAAAvpD,IAyEA,IAxEAo0D,EAAA6/B,YAAA,WACAjB,GAAAL,GAAAjgD,EAAA0+C,UAAA1+C,EAAA,YAAAA,EAAA6+C,cAAA7+C,EAAA0+C,SACA,IAAAmB,GAAA1U,EAAA39E,KAAA,WACA6B,EAAA87E,EAAA39E,KAAA,WAAA6B,OACAkG,EAAA,EACAisF,EAAA,GACAtsE,EAAA,CACA,KAAA3f,EAAA,EAAAA,EAAAlG,EAAAkG,IAAA,CACA,UAAAyqC,EAAAwQ,OAEAxQ,EAAA29C,UAGAzoE,IAAA3mB,SAAAsxF,EAAA/oE,GAAAvhB,GAAAxI,SAAAizC,EAAA69C,aAAA79C,EAAA49C,UAFA1oE,EAAA3f,IAAA8qF,EAAArgD,EAAA69C,aAAA79C,EAAA49C,WAKA,IAAA/T,GAAAgW,EAAA/oE,GAAAvhB,EAAAyqC,EAAA49C,WAAA7vF,KAAA,aAMA,IAJAyzF,GADAxhD,EAAAw1C,WAAA,EACA,yBAAA0K,EAAA,IAAAI,EAAA,MAAAnc,EAAA,IAAAnkC,EAAA6+C,YAAA,6BAAAhV,EAAA,gBAEA,oBAAAt0E,EAAA,GAAA,YAEA,UAAAyqC,EAAAwQ,MACA,GAAA31C,EAAAolF,EAAAjgD,EAAA69C,YAAA,CACAtoF,GAAA,CACA,IAAAksF,GAAA,CACAzhD,GAAA29C,YACA6D,GAAA,oBAAAjsF,EAAA,GAAA,YACAksF,EAAA,GAEAlsF,EAAAksF,GACAD,EAAA,KACArW,EAAAz8E,SAAAhB,SAAA,YAEAy9E,EAAAz8E,SAAAjB,YAAA,UAEA,QAIA,GAAAi0F,GAAAvW,EAAAz8E,QACAgzF,GAAAl0F,KAAA,YAAAlB,KAAAk1F,GACAxhD,EAAAw1C,WAAA,IACAx1C,EAAAsmC,YAAA,GAEAob,EAAAl0F,KAAA,YAAAkC,IAAA,QAAAswC,EAAAy+C,YAAA,MAEA2B,EAAA7qF,GAAAyqC,EAAA6+C,YAAAyB,GAAA,GACAoB,EAAAl0F,KAAA,YAAAkC,KACAwwF,SAAAE,EAAA,KACAxN,sBAAA5yC,EAAA9G,MAAA,OAEA8G,EAAAsmC,YAAA,GACA6E,EAAAz8E,SAAAgB,IAAA,gBAAAswC,EAAAy+C,YAAAz+C,EAAA4+C,cAAA,MAEA8C,EAAAl0F,KAAA,YAAAkC,IAAAwwF,EAAAE,EAAA,MAEA,IAAAuB,GAAAD,EAAAl0F,KAAA,YAAAA,KAAA,KACAm0F,GAAA9qE,QAAAnpB,SAAA,UACAi0F,EAAAziF,GAAA,QAAA,WAUA,MATA8gC,GAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,KACA+uC,GAAAoC,EAAA9zF,MAAAP,MAAAo0F,EAAAl0F,KAAA,YAAAA,KAAA,aAAAK,QAEA0xF,EAAAoC,EAAA9zF,MAAAP,MAEAopD,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACA3+B,EAAA+qC,cAEA,KAGA5hD,EAAA2+C,MAAA,CACA,GAAAkD,GAAA,MACA7hD,GAAAw1C,UACAqM,EAAA,aAEA1W,EAAAp8E,MAAA,sBAAA8yF,EAAA,UACA,IAAAC,GAAA9hD,EAAA,SAAA,cAAA,YACAmrC,GAAAz8E,SAAAlB,KAAA,YAAAkC,IAAAoyF,EAAA9hD,EAAA4+C,cAAA,MACAl9B,EAAA6/B,cAGAltF,WAAA,WACAqtD,EAAA7rD,QACA,IAEAyrF,UAAA,SAAAS,EAAAC,GACA,GAAA7iF,GAAA,KACA03C,EAAAvpD,IAEA6R,GADA6gC,EAAAkkC,KACA6d,EAAA17D,SAAA,YAAAxP,QAEAkrE,EAAA17D,WAAAxP,OAEA,IAAAorE,GAAA,WACA,GAAAC,GAAA/iF,EAAAwmD,cACAw8B,EAAA,EACAC,EAAAF,CACAF,KACAE,EAAA,EACAC,EAAA,IAAA,EAAAlC,GAEA8B,EAAAryF,KACA1C,OAAAk1F,EAAA,KACAG,iBAAAF,EAAA,MAGAF,KACA9iF,EAAA3R,KAAA,OAAA6B,OACA8P,EAAA3R,KAAA,OAAA,GAAAoU,UACAqgF,IACA9nD,GACA0c,EAAAmnC,QAGA7+E,EAAA3R,KAAA,OAAA0R,GAAA,OAAA,WACA7K,WAAA,WACA4tF,IACA9nD,GACA0c,EAAAmnC,QAEA,OAIA7jD,GACA0c,EAAAmnC,QAIA7+C,OAAA,SAAA4iD,EAAA/1D,GACA1+B,KAAAuzF,SAAA,SAAA7gD,EAAAwQ,MACA26B,EAAAz9E,SAAA,KAEA,IAAA40F,GAAA,CACA,IAAA/C,EAAAv/C,EAAA49C,UAAAvuF,EAAA,CACA0yF,EAAAt0F,YAAA,UACAH,KAAAuzF,SAAA,SAAA7gD,EAAAwQ,MAAAxkB,KAAA,GACA+1D,EAAA9nD,QAAA+F,EAAA9G,OAGAopD,EADAt2D,KAAA,EACAuzD,EAEAA,EAAAv/C,EAAA49C,SAGA,IAAAlzE,GAAA63E,CACAv2D,MAAA,IACAthB,EAAAq3E,EAAA1yF,OACAkzF,EAAA73E,EAAA,EACA43E,EAAA,GAAA53E,IACA43E,EAAAC,IAGAviD,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,OAGA8xC,EADAt2D,KAAA,EACAuzD,EAAA7oC,EAAAlpD,KAAA,eAAA6B,OAEAkwF,EAAAv/C,EAAA49C,UAEA5xD,KAAA,IACAthB,EAAAq3E,EAAA1yF,OACAkzF,EAAA73E,EAAA,EACA43E,EAAA,IAAA53E,EACA43E,EAAAC,EACAD,EAAA,EAAA53E,IACA43E,EAAA,KAKAh1F,KAAAuzF,SAAA,SAAA7gD,EAAAwQ,MAAAxkB,KAAA,GACA+1D,EAAAjrE,GAAAwrE,GAAAtoD,OAAAgG,EAAA9G,OAEA6oD,EAAAjrE,GAAAwrE,GAAA50F,SAAA,cAEAq0F,GAAAt0F,YAAA,UACAs0F,EAAAjrE,GAAAirE,EAAA1yF,OAAA,GAAA3B,SAAA,UACAJ,KAAAuzF,SAAA,SAAA7gD,EAAAwQ,MAAAxkB,KAAA,IACA+1D,EAAA9nD,QAAA+F,EAAA9G,OACA6oD,EAAAjrE,GAAAwrE,GAAAtoD,OAAAgG,EAAA9G,SAIA+mC,KAAA,SAAA8hB,EAAA7sE,GACA8qB,EAAAs+C,OAAA,IACAppE,GAAAA,GAEA5nB,KAAAuzF,QACA7gD,EAAAsmC,YAAA,EACAyb,EAAAryF,KACAqrE,UAAA,qBAAA7lD,EAAA,WACAstE,oBAAA,qBAAAttE,EAAA,aAGA6sE,EAAAryF,KACAqrE,UAAA,gBAAA7lD,EAAA,gBACAstE,oBAAA,gBAAAttE,EAAA,kBAIA8qB,EAAAsmC,YAAA,EACAyb,EAAAryF,IAAA,WAAA,YAAA4pC,SACA1Y,KAAA1L,EAAA,MACA8qB,EAAA9G,MAAA8G,EAAA7xB,QAEA4zE,EAAAryF,IAAA,WAAA,YAAA4pC,SACAhE,MAAApgB,EAAA,MACA8qB,EAAA9G,MAAA8G,EAAA7xB,OAGA,IAAAy7D,GAAAuB,EAAAz8E,SAAAlB,KAAA,YAAAA,KAAA,KACAF,MAAA6xC,OAAAyqC,GAAA,IAEAoY,KAAA,WACA10F,KAAA6xC,OAAA0gD,GAAA,EACA,IAAAjW,GAAAuB,EAAAz8E,SAAAlB,KAAA,YAAAA,KAAA,KACAF,MAAA6xC,OAAAyqC,GAAA,IAEA3xB,MAAA,WACA,GAAApB,GAAAvpD,IACAo0D,GAAA+gC,SAAA,WACA5nF,EAAAolF,IACAE,EAAAtpC,EAAAspC,aACAtpC,EAAA1X,OAAA0gD,GAAA,GACA,EAAAhlF,EAAAolF,EAAAjgD,EAAA69C,YACAsC,EAAAtlF,EAAAolF,EAAAjgD,EAAA69C,YACAsC,EAAA,IACAA,EAAA,GAEAtpC,EAAAopB,KAAAvpB,EAAAypC,GACAngD,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,OACA+uC,GAAAlwF,EAAAqnD,EAAAlpD,KAAA,eAAA6B,OAAA2wC,EAAA49C,WACA/mC,EAAA6rC,WAAAhsC,EAAAlpD,KAAA,eAAA6B,QAEA,IAAAkwF,GACA1oC,EAAA6rC,WAAAvX,EAAA39E,KAAA,WAAA6B,WAKAqyD,EAAA+gC,YAEAC,WAAA,SAAAzlF,GACA,GAAA45C,GAAAvpD,IACA69E,GAAA39E,KAAA,eAAAE,SAAA,YACA2G,WAAA,WACAkrF,EAAAtiF,EACAkuE,EAAAz7E,IAAA,sBAAA,OACAywF,EAAAtpC,EAAAspC,aACAtpC,EAAA1X,OAAA0gD,GAAA,GACA95B,EAAAka,KAAAvpB,EAAAypC,GACA9rF,WAAA,WACA82E,EAAAz7E,IAAA,sBAAAswC,EAAA9G,MAAA,MACAiyC,EAAA39E,KAAA,eAAAC,YAAA,aACA,KACAuyC,EAAA9G,MAAA,MAEAinD,WAAA,WACA,GAAAwC,GAAA,CACA,IAAA3iD,EAAA29C,aAAA,EACAgF,EAAApD,IAAAc,EAAArgD,EAAA69C,aAAA79C,EAAA49C,eACA,CACA+E,EAAA,CACA,KAAA,GAAAptF,GAAA,EAAAA,EAAAgqF,EAAAhqF,IACAotF,GAAAp0F,SAAAsxF,EAAA/oE,GAAAvhB,GAAAxI,SAAAizC,EAAA69C,YAGA,MAAA8E,IAEAf,WAAA,WACA,GAAA/xF,EACA,QAAAmwC,EAAA8+C,sBACA,IAAA,OACAjvF,EAAA,CACA,MACA,KAAA,SACAA,EAAAowF,EAAA,EAAAK,EAAA,CACA,MACA,KAAA,QACAzwF,EAAAowF,EAAAK,EAEA,GAAAgC,GAAA/C,EAAA7oC,EAAAlpD,KAAA,eAAA6B,OACAsyF,EAAAxW,EAAAz8E,SAAAlB,KAAA,WACA,WAAAwyC,EAAAwQ,MAAAxQ,EAAAkkC,QAAA,IACAoe,GAAAX,EAAAt7D,WAAAh3B,OACAizF,EAAA,EACAA,EAAA,IACAA,EAAAX,EAAAt7D,WAAAh3B,QAGA,IAAAuzF,GAAAN,GAAAhC,EAAAtgD,EAAA6+C,aAAA,CACA+D,GAAA3C,EAAAG,IACAwC,EAAAxC,EAAAH,EAAAjgD,EAAA6+C,aAEA+D,EAAA,IACAA,EAAA,GAEAt1F,KAAA2yE,KAAA0hB,EAAAiB,IAEA5E,KAAA,WACAh+C,EAAAg+C,OACA3jD,cAAAF,GACAA,EAAAC,YAAA,WACAsc,EAAAqqC,iBACA/gD,EAAAkY,SAGA+lC,aAAA,WACA,GAAApnC,GAAAvpD,IACA0yC,GAAAg+C,MAAAh+C,EAAAi+C,eACA9S,EAAAjsE,GAAA,aAAA,WACAjV,EAAAqD,MAAAI,SAAA,YACAgpD,EAAAwB,QACAlY,EAAAg+C,MAAA,IAEA7S,EAAAjsE,GAAA,aAAA,WACAjV,EAAAqD,MAAAG,YAAA,YACA09E,EAAA39E,KAAA,gBAAA2vC,SAAA,eACA0Z,EAAAmnC,WAKA6E,UAAA,SAAAC,EAAAC,GAEA,GADA5X,EAAAz7E,IAAA,sBAAA,OACA,UAAAswC,EAAAwQ,KAAA,CACA,GAAA8gC,GAAAwR,EAAAC,EACAC,EAAA7C,EAAA7O,CACA,IAAA,GAAAz2E,EAAAolF,EAAAjgD,EAAA69C,YACA,GAAA79C,EAAAi/C,YAAA,EACA+D,EAAAnoF,EAAAolF,EAAAjgD,EAAA69C,gBACA,CACA,GAAAoF,GAAApoF,EAAAolF,EAAAjgD,EAAA69C,WACAmF,GAAAC,GAAAD,EAAAC,GAAA,MAGAD,GAAA,IACAhjD,EAAAi/C,YAAA,EACA+D,EAAA,EAEAA,GAAA,EAGA11F,MAAA2yE,KAAAvpB,EAAAssC,KAIAE,SAAA,SAAA5R,GAEA,GADAnG,EAAAz7E,IAAA,sBAAAswC,EAAA9G,MAAA,MACA,UAAA8G,EAAAwQ,KAAA,CACA,GAAA2yC,IAAA,EACAC,GAAA,CACAjD,IAAA7O,EACA,EAAAz2E,EAAAolF,EAAAjgD,EAAA69C,aACAsC,EAAAtlF,EAAAolF,EAAAjgD,EAAA69C,YACA79C,EAAA29C,aAAA,IACAwF,GAAA,IAEAhD,EAAA,IACAA,EAAA,EAEA,IAAAkD,GAAA,SAAA/8D,GACA,GAAAg9D,GAAA,CAMA,IALAH,GACA78D,IACAg9D,EAAA,GAGAtjD,EAAA29C,UAUA,IAAA,GADA4F,GAAA,EACAhuF,EAAA,EAAAA,EAAAsqF,EAAAxwF,SACAk0F,GAAAh1F,SAAAsxF,EAAA/oE,GAAAvhB,GAAAxI,SAAAizC,EAAA69C,YACA0B,EAAAhqF,EAAA+tF,IACAC,GAAApD,IAHA5qF,SAVA,CACA,GAAAkhB,GAAA0pE,IAAAE,EAAArgD,EAAA69C,aAAA79C,EAAA49C,UACA2B,GAAAhxF,SAAAkoB,GAAA6sE,EACAnD,GAAAtlF,EAAAolF,EAAAjgD,EAAA69C,aACApnE,EAAA,IAAA,GACA8oE,KAcAjO,IAAAtxC,EAAAk/C,gBACAmE,GAAA,GACAD,GAAA,GACA9R,IAAAtxC,EAAAk/C,iBACAmE,GAAA,GACAD,GAAA,GAEA1sC,EAAAlG,KAAA4yC,GACA91F,KAAAs0F,iBAEAtQ,IAAAtxC,EAAAk/C,eACAxoC,EAAAoqC,gBACAxP,IAAAtxC,EAAAk/C,gBACAxoC,EAAAqqC,iBAOA/B,WAAA,WACA,GAAAnoC,GAAAvpD,IACA,KAAAizF,EAAA,CACA,GAAAwC,GAAA,EACAD,EAAA,EACAU,GAAA,CACArY,GAAA39E,KAAA,gBAAAE,SAAA,UACAy9E,EAAAjsE,GAAA,YAAA,SAAAvS,GACA,QAAAkO,EAAAolF,GACA,IAAAplF,SAIA,WAAA5Q,EAAA0C,EAAAjB,QAAAqC,KAAA,UAAA,WAAA9D,EAAA0C,EAAAjB,QAAAqC,KAAA,WACAg1F,EAAA/iD,EAAAsmC,YAAA,EAAA35E,EAAA6iC,MAAA7iC,EAAAyiC,MACAo0D,GAAA,EACA72F,EAAAkhC,eACAlhC,EAAAkhC,iBAEAlhC,EAAAsjC,aAAA,EAGAk7C,EAAA77C,YAAA,EACA67C,EAAA77C,YAAA,EAEA67C,EAAA39E,KAAA,gBAAAC,YAAA,UAAAC,SAAA,cACA2sC,cAAAF,OAGAlwC,EAAAc,QAAAmU,GAAA,YAAA,SAAAvS,GACA62F,IACAV,EAAA9iD,EAAAsmC,YAAA,EAAA35E,EAAA6iC,MAAA7iC,EAAAyiC,MACAynB,EAAAgsC,UAAAC,EAAAC,MAGA94F,EAAAc,QAAAmU,GAAA,UAAA,SAAAvS,GACA,GAAA62F,EAAA,CACArY,EAAA39E,KAAA,gBAAAC,YAAA,cAAAC,SAAA,UACA81F,GAAA,EACAV,EAAA9iD,EAAAsmC,YAAA,EAAA35E,EAAA6iC,MAAA7iC,EAAAyiC,KACA,IAAAkiD,GAAAwR,EAAAC,CACA30F,MAAAC,IAAAijF,IAAAtxC,EAAAk/C,gBACAj1F,EAAAc,QAAAmU,GAAA,WAAA,SAAAvS,GACAA,EAAAkhC,eACAlhC,EAAAkhC,iBAEAlhC,EAAAsjC,aAAA,EAEAtjC,EAAA6jC,2BACA7jC,EAAA2hC,kBACArkC,EAAAc,QAAA2+B,IAAA,cAIAmtB,EAAAqsC,SAAA5R,QAUAyN,YAAA,WACA,GAAAloC,GAAAvpD,IACA,IAAAizF,EAAA,CACA,GAAAwC,MACAD,IACA3X,GAAAjsE,GAAA,aAAA,SAAAvS,GACAm2F,EAAAn2F,EAAA6hC,cAAAi1D,cAAA,GACAV,EAAA3zD,MAAAziC,EAAA6hC,cAAAi1D,cAAA,GAAAr0D,MACA2zD,EAAAvzD,MAAA7iC,EAAA6hC,cAAAi1D,cAAA,GAAAj0D,MACA6K,cAAAF,KAEAgxC,EAAAjsE,GAAA,YAAA,SAAAvS,GACA,GAAAkO,EAAAolF,GACA,IAAAplF,EACA,OAAA,CAGA,IAAA4U,GAAA9iB,EAAA6hC,aACAs0D,GAAArzE,EAAAg0E,cAAA,EACA,IAAAC,GAAAt1F,KAAAC,IAAAy0F,EAAA1zD,MAAA2zD,EAAA3zD,OACAu0D,EAAAv1F,KAAAC,IAAAy0F,EAAAtzD,MAAAuzD,EAAAvzD,MACAwQ,GAAAsmC,YAAA,GACA,EAAAqd,EAAAD,GACA/2F,EAAAkhC,iBAEAgpB,EAAAgsC,UAAAC,EAAAtzD,MAAAuzD,EAAAvzD,SAEA,EAAAk0D,EAAAC,GACAh3F,EAAAkhC,iBAEAgpB,EAAAgsC,UAAAC,EAAA1zD,MAAA2zD,EAAA3zD,UAIA+7C,EAAAjsE,GAAA,WAAA,WACA,GAAArE,EAAAolF,GACA,IAAAplF,EACA,OAAA,CAGA,IAAAy2E,EAEAA,GADAtxC,EAAAsmC,YAAA,EACAwc,EAAAtzD,MAAAuzD,EAAAvzD,MAEAszD,EAAA1zD,MAAA2zD,EAAA3zD,MAEAynB,EAAAqsC,SAAA5R,OAIAyK,MAAA,WACA,GAAAllC,GAAAvpD,IACAupD,GAAAmqC;AACA1zF,KAAAuzF,UAEA7gD,EAAA++C,eAAA,GACAloC,EAAAkoC,cAEA/+C,EAAAg/C,cAAA,GACAnoC,EAAAmoC,cAIA/0F,EAAAc,QAAAmU,GAAA,QAAA,WACA23C,EAAAmnC,SAGA/zF,EAAAc,QAAAmU,GAAA,OAAA,WACAm7B,cAAAF,KAGA0c,EAAA8nC,QACA9nC,EAAAonC,eACApnC,EAAAif,WACAjf,EAAAsnC,aAGAp4B,EAAAg2B,QACAr6B,EAAA7rD,KAAA,WACA6rD,EAAA8+B,eACAxgD,EAAAsmC,YAAA,GAEA2Z,EADAjgD,EAAA1tC,KAAA,EACA0tC,EAAAw+C,eAEAqB,EAAAl6B,cAEAwlB,EAAAz7E,IAAA,SAAAuwF,EAAA,OAEAA,EAAA9U,EAAA3lB,aAEAxlB,EAAAkkC,QAAA,GAAA,UAAAlkC,EAAAwQ,MACAkR,EAAAjyD,QAEAiyD,EAAA2/B,OACA,UAAArhD,EAAAwQ,MACAkG,EAAAjpD,YAAA,WAEA,UAAAuyC,EAAAwQ,OACAkR,EAAA++B,QACA/+B,EAAA0/B,OAEA/sF,WAAA,WACA,UAAA2rC,EAAAwQ,MACAkG,EAAAhpD,SAAA,YAEA,KACAsyC,EAAA2+C,OACAj9B,EAAA6/B,cAEAvhD,EAAAu+C,kBAAA,GAAAv+C,EAAAsmC,YAAA,GACA5vB,EAAAhnD,IAAA,SAAAmwF,EAAA/oE,GAAAyoE,GAAA55B,aAAA,IAEA3lB,EAAAu+C,kBAAA,IACA,UAAAv+C,EAAAwQ,KACAxQ,EAAAsmC,YAAA,EACAvgB,EAAAu7B,UAAA5qC,GAAA,GAEAqP,EAAAi4B,OAGAj4B,EAAAu7B,UAAA5qC,GAAA,IAGA1W,EAAAw1C,WAAA,GACAzvB,EAAA67B,aAEA,UAAA5hD,EAAAwQ,MACAuV,EAAA9N,QAEAjY,EAAA29C,aAAA,EACAkC,EAAAxwF,QAAA2wC,EAAA1tC,KACA64E,EAAA39E,KAAA,aAAAgjB,OAEA26D,EAAA39E,KAAA,aAAAof,OAGA80C,EAAAg/B,UAAA,GAAAT,GAAA,IAAAplF,EACAswE,EAAA39E,KAAA,aAAAgjB,OAEA26D,EAAA39E,KAAA,aAAAof,QAIA8pC,EAAAoqC,cAAA,WACA,GAAAvB,EAAA,EACAv/C,EAAA0/C,kBAAAh1F,KAAA4C,KAAAopD,EAAA6oC,GACAA,IACA7oC,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACAzvB,EAAA67B,iBAGA,IAAA5hD,EAAAkkC,QAAA,EAAA,CAEA,GADAlkC,EAAA0/C,kBAAAh1F,KAAA4C,KAAAopD,EAAA6oC,GACA,SAAAv/C,EAAAwQ,KAAA,CACA,GAAA9lC,GAAArb,EAAA,CACAkwF,GAAAhxF,SAAAmc,EAAAs1B,EAAA49C,WAEAlnC,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACAzvB,EAAA67B,iBAEA5hD,GAAAk+C,qBAAA,IACAxnC,EAAAhpD,SAAA,WACA2G,WAAA,WACAqiD,EAAAjpD,YAAA,YACA,OAIAipD,EAAAqqC,cAAA,WACA,GAAA6C,IAAA,CACA,IAAA,UAAA5jD,EAAAwQ,KAAA,CACA,GAAAqzC,GAAA99B,EAAAo6B,YACAyD,GAAAC,EAAAhpF,EAAAolF,EAAAjgD,EAAA69C,YAEA0B,EAAAv/C,EAAA49C,UAAAvuF,EAAA2wC,EAAA49C,WAAAgG,GACA5jD,EAAAy/C,kBAAA/0F,KAAA4C,KAAAopD,EAAA6oC,GACAA,IACA7oC,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACAzvB,EAAA67B,cAGA5hD,EAAAkkC,QAAA,GACAlkC,EAAAy/C,kBAAA/0F,KAAA4C,KAAAopD,EAAA6oC,GACAA,EAAA,EACA7oC,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACAzvB,EAAA67B,cAEA5hD,EAAAk+C,qBAAA,IACAxnC,EAAAhpD,SAAA,YACA2G,WAAA,WACAqiD,EAAAjpD,YAAA,aACA,OAIAipD,EAAAlG,KAAA,SAAAszC,GACA9jD,EAAAu+C,kBAAA,GAAAv+C,EAAAsmC,YAAA,GACA5vB,EAAAhnD,IAAA,SAAAmwF,EAAA/oE,GAAAyoE,GAAA55B,aAAA,IAEAzmD,KAAA,IACA,UAAA8gC,EAAAwQ,KACAuV,EAAA86B,UACAnqC,EAAAhpD,SAAA,WACA,KAAAsyC,EAAA9G,OACAiyC,EAAAz7E,IAAA,sBAAAswC,EAAA9G,MAAA,MAEA,KAAA8G,EAAA+9C,WACA5S,EAAAz7E,IAAA,6BAAAswC,EAAA+9C,YAIAh4B,EAAA86B,UACA,KAAA7gD,EAAA9G,OACAwd,EAAAhnD,IAAA,sBAAAswC,EAAA9G,MAAA,MAEA,KAAA8G,EAAA+9C,WACArnC,EAAAhnD,IAAA,6BAAAswC,EAAA+9C,aAKA+F,GACA9jD,EAAAs/C,cAAA50F,KAAA4C,KAAAopD,EAAA6oC,GAEA,UAAAv/C,EAAAwQ,KACAuV,EAAA9N,QAEA8N,EAAAi8B,OAEA7W,EAAAhuC,SAAA,aACA4oB,EAAAi4B,OAEA3pF,WAAA,WACAyvF,GACA9jD,EAAAw/C,aAAA90F,KAAA4C,KAAAopD,EAAA6oC,IAEAv/C,EAAA9G,OACAh6B,GAAA,GAEAw3C,EAAA4kC,KAAA,WACA5kC,EAAAqqC,gBACA/gD,EAAAg+C,MAAA,EACAj4B,EAAAi4B,QAEAtnC,EAAAwB,MAAA,WACAlY,EAAAg+C,MAAA,EACA3jD,cAAAF,IAEAuc,EAAAgL,QAAA,WACAA,EAAA7rD,QAEA6gD,EAAAqtC,qBAAA,WACA,GAAAzB,GAAA/C,CACA,IAAAv/C,EAAAkkC,KAAA,CACA,GAAA0c,GAAAzV,EAAA39E,KAAA,WAAA6B,OACAwyF,EAAAnrC,EAAAlpD,KAAA,eAAA6B,MAEAizF,GADA/C,GAAAsC,EAAA,EACAjB,GAAArB,EAAAsC,GACAtC,GAAAqB,EAAAiB,EACAtC,EAAAqB,EAAAiB,EAEAtC,EAAAsC,EAGA,MAAAS,GAAA,GAEA5rC,EAAAstC,mBAAA,WACA,MAAA7Y,GAAA39E,KAAA,WAAA6B,QAEAqnD,EAAAutC,UAAA,SAAAhnF,GAEAsiF,EADAv/C,EAAAkkC,KACAjnE,EAAAy5C,EAAAlpD,KAAA,eAAA6B,OAAA,EAEA4N,EAEAy5C,EAAAlG,MAAA,GACAxQ,EAAAw1C,WAAA,GACAzvB,EAAA67B,cAGAlrC,EAAAvH,QAAA,WACAuH,EAAAipC,cACAjpC,EAAAoqC,cAAA,aACApqC,EAAAqqC,cAAA,aACArqC,EAAAlG,KAAA,aACAkG,EAAA4kC,KAAA,aACA5kC,EAAAwB,MAAA,aACAxB,EAAAgL,QAAA,aACAhL,EAAAqtC,qBAAA,aACArtC,EAAAstC,mBAAA,aACAttC,EAAAutC,UAAA,aACAvtC,EAAAipC,YAAA,KACAj+B,GACA7rD,KAAA,cAEA6gD,EAAAhoD,SAAAA,SAAAlB,KAAA,uBAAAzB,SACA2qD,EAAAjpD,YAAA,8DAAAguC,WAAA,SAAA+G,SAAAA,SACAkU,EAAArwB,WAAAoV,WAAA,SACAokD,EAAApyF,YAAA,iBACAipD,EAAAlpD,KAAA,UAAAzB,SACA8zF,EAAA,KACA1lD,EAAA,KACAj7B,GAAA,EACAqgF,EAAA,IAIAlrF,WAAA,WACA2rC,EAAAq/C,aAAA30F,KAAA4C,KAAAopD,IACA,IACAzsD,EAAAc,QAAAmU,GAAA,2BAAA,SAAAvS,GACA0H,WAAA,WACA1H,EAAAkhC,eACAlhC,EAAAkhC,iBAEAlhC,EAAAsjC,aAAA,EAEAyxB,EAAA7rD,QACA,OAEAvI,OAEAtD,SCjmCA,SAAA4C,GAAA,YAAA,mBAAA8D,SAAAA,OAAAC,IAAAD,QAAA,UAAA9D,GAAAA,EAAA5C,SAAA,SAAA4C,GAAA,YAAA,SAAAkC,GAAAlC,GAAA,GAAAA,YAAAyU,MAAA,MAAAzU,EAAA,IAAA0zB,OAAA1zB,GAAAwH,MAAA2lE,GAAA,MAAAz5C,QAAA1zB,GAAAwH,MAAA,cAAAxH,EAAA4iD,OAAA5iD,IAAA0zB,OAAA1zB,GAAAwH,MAAA,QAAAxH,EAAA0zB,OAAA1zB,GAAA2D,QAAA,MAAA,MAAA,GAAA8Q,MAAAzU,EAAA,MAAA,IAAA0Y,OAAA,kBAAA1Y,EAAA,uBAAA,QAAAoJ,GAAApJ,GAAA,GAAAkC,GAAAlC,EAAA+oB,WAAAplB,QAAA,yBAAA,OAAA,OAAA,IAAAkE,QAAA3F,GAAA,QAAAgM,GAAAlO,GAAA,MAAA,UAAAkC,GAAA,GAAAgM,GAAAhM,EAAAsF,MAAA,8BAAA,IAAA0G,EAAA,IAAA,GAAAg/D,GAAA,EAAAC,EAAAj/D,EAAAzL,OAAAyqE,EAAAC,IAAAD,EAAA,CAAA,GAAA/+D,GAAAD,EAAAg/D,GAAA1lE,MAAA,kCAAA8O,EAAAlN,EAAA+E,EAAA,IAAAo4D,EAAAp4D,EAAA,IAAA,GAAA2P,EAAA3P,EAAA,IAAA,GAAAsd,EAAA,IAAAtd,GAAAA,EAAA,GAAAxF,EAAAsgB,eAAA9a,KAAAsd,EAAA9iB,EAAAwF,GAAAsd,EAAAm3B,OAAA5iD,EAAAyrB,KAAA,OAAAA,IAAA,MAAA86C,IAAA96C,EAAA1rB,EAAA+d,EAAA2N,IAAA,KAAA86C,GAAA96C,EAAA,KAAAA,EAAA,IAAAA,EAAA1C,YAAA7mB,EAAAA,EAAAyB,QAAA2S,EAAAmV,EAAA1C,aAAA,MAAA7mB,GAAAA,EAAAyB,QAAA,KAAA,MAAA,QAAA5D,GAAAC,EAAAkC,GAAA,GAAAkH,GAAA,IAAA8E,EAAA,EAAA,OAAAlO,KAAAA,EAAAA,EAAA2D,QAAA,aAAA,IAAA6C,MAAA,MAAA,IAAAxG,EAAAyC,OAAA2G,EAAApJ,EAAA,IAAAkO,EAAAlO,EAAA,GAAAoJ,EAAApJ,EAAA,KAAAwB,KAAAC,IAAAS,GAAA,EAAAkH,EAAA8E,EAAA,GAAAg/D,MAAAC,KAAAh/D,GAAAmpF,UAAA,IAAAC,QAAA,EAAA15D,OAAA,EAAAsvC,GAAAnmE,KAAA,WAAAmB,QAAAglE,EAAAnmE,KAAA,wDAAAmB,QAAAglE,EAAAnmE,KAAA,4DAAAmB,QAAAglE,EAAA,GAAAtlE,QAAAslE,EAAAxmE,KAAA,KAAA,IAAAgC,IAAA+hF,EAAA,QAAAj/D,EAAA,SAAAmO,EAAA,cAAA1rB,EAAA,aAAAD,EAAA,QAAA48E,EAAA,eAAA3V,EAAA,QAAAL,EAAA,UAAAc,EAAA,UAAAX,EAAA,YAAAO,EAAA,aAAAjB,EAAA,eAAAH,EAAA,gBAAA79D,EAAA,SAAApU,EAAAkH,EAAA8E,GAAAxN,KAAAq9B,GAAA77B,EAAAxB,KAAAopD,IAAA9pD,EAAAkC,GAAAxB,KAAA6sC,SAAA,KAAA7sC,KAAAo3C,UAAAp3C,KAAAtC,QAAA4B,EAAAub,UAAApN,GAAAzN,KAAA82F,eAAAtqB,EAAAzqE,OAAAyqE,EAAAlmE,KAAAtG,MAAAA,KAAAopD,IAAAnpD,KAAA,qBAAAD,KAAA82F,gBAAAtpF,IAAA,kBAAAA,IAAAxN,KAAAopD,IAAAx3C,GAAA,mBAAApE,GAAAxN,KAAAopD,IAAAx3C,GAAA,mBAAApE,GAAAxN,KAAAopD,IAAAx3C,GAAA,mBAAApE,IAAAxN,KAAAtC,QAAA4B,EAAAub,UAAApN,EAAAD,IAAAxN,KAAA+2F,aAAAruF,GAAA1I,KAAAtC,QAAAy/B,SAAA,GAAAn9B,KAAAojB,QAAA9jB,GAAAub,OAAAjF,EAAAkL,WAAAsC,MAAA,WAAA,OAAApjB,KAAA6sC,UAAAE,cAAA/sC,KAAA6sC,SAAA,IAAAvtC,GAAAU,IAAAA,MAAA+8E,SAAA/8E,KAAA6sC,SAAAC,YAAA,WAAAxtC,EAAAy9E,OAAA3/E,KAAAkC,IAAAU,KAAAtC,QAAAk5F,YAAA/xE,KAAA,WAAAkoB,cAAA/sC,KAAA6sC,UAAA7sC,KAAA6sC,SAAA,KAAA7sC,KAAAwpF,cAAA,WAAA1nE,OAAA,WAAA9hB,KAAA6sC,SAAA7sC,KAAA6kB,OAAA7kB,KAAAojB,SAAAwnC,MAAA,WAAA5qD,KAAA6kB,QAAAmyE,OAAA,WAAAh3F,KAAAojB,SAAA3kB,OAAA,WAAAuB,KAAA6kB,KAAAznB,KAAA4C,MAAAwsE,EAAAxsE,KAAA82F,gBAAA,WAAA92F,MAAAopD,IAAAnpD,OAAAg3F,mBAAAF,aAAA,SAAAz3F,GAAAU,KAAAk3F,UAAA11F,EAAAlC,IAAAy9E,OAAA,WAAA,GAAA,IAAA/8E,KAAAopD,IAAA/vB,QAAA,QAAAt3B,OAAA,WAAA/B,MAAAvB,QAAA,IAAA+C,GAAAkH,EAAA,SAAApJ,EAAA0d,MAAAhd,KAAAq9B,GAAA,UAAA7vB,EAAA,GAAAuG,KAAAvS,GAAAxB,KAAAk3F,UAAAljF,UAAAxG,EAAAwG,UAAAxS,EAAAV,KAAAipE,KAAAvoE,EAAA,KAAAA,GAAAxB,KAAAtC,QAAAm5F,QAAAr1F,EAAA,EAAA,EAAAV,KAAAC,IAAAS,GAAAxB,KAAAm3F,gBAAA31F,GAAAkH,IAAA1I,KAAAm3F,cAAA31F,EAAAxB,KAAAo3F,QAAA5pF,GAAAxN,KAAAk3F,UAAAl3F,KAAAo3C,QAAAigD,QAAAr3F,KAAAm3F,cAAA,GAAAG,QAAAx2F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,IAAA,GAAAI,MAAAz2F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,IAAA,GAAAtrB,KAAA/qE,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,IAAA,EAAAK,WAAA12F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,IAAA,EAAAM,YAAA32F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,GAAA,SAAAO,MAAA52F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,GAAA,GAAAQ,aAAA72F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,GAAA,GAAA,EAAAS,OAAA92F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,GAAA,SAAAhtB,MAAArpE,KAAAC,IAAAf,KAAAk3F,UAAA7yB,cAAA72D,EAAA62D,eAAAwzB,UAAA/2F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,GAAA,IAAAW,WAAAh3F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,GAAA,IAAAY,aAAAj3F,KAAAikE,MAAA/kE,KAAAm3F,cAAA,IAAAa,aAAAh4F,KAAAm3F,eAAAn3F,KAAAtC,QAAAm5F,QAAA,IAAA72F,KAAAm3F,cAAAn3F,KAAAwpF,cAAA,WAAAxpF,KAAA6kB,OAAA7kB,KAAAwpF,cAAA,aAAAA,cAAA,SAAAhoF,GAAA,GAAAkH,GAAApJ,EAAA4gC,MAAA1+B,EAAA,aAAAkH,GAAAwuF,UAAAl3F,KAAAk3F,UAAAxuF,EAAA0uF,QAAAp3F,KAAAo3F,QAAA1uF,EAAA0uC,OAAA93C,EAAAub,UAAA7a,KAAAo3C,QAAA1uC,EAAAuvF,SAAAzqF,EAAAxN,KAAAo3C,QAAAp3C,KAAAopD,IAAAvpB,QAAAn3B,MAAApJ,EAAAyS,GAAAmmF,UAAA,WAAA,GAAA12F,GAAAuoB,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EAAA,OAAAvS,MAAAJ,KAAA,WAAA,GAAA8I,GAAApJ,EAAAU,MAAAC,KAAA,qBAAA,IAAA,SAAAyI,EAAA,CAAA,GAAA8E,GAAAg/D,EAAA9jE,GAAArJ,EAAAmC,EAAA,EAAAoU,GAAAkL,UAAAyH,eAAAlpB,GAAAmO,EAAAnO,GAAAyV,MAAAtH,EAAAhM,EAAArE,MAAA,IAAA,OAAA61B,OAAA3zB,GAAAyH,MAAA,0BAAA0G,EAAAupF,aAAA35F,KAAAoQ,EAAAnO,GAAAmO,EAAA4V,SAAA9jB,EAAAkoB,MAAA,+CAAAvkB,QAAA,QAAA5D,QAAA,IAAAuW,GAAA5V,KAAAwB,EAAA,GAAAA,EAAA,SCrBA7E,EAAA,WACAA,EAAA,QAAAiV,GAAA,kBAAA,SAAA,WACAjV,EAAAqD,MAAA68B,WAAA,cAIAlgC,EAAAZ,UAAA6V,GAAA,QAAA,wBAAA,WACA,GAAAumF,GAAAx7F,EAAAqD,MAAAC,KAAA,KAEAtD,GAAA,qCAAA6lC,KAAA,0CAAA21D,EAAA,SAAApxE,EAAA+rB,EAAA1uC,GAGAzH,EAAA,yBAAAgzD,MAAA,cCZAhzD,EAAA,WAEAA,EAAA,kBAAA01F,aACArtF,KAAA,EACA4xE,MAAA,EACA6a,aAAA,EACAC,YAAA,EACAC,UAAA,EACAC,eAAA,GACAtB,UAAA,EACAC,YAAA,EACAnwF,SAAA,uBACA0wF,SAAA,sCACAC,SAAA,uCACAlwE,OAAA,iCACA+qB,MAAA,IACA48B,UAAA,EACA6oB,OAAA,EACAQ,aAEAY,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,KAIAmC,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,KAIAmC,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,KAIAmC,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,SzB5CA3zF,EAAAc,QAAA+kC,KAAA,WACA7lC,EAAA,UAAAoF,QAAA,mBAAAq2F,SACAA,OAAA,WAGA,QAAAv1D,GAAAiQ,GACA,WAAAA,IACAn2C,EAAA,wCAAAyD,SAAA,UACAzD,EAAA,0CAAAwD,YAAA,WALAi4F,OAAAC,SAAAC,YAAAz1D,OAYAlmC,EAAA,WAqaA,QAAA47F,KACA,GAAA57F,EAAAc,QAAAgC,QAAA,IAAA,CACA9C,EAAAqD,MAAAoiC,YAAA,IACAzlC,EAAA,WAAAyD,SAAA,SAEAzD,EAAA,WAAAwD,YAAA,QAGA,IAAAq4F,GAAA77F,EAAAqD,MAAAoiC,WACAo2D,GAAAC,GAAA97F,EAAAqD,MAAAoiC,YAAA,KAEAzlC,EAAA,WAAAyD,SAAA,YACAzD,EAAA,wBAAAyD,SAAA,YACAzD,EAAA,iBAAAwD,YAAA,cAGAxD,EAAA,WAAAwD,YAAA,YACAxD,EAAA,wBAAAwD,YAAA,YACAxD,EAAA,iBAAAyD,SAAA,aAEAq4F,EAAAD,GA0HA,QAAAE,KACA,GAAA54F,GAAAnD,EAAAmD,OAAA,UACAA,IAAAA,EAAAiC,OAAA,EACApF,EAAA,uBAAAyD,SAAA,OAAAD,YAAA,OAEAxD,EAAA,uBAAAwD,YAAA,OAAAC,SAAA,OAsRA,QAAAu4F,GAAAC,GACAA,EAAAt5E,OAGA,QAAAu5E,GAAAD,GACAA,EAAA11E,OAoJA,QAAA41E,GAAA3zC,GACAxoD,EAAA,eAAAqC,KAAArC,EAAA,IAAAwoD,GAAAllD,KAAA,UACAtD,EAAA,gBAAAqC,KAAArC,EAAA,IAAAwoD,GAAAllD,KAAA,cACAtD,EAAA,iBAAAwE,KAAAxE,EAAA,IAAAwoD,GAAAllD,KAAA,gBAz+BAqD,gBAEA3G,EAAA,gBAAAiV,GAAA,QAAA,WAAA,SAAAvS,GACA,GAAA05F,GAAAt7F,OAAAsF,SAAA4R,KAEAqkF,EAAAr8F,EAAA0C,EAAAjB,QAAAo7B,QAAA,UAEAy/D,EAAAD,EAAA/4F,KAAA,aACAi5F,EAAAF,EAAA94F,KAAA,QAAAO,KAAA,QAEA,IAAAs4F,EAAAh5F,QAAA,KAAA,EAAA,CACA,GAAAo5F,GAAAx8F,EAAA,WAAAkE,MACAwyC,EAAA12C,EAAA,cAAAkE,MACAgrE,EAAAlvE,EAAA,SAAAkE,MACA47C,EAAA9/C,EAAA,SAAAkE,MACAu4F,EAAAz8F,EAAA,WAAAkE,MACAk4B,EAAAp8B,EAAA,SAAAkE,MAEAw4F,EAAA18F,EAAA,qBACA28F,EAAA,EACAD,GAAAz5F,KAAA,SAAAW,EAAA+V,GACA,GAAAijF,GAAAh5F,GAAA84F,EAAAt3F,OAAA,CACAu3F,IAAA38F,EAAAqD,MAAAa,MACA04F,IACAD,GAAA,OAIAP,GAAA,WAAAI,EAAA,cAAA9lD,EAAA,SAAAw4B,EAAA,SAAApvB,EAAA,WAAA28C,EAAA,SAAArgE,EAAA,UAAAugE,EAGA38F,EAAA,0BAAAwE,KAAA+3F,GAEAv8F,EAAA,sCAAAkE,IAAAk4F,GACAp8F,EAAA,qCAAAkE,IAAAo4F,GAEAt8F,EAAA,uBAAAgzD,UAIAhzD,EAAA,iBAAAoF,QACApF,EAAA,iBAAAiD,KAAA,WACA,GAAAssF,GAAA,GAAAlD,QAAAhpF,MAEA+F,IAAA,gBACA0kF,OAAA,EACAvT,QAAA,EACA0T,UAAA,EACAC,SAAA,EACAH,QAAA,EACApqC,MAAA,GAEA3jD,GAAAZ,UAAA6V,GAAA,QAAA,iBAAA,SAAAvS,GACA,MAAA1C,GAAA0C,EAAAjB,QAAAs6B,GAAA,WACAr5B,GAAAkhC,qBAGA2rD,GAAAhpE,WAKAvmB,EAAA,mBAAAoF,QACApF,EAAA,mBAAAiD,KAAA,WACA,GAAAssF,GAAA,GAAAlD,QAAAhpF,MAEA+F,IAAA,gBACA0kF,OAAA,EACAvT,QAAA,EACA0T,UAAA,EACAC,SAAA,EACAH,QAAA,EACAC,SAAA,EACArqC,MAAA,GAGA3jD,GAAAZ,UAAA6V,GAAA,QAAA,iBAAA,SAAAvS,GACA,MAAA1C,GAAA0C,EAAAjB,QAAAs6B,GAAA,WACAr5B,GAAAkhC,qBAGA2rD,GAAAhpE,SAGAvmB,EAAA,QAAAiV,GAAA,aAAA,iBAAA,WACAs6E,EAAA7kE,SAEA1qB,EAAA,QAAAiV,GAAA,YAAA,iBAAA,WACAs6E,EAAAlzD,SAGAr8B,EAAAqD,MAAA4R,GAAA,QAAA,SAAAvS,GACA1C,EAAA,qBAAA6F,OAAA,0NAGA7F,EAAAZ,UAAA6V,GAAA,QAAA,uBAAA,SAAAvS,GACAA,EAAAkhC,iBACA2rD,EAAA7kE,SAGA1qB,EAAAZ,UAAA6V,GAAA,QAAA,uBAAA,SAAAvS,GACAA,EAAAkhC,iBACA2rD,EAAAlzD,WAQAr8B,EAAAZ,UAAA6V,GAAA,QAAA,SAAAvS,GACA,IAAA1C,EAAA0C,EAAAjB,QAAAi7B,QAAA,eAAAt3B,SACApF,EAAA,eAAAwD,YAAA,QACAxD,EAAA,sBAAAyD,SAAA,UACAzD,EAAA,6BAAAwD,YAAA,aAKAxD,EAAA,yBAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,iBACA5jC,EAAA,eAAAwD,YAAA,QACAxD,EAAA,sBAAAyD,SAAA,UACAzD,EAAA,6BAAAwD,YAAA,YAIAxD,EAAA,uBAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,iBACA5jC,EAAA,eAAAyD,SAAA,UACAzD,EAAAmD,OAAA,kBAAA,GAAAksE,KAAA,QAIArvE,EAAA,+BAAAiV,GAAA,QAAA,SAAAvS,GAEA1C,EAAAqD,MAAA6vC,SAAA,WACAlzC,EAAAqD,MAAA6vC,SAAA,UAAAlzC,EAAA,eAAAwD,YAAA,QAAAxD,EAAA,eAAAyD,SAAA,WAIAzD,EAAA,0BAAAiV,GAAA,QAAA,SAAAvS,GACA1C,EAAA,sBAAA2b,IAAA,0BAAAlY,SAAA,UACAzD,EAAA,iBAAA2b,IAAAtY,MAAAG,YAAA,UAEAxD,EAAA,0BAAA+yC,YAAA,UACA/yC,EAAAqD,MAAA0vC,YAAA,YAGA/yC,EAAA,uBAAAiV,GAAA,QAAA,SAAAvS,GACA1C,EAAA,sBAAA2b,IAAA,2BAAAlY,SAAA,UACAzD,EAAA,iBAAA2b,IAAAtY,MAAAG,YAAA,UAEAxD,EAAA,2BAAA+yC,YAAA,UACA/yC,EAAAqD,MAAA0vC,YAAA,YAGA/yC,EAAA,uBAAAiV,GAAA,QAAA,SAAAvS,GACA1C,EAAA,sBAAA2b,IAAA,2BAAAlY,SAAA,UACAzD,EAAA,iBAAA2b,IAAAtY,MAAAG,YAAA,UAEAxD,EAAA,2BAAA+yC,YAAA,UACA/yC,EAAAqD,MAAA0vC,YAAA,YAGA/yC,EAAA,uBAAAiV,GAAA,QAAA,SAAAvS,GACA1C,EAAA,sBAAA2b,IAAA,2BAAAlY,SAAA,UACAzD,EAAA,iBAAA2b,IAAAtY,MAAAG,YAAA,UAEAxD,EAAA,2BAAA+yC,YAAA,UACA/yC,EAAAqD,MAAA0vC,YAAA,YAGA/yC,EAAA,uCAAAoF,QACApF,EAAA,uCAAAyE,OAAA,UAAAsuC,YAAA,UAIA/yC,EAAA,oBAAAiD,KAAA,WACA,GAAA2pD,GAAA5sD,EAAAqD,MAAAk3F,EAAAv6F,EAAAqD,MAAAC,KAAA,YACAspD,GAAA2uC,UAAAhB,EAAA,SAAAz9E,GACA8vC,EAAAvqD,KAAAya,EAAAw+E,SAAA,4HAKAt7F,EAAA,qFAAAg3D,SACA9zB,QAAA,QACArD,UAAA,SAIA7/B,EAAA,yBAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,gBAEA,IAAAgpB,GAAA5sD,EAAAqD,KACAupD,GAAA1vB,WAAA15B,YAAA,YACAopD,EAAAnpD,SAAA,WAEA,IAAAZ,GAAA7C,EAAA,QACA6/B,EAAA7/B,EAAA,qCACA6/B,GAAAqT,SAAA,SACArT,EAAAp8B,SAAA,QAEAZ,EAAAqwC,SAAA,iBACArwC,EAAAY,SAAA,gBAGAzD,EAAA,qBAAA6sB,GAAA,GAAAtG,OACAvmB,EAAA,qBAAA6sB,GAAA,GAAAlK,SAIA3iB,EAAA,8BAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,gBAEA,IAAAgpB,GAAA5sD,EAAAqD,KACAupD,GAAAnoD,SAAAjB,YAAA,QACAxD,EAAA,QAAAwD,YAAA,kBAGAxD,EAAA,yCAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,gBAEA,IAAAgpB,GAAA5sD,EAAAqD,MACA6pD,EAAAN,EAAAnoD,QAEAyoD,GAAAna,YAAA,YAEA,IAAA8pD,GAAAjwC,EAAAtpD,KAAA,cACAw5F,EAAAlwC,EAAAtpD,KAAA,aAEA4pD,GAAAha,SAAA,aACA0Z,EAAA9oD,KAAA,QAAAg5F,GAAA9lC,QAAA,YAAAA,QAAA,QAGApK,EAAA9oD,KAAA,QAAA+4F,GAAA7lC,QAAA,YAAAA,QAAA,UAKAh3D,EAAA,gBAAAuvD,WAEAvvD,EAAA,SAAAiV,GAAA,aAAA,YAAA,WACAjV,EAAAqD,MAAAksD,SAAA,UAEAvvD,EAAA,SAAAiV,GAAA,YAAA,YAAA,WACAjV,EAAAqD,MAAAksD,SAAA,UAGAvvD,EAAA,kBAAAshC,MAAA,SAAA5+B,GACA1C,EAAA,WAAAkzC,SAAA,UACAxwC,EAAAkhC,iBACA5jC,EAAA,WAAAyD,SAAA,QACAzD,EAAA,QAAAyD,SAAA,gBAGAzD,EAAA,gBAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAjB,SAAAzB,EAAA,YAAAA,EAAA,WAAAuD,KAAAb,EAAAjB,QAAA2D,SACApF,EAAA,WAAAwD,YAAA,QACAxD,EAAA,QAAAwD,YAAA,oBAQAxD,EAAA,8BAAAshC,MAAA,WACAthC,EAAA,iCAAAyD,SAAA,aACAzD,EAAAqD,MAAAG,YAAA,eAIAxD,EAAA,SAAAshC,MAAA,WACA,GAAAy7D,GAAA/8F,EAAAqD,MAAAC,KAAA,MACA,KAAAy5F,GACAj8F,OAAA2I,KAAAszF,EAAA,GAAA,8IAIA3yF,WAAA,WACApK,EAAA,iBAAAu5D,OACA9e,QACA9jB,IAAA,WACA,GAAAqmE,KAkBA,OAhBAh9F,GAAA,cAAAoF,SAEA43F,EADAh9F,EAAA,gBAAAoF,OACApF,EAAA,gBAAA+C,SAAA/C,EAAA,WAAA+C,SAAA/C,EAAA,iBAAA+C,SAEA/C,EAAA,gBAAA+C,SAAA/C,EAAA,WAAA+C,SAAA/C,EAAA,iBAAA+C,UAIA/C,EAAA,gBAAAoF,QAAApF,EAAA,uBAAAoF,SACA43F,EAAAh9F,EAAA,uBAAA+C,SAAA/C,EAAA,WAAA+C,UAGA/C,EAAA,sBAAAoF,QAAApF,EAAA,gBAAAoF,SACA43F,EAAAh9F,EAAA,iBAAA+C,SAAA/C,EAAA,WAAA+C,UAGA,MAIA/C,EAAAZ,UAAAqmC,YAAAzlC,EAAA,eAAA+C,SACA/C,EAAA,YAAAyD,SAAA,UAEAzD,EAAA,YAAAwD,YAAA,SAGA,IAAAy5F,GAAAx6F,WAAAK,MACAo6F,EAAAl9F,EAAA,iBAAAuD,KAAA,2BAGAvD,EAAA,iBAAA+7B,GAAA,WAAA/7B,EAAA,QAAAkzC,SAAA,YACAgqD,EAAAjoF,GAAA,kBAAA,WACAioF,EAAA55F,KAAA,cAAAvC,QAAAsyD,UAAA,QAGA6pC,EAAAjoF,GAAA,mBAAA,WACAjV,EAAAqD,MAAAg5B,KAAA,YAAA52B,IAAA,MAAA,SAAAA,IAAA,SAAA,cAIAw3F,EAAA,MACAC,EAAAjoF,GAAA,kBAAA,WACAioF,EAAA55F,KAAA,cAAAvC,QAAAsyD,UAAA,WAGA6pC,EAAAjoF,GAAA,mBAAA,WACAjV,EAAAqD,MAAAg5B,KAAA,YAAA52B,IAAA,MAAA,QAAAA,IAAA,SAAA,cAMAzF,EAAA,uBAAAiV,GAAA,QAAA,WACAioF,EAAAjoF,GAAA,kBAAA,WACAioF,EAAA55F,KAAA,cAAAvC,QAAAsyD,UAAA,QAIA6pC,EAAA7gE,KAAA,eAAAN,GAAA,aACAmhE,EAAAlmC,QAAA,UAIAh3D,EAAA,iBAAAiV,GAAA,uBAAA,WAGAioF,EAAAjoF,GAAA,kBAAA,WACAioF,EAAA55F,KAAA,cAAAvC,QAAAsyD,UAAA,QAGA6pC,EAAAjoF,GAAA,mBAAA,WACAjV,EAAAqD,MAAAg5B,KAAA,YAAA52B,IAAA,MAAA,WAIAy3F,EAAA7gE,KAAA,eAAAN,GAAA,aACAmhE,EAAAlmC,QAAA,UAIAh3D,EAAA,iBAAAiV,GAAA,iBAAA,WAGAioF,EAAAjoF,GAAA,kBAAA,WACAioF,EAAA55F,KAAA,cAAAvC,QAAAsyD,UAAA,WAGA6pC,EAAAjoF,GAAA,mBAAA,WACAjV,EAAAqD,MAAAg5B,KAAA,YAAA52B,IAAA,MAAA,UAIAy3F,EAAA7gE,KAAA,eAAAN,GAAA,aACAmhE,EAAAlmC,QAAA,UAKAh3D,EAAAZ,UAAA6V,GAAA,QAAA,cAAA,WACAjV,EAAAqD,MAAA2zD,QAAA,WAGA,KAEAh3D,EAAAc,QAAAgC,SAAA,KACAsH,WAAA,WACA,GAAA+yF,GAAAn9F,EAAA,+BAAA4sB,OAEA,IAAA5sB,EAAA,8BAAA+7B,GAAA,YAAA,CACA,GAAAqhE,GAAAp9F,EAAA,8BAAA07D,aACAyhC,GAAA13F,IAAA,aAAA23F,EAAA,UAEAD,GAAA13F,IAAA,aAAA,GAGAzF,GAAA,wCAAAiV,GAAA,SAAA,WACA,GAAAjV,EAAA,8BAAA+7B,GAAA,YAAA,CACA,GAAAqhE,GAAAp9F,EAAA,8BAAA07D,aACAyhC,GAAA13F,IAAA,aAAA23F,EAAA,UAEAD,GAAA13F,IAAA,aAAA,MAKAzF,EAAA,2CAAAiV,GAAA,QAAA,WACAkoF,EAAA13F,IAAA,aAAA,OAGA,IAGA,IAAAq2F,GAAA,CAiMA,IAxKA97F,EAAA,oCAAAiV,GAAA,QAAA,uBAAA,WACAjV,EAAAqD,MAAAI,SAAA,QACAzD,EAAA,iBAAAyD,SAAA,UAGAzD,EAAAc,QAAAs1D,OAAA,SAAAt5C,GACA8+E,IACA57F,EAAAZ,UAAAqmC,YAAAzlC,EAAA,eAAA+C,SACA/C,EAAA,YAAAyD,SAAA,UAEAzD,EAAA,YAAAwD,YAAA,YAGAo4F,IAEA57F,EAAA,eAAAiV,GAAA,SAAA,iCAAA,WACA,GAAAooF,GAAAr9F,EAAAqD,MAAAS,KAAA,MACAmB,EAAAjF,EAAA,aAAAq9F,EAAA,KAAAh7F,MACArC,GAAA,eAAAqC,KAAA4C,EAEA,IAAAq4F,GAAAt9F,EAAAqD,MAAAS,KAAA,MAAA2M,UAAA,EAAAzQ,EAAAqD,MAAAS,KAAA,MAAAsB,OACAm4F,UAAAv9F,EAAA,SAAAs9F,GAAAp5F,QAGAlE,EAAA,eAAAiV,GAAA,QAAA,4BAAA,WACA,GAAA3M,GAAAtI,EAAAqD,MAAAq5B,QAAA,UAAA54B,KAAA,MACA05F,EAAAx9F,EAAAqD,MAAAS,KAAA,MAAAwC,QAAAgC,EAAA,IAAAhC,QAAA,SAAA,IAAAA,QAAA,IAAA,GAEAtG,GAAA,cAAAsI,GAAAjG,KAAArC,EAAA,cAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OAEA,IAAAlE,EAAA,eAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,mBAAAsI,GAAA9E,YAAA,UACAxD,EAAA,mBAAAsI,GAAAjG,KAAArC,EAAA,eAAAsI,GAAApE,QAEAlE,EAAA,mBAAAsI,GAAA7E,SAAA,UAIAzD,EAAA,mBAAAw9F,EAAA,IAAAl1F,EAAA,UAAAlD,SACApF,EAAA,IAAAsI,EAAA,eAAA9E,YAAA,QACA,KAAAxD,EAAA,mBAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,IAAAsI,EAAA,eAAA7E,SAAA,SAIA,IAAAzD,EAAA,gBAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,cAAAsI,GAAAo0B,QAAA,OAAAn5B,KAAA,WAAAC,YAAA,UACAxD,EAAA,cAAAsI,GAAAo0B,QAAA,OAAAn5B,KAAA,WAAAlB,KAAArC,EAAA,gBAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,cAAAsI,GAAA4qC,SAAA,UACAlzC,EAAA,cAAAsI,GAAA7E,SAAA,WAIAzD,EAAA,cAAAsI,GAAAo0B,QAAA,QAAAn5B,KAAA,WAAAE,SAAA,UACAzD,EAAA,cAAAsI,GAAA9E,YAAA,UAGA,IAAAxD,EAAA,cAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,cAAAsI,GAAAo0B,QAAA,OAAAn5B,KAAA,SAAAC,YAAA,UACAxD,EAAA,cAAAsI,GAAAo0B,QAAA,OAAAn5B,KAAA,SAAAlB,KAAArC,EAAA,cAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,MAAA,SAEAlE,EAAA,cAAAsI,GAAAo0B,QAAA,QAAAn5B,KAAA,SAAAE,SAAA,UAGAzD,EAAA,aAAAsI,GAAAjG,KAAArC,EAAA,aAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,oBAAAsI,GAAAjG,KAAArC,EAAA,oBAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,kBAAAsI,GAAAjG,KAAArC,EAAA,kBAAAw9F,EAAA,IAAAl1F,EAAA,UAAApE,OACAlE,EAAA,mBAAAsI,GAAAhF,KAAA,OAAA,kBAAAk6F,EAAA,IAAAl1F,GAEAtI,EAAA,yBAAAsI,GAAA/E,KAAA,qBAAAzB,SACA9B,EAAA,yBAAAsI,GAAA/E,KAAA,oBAAAC,YAAA,UAGAxD,EAAA,eAAAiV,GAAA,QAAA,kBAAA,WACA,GAAA,IAAAsoF,SAAA,CACA,GAAAD,GAAAt9F,EAAA,sDAAA8D,KAAA,MAAA2M,UAAA,EAAAzQ,EAAA,sDAAA8D,KAAA,MAAAsB,OACAm4F,UAAAv9F,EAAA,SAAAs9F,GAAAp5F,MACAu5F,OAAAF,aAEAE,QAAAF,QAGAG,eAAA58F,OAAA68F,OAAA76F,MACA86F,aAAA98F,OAAA68F,OAAA56F,OACA86F,SAAA,GACAC,KAAA,GAEAC,OAAAz5F,SAAA,GAAAo5F,eACAM,MAAA15F,SAAA,GAAAs5F,cAAA,IAEAG,OAAA,OACAA,OAAA,KACAF,UAAAH,cAAA,MAAA,GAEAK,OAAA,MAAAA,OAAA,KACAC,MAAA,MAAAA,MAAA,KAEAJ,aAAA,MAAAE,KAAA,IACAG,KAAAn9F,OAAA2I,KAAAg0F,OAAA,OAAA,SAAAM,OAAA,WAAAC,MAAA,SAAAH,SAAA,QAAAC,KAAA,0DAEAG,KAAAhkE,UAGAj6B,EAAA,iBAAAiV,GAAA,QAAA,kCAAA,SAAAvS,GACA,GAAAw7F,GAAAl+F,EAAAqD,KACA,IAAAH,QAAAg7F,EAAAp6F,KAAA,SAAA,IAAAo6F,EAAAp6F,KAAA,QAAA,CACApB,EAAAkhC,gBACA,IAAA1+B,GAAAlF,EAAA,qCAAAsD,KAAA,UACAxC,QAAA2I,KAAAvE,EAAA,SAAA+0B,WAIAj6B,EAAA,iBAAAiV,GAAA,QAAA,IAAA,SAAAvS,GACAA,EAAAkhC,gBACA,IAAAu6D,GAAAn+F,EAAAqD,MAAAS,KAAA,OACAhD,QAAA2I,KAAA00F,EAAA,SAAA,oFAAAlkE,UAYA8hE,IAEA/7F,EAAAZ,UAAA6V,GAAA,QAAA,+DAAA,SAAAvS,GAEA,GAAA07F,GAAAp+F,EAAAqD,MAAAq5B,QAAA,UACA2hE,EAAAD,EAAA76F,KAAA,qBAEA+6F,EAAAD,EAAA96F,KAAA,kBACA+4F,EAAA8B,EAAA96F,KAAA,aAEAi7F,EAAAD,EAAAh7F,KAAA,SACAk7F,EAAAF,EAAAh7F,KAAA,YAEAm7F,EAAAz+F,EAAAmD,OAAA,UACAk7F,GAAA96F,KAAA,aAAAwvC,YAAA,OAAAA,YAAA,OAEA0rD,EAOAA,EAAAr7F,QAAAk5F,IAAA,GACAmC,EAAAA,EAAAn4F,QAAAg2F,EAAA,IAAA,IACAgC,GACAA,EAAA95F,KAAAg6F,KAGAC,EAAAA,EAAAnC,EAAA,IACAgC,GACAA,EAAA95F,KAAA+5F,KAdAE,EAAAnC,EAAA,IACAgC,GACAA,EAAA95F,KAAA+5F,IAiBAv+F,EAAAmD,OAAA,UAAAs7F,GAAAxvB,QAAA,IAAAI,KAAA,MAEA0sB,MAGA/7F,EAAA,kBAAAoF,OACA,CACA,GAAAq5F,GAAAz+F,EAAAmD,OAAA,UACAs7F,IAEAA,EAAAr7F,QAAApD,EAAA,UAAAsD,KAAA,eAAA,IAEAtD,EAAA,aAAAyD,SAAA,OAAAD,YAAA,OACAxD,EAAA,kBAAAwE,KAAAxE,EAAA,kBAAAsD,KAAA,WAMA6B,aACA,IAAAu5F,GAAA59F,OAAAsJ,WAAA,aAAA,EACApK,GAAAc,QAAAmU,GAAA,SAAA,WACAnU,OAAA2K,aAAAizF,GACA/zF,MAAA7J,OAAAsJ,WAAA,WACAjF,eACA,OASAnF,EAAA,aAAAoF,QACA1B,mBAEA1D,EAAA,mBAAAszC,KAAA,QAAA,WACA5vC,qBAKA1D,EAAA,aAAAiV,GAAA,oBAAA,SAAAvS,GAEA1C,EAAAqD,MAAAN,OAAA/C,EAAAqD,MAAAN,YAIA/C,EAAAc,QAAA8wD,OAAA,WACA5xD,EAAA,aAAAwxC,WAAA,WAMAxxC,EAAA,+GAAAg3D,UAEAh3D,EAAA,wBAAAiV,GAAA,eAAA,SAAAvS,GACA,GAAAihE,GAAA3jE,EAAAZ,UAAAqmC,WACAhhC,QAAA2B,SAAA4zB,KAAAh6B,EAAAqD,MAAAS,KAAA,QACAhD,OAAA66C,SAAA,EAAAgoB,KAKA3jE,EAAA,aAAAmzC,MAAA,WAEAnzC,EAAA,SAAAqD,MAAAJ,KAAA,WACA,GAAA07F,GAAA3+F,EAAAqD,MAAAS,KAAA,UACA86F,EAAA5+F,EAAAqD,MAAAS,KAAA,aAEA,KAAA86F,IACA5+F,EAAAqD,MAAAS,KAAA,SAAA86F,GACA5+F,EAAAqD,MAAAS,KAAA,aAAA66F,KAKA,IAAAC,GAAA5+F,EAAA,MAAAqD,MAAAS,KAAA,cACA66F,EAAA3+F,EAAA,MAAAqD,MAAAS,KAAA,MACA,KAAA86F,IACA5+F,EAAA,MAAAqD,MAAAS,KAAA,MAAA86F,GACA5+F,EAAA,MAAAqD,MAAAS,KAAA,aAAA66F,KAIA,WACA3+F,EAAA,SAAAqD,MAAAJ,KAAA,WACA,GAAA07F,GAAA3+F,EAAAqD,MAAAS,KAAA,UACA86F,EAAA5+F,EAAAqD,MAAAS,KAAA,aAEA,KAAA86F,IACA5+F,EAAAqD,MAAAS,KAAA,SAAA86F,GACA5+F,EAAAqD,MAAAS,KAAA,aAAA66F,KAIA,IAAAA,GAAA3+F,EAAA,MAAAqD,MAAAS,KAAA,OACA86F,EAAA5+F,EAAA,MAAAqD,MAAAS,KAAA,aACA,KAAA86F,IACA5+F,EAAA,MAAAqD,MAAAS,KAAA,MAAA86F,GACA5+F,EAAA,MAAAqD,MAAAS,KAAA,aAAA66F,KAKA,IAAAE,GAAA50F,UAAAC,UAAAnG,cACAutE,EAAA,gBAAAxwE,SAAAA,OAAAg+F,eAAA1/F,mBAAA0/F,eACAC,EAAAztB,IACAutB,EAAA10F,MAAA,uBACA00F,EAAA10F,MAAA,cACA00F,EAAA10F,MAAA,eACA00F,EAAA10F,MAAA,YACA00F,EAAA10F,MAAA,UACA00F,EAAA10F,MAAA,UACA00F,EAAA10F,MAAA,gBACA00F,EAAA10F,MAAA,SAEA40F,IAIA/+F,EAAA,oFAAAiV,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,iBACAlhC,EAAA2hC,iBAEA,IAAAuoB,GAAA5sD,EAAAqD,MACA6pD,EAAAN,EAAAnoD,QACAyoD,GAAAhwB,WAAA15B,YAAA,OAEA,IAAAw7F,GAAA9xC,EAAAha,SAAA,OAKA8rD,GACAl+F,OAAAsF,SAAA4R,KAAA40C,EAAA9oD,KAAA,QAEAopD,EAAAna,YAAA,UAOA/yC,EAAA,qBAAAmzC,MAAA,WACAnzC,EAAAqD,MAAAE,KAAA,iBAAAA,KAAA,yBAAAlB,KAAA,GACA,IAAA48F,GAAAj/F,EAAAqD,MAAAE,KAAA,iBAAAA,KAAA,yBAEAogD,EAAA,GACAphD,EAAA,GACAiC,EAAA,IAEAxE,EAAAi/F,GAAA37F,KAAA,UAAAtD,EAAAi/F,GAAA37F,KAAA,YACAqgD,EAAA,6BAAA3jD,EAAAqD,MAAA+4B,SAAA,oBAAA/5B,OAAA,WAGArC,EAAAi/F,GAAA37F,KAAA,WACAf,EAAA,aAAA08F,EAAA37F,KAAA,SAAA,6BAGAtD,EAAAi/F,GAAA37F,KAAA,UACAkB,EAAAy6F,EAAA37F,KAAA,QAGA,IAAAjB,GAAAE,EAAAohD,EAAAn/C,CACAxE,GAAAqD,MAAAE,KAAA,iBAAAA,KAAA,yBAAAlB,KAAAA,KAGArC,EAAA,2BAAAk/F,UAAA,WACA,GAAAv7C,GAAA,GACAphD,EAAA,GACAiC,EAAA,IAEAxE,EAAAqD,MAAAC,KAAA,UAAAtD,EAAAqD,MAAAC,KAAA,WACAqgD,EAAA,6BAAA3jD,EAAAqD,MAAAhB,OAAA,WAGArC,EAAAqD,MAAAC,KAAA,WACAf,EAAA,aAAAvC,EAAAqD,MAAAC,KAAA,SAAA,6BAGAtD,EAAAqD,MAAAC,KAAA,UACAkB,EAAAxE,EAAAqD,MAAAC,KAAA,QAGA,IAAAjB,GAAAE,EAAAohD,EAAAn/C,CACAxE,GAAAqD,MAAAq5B,QAAA,iBAAAn5B,KAAA,yBAAAlB,KAAAA,KAMArC,EAAAZ,UAAA6V,GAAA,QAAA,mDAAA,WACA,GAAAkqF,GAAAn/F,EAAAqD,MAAAC,KAAA,KACAtD,GAAAk2C,MACA9sC,IAAA,mCAAA+1F,EACA7oD,QAAA,SAAAtvB,GACAhnB,EAAA,wBAAA8B,SACA9B,EAAA,QAAA6F,OAAAmhB,GACAhnB,EAAA,wBAAAgzD,MAAA,aAMAhzD,EAAA,4BAAAiV,GAAA,QAAA,6DAAA,SAAAvS,GACAA,EAAAkhC,iBACA5jC,EAAA,oBAAAgzD,MAAA,SAKA,IAAAosC,GAAAp/F,EAAA,YACAo/F,GAAA77F,KAAA,YAAAqzE,SACAnB,QAAA2pB,EAAA77F,KAAA,YACAmyE,SAAA0pB,EAAA77F,KAAA,aACAgyE,OAAA6pB,EAAA77F,KAAA,UACAoyE,eAAA,aACApD,UAAA,GACAC,SAAA,GACAnjC,SAAA,EACAsjC,QAAA,WACAiE,QAAA,QACAwoB,EAAA77F,KAAA,YAAAqzE,UAAAnyE,SAAAwQ,GAAA,mBAAA,SAAAvS,GACAA,EAAAkhC,gBACA,IAAAmrB,GAAArsD,EAAAqsD,OAAArsD,EAAA6hC,cAAA4nD,WACAkT,EAAAtwC,EAAAA,EAAA,EAAArsD,EAAA6hC,cAAA0nD,OAAA,CACAmT,GAAA77F,KAAA,YAAAqzE,UAAAA,QAAA,OAAAyoB,GACA9sB,UAAA,GACAljC,SAAA,EACAmjC,SAAA,GACAmC,MAAAjyE,MAaA1C,EAAA,SAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAAxzC,MAEA0zC,EAAA1zC,QAGAxoD,EAAA,eAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAAsD,YAEApD,EAAAoD,cAGAt/F,EAAA,eAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAAuD,YAEArD,EAAAqD,cAGAv/F,EAAA,cAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAAwD,WAEAtD,EAAAsD,aAGAx/F,EAAA,UAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAAyD,OAEAvD,EAAAuD,SAGAz/F,EAAA,cAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAA0D,WAEAxD,EAAAwD,aAGA1/F,EAAA,aAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAA2D,UAEAzD,EAAAyD,YAGA3/F,EAAA,WAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAA4D,QAEA1D,EAAA0D,UAGA5/F,EAAA,iBAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAA6D,cAEA3D,EAAA2D,gBAGA7/F,EAAA,gBAAAshC,MAAA,WACAthC,EAAAqD,MAAA04B,GAAA,YACAigE,EAAA8D,aAEA5D,EAAA4D,cAIA,IAAA9lE,GAAA56B,SAAAgH,SAAA4zB,IACA,IAAAA,GAAAh6B,EAAA,aAAAoF,OAAA,CACA,GAAA26F,GAAA//F,EAAA,oBAAAg6B,EAAA,IACA+lE,GAAA36F,SACA26F,EAAAxnC,IAAA,QACAynC,cAuFA,GAlFAhgG,EAAA,iBAAAshC,MAAA,WAEAthC,EAAA,iBAAAwD,YAAA,QACAxD,EAAA,uBAAAwD,YAAA,QAEAxD,EAAAqD,MAAA0vC,YAAA,QACA/yC,EAAA,qBAAAwD,YAAA,sBAAAuvC,YAAA,aACA/yC,EAAA,eAAA+yC,YAAA,UAIA/yC,EAAA,iBAAAshC,MAAA,WAEAthC,EAAA,iBAAAwD,YAAA,QACAxD,EAAA,qBAAAwD,YAAA,aACAxD,EAAA,eAAAwD,YAAA,QAEAxD,EAAA,iBAAA+yC,YAAA,QACA/yC,EAAA,uBAAA+yC,YAAA,QACA/yC,EAAA,qBAAA+yC,YAAA,wBAIA/yC,EAAA,SAAAiV,GAAA,QAAA,cAAA,WACAjV,EAAAqD,MAAAq5B,QAAA,oBAAAqW,YAAA,QACA/yC,EAAAqD,MAAA+4B,SAAA,OAAA2W,YAAA,8BACA/yC,EAAAqD,MAAA+4B,SAAA,SAAAjX,SACAnlB,EAAAqD,MAAA+4B,SAAA,SAAAjX,WAIAnlB,EAAA,wCAAAshC,MAAA,WACAthC,EAAAqD,MAAAq5B,QAAA,SAAAN,SAAA,aAAAjX,SAAA4tB,YAAA,UAIA/yC,EAAA,iBAAAiV,GAAA,QAAA,uBAAA,WACAjV,EAAA,gBAAA+yC,YAAA,YAEA/yC,EAAA,iBAAAiV,GAAA,QAAA,kBAAA,WACA,GAAAgrF,GAAAjgG,EAAA,qCAAA8D,KAAA,MAAAwC,QAAA,SAAA,kBACA45F,EAAAlgG,EAAA,IAAAigG,GAAA59F,MACAa,SAAAg9F,IACAlgG,EAAA,wBAAAuD,KAAA,eAAAlB,KAAA69F,GACAlgG,EAAA,wBAAAgzD,MAAA,WAGAhzD,EAAA,eAAAiV,GAAA,QAAA,kBAAA,WACA,GAAAgrF,GAAAjgG,EAAAqD,MAAAq5B,QAAA,UAAA54B,KAAA,MACAq8F,EAAA,GAEAngG,GAAA,gBAAAoF,SACA+6F,EAAAngG,EAAAqD,MAAAq5B,QAAA,UAAAn5B,KAAA,uBAAAO,KAAA,MAAAwC,QAAA25F,EAAA,IAAA35F,QAAA,SAAA,IAAAA,QAAA,IAAA,IAEA,IAAA45F,GAAAlgG,EAAA,kBAAAmgG,EAAA,IAAAF,GAAA59F,MAEAa,SAAAg9F,IACAlgG,EAAA,wBAAAuD,KAAA,eAAAlB,KAAA69F,GACAlgG,EAAA,wBAAAgzD,MAAA,WAGAhzD,EAAA,iBAAAiV,GAAA,SAAA,QAAA,WACAknF,EAAAn8F,EAAAqD,MAAA2gB,KAAA,SAQAhkB,EAAA,sBAAAshC,MAAA,WACA,GAAA7/B,GAAAzB,EAAAqD,KAAA22B,KAEA,IADAv4B,EAAAA,EAAA2D,OAAA3D,EAAAzB,EAAA,SAAAqD,KAAA22B,KAAAx5B,MAAA,GAAA,KACAiB,EAAA2D,OAIA,MAHApF,GAAA,aAAAqvC,SACA5J,UAAAhkC,EAAAg5C,SAAA9jB,IAAAryB,SAAAtE,EAAA,kBAAAyF,IAAA,eACA,MACA,IAKAzF,EAAA,YAAAoF,OAEA,CAAApF,EAAA,wBAAAkE,MACAlE,EAAA,0BAAAkE,MAIA,GAAAlE,EAAA,kDAAAoF,OAAA,CACA,GAAA66F,GAAAjgG,EAAA,gCAAA08B,QAAA,UAAA54B,KAAA,KACA9D,GAAA,IAAAigG,GAAAjtC,MAAA,QAIAhzD,EAAA,cAAAiV,GAAA,YAAA,oBAAA,WACAjV,EAAA,WAAAwD,YAAA,aAyGAxD,EAAA,yBAAAiV,GAAA,QAAA,UAAA,SAAAvS,GAMA,MALAA,GAAAkhC,iBAEA5jC,EAAAyvE,aAAA,aAAAJ,KAAA,MACAvuE,OAAAsF,SAAA4R,KAAA3U,KAAA2U,MAEA,I0BhoCA,SAAAlX,EAAA1B,EAAA8D,GAAA,YAgCA,SAAAk9F,GAAAv5F,EAAAw5F,GAEA,MADAA,GAAAA,GAAAhlF,MACA,WACA,GAMAilF,GAAAh1F,EANAi1F,EAAA,EAEAC,EAAA5qF,UACA+hC,EAAA6oD,EAAA,GACAtpF,EAAA,KAAArQ,EAAAA,EAAA,IAAA,IAAA8wC,EAAA,KACA2b,EAAAktC,EAAA,EAiBA,KAdAtpF,GAAAo8C,EAAAhtD,QAAA,WAAA,SAAA6D,GACA,GAAAvG,IAAAuG,EAAA3J,MAAA,MACAigG,EAAA78F,EAAA28F,CAEA,OAAAE,GAAAD,EAAAp7F,OACAs7F,GAAAF,EAAAC,IAGAt2F,IAGA+M,GAAA,wCACArQ,EAAAA,EAAA,IAAA,IAAA8wC,EAEArsC,EAAAi1F,EAAAD,EAAA,IAAAh1F,EAAAk1F,EAAAp7F,OAAAkG,IAAAg1F,EAAA,IACAppF,GAAAopF,EAAA,KAAAh1F,EAAAi1F,GAAA,IACA1nD,mBAAA6nD,GAAAF,EAAAl1F,IAGA,OAAA,IAAA+0F,GAAAnpF,IAyMA,QAAAypF,GAAAzrF,GACA,GAAA,MAAAA,GAAAsG,EAAAtG,GACA,OAAA,CAKA,IAAA9P,GAAA,UAAAyE,QAAAqL,IAAAA,EAAA9P,MAEA,SAAA8P,EAAAqB,WAAAqqF,KAAAx7F,KAIAy7F,EAAA3rF,IAAAmJ,GAAAnJ,IAAA,IAAA9P,GACA,gBAAAA,IAAAA,EAAA,GAAAA,EAAA,IAAA8P,IAsCA,QAAA7T,GAAA6T,EAAA05E,EAAAp4E,GACA,GAAAyG,GAAA7X,CACA,IAAA8P,EACA,GAAA0G,EAAA1G,GACA,IAAA+H,IAAA/H,GAGA,aAAA+H,GAAA,UAAAA,GAAA,QAAAA,GAAA/H,EAAA0W,iBAAA1W,EAAA0W,eAAA3O,IACA2xE,EAAAnuF,KAAA+V,EAAAtB,EAAA+H,GAAAA,EAAA/H,OAGA,IAAAmJ,GAAAnJ,IAAAyrF,EAAAzrF,GAAA,CACA,GAAA4rF,GAAA,gBAAA5rF,EACA,KAAA+H,EAAA,EAAA7X,EAAA8P,EAAA9P,OAAA6X,EAAA7X,EAAA6X,KACA6jF,GAAA7jF,IAAA/H,KACA05E,EAAAnuF,KAAA+V,EAAAtB,EAAA+H,GAAAA,EAAA/H,OAGA,IAAAA,EAAA7T,SAAA6T,EAAA7T,UAAAA,EACA6T,EAAA7T,QAAAutF,EAAAp4E,EAAAtB,OACA,IAAA6rF,EAAA7rF,GAEA,IAAA+H,IAAA/H,GACA05E,EAAAnuF,KAAA+V,EAAAtB,EAAA+H,GAAAA,EAAA/H,OAEA,IAAA,kBAAAA,GAAA0W,eAEA,IAAA3O,IAAA/H,GACAA,EAAA0W,eAAA3O,IACA2xE,EAAAnuF,KAAA+V,EAAAtB,EAAA+H,GAAAA,EAAA/H,OAKA,KAAA+H,IAAA/H,GACA0W,GAAAnrB,KAAAyU,EAAA+H,IACA2xE,EAAAnuF,KAAA+V,EAAAtB,EAAA+H,GAAAA,EAAA/H,EAKA,OAAAA,GAGA,QAAA8rF,GAAA9rF,EAAA05E,EAAAp4E,GAEA,IAAA,GADAgZ,GAAA3lB,OAAA2lB,KAAAta,GAAAtQ,OACA0G,EAAA,EAAAA,EAAAkkB,EAAApqB,OAAAkG,IACAsjF,EAAAnuF,KAAA+V,EAAAtB,EAAAsa,EAAAlkB,IAAAkkB,EAAAlkB,GAEA,OAAAkkB,GASA,QAAAyxE,GAAAC,GACA,MAAA,UAAAjwF,EAAAgM,GAAAikF,EAAAjkF,EAAAhM,IAaA,QAAAkwF,KACA,QAAAC,GASA,QAAAC,GAAAnsF,EAAApE,GACAA,EACAoE,EAAAosF,UAAAxwF,QAEAoE,GAAAosF,UAKA,QAAAC,GAAAC,EAAAC,EAAAl4E,GAGA,IAAA,GAFAzY,GAAA0wF,EAAAF,UAEAh2F,EAAA,EAAAo2F,EAAAD,EAAAr8F,OAAAkG,EAAAo2F,IAAAp2F,EAAA,CACA,GAAA4J,GAAAusF,EAAAn2F,EACA,IAAAq2F,EAAAzsF,IAAA0G,EAAA1G,GAEA,IAAA,GADAsa,GAAA3lB,OAAA2lB,KAAAta,GACA+D,EAAA,EAAA2oF,EAAApyE,EAAApqB,OAAA6T,EAAA2oF,EAAA3oF,IAAA,CACA,GAAAgE,GAAAuS,EAAAvW,GACA/W,EAAAgT,EAAA+H,EAEAsM,IAAAo4E,EAAAz/F,GACA2/F,EAAA3/F,GACAs/F,EAAAvkF,GAAA,GAAA7F,MAAAlV,EAAA4/F,YAEAH,EAAAH,EAAAvkF,MAAAukF,EAAAvkF,GAAAoB,GAAAnc,UACAq/F,EAAAC,EAAAvkF,IAAA/a,IAAA,IAGAs/F,EAAAvkF,GAAA/a,GAMA,MADAm/F,GAAAG,EAAA1wF,GACA0wF,EAqBA,QAAAtjF,GAAAsjF,GACA,MAAAD,GAAAC,EAAAhhG,GAAAC,KAAAmV,UAAA,IAAA,GAsBA,QAAA4J,GAAAgiF,GACA,MAAAD,GAAAC,EAAAhhG,GAAAC,KAAAmV,UAAA,IAAA,GAKA,QAAAuwC,GAAA7zC,GACA,MAAAhO,UAAAgO,EAAA,IAIA,QAAAyvF,GAAAt9F,EAAA0e,GACA,MAAAjF,GAAArU,OAAAk2E,OAAAt7E,GAAA0e,GAmBA,QAAArP,MAsBA,QAAAkuF,GAAAhiG,GAAA,MAAAA,GAIA,QAAAiiG,GAAAhxF,GAAA,MAAA,YAAA,MAAAA,IAEA,QAAAixF,GAAAhtF,GACA,MAAA0G,GAAA1G,EAAAwW,WAAAxW,EAAAwW,WAAA7hB,OAAAsa,UAAAuH,SAgBA,QAAAy2E,GAAAlxF,GAAA,MAAA,mBAAAA,GAeA,QAAAmxF,GAAAnxF,GAAA,MAAA,mBAAAA,GAgBA,QAAA0wF,GAAA1wF,GAEA,MAAA,QAAAA,GAAA,gBAAAA,GASA,QAAA8vF,GAAA9vF,GACA,MAAA,QAAAA,GAAA,gBAAAA,KAAAoxF,GAAApxF,GAgBA,QAAA4vF,GAAA5vF,GAAA,MAAA,gBAAAA,GAqBA,QAAAqxF,GAAArxF,GAAA,MAAA,gBAAAA,GAeA,QAAA4wF,GAAA5wF,GACA,MAAA,kBAAAya,GAAAjrB,KAAAwQ,GA8BA,QAAA2K,GAAA3K,GAAA,MAAA,kBAAAA;CAUA,QAAAsxF,GAAAtxF,GACA,MAAA,oBAAAya,GAAAjrB,KAAAwQ,GAWA,QAAAuK,GAAAtG,GACA,MAAAA,IAAAA,EAAApU,SAAAoU,EAIA,QAAAstF,GAAAttF,GACA,MAAAA,IAAAA,EAAAutF,YAAAvtF,EAAAwtF,OAIA,QAAAC,GAAAztF,GACA,MAAA,kBAAAwW,GAAAjrB,KAAAyU,GAIA,QAAA0tF,GAAA1tF,GACA,MAAA,sBAAAwW,GAAAjrB,KAAAyU,GAIA,QAAA2tF,GAAA3tF,GACA,MAAA,kBAAAwW,GAAAjrB,KAAAyU,GAIA,QAAA4tF,GAAA7xF,GACA,MAAA,iBAAAA,GAIA,QAAA8xF,GAAA7tF,GACA,MAAAA,IAAA0G,EAAA1G,EAAAipB,MAKA,QAAA6kE,GAAA/xF,GACA,MAAAgyF,IAAAr6F,KAAA8iB,GAAAjrB,KAAAwQ,IA6BA,QAAAiyF,GAAAzsE,GACA,SAAAA,KACAA,EAAA5tB,UACA4tB,EAAAzS,MAAAyS,EAAA3yB,MAAA2yB,EAAAlzB,OAOA,QAAA4/F,GAAA7wF,GACA,GAAAhH,GAAA4J,KAAA6kE,EAAAznE,EAAAnJ,MAAA,IACA,KAAAmC,EAAA,EAAAA,EAAAyuE,EAAA30E,OAAAkG,IACA4J,EAAA6kE,EAAAzuE,KAAA,CAEA,OAAA4J,GAIA,QAAAkuF,GAAAzpF,GACA,MAAA0pF,IAAA1pF,EAAA9Q,UAAA8Q,EAAA,IAAAA,EAAA,GAAA9Q,UAOA,QAAAy6F,GAAAC,EAAAtyF,GACA,GAAArN,GAAA2/F,EAAAngG,QAAA6N,EAIA,OAHArN,IAAA,GACA2/F,EAAAp7F,OAAAvE,EAAA,GAEAA,EA6DA,QAAAmpB,GAAAjiB,EAAA04F,EAAAC,EAAAC,GACA,GAAAloF,EAAA1Q,IAAA03F,EAAA13F,GACA,KAAA64F,IAAA,OACA,2EAEA,IAAAX,EAAAQ,GACA,KAAAG,IAAA,OACA,wDAGA,IAAAH,EA+BA,CACA,GAAA14F,IAAA04F,EAAA,KAAAG,IAAA,MACA,oDAEAF,GAAAA,MACAC,EAAAA,MAEA/B,EAAA72F,KACA24F,EAAA95F,KAAAmB,GACA44F,EAAA/5F,KAAA65F,GAGA,IAAAvmF,EACA,IAAAoB,GAAAvT,GAAA,CACA04F,EAAAp+F,OAAA,CACA,KAAA,GAAAkG,GAAA,EAAAA,EAAAR,EAAA1F,OAAAkG,IACAk4F,EAAA75F,KAAAojB,EAAAjiB,EAAAQ,GAAA,KAAAm4F,EAAAC,QAEA,CACA,GAAA5yF,GAAA0yF,EAAAlC,SAQA,IAPAjjF,GAAAmlF,GACAA,EAAAp+F,OAAA,EAEA/D,EAAAmiG,EAAA,SAAAvyF,EAAAgM,SACAumF,GAAAvmF,KAGA8jF,EAAAj2F,GAEA,IAAAmS,IAAAnS,GACA04F,EAAAvmF,GAAA8P,EAAAjiB,EAAAmS,GAAA,KAAAwmF,EAAAC,OAEA,IAAA54F,GAAA,kBAAAA,GAAA8gB,eAEA,IAAA3O,IAAAnS,GACAA,EAAA8gB,eAAA3O,KACAumF,EAAAvmF,GAAA8P,EAAAjiB,EAAAmS,GAAA,KAAAwmF,EAAAC,QAKA,KAAAzmF,IAAAnS,GACA8gB,GAAAnrB,KAAAqK,EAAAmS,KACAumF,EAAAvmF,GAAA8P,EAAAjiB,EAAAmS,GAAA,KAAAwmF,EAAAC,GAIArC,GAAAmC,EAAA1yF,QA5EA,IADA0yF,EAAA14F,EACA62F,EAAA72F,GAAA,CACA,GAAAlH,EACA,IAAA6/F,IAAA7/F,EAAA6/F,EAAArgG,QAAA0H,SACA,MAAA44F,GAAA9/F,EAOA,IAAAya,GAAAvT,GACA,MAAAiiB,GAAAjiB,KAAA24F,EAAAC,EACA,IAAAV,EAAAl4F,GACA04F,EAAA,GAAA14F,GAAAwhB,YAAAxhB,OACA,IAAA+2F,EAAA/2F,GACA04F,EAAA,GAAApsF,MAAAtM,EAAAuM,eACA,CAAA,IAAAkrF,EAAAz3F,GAGA,CACA,GAAA84F,GAAA/5F,OAAAk2E,OAAAsiB,GAAAv3F,GACA,OAAAiiB,GAAAjiB,EAAA84F,EAAAH,EAAAC,GAJAF,EAAA,GAAAh5F,QAAAM,EAAAA,OAAAA,EAAA4gB,WAAAvhB,MAAA,WAAA,IACAq5F,EAAAK,UAAA/4F,EAAA+4F,UAMAH,IACAD,EAAA95F,KAAAmB,GACA44F,EAAA/5F,KAAA65F,IAqDA,MAAAA,GAQA,QAAAM,GAAA5hG,EAAAs/F,GACA,GAAAnjF,GAAAnc,GAAA,CACAs/F,EAAAA,KAEA,KAAA,GAAAl2F,GAAA,EAAAo2F,EAAAx/F,EAAAkD,OAAAkG,EAAAo2F,EAAAp2F,IACAk2F,EAAAl2F,GAAApJ,EAAAoJ,OAEA,IAAAq2F,EAAAz/F,GAAA,CACAs/F,EAAAA,KAEA,KAAA,GAAAvkF,KAAA/a,GACA,MAAA+a,EAAAnL,OAAA,IAAA,MAAAmL,EAAAnL,OAAA,KACA0vF,EAAAvkF,GAAA/a,EAAA+a,IAKA,MAAAukF,IAAAt/F,EAiCA,QAAA6hG,GAAAC,EAAAC,GACA,GAAAD,IAAAC,EAAA,OAAA,CACA,IAAA,OAAAD,GAAA,OAAAC,EAAA,OAAA,CACA,IAAAD,IAAAA,GAAAC,IAAAA,EAAA,OAAA,CACA,IAAA7+F,GAAA6X,EAAAinF,EAAAC,QAAAH,GAAAI,QAAAH,EACA,IAAAE,GAAAC,GACA,UAAAD,EAAA,CACA,IAAA9lF,GAAA2lF,GAQA,CAAA,GAAAnC,EAAAmC,GACA,QAAAnC,EAAAoC,IACAF,EAAAC,EAAA3sF,UAAA4sF,EAAA5sF,UACA,IAAAkrF,EAAAyB,GACA,QAAAzB,EAAA0B,IAAAD,EAAAt4E,YAAAu4E,EAAAv4E,UAEA,IAAA82E,EAAAwB,IAAAxB,EAAAyB,IAAAzoF,EAAAwoF,IAAAxoF,EAAAyoF,IACA5lF,GAAA4lF,IAAApC,EAAAoC,IAAA1B,EAAA0B,GAAA,OAAA,CACAC,GAAAG,IACA,KAAApnF,IAAA+mF,GACA,GAAA,MAAA/mF,EAAAnL,OAAA,KAAA8J,EAAAooF,EAAA/mF,IAAA,CACA,IAAA8mF,EAAAC,EAAA/mF,GAAAgnF,EAAAhnF,IAAA,OAAA,CACAinF,GAAAjnF,IAAA,EAEA,IAAAA,IAAAgnF,GACA,KAAAhnF,IAAAinF,IACA,MAAAjnF,EAAAnL,OAAA,IACAmyF,EAAAhnF,KAAA/Z,GACA0Y,EAAAqoF,EAAAhnF,KAAA,OAAA,CAEA,QAAA,EA3BA,IAAAoB,GAAA4lF,GAAA,OAAA,CACA,KAAA7+F,EAAA4+F,EAAA5+F,SAAA6+F,EAAA7+F,OAAA,CACA,IAAA6X,EAAA,EAAAA,EAAA7X,EAAA6X,IACA,IAAA8mF,EAAAC,EAAA/mF,GAAAgnF,EAAAhnF,IAAA,OAAA,CAEA,QAAA,GA0BA,OAAA,EA2EA,QAAAqB,GAAAgmF,EAAAC,EAAA3gG,GACA,MAAA0gG,GAAAhmF,OAAA9d,GAAAC,KAAA8jG,EAAA3gG,IAGA,QAAA4gG,GAAA7uF,EAAA8uF,GACA,MAAAjkG,IAAAC,KAAAkV,EAAA8uF,GAAA,GAuBA,QAAAnxD,GAAAxX,EAAA1mB,GACA,GAAAsvF,GAAA9uF,UAAAxQ,OAAA,EAAAo/F,EAAA5uF,UAAA,KACA,QAAAgG,EAAAxG,IAAAA,YAAA5K,QAcA4K,EAbAsvF,EAAAt/F,OACA,WACA,MAAAwQ,WAAAxQ,OACAgQ,EAAA+C,MAAA2jB,EAAAxd,EAAAomF,EAAA9uF,UAAA,IACAR,EAAA+C,MAAA2jB,EAAA4oE,IAEA,WACA,MAAA9uF,WAAAxQ,OACAgQ,EAAA+C,MAAA2jB,EAAAlmB,WACAR,EAAA3U,KAAAq7B,IASA,QAAA6oE,GAAA1nF,EAAAhM,GACA,GAAA/M,GAAA+M,CAYA,OAVA,gBAAAgM,IAAA,MAAAA,EAAAnL,OAAA,IAAA,MAAAmL,EAAAnL,OAAA,GACA5N,EAAAhB,EACAsY,EAAAvK,GACA/M,EAAA,UACA+M,GAAA7R,IAAA6R,EACA/M,EAAA,YACAs+F,EAAAvxF,KACA/M,EAAA,UAGAA,EAmBA,QAAA0gG,GAAA1vF,EAAA2vF,GACA,MAAA,mBAAA3vF,GAAAhS,GACAo/F,EAAAuC,KACAA,EAAAA,EAAA,EAAA,MAEAhxD,KAAA+6B,UAAA15D,EAAAyvF,EAAAE,IAgBA,QAAAC,GAAArvD,GACA,MAAAorD,GAAAprD,GACA5B,KAAAC,MAAA2B,GACAA,EAIA,QAAAsvD,GAAAC,EAAAC,GACA,GAAAC,GAAA9tF,KAAA08B,MAAA,yBAAAkxD,GAAA,GACA,OAAAx/C,OAAA0/C,GAAAD,EAAAC,EAIA,QAAAC,GAAArlD,EAAA66C,GAGA,MAFA76C,GAAA,GAAA1oC,MAAA0oC,EAAAzoC,WACAyoC,EAAAirB,WAAAjrB,EAAAslD,aAAAzK,GACA76C,EAIA,QAAAulD,GAAAvlD,EAAAklD,EAAA7nE,GACAA,EAAAA,KAAA,CACA,IAAAmoE,GAAAP,EAAAC,EAAAllD,EAAAylD,oBACA,OAAAJ,GAAArlD,EAAA3iB,GAAAmoE,EAAAxlD,EAAAylD,sBAOA,QAAAC,GAAA7rF,GACAA,EAAA8rF,GAAA9rF,GAAAnU,OACA,KAGAmU,EAAA5T,QACA,MAAArD,IACA,GAAAgjG,GAAAD,GAAA,SAAA5/F,OAAA8T,GAAAtX,MACA,KACA,MAAAsX,GAAA,GAAApD,WAAAovF,GAAAtC,GAAAqC,GACAA,EACAv7F,MAAA,cAAA,GACA7D,QAAA,cAAA,SAAA6D,EAAAtB,GAAA,MAAA,IAAAw6F,GAAAx6F,KACA,MAAAnG,GACA,MAAA2gG,IAAAqC,IAgBA,QAAAE,GAAA30F,GACA,IACA,MAAAy9D,oBAAAz9D,GACA,MAAAvO,KAUA,QAAAmjG,IAAAC,GACA,GAAAC,GAAA9oF,EAAA/H,IAiBA,OAhBA7T,IAAAykG,GAAA,IAAA38F,MAAA,KAAA,SAAA28F,GACA,GAAAA,IACAC,EAAAD,EAAAx/F,QAAA,MAAA,OAAA6C,MAAA,KACA8T,EAAA2oF,EAAAG,EAAA,IACA3D,EAAAnlF,IAAA,CACA,GAAA/Y,IAAAk+F,EAAA2D,EAAA,KAAAH,EAAAG,EAAA,GACAn6E,IAAAnrB,KAAAyU,EAAA+H,GAEAoB,GAAAnJ,EAAA+H,IACA/H,EAAA+H,GAAAtT,KAAAzF,GAEAgR,EAAA+H,IAAA/H,EAAA+H,GAAA/Y,GAJAgR,EAAA+H,GAAA/Y,KASAgR,EAGA,QAAA8wF,IAAA9wF,GACA,GAAA84B,KAYA,OAXA3sC,GAAA6T,EAAA,SAAAjE,EAAAgM,GACAoB,GAAApN,GACA5P,EAAA4P,EAAA,SAAAg1F,GACAj4D,EAAArkC,KAAAu8F,GAAAjpF,GAAA,IACAgpF,KAAA,EAAA,GAAA,IAAAC,GAAAD,GAAA,OAGAj4D,EAAArkC,KAAAu8F,GAAAjpF,GAAA,IACAhM,KAAA,EAAA,GAAA,IAAAi1F,GAAAj1F,GAAA,OAGA+8B,EAAA5oC,OAAA4oC,EAAA1kC,KAAA,KAAA,GAeA,QAAA68F,IAAAjiG,GACA,MAAAgiG,IAAAhiG,GAAA,GACAoC,QAAA,QAAA,KACAA,QAAA,QAAA,KACAA,QAAA,QAAA,KAeA,QAAA4/F,IAAAhiG,EAAAkiG,GACA,MAAAvtD,oBAAA30C,GACAoC,QAAA,QAAA,KACAA,QAAA,QAAA,KACAA,QAAA,OAAA,KACAA,QAAA,QAAA,KACAA,QAAA,QAAA,KACAA,QAAA,OAAA8/F,EAAA,MAAA,KAKA,QAAAC,IAAA1sF,EAAA2sF,GACA,GAAAxiG,GAAAwH,EAAAo2F,EAAA6E,GAAAnhG,MACA,KAAAkG,EAAA,EAAAA,EAAAo2F,IAAAp2F,EAEA,GADAxH,EAAAyiG,GAAAj7F,GAAAg7F,EACAzF,EAAA/8F,EAAA6V,EAAAxS,aAAArD,IACA,MAAAA,EAGA,OAAA,MAkIA,QAAA0iG,IAAA7sF,EAAA8sF,GACA,GAAAC,GACA7/F,EACA2nE,IAGAntE,GAAAklG,GAAA,SAAAx7E,GACA,GAAA5P,GAAA4P,EAAA,OAEA27E,GAAA/sF,EAAA2jC,cAAA3jC,EAAA2jC,aAAAniC,KACAurF,EAAA/sF,EACA9S,EAAA8S,EAAAxS,aAAAgU,MAGA9Z,EAAAklG,GAAA,SAAAx7E,GACA,GACAzb,GADA6L,EAAA4P,EAAA,OAGA27E,IAAAp3F,EAAAqK,EAAA6/D,cAAA,IAAAr+D,EAAA7U,QAAA,IAAA,OAAA,QACAogG,EAAAp3F,EACAzI,EAAAyI,EAAAnI,aAAAgU,MAGAurF,IACAl4B,EAAAm4B,SAAA,OAAAN,GAAAK,EAAA,aACAD,EAAAC,EAAA7/F,GAAAA,MAAA2nE,IAsDA,QAAAi4B,IAAA9sF,EAAAitF,EAAAp4B,GACAmzB,EAAAnzB,KAAAA,KACA,IAAAq4B,IACAF,UAAA,EAEAn4B,GAAAtwD,EAAA2oF,EAAAr4B,EACA,IAAAs4B,GAAA,WAGA,GAFAntF,EAAA8rF,GAAA9rF,GAEAA,EAAAotF,WAAA,CACA,GAAA3nF,GAAAzF,EAAA,KAAAva,EAAA,WAAAomG,EAAA7rF,EAEA,MAAAgqF,IACA,UACA,mDACAvkF,EAAA9Y,QAAA,IAAA,QAAAA,QAAA,IAAA,SAGAsgG,EAAAA,MACAA,EAAA/9E,SAAA,WAAA,SAAAm+E,GACAA,EAAA/1F,MAAA,eAAA0I,MAGA60D,EAAAy4B,kBAEAL,EAAAj9F,MAAA,mBAAA,SAAAu9F,GACAA,EAAAD,kBAAA,MAIAL,EAAA/9E,QAAA,KACA,IAAAk+E,GAAAI,GAAAP,EAAAp4B,EAAAm4B,SASA,OARAI,GAAAK,QAAA,aAAA,eAAA,WAAA,YACA,SAAAC,EAAA1tF,EAAAoa,EAAAgzE,GACAM,EAAAC,OAAA,WACA3tF,EAAArW,KAAA,YAAAyjG,GACAhzE,EAAApa,GAAA0tF,QAIAN,GAGAQ,EAAA,yBACAC,EAAA,sBAOA,OALA1mG,IAAAymG,EAAA3+F,KAAA9H,EAAAqa,QACAqzD,EAAAy4B,kBAAA,EACAnmG,EAAAqa,KAAAra,EAAAqa,KAAA7U,QAAAihG,EAAA,KAGAzmG,IAAA0mG,EAAA5+F,KAAA9H,EAAAqa,MACA2rF,KAGAhmG,EAAAqa,KAAAra,EAAAqa,KAAA7U,QAAAkhG,EAAA,IACAC,GAAAC,gBAAA,SAAAC,GAIA,MAHAtmG,GAAAsmG,EAAA,SAAA9gG,GACA+/F,EAAAj9F,KAAA9C,KAEAigG,UAGAlrF,EAAA6rF,GAAAG,0BACAH,GAAAG,4BAcA,QAAAC,MACA/mG,EAAAqa,KAAA,wBAAAra,EAAAqa,KACAra,EAAAsF,SAAA0hG,SAWA,QAAAC,IAAAC,GACA,GAAAjB,GAAAU,GAAA9tF,QAAAquF,GAAAjB,UACA,KAAAA,EACA,KAAApD,IAAA,OACA,2DAEA,OAAAoD,GAAA3kF,IAAA,iBAIA,QAAA6lF,IAAA9sF,EAAA+sF,GAEA,MADAA,GAAAA,GAAA,IACA/sF,EAAA7U,QAAA6hG,GAAA,SAAA/7E,EAAA1b,GACA,OAAAA,EAAAw3F,EAAA,IAAA97E,EAAAroB,gBAMA,QAAAqkG,MACA,GAAAC,EAEA,KAAAC,GAAA,CAKA,GAAAC,GAAAC,IACAzoG,IAAAe,EAAAf,OACAqiG,EAAAmG,KACAxoG,GAAA,OAAAwoG,EAAArlG,EAAApC,EAAAynG,IAOAxoG,IAAAA,GAAAqV,GAAAH,IACAwwF,GAAA1lG,GACAme,EAAAne,GAAAqV,IACAiyF,MAAAoB,GAAApB,MACAqB,aAAAD,GAAAC,aACAC,WAAAF,GAAAE,WACA5B,SAAA0B,GAAA1B,SACA6B,cAAAH,GAAAG,gBAMAP,EAAAtoG,GAAAwe,UACAxe,GAAAwe,UAAA,SAAAc,GACA,GAAAuB,EACA,IAAAioF,GAQAA,IAAA,MAPA,KAAA,GAAA/sF,GAAAxQ,EAAA,EAAA,OAAAwQ,EAAAuD,EAAA/T,IAAAA,IACAsV,EAAA7gB,GAAAsgB,MAAAvE,EAAA,UACA8E,GAAAA,EAAAkoF,UACA/oG,GAAA+b,GAAA0jB,eAAA,WAMA6oE,GAAAhpF,KAGAomF,GAAAsD,GAGAtB,GAAA9tF,QAAA8rF,GAGA6C,IAAA,GAMA,QAAAU,IAAAh7E,EAAA7S,EAAA8tF,GACA,IAAAj7E,EACA,KAAA21E,IAAA,OAAA,wBAAAxoF,GAAA,IAAA8tF,GAAA,WAEA,OAAAj7E,GAGA,QAAAk7E,IAAAl7E,EAAA7S,EAAAguF,GAOA,MANAA,IAAA9qF,GAAA2P,KACAA,EAAAA,EAAAA,EAAA5oB,OAAA,IAGA4jG,GAAAptF,EAAAoS,GAAA7S,EAAA,wBACA6S,GAAA,gBAAAA,GAAAA,EAAA1B,YAAAnR,MAAA,eAAA6S,KACAA,EAQA,QAAAo7E,IAAAjuF,EAAA3E,GACA,GAAA,mBAAA2E,EACA,KAAAwoF,IAAA,UAAA,yCAAAntF,GAYA,QAAAs7B,IAAA58B,EAAAm6D,EAAAg6B,GACA,IAAAh6B,EAAA,MAAAn6D,EAMA,KAAA,GAJA+H,GADAuS,EAAA6/C,EAAAlmE,MAAA,KAEAmgG,EAAAp0F,EACAlF,EAAAwf,EAAApqB,OAEAkG,EAAA,EAAAA,EAAA0E,EAAA1E,IACA2R,EAAAuS,EAAAlkB,GACA4J,IACAA,GAAAo0F,EAAAp0F,GAAA+H,GAGA,QAAAosF,GAAAztF,EAAA1G,GACAo+B,EAAAg2D,EAAAp0F,GAEAA,EAQA,QAAAq0F,IAAA3/D,GAGA,GAAAnT,GAAAmT,EAAA,GACA4/D,EAAA5/D,EAAAA,EAAAxkC,OAAA,GACAqkG,GAAAhzE,EAEA,GAAA,CAEA,GADAA,EAAAA,EAAArG,aACAqG,EAAA,KACAgzE,GAAA9/F,KAAA8sB,SACAA,IAAA+yE,EAEA,OAAA/D,IAAAgE,GAeA,QAAApF,MACA,MAAAx6F,QAAAk2E,OAAA,MAmBA,QAAA2pB,IAAA5oG,GAKA,QAAA6oG,GAAAz0F,EAAAiG,EAAA3U,GACA,MAAA0O,GAAAiG,KAAAjG,EAAAiG,GAAA3U,KAJA,GAAAojG,GAAAxJ,EAAA,aACAuD,EAAAvD,EAAA,MAMAqH,EAAAkC,EAAA7oG,EAAA,UAAA+I,OAKA,OAFA49F,GAAAoC,SAAApC,EAAAoC,UAAAzJ,EAEAuJ,EAAAlC,EAAA,SAAA,WAEA,GAAAb,KAqDA,OAAA,UAAAzrF,EAAA2uF,EAAAC,GACA,GAAAX,GAAA,SAAAjuF,EAAA3E,GACA,GAAA,mBAAA2E,EACA,KAAAwoF,GAAA,UAAA,yCAAAntF,GAQA,OAJA4yF,GAAAjuF,EAAA,UACA2uF,GAAAlD,EAAAh7E,eAAAzQ,KACAyrF,EAAAzrF,GAAA,MAEAwuF,EAAA/C,EAAAzrF,EAAA,WA0OA,QAAA6uF,GAAAC,EAAAnyD,EAAAoyD,EAAAxkF,GAEA,MADAA,KAAAA,EAAAykF,GACA,WAEA,MADAzkF,GAAAwkF,GAAA,SAAAD,EAAAnyD,EAAAliC,YACAw0F,GASA,QAAAC,GAAAJ,EAAAnyD,GACA,MAAA,UAAAwyD,EAAAC,GAGA,MAFAA,IAAA3uF,EAAA2uF,KAAAA,EAAAC,aAAArvF,GACAgvF,EAAAxgG,MAAAsgG,EAAAnyD,EAAAliC,YACAw0F,GA1PA,IAAAN,EACA,KAAAF,GAAA,QAAA,sLAEAzuF,EAIA,IAAAgvF,MAGAM,KAGAC,KAEAl8B,EAAAw7B,EAAA,YAAA,SAAA,OAAAS,GAGAL,GAEAO,aAAAR,EACAS,cAAAH,EACAI,WAAAH,EAWAZ,SAAAA,EAUA3uF,KAAAA,EAaA8uF,SAAAI,EAAA,WAAA,YAWA7jG,QAAA6jG,EAAA,WAAA,WAWAS,QAAAT,EAAA,WAAA,WAWAp5F,MAAA+4F,EAAA,WAAA,SAYAe,SAAAf,EAAA,WAAA,WAAA,WAYAgB,UAAAX,EAAA,WAAA,aAkCAxlF,UAAAwlF,EAAA,mBAAA,YAkBAruF,OAAAquF,EAAA,kBAAA,YAYA1B,WAAA0B,EAAA,sBAAA,YAaAY,UAAAZ,EAAA,mBAAA,aAaA77B,OAAAA,EAYAj0D,IAAA,SAAA2wF,GAEA,MADAR,GAAA/gG,KAAAuhG,GACA7nG,MAQA,OAJA0mG,IACAv7B,EAAAu7B,GAGAK,OAoCA,QAAAe,IAAAj2F,GACA,GAAAk2F,KAEA,OAAAv3D,MAAA+6B,UAAA15D,EAAA,SAAA+H,EAAA/Y,GAEA,GADAA,EAAAygG,EAAA1nF,EAAA/Y,GACAy9F,EAAAz9F,GAAA,CAEA,GAAAknG,EAAAhoG,QAAAc,IAAA,EAAA,MAAA,kBAEAknG,GAAAzhG,KAAAzF,GAEA,MAAAA,KAIA,QAAAw8F,IAAAxrF,GACA,MAAA,kBAAAA,GACAA,EAAAwW,WAAAplB,QAAA,cAAA,IACA,mBAAA4O,GACA,YACA,gBAAAA,GACAi2F,GAAAj2F,GAEAA,EAwHA,QAAAm2F,IAAA5D,GACAvpF,EAAAupF,GACAhB,UAAAA,GACA15E,KAAAA,EACA7O,OAAAA,EACAsB,MAAAA,EACAukF,OAAAA,EACApqF,QAAA8rF,GACApkG,QAAAA,EACA0lG,SAAAI,GACArzF,KAAAA,EACAw/B,KAAAA,EACAsxD,OAAAA,EACAE,SAAAA,EACA9C,SAAAA,EACAG,YAAAA,EACAC,UAAAA,EACAvB,SAAAA,EACAjlF,WAAAA,EACA+lF,SAAAA,EACAW,SAAAA,EACAY,UAAAA,EACA7kF,QAAAA,GACAwN,QAAAA,GACAg2E,OAAAA,EACAwB,UAAAA,GACAiI,UAAAA,GACAC,WAAAC,QAAA,GACAzD,eAAAA,GACA8B,SAAAzJ,EACAqL,MAAAC,GACA7D,oBAAAA,KAGA8D,GAAAjC,GAAA5oG,EACA,KACA6qG,GAAA,YACA,MAAAjpG,GACAipG,GAAA,eAAA1B,SAAA,UAAA2B,IAGAD,GAAA,MAAA,aAAA,WACA,SAAA3E,GAEAA,EAAAiD,UACA4B,cAAAC,KAEA9E,EAAAiD,SAAA,WAAA8B,IACAd,WACAtoG,EAAAqpG,GACA57F,MAAA67F,GACAC,SAAAD,GACAnlE,KAAAqlE,GACA5yD,OAAA6yD,GACA98E,OAAA+8E,GACA5sG,MAAA6sG,GACAnkE,OAAAokE,GACAC,OAAAC,GACAC,WAAAC,GACAC,eAAAC,GACAC,QAAAC,GACAC,YAAAC,GACAC,WAAAC,GACAC,QAAAC,GACAC,aAAAC,GACAC,OAAAC,GACAC,OAAAC,GACAC,KAAAC,GACAC,UAAAC,GACAC,OAAAC,GACAC,cAAAC,GACAC,YAAAC,GACAC,SAAAC,GACAC,OAAAC,GACAC,QAAAC,GACAC,SAAAC,GACAC,aAAAC,GACAC,gBAAAC,GACAC,UAAAC,GACAC,aAAAC,GACAC,QAAAC,GACAC,OAAAC,GACAC,SAAAC,GACA52E,QAAA62E,GACAC,UAAAD,GACA/xD,SAAAiyD,GACAC,WAAAD,GACA1vD,UAAA4vD,GACAC,YAAAD,GACA7vD,UAAA+vD,GACAC,YAAAD,GACAE,QAAAC,GACAC,eAAAC,KAEAtF,WACA6C,UAAA0C,KAEAvF,UAAAwF,IACAxF,UAAAyF,IACA1J,EAAAiD,UACA0G,cAAAC,GACAC,SAAAC,GACAC,eAAAC,GACAC,gBAAAC,GACAC,SAAAC,GACAC,cAAAC,GACAC,YAAAC,GACAC,UAAAC,GACAC,kBAAAC,GACAC,QAAAC,GACAC,aAAAC,GACAC,UAAAC,GACAC,MAAAC,GACAC,qBAAAC,GACAC,2BAAAC,GACAC,aAAAC,GACAC,UAAAC,GACAC,KAAAC,GACAC,OAAAC,GACAC,WAAAC,GACAC,GAAAC,GACAC,IAAAC,GACAC,KAAAC,GACAC,aAAAC,GACAC,SAAAC,GACAC,eAAAC,GACAC,iBAAAC,GACAC,cAAAC,GACAC,SAAAC,GACAC,QAAAC,GACAC,MAAAC,GACAC,gBAAAC,GACAC,SAAAC,GACAC,UAAAC,GACAC,eAAAC,QAwIA,QAAAC,MAAA,QAAAC,GAaA,QAAA/2F,IAAAhD,GACA,MAAAA,GACA7U,QAAA6uG,GAAA,SAAAj6F,EAAAgtF,EAAA97E,EAAAquB,GACA,MAAAA,GAAAruB,EAAAnhB,cAAAmhB,IAEA9lB,QAAA8uG,GAAA,SAuBA,QAAAC,IAAAhzG,GACA,OAAAizG,GAAA1sG,KAAAvG,GAGA,QAAAkzG,IAAA9+E,GAGA,GAAAlgB,GAAAkgB,EAAAlgB,QACA,OAAAA,KAAAqqF,KAAArqF,GAAAA,IAAAi/F,GAGA,QAAAC,IAAAh/E,GACA,IAAA,GAAAxZ,KAAAy4F,IAAAj/E,EAAAk/E,OACA,OAAA,CAEA,QAAA,EAGA,QAAAC,IAAAvzG,EAAAmU,GACA,GAAAiU,GAAArL,EAAAsqB,EAEAp+B,EADAtE,EAAAwP,EAAAvP,yBACA2iC,IAEA,IAAAyrE,GAAAhzG,GAEAunC,EAAAjgC,KAAA6M,EAAAqzB,eAAAxnC,QACA,CASA,IAPAooB,EAAAA,GAAAzjB,EAAAM,YAAAkP,EAAAjX,cAAA,QACA6f,GAAAy2F,GAAArlG,KAAAnO,KAAA,GAAA,KAAA,GAAA0B,cACA2lC,EAAAxB,GAAA9oB,IAAA8oB,GAAApE,SACArZ,EAAAtqB,UAAAupC,EAAA,GAAArnC,EAAAiE,QAAAwvG,GAAA,aAAApsE,EAAA,GAGAp+B,EAAAo+B,EAAA,GACAp+B,KACAmf,EAAAA,EAAA+O,SAGAoQ,GAAAtrB,EAAAsrB,EAAAnf,EAAApqB,YAEAoqB,EAAAzjB,EAAAO,WACAkjB,EAAA2N,YAAA,GAUA,MANApxB,GAAAoxB,YAAA,GACApxB,EAAA7G,UAAA,GACAkB,EAAAuoC,EAAA,SAAAnT,GACAzvB,EAAAM,YAAAmvB,KAGAzvB,EAGA,QAAA+uG,IAAA1zG,EAAAmU,GACAA,EAAAA,GAAApX,CACA,IAAA+a,EAEA,QAAAA,EAAA67F,GAAAxlG,KAAAnO,KACAmU,EAAAjX,cAAA4a,EAAA,MAGAA,EAAAy7F,GAAAvzG,EAAAmU,IACA2D,EAAA9Z,cAOA,QAAA0oG,IAAApvF,GACA,GAAAA,YAAAovF,IACA,MAAApvF,EAGA,IAAAs8F,EAMA,IAJApV,EAAAlnF,KACAA,EAAAyH,GAAAzH,GACAs8F,GAAA,KAEA5yG,eAAA0lG,KAAA,CACA,GAAAkN,GAAA,KAAAt8F,EAAA7H,OAAA,GACA,KAAAokG,IAAA,QAAA,mHAEA,OAAA,IAAAnN,IAAApvF,GAGAs8F,EACAE,GAAA9yG,KAAA0yG,GAAAp8F,IAEAw8F,GAAA9yG,KAAAsW,GAIA,QAAAy8F,IAAAz8F,GACA,MAAAA,GAAAtS,WAAA,GAGA,QAAAgvG,IAAA18F,EAAA28F,GAGA,GAFAA,GAAAC,GAAA58F,GAEAA,EAAAjZ,iBAEA,IAAA,GADA81G,GAAA78F,EAAAjZ,iBAAA,KACA4K,EAAA,EAAAmV,EAAA+1F,EAAApxG,OAAAkG,EAAAmV,EAAAnV,IACAirG,GAAAC,EAAAlrG,IAKA,QAAAmrG,IAAA98F,EAAA1N,EAAAmJ,EAAAshG,GACA,GAAAtU,EAAAsU,GAAA,KAAAR,IAAA,UAAA,wDAEA,IAAAS,GAAAC,GAAAj9F,GACAiH,EAAA+1F,GAAAA,EAAA/1F,OACAC,EAAA81F,GAAAA,EAAA91F,MAEA,IAAAA,EAEA,GAAA5U,EAQA5K,EAAA4K,EAAA9C,MAAA,KAAA,SAAA8C,GACA,GAAAm2F,EAAAhtF,GAAA,CACA,GAAAyhG,GAAAj2F,EAAA3U,EAEA,IADAq3F,EAAAuT,MAAAzhG,GACAyhG,GAAAA,EAAAzxG,OAAA,EACA,OAIA0xG,GAAAn9F,EAAA1N,EAAA4U,SACAD,GAAA3U,SAjBA,KAAAA,IAAA2U,GACA,aAAA3U,GACA6qG,GAAAn9F,EAAA1N,EAAA4U,SAEAD,GAAA3U,GAkBA,QAAAsqG,IAAA58F,EAAAwB,GACA,GAAA47F,GAAAp9F,EAAAg8F,MACAgB,EAAAI,GAAArB,GAAAqB,EAEA,IAAAJ,EAAA,CACA,GAAAx7F,EAEA,kBADAw7F,GAAArzG,KAAA6X,EAIAw7F,GAAA91F,SACA81F,EAAA/1F,OAAAkoF,UACA6N,EAAA91F,UAAA,YAEA41F,GAAA98F,UAEA+7F,IAAAqB,GACAp9F,EAAAg8F,MAAAzyG,GAKA,QAAA0zG,IAAAj9F,EAAAq9F,GACA,GAAAD,GAAAp9F,EAAAg8F,MACAgB,EAAAI,GAAArB,GAAAqB,EAOA,OALAC,KAAAL,IACAh9F,EAAAg8F,MAAAoB,EAAA9B,KACA0B,EAAAjB,GAAAqB,IAAAn2F,UAAAtd,QAAAud,OAAA3d,IAGAyzG,EAIA,QAAAM,IAAAt9F,EAAAsD,EAAAhM,GACA,GAAAskG,GAAA57F,GAAA,CAEA,GAAAu9F,GAAA9U,EAAAnxF,GACAkmG,GAAAD,GAAAj6F,IAAA0kF,EAAA1kF,GACAm6F,GAAAn6F,EACA05F,EAAAC,GAAAj9F,GAAAw9F,GACA7zG,EAAAqzG,GAAAA,EAAArzG,IAEA,IAAA4zG,EACA5zG,EAAA2Z,GAAAhM,MACA,CACA,GAAAmmG,EACA,MAAA9zG,EAEA,IAAA6zG,EAEA,MAAA7zG,IAAAA,EAAA2Z,EAEAiB,GAAA5a,EAAA2Z,KAOA,QAAAo6F,IAAA19F,EAAAmS,GACA,QAAAnS,EAAAxS,eACA,KAAAwS,EAAAxS,aAAA,UAAA,IAAA,KAAAb,QAAA,UAAA,KACAlD,QAAA,IAAA0oB,EAAA,QAGA,QAAAwrF,IAAA39F,EAAA49F,GACAA,GAAA59F,EAAAvS,cACA/F,EAAAk2G,EAAApuG,MAAA,KAAA,SAAAquG,GACA79F,EAAAvS,aAAA,QAAAga,IACA,KAAAzH,EAAAxS,aAAA,UAAA,IAAA,KACAb,QAAA,UAAA,KACAA,QAAA,IAAA8a,GAAAo2F,GAAA,IAAA,SAMA,QAAAC,IAAA99F,EAAA49F,GACA,GAAAA,GAAA59F,EAAAvS,aAAA,CACA,GAAAswG,IAAA,KAAA/9F,EAAAxS,aAAA,UAAA,IAAA,KACAb,QAAA,UAAA,IAEAjF,GAAAk2G,EAAApuG,MAAA,KAAA,SAAAquG,GACAA,EAAAp2F,GAAAo2F,GACAE,EAAAt0G,QAAA,IAAAo0G,EAAA,YACAE,GAAAF,EAAA,OAIA79F,EAAAvS,aAAA,QAAAga,GAAAs2F,KAKA,QAAAvB,IAAA5vG,EAAA8P,GAGA,GAAAA,EAGA,GAAAA,EAAAE,SACAhQ,EAAAA,EAAAnB,UAAAiR,MACA,CACA,GAAAjR,GAAAiR,EAAAjR,MAGA,IAAA,gBAAAA,IAAAiR,EAAAvV,SAAAuV,GACA,GAAAjR,EACA,IAAA,GAAAkG,GAAA,EAAAA,EAAAlG,EAAAkG,IACA/E,EAAAA,EAAAnB,UAAAiR,EAAA/K,OAIA/E,GAAAA,EAAAnB,UAAAiR,GAOA,QAAAshG,IAAAh+F,EAAAwB,GACA,MAAAy8F,IAAAj+F,EAAA,KAAAwB,GAAA,gBAAA,cAGA,QAAAy8F,IAAAj+F,EAAAwB,EAAAlK,GAGA0I,EAAApD,UAAAi/F,KACA77F,EAAAA,EAAA/W,gBAIA,KAFA,GAAAigE,GAAAxkD,GAAAlD,GAAAA,GAAAA,GAEAxB,GAAA,CACA,IAAA,GAAArO,GAAA,EAAAo2F,EAAA7+B,EAAAz9D,OAAAkG,EAAAo2F,EAAAp2F,IACA,IAAA2F,EAAAw0F,GAAAniG,KAAAqW,EAAAkpD,EAAAv3D,OAAApI,EAAA,MAAA+N,EAMA0I,GAAAA,EAAAhR,YAAAgR,EAAApD,WAAAshG,IAAAl+F,EAAAm+F,MAIA,QAAAC,IAAAp+F,GAEA,IADA08F,GAAA18F,GAAA,GACAA,EAAApS,YACAoS,EAAA1Q,YAAA0Q,EAAApS,YAIA,QAAAywG,IAAAr+F,EAAAswB,GACAA,GAAAosE,GAAA18F,EACA,IAAAlV,GAAAkV,EAAAhR,UACAlE,IAAAA,EAAAwE,YAAA0Q,GAIA,QAAAs+F,IAAAlqD,EAAA3S,GACAA,EAAAA,GAAAt6C,EACA,aAAAs6C,EAAAh8C,SAAAuI,WAIAyzC,EAAAhxC,WAAA2jD,GAGA03C,GAAArqD,GAAAnmC,GAAA,OAAA84C,GAiEA,QAAAmqD,IAAAv+F,EAAAwB,GAEA,GAAAg9F,GAAAC,GAAAj9F,EAAApX,cAGA,OAAAo0G,IAAAE,GAAAjV,EAAAzpF,KAAAw+F,EAGA,QAAAG,IAAA3+F,EAAAwB,GACA,GAAAtS,GAAA8Q,EAAA9Q,QACA,QAAA,UAAAA,GAAA,aAAAA,IAAA0vG,GAAAp9F,GAgLA,QAAAq9F,IAAA7+F,EAAAiH,GACA,GAAA63F,GAAA,SAAA37F,EAAA7Q,GAEA6Q,EAAA+mB,mBAAA,WACA,MAAA/mB,GAAAspB,iBAGA,IAAAsyE,GAAA93F,EAAA3U,GAAA6Q,EAAA7Q,MACA0sG,EAAAD,EAAAA,EAAAtzG,OAAA,CAEA,IAAAuzG,EAAA,CAEA,GAAAxW,EAAArlF,EAAA87F,6BAAA,CACA,GAAAC,GAAA/7F,EAAAypB,wBACAzpB,GAAAypB,yBAAA,WACAzpB,EAAA87F,6BAAA,EAEA97F,EAAAunB,iBACAvnB,EAAAunB,kBAGAw0E,GACAA,EAAAp4G,KAAAqc,IAKAA,EAAAsnB,8BAAA,WACA,MAAAtnB,GAAA87F,+BAAA,GAIAD,EAAA,IACAD,EAAA5U,EAAA4U,GAGA,KAAA,GAAAptG,GAAA,EAAAA,EAAAqtG,EAAArtG,IACAwR,EAAAsnB,iCACAs0E,EAAAptG,GAAA7K,KAAAkZ,EAAAmD,IAQA,OADA27F,GAAA38F,KAAAnC,EACA8+F,EA0PA,QAAA7D,MACAvxG,KAAAy1G,KAAA,WACA,MAAA56F,GAAA6qF,IACA71D,SAAA,SAAAzc,EAAAkc,GAEA,MADAlc,GAAA3yB,OAAA2yB,EAAAA,EAAA,IACA4gF,GAAA5gF,EAAAkc,IAEAlvC,SAAA,SAAAgzB,EAAAkc,GAEA,MADAlc,GAAA3yB,OAAA2yB,EAAAA,EAAA,IACAghF,GAAAhhF,EAAAkc,IAEAnvC,YAAA,SAAAizB,EAAAkc,GAEA,MADAlc,GAAA3yB,OAAA2yB,EAAAA,EAAA,IACA6gF,GAAA7gF,EAAAkc,OAkBA,QAAAomE,IAAA7jG,EAAA8jG,GACA,GAAA/7F,GAAA/H,GAAAA,EAAAosF,SAEA,IAAArkF,EAIA,MAHA,kBAAAA,KACAA,EAAA/H,EAAAosF,aAEArkF,CAGA,IAAAg8F,SAAA/jG,EAOA,OALA+H,GADA,YAAAg8F,GAAA,UAAAA,GAAA,OAAA/jG,EACAA,EAAAosF,UAAA2X,EAAA,KAAAD,GAAA7X,KAEA8X,EAAA,IAAA/jG,EASA,QAAAgkG,IAAA3V,EAAA4V,GACA,GAAAA,EAAA,CACA,GAAA/X,GAAA,CACA/9F,MAAA89F,QAAA,WACA,QAAAC,GAGA//F,EAAAkiG,EAAAlgG,KAAA+1G,IAAA/1G,MAyGA,QAAAg2G,IAAAjkG,GAGA,GAAAkkG,GAAAlkG,EAAAsW,WAAAplB,QAAAizG,GAAA,IACA5jG,EAAA2jG,EAAAnvG,MAAAqvG,GACA,OAAA7jG,GACA,aAAAA,EAAA,IAAA,IAAArP,QAAA,YAAA,KAAA,IAEA,KAGA,QAAAmzG,IAAArkG,EAAAuxF,EAAAxrF,GACA,GAAAu+F,GACAJ,EACAK,EACA3+F,CAEA,IAAA,kBAAA5F,IACA,KAAAskG,EAAAtkG,EAAAskG,SAAA,CAEA,GADAA,KACAtkG,EAAAhQ,OAAA,CACA,GAAAuhG,EAIA,KAHA9F,GAAA1lF,IAAAA,IACAA,EAAA/F,EAAA+F,MAAAk+F,GAAAjkG,IAEAw0F,GAAA,WACA,4EAAAzuF,EAEAm+F,GAAAlkG,EAAAsW,WAAAplB,QAAAizG,GAAA,IACAI,EAAAL,EAAAnvG,MAAAqvG,IACAn4G,EAAAs4G,EAAA,GAAAxwG,MAAAywG,IAAA,SAAA5rF,GACAA,EAAA1nB,QAAAuzG,GAAA,SAAA1tF,EAAA2tF,EAAA3+F,GACAu+F,EAAA/vG,KAAAwR,OAIA/F,EAAAskG,QAAAA,OAEAr7F,IAAAjJ,IACA4F,EAAA5F,EAAAhQ,OAAA,EACA8jG,GAAA9zF,EAAA4F,GAAA,MACA0+F,EAAAtkG,EAAA5U,MAAA,EAAAwa,IAEAkuF,GAAA9zF,EAAA,MAAA,EAEA,OAAAskG,GAqfA,QAAAvS,IAAA4S,EAAApT,GAuCA,QAAAqT,GAAAxmE,GACA,MAAA,UAAAv2B,EAAAhM,GACA,MAAA0wF,GAAA1kF,OACA5b,GAAA4b,EAAAgkF,EAAAztD,IAEAA,EAAAv2B,EAAAhM,IAKA,QAAAg5F,GAAA9uF,EAAA8+F,GAKA,GAJA7Q,GAAAjuF,EAAA,YACAS,EAAAq+F,IAAA57F,GAAA47F,MACAA,EAAAC,EAAAC,YAAAF,KAEAA,EAAAnB,KACA,KAAAlP,IAAA,OAAA,kDAAAzuF,EAEA,OAAAi/F,GAAAj/F,EAAAk/F,GAAAJ,EAGA,QAAAK,GAAAn/F,EAAA3U,GACA,MAAA,YACA,GAAAwgB,GAAAuzF,EAAAnT,OAAA5gG,EAAAnD,KACA,IAAA8+F,EAAAn7E,GACA,KAAA4iF,IAAA,QAAA,+DAAAzuF,EAEA,OAAA6L,IAIA,QAAAxgB,GAAA2U,EAAAq/F,EAAAC,GACA,MAAAxQ,GAAA9uF,GACA29F,KAAA2B,KAAA,EAAAH,EAAAn/F,EAAAq/F,GAAAA,IAIA,QAAA1P,GAAA3vF,EAAAmR,GACA,MAAA9lB,GAAA2U,GAAA,YAAA,SAAAu/F,GACA,MAAAA,GAAAP,YAAA7tF,MAIA,QAAArb,GAAAkK,EAAAjX,GAAA,MAAAsC,GAAA2U,EAAA8mF,EAAA/9F,IAAA,GAEA,QAAA6mG,GAAA5vF,EAAAlK,GACAm4F,GAAAjuF,EAAA,YACAi/F,EAAAj/F,GAAAlK,EACA0pG,EAAAx/F,GAAAlK,EAGA,QAAA+5F,GAAA4P,EAAAC,GACA,GAAAC,GAAAZ,EAAA93F,IAAAw4F,EAAAP,GACAU,EAAAD,EAAAhC,IAEAgC,GAAAhC,KAAA,WACA,GAAAkC,GAAAT,EAAAnT,OAAA2T,EAAAD,EACA,OAAAP,GAAAnT,OAAAyT,EAAA,MAAAI,UAAAD,KAOA,QAAAE,GAAAnB,GACA,GAAAoB,GAAAzQ,IA4CA,OA3CArpG,GAAA04G,EAAA,SAAAlzG,GAIA,QAAAu0G,GAAA11F,GACA,GAAApa,GAAAo2F,CACA,KAAAp2F,EAAA,EAAAo2F,EAAAh8E,EAAAtgB,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA,GAAA+vG,GAAA31F,EAAApa,GACA2+F,EAAAiQ,EAAA93F,IAAAi5F,EAAA,GAEApR,GAAAoR,EAAA,IAAAljG,MAAA8xF,EAAAoR,EAAA,KATA,IAAAC,EAAAl5F,IAAAvb,GAAA,CACAy0G,EAAAlC,IAAAvyG,GAAA,EAYA,KACAg6F,EAAAh6F,IACAs0G,EAAAxP,GAAA9kG,GACA6jG,EAAAA,EAAApsF,OAAA48F,EAAAC,EAAArR,WAAAxrF,OAAA68F,EAAAtQ,YACAuQ,EAAAD,EAAAxQ,cACAyQ,EAAAD,EAAAvQ,gBACAhvF,EAAA/U,GACA6jG,EAAA/gG,KAAAuwG,EAAA9S,OAAAvgG,IACAwX,GAAAxX,GACA6jG,EAAA/gG,KAAAuwG,EAAA9S,OAAAvgG,IAEAqiG,GAAAriG,EAAA,UAEA,MAAAnE,GAYA,KAXA2b,IAAAxX,KACAA,EAAAA,EAAAA,EAAAzB,OAAA,IAEA1C,EAAAwU,SAAAxU,EAAAi7B,OAAAj7B,EAAAi7B,MAAAv6B,QAAAV,EAAAwU,eAMAxU,EAAAA,EAAAwU,QAAA,KAAAxU,EAAAi7B,OAEAisE,GAAA,WAAA,gDACA/iG,EAAAnE,EAAAi7B,OAAAj7B,EAAAwU,SAAAxU,OAGAgoG,EAOA,QAAA6Q,GAAA/lG,EAAAhP,GAEA,QAAAg1G,GAAAZ,EAAAa,GACA,GAAAjmG,EAAAoW,eAAAgvF,GAAA,CACA,GAAAplG,EAAAolG,KAAAc,EACA,KAAA9R,IAAA,OAAA,iCACAgR,EAAA,OAAAvrC,EAAA/lE,KAAA,QAEA,OAAAkM,GAAAolG,GAEA,IAGA,MAFAvrC,GAAAxmD,QAAA+xF,GACAplG,EAAAolG,GAAAc,EACAlmG,EAAAolG,GAAAp0G,EAAAo0G,EAAAa,GACA,MAAA38F,GAIA,KAHAtJ,GAAAolG,KAAAc,SACAlmG,GAAAolG,GAEA97F,EACA,QACAuwD,EAAAhmE,SAKA,QAAA+9F,GAAAhyF,EAAA0mB,EAAA6/E,EAAAf,GACA,gBAAAe,KACAf,EAAAe,EACAA,EAAA,KAGA,IAEAv2G,GAAAkG,EACA2R,EAHAtH,KACA+jG,EAAAvS,GAAAyU,WAAAxmG,EAAAuxF,EAAAiU,EAIA,KAAAtvG,EAAA,EAAAlG,EAAAs0G,EAAAt0G,OAAAkG,EAAAlG,EAAAkG,IAAA,CAEA,GADA2R,EAAAy8F,EAAApuG,GACA,gBAAA2R,GACA,KAAA2sF,IAAA,OACA,sEAAA3sF,EAEAtH,GAAAhM,KACAgyG,GAAAA,EAAA/vF,eAAA3O,GACA0+F,EAAA1+F,GACAu+F,EAAAv+F,EAAA29F,IASA,MANAv8F,IAAAjJ,KACAA,EAAAA,EAAAhQ,IAKAgQ,EAAA+C,MAAA2jB,EAAAnmB,GAGA,QAAAwkG,GAAA0B,EAAAF,EAAAf,GAIA,GAAA3+C,GAAApyD,OAAAk2E,QAAA1hE,GAAAw9F,GAAAA,EAAAA,EAAAz2G,OAAA,GAAAy2G,GAAA13F,WAAA,MACA23F,EAAA1U,EAAAyU,EAAA5/C,EAAA0/C,EAAAf,EAEA,OAAAjZ,GAAAma,IAAAlgG,EAAAkgG,GAAAA,EAAA7/C,EAGA,OACAmrC,OAAAA,EACA+S,YAAAA,EACA/3F,IAAAo5F,EACA/B,SAAAtS,GAAAyU,WACAhiF,IAAA,SAAAze,GACA,MAAAi/F,GAAAxuF,eAAAzQ,EAAAk/F,IAAA7kG,EAAAoW,eAAAzQ,KAnOAwrF,EAAAA,KAAA,CACA,IAAA+U,MACArB,EAAA,WACAhrC,KACAisC,EAAA,GAAApC,SAAA,IACAkB,GACApT,UACAiD,SAAA+P,EAAA/P,GACAzjG,QAAAwzG,EAAAxzG,GACAskG,QAAAkP,EAAAlP,GACA75F,MAAA+oG,EAAA/oG,GACA85F,SAAAiP,EAAAjP,GACAC,UAAAA,IAGAkP,EAAAE,EAAAM,UACAa,EAAAnB,EAAA,SAAAQ,EAAAa,GAIA,KAHAhU,IAAA5G,SAAA4a,IACApsC,EAAA1lE,KAAA8xG,GAEA7R,GAAA,OAAA,wBAAAv6B,EAAA/lE,KAAA,WAEAqxG,KACAJ,EAAAI,EAAAD,UACAa,EAAAZ,EAAA,SAAAC,EAAAa,GACA,GAAAxR,GAAAiQ,EAAA93F,IAAAw4F,EAAAP,EAAAoB,EACA,OAAAlB,GAAAnT,OAAA6C,EAAA6O,KAAA7O,EAAA/mG,EAAA03G,IAMA,OAFAv5G,GAAA65G,EAAAnB,GAAA,SAAA3kG,GAAAA,GAAAmlG,EAAAnT,OAAAhyF,KAEAmlG,EAmNA,QAAA3J,MAEA,GAAAmL,IAAA,CAeA14G,MAAA24G,qBAAA,WACAD,GAAA,GAgJA14G,KAAAy1G,MAAA,UAAA,YAAA,aAAA,SAAAzE,EAAA1B,EAAAM,GAMA,QAAAgJ,GAAAj9F,GACA,GAAAgI,GAAA,IAOA,OANAoG,OAAAjJ,UAAA+3F,KAAAz7G,KAAAue,EAAA,SAAArF,GACA,GAAA,MAAAypF,EAAAzpF,GAEA,MADAqN,GAAArN,GACA,IAGAqN,EAGA,QAAAm1F,KAEA,GAAA1hE,GAAA2b,EAAAgmD,OAEA,IAAAxgG,EAAA6+B,GACAA,EAAAA,QACA,IAAAyoD,EAAAzoD,GAAA,CACA,GAAA3+B,GAAA2+B,EAAA,GACAh7C,EAAA40G,EAAAvpE,iBAAAhvB,EAEA2+B,GADA,UAAAh7C,EAAAmG,SACA,EAEAkW,EAAAw/B,wBAAA0Z,WAEAstC,GAAA7nD,KACAA,EAAA,EAGA,OAAAA,GAGA,QAAAkB,GAAA7/B,GACA,GAAAA,EAAA,CACAA,EAAAugG,gBAEA,IAAA5hE,GAAA0hE,GAEA,IAAA1hE,EAAA,CAcA,GAAA6hE,GAAAxgG,EAAAw/B,wBAAA3kB,GACA09E,GAAAkI,SAAA,EAAAD,EAAA7hE,QAGA45D,GAAA14D,SAAA,EAAA,GAIA,QAAAya,GAAAp8B,GACAA,EAAA6mE,EAAA7mE,GAAAA,EAAA24E,EAAA34E,MACA,IAAAwiF,EAGAxiF,IAGAwiF,EAAAp9G,EAAAC,eAAA26B,IAAA2hB,EAAA6gE,IAGAA,EAAAP,EAAA78G,EAAA03B,kBAAAkD,KAAA2hB,EAAA6gE,GAGA,QAAAxiF,GAAA2hB,EAAA,MATAA,EAAA,MAtEA,GAAAv8C,GAAAi1G,EAAAj1G,QAgGA,OAZA28G,IACA9I,EAAAvQ,OAAA,WAAA,MAAAiQ,GAAA34E,QACA,SAAAyiF,EAAAC,GAEAD,IAAAC,GAAA,KAAAD,GAEAxE,GAAA,WACAhF,EAAAxQ,WAAArsC,OAKAA,IAQA,QAAAumD,IAAAh6G,EAAAkC,GACA,MAAAlC,IAAAkC,EACAlC,EACAkC,GACAwZ,GAAA1b,KAAAA,EAAAA,EAAA2G,KAAA,MACA+U,GAAAxZ,KAAAA,EAAAA,EAAAyE,KAAA,MACA3G,EAAA,IAAAkC,GAHAlC,EADAkC,EADA,GAQA,QAAA+3G,IAAAjjG,GACA,IAAA,GAAArO,GAAA,EAAAA,EAAAqO,EAAAvU,OAAAkG,IAAA,CACA,GAAAkxG,GAAA7iG,EAAArO,EACA,IAAAkxG,EAAAjmG,WAAAsmG,GACA,MAAAL,IAKA,QAAAM,IAAAnqE,GACAkuD,EAAAluD,KACAA,EAAAA,EAAAxpC,MAAA,KAKA,IAAA+L,GAAAmvF,IAQA,OAPAhjG,GAAAsxC,EAAA,SAAAoqE,GAGAA,EAAA33G,SACA8P,EAAA6nG,IAAA,KAGA7nG,EAUA,QAAA8nG,IAAAj8G,GACA,MAAA4gG,GAAA5gG,GACAA,KA4hBA,QAAA2zG,MACArxG,KAAAy1G,MAAA,QAAA,WAAA,SAAAvE,EAAAJ,GACA,MAAAI,GAAAr6F,UACA,SAAA9E,GAAA,MAAAm/F,GAAAn/F,IACA,SAAAA,GACA,MAAA++F,GAAA/+F,EAAA,GAAA,MA4BA,QAAA6nG,IAAAn8G,EAAA1B,EAAAyzG,EAAAc,GAsBA,QAAAuJ,GAAA9nG,GACA,IACAA,EAAA+C,MAAA,KAAAqsF,EAAA5uF,UAAA,IACA,QAEA,GADAunG,IACA,IAAAA,EACA,KAAAC,EAAAh4G,QACA,IACAg4G,EAAA5pG,QACA,MAAA9Q,GACAmwG,EAAAhoF,MAAAnoB,KAOA,QAAA26G,GAAAj0G,GACA,GAAAxF,GAAAwF,EAAAhG,QAAA,IACA,OAAAQ,QAAA,GAAAwF,EAAAkO,OAAA1T,GA0HA,QAAA05G,KACAC,IACAC,IAGA,QAAAC,KACA,IACA,MAAA7xB,GAAA/5E,MACA,MAAAnP,KAOA,QAAA66G,KAEAG,EAAAD,IACAC,EAAAvb,EAAAub,GAAA,KAAAA,EAGA3Z,EAAA2Z,EAAAC,KACAD,EAAAC,GAEAA,EAAAD,EAGA,QAAAF,KACAI,IAAA9hF,EAAA1yB,OAAAy0G,IAAAH,IAIAE,EAAA9hF,EAAA1yB,MACAy0G,EAAAH,EACAr8G,EAAAy8G,EAAA,SAAAC,GACAA,EAAAjiF,EAAA1yB,MAAAs0G,MArMA,GAAA5hF,GAAAz4B,KAEA+C,GADAhH,EAAA,GACA0B,EAAAsF,UACAwlF,EAAA9qF,EAAA8qF,QACAxhF,EAAAtJ,EAAAsJ,WACAqB,EAAA3K,EAAA2K,aACAuyG,IAEAliF,GAAAmiF,QAAA,CAEA,IAAAd,GAAA,EACAC,IAGAthF,GAAAoiF,6BAAAhB,EACAphF,EAAAqiF,6BAAA,WAAAhB,KAkCArhF,EAAAsiF,gCAAA,SAAAzxF,GACA,IAAAwwF,EACAxwF,IAEAywF,EAAAzzG,KAAAgjB,GAQA,IAAA+wF,GAAAG,EACAD,EAAAx3G,EAAA4R,KACAqmG,EAAAj/G,EAAAmE,KAAA,QACA+6G,EAAA,IAEAf,KACAM,EAAAH,EAsBA5hF,EAAA1yB,IAAA,SAAAA,EAAA9C,EAAAuL,GAaA,GATAswF,EAAAtwF,KACAA,EAAA,MAIAzL,IAAAtF,EAAAsF,WAAAA,EAAAtF,EAAAsF,UACAwlF,IAAA9qF,EAAA8qF,UAAAA,EAAA9qF,EAAA8qF,SAGAxiF,EAAA,CACA,GAAAm1G,GAAAV,IAAAhsG,CAKA,IAAA+rG,IAAAx0G,KAAAuqG,EAAA/nB,SAAA2yB,GACA,MAAAziF,EAEA,IAAA0iF,GAAAZ,GAAAa,GAAAb,KAAAa,GAAAr1G,EAwBA,OAvBAw0G,GAAAx0G,EACAy0G,EAAAhsG,GAKA8hG,EAAA/nB,SAAA4yB,GAAAD,GAMAC,IAAAF,IACAA,EAAAl1G,GAEA9C,EACAF,EAAAE,QAAA8C,GACAo1G,EAGAp4G,EAAA4zB,KAAAqjF,EAAAj0G,GAFAhD,EAAA4R,KAAA5O,IAXAwiF,EAAAtlF,EAAA,eAAA,aAAAuL,EAAA,GAAAzI,GACAm0G,IAEAM,EAAAH,GAaA5hF,EAMA,MAAAwiF,IAAAl4G,EAAA4R,KAAA1R,QAAA,OAAA,MAcAw1B,EAAAjqB,MAAA,WACA,MAAA6rG,GAGA,IAAAI,MACAY,GAAA,EAgBAf,EAAA,IA8CA7hF,GAAA6iF,YAAA,SAAAhyF,GAgBA,MAdA+xF,KAMA/K,EAAA/nB,SAAA6Z,GAAA3kG,GAAAmU,GAAA,WAAAqoG,GAEA7X,GAAA3kG,GAAAmU,GAAA,aAAAqoG,GAEAoB,GAAA,GAGAZ,EAAAn0G,KAAAgjB,GACAA,GASAmP,EAAA8iF,uBAAA,WACAnZ,GAAA3kG,GAAA2+B,IAAA,sBAAA69E,IAQAxhF,EAAA+iF,iBAAArB,EAeA1hF,EAAAgjF,SAAA,WACA,GAAA9mG,GAAAqmG,EAAAv6G,KAAA,OACA,OAAAkU,GAAAA,EAAA1R,QAAA,yBAAA,IAAA,IAiBAw1B,EAAA0E,MAAA,SAAAprB,EAAAm7B,GACA,GAAAwuE,EAOA,OANA5B,KACA4B,EAAA30G,EAAA,iBACA4zG,GAAAe,GACA7B,EAAA9nG,IACAm7B,GAAA,GACAytE,EAAAe,IAAA,EACAA,GAcAjjF,EAAA0E,MAAAw+E,OAAA,SAAAC,GACA,QAAAjB,EAAAiB,WACAjB,GAAAiB,GACAxzG,EAAAwzG,GACA/B,EAAAppG,IACA,IAOA,QAAAs9F,MACA/tG,KAAAy1G,MAAA,UAAA,OAAA,WAAA,YACA,SAAAzE,EAAAxB,EAAAc,EAAAlC,GACA,MAAA,IAAAwL,IAAA5I,EAAA5C,EAAAoB,EAAAc,KAqFA,QAAArC,MAEAjuG,KAAAy1G,KAAA,WAGA,QAAAoG,GAAAC,EAAAp+G,GAwMA,QAAA02D,GAAAn2D,GACAA,GAAA89G,IACAC,EAEAA,GAAA/9G,IACA+9G,EAAA/9G,EAAAi7B,GAFA8iF,EAAA/9G,EAKAg+G,EAAAh+G,EAAAi7B,EAAAj7B,EAAAgtC,GACAgxE,EAAAh+G,EAAA89G,GACAA,EAAA99G,EACA89G,EAAA7iF,EAAA,MAQA,QAAA+iF,GAAAC,EAAAC,GACAD,GAAAC,IACAD,IAAAA,EAAAjxE,EAAAkxE,GACAA,IAAAA,EAAAjjF,EAAAgjF,IA7NA,GAAAJ,IAAAM,GACA,KAAArf,GAAA,iBAAA,MAAA,kCAAA+e,EAGA,IAAA5rG,GAAA,EACAmsG,EAAAxhG,KAAAnd,GAAAuH,GAAA62G,IACA77G,KACAq8G,EAAA5+G,GAAAA,EAAA4+G,UAAAp6D,OAAAq6D,UACAC,KACAT,EAAA,KACAC,EAAA,IAyCA,OAAAI,GAAAN,IAoBA/F,IAAA,SAAAn8F,EAAAhM,GACA,IAAAkxF,EAAAlxF,GAAA,CACA,GAAA0uG,EAAAp6D,OAAAq6D,UAAA,CACA,GAAAE,GAAAD,EAAA5iG,KAAA4iG,EAAA5iG,IAAAA,IAAAA,GAEAw6C,GAAAqoD,GAUA,MAPA7iG,KAAA3Z,IAAAiQ,IACAjQ,EAAA2Z,GAAAhM,EAEAsC,EAAAosG,GACAt8G,KAAAvB,OAAAu9G,EAAApiG,KAGAhM,IAcAmR,IAAA,SAAAnF,GACA,GAAA0iG,EAAAp6D,OAAAq6D,UAAA,CACA,GAAAE,GAAAD,EAAA5iG,EAEA,KAAA6iG,EAAA,MAEAroD,GAAAqoD,GAGA,MAAAx8G,GAAA2Z,IAcAnb,OAAA,SAAAmb,GACA,GAAA0iG,EAAAp6D,OAAAq6D,UAAA,CACA,GAAAE,GAAAD,EAAA5iG,EAEA,KAAA6iG,EAAA,MAEAA,IAAAV,IAAAA,EAAAU,EAAAxxE,GACAwxE,GAAAT,IAAAA,EAAAS,EAAAvjF,GACA+iF,EAAAQ,EAAAvjF,EAAAujF,EAAAxxE,SAEAuxE,GAAA5iG,SAGA3Z,GAAA2Z,GACA1J,KAYAwsG,UAAA,WACAz8G,KACAiQ,EAAA,EACAssG,KACAT,EAAAC,EAAA,MAaAn6D,QAAA,WACA5hD,EAAA,KACAo8G,EAAA,KACAG,EAAA,WACAJ,GAAAN,IAoBA32D,KAAA,WACA,MAAAtqC,MAAAwhG,GAAAnsG,KAAAA,MAlMA,GAAAksG,KAuQA,OAxBAP,GAAA12D,KAAA,WACA,GAAAA,KAIA,OAHAnnD,GAAAo+G,EAAA,SAAAjqG,EAAA2pG,GACA32D,EAAA22D,GAAA3pG,EAAAgzC,SAEAA,GAcA02D,EAAA98F,IAAA,SAAA+8F,GACA,MAAAM,GAAAN,IAIAD,GA+CA,QAAApL,MACAzwG,KAAAy1G,MAAA,gBAAA,SAAAzH,GACA,MAAAA,GAAA,eAstBA,QAAAtF,IAAA/E,EAAAgZ,GAaA,QAAAC,GAAA5Y,EAAA6Y,EAAAC,GACA,GAAAC,GAAA,qCAEAC,IAsBA,OApBAh/G,GAAAgmG,EAAA,SAAAiZ,EAAAC,GACA,GAAAp2G,GAAAm2G,EAAAn2G,MAAAi2G,EAEA,KAAAj2G,EACA,KAAAq2G,IAAA,OACA,oEAEAN,EAAAK,EAAAD,EACAH,EAAA,iCACA,2BAGAE,GAAAE,IACAh6D,KAAAp8C,EAAA,GAAA,GACA4a,WAAA,MAAA5a,EAAA,GACAi1C,SAAA,MAAAj1C,EAAA,GACAs2G,SAAAt2G,EAAA,IAAAo2G,KAIAF,EAGA,QAAAK,GAAAzV,EAAAiV,GACA,GAAAG,IACA3X,aAAA,KACAiY,iBAAA,KAgBA,IAdAhf,EAAAsJ,EAAA5D,SACA4D,EAAA0V,oBAAA,GACAN,EAAAM,iBAAAV,EAAAhV,EAAA5D,MACA6Y,GAAA,GACAG,EAAA3X,iBAEA2X,EAAA3X,aAAAuX,EAAAhV,EAAA5D,MACA6Y,GAAA,IAGAve,EAAAsJ,EAAA0V,oBACAN,EAAAM,iBACAV,EAAAhV,EAAA0V,iBAAAT,GAAA,IAEAve,EAAA0e,EAAAM,kBAAA,CACA,GAAAhY,GAAAsC,EAAAtC,WACAiY,EAAA3V,EAAA2V,YACA,KAAAjY,EAEA,KAAA6X,IAAA,SACA,iEACAN,EACA,KAAAW,GAAAlY,EAAAiY,GAEA,KAAAJ,IAAA,UACA,oEACAN,GAGA,MAAAG,GAGA,QAAAS,GAAA3lG,GACA,GAAAiR,GAAAjR,EAAArJ,OAAA,EACA,KAAAsa,GAAAA,IAAAi3E,GAAAj3E,GACA,KAAAo0F,IAAA,SAAA,kFAAArlG,EAEA,IAAAA,IAAAA,EAAAiG,OACA,KAAAo/F,IAAA,SACA,+FACArlG,GArFA,GAAA4lG,MACAC,EAAA,YACAC,EAAA,sCACAC,EAAA,8BACAC,EAAAhe,EAAA,6BACAie,EAAA,8BAKAC,EAAA,yBA8FAh+G,MAAA4nG,UAAA,QAAAqW,GAAAnmG,EAAAomG,GAyCA,MAxCAnY,IAAAjuF,EAAA,aACA0lF,EAAA1lF,IACA2lG,EAAA3lG,GACA6tF,GAAAuY,EAAA,oBACAR,EAAAn1F,eAAAzQ,KACA4lG,EAAA5lG,MACA6rF,EAAAxgG,QAAA2U,EAAA6lG,GAAA,YAAA,oBACA,SAAAtG,EAAA/I,GACA,GAAA6P,KAyBA,OAxBAngH,GAAA0/G,EAAA5lG,GAAA,SAAAomG,EAAA39G,GACA,IACA,GAAAqnG,GAAAyP,EAAAtT,OAAAma,EACA3lG,GAAAqvF,GACAA,GAAAl3E,QAAAkuE,EAAAgJ,KACAA,EAAAl3E,SAAAk3E,EAAAqU,OACArU,EAAAl3E,QAAAkuE,EAAAgJ,EAAAqU,OAEArU,EAAAwW,SAAAxW,EAAAwW,UAAA,EACAxW,EAAArnG,MAAAA,EACAqnG,EAAA9vF,KAAA8vF,EAAA9vF,MAAAA,EACA8vF,EAAA5uD,QAAA4uD,EAAA5uD,SAAA4uD,EAAAtC,YAAAsC,EAAA9vF,KACA8vF,EAAAyW,SAAAzW,EAAAyW,UAAA,IACA,IAAArB,GAAApV,EAAA0W,WACAjB,EAAAzV,EAAAA,EAAA9vF,KACAwmF,GAAA0e,EAAA3X,gBACAuC,EAAA2W,kBAAAvB,EAAA3X,cAEAuC,EAAAT,aAAA+W,EAAA/W,aACAgX,EAAA73G,KAAAshG,GACA,MAAAvoG,GACAivG,EAAAjvG,MAGA8+G,MAGAT,EAAA5lG,GAAAxR,KAAA43G,IAEAlgH,EAAA8Z,EAAA8lF,EAAAqgB,IAEAj+G,MAwBAA,KAAAw+G,2BAAA,SAAAC,GACA,MAAA1f,GAAA0f,IACA9B,EAAA6B,2BAAAC,GACAz+G,MAEA28G,EAAA6B,8BAyBAx+G,KAAA0+G,4BAAA,SAAAD,GACA,MAAA1f,GAAA0f,IACA9B,EAAA+B,4BAAAD,GACAz+G,MAEA28G,EAAA+B,8BA0BA,IAAA9a,IAAA,CACA5jG,MAAA4jG,iBAAA,SAAA7sE,GACA,MAAAgoE,GAAAhoE,IACA6sE,EAAA7sE,EACA/2B,MAEA4jG,GAGA5jG,KAAAy1G,MACA,YAAA,eAAA,oBAAA,mBAAA,SACA,cAAA,aAAA,YAAA,OAAA,WAAA,gBACA,SAAA4B,EAAA3I,EAAAJ,EAAAoC,EAAAhB,EACAxB,EAAA0B,EAAAxB,EAAA8B,EAAA1C,EAAAhF,GA2OA,QAAAmW,GAAAt/D,EAAAljD,GACA,IACAkjD,EAAAj/C,SAAAjE,GACA,MAAAkD,KA6CA,QAAAqxB,GAAAkuF,EAAAC,EAAAC,EAAAC,EACAC,GACAJ,YAAAxc,MAGAwc,EAAAxc,GAAAwc,IAIA5gH,EAAA4gH,EAAA,SAAAxrF,EAAA7yB,GACA6yB,EAAAlgB,UAAAovF,IAAAlvE,EAAA4B,UAAAluB,MAAA,SACA83G,EAAAr+G,GAAA6hG,GAAAhvE,GAAAiT,KAAA,iBAAAjlC,SAAA,KAGA,IAAA69G,GACAC,EAAAN,EAAAC,EAAAD,EACAE,EAAAC,EAAAC,EACAtuF,GAAAyuF,gBAAAP,EACA,IAAAr/E,GAAA,IACA,OAAA,UAAAykE,EAAAob,EAAA1hH,GACAioG,GAAA3B,EAAA,SAEAtmG,EAAAA,KACA,IAAA2hH,GAAA3hH,EAAA2hH,wBACAC,EAAA5hH,EAAA4hH,sBACAC,EAAA7hH,EAAA6hH,mBAMAF,IAAAA,EAAAG,oBACAH,EAAAA,EAAAG,mBAGAjgF,IACAA,EAAAkgF,EAAAF,GAEA,IAAAG,EAkBA,IAXAA,EANA,SAAAngF,EAMA6iE,GACAud,EAAApgF,EAAA6iE,GAAA,SAAA5/F,OAAAo8G,GAAA5/G,SAEAogH,EAGAha,GAAAjjG,MAAA/E,KAAAwhH,GAEAA,EAGAU,EACA,IAAA,GAAAM,KAAAN,GACAI,EAAAz/G,KAAA,IAAA2/G,EAAA,aAAAN,EAAAM,GAAAhnD,SAQA,OAJAloC,GAAAmvF,eAAAH,EAAA1b,GAEAob,GAAAA,EAAAM,EAAA1b,GACAib,GAAAA,EAAAjb,EAAA0b,EAAAA,EAAAL,GACAK,GAIA,QAAAD,GAAAlhH,GAEA,GAAA60B,GAAA70B,GAAAA,EAAA,EACA,OAAA60B,IAGA,kBAAA2sE,EAAA3sE,IAAAA,EAAA/K,WAAAvhB,MAAA,OAAA,MAFA,OAqBA,QAAAo4G,GAAAY,EAAAjB,EAAAkB,EAAAjB,EAAAC,EACAC,GA0CA,QAAAC,GAAAjb,EAAA8b,EAAAC,EAAAV,GACA,GAAAW,GAAAC,EAAA7sF,EAAA8sF,EAAAj4G,EAAAo2F,EAAAhoE,EAAA8pF,EACAC,CAGA,IAAAC,EAAA,CAGA,GAAAC,GAAAR,EAAA/9G,MAIA,KAHAq+G,EAAA,GAAAr2F,OAAAu2F,GAGAr4G,EAAA,EAAAA,EAAAs4G,EAAAx+G,OAAAkG,GAAA,EACAouB,EAAAkqF,EAAAt4G,GACAm4G,EAAA/pF,GAAAypF,EAAAzpF,OAGA+pF,GAAAN,CAGA,KAAA73G,EAAA,EAAAo2F,EAAAkiB,EAAAx+G,OAAAkG,EAAAo2F,GAKA,GAJAjrE,EAAAgtF,EAAAG,EAAAt4G,MACA+3G,EAAAO,EAAAt4G,KACAg4G,EAAAM,EAAAt4G,KAEA+3G,EAAA,CACA,GAAAA,EAAAhc,MAAA,CACAkc,EAAAlc,EAAAwc,OACA9vF,EAAAmvF,eAAAzd,GAAAhvE,GAAA8sF,EACA,IAAAO,GAAAT,EAAAU,iBACAD,KACAT,EAAAU,kBAAA,KACAR,EAAAS,IAAA,aAAAF,QAGAP,GAAAlc,CAIAmc,GADAH,EAAAY,wBACAC,EACA7c,EAAAgc,EAAAc,WAAAzB,IAEAW,EAAAe,uBAAA1B,EACAA,GAEAA,GAAAR,EACAgC,EAAA7c,EAAA6a,GAGA,KAGAmB,EAAAC,EAAAC,EAAA9sF,EAAA2sF,EAAAI,EACAH,OAEAC,IACAA,EAAAjc,EAAA5wE,EAAAp2B,WAAA6C,EAAAw/G,GA9FA,IAAA,GAFAh+F,GAAA88F,EAAA6B,EAAAhjH,EAAAijH,EAAAe,EAAAX,EADAE,KAGAt4G,EAAA,EAAAA,EAAA63G,EAAA/9G,OAAAkG,IACAoZ,EAAA,GAAA4/F,IAGA9C,EAAA+C,EAAApB,EAAA73G,MAAAoZ,EAAA,IAAApZ,EAAA62G,EAAAj/G,EACAk/G,GAEAiB,EAAA7B,EAAA,OACAgD,EAAAhD,EAAA2B,EAAA73G,GAAAoZ,EAAAw9F,EAAAkB,EACA,WAAAf,GACA,KAEAgB,GAAAA,EAAAhc,OACAtzE,EAAAyuF,gBAAA99F,EAAA+/F,WAGAnB,EAAAD,GAAAA,EAAAqB,YACArkH,EAAA8iH,EAAA73G,GAAAjL,cACAA,EAAA+E,OACA,KACAm9G,EAAAliH,EACAgjH,GACAA,EAAAY,0BAAAZ,EAAAe,wBACAf,EAAAc,WAAAjC,IAEAmB,GAAAC,KACAM,EAAAj6G,KAAA2B,EAAA+3G,EAAAC,GACAe,GAAA,EACAX,EAAAA,GAAAL,GAIAhB,EAAA,IAIA,OAAAgC,GAAA/B,EAAA,KAgEA,QAAA4B,GAAA7c,EAAA6a,EAAAyC,GAEA,GAAAC,GAAA,SAAAC,EAAAC,EAAAC,EAAAnC,EAAAoC,GAOA,MALAH,KACAA,EAAAxd,EAAAwc,MAAA,EAAAmB,GACAH,EAAAI,eAAA,GAGA/C,EAAA2C,EAAAC,GACApC,wBAAAiC,EACAhC,sBAAAoC,EACAnC,oBAAAA,IAIA,OAAAgC,GAaA,QAAAL,GAAA9tF,EAAA+qF,EAAA98F,EAAAy9F,EAAAC,GACA,GAEAj4G,GACA3K,EAHA+W,EAAAkgB,EAAAlgB,SACA2uG,EAAAxgG,EAAAygG,KAIA,QAAA5uG,GACA,IAAAqqF,IAEAwkB,EAAA5D,EACA6D,GAAAjiB,EAAA3sE,IAAA,IAAA0rF,EAAAC,EAGA,KAAA,GAAAt+G,GAAAqX,EAAAmqG,EAAAC,EAAAt0G,EAAAu0G,EAAAC,EAAAhvF,EAAA7B,WACA3b,EAAA,EAAA2oF,EAAA6jB,GAAAA,EAAArgH,OAAA6T,EAAA2oF,EAAA3oF,IAAA,CACA,GAAAysG,IAAA,EACAC,GAAA,CAEA7hH,GAAA2hH,EAAAxsG,GACAkC,EAAArX,EAAAqX,KACAlK,EAAAmQ,GAAAtd,EAAAmN,OAGAs0G,EAAAF,GAAAlqG,IACAqqG,EAAAI,GAAAh9G,KAAA28G,MACApqG,EAAAA,EAAA7U,QAAAu/G,GAAA,IACAvuG,OAAA,GAAAhR,QAAA,QAAA,SAAA6D,EAAAiiB,GACA,MAAAA,GAAAnhB,gBAIA,IAAA66G,GAAAP,EAAAj/G,QAAA,eAAA,GACAy/G,GAAAD,IACAP,IAAAO,EAAA,UACAJ,EAAAvqG,EACAwqG,EAAAxqG,EAAA7D,OAAA,EAAA6D,EAAA/V,OAAA,GAAA,MACA+V,EAAAA,EAAA7D,OAAA,EAAA6D,EAAA/V,OAAA,IAIAkgH,EAAAD,GAAAlqG,EAAApX,eACAmhH,EAAAI,GAAAnqG,GACAqqG,GAAA9gG,EAAAkH,eAAA05F,KACA5gG,EAAA4gG,GAAAr0G,EACAinG,GAAAzhF,EAAA6uF,KACA5gG,EAAA4gG,IAAA,IAGAU,GAAAvvF,EAAA+qF,EAAAvwG,EAAAq0G,EAAAE,GACAJ,EAAA5D,EAAA8D,EAAA,IAAAnD,EAAAC,EAAAsD,EACAC,GASA,GALAnmH,EAAAi3B,EAAAj3B,UACAmiG,EAAAniG,KAEAA,EAAAA,EAAAymH,SAEAplB,EAAArhG,IAAA,KAAAA,EACA,KAAA2K,EAAA+2G,EAAA1wG,KAAAhR,IACA8lH,EAAAD,GAAAl7G,EAAA,IACAi7G,EAAA5D,EAAA8D,EAAA,IAAAnD,EAAAC,KACA19F,EAAA4gG,GAAAlkG,GAAAjX,EAAA,KAEA3K,EAAAA,EAAA8X,OAAAnN,EAAAvG,MAAAuG,EAAA,GAAA/E,OAGA,MACA,KAAAugG,IACA,GAAA,KAAAugB,GAEA,KAAAzvF,EAAA9tB,YAAA8tB,EAAArG,aAAAqG,EAAArG,YAAA7Z,WAAAovF,IACAlvE,EAAA4B,UAAA5B,EAAA4B,UAAA5B,EAAArG,YAAAiI,UACA5B,EAAA9tB,WAAAM,YAAAwtB,EAAArG,YAGA+1F,GAAA3E,EAAA/qF,EAAA4B,UACA,MACA,KAAA+tF,IACA,IACAj8G,EAAA82G,EAAAzwG,KAAAimB,EAAA4B,WACAluB,IACAm7G,EAAAD,GAAAl7G,EAAA,IACAi7G,EAAA5D,EAAA8D,EAAA,IAAAnD,EAAAC,KACA19F,EAAA4gG,GAAAlkG,GAAAjX,EAAA,MAGA,MAAAzH,KASA,MADA8+G,GAAA58G,KAAAyhH,GACA7E,EAWA,QAAA8E,GAAA7vF,EAAA8vF,EAAAC,GACA,GAAA58E,MACAoK,EAAA,CACA,IAAAuyE,GAAA9vF,EAAA6mB,cAAA7mB,EAAA6mB,aAAAipE,IACA,EAAA,CACA,IAAA9vF,EACA,KAAA+pF,IAAA,UACA,mEACA+F,EAAAC,EAEA/vF,GAAAlgB,UAAAqqF,KACAnqE,EAAA6mB,aAAAipE,IAAAvyE,IACAvd,EAAA6mB,aAAAkpE,IAAAxyE,KAEApK,EAAAjgC,KAAA8sB,GACAA,EAAAA,EAAArG,kBACA4jB,EAAA,OAEApK,GAAAjgC,KAAA8sB,EAGA,OAAAgvE,IAAA77D,GAWA,QAAA68E,GAAAC,EAAAH,EAAAC,GACA,MAAA,UAAAnf,EAAA1tF,EAAA+K,EAAAqgG,EAAA7C,GAEA,MADAvoG,GAAA2sG,EAAA3sG,EAAA,GAAA4sG,EAAAC,GACAE,EAAArf,EAAA1tF,EAAA+K,EAAAqgG,EAAA7C,IA2BA,QAAAsC,GAAAhD,EAAAmF,EAAAC,EAAA1E,EACA2E,EAAAC,EAAAC,EAAAC,EACA3E,GAgNA,QAAA4E,GAAAC,EAAAC,EAAAZ,EAAAC,GACAU,IACAX,IAAAW,EAAAT,EAAAS,EAAAX,EAAAC,IACAU,EAAA7qE,QAAA4uD,EAAA5uD,QACA6qE,EAAAhH,cAAAA,GACAkH,IAAAnc,GAAAA,EAAAoc,kBACAH,EAAAI,GAAAJ,GAAAxe,cAAA,KAEAqe,EAAAp9G,KAAAu9G,IAEAC,IACAZ,IAAAY,EAAAV,EAAAU,EAAAZ,EAAAC,IACAW,EAAA9qE,QAAA4uD,EAAA5uD,QACA8qE,EAAAjH,cAAAA,GACAkH,IAAAnc,GAAAA,EAAAoc,kBACAF,EAAAG,GAAAH,GAAAze,cAAA,KAEAse,EAAAr9G,KAAAw9G,IAKA,QAAAI,GAAArH,EAAA7jE,EAAAqG,EAAA8kE,GACA,GAAAv2G,EAEA,IAAA4vF,EAAAxkD,GAAA,CACA,GAAAlyC,GAAAkyC,EAAAlyC,MAAAi3G,GACAjmG,EAAAkhC,EAAA5rC,UAAAtG,EAAA,GAAA/E,QACAqiH,EAAAt9G,EAAA,IAAAA,EAAA,GACAi1C,EAAA,MAAAj1C,EAAA,EAYA,IATA,OAAAs9G,EACA/kE,EAAAA,EAAAj+C,UAIAwM,EAAAu2G,GAAAA,EAAArsG,GACAlK,EAAAA,GAAAA,EAAAgrD,WAGAhrD,EAAA,CACA,GAAAmqD,GAAA,IAAAjgD,EAAA,YACAlK,GAAAw2G,EAAA/kE,EAAAkmD,cAAAxtC,GAAA1Y,EAAAp/C,KAAA83D,GAGA,IAAAnqD,IAAAmuC,EACA,KAAAohE,IAAA,QACA,iEACArlG,EAAA+kG,OAEA,IAAA7hG,GAAAg+B,GAAA,CACAprC,IACA,KAAA,GAAA3F,GAAA,EAAAo2F,EAAArlD,EAAAj3C,OAAAkG,EAAAo2F,EAAAp2F,IACA2F,EAAA3F,GAAAi8G,EAAArH,EAAA7jE,EAAA/wC,GAAAo3C,EAAA8kE,GAIA,MAAAv2G,IAAA,KAGA,QAAAy2G,GAAAhlE,EAAAh+B,EAAAw9F,EAAAyF,EAAAjf,EAAArB,GACA,GAAAmgB,GAAAnjB,IACA,KAAA,GAAAujB,KAAAD,GAAA,CACA,GAAA1c,GAAA0c,EAAAC,GACAjM,GACAkM,OAAA5c,IAAAmc,GAAAnc,EAAAoc,eAAA3e,EAAArB,EACA3kD,SAAAA,EACAolE,OAAApjG,EACAqjG,YAAA7F,GAGAvZ,EAAAsC,EAAAtC,UACA,MAAAA,IACAA,EAAAjkF,EAAAumF,EAAA9vF,MAGA,IAAA6sG,GAAAzW,EAAA5I,EAAAgT,GAAA,EAAA1Q,EAAA2V,aAOA4G,GAAAvc,EAAA9vF,MAAA6sG,EACAC,GACAvlE,EAAAp/C,KAAA,IAAA2nG,EAAA9vF,KAAA,aAAA6sG,EAAA/rD,UAGA,MAAAurD,GAGA,QAAAnE,GAAAC,EAAAjc,EAAA6gB,EAAA9E,EAAAwB,EACAuD,GA4GA,QAAAC,GAAA/gB,EAAAghB,EAAAzF,GACA,GAAAD,EAeA,OAZAngB,GAAA6E,KACAub,EAAAyF,EACAA,EAAAhhB,EACAA,EAAAnkG,GAGA+kH,IACAtF,EAAA6E,GAEA5E,IACAA,EAAAqF,EAAAvlE,EAAAj+C,SAAAi+C,GAEAkiE,EAAAvd,EAAAghB,EAAA1F,EAAAC,EAAA0F,GA3HA,GAAAh9G,GAAAo2F,EAAAglB,EAAA/d,EAAAD,EAAA8e,EAAAtF,EAAAx/D,EACAh+B,CAoCA,IAlCAiiG,IAAAuB,GACAxjG,EAAAkiG,EACAlkE,EAAAkkE,EAAAnC,YAEA/hE,EAAA+iD,GAAAyiB,GACAxjG,EAAA,GAAA4/F,IAAA5hE,EAAAkkE,IAGAQ,IACA1e,EAAArB,EAAAwc,MAAA,IAGAe,IAGA1C,EAAAkG,EACAlG,EAAAW,kBAAA+B,GAGA+C,IACAH,EAAAE,EAAAhlE,EAAAh+B,EAAAw9F,EAAAyF,EAAAjf,EAAArB,IAGA+f,IAEArzF,EAAAmvF,eAAAxgE,EAAAgmD,GAAA,IAAA6f,IAAAA,IAAAnB,GACAmB,IAAAnB,EAAAoB,uBACAz0F,EAAAyuF,gBAAA9/D,GAAA,GACAgmD,EAAAkZ,kBACAwF,EAAAxF,kBACA6G,GAAAphB,EAAA3iF,EAAAgkF,EACAA,EAAAkZ,kBACAwF,EAAA1e,IAEA8e,EAAA,CAEA,GACAnH,GACAqI,EAFAC,EAAAvB,GAAAwB,CAGAD,IAAAnB,EAAAmB,EAAAxtG,QACAklG,EAAAsI,EAAAhH,WAAAhB,iBACAhY,EAAA6e,EAAAmB,EAAAxtG,MAEAwtF,GAAAA,EAAAh0E,YAAA0rF,IACAqI,EAAA/f,EACAwf,EAAApE,kBACA0E,GAAAphB,EAAA3iF,EAAAikF,EAAA1sC,SACAokD,EAAAsI,IAGA,KAAAr9G,IAAAk8G,GAAA,CACA7e,EAAA6e,EAAAl8G,EACA,IAAAu9G,GAAAlgB,GAEAkgB,KAAAlgB,EAAA1sC,WAGA0sC,EAAA1sC,SAAA4sD,EACAnmE,EAAAp/C,KAAA,IAAAgI,EAAA,aAAAu9G,GACAlgB,IAAA+f,IAEAP,EAAApE,oBACAoE,EAAApE,kBACA0E,GAAAphB,EAAA3iF,EAAAmkG,EAAAxI,EAAAsI,MAOA,IAAAr9G,EAAA,EAAAo2F,EAAAqlB,EAAA3hH,OAAAkG,EAAAo2F,EAAAp2F,IACAo7G,EAAAK,EAAAz7G,GACAw9G,GAAApC,EACAA,EAAAhe,aAAAA,EAAArB,EACA3kD,EACAh+B,EACAgiG,EAAArqE,SAAAkrE,EAAAb,EAAAxG,cAAAwG,EAAArqE,QAAAqG,EAAA8kE,GACAtF,EAOA,IAAAoG,GAAAjhB,CAOA,KANA+f,IAAAA,EAAA9zD,UAAA,OAAA8zD,EAAA2B,eACAT,EAAA5f,GAEA4a,GAAAA,EAAAgF,EAAAJ,EAAA7nH,WAAA6C,EAAA0hH,GAGAt5G,EAAA07G,EAAA5hH,OAAA,EAAAkG,GAAA,EAAAA,IACAo7G,EAAAM,EAAA17G,GACAw9G,GAAApC,EACAA,EAAAhe,aAAAA,EAAArB,EACA3kD,EACAh+B,EACAgiG,EAAArqE,SAAAkrE,EAAAb,EAAAxG,cAAAwG,EAAArqE,QAAAqG,EAAA8kE,GACAtF,GAlZAG,EAAAA,KAqBA,KAAA,GATApX,GACAiV,EACA8I,EAGAtC,EACAuC,EAhBAC,GAAA3jE,OAAAq6D,UACAgJ,EAAAvG,EAAAuG,kBACAjB,EAAAtF,EAAAsF,qBACAP,EAAA/E,EAAA+E,yBACAmB,EAAAlG,EAAAkG,kBACAY,EAAA9G,EAAA8G,0BACAC,GAAA,EACAC,GAAA,EACApB,EAAA5F,EAAA4F,8BACAqB,EAAA1C,EAAAnC,UAAAhf,GAAAkhB,GAIA4C,EAAAzC,EACA0C,EAAAtH,EAKA52G,EAAA,EAAAo2F,EAAA8f,EAAAp8G,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA2/F,EAAAuW,EAAAl2G,EACA,IAAAi7G,GAAAtb,EAAAwe,QACAjD,EAAAvb,EAAAye,KAQA,IALAnD,IACA+C,EAAAhD,EAAAK,EAAAJ,EAAAC,IAEAwC,EAAA9lH,EAEAgmH,EAAAje,EAAAwW,SACA,KA0EA,KAvEAwH,EAAAhe,EAAA5D,SAIA4D,EAAA8d,cACApnB,EAAAsnB,IAGAU,EAAA,qBAAAvC,GAAAwB,EACA3d,EAAAqe,GACAlC,EAAAnc,GAIA0e,EAAA,qBAAAvC,EAAAnc,EACAqe,IAIAV,EAAAA,GAAA3d,GAGAiV,EAAAjV,EAAA9vF,MAEA8vF,EAAA8d,aAAA9d,EAAAtC,aACAsgB,EAAAhe,EAAAtC,WACAgf,EAAAA,GAAAtjB,KACAslB,EAAA,IAAAzJ,EAAA,eACAyH,EAAAzH,GAAAjV,EAAAqe,GACA3B,EAAAzH,GAAAjV,IAGAge,EAAAhe,EAAAkZ,cACAiF,GAAA,EAKAne,EAAA2e,QACAD,EAAA,eAAAR,EAAAle,EAAAqe,GACAH,EAAAle,GAGA,WAAAge,GACAhB,GAAA,EACAiB,EAAAje,EAAAwW,SACAuH,EAAAM,EACAA,EAAA1C,EAAAnC,UACAhf,GAAArmG,EAAAw3B,cAAA,IAAAspF,EAAA,KACA0G,EAAA1G,GAAA,MACAyG,EAAA2C,EAAA,GACAp/E,GAAA28E,EAAAriB,EAAAwkB,GAAArC,GAEA6C,EAAAz1F,EAAAi1F,EAAA9G,EAAAgH,EACAK,GAAAA,EAAApuG,MAQAguG,0BAAAA,MAGAH,EAAAvjB,GAAA2Q,GAAAuQ,IAAA58F,WACAu/F,EAAAvjH,QACAyjH,EAAAz1F,EAAAi1F,EAAA9G,KAIAjX,EAAA33C,SAWA,GAVA+1D,GAAA,EACAM,EAAA,WAAApB,EAAAtd,EAAAqe,GACAf,EAAAtd,EAEAge,EAAArtG,EAAAqvF,EAAA33C,UACA23C,EAAA33C,SAAAg2D,EAAA1C,GACA3b,EAAA33C,SAEA21D,EAAAY,GAAAZ,GAEAhe,EAAA3kG,QAAA,CASA,GARAijH,EAAAte,EAEA+d,EADA3T,GAAA4T,MAGAa,GAAA9G,EAAA/X,EAAA8e,kBAAA3oG,GAAA6nG,KAEAtC,EAAAqC,EAAA,GAEA,GAAAA,EAAA5jH,QAAAuhH,EAAApwG,WAAAqqF,GACA,KAAA4f,IAAA,QACA,uEACAN,EAAA,GAGAh2E,IAAA28E,EAAAyC,EAAA3C,EAEA,IAAAqD,KAAA7E,UAOA8E,GAAA1F,EAAAoC,KAAAqD,IACAE,GAAA1I,EAAAr5G,OAAAmD,EAAA,EAAAk2G,EAAAp8G,QAAAkG,EAAA,GAEA87G,IACA+C,EAAAF,IAEAzI,EAAAA,EAAAljG,OAAA2rG,IAAA3rG,OAAA4rG,IACAE,EAAAxD,EAAAoD,IAEAtoB,EAAA8f,EAAAp8G,WAEAkkH,GAAAjnH,KAAA4mH,EAIA,IAAAhe,EAAA8d,YACAM,GAAA,EACAM,EAAA,WAAApB,EAAAtd,EAAAqe,GACAf,EAAAtd,EAEAA,EAAA3kG,UACAijH,EAAAte,GAGAoY,EAAAgH,EAAA7I,EAAAr5G,OAAAmD,EAAAk2G,EAAAp8G,OAAAkG,GAAAg+G,EACA1C,EAAAC,EAAAuC,GAAAI,EAAAzC,EAAAC,GACAW,qBAAAA,EACAiB,kBAAAA,IAAA3d,GAAA2d,EACAxB,yBAAAA,EACAmB,kBAAAA,EACAY,0BAAAA,IAEAznB,EAAA8f,EAAAp8G,WACA,IAAA6lG,EAAAl3E,QACA,IACA2yF,EAAAzb,EAAAl3E,QAAAu1F,EAAA1C,EAAA4C,GACA5tG,EAAA8qG,GACAO,EAAA,KAAAP,EAAAH,EAAAC,GACAE,GACAO,EAAAP,EAAAQ,IAAAR,EAAAS,KAAAZ,EAAAC,GAEA,MAAA9jH,IACAivG,EAAAjvG,GAAA8iG,EAAA8jB,IAIAre,EAAAyZ,WACArB,EAAAqB,UAAA,EACAwE,EAAA/kH,KAAA6I,IAAAk8G,EAAAje,EAAAwW,WAaA,MARA4B,GAAAhc,MAAAuhB,GAAAA,EAAAvhB,SAAA,EACAgc,EAAAY,wBAAAmF,EACA/F,EAAAe,sBAAAiF,EACAhG,EAAAc,WAAAqF,EAEAnH,EAAA4F,8BAAAA,EAGA5E,EAkOA,QAAA8G,GAAA3I,GAEA,IAAA,GAAAvoG,GAAA,EAAA2oF,EAAA4f,EAAAp8G,OAAA6T,EAAA2oF,EAAA3oF,IACAuoG,EAAAvoG,GAAA8oF,EAAAyf,EAAAvoG,IAAAouG,gBAAA,IAkBA,QAAAjC,GAAAkF,EAAAnvG,EAAA/U,EAAA+7G,EAAAC,EAAAmI,EACAC,GACA,GAAArvG,IAAAinG,EAAA,MAAA,KACA,IAAAj4G,GAAA,IACA,IAAA42G,EAAAn1F,eAAAzQ,GACA,IAAA,GAAA8vF,GAAAuW,EAAA9G,EAAAt4F,IAAAjH,EAAA6lG,GACA11G,EAAA,EAAAo2F,EAAA8f,EAAAp8G,OAAAkG,EAAAo2F,EAAAp2F,IACA,IACA2/F,EAAAuW,EAAAl2G,IACA62G,IAAAj/G,GAAAi/G,EAAAlX,EAAAwW,WACAxW,EAAAyW,SAAAt+G,QAAAgD,SACAmkH,IACAtf,EAAAlJ,EAAAkJ,GAAAwe,QAAAc,EAAAb,MAAAc,KAEAF,EAAA3gH,KAAAshG,GACA9gG,EAAA8gG,GAEA,MAAAvoG,GAAAivG,EAAAjvG,GAGA,MAAAyH,GAYA,QAAA47G,GAAA5qG,GACA,GAAA4lG,EAAAn1F,eAAAzQ,GACA,IAAA,GAAA8vF,GAAAuW,EAAA9G,EAAAt4F,IAAAjH,EAAA6lG,GACA11G,EAAA,EAAAo2F,EAAA8f,EAAAp8G,OAAAkG,EAAAo2F,EAAAp2F,IAEA,GADA2/F,EAAAuW,EAAAl2G,GACA2/F,EAAAwf,aACA,OAAA,CAIA,QAAA,EAWA,QAAAL,GAAA5oB,EAAAt/F,GACA,GAAAiS,GAAAjS,EAAAijH,MACAuF,EAAAlpB,EAAA2jB,MACAziE,EAAA8+C,EAAAijB,SAGApjH,GAAAmgG,EAAA,SAAAvwF,EAAAgM,GACA,KAAAA,EAAAnL,OAAA,KACA5P,EAAA+a,IAAA/a,EAAA+a,KAAAhM,IACAA,IAAA,UAAAgM,EAAA,IAAA,KAAA/a,EAAA+a,IAEAukF,EAAAlxB,KAAArzD,EAAAhM,GAAA,EAAAkD,EAAA8I,OAKA5b,EAAAa,EAAA,SAAA+O,EAAAgM,GACA,SAAAA,GACA+kG,EAAAt/D,EAAAzxC,GACAuwF,EAAA,UAAAA,EAAA,SAAAA,EAAA,SAAA,IAAA,IAAAvwF,GACA,SAAAgM,GACAylC,EAAA5+C,KAAA,QAAA4+C,EAAA5+C,KAAA,SAAA,IAAAmN,GACAuwF,EAAA,OAAAA,EAAA,MAAAA,EAAA,MAAA,IAAA,IAAAvwF,GAIA,KAAAgM,EAAAnL,OAAA,IAAA0vF,EAAA51E,eAAA3O,KACAukF,EAAAvkF,GAAAhM,EACAy5G,EAAAztG,GAAA9I,EAAA8I,MAMA,QAAAotG,GAAA7I,EAAA8H,EAAAqB,EACAvH,EAAAoG,EAAAzC,EAAAC,EAAA3E,GACA,GACAuI,GACAC,EAFAC,KAGAC,EAAAzB,EAAA,GACA0B,EAAAxJ,EAAAn4G,QACA4hH,EAAAlpB,EAAAipB,GACAjC,YAAA;AAAA5E,WAAA,KAAA79G,QAAA,KAAAkiH,oBAAAwC,IAEAjC,EAAAntG,EAAAovG,EAAAjC,aACAiC,EAAAjC,YAAAO,EAAAqB,GACAK,EAAAjC,YACAgB,EAAAiB,EAAAjB,iBAmFA,OAjFAT,GAAAvjH,QAEAguG,EAAAgV,GACA5qF,KAAA,SAAAre,GACA,GAAA6mG,GAAAuE,EAAAlC,EAAAxF,CAIA,IAFA1jG,EAAA+pG,GAAA/pG,GAEAkrG,EAAA1kH,QAAA,CAQA,GANA0iH,EADA3T,GAAAv1F,MAGAgqG,GAAA9G,EAAA+G,EAAA3oG,GAAAtB,KAEA6mG,EAAAqC,EAAA,GAEA,GAAAA,EAAA5jH,QAAAuhH,EAAApwG,WAAAqqF,GACA,KAAA4f,IAAA,QACA,uEACAwK,EAAA7vG,KAAA4tG,EAGAmC,IAAA/F,UACAj7E,GAAAk5E,EAAAkG,EAAA3C,EACA,IAAAsD,GAAA1F,EAAAoC,KAAAuE,EAEAvpB,GAAAqpB,EAAA3jB,QACA8iB,EAAAF,GAEAzI,EAAAyI,EAAA3rG,OAAAkjG,GACA4I,EAAAO,EAAAO,OAEAvE,GAAAoE,EACAzB,EAAAjnH,KAAAyd,EAeA,KAZA0hG,EAAA34F,QAAAoiG,GAEAL,EAAApG,EAAAhD,EAAAmF,EAAAgE,EACAnB,EAAAF,EAAA0B,EAAAjE,EAAAC,EACA3E,GACAhhH,EAAA+hH,EAAA,SAAA3sF,EAAAnrB,GACAmrB,GAAAkwF,IACAvD,EAAA93G,GAAAg+G,EAAA,MAGAuB,EAAAtI,EAAA+G,EAAA,GAAAjpH,WAAAmpH,GAEAsB,EAAA1lH,QAAA,CACA,GAAAiiG,GAAAyjB,EAAAzhH,QACA8hH,EAAAL,EAAAzhH,QACA+hH,EAAAN,EAAAzhH,QACAu7G,EAAAkG,EAAAzhH,QACA6+G,EAAAoB,EAAA,EAEA,KAAAjiB,EAAAgkB,YAAA,CAEA,GAAAF,IAAAJ,EAAA,CACA,GAAAO,GAAAH,EAAA3rH,SAEA6iH,GAAA4F,+BACA+C,EAAA1kH,UAEA4hH,EAAA9R,GAAAuQ,IAEAz8E,GAAAkhF,EAAA3lB,GAAA0lB,GAAAjD,GAGAlG,EAAAvc,GAAAyiB,GAAAoD,GAGA9H,EADAoH,EAAA3G,wBACAC,EAAA7c,EAAAujB,EAAAzG,WAAAS,GAEAA,EAEAgG,EAAAC,EAAAxjB,EAAA6gB,EAAA9E,EACAI,EAAAoH,IAEAE,EAAA,OAGA,SAAAS,EAAAlkB,EAAA5wE,EAAAuxE,EAAA4c,GACA,GAAApB,GAAAoB,CACAvd,GAAAgkB,cACAP,EACAA,EAAAnhH,KAAA09F,EACA5wE,EACAuxE,EACAwb,IAEAoH,EAAA3G,0BACAT,EAAAU,EAAA7c,EAAAujB,EAAAzG,WAAAS,IAEAgG,EAAAC,EAAAxjB,EAAA5wE,EAAAuxE,EAAAwb,EACAoH,MASA,QAAAvE,GAAA1jH,EAAAkC,GACA,GAAAorB,GAAAprB,EAAA48G,SAAA9+G,EAAA8+G,QACA,OAAA,KAAAxxF,EAAAA,EACAttB,EAAAwY,OAAAtW,EAAAsW,KAAAxY,EAAAwY,KAAAtW,EAAAsW,QAAA,EACAxY,EAAAiB,MAAAiB,EAAAjB,MAGA,QAAA+lH,GAAAzwF,EAAAsyF,EAAAvgB,EAAAtxF,GAEA,QAAA8xG,GAAAC,GACA,MAAAA,GACA,aAAAA,EAAA,IACA,GAGA,GAAAF,EACA,KAAAhL,IAAA,WAAA,8DACAgL,EAAArwG,KAAAswG,EAAAD,EAAAhhB,cACAS,EAAA9vF,KAAAswG,EAAAxgB,EAAAT,cAAAtxE,EAAAssE,EAAA7rF,IAKA,QAAAwsG,GAAA3E,EAAAh9G,GACA,GAAAmnH,GAAA5Z,EAAAvtG,GAAA,EACAmnH,IACAnK,EAAA73G,MACA83G,SAAA,EACA1tF,QAAA,SAAA63F,GACA,GAAAC,GAAAD,EAAAnnH,SACAqnH,IAAAD,EAAAzmH,MAMA,OAFA0mH,IAAA/3F,EAAAg4F,kBAAAF,GAEA,SAAAxkB,EAAA5wE,GACA,GAAAhyB,GAAAgyB,EAAAhyB,QACAqnH,IAAA/3F,EAAAg4F,kBAAAtnH,GACAsvB,EAAAi4F,iBAAAvnH,EAAAknH,EAAAM,aACA5kB,EAAA3E,OAAAipB,EAAA,SAAA16G,GACAwlB,EAAA,GAAA4B,UAAApnB,QASA,QAAA+xG,GAAA/2G,EAAAqnD,GAEA,OADArnD,EAAAo3F,GAAAp3F,GAAA,SAEA,IAAA,MACA,IAAA,OACA,GAAA63C,GAAA1kD,EAAAG,cAAA,MAEA,OADAukD,GAAA3jD,UAAA,IAAA8L,EAAA,IAAAqnD,EAAA,KAAArnD,EAAA,IACA63C,EAAAzjD,WAAA,GAAAA,UACA,SACA,MAAAizD,IAKA,QAAA44D,GAAAz1F,EAAA01F,GACA,GAAA,UAAAA,EACA,MAAA5Y,GAAA6Y,IAEA,IAAAhtG,GAAAgkF,EAAA3sE,EAEA,OAAA,aAAA01F,GACA,QAAA/sG,GAAA,UAAA+sG,GACA,OAAA/sG,IAAA,OAAA+sG,GACA,SAAAA,GACA5Y,EAAA8Y,aAJA,OASA,QAAArG,IAAAvvF,EAAA+qF,EAAAvwG,EAAAkK,EAAAmxG,GACA,GAAAC,GAAAL,EAAAz1F,EAAAtb,EACAmxG,GAAAnL,EAAAhmG,IAAAmxG,CAEA,IAAAX,GAAA5Z,EAAA9gG,GAAA,EAAAs7G,EAAAD,EAGA,IAAAX,EAAA,CAGA,GAAA,aAAAxwG,GAAA,WAAAioF,EAAA3sE,GACA,KAAA+pF,IAAA,WACA,qEACAhb,EAAA/uE,GAGA+qF,GAAA73G,MACA83G,SAAA,IACA1tF,QAAA,WACA,OACAmzF,IAAA,SAAA7f,EAAA1tF,EAAA7V,GACA,GAAA0oH,GAAA1oH,EAAA0oH,cAAA1oH,EAAA0oH,eAEA,IAAAnL,EAAAz4G,KAAAuS,GACA,KAAAqlG,IAAA,cACA,2IAKA,IAAAiM,GAAA3oH,EAAAqX,EACAsxG,KAAAx7G,IAIA06G,EAAAc,GAAA1a,EAAA0a,GAAA,EAAAF,EAAAD,GACAr7G,EAAAw7G,GAKAd,IAKA7nH,EAAAqX,GAAAwwG,EAAAtkB,IAEAmlB,EAAArxG,KAAAqxG,EAAArxG,QAAAuxG,SAAA,GACA5oH,EAAA0oH,aAAA1oH,EAAA0oH,YAAArxG,GAAAwxG,SAAAtlB,GACA3E,OAAAipB,EAAA,SAAAc,EAAAG,GAOA,UAAAzxG,GAAAsxG,GAAAG,EACA9oH,EAAA+oH,aAAAJ,EAAAG,GAEA9oH,EAAAwsE,KAAAn1D,EAAAsxG,YAoBA,QAAAviF,IAAAk5E,EAAA0J,EAAAC,GACA,GAGAzhH,GAAAo2F,EAHAsrB,EAAAF,EAAA,GACAG,EAAAH,EAAA1nH,OACAX,EAAAuoH,EAAArkH,UAGA,IAAAy6G,EACA,IAAA93G,EAAA,EAAAo2F,EAAA0hB,EAAAh+G,OAAAkG,EAAAo2F,EAAAp2F,IACA,GAAA83G,EAAA93G,IAAA0hH,EAAA,CACA5J,EAAA93G,KAAAyhH,CACA,KAAA,GAAA9zG,GAAA3N,EAAA4hH,EAAAj0G,EAAAg0G,EAAA,EACArrB,EAAAwhB,EAAAh+G,OACA6T,EAAA2oF,EAAA3oF,IAAAi0G,IACAA,EAAAtrB,EACAwhB,EAAAnqG,GAAAmqG,EAAA8J,SAEA9J,GAAAnqG,EAGAmqG,GAAAh+G,QAAA6nH,EAAA,EAKA7J,EAAA5sG,UAAAw2G,IACA5J,EAAA5sG,QAAAu2G,EAEA,OAKAtoH,GACAA,EAAA0lC,aAAA4iF,EAAAC,EAIA,IAAAhmH,GAAA5H,EAAA6H,wBACAD,GAAAM,YAAA0lH,GAEAvnB,GAAAjlF,QAAAwsG,KAIAvnB,GAAAsnB,GAAAzpH,KAAAmiG,GAAAunB,GAAA1pH,QAKAvD,IAUA8oG,IAAA,EACA9oG,GAAAwe,WAAAyuG,WAVAvnB,IAAAjwF,MAAAw3G,EAAAvnB,GAAA5nF,UAcA,KAAA,GAAAqrD,GAAA,EAAAikD,EAAAL,EAAA1nH,OAAA8jE,EAAAikD,EAAAjkD,IAAA,CACA,GAAAvvD,GAAAmzG,EAAA5jD,EACAu8B,IAAA9rF,GAAA7X,SACAkF,EAAAM,YAAAqS,SACAmzG,GAAA5jD,GAGA4jD,EAAA,GAAAC,EACAD,EAAA1nH,OAAA,EAIA,QAAAkiH,IAAAlyG,EAAAg4G,GACA,MAAAlvG,GAAA,WAAA,MAAA9I,GAAA+C,MAAA,KAAAvC,YAAAR,EAAAg4G,GAIA,QAAAtE,IAAApC,EAAArf,EAAA3kD,EAAAh+B,EAAAqgG,EAAA7C,GACA,IACAwE,EAAArf,EAAA3kD,EAAAh+B,EAAAqgG,EAAA7C,GACA,MAAAx/G,GACAivG,EAAAjvG,EAAA8iG,EAAA9iD,KAOA,QAAA+lE,IAAAphB,EAAA3iF,EAAA8+E,EAAA6c,EACApV,EAAAoiB,GACA,GAAAC,EACAjsH,GAAAg/G,EAAA,SAAAC,EAAAC,GACA,GAGAgN,GACAC,EAAAC,EAAA/1F,EAJA+oF,EAAAH,EAAAG,SACArhE,EAAAkhE,EAAAlhE,SACAmH,EAAA+5D,EAAA/5D,IAUA,QANA36B,GAAAnrB,KAAAikB,EAAA+7F,KAGA/7F,EAAA+7F,GAAAv9G,GAGAqjD,GAEA,IAAA,IACA7hC,EAAA+7F,IAAArhE,IACAokD,EAAA+c,GAAAr9G,GAGAwhB,EAAAgpG,SAAAjN,EAAA,SAAAxvG,GACAuyF,EAAA+c,GAAAtvG,IAEAyT,EAAA8nG,YAAA/L,GAAAkM,QAAAtlB,EACA3iF,EAAA+7F,KAGAjd,EAAA+c,GAAAxO,EAAArtF,EAAA+7F,IAAApZ,GAEA,MAEA,KAAA,IACA,GAAAjoD,IAAA16B,EAAA+7F,GACA,MAEA+M,GAAAza,EAAAruF,EAAA+7F,IAGA/oF,EADA81F,EAAA9kD,QACAq7B,EAEA,SAAAphG,EAAAkC,GAAA,MAAAlC,KAAAkC,GAAAlC,IAAAA,GAAAkC,IAAAA,GAEA4oH,EAAAD,EAAA9gC,QAAA,WAGA,KADA6gC,GAAA/pB,EAAA+c,GAAAiN,EAAAnmB,GACAmZ,GAAA,YACA,gEACA97F,EAAA+7F,GAAAxV,EAAA9vF,OAEAoyG,EAAA/pB,EAAA+c,GAAAiN,EAAAnmB,EACA,IAAAsmB,GAAA,SAAAC,GAWA,MAVAl2F,GAAAk2F,EAAApqB,EAAA+c,MAEA7oF,EAAAk2F,EAAAL,GAKAE,EAAApmB,EAAAumB,EAAApqB,EAAA+c,IAHA/c,EAAA+c,GAAAqN,GAMAL,EAAAK,EAEAD,GAAAE,WAAA,CACA,IAAAC,EAEAA,GADAxN,EAAAv7F,WACAsiF,EAAA0mB,iBAAArpG,EAAA+7F,GAAAkN,GAEAtmB,EAAA3E,OAAAqQ,EAAAruF,EAAA+7F,GAAAkN,GAAA,KAAAH,EAAA9kD,SAEA4kD,EAAAA,MACAA,EAAA3jH,KAAAmkH,EACA,MAEA,KAAA,IAIA,GAHAN,EAAAza,EAAAruF,EAAA+7F,IAGA+M,IAAA15G,GAAAsrC,EAAA,KAEAokD,GAAA+c,GAAA,SAAA5E,GACA,MAAA6R,GAAAnmB,EAAAsU,MAKA,IAAAmI,GAAAwJ,EAAA,WACA,IAAA,GAAAhiH,GAAA,EAAAo2F,EAAA4rB,EAAAloH,OAAAkG,EAAAo2F,IAAAp2F,EACAgiH,EAAAhiH,MAEAwI,CACA,OAAAu5G,IAAAvJ,IAAAhwG,GACAu5G,EAAArJ,IAAA,WAAAF,GACAhwG,GAEAgwG,EAvpDA,GAAAQ,IAAA,SAAA3qG,EAAAq0G,GACA,GAAAA,EAAA,CACA,GACA1iH,GAAAmV,EAAAxD,EADAuS,EAAA3lB,OAAA2lB,KAAAw+F,EAGA,KAAA1iH,EAAA,EAAAmV,EAAA+O,EAAApqB,OAAAkG,EAAAmV,EAAAnV,IACA2R,EAAAuS,EAAAlkB,GACAjI,KAAA4Z,GAAA+wG,EAAA/wG,OAGA5Z,MAAA8hH,QAGA9hH,MAAAohH,UAAA9qG,EAGA2qG,IAAAngG,WAgBA8pG,WAAA5I,GAcA6I,UAAA,SAAAC,GACAA,GAAAA,EAAA/oH,OAAA,GACAyrG,EAAAptG,SAAAJ,KAAAohH,UAAA0J,IAeAC,aAAA,SAAAD,GACAA,GAAAA,EAAA/oH,OAAA,GACAyrG,EAAArtG,YAAAH,KAAAohH,UAAA0J,IAgBAtB,aAAA,SAAAwB,EAAA/C,GACA,GAAAgD,GAAAC,GAAAF,EAAA/C,EACAgD,IAAAA,EAAAlpH,QACAyrG,EAAAptG,SAAAJ,KAAAohH,UAAA6J,EAGA,IAAAE,GAAAD,GAAAjD,EAAA+C,EACAG,IAAAA,EAAAppH,QACAyrG,EAAArtG,YAAAH,KAAAohH,UAAA+J,IAaAl+C,KAAA,SAAArzD,EAAAhM,EAAAw9G,EAAAhO,GAKA,GAIA53G,GAJA4tB,EAAApzB,KAAAohH,UAAA,GACAiK,EAAAxW,GAAAzhF,EAAAxZ,GACA0xG,EAAArW,GAAA7hF,EAAAxZ,GACA7b,EAAA6b,CAyBA,IAtBAyxG,GACArrH,KAAAohH,UAAAzgG,KAAA/G,EAAAhM,GACAwvG,EAAAiO,GACAC,IACAtrH,KAAAsrH,GAAA19G,EACA7P,EAAAutH,GAGAtrH,KAAA4Z,GAAAhM,EAGAwvG,EACAp9G,KAAA8hH,MAAAloG,GAAAwjG,GAEAA,EAAAp9G,KAAA8hH,MAAAloG,GACAwjG,IACAp9G,KAAA8hH,MAAAloG,GAAAwjG,EAAAxY,GAAAhrF,EAAA,OAIApU,EAAAu6F,EAAA//F,KAAAohH,WAEA,MAAA57G,GAAA,SAAAoU,GACA,QAAApU,GAAA,QAAAoU,EAEA5Z,KAAA4Z,GAAAhM,EAAA46F,EAAA56F,EAAA,QAAAgM,OACA,IAAA,QAAApU,GAAA,WAAAoU,EAAA,CAeA,IAAA,GAbA+J,GAAA,GAGA4nG,EAAAxtG,GAAAnQ,GAEA49G,EAAA,sCACA91F,EAAA,KAAAnwB,KAAAgmH,GAAAC,EAAA,MAGAC,EAAAF,EAAAzlH,MAAA4vB,GAGAg2F,EAAA5qH,KAAAikE,MAAA0mD,EAAA1pH,OAAA,GACAkG,EAAA,EAAAA,EAAAyjH,EAAAzjH,IAAA,CACA,GAAA0jH,GAAA,EAAA1jH,CAEA0b,IAAA6kF,EAAAzqF,GAAA0tG,EAAAE,KAAA,GAEAhoG,GAAA,IAAA5F,GAAA0tG,EAAAE,EAAA,IAIA,GAAAC,GAAA7tG,GAAA0tG,EAAA,EAAAxjH,IAAAnC,MAAA,KAGA6d,IAAA6kF,EAAAzqF,GAAA6tG,EAAA,KAAA,GAGA,IAAAA,EAAA7pH,SACA4hB,GAAA,IAAA5F,GAAA6tG,EAAA,KAEA5rH,KAAA4Z,GAAAhM,EAAA+V,EAGAynG,KAAA,IACA,OAAAx9G,GAAAA,IAAA/N,EACAG,KAAAohH,UAAAjzE,WAAAivE,GAEAp9G,KAAAohH,UAAA3gH,KAAA28G,EAAAxvG,GAKA,IAAAu7G,GAAAnpH,KAAAmpH,WACAA,IAAAnrH,EAAAmrH,EAAAprH,GAAA,SAAAgU,GACA,IACAA,EAAAnE,GACA,MAAAvO,GACAivG,EAAAjvG,OAwBAgrH,SAAA,SAAAzwG,EAAA7H,GACA,GAAAsP,GAAArhB,KACAmpH,EAAA9nG,EAAA8nG,cAAA9nG,EAAA8nG,YAAAnoB,MACA6qB,EAAA1C,EAAAvvG,KAAAuvG,EAAAvvG,MAUA,OARAiyG,GAAAvlH,KAAAyL,GACA69F,EAAAxQ,WAAA,YACAysB,EAAAxC,SAAAhoG,EAAAkH,eAAA3O,IAEA7H,EAAAsP,EAAAzH,MAIA,WACAqmF,EAAA4rB,EAAA95G,KAgBA,IAAA+5G,IAAApd,EAAAod,cACAC,GAAArd,EAAAqd,YACAvF,GAAA,MAAAsF,IAAA,MAAAC,GACAptB,EACA,SAAA1uC,GACA,MAAAA,GAAAhtD,QAAA,QAAA6oH,IAAA7oH,QAAA,MAAA8oH,KAEAxJ,GAAA,cA2BA,OAzBA7xF,GAAAi4F,iBAAA/kB,EAAA,SAAAvkD,EAAA2sE,GACA,GAAAhP,GAAA39D,EAAAp/C,KAAA,eAEA+a,IAAAgxG,GACAhP,EAAAA,EAAA/hG,OAAA+wG,GAEAhP,EAAA12G,KAAA0lH,GAGA3sE,EAAAp/C,KAAA,WAAA+8G,IACAvsG,EAEAigB,EAAAg4F,kBAAA9kB,EAAA,SAAAvkD,GACAs/D,EAAAt/D,EAAA,eACA5uC,EAEAigB,EAAAmvF,eAAAjc,EAAA,SAAAvkD,EAAA2kD,EAAAioB,EAAAC,GACA,GAAAn0D,GAAAk0D,EAAAC,EAAA,0BAAA,gBAAA,QACA7sE,GAAAp/C,KAAA83D,EAAAisC,IACAvzF,EAEAigB,EAAAyuF,gBAAAvb,EAAA,SAAAvkD,EAAA4sE,GACAtN,EAAAt/D,EAAA4sE,EAAA,mBAAA,aACAx7G,EAEAigB,IA44CA,QAAAsxF,IAAAlqG,GACA,MAAAgD,IAAAhD,EAAA7U,QAAAu/G,GAAA,KA+DA,QAAA0I,IAAAiB,EAAAC,GACA,GAAA5sG,GAAA,GACA6sG,EAAAF,EAAArmH,MAAA,OACAwmH,EAAAF,EAAAtmH,MAAA,MAEAymH,GACA,IAAA,GAAAtkH,GAAA,EAAAA,EAAAokH,EAAAtqH,OAAAkG,IAAA,CAEA,IAAA,GADAiwB,GAAAm0F,EAAApkH,GACA2N,EAAA,EAAAA,EAAA02G,EAAAvqH,OAAA6T,IACA,GAAAsiB,GAAAo0F,EAAA12G,GAAA,QAAA22G,EAEA/sG,KAAAA,EAAAzd,OAAA,EAAA,IAAA,IAAAm2B,EAEA,MAAA1Y,GAGA,QAAAinG,IAAA+F,GACAA,EAAApqB,GAAAoqB,EACA,IAAAvkH,GAAAukH,EAAAzqH,MAEA,IAAAkG,GAAA,EACA,MAAAukH,EAGA,MAAAvkH,KAAA,CACA,GAAAmrB,GAAAo5F,EAAAvkH,EACAmrB,GAAAlgB,WAAA6vG,IACAj+G,GAAA1H,KAAAovH,EAAAvkH,EAAA,GAGA,MAAAukH,GAOA,QAAAhP,IAAAlY,EAAAmnB,GACA,GAAAA,GAAAjvB,EAAAivB,GAAA,MAAAA,EACA,IAAAjvB,EAAA8H,GAAA,CACA,GAAAx+F,GAAA4lH,GAAAv/G,KAAAm4F,EACA,IAAAx+F,EAAA,MAAAA,GAAA,IAeA,QAAAqnG,MACA,GAAAuT,MACAiL,GAAA,CAUA3sH,MAAA4sH,SAAA,SAAA90G,EAAAmR,GACA88E,GAAAjuF,EAAA,cACAwmF,EAAAxmF,GACA+C,EAAA6mG,EAAA5pG,GAEA4pG,EAAA5pG,GAAAmR,GASAjpB,KAAA6sH,aAAA,WACAF,GAAA,GAIA3sH,KAAAy1G,MAAA,YAAA,UAAA,SAAA4B,EAAArG,GAyGA,QAAA8b,GAAAxU,EAAAhnF,EAAAsnC,EAAA9gD,GACA,IAAAwgG,IAAAha,EAAAga,EAAAkM,QACA,KAAAznB,GAAA,eAAA,QACA,mFACAjlF,EAAAwZ,EAGAgnF,GAAAkM,OAAAlzF,GAAAsnC,EAnFA,MAAA,UAAAm0D,EAAAzU,EAAA5gG,EAAA+0G,GAQA,GAAA7zD,GAAA9xD,EAAAmiB,EAAAqI,CAMA,IALA5Z,EAAAA,KAAA,EACA+0G,GAAAjvB,EAAAivB,KACAn7F,EAAAm7F,GAGAjvB,EAAAuvB,GAAA,CAEA,GADAjmH,EAAAimH,EAAAjmH,MAAA4lH,KACA5lH,EACA,KAAAkmH,IAAA,UACA,uFACAD,EAEA9jG,GAAAniB,EAAA,GACAwqB,EAAAA,GAAAxqB,EAAA,GACAimH,EAAArL,EAAAn5F,eAAAU,GACAy4F,EAAAz4F,GACAwlB,GAAA6pE,EAAAkM,OAAAv7F,GAAA,KACA0jG,EAAAl+E,GAAAuiE,EAAA/nF,GAAA,GAAAppB,GAEAgmG,GAAAknB,EAAA9jG,GAAA,GAGA,GAAAvR,EAAA,CAWA,GAAAu1G,IAAAjyG,GAAA+xG,GACAA,EAAAA,EAAAhrH,OAAA,GAAAgrH,GAAAjsG,SACA83C,GAAApyD,OAAAk2E,OAAAuwC,GAAA,MAEA37F,GACAw7F,EAAAxU,EAAAhnF,EAAAsnC,EAAA3vC,GAAA8jG,EAAAj1G,KAGA,IAAAg/F,EACA,OAAAA,GAAAj8F,EAAA,WACA,GAAA8I,GAAA0zF,EAAAtT,OAAAgpB,EAAAn0D,EAAA0/C,EAAArvF,EAQA,OAPAtF,KAAAi1C,IAAA0lC,EAAA36E,IAAApL,EAAAoL,MACAi1C,EAAAj1C,EACA2N,GAEAw7F,EAAAxU,EAAAhnF,EAAAsnC,EAAA3vC,GAAA8jG,EAAAj1G,OAGA8gD,IAEAA,SAAAA,EACAtnC,WAAAA,IAUA,MANAsnC,GAAAy+C,EAAAP,YAAAiW,EAAAzU,EAAArvF,GAEAqI,GACAw7F,EAAAxU,EAAAhnF,EAAAsnC,EAAA3vC,GAAA8jG,EAAAj1G,MAGA8gD,KAwCA,QAAAy1C,MACAruG,KAAAy1G,MAAA,UAAA,SAAAh4G,GACA,MAAA2kG,IAAA3kG,EAAA1B,YA4CA,QAAAwyG,MACAvuG,KAAAy1G,MAAA,OAAA,SAAAjG,GACA,MAAA,UAAA0d,EAAAC,GACA3d,EAAAhoF,MAAA1S,MAAA06F,EAAAj9F,cAcA,QAAA66G,IAAAxlG,GACA,MAAA02E,GAAA12E,GACA42E,EAAA52E,GAAAA,EAAAylG,cAAA9rB,EAAA35E,GAEAA,EAIA,QAAAqnF,MAiBAjvG,KAAAy1G,KAAA,WACA,MAAA,UAAAv+D,GACA,IAAAA,EAAA,MAAA,EACA,IAAAvM,KAYA,OAXAgzD,GAAAzmD,EAAA,SAAAtpC,EAAAgM,GACA,OAAAhM,GAAAkxF,EAAAlxF,KACAoN,GAAApN,GACA5P,EAAA4P,EAAA,SAAAga,EAAAi+C,GACAl7B,EAAArkC,KAAAu8F,GAAAjpF,GAAA,IAAAipF,GAAAuqB,GAAAxlG,OAGA+iB,EAAArkC,KAAAu8F,GAAAjpF,GAAA,IAAAipF,GAAAuqB,GAAAx/G,QAIA+8B,EAAA1kC,KAAA,OAKA,QAAAkpG,MA4CAnvG,KAAAy1G,KAAA,WACA,MAAA,UAAAv+D,GAMA,QAAAzB,GAAA63E,EAAA5lG,EAAA6lG,GACA,OAAAD,GAAAxuB,EAAAwuB,KACAtyG,GAAAsyG,GACAtvH,EAAAsvH,EAAA,SAAA1/G,GACA6nC,EAAA7nC,EAAA8Z,EAAA,QAEA42E,EAAAgvB,KAAA9uB,EAAA8uB,GACA3vB,EAAA2vB,EAAA,SAAA1/G,EAAAgM,GACA67B,EAAA7nC,EAAA8Z,GACA6lG,EAAA,GAAA,KACA3zG,GACA2zG,EAAA,GAAA,QAGA5iF,EAAArkC,KAAAu8F,GAAAn7E,GAAA,IAAAm7E,GAAAuqB,GAAAE,MAnBA,IAAAp2E,EAAA,MAAA,EACA,IAAAvM,KAEA,OADA8K,GAAAyB,EAAA,IAAA,GACAvM,EAAA1kC,KAAA,OAuBA,QAAAunH,IAAAvtH,EAAA+yC,GACA,GAAAwqD,EAAAv9F,GAAA,CAEA,GAAAwtH,GAAAxtH,EAAAgD,QAAAyqH,GAAA,IAAA3vG,MAEA,IAAA0vG,EAAA,CACA,GAAAv7E,GAAAc,EAAA,iBACAd,GAAA,IAAAA,EAAAnyC,QAAA4tH,KAAAC,GAAAH,MACAxtH,EAAAwhG,EAAAgsB,KAKA,MAAAxtH,GAGA,QAAA2tH,IAAA3+G,GACA,GAAA4+G,GAAA5+G,EAAAnI,MAAAgnH,GACA,OAAAD,IAAAE,GAAAF,EAAA,IAAAtoH,KAAA0J,GASA,QAAA++G,IAAAh7E,GAGA,QAAAi7E,GAAAr0G,EAAA/Y,GACA+Y,IACA9C,EAAA8C,GAAA9C,EAAA8C,GAAA9C,EAAA8C,GAAA,KAAA/Y,EAAAA,GAJA,GAAAoH,GAAA6O,EAAAkqF,IAmBA,OAXAxD,GAAAxqD,GACAh1C,EAAAg1C,EAAAltC,MAAA,MAAA,SAAAooH,GACAjmH,EAAAimH,EAAAnuH,QAAA,KACAkuH,EAAAjuB,GAAAjiF,GAAAmwG,EAAAj6G,OAAA,EAAAhM,KAAA8V,GAAAmwG,EAAAj6G,OAAAhM,EAAA,OAEAq2F,EAAAtrD,IACAh1C,EAAAg1C,EAAA,SAAAm7E,EAAAC,GACAH,EAAAjuB,GAAAouB,GAAArwG,GAAAowG,MAIAr3G,EAgBA,QAAAu3G,IAAAr7E,GACA,GAAAs7E,EAEA,OAAA,UAAAx2G,GAGA,GAFAw2G,IAAAA,EAAAN,GAAAh7E,IAEAl7B,EAAA,CACA,GAAAlK,GAAA0gH,EAAAtuB,GAAAloF,GAIA,OAHA,UAAAlK,IACAA,EAAA,MAEAA,EAGA,MAAA0gH,IAgBA,QAAAC,IAAAtuH,EAAA+yC,EAAAF,EAAA/X,GACA,MAAAxiB,GAAAwiB,GACAA,EAAA96B,EAAA+yC,EAAAF,IAGA90C,EAAA+8B,EAAA,SAAAhpB,GACA9R,EAAA8R,EAAA9R,EAAA+yC,EAAAF,KAGA7yC,GAIA,QAAA+mB,IAAA8rB,GACA,MAAA,MAAAA,GAAAA,EAAA,IAUA,QAAAi8D,MAkCA,GAAAl0D,GAAA76C,KAAA66C,UAEA2zE,mBAAAhB,IAGAiB,kBAAA,SAAAjhH,GACA,OAAA8wF,EAAA9wF,IAAA8xF,EAAA9xF,IAAAgyF,EAAAhyF,IAAA+xF,EAAA/xF,GAAAA,EAAA+zF,EAAA/zF,KAIAwlC,SACA07E,QACAC,OAAA,qCAEA7K,KAAArjB,EAAAmuB,IACA7Y,IAAAtV,EAAAmuB,IACAC,MAAApuB,EAAAmuB,KAGAE,eAAA,aACAC,eAAA,eAEAC,gBAAA,wBAGAC,GAAA,CAoBAjvH,MAAAivH,cAAA,SAAArhH,GACA,MAAAmxF,GAAAnxF,IACAqhH,IAAArhH,EACA5N,MAEAivH,EAgBA,IAAAC,GAAAlvH,KAAAmvH,eAEAnvH,MAAAy1G,MAAA,eAAA,iBAAA,gBAAA,aAAA,KAAA,YACA,SAAArG,EAAAsC,EAAA1D,EAAA4B,EAAAE,EAAAuH,GAqiBA,QAAAvI,GAAAsgB,GA+EA,QAAAZ,GAAAznG,GAEA,GAAAsoG,GAAAx0G,KAAAkM,EAMA,OALAA,GAAA9mB,KAGAovH,EAAApvH,KAAAsuH,GAAAxnG,EAAA9mB,KAAA8mB,EAAAisB,QAAAjsB,EAAA+rB,OAAAq4B,EAAAqjD,mBAFAa,EAAApvH,KAAA8mB,EAAA9mB,KAIA+mB,GAAAD,EAAA+rB,QACAu8E,EACAvf,EAAA10E,OAAAi0F,GAGA,QAAAC,GAAAt8E,EAAAm4B,GACA,GAAAokD,GAAAC,IAaA,OAXAxxH,GAAAg1C,EAAA,SAAAy8E,EAAAv4F,GACA3e,EAAAk3G,IACAF,EAAAE,EAAAtkD,GACA,MAAAokD,IACAC,EAAAt4F,GAAAq4F,IAGAC,EAAAt4F,GAAAu4F,IAIAD,EAGA,QAAAE,GAAAvkD,GACA,GAEAwkD,GAAAC,EAAAC,EAFAC,EAAAj1E,EAAA7H,QACA+8E,EAAAl1G,KAAAswD,EAAAn4B,QAGA88E,GAAAj1G,KAAAi1G,EAAApB,OAAAoB,EAAA9vB,GAAA70B,EAAA12B,SAGAu7E,GACA,IAAAL,IAAAG,GAAA,CACAF,EAAA5vB,GAAA2vB,EAEA,KAAAE,IAAAE,GACA,GAAA/vB,GAAA6vB,KAAAD,EACA,QAAAI,EAIAD,GAAAJ,GAAAG,EAAAH,GAIA,MAAAL,GAAAS,EAAAtvB,EAAAt1B,IAjIA,IAAAi5B,GAAA9F,SAAA8wB,GACA,KAAAryB,GAAA,SAAA,SAAA,+DAAAqyB,EAGA,IAAAjkD,GAAAtwD,GACA45B,OAAA,MACAg6E,iBAAA5zE,EAAA4zE,iBACAD,kBAAA3zE,EAAA2zE,kBACAQ,gBAAAn0E,EAAAm0E,iBACAI,EAEAjkD,GAAAn4B,QAAA08E,EAAAN,GACAjkD,EAAA12B,OAAAwzD,GAAA98B,EAAA12B,QACA02B,EAAA6jD,gBAAAxxB,EAAAryB,EAAA6jD,iBACA3X,EAAAt4F,IAAAosD,EAAA6jD,iBAAA7jD,EAAA6jD,eAEA,IAAAiB,GAAA,SAAA9kD,GACA,GAAAn4B,GAAAm4B,EAAAn4B,QACAk9E,EAAA3B,GAAApjD,EAAAlrE,KAAAouH,GAAAr7E,GAAAnzC,EAAAsrE,EAAAsjD,iBAgBA,OAbA3vB,GAAAoxB,IACAlyH,EAAAg1C,EAAA,SAAAplC,EAAAspB,GACA,iBAAA8oE,GAAA9oE,UACA8b,GAAA9b,KAKA4nE,EAAA3zB,EAAAglD,mBAAArxB,EAAAjkD,EAAAs1E,mBACAhlD,EAAAglD,gBAAAt1E,EAAAs1E,iBAIAC,EAAAjlD,EAAA+kD,GAAAp1F,KAAA0zF,EAAAA,IAGA6B,GAAAJ,EAAApwH,GACA6kB,EAAAorF,EAAAt0E,KAAA2vC,EAYA,KATAntE,EAAAsyH,EAAA,SAAAC,IACAA,EAAA3pC,SAAA2pC,EAAAC,eACAH,EAAA7qG,QAAA+qG,EAAA3pC,QAAA2pC,EAAAC,eAEAD,EAAAxpG,UAAAwpG,EAAAE,gBACAJ,EAAA/pH,KAAAiqH,EAAAxpG,SAAAwpG,EAAAE,iBAIAJ,EAAAtuH,QAAA,CACA,GAAA2uH,GAAAL,EAAArqH,QACA2qH,EAAAN,EAAArqH,OAEA0e,GAAAA,EAAAoW,KAAA41F,EAAAC,GAqBA,MAlBAjsG,GAAAuuB,QAAA,SAAAlhC,GAMA,MALA8zF,IAAA9zF,EAAA,MAEA2S,EAAAoW,KAAA,SAAA/T,GACAhV,EAAAgV,EAAA9mB,KAAA8mB,EAAA+rB,OAAA/rB,EAAAisB,QAAAm4B,KAEAzmD,GAGAA,EAAA8C,MAAA,SAAAzV,GAMA,MALA8zF,IAAA9zF,EAAA,MAEA2S,EAAAoW,KAAA,KAAA,SAAA/T,GACAhV,EAAAgV,EAAA9mB,KAAA8mB,EAAA+rB,OAAA/rB,EAAAisB,QAAAm4B,KAEAzmD,GAGAA,EAsKA,QAAAksG,GAAApxD,GACAxhE,EAAAuU,UAAA,SAAAuF,GACAg3F,EAAAh3F,GAAA,SAAA/R,EAAAolE,GACA,MAAA2jC,GAAAj0F,KAAAswD,OACA12B,OAAA38B,EACA/R,IAAAA,QAOA,QAAA8qH,GAAA/4G,GACA9Z,EAAAuU,UAAA,SAAAuF,GACAg3F,EAAAh3F,GAAA,SAAA/R,EAAA9F,EAAAkrE,GACA,MAAA2jC,GAAAj0F,KAAAswD,OACA12B,OAAA38B,EACA/R,IAAAA,EACA9F,KAAAA,QAaA,QAAAmwH,GAAAjlD,EAAA+kD,GA+DA,QAAAjtG,GAAA6vB,EAAA/rB,EAAA+pG,EAAA39E,GAUA,QAAA49E,KACAC,EAAAjqG,EAAA+rB,EAAAg+E,EAAA39E,GAVAhhC,IACA6U,GAAA8rB,GACA3gC,EAAA4jG,IAAAhwG,GAAA+sC,EAAA/rB,EAAAinG,GAAA8C,GAAA39E,IAGAhhC,EAAA1T,OAAAsH,IAQAkpH,EACArf,EAAAqhB,YAAAF,IAEAA,IACAnhB,EAAAshB,SAAAthB,EAAA3L,UAQA,QAAA+sB,GAAAjqG,EAAA+rB,EAAAE,EAAAG,GAEAL,EAAAhyC,KAAA6I,IAAAmpC,EAAA,IAEA9rB,GAAA8rB,GAAAhvB,EAAAqX,QAAArX,EAAAsX,SACAn7B,KAAA8mB,EACA+rB,OAAAA,EACAE,QAAAq7E,GAAAr7E,GACAm4B,OAAAA,EACAh4B,WAAAA,IAIA,QAAAg+E,GAAAxtG,GACAqtG,EAAArtG,EAAA1jB,KAAA0jB,EAAAmvB,OAAA2tD,EAAA98E,EAAAqvB,WAAArvB,EAAAwvB,YAGA,QAAAi+E,KACA,GAAA/6F,GAAAy4E,EAAA1rD,gBAAArjD,QAAAorE,EACA90C,SAAAy4E,EAAA1rD,gBAAAt+C,OAAAuxB,EAAA,GA3GA,GAEAlkB,GACAk/G,EAHAvtG,EAAAgsF,EAAA3yE,QACAzY,EAAAZ,EAAAY,QAGAqrG,EAAA5kD,EAAAn4B,QACAjtC,EAAAurH,EAAAnmD,EAAAplE,IAAAolE,EAAA6jD,gBAAA7jD,EAAAj0B,QAoCA,IAlCA43D,EAAA1rD,gBAAA98C,KAAA6kE,GACAzmD,EAAAoW,KAAAs2F,EAAAA,IAGAjmD,EAAAh5D,QAAA0oC,EAAA1oC,OAAAg5D,EAAAh5D,SAAA,GACA,QAAAg5D,EAAA12B,QAAA,UAAA02B,EAAA12B,SACAtiC,EAAAmsF,EAAAnzB,EAAAh5D,OAAAg5D,EAAAh5D,MACAmsF,EAAAzjD,EAAA1oC,OAAA0oC,EAAA1oC,MACAo/G,GAGAp/G,IACAk/G,EAAAl/G,EAAA4M,IAAAhZ,GACAg5F,EAAAsyB,GACA3xB,EAAA2xB,GAEAA,EAAAv2F,KAAAq2F,EAAAA,GAGAn2G,GAAAq2G,GACAL,EAAAK,EAAA,GAAAA,EAAA,GAAA5wB,EAAA4wB,EAAA,IAAAA,EAAA,IAEAL,EAAAK,EAAA,OAAA,MAKAl/G,EAAA4jG,IAAAhwG,EAAA2e,IAOAo6E,EAAAuyB,GAAA,CACA,GAAAG,GAAAC,GAAAtmD,EAAAplE,KACA2rG,IAAAvmC,EAAA2jD,gBAAAj0E,EAAAi0E,gBACAjvH,CACA2xH,KACAzB,EAAA5kD,EAAA4jD,gBAAAl0E,EAAAk0E,gBAAAyC,GAGApiB,EAAAjkC,EAAA12B,OAAA1uC,EAAAmqH,EAAAjtG,EAAA8sG,EAAA5kD,EAAA3zD,QACA2zD,EAAAglD,gBAAAhlD,EAAAumD,cAGA,MAAAhtG,GA2DA,QAAA4sG,GAAAvrH,EAAA4rH,GAIA,MAHAA,GAAA5vH,OAAA,IACAgE,IAAAA,EAAAhG,QAAA,SAAA,IAAA,KAAA4xH,GAEA5rH,EA16BA,GAAAwrH,GAAAvjB,EAAA,QAKAnzD,GAAAm0E,gBAAAxxB,EAAA3iD,EAAAm0E,iBACA3X,EAAAt4F,IAAA87B,EAAAm0E,iBAAAn0E,EAAAm0E,eAOA,IAAAsB,KAswBA,OApwBAtyH,GAAAkxH,EAAA,SAAA0C,GACAtB,EAAA9qG,QAAAg4E,EAAAo0B,GACAva,EAAAt4F,IAAA6yG,GAAAva,EAAAtT,OAAA6tB,MAypBA9iB,EAAA1rD,mBAkDAwtE,EAAA,MAAA,SAAA,OAAA,SAwCAC,EAAA,OAAA,MAAA,SAYA/hB,EAAAj0D,SAAAA,EAGAi0D,IA4JA,QAAA+iB,MACA,MAAA,IAAAp0H,GAAA0I,eAmBA,QAAAkpG,MACArvG,KAAAy1G,MAAA,WAAA,UAAA,YAAA,SAAA3H,EAAAkD,EAAA5C,GACA,MAAA0jB,IAAAhkB,EAAA+jB,GAAA/jB,EAAA3wE,MAAA6zE,EAAA5M,QAAA8D,UAAAkG,EAAA,MAIA,QAAA0jB,IAAAhkB,EAAA+jB,EAAAE,EAAA7pB,EAAA8pB,GA8GA,QAAAC,GAAAlsH,EAAAmsH,EAAAjvG,GAIA,GAAAizB,GAAA87E,EAAA91H,cAAA,UAAAotB,EAAA,IA6BA,OA5BA4sB,GAAAttC,KAAA,kBACAstC,EAAAr3C,IAAAkH,EACAmwC,EAAAlF,OAAA,EAEA1nB,EAAA,SAAA7P,GACAg6F,GAAAv9D,EAAA,OAAA5sB,GACAmqF,GAAAv9D,EAAA,QAAA5sB,GACA0oG,EAAAxyH,KAAAoG,YAAAswC,GACAA,EAAA,IACA,IAAApD,MACA3xC,EAAA,SAEAsY,KACA,SAAAA,EAAA7Q,MAAAs/F,EAAAgqB,GAAA/oE,SACA1vC,GAAA7Q,KAAA,UAEAzH,EAAAsY,EAAA7Q,KACAkqC,EAAA,UAAAr5B,EAAA7Q,KAAA,IAAA,KAGAqa,GACAA,EAAA6vB,EAAA3xC,IAIAgxH,GAAAj8E,EAAA,OAAA5sB,GACA6oG,GAAAj8E,EAAA,QAAA5sB,GACA0oG,EAAAxyH,KAAAyE,YAAAiyC,GACA5sB,EA7IA,MAAA,UAAAmrB,EAAA1uC,EAAA+9G,EAAAx6F,EAAA0pB,EAAAx7B,EAAA24G,EAAAuB,GA2FA,QAAAU,KACAC,GAAAA,IACAjuH,GAAAA,EAAAmwC,QAGA,QAAA+9E,GAAAhpG,EAAAwpB,EAAA/rB,EAAA+pG,EAAA39E,GAEAuoE,IAAA77G,GACAkyH,EAAApW,OAAAD,GAEA2W,EAAAjuH,EAAA,KAEAklB,EAAAwpB,EAAA/rB,EAAA+pG,EAAA39E,GACA26D,EAAA+M,6BAAApqG,GApGA,GAHAq9F,EAAAgN,+BACA/0G,EAAAA,GAAA+nG,EAAA/nG,MAEA,SAAAi6F,GAAAvrD,GAAA,CACA,GAAAy9E,GAAA,KAAAhqB,EAAAC,WAAA9/E,SAAA,GACA6/E,GAAAgqB,GAAA,SAAAjyH,GACAioG,EAAAgqB,GAAAjyH,KAAAA,EACAioG,EAAAgqB,GAAA/oE,QAAA,EAGA,IAAAkpE,GAAAJ,EAAAlsH,EAAA9C,QAAA,gBAAA,qBAAAivH,GACAA,EAAA,SAAAp/E,EAAA3xC,GACAmxH,EAAAhpG,EAAAwpB,EAAAo1D,EAAAgqB,GAAAjyH,KAAA,GAAAkB,GACA+mG,EAAAgqB,GAAAzhH,QAEA,CAEA,GAAArM,GAAAytH,GAEAztH,GAAAgC,KAAAquC,EAAA1uC,GAAA,GACA/H,EAAAg1C,EAAA,SAAAplC,EAAAgM,GACAmlF,EAAAnxF,IACAxJ,EAAA+vC,iBAAAv6B,EAAAhM,KAIAxJ,EAAA8E,OAAA,WACA,GAAAiqC,GAAA/uC,EAAA+uC,YAAA,GAIApsB,EAAA,YAAA3iB,GAAAA,EAAA2iB,SAAA3iB,EAAAO,aAGAmuC,EAAA,OAAA1uC,EAAA0uC,OAAA,IAAA1uC,EAAA0uC,MAKA,KAAAA,IACAA,EAAA/rB,EAAA,IAAA,QAAAwrG,GAAAxsH,GAAAysH,SAAA,IAAA,GAGAF,EAAAhpG,EACAwpB,EACA/rB,EACA3iB,EAAA8vC,wBACAf,GAGA,IAAAq9E,GAAA,WAGA8B,EAAAhpG,KAAA,KAAA,KAAA,IAUA,IAPAllB,EAAA2E,QAAAynH,EACApsH,EAAAquH,QAAAjC,EAEAL,IACA/rH,EAAA+rH,iBAAA,GAGAuB,EACA,IACAttH,EAAAstH,aAAAA,EACA,MAAAryH,GAQA,GAAA,SAAAqyH,EACA,KAAAryH,GAKA+E,EAAAiC,KAAAy9G,GAGA,GAAAtsG,EAAA,EACA,GAAAkkG,GAAAqW,EAAAK,EAAA56G,OACAkoF,GAAAloF,IACAA,EAAAsjB,KAAAs3F,IAyGA,QAAAzjB,MACA,GAAAmd,GAAA,KACAC,EAAA,IAWA/rH,MAAA8rH,YAAA,SAAAl+G,GACA,MAAAA,IACAk+G,EAAAl+G,EACA5N,MAEA8rH,GAaA9rH,KAAA+rH,UAAA,SAAAn+G,GACA,MAAAA,IACAm+G,EAAAn+G,EACA5N,MAEA+rH,GAKA/rH,KAAAy1G,MAAA,SAAA,oBAAA,OAAA,SAAA/F,EAAApB,EAAA4B,GAMA,QAAA5hD,GAAAokE,GACA,MAAA,SAAAA,EAGA,QAAAC,GAAAxxH,GACA,MAAAA,GAAA8B,QAAA2vH,EAAA9G,GACA7oH,QAAA4vH,EAAA9G,GAGA,QAAAxgD,GAAA39D,GACA,GAAA,MAAAA,EACA,MAAA,EAEA,cAAAA,IACA,IAAA,SACA,KACA,KAAA,SACAA,EAAA,GAAAA,CACA,MACA,SACAA,EAAA2zF,EAAA3zF,GAGA,MAAAA,GAiGA,QAAA8gG,GAAAvtG,EAAA2xH,EAAA5J,EAAAD,GA0FA,QAAA8J,GAAAnlH,GACA,IAEA,MADAA,GAAAolH,EAAAplH,GACAq7G,IAAAlqB,EAAAnxF,GAAAA,EAAA29D,EAAA39D,GACA,MAAA6N,GACA6yF,EAAA2kB,GAAAC,OAAA/xH,EAAAsa,KA9FAwtG,IAAAA,CAWA,KAVA,GAAA7nB,GACA+xB,EAKAC,EAJA7yH,EAAA,EACAqoH,KACAyK,KACAC,EAAAnyH,EAAAY,OAEAkZ,KACAs4G,KAEAhzH,EAAA+yH,GAAA,CACA,IAAAlyB,EAAAjgG,EAAApB,QAAA+rH,EAAAvrH,UACA4yH,EAAAhyH,EAAApB,QAAAgsH,EAAA3qB,EAAAoyB,QAUA,CAEAjzH,IAAA+yH,GACAr4G,EAAA3U,KAAAqsH,EAAAxxH,EAAAiM,UAAA7M,IAEA,OAdAA,IAAA6gG,GACAnmF,EAAA3U,KAAAqsH,EAAAxxH,EAAAiM,UAAA7M,EAAA6gG,KAEAgyB,EAAAjyH,EAAAiM,UAAAg0F,EAAAoyB,EAAAL,GACAvK,EAAAtiH,KAAA8sH,GACAC,EAAA/sH,KAAAopG,EAAA0jB,EAAAL,IACAxyH,EAAA4yH,EAAAM,EACAF,EAAAjtH,KAAA2U,EAAAlZ,QACAkZ,EAAA3U,KAAA,IAoBA,GAJA4iH,GAAAjuG,EAAAlZ,OAAA,GACAkxH,GAAAS,cAAAvyH,IAGA2xH,GAAAlK,EAAA7mH,OAAA,CACA,GAAA4xH,GAAA,SAAAn0G,GACA,IAAA,GAAAvX,GAAA,EAAAo2F,EAAAuqB,EAAA7mH,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA,GAAAghH,GAAAnqB,EAAAt/E,EAAAvX,IAAA,MACAgT,GAAAs4G,EAAAtrH,IAAAuX,EAAAvX,GAEA,MAAAgT,GAAAhV,KAAA,KAGA+sH,EAAA,SAAAplH,GACA,MAAAs7G,GACAhZ,EAAA0jB,WAAA1K,EAAAt7G,GACAsiG,EAAAzR,QAAA7wF,GAGA,OAAAiN,GAAA,SAAA1H,GACA,GAAAlL,GAAA,EACAo2F,EAAAuqB,EAAA7mH,OACAyd,EAAA,GAAAuK,OAAAs0E,EAEA,KACA,KAAAp2F,EAAAo2F,EAAAp2F,IACAuX,EAAAvX,GAAAorH,EAAAprH,GAAAkL,EAGA,OAAAwgH,GAAAn0G,GACA,MAAA/D,GACA6yF,EAAA2kB,GAAAC,OAAA/xH,EAAAsa,OAKA23G,IAAAjyH,EACAynH,YAAAA,EACAiL,gBAAA,SAAA7vB,EAAA0W,GACA,GAAAwP,EACA,OAAAlmB,GAAA8vB,YAAAT,EAAA,SAAA7zG,EAAAu0G,GACA,GAAAC,GAAAL,EAAAn0G,EACAjH,GAAAmiG,IACAA,EAAAt9G,KAAA4C,KAAAg0H,EAAAx0G,IAAAu0G,EAAA7J,EAAA8J,EAAAhwB,GAEAkmB,EAAA8J,QAjNA,GAAAR,GAAA1H,EAAA/pH,OACA0xH,EAAA1H,EAAAhqH,OACA6wH,EAAA,GAAAzrH,QAAA2kH,EAAA7oH,QAAA,KAAAqrD,GAAA,KACAukE,EAAA,GAAA1rH,QAAA4kH,EAAA9oH,QAAA,KAAAqrD,GAAA,IA8PA,OApBAogD,GAAAod,YAAA,WACA,MAAAA,IAeApd,EAAAqd,UAAA,WACA,MAAAA,IAGArd,IAIA,QAAAG,MACA7uG,KAAAy1G,MAAA,aAAA,UAAA,KAAA,MACA,SAAA7F,EAAAoB,EAAAlB,EAAAE,GAiIA,QAAAnjE,GAAA96B,EAAAm7B,EAAAhQ,EAAA+2F,GACA,GAAAC,GAAA3hH,UAAAxQ,OAAA,EACAuQ,EAAA4hH,EAAA/yB,EAAA5uF,UAAA,MACAu6B,EAAAkkE,EAAAlkE,YACAC,EAAAikE,EAAAjkE,cACAonF,EAAA,EACAC,EAAAr1B,EAAAk1B,KAAAA,EACAnwG,GAAAswG,EAAApkB,EAAAF,GAAA3yE,QACAzY,EAAAZ,EAAAY,OAuBA,OArBAwY,GAAA6hE,EAAA7hE,GAAAA,EAAA,EAEAxY,EAAAoW,KAAA,KAAA,KAAAo5F,EAAA,WACAniH,EAAA+C,MAAA,KAAAxC,IADAP,GAIA2S,EAAA2vG,aAAAvnF,EAAA,WACAhpB,EAAAuX,OAAA84F,KAEAj3F,EAAA,GAAAi3F,GAAAj3F,IACApZ,EAAAqX,QAAAg5F,GACApnF,EAAAroB,EAAA2vG,oBACAC,GAAA5vG,EAAA2vG,eAGAD,GAAAxkB,EAAA3L,UAEA/2D,GAEAonF,EAAA5vG,EAAA2vG,cAAAvwG,EAEAY,EA/JA,GAAA4vG,KAuLA,OAVAznF,GAAA8uE,OAAA,SAAAj3F,GACA,SAAAA,GAAAA,EAAA2vG,eAAAC,MACAA,EAAA5vG,EAAA2vG,cAAAj5F,OAAA,YACA41E,EAAAjkE,cAAAroB,EAAA2vG,oBACAC,GAAA5vG,EAAA2vG,eACA,IAKAxnF,IAcA,QAAA07D,MACAvoG,KAAAy1G,KAAA,WACA,OACAxwG,GAAA,QAEAsvH,gBACAC,YAAA,IACAC,UAAA,IACAC,WAEAC,OAAA,EACAC,QAAA,EACAC,QAAA,EACAC,OAAA,GACAC,OAAA,GACAC,OAAA,IACAC,OAAA,GACAC,MAAA,EACAC,OAAA,IAEAR,OAAA,EACAC,QAAA,EACAC,QAAA,EACAC,OAAA,IACAC,OAAA,GACAC,OAAA,KACAC,OAAA,IACAC,MAAA,EACAC,OAAA,IAGAC,aAAA,KAGAC,kBACAC,MACA,wFACAxvH,MAAA,KACAyvH,WAAA,kDAAAzvH,MAAA,KACA0vH,IAAA,2DAAA1vH,MAAA,KACA2vH,SAAA,8BAAA3vH,MAAA,KACA4vH,OAAA,KAAA,MACAC,OAAA,qBACAC,QAAA,gBACAC,SAAA,kBACAC,SAAA,YACAC,WAAA,WACAC,UAAA,SACAC,WAAA,YACAC,UAAA,SACAC,UACA,gBACA,eAEAC,MACA,KACA,OAIAC,UAAA,SAAAltG,GACA,MAAA,KAAAA,EACA,MAEA,WAiBA,QAAAmtG,IAAAtqD,GAIA,IAHA,GAAAuqD,GAAAvqD,EAAAlmE,MAAA,KACAmC,EAAAsuH,EAAAx0H,OAEAkG,KACAsuH,EAAAtuH,GAAA66F,GAAAyzB,EAAAtuH,GAGA,OAAAsuH,GAAAtwH,KAAA,KAGA,QAAAuwH,IAAAC,EAAAC,GACA,GAAAC,GAAApE,GAAAkE,EAEAC,GAAAE,WAAAD,EAAAnE,SACAkE,EAAAG,OAAAF,EAAA3zH,SACA0zH,EAAAI,OAAAh0E,EAAA6zE,EAAAxzE,OAAA4zE,GAAAJ,EAAAnE,WAAA,KAIA,QAAAwE,IAAAC,EAAAP,GACA,GAAAQ,GAAA,MAAAD,EAAAxoH,OAAA,EACAyoH,KACAD,EAAA,IAAAA,EAEA,IAAAnwH,GAAAyrH,GAAA0E,EACAP,GAAAS,OAAA9rD,mBAAA6rD,GAAA,MAAApwH,EAAA0hF,SAAA/5E,OAAA,GACA3H,EAAA0hF,SAAAp7E,UAAA,GAAAtG,EAAA0hF,UACAkuC,EAAAU,SAAA50B,GAAA17F,EAAA4sE,QACAgjD,EAAAW,OAAAhsD,mBAAAvkE,EAAA6vB,MAGA+/F,EAAAS,QAAA,KAAAT,EAAAS,OAAA1oH,OAAA,KACAioH,EAAAS,OAAA,IAAAT,EAAAS,QAYA,QAAAG,IAAAC,EAAAC,GACA,GAAA,IAAAA,EAAAz3H,QAAAw3H,GACA,MAAAC,GAAAvjH,OAAAsjH,EAAAx1H,QAKA,QAAAq5G,IAAAr1G,GACA,GAAAxF,GAAAwF,EAAAhG,QAAA,IACA,OAAAQ,OAAAwF,EAAAA,EAAAkO,OAAA,EAAA1T,GAGA,QAAAk3H,IAAA1xH,GACA,MAAAA,GAAA9C,QAAA,WAAA,MAIA,QAAAy0H,IAAA3xH,GACA,MAAAA,GAAAkO,OAAA,EAAAmnG,GAAAr1G,GAAAy5C,YAAA,KAAA,GAIA,QAAAm4E,IAAA5xH,GACA,MAAAA,GAAAqH,UAAA,EAAArH,EAAAhG,QAAA,IAAAgG,EAAAhG,QAAA,MAAA,IAYA,QAAA63H,IAAAC,EAAAC,GACA93H,KAAA+3H,SAAA,EACAD,EAAAA,GAAA,EACA,IAAAE,GAAAN,GAAAG,EACArB,IAAAqB,EAAA73H,MAQAA,KAAAi4H,QAAA,SAAAlyH,GACA,GAAAmyH,GAAAZ,GAAAU,EAAAjyH,EACA,KAAAy3F,EAAA06B,GACA,KAAAC,IAAA,WAAA,gDAAApyH,EACAiyH,EAGAhB,IAAAkB,EAAAl4H,MAEAA,KAAAm3H,SACAn3H,KAAAm3H,OAAA,KAGAn3H,KAAAo4H,aAOAp4H,KAAAo4H,UAAA,WACA,GAAA1kD,GAAAivB,GAAA3iG,KAAAo3H,UACAzgG,EAAA32B,KAAAq3H,OAAA,IAAAv0B,GAAA9iG,KAAAq3H,QAAA,EAEAr3H,MAAAq4H,MAAA/B,GAAAt2H,KAAAm3H,SAAAzjD,EAAA,IAAAA,EAAA,IAAA/8C,EACA32B,KAAAs4H,SAAAN,EAAAh4H,KAAAq4H,MAAApkH,OAAA,IAGAjU,KAAAu4H,eAAA,SAAAxyH,EAAAyyH,GACA,GAAAA,GAAA,MAAAA,EAAA,GAIA,MADAx4H,MAAA22B,KAAA6hG,EAAAr7H,MAAA,KACA,CAEA,IAAAs7H,GAAAC,EACAC,CAiBA,QAfAF,EAAAnB,GAAAO,EAAA9xH,MAAAlG,GACA64H,EAAAD,EAEAE,GADAF,EAAAnB,GAAAQ,EAAAW,MAAA54H,EACAm4H,GAAAV,GAAA,IAAAmB,IAAAA,GAEAZ,EAAAa,IAEAD,EAAAnB,GAAAU,EAAAjyH,MAAAlG,EACA84H,EAAAX,EAAAS,EACAT,GAAAjyH,EAAA,MACA4yH,EAAAX,GAEAW,GACA34H,KAAAi4H,QAAAU,KAEAA,GAcA,QAAAC,IAAAf,EAAAgB,GACA,GAAAb,GAAAN,GAAAG,EAEArB,IAAAqB,EAAA73H,MAQAA,KAAAi4H,QAAA,SAAAlyH,GA8CA,QAAA+yH,GAAA9sD,EAAAjmE,EAAA2nB,GAKA,GAEAqrG,GAFAC,EAAA,iBAUA,OALA,KAAAjzH,EAAAhG,QAAA2tB,KACA3nB,EAAAA,EAAA9C,QAAAyqB,EAAA,KAIAsrG,EAAA7rH,KAAApH,GACAimE,GAGA+sD,EAAAC,EAAA7rH,KAAA6+D,GACA+sD,EAAAA,EAAA,GAAA/sD,GAjEA,GACAitD,GADAC,EAAA5B,GAAAO,EAAA9xH,IAAAuxH,GAAAU,EAAAjyH,EAGA+4F,GAAAo6B,IAAA,MAAAA,EAAAzqH,OAAA,GAcAzO,KAAA+3H,QACAkB,EAAAC,GAEAD,EAAA,GACAn6B,EAAAo6B,KACArB,EAAA9xH,EACA/F,KAAAiD,aAhBAg2H,EAAA3B,GAAAuB,EAAAK,GACAp6B,EAAAm6B,KAEAA,EAAAC,IAkBAlC,GAAAiC,EAAAj5H,MAEAA,KAAAm3H,OAAA2B,EAAA94H,KAAAm3H,OAAA8B,EAAApB,GAEA73H,KAAAo4H,aAyCAp4H,KAAAo4H,UAAA,WACA,GAAA1kD,GAAAivB,GAAA3iG,KAAAo3H,UACAzgG,EAAA32B,KAAAq3H,OAAA,IAAAv0B,GAAA9iG,KAAAq3H,QAAA,EAEAr3H,MAAAq4H,MAAA/B,GAAAt2H,KAAAm3H,SAAAzjD,EAAA,IAAAA,EAAA,IAAA/8C,EACA32B,KAAAs4H,SAAAT,GAAA73H,KAAAq4H,MAAAQ,EAAA74H,KAAAq4H,MAAA,KAGAr4H,KAAAu4H,eAAA,SAAAxyH,EAAAyyH,GACA,MAAApd,IAAAyc,IAAAzc,GAAAr1G,KACA/F,KAAAi4H,QAAAlyH,IACA,IAgBA,QAAAozH,IAAAtB,EAAAgB,GACA74H,KAAA+3H,SAAA,EACAa,GAAA9jH,MAAA9U,KAAAuS,UAEA,IAAAylH,GAAAN,GAAAG,EAEA73H,MAAAu4H,eAAA,SAAAxyH,EAAAyyH,GACA,GAAAA,GAAA,MAAAA,EAAA,GAIA,MADAx4H,MAAA22B,KAAA6hG,EAAAr7H,MAAA,KACA,CAGA,IAAAw7H,GACAF,CAYA,OAVAZ,IAAAzc,GAAAr1G,GACA4yH,EAAA5yH,GACA0yH,EAAAnB,GAAAU,EAAAjyH,IACA4yH,EAAAd,EAAAgB,EAAAJ,EACAT,IAAAjyH,EAAA,MACA4yH,EAAAX,GAEAW,GACA34H,KAAAi4H,QAAAU,KAEAA,GAGA34H,KAAAo4H,UAAA,WACA,GAAA1kD,GAAAivB,GAAA3iG,KAAAo3H,UACAzgG,EAAA32B,KAAAq3H,OAAA,IAAAv0B,GAAA9iG,KAAAq3H,QAAA,EAEAr3H,MAAAq4H,MAAA/B,GAAAt2H,KAAAm3H,SAAAzjD,EAAA,IAAAA,EAAA,IAAA/8C,EAEA32B,KAAAs4H,SAAAT,EAAAgB,EAAA74H,KAAAq4H,OA0UA,QAAAe,IAAAxmC,GACA,MAAA,YACA,MAAA5yF,MAAA4yF,IAKA,QAAAymC,IAAAzmC,EAAA0mC,GACA,MAAA,UAAA1rH,GACA,MAAAkxF,GAAAlxF,GACA5N,KAAA4yF,IAGA5yF,KAAA4yF,GAAA0mC,EAAA1rH,GACA5N,KAAAo4H,YAEAp4H,OAqCA,QAAAuvG,MACA,GAAAspB,GAAA,GACAU,GACAxiG,SAAA,EACAyiG,aAAA,EACAC,cAAA,EAUAz5H,MAAA64H,WAAA,SAAAnxG,GACA,MAAAq3E,GAAAr3E,IACAmxG,EAAAnxG,EACA1nB,MAEA64H,GAuBA74H,KAAAu5H,UAAA,SAAAr2E,GACA,MAAAu8C,GAAAv8C,IACAq2E,EAAAxiG,QAAAmsB,EACAljD,MACAs+F,EAAAp7C,IAEAu8C,EAAAv8C,EAAAnsB,WACAwiG,EAAAxiG,QAAAmsB,EAAAnsB,SAGA0oE,EAAAv8C,EAAAs2E,eACAD,EAAAC,YAAAt2E,EAAAs2E,aAGA/5B,EAAAv8C,EAAAu2E,gBACAF,EAAAE,aAAAv2E,EAAAu2E,cAGAz5H,MAEAu5H,GA2CAv5H,KAAAy1G,MAAA,aAAA,WAAA,WAAA,eAAA,UACA,SAAA7F,EAAA9B,EAAAwC,EAAAyP,EAAA/O,GAyBA,QAAA0oB,GAAA3zH,EAAA9C,EAAAuL,GACA,GAAAmrH,GAAArqB,EAAAvpG,MACA6zH,EAAAtqB,EAAAuqB,OACA,KACA/rB,EAAA/nG,IAAAA,EAAA9C,EAAAuL,GAKA8gG,EAAAuqB,QAAA/rB,EAAAt/F,QACA,MAAAnP,GAKA,KAHAiwG,GAAAvpG,IAAA4zH,GACArqB,EAAAuqB,QAAAD,EAEAv6H,GA+HA,QAAAy6H,GAAAH,EAAAC,GACAhqB,EAAAmqB,WAAA,yBAAAzqB,EAAA0qB,SAAAL,EACArqB,EAAAuqB,QAAAD,GAxKA,GAAAtqB,GACA2qB,EAGApC,EAFApc,EAAA3N,EAAA2N,WACAye,EAAApsB,EAAA/nG,KAGA,IAAAwzH,EAAAxiG,QAAA,CACA,IAAA0kF,GAAA8d,EAAAC,YACA,KAAArB,IAAA,SACA,+DAEAN,GAAAF,GAAAuC,IAAAze,GAAA,KACAwe,EAAA3pB,EAAA/nB,QAAAqvC,GAAAuB,OAEAtB,GAAAzc,GAAA8e,GACAD,EAAArB,EAEAtpB,GAAA,GAAA2qB,GAAApC,EAAA,IAAAgB,GACAvpB,EAAAipB,eAAA2B,EAAAA,GAEA5qB,EAAAuqB,QAAA/rB,EAAAt/F,OAEA,IAAA2rH,GAAA,2BAqBApa,GAAAnuG,GAAA,QAAA,SAAA6H,GAIA,GAAA8/G,EAAAE,eAAAhgH,EAAAmoD,UAAAnoD,EAAA+nB,UAAA/nB,EAAAwjE,UAAA,GAAAxjE,EAAA2H,OAAA,GAAA3H,EAAA0d,OAAA,CAKA,IAHA,GAAAgiF,GAAA/W,GAAA3oF,EAAArb,QAGA,MAAA2hG,EAAAoZ,EAAA,KAEA,GAAAA,EAAA,KAAA4G,EAAA,MAAA5G,EAAAA,EAAA/3G,UAAA,GAAA,MAGA,IAAAg5H,GAAAjhB,EAAAx4F,KAAA,QAGA63G,EAAArf,EAAA14G,KAAA,SAAA04G,EAAA14G,KAAA,aAEA69F,GAAA87B,IAAA,+BAAAA,EAAA/xG,aAGA+xG,EAAA7H,GAAA6H,EAAAxX,SAAAjuG,MAIAwlH,EAAA50H,KAAA60H,KAEAA,GAAAjhB,EAAA14G,KAAA,WAAAgZ,EAAA+mB,sBACA8uE,EAAAipB,eAAA6B,EAAA5B,KAIA/+G,EAAA8mB,iBAEA+uE,EAAA0qB,UAAAlsB,EAAA/nG,QACA6pG,EAAA3L,SAEA+M,EAAA5M,QAAA,6BAAA,OAQAqzB,GAAAnoB,EAAA0qB,WAAAvC,GAAAyC,IACApsB,EAAA/nG,IAAAupG,EAAA0qB,UAAA,EAGA,IAAAlkE,IAAA,CAuEA,OApEAg4C,GAAAwN,YAAA,SAAA+e,EAAAC,GACA1qB,EAAAxQ,WAAA,WACA,GAEAr8D,GAFA42F,EAAArqB,EAAA0qB,SACAJ,EAAAtqB,EAAAuqB,OAGAvqB,GAAA2oB,QAAAoC,GACA/qB,EAAAuqB,QAAAS,EAEAv3F,EAAA6sE,EAAAmqB,WAAA,uBAAAM,EAAAV,EACAW,EAAAV,GAAA72F,iBAIAusE,EAAA0qB,WAAAK,IAEAt3F,GACAusE,EAAA2oB,QAAA0B,GACArqB,EAAAuqB,QAAAD,EACAF,EAAAC,GAAA,EAAAC,KAEA9jE,GAAA,EACAgkE,EAAAH,EAAAC,OAGAhqB,EAAAshB,SAAAthB,EAAA2qB,YAIA3qB,EAAAvQ,OAAA,WACA,GAAAs6B,GAAAlC,GAAA3pB,EAAA/nG,OACAs0H,EAAA5C,GAAAnoB,EAAA0qB,UACAJ,EAAA9rB,EAAAt/F,QACAgsH,EAAAlrB,EAAAmrB,UACAC,EAAAf,IAAAU,GACA/qB,EAAAyoB,SAAAznB,EAAA/nB,SAAAqxC,IAAAtqB,EAAAuqB,SAEA/jE,GAAA4kE,KACA5kE,GAAA,EAEA85C,EAAAxQ,WAAA,WACA,GAAAi7B,GAAA/qB,EAAA0qB,SACAj3F,EAAA6sE,EAAAmqB,WAAA,uBAAAM,EAAAV,EACArqB,EAAAuqB,QAAAD,GAAA72F,gBAIAusE,GAAA0qB,WAAAK,IAEAt3F,GACAusE,EAAA2oB,QAAA0B,GACArqB,EAAAuqB,QAAAD,IAEAc,GACAhB,EAAAW,EAAAG,EACAZ,IAAAtqB,EAAAuqB,QAAA,KAAAvqB,EAAAuqB,SAEAC,EAAAH,EAAAC,QAKAtqB,EAAAmrB,WAAA,IAMAnrB,IAqDA,QAAAG,MACA,GAAAx2D,IAAA,EACAxgB,EAAAz4B,IASAA,MAAA26H,aAAA,SAAAvhH,GACA,MAAA2lF,GAAA3lF,IACA6/B,EAAA7/B,EACApZ,MAEAi5C,GAIAj5C,KAAAy1G,MAAA,UAAA,SAAAzE,GAwDA,QAAA4pB,GAAAjwG,GAUA,MATAA,aAAA3S,SACA2S,EAAA2P,MACA3P,EAAAA,EAAA9W,SAAA8W,EAAA2P,MAAAv6B,QAAA4qB,EAAA9W,cACA,UAAA8W,EAAA9W,QAAA,KAAA8W,EAAA2P,MACA3P,EAAA2P,MACA3P,EAAAkwG,YACAlwG,EAAAA,EAAA9W,QAAA,KAAA8W,EAAAkwG,UAAA,IAAAlwG,EAAAujG,OAGAvjG,EAGA,QAAAmwG,GAAAlyH,GACA,GAAAgL,GAAAo9F,EAAAp9F,YACAmnH,EAAAnnH,EAAAhL,IAAAgL,EAAAqsC,KAAAxvC,EACAuqH,GAAA,CAIA,KACAA,IAAAD,EAAAjmH,MACA,MAAAzV,IAEA,MAAA27H,GACA,WACA,GAAA1oH,KAIA,OAHAtU,GAAAuU,UAAA,SAAAoY,GACArY,EAAAhM,KAAAs0H,EAAAjwG,MAEAowG,EAAAjmH,MAAAlB,EAAAtB,IAMA,SAAA2oH,EAAAC,GACAH,EAAAE,EAAA,MAAAC,EAAA,GAAAA,IA5FA,OAQAj7E,IAAA66E,EAAA,OASA31E,KAAA21E,EAAA,QASAzqH,KAAAyqH,EAAA,QASAtzG,MAAAszG,EAAA,SASA7hF,MAAA,WACA,GAAAlnC,GAAA+oH,EAAA,QAEA,OAAA,YACA7hF,GACAlnC,EAAA+C,MAAA2jB,EAAAlmB,kBAsFA,QAAA4oH,IAAArjH,EAAAsjH,GACA,GAAA,qBAAAtjH,GAAA,qBAAAA,GACA,qBAAAA,GAAA,qBAAAA,GACA,cAAAA,EACA,KAAAujH,IAAA,UACA,kFACAD,EAEA,OAAAtjH,GAGA,QAAAwjH,IAAAzpH,EAAAupH,GAEA,GAAAvpH,EAAA,CACA,GAAAA,EAAAoX,cAAApX,EACA,KAAAwpH,IAAA,SACA,6EACAD,EACA,IACAvpH,EAAApU,SAAAoU,EACA,KAAAwpH,IAAA,aACA,+EACAD,EACA,IACAvpH,EAAAknB,WAAAlnB,EAAArM,UAAAqM,EAAA8O,MAAA9O,EAAApR,MAAAoR,EAAA3R,MACA,KAAAm7H,IAAA,UACA,8EACAD,EACA,IACAvpH,IAAArL,OACA,KAAA60H,IAAA,UACA,2EACAD,GAGA,MAAAvpH,GAOA,QAAA0pH,IAAA1pH,EAAAupH,GACA,GAAAvpH,EAAA,CACA,GAAAA,EAAAoX,cAAApX,EACA,KAAAwpH,IAAA,SACA,6EACAD,EACA,IAAAvpH,IAAA2pH,IAAA3pH,IAAA4pH,IAAA5pH,IAAA6pH,GACA,KAAAL,IAAA,SACA,wFACAD,IAggBA,QAAAO,IAAA/zG,EAAApa,GACA,MAAA,mBAAAoa,GAAAA,EAAApa,EAGA,QAAAouH,IAAAx+G,EAAA+b,GACA,MAAA,mBAAA/b,GAAA+b,EACA,mBAAAA,GAAA/b,EACAA,EAAA+b,EAGA,QAAA0iG,IAAArtB,EAAAstB,GACA,GAAA/pH,GAAAy8F,EAAAstB,EACA,QAAA/pH,EAAAy4G,UAGA,QAAAuR,IAAAC,EAAAxtB,GACA,GAAAytB,GACAC,CACA,QAAAF,EAAApzH,MACA,IAAAuzH,IAAAC,QACAH,GAAA,EACAj+H,EAAAg+H,EAAAx8H,KAAA,SAAAk1B,GACAqnG,GAAArnG,EAAAq4F,WAAAve,GACAytB,EAAAA,GAAAvnG,EAAAq4F,WAAArlB,WAEAs0B,EAAAt0B,SAAAu0B,CACA,MACA,KAAAE,IAAAE,QACAL,EAAAt0B,UAAA,EACAs0B,EAAAM,UACA,MACA,KAAAH,IAAAI,gBACAR,GAAAC,EAAA7uG,SAAAqhF,GACAwtB,EAAAt0B,SAAAs0B,EAAA7uG,SAAAu6E,SACAs0B,EAAAM,QAAAN,EAAA7uG,SAAAmvG,OACA,MACA,KAAAH,IAAAK,iBACAT,GAAAC,EAAAh0F,KAAAwmE,GACAutB,GAAAC,EAAAzsE,MAAAi/C,GACAwtB,EAAAt0B,SAAAs0B,EAAAh0F,KAAA0/D,UAAAs0B,EAAAzsE,MAAAm4C,SACAs0B,EAAAM,QAAAN,EAAAh0F,KAAAs0F,QAAArhH,OAAA+gH,EAAAzsE,MAAA+sE,QACA,MACA,KAAAH,IAAAM,kBACAV,GAAAC,EAAAh0F,KAAAwmE,GACAutB,GAAAC,EAAAzsE,MAAAi/C,GACAwtB,EAAAt0B,SAAAs0B,EAAAh0F,KAAA0/D,UAAAs0B,EAAAzsE,MAAAm4C,SACAs0B,EAAAM,QAAAN,EAAAt0B,aAAAs0B,EACA,MACA,KAAAG,IAAAO,sBACAX,GAAAC,EAAAz2H,KAAAipG,GACAutB,GAAAC,EAAAW,UAAAnuB,GACAutB,GAAAC,EAAAY,WAAApuB,GACAwtB,EAAAt0B,SAAAs0B,EAAAz2H,KAAAmiG,UAAAs0B,EAAAW,UAAAj1B,UAAAs0B,EAAAY,WAAAl1B,SACAs0B,EAAAM,QAAAN,EAAAt0B,aAAAs0B,EACA,MACA,KAAAG,IAAAU,WACAb,EAAAt0B,UAAA,EACAs0B,EAAAM,SAAAN,EACA,MACA,KAAAG,IAAAW,iBACAf,GAAAC,EAAA/iH,OAAAu1F,GACAwtB,EAAAr0F,UACAo0F,GAAAC,EAAAppC,SAAA4b,GAEAwtB,EAAAt0B,SAAAs0B,EAAA/iH,OAAAyuF,YAAAs0B,EAAAr0F,UAAAq0F,EAAAppC,SAAA8U,UACAs0B,EAAAM,SAAAN,EACA,MACA,KAAAG,IAAAY,eACAd,IAAAD,EAAArjH,QAAAkjH,GAAArtB,EAAAwtB,EAAAgB,OAAAllH,MACAokH,KACAl+H,EAAAg+H,EAAAzpH,UAAA,SAAAmiB,GACAqnG,GAAArnG,EAAA85E,GACAytB,EAAAA,GAAAvnG,EAAAgzE,SACAhzE,EAAAgzE,UACAw0B,EAAA51H,KAAAwO,MAAAonH,EAAAxnG,EAAA4nG,WAGAN,EAAAt0B,SAAAu0B,EACAD,EAAAM,QAAAN,EAAArjH,QAAAkjH,GAAArtB,EAAAwtB,EAAAgB,OAAAllH,MAAAokH,GAAAF,EACA,MACA,KAAAG,IAAAc,qBACAlB,GAAAC,EAAAh0F,KAAAwmE,GACAutB,GAAAC,EAAAzsE,MAAAi/C,GACAwtB,EAAAt0B,SAAAs0B,EAAAh0F,KAAA0/D,UAAAs0B,EAAAzsE,MAAAm4C,SACAs0B,EAAAM,SAAAN,EACA,MACA,KAAAG,IAAAe,gBACAjB,GAAA,EACAC,KACAl+H,EAAAg+H,EAAAhpH,SAAA,SAAA0hB,GACAqnG,GAAArnG,EAAA85E,GACAytB,EAAAA,GAAAvnG,EAAAgzE,SACAhzE,EAAAgzE,UACAw0B,EAAA51H,KAAAwO,MAAAonH,EAAAxnG,EAAA4nG,WAGAN,EAAAt0B,SAAAu0B,EACAD,EAAAM,QAAAJ,CACA,MACA,KAAAC,IAAAgB,iBACAlB,GAAA,EACAC,KACAl+H,EAAAg+H,EAAAt4G,WAAA,SAAAkvE,GACAmpC,GAAAnpC,EAAAhlF,MAAA4gG,GACAytB,EAAAA,GAAArpC,EAAAhlF,MAAA85F,SACA9U,EAAAhlF,MAAA85F,UACAw0B,EAAA51H,KAAAwO,MAAAonH,EAAAtpC,EAAAhlF,MAAA0uH,WAGAN,EAAAt0B,SAAAu0B,EACAD,EAAAM,QAAAJ,CACA,MACA,KAAAC,IAAAiB,eACApB,EAAAt0B,UAAA,EACAs0B,EAAAM,YAKA,QAAAe,IAAA79H,GACA,GAAA,GAAAA,EAAAuC,OAAA,CACA,GAAAu7H,GAAA99H,EAAA,GAAAutH,WACA9gH,EAAAqxH,EAAAhB,OACA,OAAA,KAAArwH,EAAAlK,OAAAkK,EACAA,EAAA,KAAAqxH,EAAArxH,EAAApM,GAGA,QAAA09H,IAAAvB,GACA,MAAAA,GAAApzH,OAAAuzH,GAAAU,YAAAb,EAAApzH,OAAAuzH,GAAAW,iBAGA,QAAAU,IAAAxB,GACA,GAAA,IAAAA,EAAAx8H,KAAAuC,QAAAw7H,GAAAvB,EAAAx8H,KAAA,GAAAutH,YACA,OAAAnkH,KAAAuzH,GAAAc,qBAAAj1F,KAAAg0F,EAAAx8H,KAAA,GAAAutH,WAAAx9D,OAAA3mD,KAAAuzH,GAAAsB,kBAAA9nG,SAAA,KAIA,QAAA+nG,IAAA1B,GACA,MAAA,KAAAA,EAAAx8H,KAAAuC,QACA,IAAAi6H,EAAAx8H,KAAAuC,SACAi6H,EAAAx8H,KAAA,GAAAutH,WAAAnkH,OAAAuzH,GAAAE,SACAL,EAAAx8H,KAAA,GAAAutH,WAAAnkH,OAAAuzH,GAAAe,iBACAlB,EAAAx8H,KAAA,GAAAutH,WAAAnkH,OAAAuzH,GAAAgB,kBAGA,QAAAQ,IAAA3B,GACA,MAAAA,GAAAt0B,SAGA,QAAAk2B,IAAAC,EAAArvB,GACAxuG,KAAA69H,WAAAA,EACA79H,KAAAwuG,QAAAA,EAudA,QAAAsvB,IAAAD,EAAArvB,GACAxuG,KAAA69H,WAAAA,EACA79H,KAAAwuG,QAAAA,EAsYA,QAAAxxE,IAAAnrB,EAAAm6D,EAAA+xD,EAAAC,GACA1C,GAAAzpH,EAAAmsH,EAGA,KAAA,GADApkH,GAAAtD,EAAA01D,EAAAlmE,MAAA,KACAmC,EAAA,EAAAqO,EAAAvU,OAAA,EAAAkG,IAAA,CACA2R,EAAAuhH,GAAA7kH,EAAAtQ,QAAAg4H,EACA,IAAAC,GAAA3C,GAAAzpH,EAAA+H,GAAAokH,EACAC,KACAA,KACApsH,EAAA+H,GAAAqkH,GAEApsH,EAAAosH,EAKA,MAHArkH,GAAAuhH,GAAA7kH,EAAAtQ,QAAAg4H,GACA1C,GAAAzpH,EAAA+H,GAAAokH,GACAnsH,EAAA+H,GAAAmkH,EACAA,EAMA,QAAAG,IAAApmH,GACA,MAAA,eAAAA,EAKA,QAAAqmH,IAAAvwH,GACA,MAAA2K,GAAA3K,EAAA6wF,SAAA7wF,EAAA6wF,UAAA2/B,GAAAhhI,KAAAwQ,GAsDA,QAAA+hG,MACA,GAAA0uB,GAAAr9B,KACAs9B,EAAAt9B,IAEAhhG,MAAAy1G,MAAA,UAAA,WAAA,SAAAjH,EAAA8B,GAkDA,QAAAiuB,GAAAnV,EAAAoV,GAEA,MAAA,OAAApV,GAAA,MAAAoV,EACApV,IAAAoV,GAGA,gBAAApV,KAKAA,EAAA+U,GAAA/U,GAEA,gBAAAA,OASAA,IAAAoV,GAAApV,IAAAA,GAAAoV,IAAAA,GAGA,QAAAC,GAAAz6B,EAAA0W,EAAAgkB,EAAAC,EAAAC,GACA,GACAC,GADAC,EAAAH,EAAAI,MAGA,IAAA,IAAAD,EAAA/8H,OAAA,CACA,GAAAi9H,GAAAT,CAEA,OADAO,GAAAA,EAAA,GACA96B,EAAA3E,OAAA,SAAA2E,GACA,GAAAi7B,GAAAH,EAAA96B,EAKA,OAJAu6B,GAAAU,EAAAD,KACAH,EAAAF,EAAA36B,EAAAnkG,EAAAA,GAAAo/H,IACAD,EAAAC,GAAAd,GAAAc,IAEAJ,GACAnkB,EAAAgkB,EAAAE,GAKA,IAAA,GAFAM,MACAC,KACAl3H,EAAA,EAAAo2F,EAAAygC,EAAA/8H,OAAAkG,EAAAo2F,EAAAp2F,IACAi3H,EAAAj3H,GAAAs2H,EACAY,EAAAl3H,GAAA,IAGA,OAAA+7F,GAAA3E,OAAA,SAAA2E,GAGA,IAAA,GAFA15C,IAAA,EAEAriD,EAAA,EAAAo2F,EAAAygC,EAAA/8H,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA,GAAAg3H,GAAAH,EAAA72H,GAAA+7F,IACA15C,IAAAA,GAAAi0E,EAAAU,EAAAC,EAAAj3H,QACAk3H,EAAAl3H,GAAAg3H,EACAC,EAAAj3H,GAAAg3H,GAAAd,GAAAc,IAQA,MAJA30E,KACAu0E,EAAAF,EAAA36B,EAAAnkG,EAAAA,EAAAs/H,IAGAN,GACAnkB,EAAAgkB,EAAAE,GAGA,QAAAQ,GAAAp7B,EAAA0W,EAAAgkB,EAAAC,GACA,GAAAlU,GAAAP,CACA,OAAAO,GAAAzmB,EAAA3E,OAAA,SAAA2E,GACA,MAAA26B,GAAA36B,IACA,SAAAp2F,EAAAqd,EAAA+4E,GACAkmB,EAAAt8G,EACA2K,EAAAmiG,IACAA,EAAA5lG,MAAA9U,KAAAuS,WAEAwsF,EAAAnxF,IACAo2F,EAAAq7B,aAAA,WACAtgC,EAAAmrB,IACAO,OAIAiU,GAGA,QAAAY,GAAAt7B,EAAA0W,EAAAgkB,EAAAC,GAgBA,QAAAY,GAAA3xH,GACA,GAAA4xH,IAAA,CAIA,OAHAxhI,GAAA4P,EAAA,SAAA/M,GACAk+F,EAAAl+F,KAAA2+H,GAAA,KAEAA,EApBA,GAAA/U,GAAAP,CACA,OAAAO,GAAAzmB,EAAA3E,OAAA,SAAA2E,GACA,MAAA26B,GAAA36B,IACA,SAAAp2F,EAAAqd,EAAA+4E,GACAkmB,EAAAt8G,EACA2K,EAAAmiG,IACAA,EAAAt9G,KAAA4C,KAAA4N,EAAAqd,EAAA+4E,GAEAu7B,EAAA3xH,IACAo2F,EAAAq7B,aAAA,WACAE,EAAArV,IAAAO,OAGAiU,GAWA,QAAAe,GAAAz7B,EAAA0W,EAAAgkB,EAAAC,GACA,GAAAlU,EACA,OAAAA,GAAAzmB,EAAA3E,OAAA,SAAA2E,GACA,MAAA26B,GAAA36B,IACA,SAAAp2F,EAAAqd,EAAA+4E,GACAzrF,EAAAmiG,IACAA,EAAA5lG,MAAA9U,KAAAuS,WAEAk4G,KACAiU,GAGA,QAAAgB,GAAAf,EAAAgB,GACA,IAAAA,EAAA,MAAAhB,EACA,IAAAiB,GAAAjB,EAAA9K,gBAEAgM,EACAD,IAAAN,GACAM,IAAAR,EAEArtH,EAAA8tH,EAAA,SAAA77B,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAnxH,GAAA+wH,EAAA36B,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAAY,GAAA/xH,EAAAo2F,EAAAsU,IACA,SAAAtU,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAnxH,GAAA+wH,EAAA36B,EAAAsU,EAAAjvB,EAAA01C,GACAp7G,EAAAg8G,EAAA/xH,EAAAo2F,EAAAsU,EAGA,OAAAvZ,GAAAnxF,GAAA+V,EAAA/V,EAcA,OAVA+wH,GAAA9K,iBACA8K,EAAA9K,kBAAA4K,EACA1sH,EAAA8hH,gBAAA8K,EAAA9K,gBACA8L,EAAAnV,YAGAz4G,EAAA8hH,gBAAA4K,EACA1sH,EAAAgtH,OAAAJ,EAAAI,OAAAJ,EAAAI,QAAAJ,IAGA5sH,EA3MA,GAAA+tH,IACAz3B,IAAAiI,EAAAjI,IACA03B,iBAAA,GAEAC,GACA33B,IAAAiI,EAAAjI,IACA03B,iBAAA,EAGA,OAAA,UAAA3M,EAAAuM,EAAAI,GACA,GAAApB,GAAAsB,EAAAC,CAEA,cAAA9M,IACA,IAAA,SACAA,EAAAA,EAAAr1G,OACAmiH,EAAA9M,CAEA,IAAAjhH,GAAA4tH,EAAAzB,EAAAD,CAGA,IAFAM,EAAAxsH,EAAA+tH,IAEAvB,EAAA,CACA,MAAAvL,EAAA3kH,OAAA,IAAA,MAAA2kH,EAAA3kH,OAAA,KACAwxH,GAAA,EACA7M,EAAAA,EAAAhmH,UAAA,GAEA,IAAA+yH,GAAAJ,EAAAC,EAAAF,EACAM,EAAA,GAAAC,IAAAF,GACAG,EAAA,GAAAC,IAAAH,EAAA5xB,EAAA2xB,EACAxB,GAAA2B,EAAA7vF,MAAA2iF,GACAuL,EAAAj3B,SACAi3B,EAAA9K,gBAAA4L,EACAQ,EACAtB,EAAA9K,gBAAA8K,EAAAt5D,QACAi6D,EAAAF,EACAT,EAAAI,SACAJ,EAAA9K,gBAAA4K,GAEAtsH,EAAA+tH,GAAAvB,EAEA,MAAAe,GAAAf,EAAAgB,EAEA,KAAA,WACA,MAAAD,GAAAtM,EAAAuM,EAEA,SACA,MAAAlvH,OAyXA,QAAAs/F,MAEA/vG,KAAAy1G,MAAA,aAAA,oBAAA,SAAA7F,EAAAtB,GACA,MAAAkyB,IAAA,SAAAl3G,GACAsmF,EAAAxQ,WAAA91E,IACAglF,KAIA,QAAA2B,MACAjwG,KAAAy1G,MAAA,WAAA,oBAAA,SAAA3H,EAAAQ,GACA,MAAAkyB,IAAA,SAAAl3G,GACAwkF,EAAA3wE,MAAA7T,IACAglF,KAYA,QAAAkyB,IAAAC,EAAAC,GAEA,QAAAC,GAAAloG,EAAAmoG,EAAAjQ,GAEA,QAAAtqF,GAAAt0B,GACA,MAAA,UAAAnE,GACAu7C,IACAA,GAAA,EACAp3C,EAAA3U,KAAAq7B,EAAA7qB,KALA,GAAAu7C,IAAA,CASA,QAAA9iB,EAAAu6F,GAAAv6F,EAAAsqF,IAiBA,QAAAkQ,KACA7gI,KAAA65H,SAAA/mF,OAAA,GA4BA,QAAAguF,GAAA3tH,EAAApB,GACA,MAAA,UAAAnE,GACAmE,EAAA3U,KAAA+V,EAAAvF,IAIA,QAAAmzH,GAAAvyH,GACA,GAAAuD,GAAA+R,EAAA25B,CAEAA,GAAAjvC,EAAAivC,QACAjvC,EAAAwyH,kBAAA,EACAxyH,EAAAivC,QAAA59C,CACA,KAAA,GAAAoI,GAAA,EAAAo2F,EAAA5gD,EAAA17C,OAAAkG,EAAAo2F,IAAAp2F,EAAA,CACA6b,EAAA25B,EAAAx1C,GAAA,GACA8J,EAAA0rC,EAAAx1C,GAAAuG,EAAAskC,OACA,KACAv6B,EAAAxG,GACA+R,EAAAqX,QAAAppB,EAAAvD,EAAAZ,QACA,IAAAY,EAAAskC,OACAhvB,EAAAqX,QAAA3sB,EAAAZ,OAEAkW,EAAAsX,OAAA5sB,EAAAZ,OAEA,MAAAvO,GACAykB,EAAAsX,OAAA/7B,GACAqhI,EAAArhI,KAKA,QAAA4hI,GAAAzyH,IACAA,EAAAwyH,kBAAAxyH,EAAAivC,UACAjvC,EAAAwyH,kBAAA,EACAP,EAAA,WAAAM,EAAAvyH,MAGA,QAAAuV,KACA/jB,KAAA0kB,QAAA,GAAAm8G,GAEA7gI,KAAAm7B,QAAA2lG,EAAA9gI,KAAAA,KAAAm7B,SACAn7B,KAAAo7B,OAAA0lG,EAAA9gI,KAAAA,KAAAo7B,QACAp7B,KAAAq7B,OAAAylG,EAAA9gI,KAAAA,KAAAq7B,QA4LA,QAAAvS,GAAAo4G,GACA,GAAAp9G,GAAA,GAAAC,GACAokF,EAAA,EACA79E,EAAAtP,GAAAkmH,QAkBA,OAhBAljI,GAAAkjI,EAAA,SAAAx8G,EAAA9K,GACAuuF,IACA3sE,EAAA9W,GAAAoW,KAAA,SAAAltB,GACA0c,EAAA/B,eAAA3O,KACA0Q,EAAA1Q,GAAAhM,IACAu6F,GAAArkF,EAAAqX,QAAA7Q,KACA,SAAAs7E,GACAt7E,EAAA/B,eAAA3O,IACAkK,EAAAsX,OAAAwqE,OAIA,IAAAuC,GACArkF,EAAAqX,QAAA7Q,GAGAxG,EAAAY,QAnTA,GAAAy8G,GAAApkC,EAAA,KAAAl9C,WAwBA1iB,EAAA,WACA,MAAA,IAAApZ,GAOA88G,GAAA//G,WACAga,KAAA,SAAAsmG,EAAAC,EAAAC,GACA,GAAA39G,GAAA,GAAAI,EAMA,OAJA/jB,MAAA65H,QAAAp8E,QAAAz9C,KAAA65H,QAAAp8E,YACAz9C,KAAA65H,QAAAp8E,QAAAn3C,MAAAqd,EAAAy9G,EAAAC,EAAAC,IACAthI,KAAA65H,QAAA/mF,OAAA,GAAAmuF,EAAAjhI,KAAA65H,SAEAl2G,EAAAe,SAGA68G,QAAA,SAAAj4G,GACA,MAAAtpB,MAAA86B,KAAA,KAAAxR,IAGAk4G,UAAA,SAAAl4G,EAAAg4G,GACA,MAAAthI,MAAA86B,KAAA,SAAAltB,GACA,MAAA6zH,GAAA7zH,GAAA,EAAA0b,IACA,SAAA9B,GACA,MAAAi6G,GAAAj6G,GAAA,EAAA8B,IACAg4G,KAiDAv9G,EAAAjD,WACAqa,QAAA,SAAAt6B,GACAb,KAAA0kB,QAAAm1G,QAAA/mF,SACAjyC,IAAAb,KAAA0kB,QACA1kB,KAAA0hI,SAAAP,EACA,SACA,qEACAtgI,IAEAb,KAAA2hI,UAAA9gI,KAKA8gI,UAAA,SAAA9gI,GACA,GAAAi6B,GAAAC,CAEAA,GAAA4lG,EAAA3gI,KAAAA,KAAA2hI,UAAA3hI,KAAA0hI,SACA,MACApjC,EAAAz9F,IAAA0X,EAAA1X,MAAAi6B,EAAAj6B,GAAAA,EAAAi6B,MACAviB,EAAAuiB,IACA96B,KAAA0kB,QAAAm1G,QAAA/mF,UACAhY,EAAA19B,KAAAyD,EAAAk6B,EAAA,GAAAA,EAAA,GAAA/6B,KAAAq7B,UAEAr7B,KAAA0kB,QAAAm1G,QAAAjsH,MAAA/M,EACAb,KAAA0kB,QAAAm1G,QAAA/mF,OAAA,EACAmuF,EAAAjhI,KAAA0kB,QAAAm1G,UAEA,MAAAx6H,GACA07B,EAAA,GAAA17B,GACAqhI,EAAArhI,KAIA+7B,OAAA,SAAAwqE,GACA5lG,KAAA0kB,QAAAm1G,QAAA/mF,QACA9yC,KAAA0hI,SAAA97B,IAGA87B,SAAA,SAAA97B,GACA5lG,KAAA0kB,QAAAm1G,QAAAjsH,MAAAg4F,EACA5lG,KAAA0kB,QAAAm1G,QAAA/mF,OAAA,EACAmuF,EAAAjhI,KAAA0kB,QAAAm1G,UAGAx+F,OAAA,SAAApW,GACA,GAAAijF,GAAAloG,KAAA0kB,QAAAm1G,QAAAp8E,OAEAz9C,MAAA0kB,QAAAm1G,QAAA/mF,QAAA,GAAAo1D,GAAAA,EAAAnmG,QACA0+H,EAAA,WAEA,IAAA,GADAn3G,GAAA3F,EACA1b,EAAA,EAAAo2F,EAAA6J,EAAAnmG,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA0b,EAAAukF,EAAAjgG,GAAA,GACAqhB,EAAA4+E,EAAAjgG,GAAA,EACA,KACA0b,EAAA0X,OAAA9iB,EAAA+Q,GAAAA,EAAArE,GAAAA,GACA,MAAA5lB,GACAqhI,EAAArhI,QA4CA,IAAA+7B,GAAA,SAAAwqE,GACA,GAAAjiF,GAAA,GAAAI,EAEA,OADAJ,GAAAyX,OAAAwqE,GACAjiF,EAAAe,SAGAk9G,EAAA,SAAAh0H,EAAAi0H,GACA,GAAAl+G,GAAA,GAAAI,EAMA,OALA89G,GACAl+G,EAAAwX,QAAAvtB,GAEA+V,EAAAyX,OAAAxtB,GAEA+V,EAAAe,SAGA+8G,EAAA,SAAA7zH,EAAAk0H,EAAAx4G,GACA,GAAAy4G,GAAA,IACA,KACAxpH,EAAA+Q,KAAAy4G,EAAAz4G,KACA,MAAAjqB,GACA,MAAAuiI,GAAAviI,GAAA,GAEA,MAAAqgG,GAAAqiC,GACAA,EAAAjnG,KAAA,WACA,MAAA8mG,GAAAh0H,EAAAk0H,IACA,SAAAt6G,GACA,MAAAo6G,GAAAp6G,GAAA,KAGAo6G,EAAAh0H,EAAAk0H,IAmBAtmG,EAAA,SAAA5tB,EAAA0b,EAAA04G,EAAAV,GACA,GAAA39G,GAAA,GAAAI,EAEA,OADAJ,GAAAwX,QAAAvtB,GACA+V,EAAAe,QAAAoW,KAAAxR,EAAA04G,EAAAV,IAcAnmG,EAAAK,EA0CAymG,EAAA,QAAA74C,GAAA84C,GAYA,QAAAtB,GAAAhzH,GACAkW,EAAAqX,QAAAvtB,GAGA,QAAA+iH,GAAA/qB,GACA9hF,EAAAsX,OAAAwqE,GAhBA,IAAArtF,EAAA2pH,GACA,KAAAf,GAAA,UAAA,iCAAAe,EAGA,MAAAliI,eAAAopF,IAEA,MAAA,IAAAA,GAAA84C,EAGA,IAAAp+G,GAAA,GAAAC,EAYA,OAFAm+G,GAAAtB,EAAAjQ,GAEA7sG,EAAAY,QASA,OANAu9G,GAAA9kG,MAAAA,EACA8kG,EAAA7mG,OAAAA,EACA6mG,EAAAzmG,KAAAA,EACAymG,EAAA9mG,QAAAA,EACA8mG,EAAAn5G,IAAAA,EAEAm5G,EAGA,QAAA9wB,MACAnxG,KAAAy1G,MAAA,UAAA,WAAA,SAAAzE,EAAAF,GA8BA,QAAAqxB,KACA,IAAA,GAAAl6H,GAAA,EAAAA,EAAAm6H,EAAArgI,OAAAkG,IAAA,CACA,GAAAo6H,GAAAD,EAAAn6H,EACAo6H,KACAD,EAAAn6H,GAAA,KACAo6H,KAGAC,EAAAF,EAAArgI,OAAA,EAGA,QAAAwgI,GAAAC,GACA,GAAAjiI,GAAA6hI,EAAArgI,MASA,OAPAugI,KACAF,EAAA97H,KAAAk8H,GAEA,IAAAjiI,IACAkiI,EAAAC,EAAAP,IAGA,WACA5hI,GAAA,IACA6hI,EAAA7hI,GAAA,KACAA,EAAA,KAEA,MAAA+hI,GAAAG,IACAA,IACAA,EAAA,KACAL,EAAArgI,OAAA,KA1DA,GAAAwE,GAAAyqG,EAAAzqG,uBACAyqG,EAAA91B,4BAEAG,EAAA21B,EAAA31B,sBACA21B,EAAA11B,4BACA01B,EAAA2xB,kCAEAC,IAAAr8H,EACAm8H,EAAAE,EACA,SAAA7wH,GACA,GAAA9M,GAAAsB,EAAAwL,EACA,OAAA,YACAspE,EAAAp2E,KAGA,SAAA8M,GACA,GAAAzK,GAAAwpG,EAAA/+F,EAAA,OAAA,EACA,OAAA,YACA++F,EAAA6K,OAAAr0G,IAIAi7H,GAAA1rH,UAAA+rH,CAEA,IAAAH,GACAH,EAAA,EACAF,IACA,OAAAG,KA0GA,QAAA1yB,MAaA,QAAAgzB,GAAAzhI,GACA,QAAA0hI,KACA9iI,KAAA+iI,WAAA/iI,KAAAgjI,cACAhjI,KAAAijI,YAAAjjI,KAAAkjI,YAAA,KACAljI,KAAAmjI,eACAnjI,KAAAojI,mBACApjI,KAAAqjI,gBAAA,EACArjI,KAAAsjI,IAAAxlC,IACA99F,KAAAujI,aAAA,KAGA,MADAT,GAAAhiH,UAAA1f,EACA0hI,EAvBA,GAAAU,GAAA,GACAC,EAAA1mC,EAAA,cACA2mC,EAAA,KACAC,EAAA,IAEA3jI,MAAA4jI,UAAA,SAAAh2H,GAIA,MAHA2E,WAAAxQ,SACAyhI,EAAA51H,GAEA41H,GAiBAxjI,KAAAy1G,MAAA,YAAA,oBAAA,SAAA,WACA,SAAA4B,EAAA/I,EAAAoB,EAAA5B,GAEA,QAAA+1B,GAAAC,GACAA,EAAAC,aAAA/b,aAAA,EA8CA,QAAAgc,KACAhkI,KAAAsjI,IAAAxlC,IACA99F,KAAAkxH,QAAAlxH,KAAA6pD,QAAA7pD,KAAA+iI,WACA/iI,KAAAgjI,cAAAhjI,KAAAikI,cACAjkI,KAAAijI,YAAAjjI,KAAAkjI,YAAA,KACAljI,KAAAkkI,MAAAlkI,KACAA,KAAAgoH,aAAA,EACAhoH,KAAAmjI,eACAnjI,KAAAojI;AACApjI,KAAAqjI,gBAAA,EACArjI,KAAAu+G,kBAAA,KAmnCA,QAAA4lB,GAAAC,GACA,GAAAx0B,EAAAshB,QACA,KAAAuS,GAAA,SAAA,0BAAA7zB,EAAAshB,QAGAthB,GAAAshB,QAAAkT,EAGA,QAAAC,KACAz0B,EAAAshB,QAAA,KAGA,QAAAoT,GAAAp9G,EAAAgW,GACA,EACAhW,GAAAm8G,iBAAAnmG,QACAhW,EAAAA,EAAA2iC,SAGA,QAAA06E,GAAAr9G,EAAAgW,EAAAplB,GACA,EACAoP,GAAAk8G,gBAAAtrH,IAAAolB,EAEA,IAAAhW,EAAAk8G,gBAAAtrH,UACAoP,GAAAk8G,gBAAAtrH,SAEAoP,EAAAA,EAAA2iC,SAOA,QAAA26E,MAEA,QAAAC,KACA,KAAAC,EAAA3iI,QACA,IACA2iI,EAAA1+H,UACA,MAAA3G,GACAivG,EAAAjvG,GAGAskI,EAAA,KAGA,QAAAgB,KACA,OAAAhB,IACAA,EAAA71B,EAAA3wE,MAAA,WACAyyE,EAAA3L,OAAAwgC,MAxoCAT,EAAAljH,WACAmI,YAAA+6G,EA8BAxjB,KAAA,SAAAokB,EAAAxjI,GACA,GAAAyjI,EA+BA,OA7BAzjI,GAAAA,GAAApB,KAEA4kI,GACAC,EAAA,GAAAb,GACAa,EAAAX,MAAAlkI,KAAAkkI,QAIAlkI,KAAAujI,eACAvjI,KAAAujI,aAAAV,EAAA7iI,OAEA6kI,EAAA,GAAA7kI,MAAAujI,cAEAsB,EAAAh7E,QAAAzoD,EACAyjI,EAAAZ,cAAA7iI,EAAA8hI,YACA9hI,EAAA6hI,aACA7hI,EAAA8hI,YAAAF,cAAA6B,EACAzjI,EAAA8hI,YAAA2B,GAEAzjI,EAAA6hI,YAAA7hI,EAAA8hI,YAAA2B,GAQAD,GAAAxjI,GAAApB,OAAA6kI,EAAAlkB,IAAA,WAAAkjB,GAEAgB,GAuHAxlC,OAAA,SAAAylC,EAAApqB,EAAAgkB,EAAAE,GACA,GAAA7/G,GAAA2wF,EAAAo1B,EAEA,IAAA/lH,EAAA80G,gBACA,MAAA90G,GAAA80G,gBAAA7zH,KAAA06G,EAAAgkB,EAAA3/G,EAAA+lH,EAEA,IAAA9gC,GAAAhkG,KACAkgG,EAAA8D,EAAA++B,WACAgC,GACAhzH,GAAA2oG,EACA/iG,KAAA6sH,EACAzlH,IAAAA,EACAq0G,IAAAwL,GAAAkG,EACAt7G,KAAAk1G,EAiBA,OAdAgF,GAAA,KAEAnrH,EAAAmiG,KACAqqB,EAAAhzH,GAAAtB,GAGAyvF,IACAA,EAAA8D,EAAA++B,eAIA7iC,EAAA16E,QAAAu/G,GACAT,EAAAtkI,KAAA,GAEA,WACAigG,EAAAC,EAAA6kC,IAAA,GACAT,EAAAtgC,MAEA0/B,EAAA,OA6BA5P,YAAA,SAAAkR,EAAAtqB,GAwCA,QAAAuqB,KACAC,GAAA,EAEAnpD,GACAA,GAAA,EACA2+B,EAAAyqB,EAAAA,EAAA1sG,IAEAiiF,EAAAyqB,EAAApR,EAAAt7F,GA9CA,GAAAs7F,GAAA,GAAAhqG,OAAAi7G,EAAAjjI,QACAojI,EAAA,GAAAp7G,OAAAi7G,EAAAjjI,QACAqjI,KACA3sG,EAAAz4B,KACAklI,GAAA,EACAnpD,GAAA,CAEA,KAAAipD,EAAAjjI,OAAA,CAEA,GAAAsjI,IAAA,CAIA,OAHA5sG,GAAA2mE,WAAA,WACAimC,GAAA3qB,EAAAyqB,EAAAA,EAAA1sG,KAEA,WACA4sG,GAAA,GAIA,MAAA,KAAAL,EAAAjjI,OAEA/B,KAAAq/F,OAAA2lC,EAAA,GAAA,SAAAp3H,EAAA27G,EAAAvlB,GACAmhC,EAAA,GAAAv3H,EACAmmH,EAAA,GAAAxK,EACA7O,EAAAyqB,EAAAv3H,IAAA27G,EAAA4b,EAAApR,EAAA/vB,MAIAhmG,EAAAgnI,EAAA,SAAAtwG,EAAAzsB,GACA,GAAAq9H,GAAA7sG,EAAA4mE,OAAA3qE,EAAA,SAAA9mB,EAAA27G,GACA4b,EAAAl9H,GAAA2F,EACAmmH,EAAA9rH,GAAAshH,EACA2b,IACAA,GAAA,EACAzsG,EAAA2mE,WAAA6lC,KAGAG,GAAA9+H,KAAAg/H,KAcA,WACA,KAAAF,EAAArjI,QACAqjI,EAAAp/H,aA6DA0kH,iBAAA,SAAA74G,EAAA6oG,GAoBA,QAAA6qB,GAAAC,GACApc,EAAAoc,CACA,IAAAC,GAAA7rH,EAAA8rH,EAAAC,EAAAC,CAGA,KAAA9mC,EAAAsqB,GAAA,CAEA,GAAA9qB,EAAA8qB,GAKA,GAAA9rB,EAAA8rB,GAAA,CACAG,IAAAsc,IAEAtc,EAAAsc,EACAC,EAAAvc,EAAAxnH,OAAA,EACAgkI,KAGAN,EAAArc,EAAArnH,OAEA+jI,IAAAL,IAEAM,IACAxc,EAAAxnH,OAAA+jI,EAAAL,EAGA,KAAA,GAAAx9H,GAAA,EAAAA,EAAAw9H,EAAAx9H,IACA29H,EAAArc,EAAAthH,GACA09H,EAAAvc,EAAAnhH,GAEAy9H,EAAAE,IAAAA,GAAAD,IAAAA,EACAD,GAAAE,IAAAD,IACAI,IACAxc,EAAAthH,GAAA09H,OAGA,CACApc,IAAAyc,IAEAzc,EAAAyc,KACAF,EAAA,EACAC,KAGAN,EAAA,CACA,KAAA7rH,IAAAwvG,GACAA,EAAA7gG,eAAA3O,KACA6rH,IACAE,EAAAvc,EAAAxvG,GACAgsH,EAAArc,EAAA3vG,GAEAA,IAAA2vG,IACAmc,EAAAE,IAAAA,GAAAD,IAAAA,EACAD,GAAAE,IAAAD,IACAI,IACAxc,EAAA3vG,GAAA+rH,KAGAG,IACAvc,EAAA3vG,GAAA+rH,EACAI,KAIA,IAAAD,EAAAL,EAAA,CAEAM,GACA,KAAAnsH,IAAA2vG,GACAH,EAAA7gG,eAAA3O,KACAksH,UACAvc,GAAA3vG,SAhEA2vG,KAAAH,IACAG,EAAAH,EACA2c,IAmEA,OAAAA,IAGA,QAAAE,KASA,GARAC,GACAA,GAAA,EACAxrB,EAAA0O,EAAAA,EAAA3wF,IAEAiiF,EAAA0O,EAAA+c,EAAA1tG,GAIA2tG,EACA,GAAA9nC,EAAA8qB,GAGA,GAAA9rB,EAAA8rB,GAAA,CACA+c,EAAA,GAAAp8G,OAAAq/F,EAAArnH,OACA,KAAA,GAAAkG,GAAA,EAAAA,EAAAmhH,EAAArnH,OAAAkG,IACAk+H,EAAAl+H,GAAAmhH,EAAAnhH,OAEA,CACAk+H,IACA,KAAA,GAAAvsH,KAAAwvG,GACA7gG,GAAAnrB,KAAAgsH,EAAAxvG,KACAusH,EAAAvsH,GAAAwvG,EAAAxvG,QAVAusH,GAAA/c,EA/GAmc,EAAA/a,WAAA,CAEA,IAEApB,GAGAG,EAEA4c,EAPA1tG,EAAAz4B,KASAomI,EAAA1rB,EAAA34G,OAAA,EACAgkI,EAAA,EACAM,EAAA32B,EAAA79F,EAAA0zH,GACAM,KACAG,KACAE,GAAA,EACAJ,EAAA,CA+GA,OAAA9lI,MAAAq/F,OAAAgnC,EAAAJ,IAsDA1L,QAAA,WACA,GAAA+L,GAAA14H,EAAA+J,EACA4uH,EACAxkI,EACAykI,EACAxtG,EAAA9R,EAEAu/G,EAAAC,EAHAC,EAAAnD,EACAplI,EAAA4B,KACA4mI,IAGAzC,GAAA,WAEAr2B,EAAA0N,mBAEAx7G,OAAA4vG,GAAA,OAAA+zB,IAGA71B,EAAA3wE,MAAAw+E,OAAAgoB,GACAc,KAGAf,EAAA,IAEA,GAAA,CAIA,IAHA8C,GAAA,EACAt/G,EAAA9oB,EAEAyoI,EAAA9kI,QAAA,CACA,IACA2kI,EAAAG,EAAA7gI,QACA0gI,EAAA1iC,MAAA8iC,MAAAJ,EAAA3Z,WAAA2Z,EAAApuB,QACA,MAAAj5G,GACAivG,EAAAjvG,GAEAqkI,EAAA,KAGAqD,EACA,EAAA,CACA,GAAAR,EAAAr/G,EAAA67G,WAGA,IADAhhI,EAAAwkI,EAAAxkI,OACAA,KACA,IAIA,GAHAukI,EAAAC,EAAAxkI,GAIA,IAAA6L,EAAA04H,EAAAvnH,IAAAmI,OAAAvP,EAAA2uH,EAAA3uH,QACA2uH,EAAA98G,GACAk3E,EAAA9yF,EAAA+J,GACA,gBAAA/J,IAAA,gBAAA+J,IACAwqC,MAAAv0C,IAAAu0C,MAAAxqC,KAcA,GAAA2uH,IAAA5C,EAAA,CAGA8C,GAAA,CACA,MAAAO,QAjBAP,IAAA,EACA9C,EAAA4C,EACAA,EAAA3uH,KAAA2uH,EAAA98G,GAAAE,EAAA9b,EAAA,MAAAA,EACA04H,EAAAv0H,GAAAnE,EAAA+J,IAAA6sH,EAAA52H,EAAA+J,EAAAuP,GACAy/G,EAAA,IACAF,EAAA,EAAAE,EACAC,EAAAH,KAAAG,EAAAH,OACAG,EAAAH,GAAAngI,MACAwjB,IAAAvR,EAAA+tH,EAAAlT,KAAA,QAAAkT,EAAAlT,IAAAt7G,MAAAwuH,EAAAlT,IAAA/qG,YAAAi+G,EAAAlT,IACAha,OAAAxrG,EACAyrG,OAAA1hG,KAUA,MAAAtY,GACAivG,EAAAjvG,GAQA,KAAA25B,EAAA9R,EAAAm8G,iBAAAn8G,EAAA+7G,aACA/7G,IAAA9oB,GAAA8oB,EAAA87G,eACA,KAAA97G,IAAA9oB,KAAA46B,EAAA9R,EAAA87G,gBACA97G,EAAAA,EAAA2iC,cAGA3iC,EAAA8R,EAIA,KAAAwtG,GAAAK,EAAA9kI,UAAA4kI,IAEA,KADAtC,KACAZ,EAAA,SACA,4FAEAD,EAAAoD,SAGAJ,GAAAK,EAAA9kI,OAIA,KAFAsiI,IAEA2C,EAAAjlI,QACA,IACAilI,EAAAhhI,UACA,MAAA3G,GACAivG,EAAAjvG,KAwCAomG,SAAA,WAEA,IAAAzlG,KAAAgoH,YAAA,CACA,GAAA5mH,GAAApB,KAAA6pD,OAEA7pD,MAAA+5H,WAAA,YACA/5H,KAAAgoH,aAAA,EAEAhoH,OAAA4vG,GAEA9B,EAAAyN,yBAGA+oB,EAAAtkI,MAAAA,KAAAqjI,gBACA,KAAA,GAAAnlG,KAAAl+B,MAAAojI,gBACAmB,EAAAvkI,KAAAA,KAAAojI,gBAAAllG,GAAAA,EAKA98B,IAAAA,EAAA6hI,aAAAjjI,OAAAoB,EAAA6hI,YAAAjjI,KAAAgjI,eACA5hI,GAAAA,EAAA8hI,aAAAljI,OAAAoB,EAAA8hI,YAAAljI,KAAAikI,eACAjkI,KAAAikI,gBAAAjkI,KAAAikI,cAAAjB,cAAAhjI,KAAAgjI,eACAhjI,KAAAgjI,gBAAAhjI,KAAAgjI,cAAAiB,cAAAjkI,KAAAikI,eAGAjkI,KAAAylG,SAAAzlG,KAAAu6H,QAAAv6H,KAAAikG,OAAAjkG,KAAAo/F,WAAAp/F,KAAAixH,YAAAxgH,EACAzQ,KAAA2gH,IAAA3gH,KAAAq/F,OAAAr/F,KAAA8zH,YAAA,WAAA,MAAArjH,IACAzQ,KAAAmjI,eAUAnjI,KAAA6pD,QAAA7pD,KAAAgjI,cAAAhjI,KAAAikI,cAAAjkI,KAAAijI,YACAjjI,KAAAkjI,YAAAljI,KAAAkkI,MAAAlkI,KAAA+iI,WAAA,OA+BA+D,MAAA,SAAApyG,EAAA4jF,GACA,MAAA5I,GAAAh7E,GAAA10B,KAAAs4G,IAiCAlZ,WAAA,SAAA1qE,EAAA4jF,GAGA1I,EAAAshB,SAAA2V,EAAA9kI,QACA+rG,EAAA3wE,MAAA,WACA0pG,EAAA9kI,QACA6tG,EAAA2qB,YAKAsM,EAAAvgI,MAAA09F,MAAAhkG,KAAA+sH,WAAAr4F,EAAA4jF,OAAAA,KAGA+mB,aAAA,SAAAttH,GACAi1H,EAAA1gI,KAAAyL,IAgDAkyF,OAAA,SAAAvvE,GACA,IAEA,MADAyvG,GAAA,UACAnkI,KAAA8mI,MAAApyG,GACA,MAAAr1B,GACAivG,EAAAjvG,GACA,QACAglI,GACA,KACAz0B,EAAA2qB,UACA,MAAAl7H,GAEA,KADAivG,GAAAjvG,GACAA,KAsBA4xH,YAAA,SAAAv8F,GAKA,QAAAuyG,KACAjjC,EAAA8iC,MAAApyG,GALA,GAAAsvE,GAAAhkG,IACA00B,IAAAgwG,EAAAp+H,KAAA2gI,GACAtC,KAkCAhkB,IAAA,SAAA7oG,EAAA4iG,GACA,GAAAwsB,GAAAlnI,KAAAmjI,YAAArrH,EACAovH,KACAlnI,KAAAmjI,YAAArrH,GAAAovH,MAEAA,EAAA5gI,KAAAo0G,EAEA,IAAAxzF,GAAAlnB,IACA,GACAknB,GAAAk8G,gBAAAtrH,KACAoP,EAAAk8G,gBAAAtrH,GAAA,GAEAoP,EAAAk8G,gBAAAtrH,WACAoP,EAAAA,EAAA2iC,QAEA,IAAApxB,GAAAz4B,IACA,OAAA,YACA,GAAAmnI,GAAAD,EAAAnnI,QAAA26G,EACAysB,UACAD,EAAAC,GAAA,KACA5C,EAAA9rG,EAAA,EAAA3gB,MA4BAsvH,MAAA,SAAAtvH,EAAAxF,GACA,GACA40H,GAaAj/H,EAAAlG,EAdAW,KAEAshG,EAAAhkG,KACAghC,GAAA,EACAvnB,GACA3B,KAAAA,EACAuvH,YAAArjC,EACAhjE,gBAAA,WAAAA,GAAA,GACAT,eAAA,WACA9mB,EAAAspB,kBAAA,GAEAA,kBAAA,GAEAukG,EAAArsH,GAAAxB,GAAAlH,UAAA,EAGA,GAAA,CAGA,IAFA20H,EAAAljC,EAAAm/B,YAAArrH,IAAApV,EACA+W,EAAAsqH,aAAA//B,EACA/7F,EAAA,EAAAlG,EAAAmlI,EAAAnlI,OAAAkG,EAAAlG,EAAAkG,IAGA,GAAAi/H,EAAAj/H,GAMA,IAEAi/H,EAAAj/H,GAAA6M,MAAA,KAAAwyH,GACA,MAAAjoI,GACAivG,EAAAjvG,OATA6nI,GAAApiI,OAAAmD,EAAA,GACAA,IACAlG,GAWA,IAAAi/B,EAEA,MADAvnB,GAAAsqH,aAAA,KACAtqH,CAGAuqF,GAAAA,EAAAn6C,cACAm6C,EAIA,OAFAvqF,GAAAsqH,aAAA,KAEAtqH,GAyBAsgH,WAAA,SAAAjiH,EAAAxF,GACA,GAAAlU,GAAA4B,KACAknB,EAAA9oB,EACA46B,EAAA56B,EACAqb,GACA3B,KAAAA,EACAuvH,YAAAjpI,EACAmiC,eAAA,WACA9mB,EAAAspB,kBAAA,GAEAA,kBAAA,EAGA,KAAA3kC,EAAAglI,gBAAAtrH,GAAA,MAAA2B,EAMA,KAJA,GACAoyG,GAAA5jH,EAAAlG,EADAulI,EAAArsH,GAAAxB,GAAAlH,UAAA,GAIA2U,EAAA8R,GAAA,CAGA,IAFAvf,EAAAsqH,aAAA78G,EACA2kG,EAAA3kG,EAAAi8G,YAAArrH,OACA7P,EAAA,EAAAlG,EAAA8pH,EAAA9pH,OAAAkG,EAAAlG,EAAAkG,IAEA,GAAA4jH,EAAA5jH,GAOA,IACA4jH,EAAA5jH,GAAA6M,MAAA,KAAAwyH,GACA,MAAAjoI,GACAivG,EAAAjvG,OATAwsH,GAAA/mH,OAAAmD,EAAA,GACAA,IACAlG,GAeA,MAAAi3B,EAAA9R,EAAAk8G,gBAAAtrH,IAAAoP,EAAA+7G,aACA/7G,IAAA9oB,GAAA8oB,EAAA87G,eACA,KAAA97G,IAAA9oB,KAAA46B,EAAA9R,EAAA87G,gBACA97G,EAAAA,EAAA2iC,QAMA,MADApwC,GAAAsqH,aAAA,KACAtqH,GAIA,IAAAm2F,GAAA,GAAAo0B,GAGA6C,EAAAj3B,EAAA23B,gBACAP,EAAAp3B,EAAA43B,qBACA9C,EAAA90B,EAAA63B,oBAEA,OAAA73B,KA8DA,QAAAnH,MACA,GAAA+V,GAAA,oCACAE,EAAA,4CAkBA1+G,MAAAw+G,2BAAA,SAAAC,GACA,MAAA1f,GAAA0f,IACAD,EAAAC,EACAz+G,MAEAw+G,GAoBAx+G,KAAA0+G,4BAAA,SAAAD,GACA,MAAA1f,GAAA0f,IACAC,EAAAD,EACAz+G,MAEA0+G,GAGA1+G,KAAAy1G,KAAA,WACA,MAAA,UAAAiyB,EAAAC,GACA,GACAC,GADAthF,EAAAqhF,EAAAjpB,EAAAF,CAGA,OADAopB,GAAArV,GAAAmV,GAAA/yH,KACA,KAAAizH,GAAAA,EAAA9gI,MAAAw/C,GAGAohF,EAFA,UAAAE,IAgCA,QAAAC,IAAAr6G,GACA,GAAA,SAAAA,EACA,MAAAA,EACA,IAAAgwE,EAAAhwE,GAAA,CAKA,GAAAA,EAAAztB,QAAA,UACA,KAAA+nI,IAAA,SACA,uDAAAt6G,EAKA,OAHAA,GAAAu6G,GAAAv6G,GACAvqB,QAAA,SAAA,MACAA,QAAA,MAAA,cACA,GAAAkE,QAAA,IAAAqmB,EAAA,KACA,GAAA0xE,EAAA1xE,GAIA,MAAA,IAAArmB,QAAA,IAAAqmB,EAAA/lB,OAAA,IAEA,MAAAqgI,IAAA,WACA,kEAKA,QAAAE,IAAA75G,GACA,GAAA85G,KAMA,OALAlpC,GAAA5wE,IACAnwB,EAAAmwB,EAAA,SAAAX,GACAy6G,EAAA3hI,KAAAuhI,GAAAr6G,MAGAy6G,EAuEA,QAAA53B,MACArwG,KAAAkoI,aAAAA,EAGA,IAAAC,IAAA,QACAC,IAwBApoI,MAAAmoI,qBAAA,SAAAv6H,GAIA,MAHA2E,WAAAxQ,SACAomI,EAAAH,GAAAp6H,IAEAu6H,GA8BAnoI,KAAAooI,qBAAA,SAAAx6H,GAIA,MAHA2E,WAAAxQ,SACAqmI,EAAAJ,GAAAp6H,IAEAw6H,GAGApoI,KAAAy1G,MAAA,YAAA,SAAA4B,GAWA,QAAAgxB,GAAA76G,EAAAmpG,GACA,MAAA,SAAAnpG,EACAikG,GAAAkF,KAGAnpG,EAAArgB,KAAAwpH,EAAAhiH,MAIA,QAAA2zH,GAAAviI,GACA,GACAkC,GAAAixB,EADAy9F,EAAApE,GAAAxsH,EAAAsiB,YACAkgH,GAAA,CAEA,KAAAtgI,EAAA,EAAAixB,EAAAivG,EAAApmI,OAAAkG,EAAAixB,EAAAjxB,IACA,GAAAogI,EAAAF,EAAAlgI,GAAA0uH,GAAA,CACA4R,GAAA,CACA,OAGA,GAAAA,EAEA,IAAAtgI,EAAA,EAAAixB,EAAAkvG,EAAArmI,OAAAkG,EAAAixB,EAAAjxB,IACA,GAAAogI,EAAAD,EAAAngI,GAAA0uH,GAAA,CACA4R,GAAA,CACA,OAIA,MAAAA,GAGA,QAAAC,GAAAC,GACA,GAAAC,GAAA,SAAAC,GACA3oI,KAAA4oI,qBAAA,WACA,MAAAD,IAYA,OATAF,KACAC,EAAA5nH,UAAA,GAAA2nH,IAEAC,EAAA5nH,UAAA29E,QAAA,WACA,MAAAz+F,MAAA4oI,wBAEAF,EAAA5nH,UAAAuH,SAAA,WACA,MAAAroB,MAAA4oI,uBAAAvgH,YAEAqgH,EA6BA,QAAAG,GAAAjgI,EAAA+/H,GACA,GAAA5+E,GAAA++E,EAAAvgH,eAAA3f,GAAAkgI,EAAAlgI,GAAA,IACA,KAAAmhD,EACA,KAAA+9E,IAAA,WACA,0EACAl/H,EAAA+/H,EAEA,IAAA,OAAAA,GAAAA,IAAA9oI,GAAA,KAAA8oI,EACA,MAAAA,EAIA,IAAA,gBAAAA,GACA,KAAAb,IAAA,QACA,sFACAl/H,EAEA,OAAA,IAAAmhD,GAAA4+E,GAqBA,QAAAlqC,GAAAsqC,GACA,MAAAA,aAAAC,GACAD,EAAAH,uBAEAG,EAmBA,QAAAnV,GAAAhrH,EAAAmgI,GACA,GAAA,OAAAA,GAAAA,IAAAlpI,GAAA,KAAAkpI,EACA,MAAAA,EAEA,IAAA9/G,GAAA6/G,EAAAvgH,eAAA3f,GAAAkgI,EAAAlgI,GAAA,IACA,IAAAqgB,GAAA8/G,YAAA9/G,GACA,MAAA8/G,GAAAH,sBAKA,IAAAhgI,IAAAs/H,GAAAlf,aAAA,CACA,GAAAsf,EAAAS,GACA,MAAAA,EAEA,MAAAjB,IAAA,WACA,kFACAiB,EAAA1gH,YAEA,GAAAzf,IAAAs/H,GAAAnf,KACA,MAAAkgB,GAAAF,EAEA,MAAAjB,IAAA,SAAA,wDAvKA,GAAAmB,GAAA,SAAAjqI,GACA,KAAA8oI,IAAA,SAAA,wDAGAzwB,GAAA9gF,IAAA,eACA0yG,EAAA5xB,EAAAt4F,IAAA,aAqDA,IAAAiqH,GAAAR,IACAM,IA+GA,OA7GAA,GAAAZ,GAAAnf,MAAAyf,EAAAQ,GACAF,EAAAZ,GAAAgB,KAAAV,EAAAQ,GACAF,EAAAZ,GAAAiB,KAAAX,EAAAQ,GACAF,EAAAZ,GAAAkB,IAAAZ,EAAAQ,GACAF,EAAAZ,GAAAlf,cAAAwf,EAAAM,EAAAZ,GAAAiB,OAyGAN,QAAAA,EACAjV,WAAAA,EACAn1B,QAAAA,KA8RA,QAAA0R,MACA,GAAAp5E,IAAA,CAaA/2B,MAAA+2B,QAAA,SAAAnpB,GAIA,MAHA2E,WAAAxQ,SACAg1B,IAAAnpB,GAEAmpB,GAkDA/2B,KAAAy1G,MAAA,SAAA,eAAA,SACA/F,EAAAU,GAGA,GAAAr5E,GAAA8rF,GAAA,EACA,KAAAilB,IAAA,WACA,qPAKA,IAAAuB,GAAA5oC,EAAAynC,GAaAmB,GAAAC,UAAA,WACA,MAAAvyG,IAEAsyG,EAAAR,QAAAz4B,EAAAy4B,QACAQ,EAAAzV,WAAAxjB,EAAAwjB,WACAyV,EAAA5qC,QAAA2R,EAAA3R,QAEA1nE,IACAsyG,EAAAR,QAAAQ,EAAAzV,WAAA,SAAAhrH,EAAAgF,GAAA,MAAAA,IACAy7H,EAAA5qC,QAAAE,GAsBA0qC,EAAAE,QAAA,SAAA3gI,EAAA8rB,GACA,GAAA5d,GAAA44F,EAAAh7E,EACA,OAAA5d,GAAAuuD,SAAAvuD,EAAA4wF,SACA5wF,EAEA44F,EAAAh7E,EAAA,SAAA9mB,GACA,MAAAy7H,GAAAzV,WAAAhrH,EAAAgF,KAwPA,IAAA6iC,GAAA44F,EAAAE,QACA3V,EAAAyV,EAAAzV,WACAiV,EAAAQ,EAAAR,OAeA,OAbA7qI,GAAAkqI,GAAA,SAAAsB,EAAA1xH,GACA,GAAA2xH,GAAAzpC,GAAAloF,EACAuxH,GAAAvuH,GAAA,YAAA2uH,IAAA,SAAA/0G,GACA,MAAA+b,GAAA+4F,EAAA90G,IAEA20G,EAAAvuH,GAAA,eAAA2uH,IAAA,SAAA77H,GACA,MAAAgmH,GAAA4V,EAAA57H,IAEAy7H,EAAAvuH,GAAA,YAAA2uH,IAAA,SAAA77H,GACA,MAAAi7H,GAAAW,EAAA57H,MAIAy7H,IAkBA,QAAA94B,MACAvwG,KAAAy1G,MAAA,UAAA,YAAA,SAAAzE,EAAA5C,GACA,GAKAs7B,GAKA5iI,EAVA6iI,KACAC,EACA9mF,GAAA,gBAAA31C,KAAA6yF,IAAAgR,EAAApqG,eAAAC,iBAAA,IACAgjI,EAAA,SAAAtkI,MAAAyrG,EAAApqG,eAAAC,WACA9K,EAAAqyG,EAAA,OAEA07B,EAAA,4BACAC,EAAAhuI,EAAAyD,MAAAzD,EAAAyD,KAAApD,MACA4tI,GAAA,EACAC,GAAA,CAGA,IAAAF,EAAA,CACA,IAAA,GAAAppH,KAAAopH,GACA,GAAAjjI,EAAAgjI,EAAA38H,KAAAwT,GAAA,CACA+oH,EAAA5iI,EAAA,GACA4iI,EAAAA,EAAAz1H,OAAA,EAAA,GAAArM,cAAA8hI,EAAAz1H,OAAA,EACA,OAIAy1H,IACAA,EAAA,iBAAAK,IAAA,UAGAC,KAAA,cAAAD,IAAAL,EAAA,cAAAK,IACAE,KAAA,aAAAF,IAAAL,EAAA,aAAAK,KAEAH,GAAAI,GAAAC,IACAD,EAAAxsC,EAAAusC,EAAAG,kBACAD,EAAAzsC,EAAAusC,EAAAI,kBAKA,OAUA5hD,WAAAyoB,EAAAzoB,UAAAyoB,EAAAzoB,QAAA6hD,WAAAR,EAAA,GAAAC,GAEAQ,SAAA,SAAA5wH,GAMA,GAAA,UAAAA,GAAAopG,IAAA,GAAA,OAAA,CAEA,IAAA/jB,EAAA6qC,EAAAlwH,IAAA,CACA,GAAA6wH,GAAAvuI,EAAAG,cAAA,MACAytI,GAAAlwH,GAAA,KAAAA,IAAA6wH,GAGA,MAAAX,GAAAlwH,IAEA4uF,IAAAA,KACAqhC,aAAAA,EACAM,YAAAA,EACAC,WAAAA,EACAL,QAAAA,KA0BA,QAAAj5B,MACA3wG,KAAAy1G,MAAA,iBAAA,QAAA,KAAA,OAAA,SAAAjF,EAAA1B,EAAAgB,EAAAI,GACA,QAAAq6B,GAAAhzD,EAAAizD,GAoCA,QAAAC,GAAApb,GACA,IAAAmb,EACA,KAAArtB,IAAA,SAAA,sDACA5lC,EAAA83C,EAAAv8E,OAAAu8E,EAAAl8E,WAEA,OAAA28D,GAAA10E,OAAAi0F,GAxCAkb,EAAAG,uBAOAltC,EAAAjmB,IAAAi5B,EAAAzxF,IAAAw4D,KACAA,EAAA24B,EAAAy6B,sBAAApzD,GAGA,IAAAi3C,GAAA1f,EAAAj0D,UAAAi0D,EAAAj0D,SAAA2zE,iBAEAxzG,IAAAwzG,GACAA,EAAAA,EAAA71G,OAAA,SAAAiyH,GACA,MAAAA,KAAApd,KAEAgB,IAAAhB,KACAgB,EAAA,KAGA,IAAAqc,IACA14H,MAAAq+F,EACAge,kBAAAA,EAGA,OAAA1f,GAAA/vF,IAAAw4D,EAAAszD,GACA,WAAA,WACAN,EAAAG,yBAEA5vG,KAAA,SAAA/T,GAEA,MADAypF,GAAAuF,IAAAx+B,EAAAxwD,EAAA9mB,MACA8mB,EAAA9mB,MACAwqI,GAaA,MAFAF,GAAAG,qBAAA,EAEAH,IAIA,QAAA15B,MACA7wG,KAAAy1G,MAAA,aAAA,WAAA,YACA,SAAA7F,EAAA9B,EAAAwB,GASA,GAAAw7B,KAoGA,OAtFAA,GAAAC,aAAA,SAAAz0H,EAAAy2G,EAAAie,GACA,GAAAhuB,GAAA1mG,EAAAoV,uBAAA,cACA9W,IAkBA,OAjBA5W,GAAAg/G,EAAA,SAAAgP,GACA,GAAAif,GAAA7mC,GAAA9tF,QAAA01G,GAAA/rH,KAAA,WACAgrI,IACAjtI,EAAAitI,EAAA,SAAAC,GACA,GAAAF,EAAA,CACA,GAAAx9G,GAAA,GAAArmB,QAAA,UAAA4gI,GAAAhb,GAAA,cACAv/F,GAAAjoB,KAAA2lI,IACAt2H,EAAAtO,KAAA0lH,OAGAkf,GAAAnrI,QAAAgtH,QACAn4G,EAAAtO,KAAA0lH,OAMAp3G,GAeAk2H,EAAAK,WAAA,SAAA70H,EAAAy2G,EAAAie,GAEA,IAAA,GADAI,IAAA,MAAA,WAAA,SACAngG,EAAA,EAAAA,EAAAmgG,EAAArpI,SAAAkpC,EAAA,CACA,GAAAogG,GAAAL,EAAA,IAAA,KACAviH,EAAA,IAAA2iH,EAAAngG,GAAA,QAAAogG,EAAA,IAAAte,EAAA,KACA/5G,EAAAsD,EAAAjZ,iBAAAorB,EACA,IAAAzV,EAAAjR,OACA,MAAAiR,KAYA83H,EAAAQ,YAAA,WACA,MAAAh8B,GAAAvpG,OAYA+kI,EAAAS,YAAA,SAAAxlI,GACAA,IAAAupG,EAAAvpG,QACAupG,EAAAvpG,IAAAA,GACA6pG,EAAA2qB,YAYAuQ,EAAAU,WAAA,SAAAliH,GACAwkF,EAAAiN,gCAAAzxF,IAGAwhH,IAIA,QAAA/5B,MACA/wG,KAAAy1G,MAAA,aAAA,WAAA,KAAA,MAAA,oBACA,SAAA7F,EAAA9B,EAAAgC,EAAAE,EAAA1B,GAkCA,QAAA92F,GAAAzF,EAAAm7B,EAAA+mF,GACA17G,EAAAxG,KACAkiH,EAAA/mF,EACAA,EAAAn7B,EACAA,EAAAtB,EAGA,IAIAirG,GAJAppG,EAAA6uF,EAAA5uF,UAAA,GACA6hH,EAAAr1B,EAAAk1B,KAAAA,EACAnwG,GAAAswG,EAAApkB,EAAAF,GAAA3yE,QACAzY,EAAAZ,EAAAY,OAoBA,OAjBAg3F,GAAA5N,EAAA3wE,MAAA,WACA,IACArZ,EAAAqX,QAAAppB,EAAA+C,MAAA,KAAAxC,IACA,MAAAjT,GACAykB,EAAAsX,OAAA/7B,GACAivG,EAAAjvG,GAEA,cACAosI,GAAA/mH,EAAAgnH,aAGAtX,GAAAxkB,EAAA3L,UACA/2D,GAEAxoB,EAAAgnH,YAAAhwB,EACA+vB,EAAA/vB,GAAA53F,EAEAY,EA9DA,GAAA+mH,KAuFA,OATAj0H,GAAAmkG,OAAA,SAAAj3F,GACA,SAAAA,GAAAA,EAAAgnH,cAAAD,MACAA,EAAA/mH,EAAAgnH,aAAAtwG,OAAA,kBACAqwG,GAAA/mH,EAAAgnH,aACA59B,EAAA3wE,MAAAw+E,OAAAj3F,EAAAgnH,eAKAl0H,IAmEA,QAAA+6G,IAAAxsH,GACA,GAAA4O,GAAA5O,CAYA,OAVA88G,MAGA8oB,GAAA5nI,aAAA,OAAA4Q,GACAA,EAAAg3H,GAAAh3H,MAGAg3H,GAAA5nI,aAAA,OAAA4Q,IAIAA,KAAAg3H,GAAAh3H,KACA69G,SAAAmZ,GAAAnZ,SAAAmZ,GAAAnZ,SAAAvvH,QAAA,KAAA,IAAA,GACAwxG,KAAAk3B,GAAAl3B,KACA/gC,OAAAi4D,GAAAj4D,OAAAi4D,GAAAj4D,OAAAzwE,QAAA,MAAA,IAAA,GACA0zB,KAAAg1G,GAAAh1G,KAAAg1G,GAAAh1G,KAAA1zB,QAAA,KAAA,IAAA,GACAD,SAAA2oI,GAAA3oI,SACAmgD,KAAAwoF,GAAAxoF,KACAqlC,SAAA,MAAAmjD,GAAAnjD,SAAA/5E,OAAA,GACAk9H,GAAAnjD,SACA,IAAAmjD,GAAAnjD,UAWA,QAAAipC,IAAAma,GACA,GAAA90H,GAAA0mF,EAAAouC,GAAArZ,GAAAqZ,GAAAA,CACA,OAAA90H,GAAA07G,WAAAqZ,GAAArZ,UACA17G,EAAA29F,OAAAo3B,GAAAp3B,KA4CA,QAAAxD,MACAjxG,KAAAy1G,KAAA7W,EAAAnhG,GAYA,QAAAquI,IAAA19B,GAKA,QAAA29B,GAAA98H,GACA,IACA,MAAAo8D,oBAAAp8D,GACA,MAAA5P,GACA,MAAA4P,IARA,GAAA+iH,GAAA5jB,EAAA,OACA49B,KACAC,EAAA,EAUA,OAAA,YACA,GAAAC,GAAApsI,EAAAmI,EAAA1H,EAAAuX,EACAq0H,EAAAna,EAAAlyH,QAAA,EAEA,IAAAqsI,IAAAF,EAKA,IAJAA,EAAAE,EACAD,EAAAD,EAAAnmI,MAAA,MACAkmI,KAEA/jI,EAAA,EAAAA,EAAAikI,EAAAnqI,OAAAkG,IACAnI,EAAAosI,EAAAjkI,GACA1H,EAAAT,EAAAC,QAAA,KACAQ,EAAA,IACAuX,EAAAi0H,EAAAjsI,EAAAsN,UAAA,EAAA7M,IAIAyrI,EAAAl0H,KAAAjY,IACAmsI,EAAAl0H,GAAAi0H,EAAAjsI,EAAAsN,UAAA7M,EAAA,KAKA,OAAAyrI,IAMA,QAAAr6B,MACA3xG,KAAAy1G,KAAAq2B,GAuGA,QAAAr9B,IAAA9K,GAkBA,QAAAipB,GAAA90G,EAAA3U,GACA,GAAAm7F,EAAAxmF,GAAA,CACA,GAAAggB,KAIA,OAHA95B,GAAA8Z,EAAA,SAAAa,EAAAiB,GACAke,EAAAle,GAAAgzG,EAAAhzG,EAAAjB,KAEAmf,EAEA,MAAA6rE,GAAAxgG,QAAA2U,EAAA2yB,EAAAtnC,GAzBA,GAAAsnC,GAAA,QA4BAzqC,MAAA4sH,SAAAA,EAEA5sH,KAAAy1G,MAAA,YAAA,SAAA4B,GACA,MAAA,UAAAv/F,GACA,MAAAu/F,GAAAt4F,IAAAjH,EAAA2yB,MAkBAmiF,EAAA,WAAAwf,IACAxf,EAAA,OAAAyf,IACAzf,EAAA,SAAA0f,IACA1f,EAAA,OAAA2f,IACA3f,EAAA,UAAA4f,IACA5f,EAAA,YAAA6f,IACA7f,EAAA,SAAA8f,IACA9f,EAAA,UAAA+f,IACA/f,EAAA,YAAAggB,IAkIA,QAAAN,MACA,MAAA,UAAApsC,EAAA6sB,EAAA8f,GACA,IAAAvvC,EAAA4C,GAAA,CACA,GAAA,MAAAA,EACA,MAAAA,EAEA,MAAAnD,GAAA,UAAA,WAAA,mCAAAmD,GAIA,GACA4sC,GACAC,EAFAC,EAAAC,GAAAlgB,EAIA,QAAAigB,GACA,IAAA,WACAF,EAAA/f,CACA,MACA,KAAA,UACA,IAAA,OACA,IAAA,SACA,IAAA,SACAggB,GAAA,CAEA,KAAA,SAEAD,EAAAI,GAAAngB,EAAA8f,EAAAE,EACA,MACA,SACA,MAAA7sC,GAGA,MAAAn2E,OAAAjJ,UAAAnI,OAAAvb,KAAA8iG,EAAA4sC,IAKA,QAAAI,IAAAngB,EAAA8f,EAAAE,GACA,GACAD,GADAK,EAAA7uC,EAAAyuB,IAAA,KAAAA,EAiCA,OA9BA8f,MAAA,EACAA,EAAAnsC,EACAnoF,EAAAs0H,KACAA,EAAA,SAAAO,EAAAtmF,GACA,OAAAg4C,EAAAsuC,KAIA,OAAAA,GAAA,OAAAtmF,EAEAsmF,IAAAtmF,IAEAw3C,EAAAx3C,IAAAw3C,EAAA8uC,KAAAvuC,EAAAuuC,MAKAA,EAAAptC,GAAA,GAAAotC,GACAtmF,EAAAk5C,GAAA,GAAAl5C,GACAsmF,EAAArtI,QAAA+mD,YAIAgmF,EAAA,SAAA9nI,GACA,MAAAmoI,KAAA7uC,EAAAt5F,GACAqoI,GAAAroI,EAAA+nH,EAAApwH,EAAAkwI,GAAA,GAEAQ,GAAAroI,EAAA+nH,EAAA8f,EAAAE,IAMA,QAAAM,IAAAD,EAAAtmF,EAAA+lF,EAAAE,EAAAO,GACA,GAAAC,GAAAN,GAAAG,GACAI,EAAAP,GAAAnmF,EAEA,IAAA,WAAA0mF,GAAA,MAAA1mF,EAAAr4C,OAAA,GACA,OAAA4+H,GAAAD,EAAAtmF,EAAA15C,UAAA,GAAAy/H,EAAAE,EACA,IAAA/xH,GAAAoyH,GAGA,MAAAA,GAAAv0B,KAAA,SAAA7zG,GACA,MAAAqoI,IAAAroI,EAAA8hD,EAAA+lF,EAAAE,IAIA,QAAAQ,GACA,IAAA,SACA,GAAA3zH,EACA,IAAAmzH,EAAA,CACA,IAAAnzH,IAAAwzH,GACA,GAAA,MAAAxzH,EAAAnL,OAAA,IAAA4+H,GAAAD,EAAAxzH,GAAAktC,EAAA+lF,GAAA,GACA,OAAA,CAGA,QAAAS,GAAAD,GAAAD,EAAAtmF,EAAA+lF,GAAA,GACA,GAAA,WAAAW,EAAA,CACA,IAAA5zH,IAAAktC,GAAA,CACA,GAAA2mF,GAAA3mF,EAAAltC,EACA,KAAArB,EAAAk1H,KAAA3uC,EAAA2uC,GAAA,CAIA,GAAAC,GAAA,MAAA9zH,EACA+zH,EAAAD,EAAAN,EAAAA,EAAAxzH,EACA,KAAAyzH,GAAAM,EAAAF,EAAAZ,EAAAa,EAAAA,GACA,OAAA,GAGA,OAAA,EAEA,MAAAb,GAAAO,EAAAtmF,EAGA,KAAA,WACA,OAAA,CACA,SACA,MAAA+lF,GAAAO,EAAAtmF,IAKA,QAAAmmF,IAAApsI,GACA,MAAA,QAAAA,EAAA,aAAAA,GAwDA,QAAAurI,IAAAwB,GACA,GAAAC,GAAAD,EAAArZ,cACA,OAAA,UAAAuZ,EAAAC,EAAAC,GAUA,MATAlvC,GAAAivC,KACAA,EAAAF,EAAAzY,cAGAt2B,EAAAkvC,KACAA,EAAAH,EAAAnZ,SAAA,GAAAG,SAIA,MAAAiZ,EACAA,EACA/mE,GAAA+mE,EAAAD,EAAAnZ,SAAA,GAAAmZ,EAAApZ,UAAAoZ,EAAArZ,YAAAwZ,GACA/qI,QAAA,UAAA8qI,IA2DA,QAAArB,IAAAkB,GACA,GAAAC,GAAAD,EAAArZ,cACA,OAAA,UAAA53E,EAAAqxF,GAGA,MAAA,OAAArxF,EACAA,EACAoqB,GAAApqB,EAAAkxF,EAAAnZ,SAAA,GAAAmZ,EAAApZ,UAAAoZ,EAAArZ,YACAwZ,IAKA,QAAAjnE,IAAApqB,EAAAjnB,EAAAu4G,EAAAC,EAAAF,GACA,GAAA1vC,EAAA3hD,GAAA,MAAA,EAEA,IAAAwxF,GAAAxxF,EAAA,CACAA,GAAA77C,KAAAC,IAAA47C,EAEA,IAAAyxF,GAAAzxF,IAAA0xF,EAAAA,CACA,KAAAD,IAAAE,SAAA3xF,GAAA,MAAA,EAEA,IAAA4xF,GAAA5xF,EAAA,GACA6xF,EAAA,GACAC,GAAA,EACA9jG,IAIA,IAFAyjG,IAAAI,EAAA,MAEAJ,GAAAG,EAAAxuI,QAAA,UAAA,CACA,GAAA+G,GAAAynI,EAAAznI,MAAA,sBACAA,IAAA,KAAAA,EAAA,IAAAA,EAAA,GAAAknI,EAAA,EACArxF,EAAA,GAEA6xF,EAAAD,EACAE,GAAA,GAIA,GAAAL,GAAAK,EA6CAT,EAAA,GAAArxF,EAAA,IACA6xF,EAAA7xF,EAAA+xF,QAAAV,GACArxF,EAAA1uC,WAAAugI,QA/CA,CACA,GAAAG,IAAAJ,EAAAzoI,MAAA0uH,IAAA,IAAA,IAAAzyH,MAGA+8F,GAAAkvC,KACAA,EAAAltI,KAAAo8C,IAAAp8C,KAAA6I,IAAA+rB,EAAAk/F,QAAA+Z,GAAAj5G,EAAAm/F,UAMAl4E,IAAA77C,KAAAI,QAAAy7C,EAAAt0B,WAAA,IAAA2lH,IAAA3lH,WAAA,KAAA2lH,EAEA,IAAAY,IAAA,GAAAjyF,GAAA72C,MAAA0uH,IACAgD,EAAAoX,EAAA,EACAA,GAAAA,EAAA,IAAA,EAEA,IAAA3mI,GAAAoF,EAAA,EACAwhI,EAAAn5G,EAAAy/F,OACAn3E,EAAAtoB,EAAAw/F,KAEA,IAAAsC,EAAAz1H,QAAA8sI,EAAA7wF,EAEA,IADA3wC,EAAAmqH,EAAAz1H,OAAA8sI,EACA5mI,EAAA,EAAAA,EAAAoF,EAAApF,KACAoF,EAAApF,GAAA+1C,IAAA,GAAA,IAAA/1C,IACAumI,GAAAP,GAEAO,GAAAhX,EAAA/oH,OAAAxG,EAIA,KAAAA,EAAAoF,EAAApF,EAAAuvH,EAAAz1H,OAAAkG,KACAuvH,EAAAz1H,OAAAkG,GAAA4mI,IAAA,GAAA,IAAA5mI,IACAumI,GAAAP,GAEAO,GAAAhX,EAAA/oH,OAAAxG,EAIA,MAAA2mI,EAAA7sI,OAAAisI,GACAY,GAAA,GAGAZ,IAAA,MAAAA,IAAAQ,GAAAN,EAAAU,EAAA36H,OAAA,EAAA+5H,IAeA,MAPA,KAAArxF,IACAwxF,GAAA,GAGAxjG,EAAArkC,KAAA6nI,EAAAz4G,EAAAs/F,OAAAt/F,EAAAo/F,OACA0Z,EACAL,EAAAz4G,EAAAu/F,OAAAv/F,EAAAq/F,QACApqF,EAAA1kC,KAAA,IAGA,QAAA6oI,IAAA3lH,EAAAyzB,EAAA7+B,GACA,GAAAgxH,GAAA,EAMA,KALA5lH,EAAA,IACA4lH,EAAA,IACA5lH,GAAAA,GAEAA,EAAA,GAAAA,EACAA,EAAApnB,OAAA66C,GAAAzzB,EAAA,IAAAA,CAIA,OAHApL,KACAoL,EAAAA,EAAAlV,OAAAkV,EAAApnB,OAAA66C,IAEAmyF,EAAA5lH,EAIA,QAAA6lH,IAAAl3H,EAAA5H,EAAAknC,EAAAr5B,GAEA,MADAq5B,GAAAA,GAAA,EACA,SAAAqF,GACA,GAAA7uC,GAAA6uC,EAAA,MAAA3kC,IAKA,QAJAs/B,EAAA,GAAAxpC,GAAAwpC,KACAxpC,GAAAwpC,GAEA,IAAAxpC,GAAAwpC,SAAAxpC,EAAA,IACAkhI,GAAAlhI,EAAAsC,EAAA6N,IAIA,QAAAkxH,IAAAn3H,EAAAo3H,GACA,MAAA,UAAAzyF,EAAAoxF,GACA,GAAAjgI,GAAA6uC,EAAA,MAAA3kC,KACAiH,EAAAkpF,GAAAinC,EAAA,QAAAp3H,EAAAA,EAEA,OAAA+1H,GAAA9uH,GAAAnR,IAIA,QAAAuhI,IAAA1yF,EAAAoxF,EAAAz2F,GACA,GAAAg4F,MAAAh4F,EACAi4F,EAAAD,GAAA,EAAA,IAAA,EAKA,OAHAC,IAAAP,GAAAhuI,KAAAsuI,EAAA,EAAA,QAAA,QAAAA,EAAA,IAAA,GACAN,GAAAhuI,KAAAC,IAAAquI,EAAA,IAAA,GAKA,QAAAE,IAAA7qE,GAEA,GAAA8qE,GAAA,GAAAx7H,MAAA0wD,EAAA,EAAA,GAAA9E,QAGA,OAAA,IAAA5rD,MAAA0wD,EAAA,GAAA8qE,GAAA,EAAA,EAAA,IAAAA,GAGA,QAAAC,IAAAC,GACA,MAAA,IAAA17H,MAAA07H,EAAAprE,cAAAorE,EAAArrE,WAEAqrE,EAAAtrE,WAAA,EAAAsrE,EAAA9vE,WAGA,QAAA+vE,IAAAx/H,GACA,MAAA,UAAAusC,GACA,GAAAkzF,GAAAL,GAAA7yF,EAAA4nB,eACAurE,EAAAJ,GAAA/yF,GAEA7vB,GAAAgjH,GAAAD,EACAhsH,EAAA,EAAA7iB,KAAAI,MAAA0rB,EAAA,OAEA,OAAAkiH,IAAAnrH,EAAAzT,IAIA,QAAA2/H,IAAApzF,EAAAoxF,GACA,MAAApxF,GAAAorB,WAAA,GAAAgmE,EAAAnY,MAAA,GAAAmY,EAAAnY,MAAA,GAGA,QAAAoa,IAAArzF,EAAAoxF,GACA,MAAApxF,GAAA4nB,eAAA,EAAAwpE,EAAAzX,KAAA,GAAAyX,EAAAzX,KAAA,GAGA,QAAA2Z,IAAAtzF,EAAAoxF,GACA,MAAApxF,GAAA4nB,eAAA,EAAAwpE,EAAA1X,SAAA,GAAA0X,EAAA1X,SAAA,GAqIA,QAAAkW,IAAAuB,GAKA,QAAAoC,GAAAx9H,GACA,GAAA1L,EACA,IAAAA,EAAA0L,EAAA1L,MAAAmpI,GAAA,CACA,GAAAxzF,GAAA,GAAA1oC,MAAA,GACAm8H,EAAA,EACAC,EAAA,EACAC,EAAAtpI,EAAA,GAAA21C,EAAA4zF,eAAA5zF,EAAA6zF,YACAC,EAAAzpI,EAAA,GAAA21C,EAAA+zF,YAAA/zF,EAAAgrB,QAEA3gE,GAAA,KACAopI,EAAAptF,EAAAh8C,EAAA,GAAAA,EAAA,KACAqpI,EAAArtF,EAAAh8C,EAAA,GAAAA,EAAA,MAEAspI,EAAAhzI,KAAAq/C,EAAAqG,EAAAh8C,EAAA,IAAAg8C,EAAAh8C,EAAA,IAAA,EAAAg8C,EAAAh8C,EAAA,IACA,IAAA2G,GAAAq1C,EAAAh8C,EAAA,IAAA,GAAAopI,EACAnlH,EAAA+3B,EAAAh8C,EAAA,IAAA,GAAAqpI,EACAxgI,EAAAmzC,EAAAh8C,EAAA,IAAA,GACA2pI,EAAA3vI,KAAAI,MAAA,IAAA+M,WAAA,MAAAnH,EAAA,IAAA,IAEA,OADAypI,GAAAnzI,KAAAq/C,EAAAhvC,EAAAsd,EAAApb,EAAA8gI,GACAh0F,EAEA,MAAAjqC,GAvBA,GAAAy9H,GAAA,sGA2BA,OAAA,UAAAxzF,EAAA3B,EAAA6mD,GACA,GAEA5vF,GAAAjL,EAFA3F,EAAA,GACAwpC,IAaA,IAVAmQ,EAAAA,GAAA,aACAA,EAAA8yF,EAAAvY,iBAAAv6E,IAAAA,EACA0iD,EAAA/gD,KACAA,EAAAi0F,GAAAnrI,KAAAk3C,GAAAqG,EAAArG,GAAAuzF,EAAAvzF,IAGAwiD,EAAAxiD,KACAA,EAAA,GAAA1oC,MAAA0oC,KAGA+hD,EAAA/hD,KAAA6xF,SAAA7xF,EAAAzoC,WACA,MAAAyoC,EAGA,MAAA3B,GACAh0C,EAAA6pI,GAAAxjI,KAAA2tC,GACAh0C,GACA6jC,EAAA1vB,EAAA0vB,EAAA7jC,EAAA,GACAg0C,EAAAnQ,EAAAx6B,QAEAw6B,EAAArkC,KAAAw0C,GACAA,EAAA,KAIA,IAAA81F,GAAAn0F,EAAAylD,mBAWA,OAVAP,KACAivC,EAAAlvC,EAAAC,EAAAllD,EAAAylD,qBACAzlD,EAAAulD,EAAAvlD,EAAAklD,GAAA,IAEA3jG,EAAA2sC,EAAA,SAAA/8B,GACAmE,EAAA8+H,GAAAjjI,GACAzM,GAAA4Q,EAAAA,EAAA0qC,EAAAmxF,EAAAvY,iBAAAub,GACAhjI,EAAA3K,QAAA,WAAA,IAAAA,QAAA,MAAA,OAGA9B,GAoCA,QAAAorI,MACA,MAAA,UAAAtzH,EAAA63H,GAIA,MAHAhyC,GAAAgyC,KACAA,EAAA,GAEAvvC,EAAAtoF,EAAA63H,IA4HA,QAAAtE,MACA,MAAA,UAAAz/H,EAAAm6C,EAAAqwE,GAMA,MAJArwE,GADApmD,KAAAC,IAAAmhD,OAAAgF,MAAAmnF,EAAAA,EACAnsF,OAAAgF,GAEApE,EAAAoE,GAEA/E,MAAA+E,GAAAn6C,GAEAkyF,EAAAlyF,KAAAA,EAAAA,EAAAsb,YACArN,GAAAjO,IAAAywF,EAAAzwF,IAEAwqH,GAAAA,GAAAp1E,MAAAo1E,GAAA,EAAAz0E,EAAAy0E,GACAA,EAAAA,EAAA,GAAAA,IAAAxqH,EAAAhL,OAAAgL,EAAAhL,OAAAw1H,EAAAA,EAEArwE,GAAA,EACAn6C,EAAA5P,MAAAo6H,EAAAA,EAAArwE,GAEA,IAAAqwE,EACAxqH,EAAA5P,MAAA+pD,EAAAn6C,EAAAhL,QAEAgL,EAAA5P,MAAA2D,KAAA6I,IAAA,EAAA4tH,EAAArwE,GAAAqwE,IAXAxqH,IA+LA,QAAA4/H,IAAAj9B,GAsCA,QAAAqhC,GAAAC,EAAAC,GAEA,MADAA,GAAAA,KAAA,EACAD,EAAAjsI,IAAA,SAAAmsI,GACA,GAAAC,GAAA,EAAApyH,EAAA4/E,CAEA,IAAApmF,EAAA24H,GACAnyH,EAAAmyH,MACA,IAAA1zC,EAAA0zC,KACA,KAAAA,EAAAziI,OAAA,IAAA,KAAAyiI,EAAAziI,OAAA,KACA0iI,EAAA,KAAAD,EAAAziI,OAAA,MAAA,EACAyiI,EAAAA,EAAA9jI,UAAA,IAEA,KAAA8jI,IACAnyH,EAAA2wF,EAAAwhC,GACAnyH,EAAA2oF,WAAA,CACA,GAAA9tF,GAAAmF,GACAA,GAAA,SAAAnR,GAAA,MAAAA,GAAAgM,IAIA,OAAAmF,IAAAA,EAAAoyH,WAAAA,EAAAF,KAIA,QAAAxzC,GAAA7vF,GACA,aAAAA,IACA,IAAA,SACA,IAAA,UACA,IAAA,SACA,OAAA,CACA,SACA,OAAA,GAIA,QAAAwjI,GAAAxjI,EAAArN,GAEA,MAAA,kBAAAqN,GAAA6wF,UACA7wF,EAAAA,EAAA6wF,UACAhB,EAAA7vF,IAAAA,EAGAixF,EAAAjxF,KACAA,EAAAA,EAAAya,WACAo1E,EAAA7vF,IAAAA,EAGArN,EAGA,QAAA8wI,GAAAzjI,EAAArN,GACA,GAAAqI,SAAAgF,EASA,OARA,QAAAA,GACAhF,EAAA,SACAgF,EAAA,QACA,WAAAhF,EACAgF,EAAAA,EAAAlN,cACA,WAAAkI,IACAgF,EAAAwjI,EAAAxjI,EAAArN,KAEAqN,MAAAA,EAAAhF,KAAAA,GAGA,QAAAyrB,GAAAi9G,EAAAC,GACA,GAAA5tH,GAAA,CAQA,OAPA2tH,GAAA1oI,OAAA2oI,EAAA3oI,KACA0oI,EAAA1jI,QAAA2jI,EAAA3jI,QACA+V,EAAA2tH,EAAA1jI,MAAA2jI,EAAA3jI,SAAA,GAGA+V,EAAA2tH,EAAA1oI,KAAA2oI,EAAA3oI,QAAA,EAEA+a,EA7GA,MAAA,UAAAu8E,EAAA8wC,EAAAC,GAkBA,QAAAO,GAAA5jI,EAAArN,GACA,OACAqN,MAAAA,EACA6jI,gBAAAC,EAAA3sI,IAAA,SAAAmsI,GACA,MAAAG,GAAAH,EAAAnyH,IAAAnR,GAAArN,MAKA,QAAAoxI,GAAAL,EAAAC,GAEA,IAAA,GADA5tH,GAAA,EACApjB,EAAA,EAAAwB,EAAA2vI,EAAA3vI,OAAAxB,EAAAwB,KACA4hB,EAAA0Q,EAAAi9G,EAAAG,gBAAAlxI,GAAAgxI,EAAAE,gBAAAlxI,IAAAmxI,EAAAnxI,GAAA4wI,cADA5wI,GAIA,MAAAojB,GA/BA,IAAA25E,EAAA4C,GAAA,MAAAA,EAEAllF,IAAAg2H,KAAAA,GAAAA,IACA,IAAAA,EAAAjvI,SAAAivI,GAAA,KAEA,IAAAU,GAAAX,EAAAC,EAAAC,GAKAW,EAAA7nH,MAAAjJ,UAAA/b,IAAA3H,KAAA8iG,EAAAsxC,EAIA,OAHAI,GAAArwI,KAAAowI,GACAzxC,EAAA0xC,EAAA7sI,IAAA,SAAAC,GAAA,MAAAA,GAAA4I,SAmGA,QAAAikI,IAAAjqC,GAOA,MANArvF,GAAAqvF,KACAA,GACAqU,KAAArU,IAGAA,EAAAyW,SAAAzW,EAAAyW,UAAA,KACAzf,EAAAgJ,GAifA,QAAAkqC,IAAAC,EAAAj6H,GACAi6H,EAAAC,MAAAl6H,EA8CA,QAAAm6H,IAAA37H,EAAA+K,EAAAmjG,EAAAhX,EAAAkB,GACA,GAAAjrE,GAAAzjC,KACAwoE,KAEA0pE,EAAAzuG,EAAA0uG,aAAA77H,EAAAlV,SAAAkkG,WAAA,SAAA8sC,EAGA3uG,GAAA4uG,UACA5uG,EAAA6uG,aACA7uG,EAAA8uG,SAAA1yI,EACA4jC,EAAAuuG,MAAAtjC,EAAArtF,EAAAvJ,MAAAuJ,EAAA8oF,QAAA,IAAAqa,GACA/gF,EAAA+uG,QAAA,EACA/uG,EAAAgvG,WAAA,EACAhvG,EAAAivG,QAAA,EACAjvG,EAAAkvG,UAAA,EACAlvG,EAAAmvG,YAAA,EAEAV,EAAAW,YAAApvG,GAaAA,EAAAqvG,mBAAA,WACA90I,EAAAwqE,EAAA,SAAAupE,GACAA,EAAAe,wBAeArvG,EAAAsvG,iBAAA,WACA/0I,EAAAwqE,EAAA,SAAAupE,GACAA,EAAAgB,sBAaAtvG,EAAAovG,YAAA,SAAAd,GAGAhsC,GAAAgsC,EAAAC,MAAA,SACAxpE,EAAAliE,KAAAyrI,GAEAA,EAAAC,QACAvuG,EAAAsuG,EAAAC,OAAAD,IAKAtuG,EAAAuvG,gBAAA,SAAAjB,EAAAkB,GACA,GAAAC,GAAAnB,EAAAC,KAEAvuG,GAAAyvG,KAAAnB,SACAtuG,GAAAyvG,GAEAzvG,EAAAwvG,GAAAlB,EACAA,EAAAC,MAAAiB,GAYAxvG,EAAA0vG,eAAA,SAAApB,GACAA,EAAAC,OAAAvuG,EAAAsuG,EAAAC,SAAAD,SACAtuG,GAAAsuG,EAAAC,OAEAh0I,EAAAylC,EAAA8uG,SAAA,SAAA3kI,EAAAkK,GACA2rB,EAAA2vG,aAAAt7H,EAAA,KAAAi6H,KAEA/zI,EAAAylC,EAAA4uG,OAAA,SAAAzkI,EAAAkK,GACA2rB,EAAA2vG,aAAAt7H,EAAA,KAAAi6H,KAEA/zI,EAAAylC,EAAA6uG,UAAA,SAAA1kI,EAAAkK,GACA2rB,EAAA2vG,aAAAt7H,EAAA,KAAAi6H,KAGA9xC,EAAAz3B,EAAAupE,IAaAsB,IACAC,KAAAtzI,KACAq/C,SAAA/oC,EACAtK,IAAA,SAAAiN,EAAA25E,EAAA0S,GACA,GAAA3pF,GAAA1C,EAAA25E,EACA,IAAAj3E,EAEA,CACA,GAAApb,GAAAob,EAAA5b,QAAAulG,EACA/kG,SACAob,EAAArV,KAAAg/F,OAJArsF,GAAA25E,IAAA0S,IAQAiuC,MAAA,SAAAt6H,EAAA25E,EAAA0S,GACA,GAAA3pF,GAAA1C,EAAA25E,EACAj3E,KAGAskF,EAAAtkF,EAAA2pF,GACA,IAAA3pF,EAAA5Z,cACAkX,GAAA25E,KAGAs/C,WAAAA,EACA1kC,SAAAA,IAaA/pE,EAAA+vG,UAAA,WACAhmC,EAAArtG,YAAAmW,EAAAm9H,IACAjmC,EAAAptG,SAAAkW,EAAAo9H,IACAjwG,EAAA+uG,QAAA,EACA/uG,EAAAgvG,WAAA,EACAP,EAAAsB,aAiBA/vG,EAAAkwG,aAAA,WACAnmC,EAAAomC,SAAAt9H,EAAAm9H,GAAAC,GAAA,IAAAG,IACApwG,EAAA+uG,QAAA,EACA/uG,EAAAgvG,WAAA,EACAhvG,EAAAmvG,YAAA,EACA50I,EAAAwqE,EAAA,SAAAupE,GACAA,EAAA4B,kBAiBAlwG,EAAAqwG,cAAA,WACA91I,EAAAwqE,EAAA,SAAAupE,GACAA,EAAA+B,mBAWArwG,EAAAswG,cAAA,WACAvmC,EAAAptG,SAAAkW,EAAAu9H,IACApwG,EAAAmvG,YAAA,EACAV,EAAA6B,iBA4vCA,QAAAC,IAAAV,GACAA,EAAAW,YAAA3tI,KAAA,SAAAsH,GACA,MAAA0lI,GAAAY,SAAAtmI,GAAAA,EAAAA,EAAAya,aAIA,QAAA8rH,IAAAnwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GACAsmC,GAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GACAkmC,GAAAV,GAGA,QAAAc,IAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GACA,GAAAllG,GAAAo3F,GAAA1pF,EAAA,GAAA1N,KAKA,KAAA0nG,EAAAs5B,QAAA,CACA,GAAAyK,IAAA,CAEA/9H,GAAA1E,GAAA,mBAAA,SAAA3R,GACAo0I,GAAA,IAGA/9H,EAAA1E,GAAA,iBAAA,WACAyiI,GAAA,EACA35B,MAIA,GAAAA,GAAA,SAAA45B,GAKA,GAJA98H,IACAs2F,EAAA3wE,MAAAw+E,OAAAnkG,GACAA,EAAA,OAEA68H,EAAA,CACA,GAAAzmI,GAAA0I,EAAAzV,MACA4Y,EAAA66H,GAAAA,EAAA1rI,IAKA,cAAAA,GAAAnI,EAAA8zI,QAAA,UAAA9zI,EAAA8zI,SACA3mI,EAAAmQ,GAAAnQ,KAMA0lI,EAAAkB,aAAA5mI,GAAA,KAAAA,GAAA0lI,EAAAmB,wBACAnB,EAAAoB,cAAA9mI,EAAA6L,IAMA,IAAA62F,EAAA+5B,SAAA,SACA/zH,EAAA1E,GAAA,QAAA8oG,OACA,CACA,GAAAljG,GAEAm9H,EAAA,SAAAL,EAAAvnI,EAAA6nI,GACAp9H,IACAA,EAAAs2F,EAAA3wE,MAAA,WACA3lB,EAAA,KACAzK,GAAAA,EAAAa,QAAAgnI,GACAl6B,EAAA45B,MAMAh+H,GAAA1E,GAAA,UAAA,SAAA6H,GACA,GAAAG,GAAAH,EAAAkoB,OAIA,MAAA/nB,GAAA,GAAAA,GAAAA,EAAA,IAAA,IAAAA,GAAAA,GAAA,IAEA+6H,EAAAl7H,EAAAzZ,KAAAA,KAAA4N,SAIA0iG,EAAA+5B,SAAA,UACA/zH,EAAA1E,GAAA,YAAA+iI,GAMAr+H,EAAA1E,GAAA,SAAA8oG,GAEA44B,EAAAuB,QAAA,WACAv+H,EAAAzV,IAAAyyI,EAAAY,SAAAZ,EAAAkB,YAAA,GAAAlB,EAAAkB,aAIA,QAAAM,IAAAC,EAAAC,GACA,GAAAx2C,EAAAu2C,GACA,MAAAA,EAGA,IAAAv3C,EAAAu3C,GAAA,CACAE,GAAAz0C,UAAA,CACA,IAAA71D,GAAAsqG,GAAA9nI,KAAA4nI,EACA,IAAApqG,EAAA,CACA,GAAA85B,IAAA95B,EAAA,GACAuqG,GAAAvqG,EAAA,GACA4sD,EAAA,EACAD,EAAA,EACAD,EAAA,EACA89C,EAAA,EACAxF,EAAAL,GAAA7qE,GACA2wE,EAAA,GAAAF,EAAA,EASA,OAPAF,KACAz9C,EAAAy9C,EAAAntE,WACAyvB,EAAA09C,EAAAjzC,aACA1K,EAAA29C,EAAAK,aACAF,EAAAH,EAAAM,mBAGA,GAAAvhI,MAAA0wD,EAAA,EAAAkrE,EAAAxrE,UAAAixE,EAAA79C,EAAAD,EAAAD,EAAA89C,IAIA,MAAAI,KAGA,QAAAC,IAAA/2B,EAAAg3B,GACA,MAAA,UAAAC,EAAAj5F,GACA,GAAA9R,GAAA5lC,CAEA,IAAAy5F,EAAAk3C,GACA,MAAAA,EAGA,IAAAl4C,EAAAk4C,GAAA,CAOA,GAHA,KAAAA,EAAAjnI,OAAA,IAAA,KAAAinI,EAAAjnI,OAAAinI,EAAA3zI,OAAA,KACA2zI,EAAAA,EAAAtoI,UAAA,EAAAsoI,EAAA3zI,OAAA,IAEA4zI,GAAApwI,KAAAmwI,GACA,MAAA,IAAA3hI,MAAA2hI,EAKA,IAHAj3B,EAAAje,UAAA,EACA71D,EAAA8zE,EAAAtxG,KAAAuoI,GAuBA,MApBA/qG,GAAA3kC,QAEAjB,EADA03C,GAEAm5F,KAAAn5F,EAAA4nB,cACAwxE,GAAAp5F,EAAA2nB,WAAA,EACA0xE,GAAAr5F,EAAA0nB,UACA4xE,GAAAt5F,EAAAorB,WACAmuE,GAAAv5F,EAAAslD,aACAk0C,GAAAx5F,EAAA44F,aACAa,IAAAz5F,EAAA64F,kBAAA,MAGAM,KAAA,KAAAC,GAAA,EAAAC,GAAA,EAAAC,GAAA,EAAAC,GAAA,EAAAC,GAAA,EAAAC,IAAA,GAGAl4I,EAAA2sC,EAAA,SAAAwrG,EAAA51I,GACAA,EAAAk1I,EAAA1zI,SACAgD,EAAA0wI,EAAAl1I,KAAA41I,KAGA,GAAApiI,MAAAhP,EAAA6wI,KAAA7wI,EAAA8wI,GAAA,EAAA9wI,EAAA+wI,GAAA/wI,EAAAgxI,GAAAhxI,EAAAixI,GAAAjxI,EAAAkxI,IAAA,EAAA,IAAAlxI,EAAAmxI,KAAA,GAIA,MAAAX,MAIA,QAAAa,IAAAxtI,EAAA61G,EAAAt8C,EAAArnB,GACA,MAAA,UAAAkpD,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,EAAAU,GA4DA,QAAA6nC,GAAAzoI,GAEA,MAAAA,MAAAA,EAAAoG,SAAApG,EAAAoG,YAAApG,EAAAoG,WAGA,QAAAsiI,GAAAz1I,GACA,MAAAk+F,GAAAl+F,GAAA29F,EAAA39F,GAAAA,EAAAshE,EAAAthE,GAAAhB,EAjEA02I,GAAAvyC,EAAA1tF,EAAA7V,EAAA6yI,GACAc,GAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,EACA,IACA0oC,GADA70C,EAAA2xC,GAAAA,EAAAmD,UAAAnD,EAAAmD,SAAA90C,QAmCA,IAhCA2xC,EAAAoD,aAAA9tI,EACA0qI,EAAAqD,SAAArwI,KAAA,SAAAsH,GACA,GAAA0lI,EAAAY,SAAAtmI,GAAA,MAAA,KACA,IAAA6wG,EAAAl5G,KAAAqI,GAAA,CAIA,GAAAgpI,GAAAz0E,EAAAv0D,EAAA4oI,EAIA,OAHA70C,KACAi1C,EAAA50C,EAAA40C,EAAAj1C,IAEAi1C,EAEA,MAAA/2I,KAGAyzI,EAAAW,YAAA3tI,KAAA,SAAAsH,GACA,GAAAA,IAAA4wF,EAAA5wF,GACA,KAAAipI,IAAA,UAAA,8BAAAjpI,EAEA,OAAAyoI,GAAAzoI,IACA4oI,EAAA5oI,EACA4oI,GAAA70C,IACA60C,EAAAx0C,EAAAw0C,EAAA70C,GAAA,IAEA6M,EAAA,QAAA5gG,EAAAktC,EAAA6mD,KAEA60C,EAAA,KACA,MAIAz3C,EAAAt+F,EAAAy8C,MAAAz8C,EAAAq2I,MAAA,CACA,GAAAC,EACAzD,GAAA0D,YAAA95F,IAAA,SAAAtvC,GACA,OAAAyoI,EAAAzoI,IAAAkxF,EAAAi4C,IAAA50E,EAAAv0D,IAAAmpI,GAEAt2I,EAAA4pH,SAAA,MAAA,SAAAxpH,GACAk2I,EAAAT,EAAAz1I,GACAyyI,EAAA2D,cAIA,GAAAl4C,EAAAt+F,EAAAkJ,MAAAlJ,EAAAy2I,MAAA,CACA,GAAAC,EACA7D,GAAA0D,YAAArtI,IAAA,SAAAiE,GACA,OAAAyoI,EAAAzoI,IAAAkxF,EAAAq4C,IAAAh1E,EAAAv0D,IAAAupI,GAEA12I,EAAA4pH,SAAA,MAAA,SAAAxpH,GACAs2I,EAAAb,EAAAz1I,GACAyyI,EAAA2D,gBAeA,QAAAV,IAAAvyC,EAAA1tF,EAAA7V,EAAA6yI,GACA,GAAAlgH,GAAA9c,EAAA,GACA8gI,EAAA9D,EAAAmB,sBAAAn2C,EAAAlrE,EAAAksB,SACA83F,IACA9D,EAAAqD,SAAArwI,KAAA,SAAAsH,GACA,GAAA0xC,GAAAhpC,EAAAqK,KAAA02H,OAKA,OAAA/3F,GAAAC,WAAAD,EAAAg4F,aAAAz3I,EAAA+N,IAKA,QAAA2pI,IAAAvzC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GAqBA,GApBAyoC,GAAAvyC,EAAA1tF,EAAA7V,EAAA6yI,GACAc,GAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GAEAwlC,EAAAoD,aAAA,SACApD,EAAAqD,SAAArwI,KAAA,SAAAsH,GACA,MAAA0lI,GAAAY,SAAAtmI,GAAA,KACA4pI,GAAAjyI,KAAAqI,GAAAK,WAAAL,GACA/N,IAGAyzI,EAAAW,YAAA3tI,KAAA,SAAAsH,GACA,IAAA0lI,EAAAY,SAAAtmI,GAAA,CACA,IAAAqxF,EAAArxF,GACA,KAAAipI,IAAA,SAAA,gCAAAjpI,EAEAA,GAAAA,EAAAya,WAEA,MAAAza,KAGAmxF,EAAAt+F,EAAAy8C,MAAAz8C,EAAAq2I,MAAA,CACA,GAAAC,EACAzD,GAAA0D,YAAA95F,IAAA,SAAAtvC,GACA,MAAA0lI,GAAAY,SAAAtmI,IAAAkxF,EAAAi4C,IAAAnpI,GAAAmpI,GAGAt2I,EAAA4pH,SAAA,MAAA,SAAAxpH,GACAk+F,EAAAl+F,KAAAo+F,EAAAp+F,KACAA,EAAAoN,WAAApN,EAAA,KAEAk2I,EAAA93C,EAAAp+F,KAAAshD,MAAAthD,GAAAA,EAAAhB,EAEAyzI,EAAA2D,cAIA,GAAAl4C,EAAAt+F,EAAAkJ,MAAAlJ,EAAAy2I,MAAA,CACA,GAAAC,EACA7D,GAAA0D,YAAArtI,IAAA,SAAAiE,GACA,MAAA0lI,GAAAY,SAAAtmI,IAAAkxF,EAAAq4C,IAAAvpI,GAAAupI,GAGA12I,EAAA4pH,SAAA,MAAA,SAAAxpH,GACAk+F,EAAAl+F,KAAAo+F,EAAAp+F,KACAA,EAAAoN,WAAApN,EAAA,KAEAs2I,EAAAl4C,EAAAp+F,KAAAshD,MAAAthD,GAAAA,EAAAhB,EAEAyzI,EAAA2D,eAKA,QAAAQ,IAAAzzC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GAGAsmC,GAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GACAkmC,GAAAV,GAEAA,EAAAoD,aAAA,MACApD,EAAA0D,YAAAjxI,IAAA,SAAA2xI,EAAAC,GACA,GAAA/pI,GAAA8pI,GAAAC,CACA,OAAArE,GAAAY,SAAAtmI,IAAAgqI,GAAAryI,KAAAqI,IAIA,QAAAiqI,IAAA7zC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GAGAsmC,GAAApwC,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,GACAkmC,GAAAV,GAEAA,EAAAoD,aAAA,QACApD,EAAA0D,YAAAx6F,MAAA,SAAAk7F,EAAAC,GACA,GAAA/pI,GAAA8pI,GAAAC,CACA,OAAArE,GAAAY,SAAAtmI,IAAAkqI,GAAAvyI,KAAAqI,IAIA,QAAAmqI,IAAA/zC,EAAA1tF,EAAA7V,EAAA6yI,GAEAx0C,EAAAr+F,EAAAqX,OACAxB,EAAA7V,KAAA,OAAAq9F,IAGA,IAAA4c,GAAA,SAAA45B,GACAh+H,EAAA,GAAAiG,SACA+2H,EAAAoB,cAAAj0I,EAAAmN,MAAA0mI,GAAAA,EAAA1rI,MAIA0N,GAAA1E,GAAA,QAAA8oG,GAEA44B,EAAAuB,QAAA,WACA,GAAAjnI,GAAAnN,EAAAmN,KACA0I,GAAA,GAAAiG,QAAA3O,GAAA0lI,EAAAkB,YAGA/zI,EAAA4pH,SAAA,QAAAipB,EAAAuB,SAGA,QAAAmD,IAAAtoC,EAAAv8F,EAAA2E,EAAAi1G,EAAAnrB,GACA,GAAAq2C,EACA,IAAAl5C,EAAAguB,GAAA,CAEA,GADAkrB,EAAAvoC,EAAAqd,IACAkrB,EAAAvwC,SACA,KAAA3K,GAAA,WAAA,YAAA,yDACAjlF,EAAAi1G,EAEA,OAAAkrB,GAAA9kI,GAEA,MAAAyuF,GAGA,QAAAs2C,IAAAl0C,EAAA1tF,EAAA7V,EAAA6yI,EAAAhjC,EAAAxC,EAAAU,EAAAkB,GACA,GAAAyoC,GAAAH,GAAAtoC,EAAA1L,EAAA,cAAAvjG,EAAA23I,aAAA,GACAC,EAAAL,GAAAtoC,EAAA1L,EAAA,eAAAvjG,EAAA63I,cAAA,GAEA59B,EAAA,SAAA45B,GACAhB,EAAAoB,cAAAp+H,EAAA,GAAAiG,QAAA+3H,GAAAA,EAAA1rI,MAGA0N,GAAA1E,GAAA,QAAA8oG,GAEA44B,EAAAuB,QAAA,WACAv+H,EAAA,GAAAiG,QAAA+2H,EAAAkB,YAMAlB,EAAAY,SAAA,SAAAtmI,GACA,MAAAA,MAAA,GAGA0lI,EAAAW,YAAA3tI,KAAA,SAAAsH,GACA,MAAA8yF,GAAA9yF,EAAAuqI,KAGA7E,EAAAqD,SAAArwI,KAAA,SAAAsH,GACA,MAAAA,GAAAuqI,EAAAE,IA6iBA,QAAAE,IAAAzgI,EAAA2Q,GAEA,MADA3Q,GAAA,UAAAA,GACA,WAAA,SAAA01F,GAiFA,QAAAgrC,GAAAnsB,EAAAC,GACA,GAAA9sG,KAEA+sG,GACA,IAAA,GAAAtkH,GAAA,EAAAA,EAAAokH,EAAAtqH,OAAAkG,IAAA,CAEA,IAAA,GADAiwB,GAAAm0F,EAAApkH,GACA2N,EAAA,EAAAA,EAAA02G,EAAAvqH,OAAA6T,IACA,GAAAsiB,GAAAo0F,EAAA12G,GAAA,QAAA22G,EAEA/sG,GAAAlZ,KAAA4xB,GAEA,MAAA1Y,GAGA,QAAAi5H,GAAA3tB,GACA,GAAAx7E,KACA,OAAAt0B,IAAA8vG,IACA9sH,EAAA8sH,EAAA,SAAAljG,GACA0nB,EAAAA,EAAAr0B,OAAAw9H,EAAA7wH,MAEA0nB,GACAkuD,EAAAstB,GACAA,EAAAhlH,MAAA,KACAw4F,EAAAwsB,IACA9sH,EAAA8sH,EAAA,SAAAljG,EAAAi+C,GACAj+C,IACA0nB,EAAAA,EAAAr0B,OAAA4qD,EAAA//D,MAAA,SAGAwpC,GAEAw7E,EA/GA,OACAzM,SAAA,KACApC,KAAA,SAAAjY,EAAA1tF,EAAA7V,GAuBA,QAAAi4I,GAAAppG,GACA,GAAA07E,GAAA2tB,EAAArpG,EAAA,EACA7uC,GAAAoqH,UAAAG,GAGA,QAAA4tB,GAAAtpG,GACA,GAAA07E,GAAA2tB,EAAArpG,KACA7uC,GAAAsqH,aAAAC,GAGA,QAAA2tB,GAAArpG,EAAApS,GAGA,GAAA27G,GAAAviI,EAAArW,KAAA,iBAAA+gG,KACA83C,IAUA,OATA96I,GAAAsxC,EAAA,SAAAnzC,IACA+gC,EAAA,GAAA27G,EAAA18I,MACA08I,EAAA18I,IAAA08I,EAAA18I,IAAA,GAAA+gC,EACA27G,EAAA18I,OAAA+gC,EAAA,IACA47G,EAAAxyI,KAAAnK,MAIAma,EAAArW,KAAA,eAAA44I,GACAC,EAAA7yI,KAAA,KAGA,QAAA8yI,GAAA9wB,EAAA+C,GACA,GAAAC,GAAAutB,EAAAxtB,EAAA/C,GACAkD,EAAAqtB,EAAAvwB,EAAA+C,EACAC,GAAA0tB,EAAA1tB,EAAA,GACAE,EAAAwtB,EAAAxtB,MACAF,GAAAA,EAAAlpH,QACAyrG,EAAAptG,SAAAkW,EAAA20G,GAEAE,GAAAA,EAAAppH,QACAyrG,EAAArtG,YAAAmW,EAAA60G,GAIA,QAAA6tB,GAAA5/B,GACA,GAAA3wF,KAAA,GAAAu7E,EAAAi1C,OAAA,IAAAxwH,EAAA,CACA,GAAAuiG,GAAAytB,EAAAr/B,MACA,IAAAC,GAEA,IAAA3Y,EAAA0Y,EAAAC,GAAA,CACA,GAAA4O,GAAAwwB,EAAAp/B,EACA0/B,GAAA9wB,EAAA+C,QAHA0tB,GAAA1tB,GAMA3R,EAAA5Y,EAAA2Y,GAxEA,GAAAC,EAEArV,GAAA3E,OAAA5+F,EAAAqX,GAAAkhI,GAAA,GAEAv4I,EAAA4pH,SAAA,QAAA,SAAAz8G,GACAorI,EAAAh1C,EAAA8iC,MAAArmI,EAAAqX,OAIA,YAAAA,GACAksF,EAAA3E,OAAA,SAAA,SAAA45C,EAAAC,GAEA,GAAAC,GAAA,EAAAF,CACA,IAAAE,KAAA,EAAAD,GAAA,CACA,GAAA5pG,GAAAmpG,EAAAz0C,EAAA8iC,MAAArmI,EAAAqX,IACAqhI,KAAA1wH,EACAiwH,EAAAppG,GACAspG,EAAAtpG,UAknGA,QAAA+jG,IAAAlgI,GAaA,QAAAimI,GAAAC,EAAA7qI,EAAA82F,GACA92F,IAAA3O,EACAy5I,EAAA,WAAAD,EAAA/zC,GAEAi0C,EAAA,WAAAF,EAAA/zC,GAEA7F,EAAAjxF,GAIAA,GACA+kI,EAAAD,EAAAjB,OAAAgH,EAAA/zC,GACAt5F,EAAAsnI,EAAAhB,UAAA+G,EAAA/zC,KAEAt5F,EAAAsnI,EAAAjB,OAAAgH,EAAA/zC,GACAiuC,EAAAD,EAAAhB,UAAA+G,EAAA/zC,KARAiuC,EAAAD,EAAAjB,OAAAgH,EAAA/zC,GACAiuC,EAAAD,EAAAhB,UAAA+G,EAAA/zC,IAUAguC,EAAAf,UACAiH,EAAAC,IAAA,GACAnG,EAAAZ,OAAAY,EAAAX,SAAA9yI,EACA65I,EAAA,GAAA,QAEAF,EAAAC,IAAA,GACAnG,EAAAZ,OAAAiH,GAAArG,EAAAjB,QACAiB,EAAAX,UAAAW,EAAAZ,OACAgH,EAAA,GAAApG,EAAAZ,QAOA,IAAAkH,EAEAA,GADAtG,EAAAf,UAAAe,EAAAf,SAAA8G,GACAx5I,GACAyzI,EAAAjB,OAAAgH,OAEA/F,EAAAhB,UAAA+G,IAGA,MAGAK,EAAAL,EAAAO,GACA1H,EAAAkB,aAAAiG,EAAAO,EAAAtG,GAGA,QAAAgG,GAAAxhI,EAAAlK,EAAA03F,GACAguC,EAAAx7H,KACAw7H,EAAAx7H,OAEA9L,EAAAsnI,EAAAx7H,GAAAlK,EAAA03F,GAGA,QAAAi0C,GAAAzhI,EAAAlK,EAAA03F,GACAguC,EAAAx7H,IACAy7H,EAAAD,EAAAx7H,GAAAlK,EAAA03F,GAEAq0C,GAAArG,EAAAx7H,MACAw7H,EAAAx7H,GAAAjY,GAIA,QAAA25I,GAAAr9I,EAAA09I,GACAA,IAAA/oH,EAAA30B,IACAqxG,EAAAptG,SAAAi/C,EAAAljD,GACA20B,EAAA30B,IAAA,IACA09I,GAAA/oH,EAAA30B,KACAqxG,EAAArtG,YAAAk/C,EAAAljD,GACA20B,EAAA30B,IAAA,GAIA,QAAAu9I,GAAAL,EAAAS,GACAT,EAAAA,EAAA,IAAAz0C,GAAAy0C,EAAA,KAAA,GAEAG,EAAAO,GAAAV,EAAAS,KAAA,GACAN,EAAAQ,GAAAX,EAAAS,KAAA,GA1FA,GAAAxG,GAAAngI,EAAAmgI,KACAj0F,EAAAlsC,EAAAksC,SACAvuB,KACA9kB,EAAAmH,EAAAnH,IACAunI,EAAApgI,EAAAogI,MACArB,EAAA/+H,EAAA++H,WACA1kC,EAAAr6F,EAAAq6F,QAEA18E,GAAAkpH,MAAAlpH,EAAAipH,IAAA16F,EAAAxP,SAAAkqG,KAEAzG,EAAAF,aAAAgG,EAoFA,QAAAO,IAAA9nI,GACA,GAAAA,EACA,IAAA,GAAA8O,KAAA9O,GACA,GAAAA,EAAA0W,eAAA5H,GACA,OAAA,CAIA,QAAA,EAh6xBA,GAAAs5H,IAAA,qBAIA5C,GAAA,WAYAr3C,GAAA,SAAAxtF,GAAA,MAAAgrF,GAAAhrF,GAAAA,EAAA9R,cAAA8R,GACA+V,GAAA/hB,OAAAsa,UAAAyH,eAYA0/E,GAAA,SAAAz1F,GAAA,MAAAgrF,GAAAhrF,GAAAA,EAAA5K,cAAA4K,GAGA0nI,GAAA,SAAAvqI,GAEA,MAAA6tF,GAAA7tF,GACAA,EAAA1M,QAAA,SAAA,SAAAyvH,GAAA,MAAA1/F,QAAAC,aAAA,GAAAy/F,EAAAtqC,WAAA,MACAz4E,GAEAwqI,GAAA,SAAAxqI,GAEA,MAAA6tF,GAAA7tF,GACAA,EAAA1M,QAAA,SAAA,SAAAyvH,GAAA,MAAA1/F,QAAAC,aAAAy/F,EAAAtqC,WAAA,UACAz4E,EAOA,OAAA,IAAAjP,gBACAs/F,GAAAk6C,GACAjyC,GAAAkyC,GAIA,IACAt3B,IACAzgB,GACA1lG,GAUA4rG,GATAnrG,MAAAA,MACA2H,MAAAA,OACAwB,MAAAA,KACA+hB,GAAA7hB,OAAAsa,UAAAuH,SACA22E,GAAAx4F,OAAAw4F,eACAsB,GAAAvD,EAAA,MAGAqH,GAAA3mG,EAAA2mG,UAAA3mG,EAAA2mG,YAEArG,GAAA,CAMA8kB,IAAA9mH,EAAAqlF,aA6PA3wE,EAAA4lG,WAsBA1X,EAAA0X,UAsIA,IA+gCA7Q,IA/gCAxqF,GAAA+O,MAAA/O,QAuEA4kF,GAAA,gGAMA7hF,GAAA,SAAAnQ,GACA,MAAA4vF,GAAA5vF,GAAAA,EAAAmQ,OAAAnQ,GAMAm6H,GAAA,SAAAp4H,GACA,MAAAA,GAAA1M,QAAA,gCAAA,QACAA,QAAA,QAAA,UA4SAolG,GAAA,WACA,GAAAtJ,EAAAsJ,GAAA+xC,WAAA,MAAA/xC,IAAA+xC,SAEA,IAAAvoG,MAAA91C,EAAAo6E,cAAA,cACAp6E,EAAAo6E,cAAA,iBAEA,KAAAtkC,EACA,IAEA,GAAAl/B,UAAA,IAEA,MAAAtT,GACAwyC,GAAA,EAIA,MAAAw2D,IAAA+xC,UAAAvoG,GAyCAszD,GAAA,WACA,GAAApG,EAAAoG,GAAAk1C,OAAA,MAAAl1C,IAAAk1C,KACA,IAAAh9G,GACAp1B,EAAAyf,EAAA5P,EAAAumF,EAAA6E,GAAAnhG,MACA,KAAAkG,EAAA,EAAAA,EAAAo2F,IAAAp2F,EAEA,GADAyf,EAAAw7E,GAAAj7F,GACAo1B,EAAAthC,EAAAo6E,cAAA,IAAAzuD,EAAAzkB,QAAA,IAAA,OAAA,OAAA,CACA6U,EAAAulB,EAAAv5B,aAAA4jB,EAAA,KACA,OAIA,MAAAy9E,IAAAk1C,MAAAviI,GAgQAorF,IAAA,MAAA,WAAA,MAAA,SA+TA4B,GAAA,SAQAG,IAAA,EAyJA1H,GAAA,EACA+8C,GAAA,EACAh4C,GAAA,EACAygB,GAAA,EACA5Q,GAAA,EACAqC,GAAA,GAueAhsF,IACAulE,KAAA,QACAwsD,MAAA,EACAC,MAAA,EACAC,IAAA,EACAC,SAAA,uBA+PAh1C,IAAAlrF,QAAA,OAEA,IAAA63F,IAAA3M,GAAAvzF,SACA0/F,GAAA,EACAsgB,GAAA,SAAA77G,EAAA1N,EAAAmJ,GACAuE,EAAAjP,iBAAAuB,EAAAmJ,GAAA,IAEA0hG,GAAA,SAAAn9F,EAAA1N,EAAAmJ,GACAuE,EAAAgD,oBAAA1Q,EAAAmJ,GAAA,GAMA2zF,IAAA1oF,MAAA,SAAAoW,GAEA,MAAApzB,MAAAmS,MAAAihB,EAAApzB,KAAAwa,cAMA,IAAAs3F,IAAA,kBACAC,GAAA,cACA4oC,IAAAv3G,WAAA,WAAAD,WAAA,aACA0vE,GAAA9V,EAAA,UAeA4V,GAAA,6BACAV,GAAA,YACAO,GAAA,YACAC,GAAA,0EAEA5tE,IACAC,QAAA,EAAA,+BAAA,aAEAI,OAAA,EAAA,UAAA,YACAE,KAAA,EAAA,oBAAA,uBACAD,IAAA,EAAA,iBAAA,oBACAE,IAAA,EAAA,qBAAA,yBACA5E,UAAA,EAAA,GAAA,IAGAoE,IAAAW,SAAAX,GAAAC,OACAD,GAAAjH,MAAAiH,GAAAY,MAAAZ,GAAAa,SAAAb,GAAAc,QAAAd,GAAAK,MACAL,GAAAe,GAAAf,GAAAQ,EAkUA,IAAA+/D,IAAAM,GAAA5kF,WACApH,MAAA,SAAA3H,GAGA,QAAA8tB,KACA3F,IACAA,GAAA,EACAnoB,KALA,GAAAmoB,IAAA,CASA,cAAAn+B,EAAAuI,WACAyC,WAAA84B,IAEA7/B,KAAA4R,GAAA,mBAAAiuB,GAGA6lE,GAAAjoG,GAAAmU,GAAA,OAAAiuB,KAIAxX,SAAA,WACA,GAAAza,KAEA,OADA5P,GAAAgC,KAAA,SAAAX,GAAAuO,EAAAtH,KAAA,GAAAjH,KACA,IAAAuO,EAAA3H,KAAA,MAAA,KAGAujB,GAAA,SAAAjpB,GACA,MAAA6hG,IAAA7hG,GAAA,EAAAP,KAAAO,GAAAP,KAAAA,KAAA+B,OAAAxB,KAGAwB,OAAA,EACAuE,KAAAA,GACA/E,QAAAA,KACAuD,UAAAA,QAQAiwG,KACA/2G,GAAA,4DAAA8H,MAAA,KAAA,SAAA8H,GACAmnG,GAAA/U,GAAApyF,IAAAA,GAEA,IAAAonG,MACAh3G,GAAA,mDAAA8H,MAAA,KAAA,SAAA8H,GACAonG,GAAApnG,IAAA,GAEA,IAAAsnG,KACAtI,YAAA,YACAE,YAAA,YACAgqC,MAAA,MACAI,MAAA,MACA1qC,UAAA,UAgBAxuG,IACAiC,KAAA2zG,GACA/2E,WAAAq2E,GACA/1F,QAAAi1F,IACA,SAAArgG,EAAA+F,GACA4tF,GAAA5tF,GAAA/F,IAGA/T,GACAiC,KAAA2zG,GACArO,cAAAgP,GAEAvQ,MAAA,SAAA1tF,GAEA,MAAA8rF,IAAAniG,KAAAqW,EAAA,WAAAi+F,GAAAj+F,EAAAhR,YAAAgR,GAAA,gBAAA,YAGA+uF,aAAA,SAAA/uF,GAEA,MAAA8rF,IAAAniG,KAAAqW,EAAA,kBAAA8rF,GAAAniG,KAAAqW,EAAA,4BAGAgvF,WAAAgP,GAEA5Q,SAAA,SAAAptF,GACA,MAAAi+F,IAAAj+F,EAAA,cAGA63B,WAAA,SAAA73B,EAAAwB,GACAxB,EAAAzF,gBAAAiH,IAGA+3B,SAAAmkE,GAEA5xG,IAAA,SAAAkU,EAAAwB,EAAAlK,GAGA,MAFAkK,GAAAgD,GAAAhD,GAEAinF,EAAAnxF,QACA0I,EAAAla,MAAA0b,GAAAlK,GAEA0I,EAAAla,MAAA0b,IAIArX,KAAA,SAAA6V,EAAAwB,EAAAlK,GACA,GAAAsF,GAAAoD,EAAApD,QACA,IAAAA,IAAAovF,IAAApvF,IAAAonI,IAAApnI,IAAA6vG,GAAA,CAGA,GAAA63B,GAAA56C,GAAAloF,EACA,IAAAi9F,GAAA6lC,GAAA,CACA,IAAA77C,EAAAnxF,GASA,MAAA0I,GAAAwB,KACAxB,EAAAib,WAAAspH,aAAA/iI,IAAArH,GAAAkkB,UACAimH,EACA/6I,CAXA+N,IACA0I,EAAAwB,IAAA,EACAxB,EAAAvS,aAAA+T,EAAA8iI,KAEAtkI,EAAAwB,IAAA,EACAxB,EAAAzF,gBAAA+pI,QAQA,IAAA77C,EAAAnxF,GACA0I,EAAAvS,aAAA+T,EAAAlK,OACA,IAAA0I,EAAAxS,aAAA,CAGA,GAAAuW,GAAA/D,EAAAxS,aAAAgU,EAAA,EAEA,OAAA,QAAAuC,EAAAxa,EAAAwa,KAIAsG,KAAA,SAAArK,EAAAwB,EAAAlK,GACA,MAAAmxF,GAAAnxF,QACA0I,EAAAwB,GAAAlK,GAEA0I,EAAAwB,IAIA3W,KAAA,WAIA,QAAAqvB,GAAAla,EAAA1I,GACA,GAAAkxF,EAAAlxF,GAAA,CACA,GAAAsF,GAAAoD,EAAApD,QACA,OAAAA,KAAAqqF,IAAArqF,IAAAovF,GAAAhsF,EAAAye,YAAA,GAEAze,EAAAye,YAAAnnB,EAPA,MADA4iB,GAAAsqH,IAAA,GACAtqH,KAWA3vB,IAAA,SAAAyV,EAAA1I,GACA,GAAAkxF,EAAAlxF,GAAA,CACA,GAAA0I,EAAAykI,UAAA,WAAAh7C,EAAAzpF,GAAA,CACA,GAAAqN,KAMA,OALA3lB,GAAAsY,EAAA5Y,QAAA,SAAAonC,GACAA,EAAA7mB,UACA0F,EAAArd,KAAAw+B,EAAAl3B,OAAAk3B,EAAA3jC,QAGA,IAAAwiB,EAAA5hB,OAAA,KAAA4hB,EAEA,MAAArN,GAAA1I,MAEA0I,EAAA1I,MAAAA,GAGA5O,KAAA,SAAAsX,EAAA1I,GACA,MAAAkxF,GAAAlxF,GACA0I,EAAAxZ,WAEAk2G,GAAA18F,GAAA,QACAA,EAAAxZ,UAAA8Q,KAGAlL,MAAAgyG,IACA,SAAA3iG,EAAA+F,GAIA4tF,GAAA5kF,UAAAhJ,GAAA,SAAAmjH,EAAAC,GACA,GAAAjzH,GAAA2R,EACAohI,EAAAh7I,KAAA+B,MAKA,IAAAgQ,IAAA2iG,KACA,GAAA3iG,EAAAhQ,QAAAgQ,IAAAiiG,IAAAjiG,IAAAuiG,GAAA2mB,EAAAC,KAAAr7H,EAAA,CACA,GAAAy+F,EAAA28B,GAAA,CAGA,IAAAhzH,EAAA,EAAAA,EAAA+yI,EAAA/yI,IACA,GAAA8J,IAAA6hG,GAEA7hG,EAAA/R,KAAAiI,GAAAgzH,OAEA,KAAArhH,IAAAqhH,GACAlpH,EAAA/R,KAAAiI,GAAA2R,EAAAqhH,EAAArhH,GAKA,OAAA5Z,MAOA,IAAA,GAHA4N,GAAAmE,EAAA+oI,IAEAv8C,EAAA3wF,IAAA/N,EAAAiB,KAAAo8C,IAAA89F,EAAA,GAAAA,EACAplI,EAAA,EAAAA,EAAA2oF,EAAA3oF,IAAA,CACA,GAAAof,GAAAjjB,EAAA/R,KAAA4V,GAAAqlH,EAAAC,EACAttH,GAAAA,EAAAA,EAAAonB,EAAAA,EAEA,MAAApnB,GAIA,IAAA3F,EAAA,EAAAA,EAAA+yI,EAAA/yI,IACA8J,EAAA/R,KAAAiI,GAAAgzH,EAAAC,EAGA,OAAAl7H,SA2DAhC,GACA6+B,WAAAq2E,GAEAthG,GAAA,QAAAqpI,IAAA3kI,EAAA1N,EAAAmJ,EAAAshG,GACA,GAAAtU,EAAAsU,GAAA,KAAAR,IAAA,SAAA,wEAGA,IAAAX,GAAA57F,GAAA,CAIA,GAAAg9F,GAAAC,GAAAj9F,GAAA,GACAiH,EAAA+1F,EAAA/1F,OACAC,EAAA81F,EAAA91F,MAEAA,KACAA,EAAA81F,EAAA91F,OAAA23F,GAAA7+F,EAAAiH,GAOA,KAHA,GAAAvU,GAAAJ,EAAA7I,QAAA,MAAA,EAAA6I,EAAA9C,MAAA,MAAA8C,GACAX,EAAAe,EAAAjH,OAEAkG,KAAA,CACAW,EAAAI,EAAAf,EACA,IAAAotG,GAAA93F,EAAA3U,EAEAysG,KACA93F,EAAA3U,MAEA,eAAAA,GAAA,eAAAA,EAKAqyI,GAAA3kI,EAAAqkI,GAAA/xI,GAAA,SAAA6Q,GACA,GAAArb,GAAA4B,KAAAujC,EAAA9pB,EAAA6oB,aAGAiB,KAAAA,IAAAnlC,GAAAA,EAAAqtB,SAAA8X,KACA/lB,EAAA/D,EAAA7Q,KAKA,aAAAA,GACAupH,GAAA77G,EAAA1N,EAAA4U,GAGA63F,EAAA93F,EAAA3U,IAEAysG,EAAA/uG,KAAAyL,MAIAqqB,IAAAg3E,GAEApvE,IAAA,SAAA1tB,EAAA1N,EAAAmJ,GACAuE,EAAA8rF,GAAA9rF,GAKAA,EAAA1E,GAAAhJ,EAAA,QAAAsyI,KACA5kI,EAAA8lB,IAAAxzB,EAAAmJ,GACAuE,EAAA8lB,IAAAxzB,EAAAsyI,KAEA5kI,EAAA1E,GAAAhJ,EAAAmJ,IAGA80B,YAAA,SAAAvwB,EAAA6kI,GACA,GAAA56I,GAAAa,EAAAkV,EAAAhR,UACA0tG,IAAA18F,GACAtY,EAAA,GAAA0nG,IAAAy1C,GAAA,SAAA/nH,GACA7yB,EACAa,EAAArE,aAAAq2B,EAAA7yB,EAAAwsB,aAEA3rB,EAAA0lC,aAAA1T,EAAA9c,GAEA/V,EAAA6yB,KAIA2F,SAAA,SAAAziB,GACA,GAAAyiB,KAMA,OALA/6B,GAAAsY,EAAAtZ,WAAA,SAAAsZ,GACAA,EAAApD,WAAAqqF,IACAxkE,EAAAzyB,KAAAgQ,KAGAyiB,GAGArS,SAAA,SAAApQ,GACA,MAAAA,GAAAmI,iBAAAnI,EAAAtZ,gBAGAwF,OAAA,SAAA8T,EAAA8c,GACA,GAAAlgB,GAAAoD,EAAApD,QACA,IAAAA,IAAAqqF,IAAArqF,IAAAshG,GAAA,CAEAphF,EAAA,GAAAsyE,IAAAtyE,EAEA,KAAA,GAAAnrB,GAAA,EAAAo2F,EAAAjrE,EAAArxB,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA,GAAA48H,GAAAzxG,EAAAnrB,EACAqO,GAAArS,YAAA4gI,MAIAn+F,QAAA,SAAApwB,EAAA8c,GACA,GAAA9c,EAAApD,WAAAqqF,GAAA,CACA,GAAAh9F,GAAA+V,EAAApS,UACAlG,GAAA,GAAA0nG,IAAAtyE,GAAA,SAAAyxG,GACAvuH,EAAAvZ,aAAA8nI,EAAAtkI,OAKA8lC,KAAA,SAAA/vB,EAAA8kI;AACAA,EAAAh5C,GAAAg5C,GAAA5xH,GAAA,GAAArnB,QAAA,EACA,IAAAf,GAAAkV,EAAAhR,UACAlE,IACAA,EAAA0lC,aAAAs0G,EAAA9kI,GAEA8kI,EAAAn3I,YAAAqS,IAGA7X,OAAAk2G,GAEAt7F,OAAA,SAAA/C,GACAq+F,GAAAr+F,GAAA,IAGA7U,MAAA,SAAA6U,EAAA+kI,GACA,GAAA96I,GAAA+V,EAAAlV,EAAAkV,EAAAhR,UACA+1I,GAAA,GAAA31C,IAAA21C,EAEA,KAAA,GAAApzI,GAAA,EAAAo2F,EAAAg9C,EAAAt5I,OAAAkG,EAAAo2F,EAAAp2F,IAAA,CACA,GAAAmrB,GAAAioH,EAAApzI,EACA7G,GAAArE,aAAAq2B,EAAA7yB,EAAAwsB,aACAxsB,EAAA6yB,IAIAhzB,SAAAg0G,GACAj0G,YAAA8zG,GAEAvkE,YAAA,SAAAp5B,EAAAmS,EAAAzJ,GACAyJ,GACAzqB,EAAAyqB,EAAA3iB,MAAA,KAAA,SAAA3J,GACA,GAAAm/I,GAAAt8H,CACA8/E,GAAAw8C,KACAA,GAAAtnC,GAAA19F,EAAAna,KAEAm/I,EAAAlnC,GAAAH,IAAA39F,EAAAna,MAKAiF,OAAA,SAAAkV,GACA,GAAAlV,GAAAkV,EAAAhR,UACA,OAAAlE,IAAAA,EAAA8R,WAAAshG,GAAApzG,EAAA,MAGA43B,KAAA,SAAA1iB,GACA,MAAAA,GAAAnX,oBAGAe,KAAA,SAAAoW,EAAAmS,GACA,MAAAnS,GAAAtP,qBACAsP,EAAAtP,qBAAAyhB,OAMAtmB,MAAA4wG,GAEA52E,eAAA,SAAA7lB,EAAAmD,EAAA8hI,GAEA,GAAAC,GAAAC,EAAAC,EACAx9G,EAAAzkB,EAAA7Q,MAAA6Q,EACA65F,EAAAC,GAAAj9F,GACAiH,EAAA+1F,GAAAA,EAAA/1F,OACA83F,EAAA93F,GAAAA,EAAA2gB,EAEAm3E,KAEAmmC,GACAj7G,eAAA,WAAAvgC,KAAA+iC,kBAAA,GACAvC,mBAAA,WAAA,MAAAxgC,MAAA+iC,oBAAA,GACAG,yBAAA,WAAAljC,KAAAu1G,6BAAA,GACAx0E,8BAAA,WAAA,MAAA/gC,MAAAu1G,+BAAA,GACAv0E,gBAAAvwB,EACA7H,KAAAs1B,EACA9/B,OAAAkY,GAIAmD,EAAA7Q,OACA4yI,EAAA3gI,EAAA2gI,EAAA/hI,IAIAgiI,EAAAh7C,EAAA4U,GACAqmC,EAAAH,GAAAC,GAAAvgI,OAAAsgI,IAAAC,GAEAx9I,EAAAy9I,EAAA,SAAA1pI,GACAypI,EAAAz6G,iCACAhvB,EAAA+C,MAAAwB,EAAAolI,QAKA,SAAA3pI,EAAA+F,GAIA4tF,GAAA5kF,UAAAhJ,GAAA,SAAAmjH,EAAAC,EAAAygB,GAGA,IAAA,GAFA/tI,GAEA3F,EAAA,EAAAo2F,EAAAr+F,KAAA+B,OAAAkG,EAAAo2F,EAAAp2F,IACA62F,EAAAlxF,IACAA,EAAAmE,EAAA/R,KAAAiI,GAAAgzH,EAAAC,EAAAygB,GACA58C,EAAAnxF,KAEAA,EAAAw0F,GAAAx0F,KAGAklG,GAAAllG,EAAAmE,EAAA/R,KAAAiI,GAAAgzH,EAAAC,EAAAygB,GAGA,OAAA58C,GAAAnxF,GAAAA,EAAA5N,MAIA0lG,GAAA5kF,UAAAmvB,KAAAy1D,GAAA5kF,UAAAlP,GACA8zF,GAAA5kF,UAAAovB,OAAAw1D,GAAA5kF,UAAAsb,MAoEAy5E,GAAA/0F,WAMAi1F,IAAA,SAAAn8F,EAAAhM,GACA5N,KAAA01G,GAAA97F,EAAA5Z,KAAA89F,UAAAlwF,GAOAmR,IAAA,SAAAnF,GACA,MAAA5Z,MAAA01G,GAAA97F,EAAA5Z,KAAA89F,WAOAr/F,OAAA,SAAAmb,GACA,GAAAhM,GAAA5N,KAAA4Z,EAAA87F,GAAA97F,EAAA5Z,KAAA89F,SAEA,cADA99F,MAAA4Z,GACAhM,GAIA,IAAA6jG,KAAA,WACAzxG,KAAAy1G,MAAA,WACA,MAAAI,QAkEAM,GAAA,qCACAI,GAAA,IACAC,GAAA,uBACAN,GAAA,mCACA3P,GAAAxJ,EAAA,YA8wBA+G,IAAAyU,WAAAnC,EAiRA,IAAAwlC,IAAA7+C,EAAA,YACAyc,GAAA,EACAqiC,GAAA,aAmDAhuC,GAAA,WACA7tG,KAAAy1G,MAAA,KAAA,QAAA,SAAA3F,EAAAoB,GACA,QAAA4qC,MAiBA,MAhBAA,GAAAhzH,IAAArY,EACAqrI,EAAAzrB,MAAA5/G,EACAqrI,EAAAh7H,WACAF,IAAAnQ,EACAkrG,OAAAlrG,EACAumF,OAAAvmF,EACAm6C,MAAAn6C,EACA6D,SAAA7D,EACAqqB,KAAA,SAAAihH,EAAA72H,GACA,MAAA4qF,GAAA,SAAA30E,GACA+1E,EAAA,WACA/1E,QAEAL,KAAAihH,EAAA72H,KAGA42H,KAMAnuC,GAAA,WACA,GAAAq5B,GAAA,GAAAnxB,IACAmmC,IAEAh8I,MAAAy1G,MAAA,kBAAA,aACA,SAAA7H,EAAAgC,GAsBA,QAAAqsC,GAAA3lI,EAAAmH,EAAAhf,GACA,GAAAwB,GAAA+mI,EAAAjoH,IAAAzI,EAGArW,KACA+mI,EAAAjxB,IAAAz/F,EAAArW,MACA+7I,EAAA11I,KAAAgQ,IAGAmH,GACAzf,EAAAyf,EAAA3X,MAAA,KAAA,SAAA3J,GACAA,IACA8D,EAAA9D,IAAA,KAKAsC,GACAT,EAAAS,EAAAqH,MAAA,KAAA,SAAA3J,GACAA,IACA8D,EAAA9D,IAAA,KAKA6/I,EAAAj6I,OAAA,GAEA6tG,EAAAyvB,aAAA,WACArhI,EAAAg+I,EAAA,SAAA1lI,GACA,GAAArW,GAAA+mI,EAAAjoH,IAAAzI,EACA,IAAArW,EAAA,CACA,GAAAi8I,GAAAziC,GAAAnjG,EAAA7V,KAAA,UACAwqH,EAAA,GACAE,EAAA,EACAntH,GAAAiC,EAAA,SAAA6yC,EAAA32C,GACA,GAAA0zC,KAAAqsG,EAAA//I,EACA22C,KAAAjD,IACAiD,EACAm4E,IAAAA,EAAAlpH,OAAA,IAAA,IAAA5F,EAEAgvH,IAAAA,EAAAppH,OAAA,IAAA,IAAA5F,KAKA6B,EAAAsY,EAAA,SAAA6iG,GACA8R,GAAA7W,GAAA+E,EAAA8R,GACAE,GAAAlX,GAAAkF,EAAAgS,KAEA6b,EAAAvoI,OAAA6X,MAIA0lI,EAAAj6I,OAAA,IA1EA,OACAg1B,QAAAtmB,EACAmB,GAAAnB,EACA2rB,IAAA3rB,EACA0rI,IAAA1rI,EAEAnK,KAAA,SAAAgQ,EAAAmD,EAAA/b,EAAA0+I,GAWA,MAVAA,IAAAA,IAEA1+I,EAAAA,MACAA,EAAAyrF,MAAA7yE,EAAAlU,IAAA1E,EAAAyrF,MACAzrF,EAAAquC,IAAAz1B,EAAAlU,IAAA1E,EAAAquC,KAEAruC,EAAA0C,UAAA1C,EAAAyC,cACA87I,EAAA3lI,EAAA5Y,EAAA0C,SAAA1C,EAAAyC,aAGA,GAAAytG,QA2EAH,IAAA,WAAA,SAAA9J,GACA,GAAAiD,GAAA5mG,IAEAA,MAAAq8I,uBAAA71I,OAAAk2E,OAAA,MAyCA18E,KAAA4sH,SAAA,SAAA90G,EAAA3U,GACA,GAAA2U,GAAA,MAAAA,EAAArJ,OAAA,GACA,KAAAmtI,IAAA,UAAA,wDAAA9jI,EAGA,IAAA8B,GAAA9B,EAAA,YACA8uF,GAAAy1C,uBAAAvkI,EAAA7D,OAAA,IAAA2F,EACA+pF,EAAAxgG,QAAAyW,EAAAzW,IAiBAnD,KAAAs8I,gBAAA,SAAAvvB,GACA,GAAA,IAAAx6G,UAAAxQ,SACA/B,KAAAu8I,kBAAAxvB,YAAA5lH,QAAA4lH,EAAA,KACA/sH,KAAAu8I,mBAAA,CACA,GAAAC,GAAA,GAAAr1I,QAAA,aAAA00I,GAAA,aACA,IAAAW,EAAAj3I,KAAAvF,KAAAu8I,kBAAAl0H,YACA,KAAAuzH,IAAA,UAAA,wHAAAC,IAKA,MAAA77I,MAAAu8I,mBAGAv8I,KAAAy1G,MAAA,iBAAA,SAAA/H,GACA,QAAA+uC,GAAAnmI,EAAA/X,EAAAm+I,GAIA,GAAAA,EAAA,CACA,GAAAC,GAAApjC,GAAAmjC,IACAC,GAAAA,EAAAr3I,YAAAq3I,EAAAC,yBACAF,EAAA,MAGAA,EAAAA,EAAAj7I,MAAA6U,GAAA/X,EAAAmoC,QAAApwB,GAsBA,OA8BA1E,GAAA87F,EAAA97F,GA0BAwqB,IAAAsxE,EAAAtxE,IAkBA+/G,IAAAzuC,EAAAyuC,IA+BAplH,QAAA22E,EAAA32E,QAUA4kF,OAAA,SAAAkhC,GACAA,EAAAj8H,KAAAi8H,EAAAj8H,OAqBA2vC,MAAA,SAAAj6C,EAAAlV,EAAAK,EAAA/D,GAKA,MAJA0D,GAAAA,GAAAghG,GAAAhhG,GACAK,EAAAA,GAAA2gG,GAAA3gG,GACAL,EAAAA,GAAAK,EAAAL,SACAq7I,EAAAnmI,EAAAlV,EAAAK,GACAisG,EAAApnG,KAAAgQ,EAAA,QAAAqjG,GAAAj8G,KAqBAi1E,KAAA,SAAAr8D,EAAAlV,EAAAK,EAAA/D,GAKA,MAJA0D,GAAAA,GAAAghG,GAAAhhG,GACAK,EAAAA,GAAA2gG,GAAA3gG,GACAL,EAAAA,GAAAK,EAAAL,SACAq7I,EAAAnmI,EAAAlV,EAAAK,GACAisG,EAAApnG,KAAAgQ,EAAA,OAAAqjG,GAAAj8G,KAgBA8yD,MAAA,SAAAl6C,EAAA5Y,GACA,MAAAgwG,GAAApnG,KAAAgQ,EAAA,QAAAqjG,GAAAj8G,GAAA,WACA4Y,EAAA7X,YAsBA2B,SAAA,SAAAkW,EAAAna,EAAAuB,GAGA,MAFAA,GAAAi8G,GAAAj8G,GACAA,EAAA0C,SAAAk5G,GAAA57G,EAAAo/I,SAAA3gJ,GACAuxG,EAAApnG,KAAAgQ,EAAA,WAAA5Y,IAqBAyC,YAAA,SAAAmW,EAAAna,EAAAuB,GAGA,MAFAA,GAAAi8G,GAAAj8G,GACAA,EAAAyC,YAAAm5G,GAAA57G,EAAAyC,YAAAhE,GACAuxG,EAAApnG,KAAAgQ,EAAA,cAAA5Y,IAsBAk2I,SAAA,SAAAt9H,EAAAmH,EAAAhf,EAAAf,GAIA,MAHAA,GAAAi8G,GAAAj8G,GACAA,EAAA0C,SAAAk5G,GAAA57G,EAAA0C,SAAAqd,GACA/f,EAAAyC,YAAAm5G,GAAA57G,EAAAyC,YAAA1B,GACAivG,EAAApnG,KAAAgQ,EAAA,WAAA5Y,IAwBAsuC,QAAA,SAAA11B,EAAA6yE,EAAAp9C,EAAA5vC,EAAAuB,GAOA,MANAA,GAAAi8G,GAAAj8G,GACAA,EAAAyrF,KAAAzrF,EAAAyrF,KAAAtuE,EAAAnd,EAAAyrF,KAAAA,GAAAA,EACAzrF,EAAAquC,GAAAruC,EAAAquC,GAAAlxB,EAAAnd,EAAAquC,GAAAA,GAAAA,EAEA5vC,EAAAA,GAAA,oBACAuB,EAAAq/I,YAAAzjC,GAAA57G,EAAAq/I,YAAA5gJ,GACAuxG,EAAApnG,KAAAgQ,EAAA,UAAA5Y,SA48CAy/G,GAAApgB,EAAA,WAQA2L,IAAA2N,SAAA,WAAA,wBAm5DA,IAAAmM,IAAA,wBAsGAwK,GAAAjwB,EAAA,eAGA2vB,GAAA,0BAuPAiB,GAAA,mBACAiB,IAAAouB,eAAArvB,GAAA,kBACAG,GAAA,gBACAC,IACAkvB,IAAA,KACAC,IAAA,MAEAxvB,GAAA,eAi7CAuF,GAAA7uB,GAAA6uB,mBAAAl2B,EAAA,eACAk2B,IAAAS,cAAA,SAAAvyH,GACA,KAAA8xH,IAAA,WACA,yMAEA9xH,IAGA8xH,GAAAC,OAAA,SAAA/xH,EAAAsa,GACA,MAAAw3G,IAAA,SAAA,8BAAA9xH,EAAAsa,EAAA4M,YAmmBA,IAAA80H,IAAA,kCACApmB,IAAAqmB,KAAA,GAAAC,MAAA,IAAAC,IAAA,IACAnlB,GAAAp7B,EAAA,aAkUAwgD,IAMAxlB,SAAA,EAMA0C,WAAA,EAqBAT,OAAAZ,GAAA,YAuBArzH,IAAA,SAAAA,GACA,GAAA+4F,EAAA/4F,GACA,MAAA/F,MAAAq4H,KAGA,IAAAvxH,GAAAq2I,GAAAhwI,KAAApH,EAKA,QAJAe,EAAA,IAAA,KAAAf,IAAA/F,KAAAgsE,KAAAX,mBAAAvkE,EAAA,MACAA,EAAA,IAAAA,EAAA,IAAA,KAAAf,IAAA/F,KAAA0zE,OAAA5sE,EAAA,IAAA,IACA9G,KAAA22B,KAAA7vB,EAAA,IAAA,IAEA9G,MAqBAwyH,SAAA4G,GAAA,cA4BA3kB,KAAA2kB,GAAA,UAoBAj2E,KAAAi2E,GAAA,UA0BAptD,KAAAqtD,GAAA,SAAA,SAAArtD,GAEA,MADAA,GAAA,OAAAA,EAAAA,EAAA3jD,WAAA,GACA,KAAA2jD,EAAAv9D,OAAA,GAAAu9D,EAAA,IAAAA,IAgDA0H,OAAA,SAAAA,EAAA8pE,GACA,OAAAjrI,UAAAxQ,QACA,IAAA,GACA,MAAA/B,MAAAo3H,QACA,KAAA,GACA,GAAA55B,EAAA9pB,IAAAurB,EAAAvrB,GACAA,EAAAA,EAAArrD,WACAroB,KAAAo3H,SAAA50B,GAAA9uB,OACA,CAAA,IAAA4qB,EAAA5qB,GASA,KAAAykD,IAAA,WACA,qFATAzkD,GAAAhqD,EAAAgqD,MAEA11E,EAAA01E,EAAA,SAAA9lE,EAAAgM,GACA,MAAAhM,SAAA8lE,GAAA95D,KAGA5Z,KAAAo3H,SAAA1jD,EAKA,KACA,SACAorB,EAAA0+C,IAAA,OAAAA,QACAx9I,MAAAo3H,SAAA1jD,GAEA1zE,KAAAo3H,SAAA1jD,GAAA8pE,EAKA,MADAx9I,MAAAo4H,YACAp4H,MAwBA22B,KAAA0iG,GAAA,SAAA,SAAA1iG,GACA,MAAA,QAAAA,EAAAA,EAAAtO,WAAA,KAWAplB,QAAA,WAEA,MADAjD,MAAAy6H,WAAA,EACAz6H,MAIAhC,IAAAm7H,GAAAP,GAAAhB,IAAA,SAAA6lB,GACAA,EAAA38H,UAAAta,OAAAk2E,OAAA6gE,IAqBAE,EAAA38H,UAAAtS,MAAA,SAAAA,GACA,IAAA+D,UAAAxQ,OACA,MAAA/B,MAAA65H,OAGA,IAAA4jB,IAAA7lB,KAAA53H,KAAA+3H,QACA,KAAAI,IAAA,UAAA,8GAQA,OAFAn4H,MAAA65H,QAAA/6B,EAAAtwF,GAAA,KAAAA,EAEAxO,OAigBA,IAAAq7H,IAAAt+B,EAAA,UAgEAy+B,GAAA7oH,SAAAmO,UAAA1jB,KACAq+H,GAAA9oH,SAAAmO,UAAAhM,MACA4mH,GAAA/oH,SAAAmO,UAAAmvB,KAgBAytG,GAAA18C,IACAhjG,GAAA,gDAAA8H,MAAA,KAAA,SAAA6vB,GAAA+nH,GAAA/nH,IAAA,GACA,IAAAmhC,KAAA59B,EAAA,KAAAszC,EAAA,KAAArzC,EAAA,KAAAuF,EAAA,KAAA9W,EAAA,OAAAggE,IAAA,IAAAD,IAAA,KASA04C,GAAA,SAAA3iI,GACAsC,KAAAtC,QAAAA,EAGA2iI,IAAAv/G,WACAmI,YAAAo3G,GAEAsd,IAAA,SAAAx8I,GAKA,IAJAnB,KAAAmB,KAAAA,EACAnB,KAAAO,MAAA,EACAP,KAAAstB,UAEAttB,KAAAO,MAAAP,KAAAmB,KAAAY,QAAA,CACA,GAAA2wH,GAAA1yH,KAAAmB,KAAAsN,OAAAzO,KAAAO,MACA,IAAA,MAAAmyH,GAAA,MAAAA,EACA1yH,KAAA49I,WAAAlrB,OACA,IAAA1yH,KAAAi/F,SAAAyzB,IAAA,MAAAA,GAAA1yH,KAAAi/F,SAAAj/F,KAAA69I,QACA79I,KAAA89I,iBACA,IAAA99I,KAAA+9I,QAAArrB,GACA1yH,KAAAg+I,gBACA,IAAAh+I,KAAA04B,GAAAg6F,EAAA,eACA1yH,KAAAstB,OAAAhnB,MAAA/F,MAAAP,KAAAO,MAAAY,KAAAuxH,IACA1yH,KAAAO,YACA,IAAAP,KAAAi+I,aAAAvrB,GACA1yH,KAAAO,YACA,CACA,GAAA29I,GAAAxrB,EAAA1yH,KAAA69I,OACAM,EAAAD,EAAAl+I,KAAA69I,KAAA,GACAO,EAAAV,GAAAhrB,GACA2rB,EAAAX,GAAAQ,GACAI,EAAAZ,GAAAS,EACA,IAAAC,GAAAC,GAAAC,EAAA,CACA,GAAApmH,GAAAomH,EAAAH,EAAAE,EAAAH,EAAAxrB,CACA1yH,MAAAstB,OAAAhnB,MAAA/F,MAAAP,KAAAO,MAAAY,KAAA+2B,EAAAvC,UAAA,IACA31B,KAAAO,OAAA23B,EAAAn2B,WAEA/B,MAAAu+I,WAAA,6BAAAv+I,KAAAO,MAAAP,KAAAO,MAAA,IAIA,MAAAP,MAAAstB,QAGAoL,GAAA,SAAAg6F,EAAAxlH,GACA,MAAAA,GAAAnN,QAAA2yH,SAGAmrB,KAAA,SAAA51I,GACA,GAAAkhB,GAAAlhB,GAAA,CACA,OAAAjI,MAAAO,MAAA4oB,EAAAnpB,KAAAmB,KAAAY,QAAA/B,KAAAmB,KAAAsN,OAAAzO,KAAAO,MAAA4oB,IAGA81E,SAAA,SAAAyzB,GACA,MAAA,KAAAA,GAAAA,GAAA,KAAA,gBAAAA,IAGAurB,aAAA,SAAAvrB,GAEA,MAAA,MAAAA,GAAA,OAAAA,GAAA,OAAAA,GACA,OAAAA,GAAA,SAAAA,GAAA,MAAAA,GAGAqrB,QAAA,SAAArrB,GACA,MAAA,KAAAA,GAAAA,GAAA,KACA,KAAAA,GAAAA,GAAA,KACA,MAAAA,GAAA,MAAAA,GAGA8rB,cAAA,SAAA9rB,GACA,MAAA,MAAAA,GAAA,MAAAA,GAAA1yH,KAAAi/F,SAAAyzB,IAGA6rB,WAAA,SAAA/2H,EAAApE,EAAAxC,GACAA,EAAAA,GAAA5gB,KAAAO,KACA,IAAAk+I,GAAA1/C,EAAA37E,GACA,KAAAA,EAAA,IAAApjB,KAAAO,MAAA,KAAAP,KAAAmB,KAAAiM,UAAAgW,EAAAxC,GAAA,IACA,IAAAA,CACA,MAAAy6G,IAAA,SAAA,qDACA7zG,EAAAi3H,EAAAz+I,KAAAmB,OAGA28I,WAAA,WAGA,IAFA,GAAAnhG,GAAA,GACAv5B,EAAApjB,KAAAO,MACAP,KAAAO,MAAAP,KAAAmB,KAAAY,QAAA,CACA,GAAA2wH,GAAA1yB,GAAAhgG,KAAAmB,KAAAsN,OAAAzO,KAAAO,OACA,IAAA,KAAAmyH,GAAA1yH,KAAAi/F,SAAAyzB,GACA/1E,GAAA+1E,MACA,CACA,GAAAgsB,GAAA1+I,KAAA69I,MACA,IAAA,KAAAnrB,GAAA1yH,KAAAw+I,cAAAE,GACA/hG,GAAA+1E,MACA,IAAA1yH,KAAAw+I,cAAA9rB,IACAgsB,GAAA1+I,KAAAi/F,SAAAy/C,IACA,KAAA/hG,EAAAluC,OAAAkuC,EAAA56C,OAAA,GACA46C,GAAA+1E,MACA,CAAA,IAAA1yH,KAAAw+I,cAAA9rB,IACAgsB,GAAA1+I,KAAAi/F,SAAAy/C,IACA,KAAA/hG,EAAAluC,OAAAkuC,EAAA56C,OAAA,GAGA,KAFA/B,MAAAu+I,WAAA,qBAKAv+I,KAAAO,QAEAP,KAAAstB,OAAAhnB,MACA/F,MAAA6iB,EACAjiB,KAAAw7C,EACA+qD,UAAA,EACA95F,MAAAs0C,OAAAvF,MAIAqhG,UAAA,WAEA,IADA,GAAA56H,GAAApjB,KAAAO,MACAP,KAAAO,MAAAP,KAAAmB,KAAAY,QAAA,CACA,GAAA2wH,GAAA1yH,KAAAmB,KAAAsN,OAAAzO,KAAAO,MACA,KAAAP,KAAA+9I,QAAArrB,KAAA1yH,KAAAi/F,SAAAyzB,GACA,KAEA1yH,MAAAO,QAEAP,KAAAstB,OAAAhnB,MACA/F,MAAA6iB,EACAjiB,KAAAnB,KAAAmB,KAAAhE,MAAAimB,EAAApjB,KAAAO,OACA+wB,YAAA,KAIAssH,WAAA,SAAAe,GACA,GAAAv7H,GAAApjB,KAAAO,KACAP,MAAAO,OAIA,KAHA,GAAAiS,GAAA,GACAosI,EAAAD,EACArwF,GAAA,EACAtuD,KAAAO,MAAAP,KAAAmB,KAAAY,QAAA,CACA,GAAA2wH,GAAA1yH,KAAAmB,KAAAsN,OAAAzO,KAAAO,MAEA,IADAq+I,GAAAlsB,EACApkE,EAAA,CACA,GAAA,MAAAokE,EAAA,CACA,GAAAmsB,GAAA7+I,KAAAmB,KAAAiM,UAAApN,KAAAO,MAAA,EAAAP,KAAAO,MAAA,EACAs+I,GAAA/3I,MAAA,gBACA9G,KAAAu+I,WAAA,8BAAAM,EAAA,KAEA7+I,KAAAO,OAAA,EACAiS,GAAAwgB,OAAAC,aAAAhyB,SAAA49I,EAAA,SACA,CACA,GAAAC,GAAAhoF,GAAA47D,EACAlgH,IAAAssI,GAAApsB,EAEApkE,GAAA,MACA,IAAA,OAAAokE,EACApkE,GAAA,MACA,CAAA,GAAAokE,IAAAisB,EAQA,MAPA3+I,MAAAO,YACAP,MAAAstB,OAAAhnB,MACA/F,MAAA6iB,EACAjiB,KAAAy9I,EACAl3C,UAAA,EACA95F,MAAA4E,GAIAA,IAAAkgH,EAEA1yH,KAAAO,QAEAP,KAAAu+I,WAAA,qBAAAn7H,IAIA,IAAA+4G,IAAA,SAAAiE,EAAA1iI,GACAsC,KAAAogI,MAAAA,EACApgI,KAAAtC,QAAAA,EAGAy+H,IAAAC,QAAA,UACAD,GAAA4iB,oBAAA,sBACA5iB,GAAAc,qBAAA,uBACAd,GAAAO,sBAAA,wBACAP,GAAAM,kBAAA,oBACAN,GAAAK,iBAAA,mBACAL,GAAAI,gBAAA,kBACAJ,GAAAY,eAAA,iBACAZ,GAAAW,iBAAA,mBACAX,GAAAU,WAAA,aACAV,GAAAE,QAAA,UACAF,GAAAe,gBAAA,kBACAf,GAAA6iB,SAAA,WACA7iB,GAAAgB,iBAAA,mBACAhB,GAAAiB,eAAA,iBAGAjB,GAAAsB,iBAAA,mBAEAtB,GAAAr7G,WACAk7G,IAAA,SAAA76H,GACAnB,KAAAmB,KAAAA,EACAnB,KAAAstB,OAAAttB,KAAAogI,MAAAud,IAAAx8I,EAEA,IAAAyM,GAAA5N,KAAAi/I,SAMA,OAJA,KAAAj/I,KAAAstB,OAAAvrB,QACA/B,KAAAu+I,WAAA,yBAAAv+I,KAAAstB,OAAA,IAGA1f,GAGAqxI,QAAA,WAEA,IADA,GAAAz/I,QAIA,GAFAQ,KAAAstB,OAAAvrB,OAAA,IAAA/B,KAAA69I,KAAA,IAAA,IAAA,IAAA,MACAr+I,EAAA8G,KAAAtG,KAAAk/I,wBACAl/I,KAAAm/I,OAAA,KACA,OAAAv2I,KAAAuzH,GAAAC,QAAA58H,KAAAA,IAKA0/I,oBAAA,WACA,OAAAt2I,KAAAuzH,GAAA4iB,oBAAAhyB,WAAA/sH,KAAAo/I,gBAGAA,YAAA,WAGA,IAFA,GACAlnH,GADA8P,EAAAhoC,KAAA+sH,aAEA70F,EAAAl4B,KAAAm/I,OAAA,MACAn3G,EAAAhoC,KAAA2Y,OAAAqvB,EAEA,OAAAA,IAGA+kF,WAAA,WACA,MAAA/sH,MAAAq/I,cAGAA,WAAA,WACA,GAAA17H,GAAA3jB,KAAAs/I,SAIA,OAHAt/I,MAAAm/I,OAAA,OACAx7H,GAAA/a,KAAAuzH,GAAAc,qBAAAj1F,KAAArkB,EAAA4rC,MAAAvvD,KAAAq/I,aAAA1pH,SAAA,MAEAhS,GAGA27H,QAAA,WACA,GACA3iB,GACAC,EAFAr3H,EAAAvF,KAAAu/I,WAGA,OAAAv/I,MAAAm/I,OAAA,OACAxiB,EAAA38H,KAAA+sH,aACA/sH,KAAAw/I,QAAA,OACA5iB,EAAA58H,KAAA+sH,cACAnkH,KAAAuzH,GAAAO,sBAAAn3H,KAAAA,EAAAo3H,UAAAA,EAAAC,WAAAA,IAGAr3H,GAGAg6I,UAAA,WAEA,IADA,GAAAv3G,GAAAhoC,KAAAy/I,aACAz/I,KAAAm/I,OAAA,OACAn3G,GAAAp/B,KAAAuzH,GAAAM,kBAAA9mG,SAAA,KAAAqS,KAAAA,EAAAunB,MAAAvvD,KAAAy/I,aAEA,OAAAz3G,IAGAy3G,WAAA,WAEA,IADA,GAAAz3G,GAAAhoC,KAAA0/I,WACA1/I,KAAAm/I,OAAA,OACAn3G,GAAAp/B,KAAAuzH,GAAAM,kBAAA9mG,SAAA,KAAAqS,KAAAA,EAAAunB,MAAAvvD,KAAA0/I,WAEA,OAAA13G,IAGA03G,SAAA,WAGA,IAFA,GACAxnH,GADA8P,EAAAhoC,KAAA2/I,aAEAznH,EAAAl4B,KAAAm/I,OAAA,KAAA,KAAA,MAAA,QACAn3G,GAAAp/B,KAAAuzH,GAAAK,iBAAA7mG,SAAAuC,EAAA/2B,KAAA6mC,KAAAA,EAAAunB,MAAAvvD,KAAA2/I,aAEA,OAAA33G,IAGA23G,WAAA,WAGA,IAFA,GACAznH,GADA8P,EAAAhoC,KAAA4/I,WAEA1nH,EAAAl4B,KAAAm/I,OAAA,IAAA,IAAA,KAAA,OACAn3G,GAAAp/B,KAAAuzH,GAAAK,iBAAA7mG,SAAAuC,EAAA/2B,KAAA6mC,KAAAA,EAAAunB,MAAAvvD,KAAA4/I,WAEA,OAAA53G,IAGA43G,SAAA,WAGA,IAFA,GACA1nH,GADA8P,EAAAhoC,KAAA6/I,iBAEA3nH,EAAAl4B,KAAAm/I,OAAA,IAAA,MACAn3G,GAAAp/B,KAAAuzH,GAAAK,iBAAA7mG,SAAAuC,EAAA/2B,KAAA6mC,KAAAA,EAAAunB,MAAAvvD,KAAA6/I,iBAEA,OAAA73G,IAGA63G,eAAA,WAGA,IAFA,GACA3nH,GADA8P,EAAAhoC,KAAA8/I,QAEA5nH,EAAAl4B,KAAAm/I,OAAA,IAAA,IAAA,MACAn3G,GAAAp/B,KAAAuzH,GAAAK,iBAAA7mG,SAAAuC,EAAA/2B,KAAA6mC,KAAAA,EAAAunB,MAAAvvD,KAAA8/I,QAEA,OAAA93G,IAGA83G,MAAA,WACA,GAAA5nH,EACA,QAAAA,EAAAl4B,KAAAm/I,OAAA,IAAA,IAAA,OACAv2I,KAAAuzH,GAAAI,gBAAA5mG,SAAAuC,EAAA/2B,KAAAumB,QAAA,EAAAyF,SAAAntB,KAAA8/I,SAEA9/I,KAAA+/I,WAIAA,QAAA,WACA,GAAAA,EACA//I,MAAAm/I,OAAA,MACAY,EAAA//I,KAAAo/I,cACAp/I,KAAAw/I,QAAA,MACAx/I,KAAAm/I,OAAA,KACAY,EAAA//I,KAAAggJ,mBACAhgJ,KAAAm/I,OAAA,KACAY,EAAA//I,KAAAiZ,SACAjZ,KAAAigJ,UAAA13H,eAAAvoB,KAAA69I,OAAA18I,MACA4+I,EAAAr2H,EAAA1pB,KAAAigJ,UAAAjgJ,KAAAw/I,UAAAr+I,OACAnB,KAAA69I,OAAAvsH,WACAyuH,EAAA//I,KAAAsxB,aACAtxB,KAAA69I,OAAAn2C,SACAq4C,EAAA//I,KAAA0nG,WAEA1nG,KAAAu+I,WAAA,2BAAAv+I,KAAA69I,OAIA,KADA,GAAA7kH,GACAA,EAAAh5B,KAAAm/I,OAAA,IAAA,IAAA,MACA,MAAAnmH,EAAA73B,MACA4+I,GAAAn3I,KAAAuzH,GAAAY,eAAAC,OAAA+iB,EAAAxtI,UAAAvS,KAAAkgJ,kBACAlgJ,KAAAw/I,QAAA,MACA,MAAAxmH,EAAA73B,MACA4+I,GAAAn3I,KAAAuzH,GAAAW,iBAAA7jH,OAAA8mI,EAAAntD,SAAA5yF,KAAA+sH,aAAAplF,UAAA,GACA3nC,KAAAw/I,QAAA,MACA,MAAAxmH,EAAA73B,KACA4+I,GAAAn3I,KAAAuzH,GAAAW,iBAAA7jH,OAAA8mI,EAAAntD,SAAA5yF,KAAAsxB,aAAAqW,UAAA,GAEA3nC,KAAAu+I,WAAA,aAGA,OAAAwB,IAGApnI,OAAA,SAAAwnI,GAIA,IAHA,GAAA7tI,IAAA6tI,GACAx8H,GAAA/a,KAAAuzH,GAAAY,eAAAC,OAAAh9H,KAAAsxB,aAAA/e,UAAAD,EAAAqG,QAAA,GAEA3Y,KAAAm/I,OAAA,MACA7sI,EAAAhM,KAAAtG,KAAA+sH,aAGA,OAAAppG,IAGAu8H,eAAA,WACA,GAAA5tI,KACA,IAAA,MAAAtS,KAAAogJ,YAAAj/I,KACA,EACAmR,GAAAhM,KAAAtG,KAAA+sH,oBACA/sH,KAAAm/I,OAAA,KAEA,OAAA7sI,IAGAgf,WAAA,WACA,GAAA4G,GAAAl4B,KAAAw/I,SAIA,OAHAtnH,GAAA5G,YACAtxB,KAAAu+I,WAAA,4BAAArmH,IAEAtvB,KAAAuzH,GAAAU,WAAA/kH,KAAAogB,EAAA/2B,OAGAumG,SAAA,WAEA,OAAA9+F,KAAAuzH,GAAAE,QAAAzuH,MAAA5N,KAAAw/I,UAAA5xI,QAGAoyI,iBAAA,WACA,GAAAhtI,KACA,IAAA,MAAAhT,KAAAogJ,YAAAj/I,KACA,EAAA,CACA,GAAAnB,KAAA69I,KAAA,KAEA,KAEA7qI,GAAA1M,KAAAtG,KAAA+sH,oBACA/sH,KAAAm/I,OAAA,KAIA,OAFAn/I,MAAAw/I,QAAA,MAEA52I,KAAAuzH,GAAAe,gBAAAlqH,SAAAA,IAGAiG,OAAA,WACA,GAAA25E,GAAAlvE,IACA,IAAA,MAAA1jB,KAAAogJ,YAAAj/I,KACA,EAAA,CACA,GAAAnB,KAAA69I,KAAA,KAEA,KAEAjrD,IAAAhqF,KAAAuzH,GAAA6iB,SAAAqB,KAAA,QACArgJ,KAAA69I,OAAAn2C,SACA9U,EAAAh5E,IAAA5Z,KAAA0nG,WACA1nG,KAAA69I,OAAAvsH,WACAshE,EAAAh5E,IAAA5Z,KAAAsxB,aAEAtxB,KAAAu+I,WAAA,cAAAv+I,KAAA69I,QAEA79I,KAAAw/I,QAAA,KACA5sD,EAAAhlF,MAAA5N,KAAA+sH,aACArpG,EAAApd,KAAAssF,SACA5yF,KAAAm/I,OAAA,KAIA,OAFAn/I,MAAAw/I,QAAA,MAEA52I,KAAAuzH,GAAAgB,iBAAAz5G,WAAAA,IAGA66H,WAAA,SAAAz0H,EAAAoO,GACA,KAAAmjG,IAAA,SACA,yFACAnjG,EAAA/2B,KAAA2oB,EAAAoO,EAAA33B,MAAA,EAAAP,KAAAmB,KAAAnB,KAAAmB,KAAAiM,UAAA8qB,EAAA33B,SAGAi/I,QAAA,SAAAc,GACA,GAAA,IAAAtgJ,KAAAstB,OAAAvrB,OACA,KAAAs5H,IAAA,OAAA,oCAAAr7H,KAAAmB,KAGA,IAAA+2B,GAAAl4B,KAAAm/I,OAAAmB,EAIA,OAHApoH,IACAl4B,KAAAu+I,WAAA,6BAAA+B,EAAA,IAAAtgJ,KAAA69I,QAEA3lH,GAGAkoH,UAAA,WACA,GAAA,IAAApgJ,KAAAstB,OAAAvrB,OACA,KAAAs5H,IAAA,OAAA,oCAAAr7H,KAAAmB,KAEA,OAAAnB,MAAAstB,OAAA,IAGAuwH,KAAA,SAAAyC,EAAAC,EAAAC,EAAAC,GACA,MAAAzgJ,MAAA0gJ,UAAA,EAAAJ,EAAAC,EAAAC,EAAAC,IAGAC,UAAA,SAAAz4I,EAAAq4I,EAAAC,EAAAC,EAAAC,GACA,GAAAzgJ,KAAAstB,OAAAvrB,OAAAkG,EAAA,CACA,GAAAiwB,GAAAl4B,KAAAstB,OAAArlB,GACAy2B,EAAAxG,EAAA/2B,IACA,IAAAu9B,IAAA4hH,GAAA5hH,IAAA6hH,GAAA7hH,IAAA8hH,GAAA9hH,IAAA+hH,IACAH,IAAAC,IAAAC,IAAAC,EACA,MAAAvoH,GAGA,OAAA,GAGAinH,OAAA,SAAAmB,EAAAC,EAAAC,EAAAC,GACA,GAAAvoH,GAAAl4B,KAAA69I,KAAAyC,EAAAC,EAAAC,EAAAC,EACA,SAAAvoH,IACAl4B,KAAAstB,OAAAtnB,QACAkyB,IASA+nH,WACAU,QAAA/3I,KAAAuzH,GAAAE,QAAAzuH,OAAA,GACAgzI,SAAAh4I,KAAAuzH,GAAAE,QAAAzuH,OAAA,GACAizI,QAAAj4I,KAAAuzH,GAAAE,QAAAzuH,MAAA,MACA/N,WAAA+I,KAAAuzH,GAAAE,QAAAzuH,MAAA/N,GACAG,QAAA4I,KAAAuzH,GAAAiB,kBA8JAQ,GAAA98G,WACA4P,QAAA,SAAAq8F,EAAAgT,GACA,GAAAtnG,GAAAz4B,KACAg8H,EAAAh8H,KAAA69H,WAAA7B,IAAAjP,EACA/sH,MAAAwO,OACAsyI,OAAA,EACAhpH,WACAioG,gBAAAA,EACAhuH,IAAAgvI,QAAAvhJ,QAAAwhJ,QACA33D,QAAA03D,QAAAvhJ,QAAAwhJ,QACAjiB,WAEAhD,GAAAC,EAAAvjG,EAAA+1E,QACA,IACAyyC,GADAnhI,EAAA,EAGA,IADA9f,KAAAg9E,MAAA,SACAikE,EAAAzjB,GAAAxB,GAAA,CACAh8H,KAAAwO,MAAA0yI,UAAA,QACA,IAAAv9H,GAAA3jB,KAAA8gJ,QACA9gJ,MAAAmhJ,QAAAF,EAAAt9H,GACA7D,EAAA,aAAA9f,KAAAohJ,iBAAA,SAAA,SAEA,GAAA9kB,GAAAe,GAAArB,EAAAx8H,KACAi5B,GAAAukD,MAAA,SACAh/E,EAAAs+H,EAAA,SAAAgK,EAAA1sH,GACA,GAAAynI,GAAA,KAAAznI,CACA6e,GAAAjqB,MAAA6yI,IAAAN,QAAAvhJ,QAAAwhJ,QACAvoH,EAAAjqB,MAAA0yI,UAAAG,CACA,IAAAC,GAAA7oH,EAAAqoH,QACAroH,GAAA0oH,QAAA7a,EAAAgb,GACA7oH,EAAA8oH,QAAAD,GACA7oH,EAAAjqB,MAAAuwH,OAAAz4H,KAAA+6I,GACA/a,EAAAkb,QAAA5nI,IAEA5Z,KAAAwO,MAAA0yI,UAAA,KACAlhJ,KAAAg9E,MAAA,OACAh9E,KAAAmhJ,QAAAnlB,EACA,IAAAylB,GAGA,IAAAzhJ,KAAA0hJ,IAAA,IAAA1hJ,KAAA2hJ,OAAA,OACA3hJ,KAAA4hJ,eACA,UAAA5hJ,KAAAohJ,iBAAA,KAAA,WACAthI,EACA9f,KAAA6hJ,WACA,aAGA9vI,EAAA,GAAAY,UAAA,UACA,uBACA,mBACA,qBACA,YACA,OACA,OACA8uI,GACAzhJ,KAAAwuG,QACA2sB,GACAG,GACAC,GACAI,GACAC,GACA7O,EAKA,OAHA/sH,MAAAwO,MAAAxO,KAAAg9E,MAAAn9E,EACAkS,EAAAszD,QAAAq4D,GAAA1B,GACAjqH,EAAA21F,SAAAi2B,GAAA3B,GACAjqH,GAGA2vI,IAAA,MAEAC,OAAA,SAEAE,SAAA,WACA,GAAAl+H,MACAoX,EAAA/6B,KAAAwO,MAAAuwH,OACAtmG,EAAAz4B,IAOA,OANAhC,GAAA+8B,EAAA,SAAAjjB,GACA6L,EAAArd,KAAA,OAAAwR,EAAA,IAAA2gB,EAAA2oH,iBAAAtpI,EAAA,QAEAijB,EAAAh5B,QACA4hB,EAAArd,KAAA,cAAAy0B,EAAA90B,KAAA,KAAA,MAEA0d,EAAA1d,KAAA,KAGAm7I,iBAAA,SAAAtpI,EAAAo/B,GACA,MAAA,YAAAA,EAAA,KACAl3C,KAAA8hJ,WAAAhqI,GACA9X,KAAAR,KAAAsY,GACA,MAGA8pI,aAAA,WACA,GAAAj3G,MACAlS,EAAAz4B,IAIA,OAHAhC,GAAAgC,KAAAwO,MAAAspB,QAAA,SAAA7yB,EAAA0T,GACAgyB,EAAArkC,KAAArB,EAAA,YAAAwzB,EAAA61B,OAAA31C,GAAA,OAEAgyB,EAAA5oC,OAAA,OAAA4oC,EAAA1kC,KAAA,KAAA,IACA,IAGA67I,WAAA,SAAAC,GACA,MAAA/hJ,MAAAwO,MAAAuzI,GAAAhB,KAAAh/I,OAAA,OAAA/B,KAAAwO,MAAAuzI,GAAAhB,KAAA96I,KAAA,KAAA,IAAA,IAGAzG,KAAA,SAAAuiJ,GACA,MAAA/hJ,MAAAwO,MAAAuzI,GAAAviJ,KAAAyG,KAAA,KAGAk7I,QAAA,SAAAnlB,EAAAslB,EAAAU,EAAAC,EAAAvlE,EAAAwlE,GACA,GAAAl6G,GAAAunB,EAAAj9C,EAAAy6G,EAAAt0F,EAAAz4B,IAEA,IADAiiJ,EAAAA,GAAAxxI,GACAyxI,GAAAnjD,EAAAi9B,EAAAwlB,SAMA,MALAF,GAAAA,GAAAthJ,KAAA8gJ,aACA9gJ,MAAAmiJ,IAAA,IACAniJ,KAAAoiJ,WAAAd,EAAAthJ,KAAAqiJ,eAAA,IAAArmB,EAAAwlB,UACAxhJ,KAAAsiJ,YAAAtmB,EAAAslB,EAAAU,EAAAC,EAAAvlE,GAAA,GAIA,QAAAs/C,EAAApzH,MACA,IAAAuzH,IAAAC,QACAp+H,EAAAg+H,EAAAx8H,KAAA,SAAAutH,EAAA1/G,GACAorB,EAAA0oH,QAAAp0B,EAAAA,WAAAltH,EAAAA,EAAA,SAAA60B,GAAA66B,EAAA76B,IACArnB,IAAA2uH,EAAAx8H,KAAAuC,OAAA,EACA02B,EAAAvR,UAAA1nB,KAAA8G,KAAAipD,EAAA,KAEA92B,EAAA8oH,QAAAhyF,IAGA,MACA,KAAA4sE,IAAAE,QACAtP,EAAA/sH,KAAAsuD,OAAA0tE,EAAApuH,OACA5N,KAAAqpF,OAAAi4D,EAAAv0B,GACAk1B,EAAAl1B,EACA,MACA,KAAAoP,IAAAI,gBACAv8H,KAAAmhJ,QAAAnlB,EAAA7uG,SAAAttB,EAAAA,EAAA,SAAA60B,GAAA66B,EAAA76B,IACAq4F,EAAAiP,EAAArmG,SAAA,IAAA31B,KAAA27H,UAAApsE,EAAA,GAAA,IACAvvD,KAAAqpF,OAAAi4D,EAAAv0B,GACAk1B,EAAAl1B,EACA,MACA,KAAAoP,IAAAK,iBACAx8H,KAAAmhJ,QAAAnlB,EAAAh0F,KAAAnoC,EAAAA,EAAA,SAAA60B,GAAAsT,EAAAtT,IACA10B,KAAAmhJ,QAAAnlB,EAAAzsE,MAAA1vD,EAAAA,EAAA,SAAA60B,GAAA66B,EAAA76B,IAEAq4F,EADA,MAAAiP,EAAArmG,SACA31B,KAAAuiJ,KAAAv6G,EAAAunB,GACA,MAAAysE,EAAArmG,SACA31B,KAAA27H,UAAA3zF,EAAA,GAAAg0F,EAAArmG,SAAA31B,KAAA27H,UAAApsE,EAAA,GAEA,IAAAvnB,EAAA,IAAAg0F,EAAArmG,SAAA,IAAA45B,EAAA,IAEAvvD,KAAAqpF,OAAAi4D,EAAAv0B,GACAk1B,EAAAl1B,EACA,MACA,KAAAoP,IAAAM,kBACA6kB,EAAAA,GAAAthJ,KAAA8gJ,SACAroH,EAAA0oH,QAAAnlB,EAAAh0F,KAAAs5G,GACA7oH,EAAA0pH,IAAA,OAAAnmB,EAAArmG,SAAA2rH,EAAA7oH,EAAAngB,IAAAgpI,GAAA7oH,EAAA6pH,YAAAtmB,EAAAzsE,MAAA+xF,IACAW,EAAAX,EACA,MACA,KAAAnlB,IAAAO,sBACA4kB,EAAAA,GAAAthJ,KAAA8gJ,SACAroH,EAAA0oH,QAAAnlB,EAAAz2H,KAAA+7I,GACA7oH,EAAA0pH,IAAAb,EAAA7oH,EAAA6pH,YAAAtmB,EAAAW,UAAA2kB,GAAA7oH,EAAA6pH,YAAAtmB,EAAAY,WAAA0kB,IACAW,EAAAX,EACA,MACA,KAAAnlB,IAAAU,WACAykB,EAAAA,GAAAthJ,KAAA8gJ,SACAkB,IACAA,EAAA7uI,QAAA,WAAAslB,EAAAukD,MAAA,IAAAh9E,KAAAqpF,OAAArpF,KAAA8gJ,SAAA9gJ,KAAAwiJ,kBAAA,IAAAxmB,EAAAlkH,MAAA,QACAkqI,EAAAr6G,UAAA,EACAq6G,EAAAlqI,KAAAkkH,EAAAlkH,MAEAqjH,GAAAa,EAAAlkH,MACA2gB,EAAA0pH,IAAA,WAAA1pH,EAAAukD,OAAAvkD,EAAAngB,IAAAmgB,EAAA+pH,kBAAA,IAAAxmB,EAAAlkH,OACA,WACA2gB,EAAA0pH,IAAA,WAAA1pH,EAAAukD,OAAA,IAAA,WACAN,GAAA,IAAAA,GACAjkD,EAAA0pH,IACA1pH,EAAAngB,IAAAmgB,EAAAgqH,kBAAA,IAAAzmB,EAAAlkH,OACA2gB,EAAA2pH,WAAA3pH,EAAAgqH,kBAAA,IAAAzmB,EAAAlkH,MAAA,OAEA2gB,EAAA4wD,OAAAi4D,EAAA7oH,EAAAgqH,kBAAA,IAAAzmB,EAAAlkH,UAEAwpI,GAAA7oH,EAAA2pH,WAAAd,EAAA7oH,EAAAgqH,kBAAA,IAAAzmB,EAAAlkH,SAEA2gB,EAAAjqB,MAAAuxH,iBAAA7B,GAAAlC,EAAAlkH,QACA2gB,EAAAiqH,oBAAApB,GAEAW,EAAAX,EACA,MACA,KAAAnlB,IAAAW,iBACA90F,EAAAg6G,IAAAA,EAAA7uI,QAAAnT,KAAA8gJ,WAAA9gJ,KAAA8gJ,SACAQ,EAAAA,GAAAthJ,KAAA8gJ,SACAroH,EAAA0oH,QAAAnlB,EAAA/iH,OAAA+uB,EAAAnoC,EAAA,WACA44B,EAAA0pH,IAAA1pH,EAAAkqH,QAAA36G,GAAA,WACAg0F,EAAAr0F,UACA4nB,EAAA92B,EAAAqoH,SACAroH,EAAA0oH,QAAAnlB,EAAAppC,SAAArjC,GACA92B,EAAAmqH,wBAAArzF,GACAmtB,GAAA,IAAAA,GACAjkD,EAAA0pH,IAAA1pH,EAAAngB,IAAAmgB,EAAA4pH,eAAAr6G,EAAAunB,IAAA92B,EAAA2pH,WAAA3pH,EAAA4pH,eAAAr6G,EAAAunB,GAAA,OAEAw9D,EAAAt0F,EAAA6iG,iBAAA7iG,EAAA4pH,eAAAr6G,EAAAunB,IACA92B,EAAA4wD,OAAAi4D,EAAAv0B,GACAi1B,IACAA,EAAAr6G,UAAA,EACAq6G,EAAAlqI,KAAAy3C,KAGA4rE,GAAAa,EAAAppC,SAAA96E,MACA4kE,GAAA,IAAAA,GACAjkD,EAAA0pH,IAAA1pH,EAAAngB,IAAAmgB,EAAAgqH,kBAAAz6G,EAAAg0F,EAAAppC,SAAA96E,OAAA2gB,EAAA2pH,WAAA3pH,EAAAgqH,kBAAAz6G,EAAAg0F,EAAAppC,SAAA96E,MAAA,OAEAi1G,EAAAt0F,EAAAgqH,kBAAAz6G,EAAAg0F,EAAAppC,SAAA96E,OACA2gB,EAAAjqB,MAAAuxH,iBAAA7B,GAAAlC,EAAAppC,SAAA96E,SACAi1G,EAAAt0F,EAAA6iG,iBAAAvO,IAEAt0F,EAAA4wD,OAAAi4D,EAAAv0B,GACAi1B,IACAA,EAAAr6G,UAAA,EACAq6G,EAAAlqI,KAAAkkH,EAAAppC,SAAA96E,QAGA,WACA2gB,EAAA4wD,OAAAi4D,EAAA,eAEAW,EAAAX,MACA5kE,EACA,MACA,KAAAy/C,IAAAY,eACAukB,EAAAA,GAAAthJ,KAAA8gJ,SACA9kB,EAAArjH,QACA42C,EAAA92B,EAAA9f,OAAAqjH,EAAAgB,OAAAllH,MACAxF,KACAtU,EAAAg+H,EAAAzpH,UAAA,SAAAmiB,GACA,GAAAvH,GAAAsL,EAAAqoH,QACAroH,GAAA0oH,QAAAzsH,EAAAvH,GACA7a,EAAAhM,KAAA6mB,KAEA4/F,EAAAx9D,EAAA,IAAAj9C,EAAArM,KAAA,KAAA,IACAwyB,EAAA4wD,OAAAi4D,EAAAv0B,GACAk1B,EAAAX,KAEA/xF,EAAA92B,EAAAqoH,SACA94G,KACA11B,KACAmmB,EAAA0oH,QAAAnlB,EAAAgB,OAAAztE,EAAAvnB,EAAA,WACAvP,EAAA0pH,IAAA1pH,EAAAkqH,QAAApzF,GAAA,WACA92B,EAAAoqH,sBAAAtzF,GACAvxD,EAAAg+H,EAAAzpH,UAAA,SAAAmiB,GACA+D,EAAA0oH,QAAAzsH,EAAA+D,EAAAqoH,SAAAjhJ,EAAA,SAAAstB,GACA7a,EAAAhM,KAAAmyB,EAAA6iG,iBAAAnuG,QAGA6a,EAAAlwB,MACA2gB,EAAAjqB,MAAAuxH,iBACAtnG,EAAAiqH,oBAAA16G,EAAA70B,SAEA45G,EAAAt0F,EAAAqqH,OAAA96G,EAAA70B,QAAA60B,EAAAlwB,KAAAkwB,EAAAL,UAAA,IAAAr1B,EAAArM,KAAA,KAAA,KAEA8mH,EAAAx9D,EAAA,IAAAj9C,EAAArM,KAAA,KAAA,IAEA8mH,EAAAt0F,EAAA6iG,iBAAAvO,GACAt0F,EAAA4wD,OAAAi4D,EAAAv0B,IACA,WACAt0F,EAAA4wD,OAAAi4D,EAAA,eAEAW,EAAAX,KAGA,MACA,KAAAnlB,IAAAc,qBAGA,GAFA1tE,EAAAvvD,KAAA8gJ,SACA94G,MACAu1F,GAAAvB,EAAAh0F,MACA,KAAAqzF,IAAA,OAAA,4CAEAr7H,MAAAmhJ,QAAAnlB,EAAAh0F,KAAAnoC,EAAAmoC,EAAA,WACAvP,EAAA0pH,IAAA1pH,EAAAkqH,QAAA36G,EAAA70B,SAAA,WACAslB,EAAA0oH,QAAAnlB,EAAAzsE,MAAAA,GACA92B,EAAAiqH,oBAAAjqH,EAAAqqH,OAAA96G,EAAA70B,QAAA60B,EAAAlwB,KAAAkwB,EAAAL,WACAolF,EAAAt0F,EAAAqqH,OAAA96G,EAAA70B,QAAA60B,EAAAlwB,KAAAkwB,EAAAL,UAAAq0F,EAAArmG,SAAA45B,EACA92B,EAAA4wD,OAAAi4D,EAAAv0B,GACAk1B,EAAAX,GAAAv0B,MAEA,EACA,MACA,KAAAoP,IAAAe,gBACA5qH,KACAtU,EAAAg+H,EAAAhpH,SAAA,SAAA0hB,GACA+D,EAAA0oH,QAAAzsH,EAAA+D,EAAAqoH,SAAAjhJ,EAAA,SAAAstB,GACA7a,EAAAhM,KAAA6mB,OAGA4/F,EAAA,IAAAz6G,EAAArM,KAAA,KAAA,IACAjG,KAAAqpF,OAAAi4D,EAAAv0B,GACAk1B,EAAAl1B,EACA,MACA,KAAAoP,IAAAgB,iBACA7qH,KACAtU,EAAAg+H,EAAAt4G,WAAA,SAAAkvE,GACAn6D,EAAA0oH,QAAAvuD,EAAAhlF,MAAA6qB,EAAAqoH,SAAAjhJ,EAAA,SAAA60B,GACApiB,EAAAhM,KAAAmyB,EAAA61B,OACAskC,EAAAh5E,IAAAhR,OAAAuzH,GAAAU,WAAAjqC,EAAAh5E,IAAA9B,KACA,GAAA86E,EAAAh5E,IAAAhM,OACA,IAAA8mB,OAGAq4F,EAAA,IAAAz6G,EAAArM,KAAA,KAAA,IACAjG,KAAAqpF,OAAAi4D,EAAAv0B,GACAk1B,EAAAl1B,EACA,MACA,KAAAoP,IAAAiB,eACAp9H,KAAAqpF,OAAAi4D,EAAA,KACAW,EAAA,IACA,MACA,KAAA9lB,IAAAsB,iBACAz9H,KAAAqpF,OAAAi4D,EAAA,KACAW,EAAA,OAKAO,kBAAA,SAAAlsI,EAAAs8E,GACA,GAAAh5E,GAAAtD,EAAA,IAAAs8E,EACAouD,EAAAhhJ,KAAAknB,UAAA85H,GAIA,OAHAA,GAAAz4H,eAAA3O,KACAonI,EAAApnI,GAAA5Z,KAAA8gJ,QAAA,EAAAxqI,EAAA,MAAAtW,KAAAsuD,OAAAskC,GAAA,OAAAt8E,EAAA,MAEA0qI,EAAApnI,IAGAyvE,OAAA,SAAApkF,EAAA2I,GACA,GAAA3I,EAEA,MADAjF,MAAAknB,UAAA1nB,KAAA8G,KAAArB,EAAA,IAAA2I,EAAA,KACA3I,GAGA0T,OAAA,SAAAmjH,GAIA,MAHA97H,MAAAwO,MAAAspB,QAAAvP,eAAAuzG,KACA97H,KAAAwO,MAAAspB,QAAAgkG,GAAA97H,KAAA8gJ,QAAA,IAEA9gJ,KAAAwO,MAAAspB,QAAAgkG,IAGAH,UAAA,SAAA12H,EAAAiZ,GACA,MAAA,aAAAjZ,EAAA,IAAAjF,KAAAsuD,OAAApwC,GAAA,KAGAqkI,KAAA,SAAAv6G,EAAAunB,GACA,MAAA,QAAAvnB,EAAA,IAAAunB,EAAA,KAGAgyF,QAAA,SAAAt8I,GACAjF,KAAAknB,UAAA1nB,KAAA8G,KAAA,UAAArB,EAAA,MAGAk9I,IAAA,SAAA58I,EAAAo3H,EAAAC,GACA,GAAAr3H,KAAA,EACAo3H,QACA,CACA,GAAAn9H,GAAAQ,KAAAknB,UAAA1nB,IACAA,GAAA8G,KAAA,MAAAf,EAAA,MACAo3H,IACAn9H,EAAA8G,KAAA,KACAs2H,IACAp9H,EAAA8G,KAAA,SACAs2H,IACAp9H,EAAA8G,KAAA,QAKAgS,IAAA,SAAAy0G,GACA,MAAA,KAAAA,EAAA,KAGA41B,QAAA,SAAA51B,GACA,MAAAA,GAAA,UAGA01B,kBAAA,SAAAz6G,EAAAunB,GACA,MAAAvnB,GAAA,IAAAunB,GAGA8yF,eAAA,SAAAr6G,EAAAunB,GACA,MAAAvnB,GAAA,IAAAunB,EAAA,KAGAuzF,OAAA,SAAA96G,EAAAunB,EAAA5nB,GACA,MAAAA,GAAA3nC,KAAAqiJ,eAAAr6G,EAAAunB,GACAvvD,KAAAyiJ,kBAAAz6G,EAAAunB,IAGAmzF,oBAAA,SAAA19I,GACAhF,KAAAknB,UAAA1nB,KAAA8G,KAAAtG,KAAAs7H,iBAAAt2H,GAAA,MAGA49I,wBAAA,SAAA59I,GACAhF,KAAAknB,UAAA1nB,KAAA8G,KAAAtG,KAAAm7H,qBAAAn2H,GAAA,MAGA69I,sBAAA,SAAA79I,GACAhF,KAAAknB,UAAA1nB,KAAA8G,KAAAtG,KAAAu7H,mBAAAv2H,GAAA,MAGAs2H,iBAAA,SAAAt2H,GACA,MAAA,oBAAAA,EAAA,UAGAm2H,qBAAA,SAAAn2H,GACA,MAAA,wBAAAA,EAAA,UAGAu2H,mBAAA,SAAAv2H,GACA,MAAA,sBAAAA,EAAA,UAGAs9I,YAAA,SAAAtmB,EAAAslB,EAAAU,EAAAC,EAAAvlE,EAAAwlE,GACA,GAAAzpH,GAAAz4B,IACA,OAAA,YACAy4B,EAAA0oH,QAAAnlB,EAAAslB,EAAAU,EAAAC,EAAAvlE,EAAAwlE,KAIAE,WAAA,SAAAn9I,EAAA2I,GACA,GAAA6qB,GAAAz4B,IACA,OAAA,YACAy4B,EAAA4wD,OAAApkF,EAAA2I,KAIAm1I,kBAAA,iBAEAC,eAAA,SAAAt6I,GACA,MAAA,OAAA,OAAAA,EAAA0/E,WAAA,GAAA//D,SAAA,KAAAlrB,WAGAmxD,OAAA,SAAA1gD,GACA,GAAA4vF,EAAA5vF,GAAA,MAAA,IAAAA,EAAA3K,QAAAjD,KAAA+iJ,kBAAA/iJ,KAAAgjJ,gBAAA,GACA,IAAA/jD,EAAArxF,GAAA,MAAAA,GAAAya,UACA,IAAAza,KAAA,EAAA,MAAA,MACA,IAAAA,KAAA,EAAA,MAAA,OACA,IAAA,OAAAA,EAAA,MAAA,MACA,IAAA,mBAAAA,GAAA,MAAA,WAEA,MAAAytH,IAAA,MAAA,eAGAylB,OAAA,SAAAmC,EAAA16I,GACA,GAAAtD,GAAA,IAAAjF,KAAAwO,MAAAsyI,QAIA,OAHAmC,IACAjjJ,KAAAknB,UAAA65H,KAAAz6I,KAAArB,GAAAsD,EAAA,IAAAA,EAAA,KAEAtD,GAGAiiB,QAAA,WACA,MAAAlnB,MAAAwO,MAAAxO,KAAAwO,MAAA0yI,aAUApjB,GAAAh9G,WACA4P,QAAA,SAAAq8F,EAAAgT,GACA,GAAAtnG,GAAAz4B,KACAg8H,EAAAh8H,KAAA69H,WAAA7B,IAAAjP,EACA/sH,MAAA+sH,WAAAA,EACA/sH,KAAA+/H,gBAAAA,EACAhE,GAAAC,EAAAvjG,EAAA+1E,QACA,IAAAyyC,GACA53D,GACA43D,EAAAzjB,GAAAxB,MACA3yC,EAAArpF,KAAAmhJ,QAAAF,GAEA,IACAliB,GADAzC,EAAAe,GAAArB,EAAAx8H,KAEA88H,KACAyC,KACA/gI,EAAAs+H,EAAA,SAAAgK,EAAA1sH,GACA,GAAA7M,GAAA0rB,EAAA0oH,QAAA7a,EACAA,GAAAv5H,MAAAA,EACAgyH,EAAAz4H,KAAAyG,GACAu5H,EAAAkb,QAAA5nI,IAGA,IAAAgvG,KACA5qH,GAAAg+H,EAAAx8H,KAAA,SAAAutH,GACAnE,EAAAtiH,KAAAmyB,EAAA0oH,QAAAp0B,EAAAA,cAEA,IAAAh7G,GAAA,IAAAiqH,EAAAx8H,KAAAuC,OAAA,aACA,IAAAi6H,EAAAx8H,KAAAuC,OAAA6mH,EAAA,GACA,SAAA5kB,EAAAsU,GACA,GAAA4R,EAIA,OAHAlsH,GAAA4qH,EAAA,SAAAwK,GACAlJ,EAAAkJ,EAAApvB,EAAAsU,KAEA4R,EAYA,OAVA7gC,KACAt3E,EAAAs3E,OAAA,SAAA2a,EAAAp2F,EAAA0qG,GACA,MAAAjvB,GAAA2a,EAAAsU,EAAA1qG,KAGAmxH,IACAhtH,EAAAgtH,OAAAA,GAEAhtH,EAAAszD,QAAAq4D,GAAA1B,GACAjqH,EAAA21F,SAAAi2B,GAAA3B,GACAjqH,GAGAovI,QAAA,SAAAnlB,EAAA7oH,EAAAupE,GACA,GAAA10C,GAAAunB,EAAAj9C,EAAAmmB,EAAAz4B,IACA,IAAAg8H,EAAAjvH,MACA,MAAA/M,MAAA++H,OAAA/C,EAAAjvH,MAAAivH,EAAAwlB,QAEA,QAAAxlB,EAAApzH,MACA,IAAAuzH,IAAAE,QACA,MAAAr8H,MAAA4N,MAAAouH,EAAApuH,MAAAuF,EACA,KAAAgpH,IAAAI,gBAEA,MADAhtE,GAAAvvD,KAAAmhJ,QAAAnlB,EAAA7uG,UACAntB,KAAA,QAAAg8H,EAAArmG,UAAA45B,EAAAp8C,EACA,KAAAgpH,IAAAK,iBAGA,MAFAx0F,GAAAhoC,KAAAmhJ,QAAAnlB,EAAAh0F,MACAunB,EAAAvvD,KAAAmhJ,QAAAnlB,EAAAzsE,OACAvvD,KAAA,SAAAg8H,EAAArmG,UAAAqS,EAAAunB,EAAAp8C,EACA,KAAAgpH,IAAAM,kBAGA,MAFAz0F,GAAAhoC,KAAAmhJ,QAAAnlB,EAAAh0F,MACAunB,EAAAvvD,KAAAmhJ,QAAAnlB,EAAAzsE,OACAvvD,KAAA,SAAAg8H,EAAArmG,UAAAqS,EAAAunB,EAAAp8C,EACA,KAAAgpH,IAAAO,sBACA,MAAA18H,MAAA,aACAA,KAAAmhJ,QAAAnlB,EAAAz2H,MACAvF,KAAAmhJ,QAAAnlB,EAAAW,WACA38H,KAAAmhJ,QAAAnlB,EAAAY,YACAzpH,EAEA,KAAAgpH,IAAAU,WAEA,MADA1B,IAAAa,EAAAlkH,KAAA2gB,EAAAs0F,YACAt0F,EAAAnH,WAAA0qG,EAAAlkH,KACA2gB,EAAAsnG,iBAAA7B,GAAAlC,EAAAlkH,MACA3E,EAAAupE,EAAAjkD,EAAAs0F,WACA,KAAAoP,IAAAW,iBAOA,MANA90F,GAAAhoC,KAAAmhJ,QAAAnlB,EAAA/iH,QAAA,IAAAyjE,GACAs/C,EAAAr0F,WACAwzF,GAAAa,EAAAppC,SAAA96E,KAAA2gB,EAAAs0F,YACAx9D,EAAAysE,EAAAppC,SAAA96E,MAEAkkH,EAAAr0F,WAAA4nB,EAAAvvD,KAAAmhJ,QAAAnlB,EAAAppC,WACAopC,EAAAr0F,SACA3nC,KAAAqiJ,eAAAr6G,EAAAunB,EAAAp8C,EAAAupE,EAAAjkD,EAAAs0F,YACA/sH,KAAAyiJ,kBAAAz6G,EAAAunB,EAAA92B,EAAAsnG,gBAAA5sH,EAAAupE,EAAAjkD,EAAAs0F,WACA,KAAAoP,IAAAY,eAOA,MANAzqH,MACAtU,EAAAg+H,EAAAzpH,UAAA,SAAAmiB,GACApiB,EAAAhM,KAAAmyB,EAAA0oH,QAAAzsH,MAEAsnG,EAAArjH,SAAA42C,EAAAvvD,KAAAwuG,QAAAwtB,EAAAgB,OAAAllH,OACAkkH,EAAArjH,SAAA42C,EAAAvvD,KAAAmhJ,QAAAnlB,EAAAgB,QAAA,IACAhB,EAAArjH,OACA,SAAAqrF,EAAAsU,EAAAjvB,EAAA01C,GAEA,IAAA,GADAv/G,MACAvX,EAAA,EAAAA,EAAAqK,EAAAvQ,SAAAkG,EACAuX,EAAAlZ,KAAAgM,EAAArK,GAAA+7F,EAAAsU,EAAAjvB,EAAA01C,GAEA,IAAAnxH,GAAA2hD,EAAAz6C,MAAAjV,EAAA2f,EAAAu/G,EACA,OAAA5rH,IAAAA,QAAAtT,EAAAiY,KAAAjY,EAAA+N,MAAAA,GAAAA,GAEA,SAAAo2F,EAAAsU,EAAAjvB,EAAA01C,GACA,GACAnxH,GADAs1I,EAAA3zF,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EAEA,IAAA,MAAAmkB,EAAAt1I,MAAA,CACA0tH,GAAA4nB,EAAA/vI,QAAAslB,EAAAs0F,YACAwO,GAAA2nB,EAAAt1I,MAAA6qB,EAAAs0F,WAEA,KAAA,GADAvtG,MACAvX,EAAA,EAAAA,EAAAqK,EAAAvQ,SAAAkG,EACAuX,EAAAlZ,KAAAg1H,GAAAhpH,EAAArK,GAAA+7F,EAAAsU,EAAAjvB,EAAA01C,GAAAtmG,EAAAs0F,YAEAn/G,GAAA0tH,GAAA4nB,EAAAt1I,MAAAkH,MAAAouI,EAAA/vI,QAAAqM,GAAAiZ,EAAAs0F,YAEA,MAAA55G,IAAAvF,MAAAA,GAAAA,EAEA,KAAAuuH,IAAAc,qBAGA,MAFAj1F,GAAAhoC,KAAAmhJ,QAAAnlB,EAAAh0F,MAAA,EAAA,GACAunB,EAAAvvD,KAAAmhJ,QAAAnlB,EAAAzsE,OACA,SAAAy0C,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAokB,GAAAn7G,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GACAmkB,EAAA3zF,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EAGA,OAFAzD,IAAA6nB,EAAAv1I,MAAA6qB,EAAAs0F,YACAo2B,EAAAhwI,QAAAgwI,EAAArrI,MAAAorI,EACA/vI,GAAAvF,MAAAs1I,GAAAA,EAEA,KAAA/mB,IAAAe,gBAKA,MAJA5qH,MACAtU,EAAAg+H,EAAAhpH,SAAA,SAAA0hB,GACApiB,EAAAhM,KAAAmyB,EAAA0oH,QAAAzsH,MAEA,SAAAsvE,EAAAsU,EAAAjvB,EAAA01C,GAEA,IAAA,GADAnxH,MACA3F,EAAA,EAAAA,EAAAqK,EAAAvQ,SAAAkG,EACA2F,EAAAtH,KAAAgM,EAAArK,GAAA+7F,EAAAsU,EAAAjvB,EAAA01C,GAEA,OAAA5rH,IAAAvF,MAAAA,GAAAA,EAEA,KAAAuuH,IAAAgB,iBASA,MARA7qH,MACAtU,EAAAg+H,EAAAt4G,WAAA,SAAAkvE,GACAtgF,EAAAhM,MAAAsT,IAAAg5E,EAAAh5E,IAAAhR,OAAAuzH,GAAAU,WACAjqC,EAAAh5E,IAAA9B,KACA,GAAA86E,EAAAh5E,IAAAhM,MACAA,MAAA6qB,EAAA0oH,QAAAvuD,EAAAhlF,WAGA,SAAAo2F,EAAAsU,EAAAjvB,EAAA01C,GAEA,IAAA,GADAnxH,MACA3F,EAAA,EAAAA,EAAAqK,EAAAvQ,SAAAkG,EACA2F,EAAA0E,EAAArK,GAAA2R,KAAAtH,EAAArK,GAAA2F,MAAAo2F,EAAAsU,EAAAjvB,EAAA01C,EAEA,OAAA5rH,IAAAvF,MAAAA,GAAAA,EAEA,KAAAuuH,IAAAiB,eACA,MAAA,UAAAp5B,GACA,MAAA7wF,IAAAvF,MAAAo2F,GAAAA,EAEA,KAAAm4B,IAAAsB,iBACA,MAAA,UAAAz5B,EAAAsU,EAAAjvB,EAAA01C,GACA,MAAA5rH,IAAAvF,MAAAy7E,GAAAA,KAKA+5D,SAAA,SAAAj2H,EAAAha,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAwC,EAAA62E,EAAAsU,EAAAjvB,EAAA01C,EAMA,OAJAp0G,GADAo0E,EAAAp0E,IACAA,EAEA,EAEAxX,GAAAvF,MAAA+c,GAAAA,IAGA04H,SAAA,SAAAl2H,EAAAha,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAwC,EAAA62E,EAAAsU,EAAAjvB,EAAA01C,EAMA,OAJAp0G,GADAo0E,EAAAp0E,IACAA,EAEA,EAEAxX,GAAAvF,MAAA+c,GAAAA,IAGA24H,SAAA,SAAAn2H,EAAAha,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,IAAAwC,EAAA62E,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGA44H,UAAA,SAAAv7G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAokB,GAAAn7G,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GACAmkB,EAAA3zF,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,GACAp0G,EAAAixG,GAAAunB,EAAAD,EACA,OAAA/vI,IAAAvF,MAAA+c,GAAAA,IAGA64H,UAAA,SAAAx7G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAokB,GAAAn7G,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GACAmkB,EAAA3zF,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,GACAp0G,GAAAo0E,EAAAokD,GAAAA,EAAA,IAAApkD,EAAAmkD,GAAAA,EAAA,EACA,OAAA/vI,IAAAvF,MAAA+c,GAAAA,IAGA84H,UAAA,SAAAz7G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGA+4H,UAAA,SAAA17G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAg5H,UAAA,SAAA37G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAi5H,YAAA,SAAA57G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,KAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAk5H,YAAA,SAAA77G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,KAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAm5H,WAAA,SAAA97G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAo5H,WAAA,SAAA/7G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAq5H,UAAA,SAAAh8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAs5H,UAAA,SAAAj8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,GAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAu5H,WAAA,SAAAl8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAw5H,WAAA,SAAAn8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGAy5H,WAAA,SAAAp8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGA05H,WAAA,SAAAr8G,EAAAunB,EAAAp8C,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAqd,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,IAAAxvE,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGA25H,YAAA,SAAA/+I,EAAAo3H,EAAAC,EAAAzpH,GACA,MAAA,UAAA6wF,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAp0G,GAAAplB,EAAAy+F,EAAAsU,EAAAjvB,EAAA01C,GAAApC,EAAA34B,EAAAsU,EAAAjvB,EAAA01C,GAAAnC,EAAA54B,EAAAsU,EAAAjvB,EAAA01C,EACA,OAAA5rH,IAAAvF,MAAA+c,GAAAA,IAGA/c,MAAA,SAAAA,EAAAuF,GACA,MAAA,YAAA,MAAAA,IAAAA,QAAAtT,EAAAiY,KAAAjY,EAAA+N,MAAAA,GAAAA,IAEA0jB,WAAA,SAAAxZ,EAAAioH,EAAA5sH,EAAAupE,EAAAqwC,GACA,MAAA,UAAA/oB,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAArxG,GAAA4qF,GAAAxgG,IAAAwgG,GAAAA,EAAAtU,CACAtnB,IAAA,IAAAA,GAAAhvD,IAAAA,EAAA5V,KACA4V,EAAA5V,MAEA,IAAAlK,GAAA8f,EAAAA,EAAA5V,GAAAjY,CAIA,OAHAkgI,IACAzE,GAAA1tH,EAAAm/G,GAEA55G,GACAA,QAAAua,EAAA5V,KAAAA,EAAAlK,MAAAA,GAEAA,IAIAy0I,eAAA,SAAAr6G,EAAAunB,EAAAp8C,EAAAupE,EAAAqwC,GACA,MAAA,UAAA/oB,EAAAsU,EAAAjvB,EAAA01C,GACA,GACAmkB,GACAt1I,EAFAu1I,EAAAn7G,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,EAYA,OATA,OAAAokB,IACAD,EAAA3zF,EAAAy0C,EAAAsU,EAAAjvB,EAAA01C,GACA5D,GAAA+nB,EAAAn2B,GACArwC,GAAA,IAAAA,GAAAymE,IAAAA,EAAAD,KACAC,EAAAD,OAEAt1I,EAAAu1I,EAAAD,GACA5nB,GAAA1tH,EAAAm/G,IAEA55G,GACAA,QAAAgwI,EAAArrI,KAAAorI,EAAAt1I,MAAAA,GAEAA,IAIA60I,kBAAA,SAAAz6G,EAAAunB,EAAAwwE,EAAA5sH,EAAAupE,EAAAqwC,GACA,MAAA,UAAA/oB,EAAAsU,EAAAjvB,EAAA01C,GACA,GAAAokB,GAAAn7G,EAAAg8D,EAAAsU,EAAAjvB,EAAA01C,EACAriD,IAAA,IAAAA,GAAAymE,IAAAA,EAAA5zF,KACA4zF,EAAA5zF,MAEA,IAAA3hD,GAAA,MAAAu1I,EAAAA,EAAA5zF,GAAA1vD,CAIA,QAHAkgI,GAAA7B,GAAA3uE,KACA+rE,GAAA1tH,EAAAm/G,GAEA55G,GACAA,QAAAgwI,EAAArrI,KAAAy3C,EAAA3hD,MAAAA,GAEAA,IAIAmxH,OAAA,SAAAhyH,EAAAy0I,GACA,MAAA,UAAAx9C,EAAAp2F,EAAA0qG,EAAAymB,GACA,MAAAA,GAAAA,EAAAyiB,GACAz0I,EAAAi3F,EAAAp2F,EAAA0qG,KAQA,IAAAioB,IAAA,SAAAH,EAAA5xB,EAAA9wG,GACAsC,KAAAogI,MAAAA,EACApgI,KAAAwuG,QAAAA,EACAxuG,KAAAtC,QAAAA,EACAsC,KAAAg8H,IAAA,GAAAG,IAAAn8H,KAAAogI,OACApgI,KAAAukJ,YAAA7mJ,EAAA2qG,IAAA,GAAAy1B,IAAA99H,KAAAg8H,IAAAxtB,GACA,GAAAovB,IAAA59H,KAAAg8H,IAAAxtB,GAGA+xB,IAAAz/G,WACAmI,YAAAs3G,GAEA9vF,MAAA,SAAAtvC,GACA,MAAAnB,MAAAukJ,YAAA7zH,QAAAvvB,EAAAnB,KAAAtC,QAAAqiI,kBA2BA,IAOA3B,KAPAp9B,KACAA,KAMAx6F,OAAAsa,UAAA29E,SA+yEAqpC,GAAA/qC,EAAA,QAEAmrC,IACAnf,KAAA,OACAmgB,IAAA,MACAC,IAAA,MAGAngB,aAAA,cACAogB,GAAA,MAsmCAjsB,GAAApgB,EAAA,YAmSA4uC,GAAA5vI,EAAAG,cAAA,KACA2vI,GAAAtZ,GAAA90H,EAAAsF,SAAA4R,KA6LAm3H,IAAAz1B,SAAA,aAyGA5H,GAAA4H,SAAA,YAkXA+1B,GAAA/1B,SAAA,WA0EAq2B,GAAAr2B,SAAA,UAaA,IAAAme,IAAA,IA4KAqc,IACA+E,KAAA5G,GAAA,WAAA,GACAwV,GAAAxV,GAAA,WAAA,EAAA,GAAA,GACApiE,EAAAoiE,GAAA,WAAA,GACAyV,KAAAxV,GAAA,SACAyV,IAAAzV,GAAA,SAAA,GACA4G,GAAA7G,GAAA,QAAA,EAAA,GACA76D,EAAA66D,GAAA,QAAA,EAAA,GACA8G,GAAA9G,GAAA,OAAA,GACAxhI,EAAAwhI,GAAA,OAAA,GACA+G,GAAA/G,GAAA,QAAA,GACAx6D,EAAAw6D,GAAA,QAAA,GACA2V,GAAA3V,GAAA,QAAA,OACAvhI,EAAAuhI,GAAA,QAAA,OACAgH,GAAAhH,GAAA,UAAA,GACAjkH,EAAAikH,GAAA,UAAA,GACAiH,GAAAjH,GAAA,UAAA,GACAr/H,EAAAq/H,GAAA,UAAA,GAGAkH,IAAAlH,GAAA,eAAA,GACA4V,KAAA3V,GAAA,OACA4V,IAAA5V,GAAA,OAAA,GACA3vI,EAAAuwI,GACAtmD,EAAA4lD,GACA2V,GAAApV,GAAA,GACAniI,EAAAmiI,GAAA,GACAzmD,EAAA6mD,GACAiV,GAAAjV,GACAkV,IAAAlV,GACAmV,KAAAlV,IAGAY,GAAA,uFACAD,GAAA,UA+FArE,IAAAh2B,SAAA,UA8HA,IAAAo2B,IAAA7tC,EAAAoB,IAWA4sC,GAAAhuC,EAAAqJ,GA4SA0kC,IAAAt2B,SAAA,SA0IA,IAAA1N,IAAA/J,GACAyf,SAAA,IACA3tF,QAAA,SAAApa,EAAA7V,GACA,IAAAA,EAAAkU,OAAAlU,EAAAykJ,UACA,MAAA,UAAAlhD,EAAA1tF,GAEA,GAAA,MAAAA,EAAA,GAAA9Q,SAAA9E,cAAA,CAGA,GAAAiU,GAAA,+BAAA0T,GAAAjrB,KAAAkZ,EAAAqK,KAAA,SACA,aAAA,MACArK,GAAA1E,GAAA,QAAA,SAAA6H,GAEAnD,EAAA7V,KAAAkU,IACA8E,EAAA8mB,wBAsWA6sE,KAGApvG,GAAA+2G,GAAA,SAAAzmE,EAAA8uE,GAIA,QAAA+nC,GAAAnhD,EAAA1tF,EAAA7V,GACAujG,EAAA3E,OAAA5+F,EAAA2kJ,GAAA,SAAAx3I,GACAnN,EAAAwsE,KAAAmwC,IAAAxvG,KAJA,GAAA,YAAA0gC,EAAA,CAQA,GAAA82G,GAAApjC,GAAA,MAAA5E,GACAiG,EAAA8hC,CAEA,aAAA72G,IACA+0E,EAAA,SAAArf,EAAA1tF,EAAA7V,GAEAA,EAAAwrG,UAAAxrG,EAAA2kJ,IACAD,EAAAnhD,EAAA1tF,EAAA7V,KAKA2sG,GAAAg4C,GAAA,WACA,OACA/mC,SAAA,IACAD,SAAA,IACAnC,KAAAoH,OAMArlH,EAAAk3G,GAAA,SAAAmwC,EAAApiD,GACAmK,GAAAnK,GAAA,WACA,OACAmb,SAAA,IACAnC,KAAA,SAAAjY,EAAA1tF,EAAA7V,GAGA,GAAA,cAAAwiG,GAAA,KAAAxiG,EAAA+rG,UAAA/9F,OAAA,GAAA,CACA,GAAA3H,GAAArG,EAAA+rG,UAAA1lG,MAAAmzI,GACA,IAAAnzI,EAEA,WADArG,GAAAwsE,KAAA,YAAA,GAAA9lE,QAAAL,EAAA,GAAAA,EAAA,KAKAk9F,EAAA3E,OAAA5+F,EAAAwiG,GAAA,SAAAr1F,GACAnN,EAAAwsE,KAAAg2B,EAAAr1F,UAQA5P,GAAA,MAAA,SAAA,QAAA,SAAAo/G,GACA,GAAAgoC,GAAApjC,GAAA,MAAA5E,EACAhQ,IAAAg4C,GAAA,WACA,OACAhnC,SAAA,GACAnC,KAAA,SAAAjY,EAAA1tF,EAAA7V,GACA,GAAA6tC,GAAA8uE,EACAtlG,EAAAslG,CAEA,UAAAA,GACA,+BAAA/0F,GAAAjrB,KAAAkZ,EAAAqK,KAAA,WACA7I,EAAA,YACArX,EAAAqhH,MAAAhqG,GAAA,aACAw2B,EAAA,MAGA7tC,EAAA4pH,SAAA+6B,EAAA,SAAAx3I,GACA,MAAAA,IAOAnN,EAAAwsE,KAAAn1D,EAAAlK,QAMAi1G,IAAAv0E,GAAAh4B,EAAAqK,KAAA2tB,EAAA7tC,EAAAqX,WAZA,SAAAslG,GACA38G,EAAAwsE,KAAAn1D,EAAA,aAoBA,IAAAs6H,KACAS,YAAApiI,EACAuiI,gBAAAlB,GACAqB,eAAA1iI,EACA2iI,aAAA3iI,EACA+iI,UAAA/iI,EACAkjI,aAAAljI,EACAsjI,cAAAtjI,GAEAojI,GAAA,cAgDA5B,IAAA57B,SAAA,WAAA,SAAA,SAAA,WAAA,eAqYA,IAAAivC,IAAA,SAAAC,GACA,OAAA,WAAA,SAAAz0C,GACA,GAAAhI,IACAhxF,KAAA,OACAumG,SAAAknC,EAAA,MAAA,IACAjgD,WAAA2sC,GACAvhH,QAAA,SAAA80H,EAAA/kJ,GAEA+kJ,EAAAplJ,SAAAqzI,IAAArzI,SAAA25I,GAEA,IAAA0L,GAAAhlJ,EAAAqX,KAAA,UAAAytI,IAAA9kJ,EAAA0pG,SAAA,QAEA,QACA0Z,IAAA,SAAA7f,EAAAwhD,EAAA/kJ,EAAA6kG,GAEA,KAAA,UAAA7kG,IAAA,CAOA,GAAAilJ,GAAA,SAAAjsI,GACAuqF,EAAAC,OAAA,WACAqB,EAAAytC,mBACAztC,EAAAyuC,kBAGAt6H,EAAA8mB,iBAGA4xF,IAAAqzB,EAAA,GAAA,SAAAE,GAIAF,EAAA5zI,GAAA,WAAA,WACAk/F,EAAA,WACA2C,GAAA+xC,EAAA,GAAA,SAAAE,IACA,GAAA,KAIA,GAAAC,GAAArgD,EAAA6sC,YAEAsT,KACAzoH,GAAAgnE,EAAAsB,EAAA0sC,MAAA1sC,EAAAA,EAAA0sC,OACAvxI,EAAA4pH,SAAAo7B,EAAA,SAAAr8B,GACA9jB,EAAA0sC,QAAA5oB,IACApsF,GAAAgnE,EAAAsB,EAAA0sC,MAAAnyI,EAAAylG,EAAA0sC,OACA2T,EAAA3S,gBAAA1tC,EAAA8jB,GACApsF,GAAAgnE,EAAAsB,EAAA0sC,MAAA1sC,EAAAA,EAAA0sC,WAGAwT,EAAA5zI,GAAA,WAAA,WACA+zI,EAAAxS,eAAA7tC,GACAmgD,GACAzoH,GAAAgnE,EAAAvjG,EAAAglJ,GAAA5lJ,EAAAylG,EAAA0sC,OAEAn3H,EAAAyqF,EAAA8sC,SAOA,OAAAtpC,MAIAA,GAAAw8C,KACAl7C,GAAAk7C,IAAA,GAYA3P,GAAA,2EACAiC,GAAA,sFACAE,GAAA,oGACAN,GAAA,oDACAoO,GAAA,4BACAC,GAAA,gEACA5Q,GAAA,oBACA6Q,GAAA,mBACAC,GAAA,0CAEAC;AAgGA7kJ,KAAAgzI,GA+FA13F,KAAA25F,GAAA,OAAAwP,GACApQ,GAAAoQ,IAAA,OAAA,KAAA,OACA,cA6FAK,iBAAA7P,GAAA,gBAAAyP,GACArQ,GAAAqQ,IAAA,OAAA,KAAA,KAAA,KAAA,KAAA,KAAA,QACA,2BA8FA14G,KAAAipG,GAAA,OAAA2P,GACAvQ,GAAAuQ,IAAA,KAAA,KAAA,KAAA,QACA,gBA+FA7Q,KAAAkB,GAAA,OAAAnB,GAAAH,GAAA,YA+FAtwE,MAAA4xE,GAAA,QAAA0P,GACAtQ,GAAAsQ,IAAA,OAAA,OACA,WA6GAnpG,OAAA46F,GAmGAxxI,IAAA0xI,GAkGAj7F,MAAAq7F,GAkEArgH,MAAAugH,GA0DAtgH,SAAAygH,GAEA34H,OAAA9O,EACA0mB,OAAA1mB,EACAmnB,OAAAnnB,EACAonB,MAAApnB,EACAinB,KAAAjnB,GA4kBAm4F,IAAA,WAAA,WAAA,UAAA,SACA,SAAAkF,EAAAwC,EAAA9B,EAAAkB,GACA,OACA2O,SAAA,IACArlE,SAAA,YACAijE,MACA4H,IAAA,SAAA7f,EAAA1tF,EAAA7V,EAAAylJ,GACAA,EAAA,KACAF,GAAAhmD,GAAAv/F,EAAAmI,QAAAo9I,GAAA7kJ,MAAA6iG,EAAA1tF,EAAA7V,EAAAylJ,EAAA,GAAA51C,EACAxC,EAAAU,EAAAkB,QASAy2C,GAAA,qBA0DAn5C,GAAA,WACA,OACAqR,SAAA,IACAD,SAAA,IACA1tF,QAAA,SAAA6mD,EAAA6uE,GACA,MAAAD,IAAA5gJ,KAAA6gJ,EAAAr5C,SACA,SAAA/I,EAAAmV,EAAA14G,GACAA,EAAAwsE,KAAA,QAAA+2B,EAAA8iC,MAAArmI,EAAAssG,WAGA,SAAA/I,EAAAmV,EAAA14G,GACAujG,EAAA3E,OAAA5+F,EAAAssG,QAAA,SAAAn/F,GACAnN,EAAAwsE,KAAA,QAAAr/D,SA2DAw7F,IAAA,WAAA,SAAAi9C,GACA,OACAhoC,SAAA,KACA3tF,QAAA,SAAA41H,GAEA,MADAD,GAAA39B,kBAAA49B,GACA,SAAAtiD,EAAA1tF,EAAA7V,GACA4lJ,EAAA19B,iBAAAryG,EAAA7V,EAAA0oG,QACA7yF,EAAAA,EAAA,GACA0tF,EAAA3E,OAAA5+F,EAAA0oG,OAAA,SAAAv7F,GACA0I,EAAAye,YAAAnnB,IAAA/N,EAAA,GAAA+N,SA2DA47F,IAAA,eAAA,WAAA,SAAAkF,EAAA23C,GACA,OACA31H,QAAA,SAAA41H,GAEA,MADAD,GAAA39B,kBAAA49B,GACA,SAAAtiD,EAAA1tF,EAAA7V,GACA,GAAA6nH,GAAA5Z,EAAAp4F,EAAA7V,KAAAA,EAAAqhH,MAAAvY,gBACA88C,GAAA19B,iBAAAryG,EAAAgyG,EAAAM,aACAtyG,EAAAA,EAAA,GACA7V,EAAA4pH,SAAA,iBAAA,SAAAz8G,GACA0I,EAAAye,YAAAnnB,IAAA/N,EAAA,GAAA+N,SAuDA07F,IAAA,OAAA,SAAA,WAAA,SAAA4G,EAAAR,EAAA22C,GACA,OACAhoC,SAAA,IACA3tF,QAAA,SAAA61H,EAAAj/B,GACA,GAAAk/B,GAAA92C,EAAA4X,EAAAje,YACAo9C,EAAA/2C,EAAA4X,EAAAje,WAAA,SAAAz7F,GACA,OAAAA,GAAA,IAAAya,YAIA,OAFAg+H,GAAA39B,kBAAA69B,GAEA,SAAAviD,EAAA1tF,EAAA7V,GACA4lJ,EAAA19B,iBAAAryG,EAAA7V,EAAA4oG,YAEArF,EAAA3E,OAAAonD,EAAA,WAGAnwI,EAAAtX,KAAAkxG,EAAAw2C,eAAAF,EAAAxiD,KAAA,WA0EAsI,GAAA1N,GACAyf,SAAA,IACArlE,QAAA,UACAijE,KAAA,SAAAjY,EAAA1tF,EAAA7V,EAAA6yI,GACAA,EAAAqT,qBAAArgJ,KAAA,WACA09F,EAAA8iC,MAAArmI,EAAA4rG,eA8SA3C,GAAA6uC,GAAA,IAAA,GAgDAzuC,GAAAyuC,GAAA,MAAA,GAgDA3uC,GAAA2uC,GAAA,OAAA,GAsDAvuC,GAAA6nC,IACAnhH,QAAA,SAAApa,EAAA7V,GACAA,EAAAwsE,KAAA,UAAAptE,GACAyW,EAAAnW,YAAA,eAsOA+pG,IAAA,WACA,OACAmU,SAAA,IACAra,OAAA,EACAsB,WAAA,IACA8Y,SAAA,OAqNA/Q,MAKAu5C,IACAnkH,MAAA,EACA7L,OAAA,EAEA54B,GACA,8IAAA8H,MAAA,KACA,SAAAo4B,GACA,GAAA2+E,GAAAmF,GAAA,MAAA9jF,EACAmvE,IAAAwP,IAAA,SAAA,aAAA,SAAAnN,EAAAE,GACA,OACAyO,SAAA,IACA3tF,QAAA,SAAA2uB,EAAA5+C,GAKA,GAAAsR,GAAA29F,EAAAjvG,EAAAo8G,GAAA,MAAA,EACA,OAAA,UAAA7Y,EAAA1tF,GACAA,EAAA1E,GAAAssB,EAAA,SAAAzkB,GACA,GAAA6P,GAAA,WACAvX,EAAAiyF,GAAA8/B,OAAArqH,IAEAmtI,IAAA1oH,IAAA0xE,EAAAshB,QACAltB,EAAA5E,WAAA91E,GAEA06E,EAAAC,OAAA36E,WA+eA,IAAAkhF,KAAA,WAAA,SAAAgD,GACA,OACA4Z,cAAA,EACAtG,WAAA,UACA1C,SAAA,IACAiD,UAAA,EACAhD,SAAA,IACAkI,OAAA,EACAtK,KAAA,SAAAuI,EAAAnlE,EAAAyiE,EAAAwxB,EAAA5uB,GACA,GAAA7c,GAAAqY,EAAA2mC,CACAriC,GAAAnlB,OAAAyiB,EAAAvX,KAAA,SAAA38F,GAEAA,EACAsyG,GACAwE,EAAA,SAAAviH,EAAA6nH,GACA9J,EAAA8J,EACA7nH,EAAAA,EAAAJ,UAAAhG,EAAAw3B,cAAA,cAAAuuF,EAAAvX,KAAA,KAIA1C,GACA1lG,MAAAA,GAEAqrG,EAAAj9C,MAAApuD,EAAAk9C,EAAAj+C,SAAAi+C,MAIAwnG,IACAA,EAAApoJ,SACAooJ,EAAA,MAEA3mC,IACAA,EAAAza,WACAya,EAAA,MAEArY,IACAg/C,EAAA3gD,GAAA2B,EAAA1lG,OACAqrG,EAAAh9C,MAAAq2F,GAAA/rH,KAAA,WACA+rH,EAAA,OAEAh/C,EAAA,aA0LA6C,IAAA,mBAAA,gBAAA,WACA,SAAAgG,EAAApD,EAAAE,GACA,OACA6Q,SAAA,MACAD,SAAA,IACAiD,UAAA,EACAP,WAAA,UACAxb,WAAAlB,GAAA3zF,KACAigB,QAAA,SAAApa,EAAA7V,GACA,GAAAqmJ,GAAArmJ,EAAAgqG,WAAAhqG,EAAA5B,IACAkoJ,EAAAtmJ,EAAAyI,QAAA,GACA89I,EAAAvmJ,EAAAwmJ,UAEA,OAAA,UAAAjjD,EAAA3kD,EAAAyiE,EAAAwxB,EAAA5uB,GACA,GACAqf,GACAmjB,EACAC,EAHAC,EAAA,EAKAC,EAAA,WACAH,IACAA,EAAAzoJ,SACAyoJ,EAAA,MAEAnjB,IACAA,EAAAt+B,WACAs+B,EAAA,MAEAojB,IACA35C,EAAAh9C,MAAA22F,GAAArsH,KAAA,WACAosH,EAAA,OAEAA,EAAAC,EACAA,EAAA,MAIAnjD,GAAA3E,OAAAynD,EAAA,SAAAjoJ,GACA,GAAAyoJ,GAAA,YACAvoD,EAAAioD,IAAAA,IAAAhjD,EAAA8iC,MAAAkgB,IACA15C,KAGAi6C,IAAAH,CAEAvoJ,IAGA6xG,EAAA7xG,GAAA,GAAAi8B,KAAA,SAAA/T,GACA,GAAAwgI,IAAAH,EAAA,CACA,GAAAp9B,GAAAhmB,EAAAwc,MACA8yB,GAAArjF,SAAAlpC,CAQA,IAAA5kB,GAAAuiH,EAAAsF,EAAA,SAAA7nH,GACAklJ,IACA75C,EAAAj9C,MAAApuD,EAAA,KAAAk9C,GAAAvkB,KAAAwsH,IAGAvjB,GAAA/Z,EACAm9B,EAAAhlJ,EAEA4hI,EAAAqD,MAAA,wBAAAvoI,GACAmlG,EAAA8iC,MAAAigB,KACA,WACAQ,IAAAH,IACAC,IACArjD,EAAAojC,MAAA,uBAAAvoI,MAGAmlG,EAAAojC,MAAA,2BAAAvoI,KAEAwoJ,IACA/T,EAAArjF,SAAA,aAaAk9C,IAAA,WACA,SAAAk5C,GACA,OACAhoC,SAAA,MACAD,cACAplE,QAAA,YACAijE,KAAA,SAAAjY,EAAA3kD,EAAAyiE,EAAAwxB,GACA,MAAA,MAAA/tI,KAAA85C,EAAA,GAAAh3B,aAIAg3B,EAAA38C,YACA2jJ,GAAA9zC,GAAA+gC,EAAArjF,SAAAl0D,GAAAiB,YAAAgnG,EACA,SAAA7hG,GACAk9C,EAAA78C,OAAAL,KACAo9G,oBAAAlgE,MAIAA,EAAArgD,KAAAs0I,EAAArjF,cACAo2F,GAAAhnG,EAAA34B,YAAAs9E,QA6DA4G,GAAAinC,IACAzzB,SAAA,IACA1tF,QAAA,WACA,OACAmzF,IAAA,SAAA7f,EAAA1tF,EAAA+K,GACA2iF,EAAA8iC,MAAAzlH,EAAAspF,aA0FAyB,GAAA,WACA,OACAiS,SAAA,IACAD,SAAA,IACAplE,QAAA,UACAijE,KAAA,SAAAjY,EAAA1tF,EAAA7V,EAAA6yI,GAGA,GAAAnnC,GAAA71F,EAAA7V,KAAAA,EAAAqhH,MAAA3V,SAAA,KACAq7C,EAAA,UAAA/mJ,EAAA8zI,OACA1vC,EAAA2iD,EAAAzpI,GAAAouF,GAAAA,EAEA17D,EAAA,SAAAknG,GAEA,IAAA74C,EAAA64C,GAAA,CAEA,GAAAh8H,KAQA,OANAg8H,IACA35I,EAAA25I,EAAA7xI,MAAA++F,GAAA,SAAAj3F,GACAA,GAAA+N,EAAArV,KAAAkhJ,EAAAzpI,GAAAnQ,GAAAA,KAIA+N,GAGA23H,GAAAqD,SAAArwI,KAAAmqC,GACA6iG,EAAAW,YAAA3tI,KAAA,SAAAsH,GACA,MAAAoN,IAAApN,GACAA,EAAA3H,KAAAkmG,GAGAtsG,IAIAyzI,EAAAY,SAAA,SAAAtmI,GACA,OAAAA,IAAAA,EAAA7L,WAcAg4I,GAAA,WACAC,GAAA,aACAvG,GAAA,cACAC,GAAA,WACA+T,GAAA,eACAC,GAAA,aACAjO,GAAA,aAGA5C,GAAA,GAAA95C,GAAA,WAwMA4qD,IAAA,SAAA,oBAAA,SAAA,WAAA,SAAA,WAAA,WAAA,aAAA,KAAA,eACA,SAAAnjC,EAAAlW,EAAAwT,EAAAziE,EAAAqwD,EAAAlC,EAAAsD,EAAAlB,EAAAE,EAAApB,GACA1uG,KAAAw0I,WAAAtyF,OAAAqzF,IACAv1I,KAAA4nJ,YAAA1lG,OAAAqzF,IACAv1I,KAAA6nJ,gBAAAhoJ,EACAG,KAAAg3I,eACAh3I,KAAA8nJ,oBACA9nJ,KAAA22I,YACA32I,KAAAi0I,eACAj0I,KAAA2mJ,wBACA3mJ,KAAA+nJ,YAAA,EACA/nJ,KAAAgoJ,UAAA,EACAhoJ,KAAAyyI,WAAA,EACAzyI,KAAAwyI,QAAA,EACAxyI,KAAA0yI,QAAA,EACA1yI,KAAA2yI,UAAA,EACA3yI,KAAAqyI,UACAryI,KAAAsyI,aACAtyI,KAAAuyI,SAAA1yI,EACAG,KAAAgyI,MAAAtjC,EAAAoT,EAAAhqG,MAAA,IAAA,GAAA0sG,EAGA,IAKAyjC,GALAC,EAAAx4C,EAAAoS,EAAA7V,SACAk8C,EAAAD,EAAA7+D,OACA++D,EAAAF,EACAG,EAAAF,EACAG,EAAA,KAEAhV,EAAAtzI,IAEAA,MAAAuoJ,aAAA,SAAA7qJ,GAEA,GADA41I,EAAAmD,SAAA/4I,EACAA,GAAAA,EAAA8qJ,aAAA,CACA,GAAAC,GAAA/4C,EAAAoS,EAAA7V,QAAA,MACAy8C,EAAAh5C,EAAAoS,EAAA7V,QAAA,SAEAm8C,GAAA,SAAA5jC,GACA,GAAAkzB,GAAAwQ,EAAA1jC,EAIA,OAHAjsG,GAAAm/H,KACAA,EAAA+Q,EAAAjkC,IAEAkzB,GAEA2Q,EAAA,SAAA7jC,EAAA4E,GACA7wG,EAAA2vI,EAAA1jC,IACAkkC,EAAAlkC,GAAAmkC,KAAArV,EAAAsU,cAEAO,EAAA3jC,EAAA8uB,EAAAsU,kBAGA,KAAAM,EAAA7+D,OACA,KAAAwtD,IAAA,YAAA,mDACA/0B,EAAA7V,QAAA9J,EAAA9iD,KAwBAr/C,KAAA60I,QAAApkI,EAoBAzQ,KAAAk0I,SAAA,SAAAtmI,GACA,MAAAkxF,GAAAlxF,IAAA,KAAAA,GAAA,OAAAA,GAAAA,IAAAA,EAGA,IAAAskI,GAAA7yF,EAAAkmD,cAAA,oBAAA6sC,GACAwW,EAAA,CAwBAvV,KACAC,KAAAtzI,KACAq/C,SAAAA,EACArzC,IAAA,SAAAiN,EAAA25E,GACA35E,EAAA25E,IAAA,GAEA2gD,MAAA,SAAAt6H,EAAA25E,SACA35E,GAAA25E,IAEAs/C,WAAAA,EACA1kC,SAAAA,IAcAxtG,KAAA2zI,aAAA,WACAL,EAAAd,QAAA,EACAc,EAAAb,WAAA,EACAjlC,EAAArtG,YAAAk/C,EAAAq0F,IACAlmC,EAAAptG,SAAAi/C,EAAAo0F,KAcAzzI,KAAAwzI,UAAA,WACAF,EAAAd,QAAA,EACAc,EAAAb,WAAA,EACAjlC,EAAArtG,YAAAk/C,EAAAo0F,IACAjmC,EAAAptG,SAAAi/C,EAAAq0F,IACAxB,EAAAsB,aAeAxzI,KAAA8zI,cAAA,WACAR,EAAA0U,UAAA,EACA1U,EAAAyU,YAAA,EACAv6C,EAAAomC,SAAAv0F,EAAAooG,GAAAC,KAcA1nJ,KAAA6oJ,YAAA,WACAvV,EAAA0U,UAAA,EACA1U,EAAAyU,YAAA,EACAv6C,EAAAomC,SAAAv0F,EAAAqoG,GAAAD,KAgEAznJ,KAAA8yI,mBAAA,WACAhiC,EAAA6K,OAAA2sC,GACAhV,EAAAkB,WAAAlB,EAAAwV,yBACAxV,EAAAuB,WAeA70I,KAAAi3I,UAAA,WAEA,IAAAh4C,EAAAq0C,EAAAsU,eAAAzlG,MAAAmxF,EAAAsU,aAAA,CAIA,GAAAjQ,GAAArE,EAAAwV,yBAKApR,EAAApE,EAAAuU,gBAEAkB,EAAAzV,EAAAZ,OACAsW,EAAA1V,EAAAsU,YAEAqB,EAAA3V,EAAAmD,UAAAnD,EAAAmD,SAAAwS,YAEA3V,GAAA4V,gBAAAxR,EAAAC,EAAA,SAAAwR,GAGAF,GAAAF,IAAAI,IAKA7V,EAAAsU,YAAAuB,EAAAzR,EAAA73I,EAEAyzI,EAAAsU,cAAAoB,GACA1V,EAAA8V,2BAOAppJ,KAAAkpJ,gBAAA,SAAAxR,EAAAC,EAAA0R,GAeA,QAAAC,KACA,GAAAC,GAAAjW,EAAAoD,cAAA,OACA,OAAAuR,KAAApoJ,GAGAooJ,IACAjqJ,EAAAs1I,EAAA0D,YAAA,SAAApvH,EAAA9P,GACAshI,EAAAthI,EAAA,QAEA9Z,EAAAs1I,EAAAwU,iBAAA,SAAAlgI,EAAA9P,GACAshI,EAAAthI,EAAA,SAIAshI,EAAAmQ,EAAAtB,GACAA,IAZA7O,EAAAmQ,EAAA,OAcA,GAGA,QAAAC,KACA,GAAAC,IAAA,CAMA,OALAzrJ,GAAAs1I,EAAA0D,YAAA,SAAAp6I,EAAAkb,GACA,GAAA6L,GAAA/mB,EAAA86I,EAAAC,EACA8R,GAAAA,GAAA9lI,EACAy1H,EAAAthI,EAAA6L,OAEA8lI,IACAzrJ,EAAAs1I,EAAAwU,iBAAA,SAAAlgI,EAAA9P,GACAshI,EAAAthI,EAAA,SAEA,GAKA,QAAA4xI,KACA,GAAAC,MACAR,GAAA,CACAnrJ,GAAAs1I,EAAAwU,iBAAA,SAAAlrJ,EAAAkb,GACA,GAAA4M,GAAA9nB,EAAA86I,EAAAC,EACA,KAAAj4C,EAAAh7E,GACA,KAAAmyH,IAAA,mBACA,6EAAAnyH,EAEA00H,GAAAthI,EAAAjY,GACA8pJ,EAAArjJ,KAAAoe,EAAAoW,KAAA,WACAs+G,EAAAthI,GAAA,IACA,SAAA0P,GACA2hI,GAAA,EACA/P,EAAAthI,GAAA,QAGA6xI,EAAA5nJ,OAGA+tG,EAAAhnF,IAAA6gI,GAAA7uH,KAAA,WACA8uH,EAAAT,IACA14I,GAJAm5I,GAAA,GAQA,QAAAxQ,GAAAthI,EAAAgiI,GACA+P,IAAAjB,GACAtV,EAAAF,aAAAt7H,EAAAgiI,GAIA,QAAA8P,GAAAT,GACAU,IAAAjB,GAEAS,EAAAF,GArFAP,GACA,IAAAiB,GAAAjB,CAGA,OAAAU,MAIAE,QAIAE,SAPAE,IAAA,IAgGA5pJ,KAAA+yI,iBAAA,WACA,GAAA4E,GAAArE,EAAAkB,UAEA1jC,GAAA6K,OAAA2sC,IAKAhV,EAAAwV,2BAAAnR,GAAA,KAAAA,GAAArE,EAAAmB,yBAGAnB,EAAAwV,yBAAAnR,EAGArE,EAAAb,WACAzyI,KAAAwzI,YAEAxzI,KAAA8pJ,uBAGA9pJ,KAAA8pJ,mBAAA,WAwCA,QAAAC,KACAzW,EAAAsU,cAAAoB,GACA1V,EAAA8V,sBAzCA,GAAAzR,GAAArE,EAAAwV,yBACApR,EAAAC,CAGA,IAFAsQ,GAAAnpD,EAAA44C,IAAA73I,EAGA,IAAA,GAAAoI,GAAA,EAAAA,EAAAqrI,EAAAqD,SAAA50I,OAAAkG,IAEA,GADAyvI,EAAApE,EAAAqD,SAAA1uI,GAAAyvI,GACA54C,EAAA44C,GAAA,CACAuQ,GAAA,CACA,OAIAhpD,EAAAq0C,EAAAsU,cAAAzlG,MAAAmxF,EAAAsU,eAEAtU,EAAAsU,YAAAQ,EAAA5jC,GAEA,IAAAwkC,GAAA1V,EAAAsU,YACAqB,EAAA3V,EAAAmD,UAAAnD,EAAAmD,SAAAwS,YACA3V,GAAAuU,gBAAAnQ,EAEAuR,IACA3V,EAAAsU,YAAAlQ,EACAqS,KAKAzW,EAAA4V,gBAAAxR,EAAApE,EAAAwV,yBAAA,SAAAK,GACAF,IAKA3V,EAAAsU,YAAAuB,EAAAzR,EAAA73I,EACAkqJ,QAWA/pJ,KAAAopJ,oBAAA,WACAf,EAAA7jC,EAAA8uB,EAAAsU,aACA5pJ,EAAAs1I,EAAAqT,qBAAA,SAAAjsC,GACA,IACAA,IACA,MAAAr7G,GACAivG,EAAAjvG,OA6CAW,KAAA00I,cAAA,SAAA9mI,EAAAiyB,GACAyzG,EAAAkB,WAAA5mI,EACA0lI,EAAAmD,WAAAnD,EAAAmD,SAAAuT,iBACA1W,EAAA2W,0BAAApqH,IAIA7/B,KAAAiqJ,0BAAA,SAAApqH,GACA,GAEAxoB,GAFA6yI,EAAA,EACAxsJ,EAAA41I,EAAAmD,QAGA/4I,IAAAqhG,EAAArhG,EAAA2Z,YACAA,EAAA3Z,EAAA2Z,SACA4nF,EAAA5nF,GACA6yI,EAAA7yI,EACA4nF,EAAA5nF,EAAAwoB,IACAqqH,EAAA7yI,EAAAwoB,GACAo/D,EAAA5nF,EAAA,cACA6yI,EAAA7yI,EAAA,aAIAy5F,EAAA6K,OAAA2sC,GACA4B,EACA5B,EAAAx3C,EAAA,WACAwiC,EAAAP,oBACAmX,GACAt6C,EAAAshB,QACAoiB,EAAAP,mBAEAvuB,EAAAvgB,OAAA,WACAqvC,EAAAP,sBAaAvuB,EAAAnlB,OAAA,WACA,GAAAq4C,GAAA0Q,EAAA5jC,EAIA,IAAAkzB,IAAApE,EAAAsU,cAEAtU,EAAAsU,cAAAtU,EAAAsU,aAAAlQ,IAAAA,GACA,CACApE,EAAAsU,YAAAtU,EAAAuU,gBAAAnQ,EACAuQ,EAAApoJ,CAMA,KAJA,GAAAsqJ,GAAA7W,EAAAW,YACA59G,EAAA8zH,EAAApoJ,OAEA41I,EAAAD,EACArhH,KACAshH,EAAAwS,EAAA9zH,GAAAshH,EAEArE,GAAAkB,aAAAmD,IACArE,EAAAkB,WAAAlB,EAAAwV,yBAAAnR,EACArE,EAAAuB,UAEAvB,EAAA4V,gBAAAxR,EAAAC,EAAAlnI,IAIA,MAAAinI,OA6KAxrC,IAAA,aAAA,SAAA0D,GACA,OACAyO,SAAA,IACArlE,SAAA,UAAA,SAAA,oBACAssD,WAAAqiD,GAIAvpC,SAAA,EACA1tF,QAAA,SAAApa,GAIA,MAFAA,GAAAlW,SAAAqzI,IAAArzI,SAAAqnJ,IAAArnJ,SAAA25I,KAGAl2B,IAAA,SAAA7f,EAAA1tF,EAAA7V,EAAAylJ,GACA,GAAAkE,GAAAlE,EAAA,GACAmE,EAAAnE,EAAA,IAAA9T,EAEAgY,GAAA7B,aAAArC,EAAA,IAAAA,EAAA,GAAAzP,UAGA4T,EAAAxX,YAAAuX,GAEA3pJ,EAAA4pH,SAAA,OAAA,SAAAjB,GACAghC,EAAApY,QAAA5oB,GACAihC,EAAArX,gBAAAoX,EAAAhhC,KAIAplB,EAAA2c,IAAA,WAAA,WACA0pC,EAAAlX,eAAAiX,MAGAtmC,KAAA,SAAA9f,EAAA1tF,EAAA7V,EAAAylJ,GACA,GAAAkE,GAAAlE,EAAA,EACAkE,GAAA3T,UAAA2T,EAAA3T,SAAA6T,UACAh0I,EAAA1E,GAAAw4I,EAAA3T,SAAA6T,SAAA,SAAAhW,GACA8V,EAAAH,0BAAA3V,GAAAA,EAAA1rI,QAIA0N,EAAA1E,GAAA,OAAA,SAAA0iI,GACA8V,EAAApC,WAEAp4C,EAAAshB,QACAltB,EAAA5E,WAAAgrD,EAAAvB,aAEA7kD,EAAAC,OAAAmmD,EAAAvB,sBASA0B,GAAA,wBAkKAr9C,GAAA,WACA,OACAmR,SAAA,IACA/Y,YAAA,SAAA,SAAA,SAAAkf,EAAAC,GACA,GAAA74D,GAAA5rD,IACAA,MAAAy2I,SAAA/sH,EAAA86F,EAAAsiB,MAAAriB,EAAAxX,iBAEAjtG,KAAAy2I,SAAA6T,WAAAzqJ,GACAG,KAAAy2I,SAAAuT,iBAAA,EAEAhqJ,KAAAy2I,SAAA6T,SAAAvsI,GAAA/d,KAAAy2I,SAAA6T,SAAArnJ,QAAAsnJ,GAAA,WAEA,MADA3+F,GAAA6qF,SAAAuT,iBAAA,EACA,QAGAhqJ,KAAAy2I,SAAAuT,iBAAA,MAmJAl/C,GAAA+mC,IAAAxwB,UAAA,EAAAjD,SAAA,MAIAosC,GAAAztD,EAAA,aAqNA0tD,GAAA,4OAaA3+C,IAAA,WAAA,SAAA,SAAAu6C,EAAA32C,GAEA,QAAAg7C,GAAAC,EAAAC,EAAA5mD,GAsDA,QAAA6mD,GAAAC,EAAAnT,EAAAoT,EAAA/sG,EAAAhnB,GACAh3B,KAAA8qJ,YAAAA,EACA9qJ,KAAA23I,UAAAA,EACA33I,KAAA+qJ,MAAAA,EACA/qJ,KAAAg+C,MAAAA,EACAh+C,KAAAg3B,SAAAA,EAGA,QAAAg0H,GAAAC,GACA,GAAAC,EAEA,KAAAC,GAAA7tD,EAAA2tD,GACAC,EAAAD,MACA,CAEAC,IACA,KAAA,GAAAE,KAAAH,GACAA,EAAA1iI,eAAA6iI,IAAA,MAAAA,EAAA38I,OAAA,IACAy8I,EAAA5kJ,KAAA8kJ,GAIA,MAAAF,GA1EA,GAAApkJ,GAAA6jJ,EAAA7jJ,MAAA2jJ,GACA,KAAA,EACA,KAAAD,IAAA,OACA,2HAGAG,EAAAxoD,EAAAyoD,GAMA,IAAAS,GAAAvkJ,EAAA,IAAAA,EAAA,GAEAqkJ,EAAArkJ,EAAA,GAGAwkJ,EAAA,OAAA/lJ,KAAAuB,EAAA,KAAAA,EAAA,GAEAykJ,EAAAzkJ,EAAA,GAEA83F,EAAA8Q,EAAA5oG,EAAA,GAAAA,EAAA,GAAAukJ,GACAG,EAAAF,GAAA57C,EAAA47C,GACAG,EAAAD,GAAA5sD,EACA8sD,EAAAH,GAAA77C,EAAA67C,GAKAI,EAAAJ,EACA,SAAA39I,EAAA0qG,GAAA,MAAAozC,GAAA1nD,EAAAsU,IACA,SAAA1qG,GAAA,MAAA8nG,IAAA9nG,IACAg+I,EAAA,SAAAh+I,EAAAgM,GACA,MAAA+xI,GAAA/9I,EAAAi+I,EAAAj+I,EAAAgM,KAGAkyI,EAAAp8C,EAAA5oG,EAAA,IAAAA,EAAA,IACAilJ,EAAAr8C,EAAA5oG,EAAA,IAAA,IACAklJ,EAAAt8C,EAAA5oG,EAAA,IAAA,IACAmlJ,EAAAv8C,EAAA5oG,EAAA,IAEAwxG,KACAuzC,EAAAV,EAAA,SAAAv9I,EAAAgM,GAGA,MAFA0+F,GAAA6yC,GAAAvxI,EACA0+F,EAAA+yC,GAAAz9I,EACA0qG,GACA,SAAA1qG,GAEA,MADA0qG,GAAA+yC,GAAAz9I,EACA0qG,EA6BA,QACAizC,QAAAA,EACAK,gBAAAA,EACAM,cAAAx8C,EAAAu8C,EAAA,SAAAhB,GAIA,GAAAkB,KACAlB,GAAAA,KAIA,KAAA,GAFAC,GAAAF,EAAAC,GACAmB,EAAAlB,EAAAnpJ,OACAxB,EAAA,EAAAA,EAAA6rJ,EAAA7rJ,IAAA,CACA,GAAAqZ,GAAAqxI,IAAAC,EAAA3qJ,EAAA2qJ,EAAA3qJ,GAGA+3G,GAFA2yC,EAAArxI,GAEAiyI,EAAAZ,EAAArxI,GAAAA,IACAkxI,EAAAa,EAAAV,EAAArxI,GAAA0+F,EAIA,IAHA6zC,EAAA7lJ,KAAAwkJ,GAGAhkJ,EAAA,IAAAA,EAAA,GAAA,CACA,GAAAikJ,GAAAe,EAAA9nD,EAAAsU,EACA6zC,GAAA7lJ,KAAAykJ,GAIA,GAAAjkJ,EAAA,GAAA,CACA,GAAAulJ,GAAAL,EAAAhoD,EAAAsU,EACA6zC,GAAA7lJ,KAAA+lJ,IAGA,MAAAF,KAGAj8F,WAAA,WAWA,IAAA,GATAo8F,MACAC,KAIAtB,EAAAgB,EAAAjoD,OACAknD,EAAAF,EAAAC,GACAmB,EAAAlB,EAAAnpJ,OAEAxB,EAAA,EAAAA,EAAA6rJ,EAAA7rJ,IAAA,CACA,GAAAqZ,GAAAqxI,IAAAC,EAAA3qJ,EAAA2qJ,EAAA3qJ,GACAqN,EAAAq9I,EAAArxI,GACA0+F,EAAAuzC,EAAAj+I,EAAAgM,GACA+9H,EAAA8T,EAAAznD,EAAAsU,GACAwyC,EAAAa,EAAAhU,EAAAr/B,GACAyyC,EAAAe,EAAA9nD,EAAAsU,GACAt6D,EAAA+tG,EAAA/nD,EAAAsU,GACAthF,EAAAg1H,EAAAhoD,EAAAsU,GACAk0C,EAAA,GAAA3B,GAAAC,EAAAnT,EAAAoT,EAAA/sG,EAAAhnB,EAEAs1H,GAAAhmJ,KAAAkmJ,GACAD,EAAAzB,GAAA0B,EAGA,OACA91E,MAAA41E,EACAC,eAAAA,EACAE,uBAAA,SAAA7+I,GACA,MAAA2+I,GAAAX,EAAAh+I,KAEA8+I,uBAAA,SAAA5nH,GAGA,MAAAymH,GAAAnnD,GAAA16E,KAAAob,EAAA6yG,WAAA7yG,EAAA6yG,cAUA,GAAAgV,GAAA5wJ,EAAAG,cAAA,UACA0wJ,EAAA7wJ,EAAAG,cAAA,WAEA,QACAmiH,SAAA,IACAgD,UAAA,EACAroE,SAAA,SAAA,YACAijE,KAAA,SAAAjY,EAAA4mD,EAAAnqJ,EAAAylJ,GAoLA,QAAA2G,GAAA/nH,EAAAxuB,GACAwuB,EAAAxuB,QAAAA,EACAA,EAAA0gB,SAAA8N,EAAA9N,SACA8N,EAAAl3B,QAAA0I,EAAA1I,QAAA0I,EAAA1I,MAAAk3B,EAAAgmH,aACAhmH,EAAAimH,QAAAz0I,EAAAy0I,QACAz0I,EAAAy0I,MAAAjmH,EAAAimH,MACAz0I,EAAAye,YAAA+P,EAAAimH,OAIA,QAAA+B,GAAA1rJ,EAAA8lB,EAAAte,EAAA09I,GACA,GAAAhwI,EAgBA,OAdA4Q,IAAA84E,GAAA94E,EAAA1hB,YAAAoD,EAEA0N,EAAA4Q,GAGA5Q,EAAAgwI,EAAAtiJ,WAAA,GACAkjB,EAKA9lB,EAAArE,aAAAuZ,EAAA4Q,GAHA9lB,EAAA6C,YAAAqS,IAMAA,EAIA,QAAAy2I,GAAA7lI,GAEA,IADA,GAAA8R,GACA9R,GACA8R,EAAA9R,EAAA6F,YACA4nF,GAAAztF,GACAA,EAAA8R,EAKA,QAAAg0H,GAAA9lI,GACA,GAAA+lI,GAAAC,GAAAA,EAAA,GACAC,EAAAC,GAAAA,EAAA,EAEA,IAAAH,GAAAE,EACA,KAAAjmI,IACAA,IAAA+lI,GACA/lI,IAAAimI,IACAjmI,EAAAA,EAAA6F,WAGA,OAAA7F,GAIA,QAAAmmI,KAEA,GAAAzrG,GAAAlkD,GAAA4vJ,EAAAC,WAEA7vJ,GAAAmuG,EAAA37C,YAEA,IAAAs9F,MACArG,EAAAyD,EAAA,GAAA1mJ,UAyEA,IAtEAupJ,GACA7C,EAAAlkH,QAAAwmH,GAGA/F,EAAA6F,EAAA7F,GAEAzpJ,EAAAg5E,MAAA14E,QAAA,SAAA8mC,GACA,GAAAkZ,GACA0vG,EACAC,CAEA7oH,GAAAkZ,OAIAA,EAAAwvG,EAAA1oH,EAAAkZ,OAEAA,IAGA0vG,EAAAZ,EAAAlC,EAAA,GACAzD,EACA,WACAyF,GAEAzF,EAAAuG,EAAA3gI,YAGA2gI,EAAA3C,MAAAjmH,EAAAkZ,MAGAA,EAAAwvG,EAAA1oH,EAAAkZ,QACA0vG,aAAAA,EACAE,qBAAAF,EAAAxpJ,aAMAypJ,EAAAb,EAAA9uG,EAAA0vG,aACA1vG,EAAA4vG,qBACA,SACAjB,GACAE,EAAA/nH,EAAA6oH,GAEA3vG,EAAA4vG,qBAAAD,EAAA5gI,cAKA4gI,EAAAb,EAAAlC,EAAA,GACAzD,EACA,SACAwF,GACAE,EAAA/nH,EAAA6oH,GAEAxG,EAAAwG,EAAA5gI,eAMAvmB,OAAA2lB,KAAAqhI,GAAAxvJ,QAAA,SAAA4b,GACAmzI,EAAAS,EAAA5zI,GAAAg0I,wBAEAb,EAAA5F,GAEA0G,EAAAhZ,WAGAgZ,EAAA3Z,SAAAtyF,GAAA,CACA,GAAAksG,GAAAR,EAAAC,aACA1hD,EAAA0/C,QAAA7qD,EAAA9+C,EAAAksG,GAAAlsG,IAAAksG,KACAD,EAAAnZ,cAAAoZ,GACAD,EAAAhZ,YA7TA,GAAAgZ,GAAA3H,EAAA,EACA,IAAA2H,EAAA,CAQA,IAAA,GADAX,GALAI,EAAApH,EAAA,GACAnL,EAAAt6I,EAAAs6I,SAKA9yI,EAAA,EAAA8wB,EAAA6xH,EAAA7xH,WAAAslE,EAAAtlE,EAAAh3B,OAAAkG,EAAAo2F,EAAAp2F,IACA,GAAA,KAAA8wB,EAAA9wB,GAAA2F,MAAA,CACAs/I,EAAAn0H,EAAAvP,GAAAvhB,EACA,OAIA,GAAAwlJ,KAAAP,EAEAE,EAAAhrD,GAAAuqD,EAAA3oJ,WAAA,GACAopJ,GAAAvsJ,IAAA,IAEA,IAAAnD,GACAmuG,EAAA6+C,EAAAjqJ,EAAAorG,UAAA++C,EAAA5mD,GAGA+pD,EAAA,WACAN,GACA7C,EAAAlkH,QAAAwmH,GAEAtC,EAAA/pJ,IAAA,IACAqsJ,EAAAvsI,KAAA,YAAA,GACAusI,EAAAzsJ,KAAA,YAAA,IAGAutJ,EAAA,WACAP,GACAP,EAAAzuJ,UAKAwvJ,EAAA,WACArD,EAAAlkH,QAAA0mH,GACAxC,EAAA/pJ,IAAA,KACAusJ,EAAAzsI,KAAA,YAAA,GACAysI,EAAA3sJ,KAAA,YAAA,IAGAytJ,EAAA,WACAd,EAAA3uJ,SAKAs8I,IAgDA8S,EAAA3Z,SAAA,SAAAtmI,GACA,OAAAA,GAAA,IAAAA,EAAA7L,QAIAurJ,EAAAa,WAAA,SAAAvgJ,GACAlQ,EAAAg5E,MAAA14E,QAAA,SAAA8mC,GACAA,EAAAxuB,QAAA2H,UAAA,IAGArQ,GACAA,EAAA5P,QAAA,SAAAgH,GACA,GAAA8/B,GAAApnC,EAAA+uJ,uBAAAznJ,EACA8/B,KAAAA,EAAA9N,WAAA8N,EAAAxuB,QAAA2H,UAAA,MAMAqvI,EAAAC,UAAA,WACA,GAAAa,GAAAxD,EAAA/pJ,UACAwtJ,IAOA,OALArwJ,GAAAowJ,EAAA,SAAAxgJ,GACA,GAAAk3B,GAAApnC,EAAA6uJ,eAAA3+I,EACAk3B,GAAA9N,UAAAq3H,EAAA/nJ,KAAA5I,EAAAgvJ,uBAAA5nH,MAGAupH,GAKAxiD,EAAA0/C,SAEAvnD,EAAA0mB,iBAAA,WACA,GAAA1vG,GAAA6yI,EAAArZ,YACA,MAAAqZ,GAAArZ,WAAAzvI,IAAA,SAAA6I,GACA,MAAAi+F,GAAA+/C,gBAAAh+I,MAGA,WACAigJ,EAAAhZ,cAxFAyY,EAAAa,WAAA,SAAAvgJ,GACA,GAAAk3B,GAAApnC,EAAA+uJ,uBAAA7+I,EAEAk3B,KAAAA,EAAA9N,SACA4zH,EAAA,GAAAh9I,QAAAk3B,EAAAgmH,cACAoD,IACAF,IAEApD,EAAA,GAAAh9I,MAAAk3B,EAAAgmH,YACAhmH,EAAAxuB,QAAA2H,UAAA,EACA6mB,EAAAxuB,QAAAvS,aAAA,WAAA,aAGA,OAAA6J,GAAA6/I,GACAS,IACAH,MAEAC,IACAC,MAKAX,EAAAC,UAAA,WAEA,GAAAe,GAAA5wJ,EAAA6uJ,eAAA3B,EAAA/pJ,MAEA,OAAAytJ,KAAAA,EAAAt3H,UACAg3H,IACAE,IACAxwJ,EAAAgvJ,uBAAA4B,IAEA,MAKAziD,EAAA0/C,SACAvnD,EAAA3E,OACA,WAAA,MAAAwM,GAAA+/C,gBAAAiC,EAAArZ,aACA,WAAAqZ,EAAAhZ,aAuDA4Y,GAIAP,EAAAzuJ,SAGA4nJ,EAAA6G,GAAAlpD,GAIAkpD,EAAA/sJ,YAAA,aAEA+sJ,EAAA9qD,GAAAuqD,EAAA3oJ,WAAA,IAKAqpJ,IAGArpD,EAAA0mB,iBAAA7e,EAAAqgD,cAAAmB,QA0UAriD,IAAA,UAAA,eAAA,OAAA,SAAA4iC,EAAAl/B,EAAAc,GACA,GAAA++C,GAAA,MACAC,EAAA,oBAEA,QACAvyC,KAAA,SAAAjY,EAAA1tF,EAAA7V,GAoDA,QAAAguJ,GAAAC,GACAp4I,EAAAnV,KAAAutJ,GAAA,IApDA,GASAC,GATAC,EAAAnuJ,EAAAy8B,MACA2xH,EAAApuJ,EAAAqhH,MAAAtmF,MAAAllB,EAAA7V,KAAAA,EAAAqhH,MAAAtmF,MACA4b,EAAA32C,EAAA22C,QAAA,EACA03G,EAAA9qD,EAAA8iC,MAAA+nB,OACAE,KACAjjC,EAAApd,EAAAod,cACAC,EAAArd,EAAAqd,YACAijC,EAAAljC,EAAA8iC,EAAA,IAAAx3G,EAAA20E,EACAkjC,EAAA7qD,GAAA3zF,IAGAzS,GAAAyC,EAAA,SAAAssH,EAAAmiC,GACA,GAAAC,GAAAX,EAAArhJ,KAAA+hJ,EACA,IAAAC,EAAA,CACA,GAAAC,IAAAD,EAAA,GAAA,IAAA,IAAAnvD,GAAAmvD,EAAA,GACAL,GAAAM,GAAA94I,EAAA7V,KAAAA,EAAAqhH,MAAAotC,OAGAlxJ,EAAA8wJ,EAAA,SAAA/hC,EAAAnzG,GACAm1I,EAAAn1I,GAAA80F,EAAAqe,EAAA9pH,QAAAsrJ,EAAAS,MAIAhrD,EAAA3E,OAAAuvD,EAAA,SAAAx1C,GACA,GAAAl8E,GAAAjvB,WAAAmrG,GACAi2C,EAAAltG,MAAAjlB,EAUA,IARAmyH,GAAAnyH,IAAA4xH,KAGA5xH,EAAA0wG,EAAAvX,UAAAn5F,EAAAka,IAKAla,IAAAyxH,KAAAU,GAAApwD,EAAA0vD,IAAAxsG,MAAAwsG,IAAA,CACAM,GACA,IAAAK,GAAAP,EAAA7xH,EACA4hE,GAAAwwD,IACA,MAAAl2C,GACA5J,EAAAv2D,MAAA,qCAAA/b,EAAA,QAAA2xH,GAEAI,EAAAx+I,EACAg+I,KAEAQ,EAAAjrD,EAAA3E,OAAAiwD,EAAAb,GAEAE,EAAAzxH,SAqTAguE,IAAA,SAAA,WAAA,SAAAwE,EAAAlC,GACA,GAAA+hD,GAAA,eACAC,EAAAzyD,EAAA,YAEA0yD,EAAA,SAAAzrD,EAAAzjG,EAAAmvJ,EAAA9hJ,EAAA+hJ,EAAA/1I,EAAAg2I,GAEA5rD,EAAA0rD,GAAA9hJ,EACA+hJ,IAAA3rD,EAAA2rD,GAAA/1I,GACAoqF,EAAAi1C,OAAA14I,EACAyjG,EAAA6rD,OAAA,IAAAtvJ,EACAyjG,EAAA8rD,MAAAvvJ,IAAAqvJ,EAAA,EACA5rD,EAAA+rD,UAAA/rD,EAAA6rD,QAAA7rD,EAAA8rD,OAEA9rD,EAAAgsD,OAAAhsD,EAAAisD,MAAA,KAAA,EAAA1vJ,KAIA2vJ,EAAA,SAAAroD,GACA,MAAAA,GAAA1lG,MAAA,IAGAguJ,EAAA,SAAAtoD,GACA,MAAAA,GAAA1lG,MAAA0lG,EAAA1lG,MAAAJ,OAAA,GAIA,QACAs8G,SAAA,IACA+I,cAAA,EACAtG,WAAA,UACA1C,SAAA,IACAiD,UAAA,EACAkF,OAAA,EACA71F,QAAA,SAAA2uB,EAAAyiE,GACA,GAAAiL,GAAAjL,EAAA7W,SACAmlD,EAAAr0J,EAAAw3B,cAAA,kBAAAw5F,EAAA,KAEAjmH,EAAAimH,EAAAjmH,MAAA,6FAEA,KAAAA,EACA,KAAA0oJ,GAAA,OAAA,yFACAziC,EAGA,IAAAo2B,GAAAr8I,EAAA,GACAo8I,EAAAp8I,EAAA,GACAupJ,EAAAvpJ,EAAA,GACAwpJ,EAAAxpJ,EAAA,EAIA,IAFAA,EAAAq8I,EAAAr8I,MAAA,2DAEAA,EACA,KAAA0oJ,GAAA,SAAA,gHACArM,EAEA,IAAAuM,GAAA5oJ,EAAA,IAAAA,EAAA,GACA6oJ,EAAA7oJ,EAAA,EAEA,IAAAupJ,KAAA,6BAAA9qJ,KAAA8qJ,IACA,4FAAA9qJ,KAAA8qJ,IACA,KAAAb,GAAA,WAAA,yFACAa,EAGA,IAAAE,GAAAC,EAAAC,EAAAC,EACAC,GAAArtB,IAAA5tB,GAaA,OAXA46C,GACAC,EAAA7gD,EAAA4gD,IAEAG,EAAA,SAAA72I,EAAAhM,GACA,MAAA8nG,IAAA9nG,IAEA8iJ,EAAA,SAAA92I,GACA,MAAAA,KAIA,SAAA4qG,EAAAnlE,EAAAyiE,EAAAwxB,EAAA5uB,GAEA6rC,IACAC,EAAA,SAAA52I,EAAAhM,EAAArN,GAKA,MAHAovJ,KAAAgB,EAAAhB,GAAA/1I,GACA+2I,EAAAjB,GAAA9hJ,EACA+iJ,EAAA1X,OAAA14I,EACAgwJ,EAAA/rC,EAAAmsC,IAYA,IAAAC,GAAA5vD,IAGAwjB,GAAAkG,iBAAAw4B,EAAA,SAAAxhI,GACA,GAAAnhB,GAAAwB,EAGA8uJ,EAIAC,EACAl3I,EAAAhM,EACAmjJ,EACAC,EACAC,EACAppD,EACAqpD,EACAznC,EAbA0nC,EAAA9xG,EAAA,GAKA+xG,EAAApwD,IAcA,IAJAqvD,IACA7rC,EAAA6rC,GAAA3uI,GAGA47E,EAAA57E,GACAuvI,EAAAvvI,EACAsvI,EAAAR,GAAAC,MACA,CACAO,EAAAR,GAAAE,EAEAO,IACA,KAAA,GAAA7F,KAAA1pI,GACAA,EAAA6G,eAAA6iI,IAAA,MAAAA,EAAA38I,OAAA,IACAwiJ,EAAA3qJ,KAAA8kJ,GASA,IAJA0F,EAAAG,EAAAlvJ,OACAmvJ,EAAA,GAAAnnI,OAAA+mI,GAGAvwJ,EAAA,EAAAA,EAAAuwJ,EAAAvwJ,IAIA,GAHAqZ,EAAA8H,IAAAuvI,EAAA1wJ,EAAA0wJ,EAAA1wJ,GACAqN,EAAA8T,EAAA9H,GACAm3I,EAAAC,EAAAp3I,EAAAhM,EAAArN,GACAqwJ,EAAAG,GAEAlpD,EAAA+oD,EAAAG,SACAH,GAAAG,GACAK,EAAAL,GAAAlpD,EACAqpD,EAAA3wJ,GAAAsnG,MACA,CAAA,GAAAupD,EAAAL,GAKA,KAHA/yJ,GAAAkzJ,EAAA,SAAArpD,GACAA,GAAAA,EAAA7D,QAAA4sD,EAAA/oD,EAAA5iG,IAAA4iG,KAEA2nD,EAAA,QACA,sJACAziC,EAAAgkC,EAAAnjJ,EAGAsjJ,GAAA3wJ,IAAA0E,GAAA8rJ,EAAA/sD,MAAAnkG,EAAAsC,MAAAtC,GACAuxJ,EAAAL,IAAA,EAKA,IAAA,GAAAM,KAAAT,GAAA,CAIA,GAHA/oD,EAAA+oD,EAAAS,GACA5nC,EAAAvjB,GAAA2B,EAAA1lG,OACAqrG,EAAAh9C,MAAAi5D,GACAA,EAAA,GAAAnkH,WAGA,IAAA/E,EAAA,EAAAwB,EAAA0nH,EAAA1nH,OAAAxB,EAAAwB,EAAAxB,IACAkpH,EAAAlpH,GAAAgvJ,IAAA,CAGA1nD,GAAA7D,MAAAyB,WAIA,IAAAllG,EAAA,EAAAA,EAAAuwJ,EAAAvwJ,IAKA,GAJAqZ,EAAA8H,IAAAuvI,EAAA1wJ,EAAA0wJ,EAAA1wJ,GACAqN,EAAA8T,EAAA9H,GACAiuF,EAAAqpD,EAAA3wJ,GAEAsnG,EAAA7D,MAAA,CAIA6sD,EAAAM,CAGA,GACAN,GAAAA,EAAA9jI,kBACA8jI,GAAAA,EAAAtB,GAEAW,GAAAroD,IAAAgpD,GAEArjD,EAAA76B,KAAAuzB,GAAA2B,EAAA1lG,OAAA,KAAAigG,GAAA+uD,IAEAA,EAAAhB,EAAAtoD,GACA4nD,EAAA5nD,EAAA7D,MAAAzjG,EAAAmvJ,EAAA9hJ,EAAA+hJ,EAAA/1I,EAAAk3I,OAGApsC,GAAA,SAAAviH,EAAA6hG,GACA6D,EAAA7D,MAAAA,CAEA,IAAAmC,GAAAiqD,EAAApsJ,WAAA,EACA7B,GAAAA,EAAAJ,UAAAokG,EAGAqH,EAAAj9C,MAAApuD,EAAA,KAAAigG,GAAA+uD,IACAA,EAAAhrD,EAIA0B,EAAA1lG,MAAAA,EACAivJ,EAAAvpD,EAAA5iG,IAAA4iG,EACA4nD,EAAA5nD,EAAA7D,MAAAzjG,EAAAmvJ,EAAA9hJ,EAAA+hJ,EAAA/1I,EAAAk3I,IAIAF,GAAAQ,SAOAE,GAAA,UACAC,GAAA,kBA8JAnmD,IAAA,WAAA,SAAAoC,GACA,OACA6Q,SAAA,IACA+I,cAAA,EACAnL,KAAA,SAAAjY,EAAA1tF,EAAA7V,GACAujG,EAAA3E,OAAA5+F,EAAA0qG,OAAA,SAAAv9F,GAKA4/F,EAAA5/F,EAAA,cAAA,YAAA0I,EAAAg7I,IACAvU,YAAAwU,WAuJAjnD,IAAA,WAAA,SAAAkD,GACA,OACA6Q,SAAA,IACA+I,cAAA,EACAnL,KAAA,SAAAjY,EAAA1tF,EAAA7V,GACAujG,EAAA3E,OAAA5+F,EAAA4pG,OAAA,SAAAz8F,GAGA4/F,EAAA5/F,EAAA,WAAA,eAAA0I,EAAAg7I,IACAvU,YAAAwU,WAqDAjmD,GAAAumC,GAAA,SAAA7tC,EAAA1tF,EAAA7V,GACAujG,EAAA3E,OAAA5+F,EAAA4qG,QAAA,SAAAmmD,EAAAC,GACAA,GAAAD,IAAAC,GACAzzJ,EAAAyzJ,EAAA,SAAA5wJ,EAAAzE,GAAAka,EAAAlU,IAAAhG,EAAA,MAEAo1J,GAAAl7I,EAAAlU,IAAAovJ,KACA,KAmIAhmD,IAAA,WAAA,SAAAgC,GACA,OACAx0D,QAAA,WAGAssD,YAAA,SAAA,WACAtlG,KAAA0xJ,WAEAz1C,KAAA,SAAAjY,EAAA1tF,EAAA7V,EAAAkxJ,GACA,GAAAC,GAAAnxJ,EAAA8qG,UAAA9qG,EAAAmR,GACAigJ,KACAC,KACAC,KACAC,KAEAC,EAAA,SAAA/xD,EAAA3/F,GACA,MAAA,YAAA2/F,EAAAp7F,OAAAvE,EAAA,IAGAyjG,GAAA3E,OAAAuyD,EAAA,SAAAhkJ,GACA,GAAA3F,GAAAo2F,CACA,KAAAp2F,EAAA,EAAAo2F,EAAA0zD,EAAAhwJ,OAAAkG,EAAAo2F,IAAAp2F,EACAulG,EAAAmO,OAAAo2C,EAAA9pJ,GAIA,KAFA8pJ,EAAAhwJ,OAAA,EAEAkG,EAAA,EAAAo2F,EAAA2zD,EAAAjwJ,OAAAkG,EAAAo2F,IAAAp2F,EAAA,CACA,GAAAgW,GAAAioF,GAAA4rD,EAAA7pJ,GAAA9F,MACA6vJ,GAAA/pJ,GAAAw9F,UACA,IAAA/gF,GAAAqtI,EAAA9pJ,GAAAulG,EAAAh9C,MAAAvyC,EACAyG,GAAAoW,KAAAm3H,EAAAF,EAAA9pJ,IAGA6pJ,EAAA/vJ,OAAA,EACAiwJ,EAAAjwJ,OAAA,GAEA8vJ,EAAAF,EAAAD,MAAA,IAAA9jJ,IAAA+jJ,EAAAD,MAAA,OACA1zJ,EAAA6zJ,EAAA,SAAAK,GACAA,EAAApxC,WAAA,SAAAqxC,EAAAC,GACAJ,EAAA1rJ,KAAA8rJ,EACA,IAAA1gJ,GAAAwgJ,EAAA57I,OACA67I,GAAAA,EAAApwJ,UAAAhG,EAAAw3B,cAAA,sBACA,IAAAs0E,IAAA1lG,MAAAgwJ,EAEAL,GAAAxrJ,KAAAuhG,GACA2F,EAAAj9C,MAAA4hG,EAAAzgJ,EAAAtQ,SAAAsQ,aASAg6F,GAAAmmC,IACA/wB,WAAA,UACA1C,SAAA,KACAplE,QAAA,YACAouE,cAAA,EACAnL,KAAA,SAAAjY,EAAA1tF,EAAA+K,EAAAiyH,EAAA5uB,GACA4uB,EAAAoe,MAAA,IAAArwI,EAAAoqF,cAAA6nC,EAAAoe,MAAA,IAAArwI,EAAAoqF,kBACA6nC,EAAAoe,MAAA,IAAArwI,EAAAoqF,cAAAnlG,MAAAw6G,WAAA4D,EAAApuG,QAAAA,OAIAs1F,GAAAimC,IACA/wB,WAAA,UACA1C,SAAA,KACAplE,QAAA,YACAouE,cAAA,EACAnL,KAAA,SAAAjY,EAAA1tF,EAAA7V,EAAA6yI,EAAA5uB,GACA4uB,EAAAoe,MAAA,KAAApe,EAAAoe,MAAA,SACApe,EAAAoe,MAAA,KAAAprJ,MAAAw6G,WAAA4D,EAAApuG,QAAAA,OA0DA01F,GAAA6lC,IACAxzB,SAAA,MACApC,KAAA,SAAAuI,EAAAnlE,EAAAolE,EAAAnf,EAAAof,GACA,IAAAA,EACA,KAAA3nB,GAAA,gBAAA,SACA,8HAGAoF,EAAA9iD,GAGAqlE,GAAA,SAAAviH,GACAk9C,EAAA38C,QACA28C,EAAA78C,OAAAL,QAsCA4mG,IAAA,iBAAA,SAAAyH,GACA,OACA6N,SAAA,IACAgD,UAAA,EACA3wF,QAAA,SAAApa,EAAA7V,GACA,GAAA,oBAAAA,EAAAmI,KAAA,CACA,GAAA88G,GAAAjlH,EAAAwE,GACA9D,EAAAmV,EAAA,GAAAnV,IAEAqvG,GAAAuF,IAAA2P,EAAAvkH,QAMAkxJ,IAAA3d,cAAAjkI,EAAAokI,QAAApkI,GAUA6hJ,IACA,WAAA,SAAA,SAAA,SAAAjzG,EAAAmlE,EAAAC,GAEA,GAAAhsF,GAAAz4B,KACAuyJ,EAAA,GAAA18C,GAGAp9E,GAAAo1H,YAAAwE,GAQA55H,EAAA20H,cAAAhrD,GAAArmG,EAAAG,cAAA,WACAu8B,EAAAw1H,oBAAA,SAAAptJ,GACA,GAAA2xJ,GAAA,KAAA98C,GAAA70G,GAAA,IACA43B,GAAA20H,cAAAvsJ,IAAA2xJ,GACAnzG,EAAA3Y,QAAAjO,EAAA20H,eACA/tG,EAAAx+C,IAAA2xJ,IAGAhuC,EAAA7D,IAAA,WAAA,WAEAloF,EAAAw1H,oBAAAx9I,IAGAgoB,EAAAy1H,oBAAA,WACAz1H,EAAA20H,cAAAhsJ,UAAAq3B,EAAA20H,cAAA3uJ,UAMAg6B,EAAA80H,UAAA,WAEA,MADA90H,GAAAy1H,sBACA7uG,EAAAx+C,OAMA43B,EAAA01H,WAAA,SAAAvgJ,GACA6qB,EAAAg6H,UAAA7kJ,IACA6qB,EAAAy1H,sBACA7uG,EAAAx+C,IAAA+M,GACA,KAAAA,GAAA6qB,EAAAy0H,YAAAvsI,KAAA,YAAA,IAEA,MAAA/S,GAAA6qB,EAAAy0H,aACAz0H,EAAAy1H,sBACA7uG,EAAAx+C,IAAA,KAEA43B,EAAAw1H,oBAAArgJ,IAOA6qB,EAAAi6H,UAAA,SAAA9kJ,EAAA0I,GACAyvF,GAAAn4F,EAAA,kBACA,KAAAA,IACA6qB,EAAAy0H,YAAA52I,EAEA,IAAA4mB,GAAAq1H,EAAAxzI,IAAAnR,IAAA,CACA2kJ,GAAAx8C,IAAAnoG,EAAAsvB,EAAA,IAIAzE,EAAAk6H,aAAA,SAAA/kJ,GACA,GAAAsvB,GAAAq1H,EAAAxzI,IAAAnR,EACAsvB,KACA,IAAAA,GACAq1H,EAAA9zJ,OAAAmP,GACA,KAAAA,IACA6qB,EAAAy0H,YAAArtJ,IAGA0yJ,EAAAx8C,IAAAnoG,EAAAsvB,EAAA,KAMAzE,EAAAg6H,UAAA,SAAA7kJ,GACA,QAAA2kJ,EAAAxzI,IAAAnR,MA2EAo7F,GAAA,WAEA,OACAqV,SAAA,IACArlE,SAAA,SAAA,YACAssD,WAAAgtD,GACAr2C,KAAA,SAAAjY,EAAA1tF,EAAA7V,EAAAylJ,GAGA,GAAA2H,GAAA3H,EAAA,EACA,IAAA2H,EAAA,CAEA,GAAAP,GAAApH,EAAA,EAwBA,IAtBAoH,EAAAO,YAAAA,EAKAA,EAAAhZ,QAAA,WACAyY,EAAAa,WAAAN,EAAArZ,aAMAl+H,EAAA1E,GAAA,SAAA,WACAoyF,EAAAC,OAAA,WACA4pD,EAAAnZ,cAAA4Y,EAAAC,iBAQA9sJ,EAAAs6I,SAAA,CAGAuS,EAAAC,UAAA,WACA,GAAArtD,KAMA,OALAliG,GAAAsY,EAAApW,KAAA,UAAA,SAAA4kC,GACAA,EAAA7mB,UACAiiF,EAAA55F,KAAAw+B,EAAAl3B,SAGAsyF,GAIAotD,EAAAa,WAAA,SAAAvgJ,GACA,GAAA8oE,GAAA,GAAAm/B,IAAAjoG,EACA5P,GAAAsY,EAAApW,KAAA,UAAA,SAAA4kC,GACAA,EAAA7mB,SAAA8gF,EAAAroB,EAAA33D,IAAA+lB,EAAAl3B,UAMA,IAAAglJ,GAAAC,EAAAtd,GACAvxC,GAAA3E,OAAA,WACAwzD,IAAAhF,EAAArZ,YAAA9zC,EAAAkyD,EAAA/E,EAAArZ,cACAoe,EAAAnyD,EAAAotD,EAAArZ,YACAqZ,EAAAhZ,WAEAge,EAAAhF,EAAArZ,aAKAqZ,EAAA3Z,SAAA,SAAAtmI,GACA,OAAAA,GAAA,IAAAA,EAAA7L,aAYAmnG,IAAA,eAAA,SAAAwF,GAEA,QAAAokD,GAAAnF,GAIAA,EAAA,GAAA1zG,aAAA,cACA0zG,EAAA,GAAA1vI,UAAA,GAIA,OACAogG,SAAA,IACAD,SAAA,IACA1tF,QAAA,SAAApa,EAAA7V,GAIA,GAAAq+F,EAAAr+F,EAAAmN,OAAA,CACA,GAAA06G,GAAA5Z,EAAAp4F,EAAAnV,QAAA,EACAmnH,IACA7nH,EAAAwsE,KAAA,QAAA32D,EAAAnV,QAIA,MAAA,UAAA6iG,EAAA1tF,EAAA7V,GAIA,GAAAsyJ,GAAA,oBACA3xJ,EAAAkV,EAAAlV,SACAksJ,EAAAlsJ,EAAAnB,KAAA8yJ,IACA3xJ,EAAAA,SAAAnB,KAAA8yJ,EAIAzF,IAAAA,EAAAO,cAEAvlC,EACAtkB,EAAA3E,OAAAipB,EAAA,SAAAlP,EAAAC,GACA54G,EAAAwsE,KAAA,QAAAmsC,GACAC,IAAAD,GACAk0C,EAAAqF,aAAAt5C,GAEAi0C,EAAAoF,UAAAt5C,EAAA9iG,GACAg3I,EAAAO,YAAAhZ,UACAie,EAAAx8I,MAGAg3I,EAAAoF,UAAAjyJ,EAAAmN,MAAA0I,GACAg3I,EAAAO,YAAAhZ,UACAie,EAAAx8I,IAGAA,EAAA1E,GAAA,WAAA,WACA07I,EAAAqF,aAAAlyJ,EAAAmN,OACA0/I,EAAAO,YAAAhZ,kBAQA5rC,GAAArK,GACAyf,SAAA,IACAgD,UAAA,IAGA5U,GAAA,WACA,OACA4R,SAAA,IACArlE,QAAA,WACAijE,KAAA,SAAAjY,EAAAmV,EAAA14G,EAAA6yI,GACAA,IACA7yI,EAAA+5C,UAAA,EAEA84F,EAAA0D,YAAAx8F,SAAA,SAAAk9F,EAAAC,GACA,OAAAl3I,EAAA+5C,WAAA84F,EAAAY,SAAAyD,IAGAl3I,EAAA4pH,SAAA,WAAA,WACAipB,EAAA2D,kBAOA1qC,GAAA,WACA,OACA8R,SAAA,IACArlE,QAAA,WACAijE,KAAA,SAAAjY,EAAAmV,EAAA14G,EAAA6yI,GACA,GAAAA,EAAA,CAEA,GAAA70B,GAAAu0C,EAAAvyJ,EAAA+rG,WAAA/rG,EAAAi1B,OACAj1B,GAAA4pH,SAAA,UAAA,SAAA/jE,GAKA,GAJAk3C,EAAAl3C,IAAAA,EAAAvkD,OAAA,IACAukD,EAAA,GAAAn/C,QAAA,IAAAm/C,EAAA,MAGAA,IAAAA,EAAA/gD,KACA,KAAAw3F,GAAA,aAAA,WACA,wDAAAi2D,EACA1sG,EAAA67C,EAAAgX,GAGAsF,GAAAn4D,GAAAzmD,EACAyzI,EAAA2D,cAGA3D,EAAA0D,YAAAthH,QAAA,SAAA9nB,GACA,MAAA0lI,GAAAY,SAAAtmI,IAAAkxF,EAAA2f,IAAAA,EAAAl5G,KAAAqI,QAOAi/F,GAAA,WACA,OACAwR,SAAA,IACArlE,QAAA,WACAijE,KAAA,SAAAjY,EAAAmV,EAAA14G,EAAA6yI,GACA,GAAAA,EAAA,CAEA,GAAAx2F,KACAr8C,GAAA4pH,SAAA,YAAA,SAAAz8G,GACA,GAAAC,GAAAi1C,EAAAl1C,EACAkvC,GAAAqF,MAAAt0C,MAAAA,EACAylI,EAAA2D,cAEA3D,EAAA0D,YAAAl6F,UAAA,SAAA46F,EAAAC,GACA,MAAA76F,GAAA,GAAAw2F,EAAAY,SAAAyD,IAAAA,EAAA51I,QAAA+6C,OAMA6vD,GAAA,WACA,OACA0R,SAAA,IACArlE,QAAA,WACAijE,KAAA,SAAAjY,EAAAmV,EAAA14G,EAAA6yI,GACA,GAAAA,EAAA,CAEA,GAAAv2F,GAAA,CACAt8C,GAAA4pH,SAAA,YAAA,SAAAz8G,GACAmvC,EAAA+F,EAAAl1C,IAAA,EACA0lI,EAAA2D,cAEA3D,EAAA0D,YAAAj6F,UAAA,SAAA26F,EAAAC,GACA,MAAArE,GAAAY,SAAAyD,IAAAA,EAAA51I,QAAAg7C,MAMA,OAAAt/C,GAAA2mG,QAAAhB,cAEAxvF,SAAAqsC,IAAA,mDAMA8kD,KAEAiD,GAAA5D,QAEAhC,IAAArmG,GAAA2d,MAAA,WACAypF,GAAApnG,EAAAqnG,QAGA3lG,OAAA1B,WAEA0B,OAAA2mG,QAAAgE,SAAA3qG,OAAA2mG,QAAA9tF,QAAAva,UAAAmE,KAAA,QAAAwmC,QAAA,kRCxs3BA,SAAAxjC,EAAAC,GACA,kBAAAC,SAAAA,OAAAC,IAEAD,UAAA,WACA,MAAAD,OAEA,gBAAAI,SAIAC,OAAAD,QAAAJ,IAEAA,KAEAnD,KAAA,WACA,YA6PA,OA5PAokG,SAAA5gG,OAAA,wBAAA2nE,QAAA,WAAA,SAAAw4B,GACA,QAAAsvD,GAAAr7C,GAEA,MADAA,GAAA4S,WAAA,EACA5S,EAGAjU,EAAAgE,UAAA,cAAA,YAAAsrD,IACAtvD,EAAAgE,UAAA,gBAAA,YAAAsrD,IACAtvD,EAAAgE,UAAA,kBAAA,YAAAsrD,OAGAvrD,SAAA,+BAAA,2BACAd,SAAA,oBAAA,+BAAA,SAAAssD,GAoBA,QAAAC,GAAAptJ,EAAAujB,EAAA8pI,EAAAtiD,GACA,GAAA56D,GAAAn6C,SAAAG,cAAA,UACAoa,EAAA+8I,EAAAA,EAAAt3J,SAAAiL,qBAAA,QAAA,GACAssJ,GAAA,CAEAp9G,GAAAttC,KAAA,kBACAstC,EAAA5xC,WACA4xC,EAAA7xC,mBAAA,WACA,aAAA6xC,EAAA5xC,YACA,WAAA4xC,EAAA5xC,aACA4xC,EAAA7xC,mBAAA,KACAysG,EACA,WACAwiD,IACAA,GAAA,EACAp9G,EAAA5wC,aAAAgR,GACAA,EAAA1Q,YAAAswC,GAEA5sB,MACA,IAAA,MAIA4sB,EAAAhtC,OAAA,WACAoqJ,IACAA,GAAA,EACAp9G,EAAA5wC,aAAAgR,GACAA,EAAA1Q,YAAAswC,GAEA5sB,MAEA4sB,EAAAntC,QAAA,WACAuqJ,IACAA,GAAA,EACAp9G,EAAA5wC,aAAAgR,GACAA,EAAA1Q,YAAAswC,GAEAk9G,OAGAl9G,EAAAr3C,IAAAkH,EACAmwC,EAAAlF,OAAA,EACA16B,EAAArS,YAAAiyC,GAcA,QAAAq9G,GAAAC,EAAA5lB,EAAA6lB,EAAA7jD,EAAAE,EAAA4jD,EAAA5iD,GAEA,QAAA6iD,GAAAC,EAAAC,GACAC,IAAAL,IAGArvD,QAAApmG,QAAA41J,EAAA,SAAAhmJ,EAAAgM,GACAi6I,EAAAj6I,GAEAwqF,QAAAppF,QAAA64I,EAAAj6I,MACAg6I,EAAAh6I,GAAA7X,OAAA8xJ,EAAAj6I,GAAA7X,cAFA6xJ,GAAAh6I,KAKAwqF,QAAApmG,QAAA61J,EAAA,SAAAjmJ,EAAAgM,GACAwqF,QAAAppF,QAAA64I,EAAAj6I,KAAAwqF,QAAA9F,SAAAu1D,EAAAj6I,KACAg6I,EAAAh6I,KACAg6I,EAAAh6I,GAAAwqF,QAAAppF,QAAA64I,EAAAj6I,WAEA+5I,EAAAC,EAAAh6I,GAAAi6I,EAAAj6I,KAEAg6I,EAAAh6I,GAAAi6I,EAAAj6I,MAMA,GAAAm6I,EAAAN,GAEA,MADAK,GAAAL,EACAM,EAAAN,EAGA,IAAAO,GACAlwI,EAAAgsF,EAAA3yE,OAwCA,OAvCAs2H,KAAAK,EACAhwI,EAAAqX,QAAAyyG,IACAomB,EAAAN,EAAA30I,IAAA00I,KACAK,EAAAL,EACA7jD,EAAAxQ,WAAA,WACAu0D,EAAA/lB,EAAAomB,GACAC,EAAAC,GAAAC,EAAAV,GACA7jD,EAAAmqB,WAAA,uBAAA05B,EAAA7lB,GACA9pH,EAAAqX,QAAAyyG,OAGAkmB,EAAAL,EACAM,EAAAN,GAAA3vI,EAAAY,QACAyuI,EAAAK,EAAA,WAEA,GAAAY,GAAAhwD,QAAAV,UAAA,aACA2wD,EAAAD,EAAAr1I,IAAA,UAEA40I,GAAA/lB,EAAAymB,GACAX,EAAA39C,IAAA09C,EAAAY,SACAN,GAAAN,GAEA7jD,EAAAqhB,YAAA,WACAgjC,EAAAC,GAAAC,EAAAV,GACA7jD,EAAAmqB,WAAA,uBAAA05B,EAAA7lB,GACA9pH,EAAAqX,QAAAyyG,MAEA,iBACAmmB,GAAAN,GAEA7jD,EAAAqhB,YAAA,WACA6iC,IAAAL,IACAK,EAAAlmB,EAAA3oI,IAEA2qG,EAAAmqB,WAAA,qBAAA05B,GACA3vI,EAAAsX,OAAAq4H,MAEA3iD,IAEAhtF,EAAAY,QAlJA,GAAA4vI,GAEAjB,EAEAY,EAKAH,EARAS,EAAA,4CAEAC,EAAA,+BAEAL,EAAAjB,EACAuB,EAAA,MACAP,EAAA,MACAH,KAEAW,IA2IA10J,MAAAu0J,sBAAA,SAAA3mJ,GACA,MAAAA,IACA2mJ,EAAA3mJ,EACA5N,MAEAu0J,GAIAv0J,KAAA20J,eAAA,SAAAC,GACAvB,EAAAuB,GAGA50J,KAAA60J,WAAA,SAAAC,GACAN,EAAAM,EACAL,EAAA,MACAP,EAAA,OAGAl0J,KAAA+0J,iBAAA,WACA3wD,QAAA57E,QAAAgyH,MAAA,EACAx6I,KAAA60J,WAAA,iBAEA70J,KAAA60J,WAAA,YACAJ,EAAA,YACAP,EAAA,cAIAl0J,KAAAs0J,cAAA,SAAA1mJ,GACA0mJ,EAAA1mJ,GAGA5N,KAAAm0J,WAAA,SAAAvmJ,GACA,MAAAA,IACAumJ,EAAAvmJ,EACA5N,MAEAm0J,GAIAn0J,KAAAg1J,sBAAA,SAAAp7I,EAAAhM,GACA8mJ,EAAA96I,GAAAhM,GAGA5N,KAAAy1G,MAAA,aAAA,YAAA,eAAA,UAAA,KAAA,wBAAA,WAAA,SAAA7F,EAAAyH,EAAA49C,EAAAC,EAAAplD,EAAAqlD,EAAArkD,GA4BA,QAAAskD,GAAA3B,GACA,GAAA4B,IAAAH,OAAAzB,EAAA6B,eAAAlxD,QAAA57E,QAAAulE,KACA,OAAAwlE,GAAAgC,EAAAnxD,QAAAvpF,UAAA65I,EAAAW,IAAAH,EAAAzB,EAAA7jD,EAAAE,EAAAqlD,EAAArkD,GA7BA,GAAAykD,GAAAN,EAAAV,EASA,OAPAN,GAAA58C,EAAAt4F,IAAAy1I,GACA5kD,EAAAxQ,WAAA,WACA,GAAAo2D,IACAA,EAAAvB,EAAAQ,GAAAN,IAAAG,IACAc,EAAAI,MAWAxpJ,IAAAopJ,EAKAr2I,IAAA,WACA,MAAA+0I,UASAltD,SAAA,wBAAA,WACA5mG,KAAAy1G,MAAA,gBAAA,SAAAzH,GACA,MAAAA,GAAA,0BAEApH,SAAA,+BAAA,WACA5mG,KAAAy1G,MAAA,gBAAA,SAAAzH,GACA,MAAAA,GAAA,gCAEA92F,KAAA,mBAAAktF,QAAA3zF,OAEA,sBC5QA,SAAAhT,EAAA2mG,EAAAvkG,GAAA,YA2QA,SAAA41J,GAAArnD,EAAAoB,EAAA1B,GAIA,QAAA4nD,GAAA59I,EAAAlK,EAAAlQ,GACA,GAAAsuE,GAAAJ,CACAluE,GAAAA,MACAkuE,EAAAluE,EAAAkuE,QACAI,EAAAo4B,EAAArF,UAAArhG,EAAAsuE,MAAAtuE,EAAAsuE,KAAA2pF,EACAvxD,EAAAtF,YAAAlxF,KACAg+D,EAAA,gCACAh+D,EAAA,IAEAw2F,EAAA5G,SAAA5xB,KACAA,EAAA,GAAA73D,MAAA63D,GAGA,IAAA38D,GAAAumC,mBAAA19B,GAAA,IAAA09B,mBAAA5nC,EACAqB,IAAA+8D,EAAA,SAAAA,EAAA,GACA/8D,GAAAvR,EAAAuuE,OAAA,WAAAvuE,EAAAuuE,OAAA,GACAh9D,GAAA28D,EAAA,YAAAA,EAAAG,cAAA,GACA98D,GAAAvR,EAAAwuE,OAAA,UAAA,EAMA,IAAA0pF,GAAA3mJ,EAAAlN,OAAA,CAOA,OANA6zJ,GAAA,MACApmD,EAAAn/F,KAAA,WAAAyH,EACA,8DACA89I,EAAA,mBAGA3mJ,EAjCA,GAAA0mJ,GAAA7nD,EAAA2N,WACAuW,EAAA5jB,EAAA,EAmCA,OAAA,UAAAt2F,EAAAlK,EAAAlQ,GACAs0H,EAAAlyH,OAAA41J,EAAA59I,EAAAlK,EAAAlQ,IA/RA0mG,EAAA5gG,OAAA,aAAA,OAOAojG,SAAA,YAAA,WA0BA,QAAAivD,GAAAn4J,GACA,MAAAA,GAAA0mG,EAAAvpF,UAAAggC,EAAAn9C,GAAAm9C,EAHA,GAAAA,GAAA76C,KAAA66C,WAiCA76C,MAAAy1G,MAAA,iBAAA,iBAAA,SAAA/D,EAAAokD,GACA,OAWA/2I,IAAA,SAAAnF,GACA,MAAA83F,KAAA93F,IAaAm8I,UAAA,SAAAn8I,GACA,GAAAhM,GAAA5N,KAAA+e,IAAAnF,EACA,OAAAhM,GAAAw2F,EAAA3C,SAAA7zF,GAAAA,GAYAkO,OAAA,WACA,MAAA41F,MAeAqE,IAAA,SAAAn8F,EAAAhM,EAAAlQ,GACAo4J,EAAAl8I,EAAAhM,EAAAioJ,EAAAn4J,KAeAs4J,UAAA,SAAAp8I,EAAAhM,EAAAlQ,GACAsC,KAAA+1G,IAAAn8F,EAAAwqF,EAAA7C,OAAA3zF,GAAAlQ,IAcAe,OAAA,SAAAmb,EAAAlc,GACAo4J,EAAAl8I,EAAA/Z,EAAAg2J,EAAAn4J,WAMA0mG,EAAA5gG,OAAA,aAiCAL,QAAA,gBAAA,WAAA,SAAA8yJ,GAEA,OAWAl3I,IAAA,SAAAnF,GACA,MAAAq8I,GAAAF,UAAAn8I,IAaAm8F,IAAA,SAAAn8F,EAAAhM,GACAqoJ,EAAAD,UAAAp8I,EAAAhM,IAYAnP,OAAA,SAAAmb,GACAq8I,EAAAx3J,OAAAmb,QA2DA67I,EAAAp/C,SAAA,YAAA,OAAA,YAEAjS,EAAA5gG,OAAA,aAAAojG,SAAA,iBAAA,WACA5mG,KAAAy1G,KAAAggD,KAIAh4J,OAAAA,OAAA2mG,SCzTA,mBAAA5gG,SAAA,mBAAAD,UAAAC,OAAAD,UAAAA,UACAC,OAAAD,QAAA,WAGA,SAAA6gG,GACA,YACAA,GACA5gG,OAAA,cACAkkG,SAAA,mBACAA,SAAA,qBAAA,IAEAvkG,QAAA,mBAAA,qBAAA,SAAA+yJ,GAMA,QAAAC,GAAA17F,EAAA7sD,GAEA,GADA6sD,EAAAA,GAAAy7F,EACAtoJ,EAAA,CACA,GAAA6sD,EACA,IACA,MAAA/9D,QAAA6gE,WAAAoH,WAAAlK,EAAA7sD,GACA,MAAAwoJ,GACA,OAIA,GAAAxoJ,EAAAy/G,YACA,MAAAz/G,GAAAy/G,cAGA,MAAA,MAGA,QAAAgpC,GAAA57F,EAAA67F,GAGA,GAFA77F,EAAAA,GAAAy7F,EAEA9xD,EAAA5F,OAAA83D,KAAAn0G,MAAAm0G,GACA,MAAAA,EAGA,IAAAlyD,EAAA5G,SAAA84D,GAAA,CACA,GAAA77F,EACA,MAAA/9D,QAAA6gE,WAAA4E,UAAA1H,EAAA67F,EAGA,IAAAC,GAAA,GAAAxiJ,MAAAuiJ,EACA,OAAAn0G,OAAAo0G,EAAAviJ,WAAA,KAAAuiJ,EAGA,MAAAnyD,GAAAnF,SAAAq3D,GAEA,GAAAviJ,MAAAuiJ,GAGA,KA5CA,OACAD,aAAAA,EACAF,aAAAA,MA8CAvuD,UAAA,UAAA,eAAA,kBAAA,SAAA4uD,EAAAC,GAEA,OACAz9G,QAAA,WACAijE,KAAA,SAAAjY,EAAA1tF,EAAA+K,EAAAikF,GACA,GAAAp1C,GAAA,WACA,MAAAk0C,GAAAvpF,UAAA27I,EAAAxyD,EAAA8iC,MAAAzlH,EAAAq1I,UAEAC,EAAA,WAIA,QAAAC,KACA,GAAAzqI,IAAA,QAAA,UAAA,UAAA,gBACAqyE,EAAA4F,EAAA5F,OAAA8G,EAAAsiD,aACAiP,IAEAr4D,IAAA8G,EAAAsiD,YAAAkP,iBAAAxgJ,EAAAinD,WAAA,WAAAu5F,iBAIAt4D,GACA4F,EAAApmG,QAAAmuB,EAAA,SAAAvS,GACAi9I,EAAAj9I,GAAA0rF,EAAAsiD,YAAA,MAAAhuI,OAGA0rF,EAAAovC,cAAAp+H,EAAAinD,WAAA,YAEAihC,GACA4F,EAAApmG,QAAAmuB,EAAA,SAAAvS,GACA0rF,EAAAkvC,WAAA,MAAA56H,GAAAi9I,EAAAj9I,OArBA,GAAAm9I,IAAA,EACArxJ,EAAAwqD,GA0BA,IAAAo1C,EAAA,CAIA,GAAA0xD,GAAAtxJ,EAAA62D,UAAA6nC,EAAA3zF,IACA/K,GAAA62D,SAAA,SAAA3uD,EAAAqpJ,GACAjzD,EAAAC,OAAA,WACA8yD,GAAA,EACAH,IACAI,EAAAppJ,EAAAqpJ,GACA3gJ,EAAAmsB,SAIA,IAAAy0H,GAAAxxJ,EAAA42D,YAAA8nC,EAAA3zF,IACA/K,GAAA42D,WAAA,SAAAvvD,EAAAkqJ,GACAF,GAAA,EACAG,EAAAnqJ,EAAAkqJ,GAGA,IAAAE,GAAAzxJ,EAAA+2D,SAAA2nC,EAAA3zF,IACA/K,GAAA+2D,QAAA,SAAA7uD,EAAAqpJ,GACAF,GAAA,EACAI,EAAAvpJ,EAAAqpJ,IAGA3gJ,EAAA8lB,IAAA,mBAAAxqB,GAAA,kBAAA,WACAmlJ,GACA/yD,EAAAC,OAAA,WACA3tF,EAAAinD,WAAA,UAAAjnD,EAAAinD,WAAA,YACAq5F,QAKAtxD,EAAA0xC,YAAAogB,gBAAA,SAAA1f,EAAAC,GACA,MAAAvzC,GAAA5F,OAAAi4D,EAAAJ,aAAAh1I,EAAAg2I,aAAA1f,KAGAryC,EAAAqxC,SAAArwI,KAAA,SAAAgwJ,GACA,MAAAG,GAAAJ,aAAAh1I,EAAAg2I,aAAAf,KAIAhxD,EAAAuvC,QAAA,WACAv+H,EAAAinD,WAAA,UAAA+nC,EAAAsiD,cAIAtxI,EAAArW,KAAA,eAEAqW,EAAAinD,WAAA,SAAA73D,GACA4Q,EAAAinD,WAAA,aAGAjnD,EAAAinD,WAAA73D,GAGA4Q,EAAA1E,GAAA,WAAA,WACA0E,EAAAinD,WAAA,QACAjnD,EAAAinD,WAAA,cAIA+nC,GAEAA,EAAAuvC,UAKA7wC,GAAA3E,OAAAnvC,EAAAymG,GAAA,QAKA/uD,UAAA,gBAAA,kBAAA,SAAA6uD,GACA,OACAz9G,QAAA,UACAijE,KAAA,SAAAjY,EAAA1tF,EAAA+K,EAAA+oI,GACA,GAAA3vF,GAAAp5C,EAAAg2I,YAGAjN,GAAAnW,YAAAzuH,QAAA,SAAA5X,GACA,MAAA6oJ,GAAAJ,aAAA57F,EAAA7sD,KAGAw8I,EAAAzT,SAAArwI,KAAA,SAAAsH,GACA,MAAA6oJ,GAAAN,aAAA17F,EAAA7sD,WAMAw2F,SCtMA,SAAAA,GACA,YAOA,IAAAkzD,GAAA,SAAAzlJ,EAAAyX,GACA,GAAA86E,EAAAppF,QAAAnJ,GACA,MAAAA,GAAA9M,IAAAukB,EAEA,IAAAjP,KAIA,OAHA7T,QAAA2lB,KAAAta,GAAA7T,QAAA,SAAA4b,EAAA/Y,GACAwZ,EAAAT,GAAA0P,EAAAzX,EAAA+H,GAAAA,KAEAS,EAGA+pF,GAAA5gG,OAAA,sBAAA2nE,QAAA,WAAA,SAAAw4B,GACAA,EAAAgE,UAAA,MAAA,YAAA,SAAAiQ,GACA,GAAA9H,GAAA8H,CAmCA,OAjCA9H,GAAAynD,WAAA,SAAAr2B,GACA,MAAApxB,GAAAhnF,IAAAwuI,EAAAp2B,EAAA,SAAAs2B,GACA,MAAAA,GAAA18H,KAGA08H,EAAA18H,KAAA,SAAAltB,GACA,OAAAY,MAAA,YAAAZ,MAAAA,IACA,SAAAg4F,GACA,OAAAp3F,MAAA,WAAAo3F,OAAAA,MALAp3F,MAAA,YAAAZ,MAAA4pJ,OAUA1nD,EAAA/qG,IAAA,SAAAya,EAAA8J,GACA,MAAAwmF,GAAAhnF,IAAAwuI,EAAA93I,EAAA8J,KAGAwmF,EAAA2nD,WAAA,SAAAj4I,EAAA8J,GACA,MAAAwmF,GAAAynD,WAAAD,EAAA93I,EAAA8J,KAGAwmF,EAAA30E,UAIA20E,EAAA30E,QAAA,SAAAvtB,GACA,MAAAA,IAAAA,EAAAktB,KACAltB,EAEAkiG,EAAA,SAAA30E,GAAAA,EAAAvtB,OAIAkiG,SAIAryG,OAAA2mG,SCtDA,SAAA3mG,EAAA2mG,EAAAvkG,GAEA,YAqBA,SAAAqpB,GAAAjQ,GACA,MAAA+B,GAAA/B,GACAA,EACAzS,OAAA2lB,KAAAlT,GAAAlU,IAAA,SAAA6U,GACA,MAAAX,GAAAW,KAQA,QAAA89I,GAAA9pJ,GACA,MAAA,QAAAA,EAUA,QAAA+pJ,GAAAC,EAAA3+I,GACA,GAAAkT,GAAA3lB,OAAA2lB,KAAAyrI,EAEA,OAAAzrI,GAAApnB,IAAA,SAAAs4B,GACA,MAAApkB,GAAAokB,KAAAx9B,GAAAoZ,EAAAokB,IAAAu6H,EAAAv6H,KACAt9B,SAAA,OAWA,QAAA83J,GAAAC,EAAApiI,GAGA,QAAA31B,GAAA+3J,EAAA7sH,EAAAviC,GAEA,IADA,GAAAkN,GAAA,EACAq1B,EAAAr1B,GAAAkiJ,EAAA/1J,QAAA,CACA,GAAA+1J,EAAArpJ,OAAAw8B,EAAAr1B,IAAAlN,EAAA,MAAAkN,EACAA,KAEA,SAGA,IAAA,GADAq1B,GAAA,EACAhjC,EAAA,EAAAA,GAAAytB,EAAA3zB,OAAAkG,IAAA,CACA,GAAA1H,GAAAR,EAAA+3J,EAAA7sH,EAAAvV,EAAAjnB,OAAAxG,GACA,IAAA1H,MAAA,OAAA,CACA0qC,IAAA1qC,EAAA,EAEA,OAAA,EAYA,QAAAw3J,GAAA73D,EAAAhnE,EAAA6zF,GACA,GAAA7vF,GAAA,CAEA,OAAAgjE,GAAAvnF,OAAA,SAAAwgG,GACA,GAAA6+C,GAAAj5D,EAAAguB,GAAA7vF,EAAAhE,GAAA6zF,EAAA5T,GAAAj8E,EAAAhE,CAGA,OAFAgE,GAAA86H,EAAA96H,EAAA,EAAAA,EAEA86H,IAiBA,QAAAC,GAAA9uI,EAAA+uI,GACA,MAAAp3J,MAAAI,MAAAioB,EAAAroB,KAAAoK,IAAA,GAAAgtJ,IAAAp3J,KAAAoK,IAAA,GAAAgtJ,GAaA,QAAAC,GAAAtmJ,EAAAyoB,EAAAl5B,GACAk5B,EAAAA,KACA,IAAAnO,GAAA3lB,OAAA2lB,KAAAta,EAcA,OAZAsa,GAAAnuB,QAAA,SAAAq/B,GAEA,GAAAihE,EAAAzsF,EAAAwrB,MAAAriB,EAAAnJ,EAAAwrB,IAAA,CAEA,GAAA4N,GAAA7pC,EAAAA,EAAA,IAAAi8B,EAAAj8B,CACA+2J,GAAAtmJ,EAAAwrB,GAAA/C,EAAA2Q,GAAA5N,OACA,CAEA,GAAAzjB,GAAAxY,EAAAA,EAAA,IAAAi8B,EAAAA,CACA/C,GAAAh0B,KAAAsT,MAGA0gB,EASA,QAAA6kE,GAAAttF,GACA,MAAAA,IAAAA,EAAAutF,YAAAvtF,EAAAwtF,OA2FA,QAAA+4D,KACA,MAAA,UAAArrJ,EAAA6oB,GACA,MAAA7oB,GAAA6oB,GAIA,QAAAyiI,KACA,MAAA,UAAAtrJ,EAAA6oB,GACA,MAAA7oB,IAAA6oB,GAIA,QAAA0iI,KACA,MAAA,UAAAvrJ,EAAA6oB,GACA,MAAA7oB,GAAA6oB,GAIA,QAAA2iI,KACA,MAAA,UAAAxrJ,EAAA6oB,GACA,MAAA7oB,IAAA6oB,GAIA,QAAA4iI,KACA,MAAA,UAAAzrJ,EAAA6oB,GACA,MAAA7oB,IAAA6oB,GAIA,QAAA6iI,KACA,MAAA,UAAA1rJ,EAAA6oB,GACA,MAAA7oB,IAAA6oB,GAIA,QAAA8iI,KACA,MAAA,UAAA3rJ,EAAA6oB,GACA,MAAA7oB,KAAA6oB,GAIA,QAAA+iI,KACA,MAAA,UAAA5rJ,EAAA6oB,GACA,MAAA7oB,KAAA6oB,GA+MA,QAAAgjI,GAAAlpD,GACA,MAAA,UAAAhuF,EAAAqrG,GAIA,MAFArrG,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,KAEA1G,EAAA0G,IAAAo9E,EAAAiuB,KAIArrG,EAAAm3F,KAAA,SAAAM,GACA,MAAA3b,GAAAuvB,IAAAzuB,EAAA6a,IAAA5gG,EAAAw0G,GACArd,EAAAqd,GAAA5T,GACAA,IAAA4T,KAkOA,QAAA8rC,GAAA34D,EAAAj4F,GAGA,MAFAA,GAAAA,GAAA,EAEAA,GAAAi4F,EAAAn+F,OACAm+F,EAEAllF,EAAAklF,EAAAj4F,IACA4wJ,EAAA34D,EAAA/iG,MAAA,EAAA8K,GACAgT,OAAAilF,EAAAj4F,GAAAi4F,EAAA/iG,MAAA8K,EAAA,IAAAA,GAEA4wJ,EAAA34D,EAAAj4F,EAAA,GAieA,QAAA6wJ,GAAAppD,GACA,MAAA,UAAAhuF,EAAAkxE,GA4BA,QAAAimB,GAAA3Y,EAAA4iD,GACA,OAAAhkD,EAAAgkD,IAGA5iD,EAAA2Y,KAAA,SAAAx7E,GACA,MAAAqjE,GAAArjE,EAAAylH,KA7BA,GAFAphI,EAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,GACA,MAAAA,EAIA,IAAAq3I,MACAh6I,EAAA2wF,EAAA9c,EAEA,OAAAkM,GAAAlM,GAEAlxE,EAAA/I,OAAA,SAAAwgG,EAAA9rG,EAAAorB;AACA,MAAAA,GAAA14B,QAAAo5G,KAAA9rG,IAGAqU,EAAA/I,OAAA,SAAAwgG,GACA,GAAAx4F,GAAA5B,EAAAo6F,EACA,QAAAN,EAAAkgD,EAAAp4I,KAGAo4I,EAAAzyJ,KAAAqa,IACA,MA+kBA,QAAAq4I,GAAA/pJ,EAAAiqB,EAAA+/H,GACA,MAAA//H,GAGAjqB,EAAAgqJ,EAAAD,EAAA/pJ,IAAAiqB,EAAA+/H,GAFAhqJ,EAgOA,QAAAiqJ,KACA,MAAA,UAAAnsJ,GACA,MAAAywF,GAAAzwF,GACAA,EACAjH,MAAA,KACAf,IAAA,SAAA2tH,GACA,MAAAA,GAAAjkH,OAAA,GAAA7G,cAAA8qH,EAAAtlH,UAAA,KAEAnH,KAAA,KACA8G,GAzhEA,GAAAgyF,GAAAqF,EAAArF,UACAD,EAAAsF,EAAAtF,YACAvmF,EAAA6rF,EAAA7rF,WACAilF,EAAA4G,EAAA5G,SACAyB,EAAAmF,EAAAnF,SACAX,EAAA8F,EAAA9F,SACAtjF,EAAAopF,EAAAppF,QACAhd,EAAAomG,EAAApmG,QACA6c,EAAAupF,EAAAvpF,OACA6O,EAAA06E,EAAA16E,KACAg3E,EAAA0D,EAAA1D,MA0FA1tE,QAAAlS,UAAA2K,WACAuH,OAAAlS,UAAA2K,SAAA,WACA,MAAAuH,QAAAlS,UAAA/gB,QAAA+U,MAAA9U,KAAAuS,kBA6DA6xF,EAAA5gG,OAAA,kBAEAmV,OAAA,cAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAAtF,YAAA/xF,MAGA4L,OAAA,YAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAArF,UAAAhyF,MAGA4L,OAAA,aAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAA7rF,WAAAxL,MAGA4L,OAAA,WAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAA5G,SAAAzwF,MAGA4L,OAAA,WAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAAnF,SAAAlyF,MAGA4L,OAAA,UAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAAppF,QAAAjO,MAGA4L,OAAA,WAAA,WACA,MAAA,UAAA5L,GACA,MAAAq3F,GAAA9F,SAAAvxF,MAGA4L,OAAA,UAAA,WACA,MAAA,UAAAgoF,EAAAC,GACA,MAAAwD,GAAA1D,OAAAC,EAAAC,MAYAwD,EAAA5gG,OAAA,qBAEAmV,QACAwgJ,cAAAf,EACAjjI,IAAAijI,EAEAgB,uBAAAf,EACAgB,KAAAhB,EAEAiB,WAAAhB,EACA5wE,IAAA4wE,EAEAiB,oBAAAhB,EACAiB,KAAAjB,EAEAkB,UAAAjB,EACAkB,KAAAlB,EAEAmB,aAAAlB,EACAmB,KAAAnB,EAEAoB,cAAAnB,EACAoB,MAAApB,EAEAqB,iBAAApB,EACAqB,MAAArB,IA2DAv0D,EAAA5gG,OAAA,kBACAmV,OAAA,SAAA,WACA,MAAA,UAAA5L,GACA,MAAA2qJ,GAAA3qJ,MAcAq3F,EAAA5gG,OAAA,sBACAmV,OAAA,aAAA,WACA,MAAA,UAAA+I,EAAAzI,GAMA,GAJAyI,EAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,GAEA1G,EAAA0G,IAAAo9E,EAAA7lF,GAAA,MAAAyI,EAEA,IAAAnhB,GAAAmhB,EAAA3c,IAAA,SAAAo0G,GACA,MAAAw+C,GAAA1+I,EAAAkgG,KACAp5G,SAAA,EAEA,OAAA2hB,GAAAvkB,MAAAoD,OAAA,EAAAA,MAeA6jG,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA+I,EAAAwb,GAKA,MAJAxb,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEA1G,EAAA0G,GACAA,EAAAvkB,MAAA+/B,GACAxb,KAaA0iF,EAAA5gG,OAAA,uBACAmV,OAAA,cAAA,WACA,MAAA,UAAA+I,EAAAzI,GAMA,GAJAyI,EAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,GAEA1G,EAAA0G,IAAAo9E,EAAA7lF,GAAA,MAAAyI,EAEA,IAAAnhB,GAAAmhB,EAAA3c,IAAA,SAAAo0G,GACA,MAAAw+C,GAAA1+I,EAAAkgG,KACAp5G,SAAA,EAEA,OAAA2hB,GAAAvkB,MAAA,EAAAoD,OAAAmhB,EAAA3f,SAAAxB,MAaA6jG,EAAA5gG,OAAA,iBACAmV,OAAA,SAAA,WACA,MAAA,UAAA+I,EAAAwb,GAKA,MAJAxb,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEA1G,EAAA0G,GACAA,EAAAvkB,MAAA,EAAA+/B,IAAAA,EAAAA,GACAxb,KAaA0iF,EAAA5gG,OAAA,gBAAA,uBACAmV,OAAA,WAAA,gBAAA,SAAAshJ,GACA,MAAA,UAAA/5D,EAAAhnE,EAAAghI,GAYA,QAAAC,GAAAjhI,EAAAr4B,GAEA,IADA,GAAAwZ,MACA6e,KAAA7e,EAAA6e,GAAAr4B,CACA,OAAAwZ,GAGA,QAAA+/I,GAAAl6D,EAAAhnE,EAAAghI,GACA,MAAAl/I,GAAAklF,GACAA,EAAAn7F,IAAA,SAAAs4B,EAAAp1B,EAAAwwB,GAGA,MAFAxwB,IAAAixB,EACAmE,EAAA5E,EAAAt7B,MAAA8K,EAAAA,EAAAixB,IACA4lE,EAAAo7D,IAAA78H,EAAAt7B,OAAAm3B,EACAmE,EAAApiB,OAAAk/I,EAAAjhI,EAAAmE,EAAAt7B,OAAAm4J,IACA78H,IACAlgC,MAAA,EAAA2D,KAAAipE,KAAAm2B,EAAAn+F,OAAAm3B,IAPAgnE,EAjBA,MAAA+5D,GAAAI,WAAA,UAAA9nJ,YACA0nJ,EAAA/nJ,QAAA,UAAAK,UAAAvS,KACAo6J,EAAAl6D,EAAAhnE,EAAAghI,QAmCA91D,EAAA5gG,OAAA,iBACAmV,OAAA,UAAA,WACA,MAAA,UAAA+I,EAAA44I,GAEA,GAAAx7D,EAAAw7D,GAAA,MAAA54I,EAEA,IAAA1G,EAAA0G,GACA,MAAA48E,GAAAg8D,GACA54I,EAAAzG,OAAAiO,EAAAoxI,IACA54I,EAAAzG,OAAAq/I,EAGA,IAAAh8D,EAAA58E,GAAA,CACA,GAAAw+E,GAAAh3E,EAAAxH,EACA,OAAA48E,GAAAg8D,GACAp6D,EAAAjlF,OAAAiO,EAAAoxI,IACAp6D,EAAAjlF,OAAAq/I,GAEA,MAAA54I,OAaA0iF,EAAA5gG,OAAA,mBACAmV,QACA8S,UAAA,SAAAmtI,GACA//C,MAAA,SAAA+/C,KA8BAx0D,EAAA5gG,OAAA,mBAEAmV,OAAA,WAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAkxE,GAEA,GAEAjyE,GAFAgD,KACA5E,EAAA2wF,EAAA9c,EAKA,OAFAlxE,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,IAAAo9E,EAAAlM,GACAlxE,GAGAA,EAAA1jB,QAAA,SAAAm7G,GACAx4F,EAAA5B,EAAAo6F,GAEAx1F,EAAAhD,KACAgD,EAAAhD,GAAA,GAGAgD,EAAAhD,OAGAgD,OAYAygF,EAAA5gG,OAAA,mBACAmV,OAAA,YAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAm5B,GAIA,GAFAn5B,EAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,KAAA48E,EAAAzjD,GACA,MAAAn5B,EAGA,IAAAyK,GAAAgsI,EAAAt9G,EAeA,OAbAn5B,GAAA1jB,QAAA,SAAAm7G,GAEAhtF,EAAAnuB,QAAA,SAAA4b,GACA,GAAA60B,GAAAihE,EAAA91F,GACAojB,EAAAyR,EAAA46C,MAEAyV,GAAArwD,EAAA0qE,KAEAn8E,EAAAm8E,EAAA1qE,EAAAoM,QAKAn5B,MAYA0iF,EAAA5gG,OAAA,gBACAmV,OAAA,SAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAqrG,GAGA,MAFArrG,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,IAEA1G,EAAA0G,KAAAo9E,EAAAiuB,KAIArrG,EAAA64I,MAAA,SAAAphD,GACA,MAAA7a,GAAA6a,IAAA5gG,EAAAw0G,GACArd,EAAAqd,GAAA5T,GACAA,IAAA4T,QAaA3oB,EAAA5gG,OAAA,oBACAmV,OAAA,YAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAgC,EAAAgwD,EAAA8mF,GACA,GAAA3tB,EAOA,OALAn5D,GAAA8pB,EAAA9pB,IAAAurB,EAAAvrB,GACA1gD,OAAA0gD,GAAAhzE,cAAAb,EAEA6hB,EAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,IAAAo9E,EAAAprB,GACAhyD,EAGAA,EAAA/I,OAAA,SAAAwgG,GACA,MAAAz1F,GAAAm1F,KAAA,SAAAl4F,GAQA,IAAAA,EAAA5gB,QAAA,KAEA,CACA,GAAA06J,GAAA95I,EAAA1d,QAAA,OAAA,IAAA6C,MAAA,IACA+mI,GAAA4tB,EACA11J,IAAA,SAAA4b,GAAA,MAAA+uF,GAAA/uF,GAAAw4F,KACAlzG,KAAA,SALA4mI,GAAAn9B,EAAA/uF,GAAAw4F,EAQA,UAAA3b,EAAAqvC,KAAA5tC,EAAA4tC,MAIAA,EAAA75G,OAAA65G,GAAAnsI,cAEA85J,EAAA3tB,IAAAn5D,EAAAm5D,EAAAphH,SAAAioD,YAeA0wB,EAAA5gG,OAAA,gBACAmV,OAAA,SAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,GACA,GAAAwX,GACAuV,EACAn8B,CAMA,OAJAoP,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEA1G,EAAA0G,IAIApP,EAAAyX,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,GACA2mB,EAAA+lE,EAAA3sF,EAAA,IAAAA,EAAA,GAAA,EACAm8B,EAAAwwD,EAAA3sF,EAAA,IAAA2sF,EAAA3sF,EAAA,IAAAzS,EAAAyS,EAAA,GAAAA,EAAA,GAEAA,EAAA,OAAAylJ,EAAAr2I,EAAAwX,EAAA,EAAAw2E,EAAAjhE,GAAAA,GACA/sB,EAAA,IARAA,MAqBA0iF,EAAA5gG,OAAA,kBACAmV,OAAA,UAAA,WACA,MAAA,UAAA+I,EAAAg5I,GAOA,MALAA,GAAAA,IAAA,EACAh5I,EAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEA1G,EAAA0G,GAIAg5I,KAEAz/I,OAAAnG,SAAA4M,GADAm3I,EAAAn3I,EAAA,GAJAA,KAqCA0iF,EAAA5gG,OAAA,mBACAmV,OAAA,WAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAkxE,EAAAlf,EAAAinF,GAEA,GACAh6I,GAAA8tB,EADAmsH,EAAAD,IAAA,CAKA,OAFAj5I,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,IAAAo9E,EAAAlM,IACAkM,EAAAprB,GACAhyD,GAGA+sB,EAAAihE,EAAA9c,GAEAlxE,EAAA/I,OAAA,SAAAwgG,GAGA,MADAx4F,GAAA8tB,EAAA0qE,KACA3b,EAAA78E,KAIAA,EAAA,EAAAA,EAAAA,EAAAjgB,cACAgzE,EAAA,EAAAA,EAAAA,EAAAhzE,cAEAm3J,EAAAl3I,EAAA+yD,MAAA,UAaA0wB,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA+I,EAAAgyD,EAAAinF,GA0BA,QAAAE,GAAA5hJ,EAAAy6D,GACA,GACA/yD,GAAAvH,EADAsK,EAAAld,OAAA2lB,KAAAlT,EAEA,OAAA,GAAAyK,EAAA/K,OAAA,SAAAwgG,GAIA,MAHAx4F,GAAA1H,EAAAkgG,KAGA//F,KAEAokF,EAAA78E,KACAA,EAAA,EAAAA,EAAAA,EAAAjgB,cACA0Y,EAAAy+I,EAAAl3I,EAAA+yD,MAAA,KAKA3xE,OAzCA,GAAA64J,GAAAD,IAAA,CAGA,OAFAj5I,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,GAEA1G,EAAA0G,IAAAo9E,EAAAprB,GACAhyD,GAGAgyD,EAAA,EAAAA,EAAAA,EAAAhzE,cAEAghB,EAAA/I,OAAA,SAAAwgG,GACA,MAAA3b,GAAA2b,IACAA,EAAA,EAAAA,EAAAA,EAAAz4G,cACAm3J,EAAA1+C,EAAAzlC,MAAA,KAEA4qB,EAAA6a,IAAA0hD,EAAA1hD,EAAAzlC,SA0CA0wB,EAAA5gG,OAAA,gBAAA,uBACAmV,OAAA,WAAA,SAAA,gBAAA,SAAA+2F,EAAAuqD,GACA,MAAA,UAAAv4I,EAAAkxE,GAgBA,QAAAkoE,GAAAp5I,EAAA+sB,GACA,GACA9tB,GADAgD,IAWA,OARA3lB,GAAA0jB,EAAA,SAAAy3F,GACAx4F,EAAA8tB,EAAA0qE,GAEAx1F,EAAAhD,KACAgD,EAAAhD,OAEAgD,EAAAhD,GAAAra,KAAA6yG,KAEAx1F,EA1BA,OAAA26E,EAAA58E,IAAAo9E,EAAAlM,GACAlxE,EAGAu4I,EAAAI,WAAA,UAAA9nJ,YACA0nJ,EAAA/nJ,QAAA,UAAAK,UAAAvS,KACA86J,EAAAp5I,EAAAguF,EAAA9c,SAiCAwR,EAAA5gG,OAAA,mBACAmV,OAAA,UAAA,WACA,MAAA,UAAA+I,GACA,MAAA48E,GAAA58E,IACAwH,EAAAxH,GAAA3f,QACA2f,EAAA3f,UAYAqiG,EAAA5gG,OAAA,eACAmV,OAAA,OAAA,WACA,MAAA,UAAA5L,EAAAguJ,GACA,MAAAj8D,GAAA/xF,KAAAiO,EAAAjO,GACAA,GAEA+xF,EAAAi8D,KAAAA,EAAA,KAEAhuJ,EAAA9G,KAAA80J,OAcA32D,EAAA5gG,OAAA,eACAmV,OAAA,QAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,GACA,GAAAwX,GACAuV,EACAn8B,EAGA0oJ,EAAAtxI,EAAAhI,EAMA,OAJAs5I,GAAA18D,EAAA08D,GACA9xI,EAAA8xI,GACAA,EAEAhgJ,EAAAggJ,IAIA1oJ,EAAAyX,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,GACA2mB,EAAA+lE,EAAA3sF,EAAA,IAAAA,EAAA,GAAA,EACAm8B,EAAAwwD,EAAA3sF,EAAA,IAAA2sF,EAAA3sF,EAAA,IAAAzS,EAAAyS,EAAA,GAAAA,EAAA,GAEAA,EAAA,OAEAylJ,EAAAiD,EAAAlhI,UAAAZ,EAAA,EAAAw2E,EAAAjhE,GAAAA,GAAA3U,UAEAkhI,EAAAA,EAAAj5J,OAAA,IAXAi5J,MAuBA52D,EAAA5gG,OAAA,cACAmV,OAAA,OAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAqrG,GAMA,MAJArrG,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,GAEA1G,EAAA0G,IAAAo9E,EAAAiuB,GACArrG,EAGAA,EAAA3c,IAAA,SAAAo0G,GACA,MAAAzJ,GAAAqd,GAAA5T,SAcA/U,EAAA5gG,OAAA,eAEAmV,OAAA,QAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAqrG,GAMA,MAJArrG,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,GAEA1G,EAAA0G,IAAAo9E,EAAAiuB,GACArrG,EAGAA,EAAA/I,OAAA,SAAAwgG,GACA,OAAAzJ,EAAAqd,GAAA5T,SAcA/U,EAAA5gG,OAAA,eAEAmV,OAAA,QAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,EAAAqrG,GAMA,MAJArrG,GAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,GAEA1G,EAAA0G,IAAAo9E,EAAAiuB,GACArrG,EAGAA,EAAA/I,OAAA,SAAAwgG,GACA,MAAAzJ,GAAAqd,GAAA5T,SAaA/U,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA5L,EAAAkuJ,EAAA73I,EAAA8rD,EAAAgsF,GACA93I,EAAAA,GAAA,EACA8rD,EAAAA,GAAA,CACA,KAAA,GAAAjnE,GAAA,EAAAA,EAAAhH,SAAAg6J,GAAAhzJ,IAAA,CACA,GAAA2N,GAAAwN,EAAAnb,EAAAinE,CACAniE,GAAAzG,KAAAiS,EAAA2iJ,GAAAA,EAAAtlJ,GAAAA,GAEA,MAAA7I,MAaAq3F,EAAA5gG,OAAA,sBACAmV,OAAA,aAAA,WACA,MAAA,UAAA+I,EAAAzI,GAEA,MAAA6lF,GAAA7lF,GACAyI,GAEAA,EAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEAA,EAAA/I,OAAA,SAAAwgG,GACA,OAAAw+C,EAAA1+I,EAAAkgG,SAeA/U,EAAA5gG,OAAA,iBAEAmV,OAAA,SAAA,WACA,MAAA,UAAA+I,GACAA,EAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,CACA,IAAApP,GAAAyX,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EAEA,OAAAyI,GAAA0G,GAIAA,EAAA/I,OAAA,SAAAmqI,GACA,OAAAxwI,EAAAumG,KAAA,SAAAsiD,GACA,MAAAz6D,GAAAy6D,EAAArY,OALAphI,KAmBA0iF,EAAA5gG,OAAA,kBACAmV,OAAA,WAAA,WACA,MAAA,UAAA5L,GAGA,MAFAA,GAAAuxF,EAAAvxF,GAAAmc,EAAAnc,GAAAA,EAEAywF,EAAAzwF,GACAA,EAAAjH,MAAA,IAAAg0B,UAAA7zB,KAAA,IAGA+U,EAAAjO,GACAA,EAAA5P,QAAA28B,UACA/sB,MAaAq3F,EAAA5gG,OAAA,uBACAmV,OAAA,eAAA,SAAA,SAAA+2F,GACA,MAAA,UAAAhuF,GAEA,GAAA3C,GAAAsnC,CAEA3kC,GAAA48E,EAAA58E,GAAAwH,EAAAxH,GAAAA,CAEA,IAAApP,GAAAyX,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EAEA,OAAAyI,GAAA0G,IAAApP,EAAAvQ,OAIA2f,EAAA3c,IAAA,SAAA+9I,GAOA,MALAz8F,GAAA/zC,EAAAvN,IAAA,SAAAshD,GAEA,OADAtnC,EAAA2wF,EAAArpD,IACAy8F,KACA78I,KAAA,KAEA4U,EAAAioI,GAAAsY,YAAA/0G,MAVA3kC,MA0BA0iF,EAAA5gG,OAAA,mBACAmV,OAAA,UAAA,WACA,MAAA,UAAA+I,EAAA25I,GAEA,MAAA/8D,GAAA58E,GAIA25I,EAEA70J,OAAA2lB,KAAAzK,GAAA3c,IAAA,SAAA6U,GACA,MAAAiB,GAAA6G,EAAA9H,IAAA0hJ,KAAA1hJ,MAFAsP,EAAAxH,GAJAA,KAsBA0iF,EAAA5gG,OAAA,iBACAmV,QACA0f,QAAA,SAAAygI,GACAyC,MAAA,SAAAzC,KAqDA10D,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA+I,EAAAzI,GACA,MAAA6lF,GAAA7lF,GAAAyI,GACAA,EAAA48E,EAAA58E,GACAwH,EAAAxH,GACAA,EAEAA,EAAA/I,OAAA,SAAAwgG,GACA,MAAAw+C,GAAA1+I,EAAAkgG,SAcA/U,EAAA5gG,OAAA,cAEAmV,OAAA,OAAA,SAAA,SAAA+2F,GACA,MAAA,UAAA8rD,EAAAC,EAAA1uC,GAcA,QAAAlU,GAAAx7E,EAAA+H,GACA,GAAAqJ,GAAAihE,EAAAqd,EACA,OAAA3nF,GAAAyzE,KAAA,SAAA6iD,GACA,MAAA3uC,GACArsB,EAAAjyD,EAAAitH,GAAAjtH,EAAApR,IACAqjE,EAAAg7D,EAAAr+H,KAZA,MALA0vF,GAAAA,IAAA,EAEAyuC,EAAAl9D,EAAAk9D,GAAAtyI,EAAAsyI,GAAAA,EACAC,EAAAn9D,EAAAm9D,GAAAvyI,EAAAuyI,GAAAA,EAEAzgJ,EAAAwgJ,IAAAxgJ,EAAAygJ,GAEAD,EAAAvgJ,OAAAwgJ,GACA9iJ,OAAA,SAAAwgG,GACA,QAAAN,EAAAM,EAAAqiD,IAAA3iD,EAAAM,EAAAsiD,MAJAD,MA0BAp3D,EAAA5gG,OAAA,mBACAmV,OAAA,MAAA,WACA,MAAA,UAAA5L,GACA,MAAAjM,MAAAC,IAAAgM,MAaAq3F,EAAA5gG,OAAA,uBACAmV,OAAA,UAAA,WACA,GAAAgjJ,KAAA1sJ,IAAA,IAAApO,IAAA,MAIA,QAHA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MAAA7C,QAAA,SAAAq/B,EAAAp1B,GACA0zJ,EAAAr1J,MAAA2I,IAAAouB,EAAAx8B,IAAA,KAAA86J,EAAA1zJ,GAAApH,QAEA,SAAA+6J,EAAA1D,GACA,GAAAj5D,EAAAi5D,IAAA5pB,SAAA4pB,IAAAA,EAAA,IAAA,GAAAA,GAAA,GACAj5D,EAAA28D,IAAAttB,SAAAstB,GAAA,CAEA,IADA,GAAA3zJ,GAAA,EACAA,EAAA0zJ,EAAA55J,OAAA,GAAA65J,GAAAD,EAAA1zJ,GAAApH,KAAAoH,GAEA,OADA2zJ,IAAA3zJ,EAAA,EAAA0zJ,EAAA1zJ,EAAA,GAAApH,IAAA,EACAo3J,EAAA2D,EAAA1D,GAAA,IAAAyD,EAAA1zJ,GAAAgH,IAEA,MAAA,SAYAm1F,EAAA5gG,OAAA,uBACAmV,OAAA,UAAA,WACA,MAAA,UAAAkjJ,EAAA3D,GAGA,GAAAj5D,EAAAi5D,IAAA5pB,SAAA4pB,IAAAA,EAAA,IAAA,GAAAA,GAAA,GACAj5D,EAAA48D,IAAAvtB,SAAAutB,GAAA,CACA,GAAAC,GAAA,IAAAD,EAAA/6J,KAAAsqC,EACA,OAAAtqC,MAAAI,MAAA46J,EAAAh7J,KAAAoK,IAAA,GAAAgtJ,IAAAp3J,KAAAoK,IAAA,GAAAgtJ,GAEA,MAAA,SAgBA9zD,EAAA5gG,OAAA,qBACAmV,OAAA,QAAA,WACA,GAAAgjJ,KAAA1sJ,IAAA,KAAApO,IAAA,MAIA,QAHA,KAAA,KAAA,KAAA,KAAA,KAAA,KAAA,MAAA7C,QAAA,SAAAq/B,EAAAp1B,GACA0zJ,EAAAr1J,MAAA2I,IAAAouB,EAAAx8B,IAAA,KAAA86J,EAAA1zJ,GAAApH,QAEA,SAAA+6J,EAAA1D,GACA,GAAAj5D,EAAAi5D,IAAA5pB,SAAA4pB,IAAAA,EAAA,IAAA,GAAAA,GAAA,GACAj5D,EAAA28D,IAAAttB,SAAAstB,GAAA,CAEA,IADA,GAAA3zJ,GAAA,EACAA,EAAA0zJ,EAAA55J,OAAA,GAAA65J,GAAAD,EAAA1zJ,GAAApH,KAAAoH,GAEA,OADA2zJ,IAAA3zJ,EAAA,EAAA0zJ,EAAA1zJ,EAAA,GAAApH,IAAA,EACAo3J,EAAA2D,EAAA1D,GAAA,IAAAyD,EAAA1zJ,GAAAgH,IAEA,MAAA,SAYAm1F,EAAA5gG,OAAA,mBACAmV,OAAA,OAAA,SAAA,SAAA+2F,GAiBA,QAAAqsD,GAAA77D,EAAAkzB,GACA,GAAA4oC,GAAA97D,EAAAn7F,IAAA,SAAAo0G,GACA,MAAAzJ,GAAA0jB,GAAAja,IAEA,OAAA6iD,GAAAj8J,QAAAe,KAAA6I,IAAAmL,MAAAhU,KAAAk7J,IApBA,MAAA,UAAAjvJ,EAAAggH,GAEA,MAAA/xG,GAAAjO,GAGA+xF,EAAAiuB,GACAjsH,KAAA6I,IAAAmL,MAAAhU,KAAAiM,GACAA,EAAAgvJ,EAAAhvJ,EAAAggH,IAJAhgH,MA6BAq3F,EAAA5gG,OAAA,mBACAmV,OAAA,OAAA,SAAA,SAAA+2F,GAiBA,QAAAusD,GAAA/7D,EAAAkzB,GACA,GAAA4oC,GAAA97D,EAAAn7F,IAAA,SAAAo0G,GACA,MAAAzJ,GAAA0jB,GAAAja,IAEA,OAAA6iD,GAAAj8J,QAAAe,KAAAo8C,IAAApoC,MAAAhU,KAAAk7J,IApBA,MAAA,UAAAjvJ,EAAAggH,GAEA,MAAA/xG,GAAAjO,GAGA+xF,EAAAiuB,GACAjsH,KAAAo8C,IAAApoC,MAAAhU,KAAAiM,GACAA,EAAAkvJ,EAAAlvJ,EAAAggH,IAJAhgH,MA4BAq3F,EAAA5gG,OAAA,uBACAmV,OAAA,UAAA,WACA,MAAA,UAAA5L,EAAAmvJ,EAAAh7J,GAEA,GAAAi7J,GAAA3+D,EAAAzwF,GAAAm1C,OAAAn1C,GAAAA,CAIA,OAHAmvJ,GAAAA,GAAA,IACAh7J,EAAAA,IAAA,GAEA+9F,EAAAk9D,IAAAh6G,MAAAg6G,GAAApvJ,EAEA7L,EACAJ,KAAAI,MAAAi7J,EAAAD,EAAA,KACAC,EAAAD,EAAA,OAYA93D,EAAA5gG,OAAA,uBACAmV,OAAA,UAAA,WACA,MAAA,UAAAmjJ,EAAA5D,GAGA,GAAAj5D,EAAAi5D,IAAA5pB,SAAA4pB,IAAAA,EAAA,IAAA,GAAAA,GAAA,GACAj5D,EAAA68D,IAAAxtB,SAAAwtB,GAAA,CACA,GAAAD,GAAA,cAAAC,EAAA,GACA,OAAAh7J,MAAAI,MAAA26J,EAAA/6J,KAAAoK,IAAA,GAAAgtJ,IAAAp3J,KAAAoK,IAAA,GAAAgtJ,GAEA,MAAA,SAcA9zD,EAAA5gG,OAAA,qBACAmV,OAAA,QAAA,WACA,MAAA,UAAA5L,EAAAqvJ,GACA,GAAAC,GAAA,4BAEA,OAAAp9D,GAAAlyF,IAAAsvJ,EAAA92J,KAAA62J,GAIArvJ,EAAAsb,SAAA+zI,GAAAx0J,cAHAmF,KAiBAq3F,EAAA5gG,OAAA,wBACAmV,OAAA,WAAA,WACA,MAAA,UAAAgkC,EAAAu7G,GACA,MAAAj5D,GAAAi5D,IAAA5pB,SAAA4pB,IAAAA,EAAA,IAAA,GAAAA,GAAA,GACAj5D,EAAAtiD,IAAA2xF,SAAA3xF,GACAA,EAAA,IACA,GAAAA,EACAA,EAAA,IACAs7G,EAAAt7G,EAAA,IAAAu7G,GAAA,KACAv7G,EAAA,IACAs7G,EAAAt7G,EAAA,IAAAu7G,GAAA,KAEAD,EAAAt7G,EAAA,IAAAu7G,GAAA,KAIA,SAWA9zD,EAAA5gG,OAAA,mBACAmV,OAAA,MAAA,WACA,MAAA,UAAA5L,EAAAuvJ,GACA,MAAAthJ,GAAAjO,GAEAA,EAAAorD,OAAA,SAAA9wC,EAAAk1I,GACA,MAAAl1I,GAAAk1I,GACAD,GAAA,GAHAvvJ,KAeAq3F,EAAA5gG,OAAA,oBAEAmV,OAAA,WAAA,WACA,MAAA,UAAA5L,EAAAyvJ,EAAA7B,GAEA,GACAp4J,GADAq4J,EAAAD,IAAA,CAGA,QAAAn9D,EAAAzwF,IAAA+xF,EAAA09D,GACAzvJ,GAGAA,EAAA,EAAAA,EAAAA,EAAArM,cACA6B,EAAAwK,EAAAhL,OAAAy6J,EAAAz6J,OAEAgL,EAAAhN,QAAA,EAAAy8J,EAAAA,EAAA97J,cAAA6B,YAYA6hG,EAAA5gG,OAAA,mBACAmV,OAAA,YAAA,WAmGA,QAAA8jJ,GAAAxtJ,GACA,MAAAA,GAAAhM,QAAA,oBAAA,SAAA3D,GACA,MAAAo9J,GAAAp9J,IAAAA,IAVA,IAAA,GA1FAq9J,KACAjvI,KAAA,IAAAkvI,QAAA,uCACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,QACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,cACAlvI,KAAA,IAAAkvI,QAAA,iBACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,IAAAkvI,QAAA,mCACAlvI,KAAA,IAAAkvI,QAAA,WACAlvI,KAAA,IAAAkvI,QAAA,oBACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,IAAAkvI,QAAA,yBACAlvI,KAAA,IAAAkvI,QAAA,UACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,IAAAkvI,QAAA,uBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,aACAlvI,KAAA,IAAAkvI,QAAA,qBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,gDACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,IAAAkvI,QAAA,eACAlvI,KAAA,IAAAkvI,QAAA,WACAlvI,KAAA,IAAAkvI,QAAA,sBACAlvI,KAAA,IAAAkvI,QAAA,sBACAlvI,KAAA,IAAAkvI,QAAA,oBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,uCACAlvI,KAAA,IAAAkvI,QAAA,aACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,eACAlvI,KAAA,IAAAkvI,QAAA,UACAlvI,KAAA,IAAAkvI,QAAA,oBACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,IAAAkvI,QAAA,wCACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,QACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,cACAlvI,KAAA,IAAAkvI,QAAA,kBACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,KAAAkvI,QAAA,OACAlvI,KAAA,IAAAkvI,QAAA,oCACAlvI,KAAA,IAAAkvI,QAAA,WACAlvI,KAAA,IAAAkvI,QAAA,oBACAlvI,KAAA,IAAAkvI,QAAA,oBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,yBACAlvI,KAAA,IAAAkvI,QAAA,WACAlvI,KAAA,IAAAkvI,QAAA,mBACAlvI,KAAA,IAAAkvI,QAAA,wBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,aACAlvI,KAAA,IAAAkvI,QAAA,sBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,gDACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,eACAlvI,KAAA,IAAAkvI,QAAA,WACAlvI,KAAA,IAAAkvI,QAAA,sBACAlvI,KAAA,IAAAkvI,QAAA,uBACAlvI,KAAA,IAAAkvI,QAAA,qBACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,uCACAlvI,KAAA,IAAAkvI,QAAA,aACAlvI,KAAA,KAAAkvI,QAAA,MACAlvI,KAAA,IAAAkvI,QAAA,gBACAlvI,KAAA,IAAAkvI,QAAA,UACAlvI,KAAA,IAAAkvI,QAAA,qBACAlvI,KAAA,IAAAkvI,QAAA,mBAGAF,KACAz0J,EAAA,EAAAA,EAAA00J,EAAA56J,OAAAkG,IAEA,IAAA,GADA20J,GAAAD,EAAA10J,GAAA20J,QAAA92J,MAAA,IACA8P,EAAA,EAAAA,EAAAgnJ,EAAA76J,OAAA6T,IACA8mJ,EAAAE,EAAAhnJ,IAAA+mJ,EAAA10J,GAAAylB,IAWA,OAAA,UAAA3gB,GAEA,MAAAywF,GAAAzwF,GACA0vJ,EAAA1vJ,GACAA,MAYAq3F,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA5L,EAAAG,GAEA,GAAA6Q,GAAA7Q,GAAA,KAEA,OAAAswF,GAAAzwF,GACAA,EAAA9J,QAAA,GAAAkE,QAAA,IAAA4W,EAAA,KAAA,IACAhR,KAYAq3F,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA5L,EAAA2oB,EAAAtc,GAEA,GAAAyjJ,GAAA,GAAA11J,QAAAuuB,EAAAtc,EAEA,OAAAokF,GAAAzwF,GACAA,EAAAjG,MAAA+1J,GACA,QAaAz4D,EAAA5gG,OAAA,kBACAmV,OAAA,UAAA,WACA,MAAA,UAAAwQ,GAEA,MADAA,IAAA,GACA,IAAAA,EAAAhsB,MAAA,EAAA,GAAA,KAAAgsB,EAAAhsB,MAAA,EAAA,GAAA,IAAAgsB,EAAAhsB,MAAA,MAYAinG,EAAA5gG,OAAA,iBACAmV,OAAA,UAAA,WACA,MAAA,UAAA5L,EAAAmsB,EAAA2rE,GAEA,GAAAi4D,KAAA5jI,CAEA,OAAAskE,GAAAzwF,IAIA+vJ,EAEA9D,EAAAjsJ,IAAAmsB,EAAA2rE,GAAA,IALA93F,MA8BAq3F,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,MAAA,UAAA5L,EAAAG,GAEA,GAAA6Q,GAAA7Q,GAAA,KAEA,OAAAswF,GAAAzwF,GACAA,EAAA9J,QAAA,GAAAkE,QAAA4W,EAAA,MAAA,IACAhR,KAYAq3F,EAAA5gG,OAAA,kBACAmV,OAAA,WAAA,WACA,MAAA,UAAA5L,EAAAgwJ,GAEA,GAAA95J,GAAA67F,EAAAi+D,GAAA,IAAAA,CAEA,OAAAv/D,GAAAzwF,GACAA,EAAArM,cAAAuC,QAAA,OAAAA,GACA8J,MAYAq3F,EAAA5gG,OAAA,gBACAmV,OAAA,QAAA,WACA,QAAAqkJ,GAAA/tJ,GACA,MAAAA,GAAAhM,QAAA,sCAAA,QAGA,MAAA,UAAA8J,EAAAguJ,EAAA9X,GACA,GAAAga,GAAAC,EAAAC,EAAAC,CAEA,OAAAt+D,GAAA/xF,KAAAywF,EAAAzwF,GACA,MAEA+xF,EAAAi8D,KAAAA,EAAA,IACA54G,MAAA8gG,KAAAA,EAAA,GAEAga,EAAA,GAAA91J,QAAA61J,EAAAjC,GAAA,KACAmC,EAAAnwJ,EAAAjG,MAAAm2J,GAEAvF,EAAAwF,IAAAja,GAAAia,EAAAn7J,QACAgL,GAGA,IAAAk2I,EAAAl2I,EAAAjH,MAAAi1J,IAEAoC,EAAApwJ,EAAAjH,MAAAi1J,GACAqC,EAAAD,EAAAr4J,OAAA,EAAAm+I,EAAA,GACAka,EAAA33I,QAAA43I,EAAAn3J,KAAA80J,IAEAoC,OAaA/4D,EAAA5gG,OAAA,sBACAmV,OAAA,aAAA,WACA,MAAA,UAAA5L,EAAAqW,EAAAu3I,GAEA,GAAAC,GAAAD,IAAA,CAEA,QAAAn9D,EAAAzwF,IAAA+xF,EAAA17E,GACArW,GAGAA,EAAA,EAAAA,EAAAA,EAAArM,eAEAqM,EAAAhN,QAAA,EAAAqjB,EAAAA,EAAA1iB,mBAYA0jG,EAAA5gG,OAAA,qBACAmV,OAAA,aAAA,WACA,MAAA,UAAA5L,GAEA,GAAAuF,GAAAyX,MAAAjJ,UAAA3jB,MAAAC,KAAAmV,UAAA,EAEA,OAAAxF,GAAA9J,QAAA,WAAA,SAAA6D,EAAA61C,GACA,MAAAmiD,GAAAxsF,EAAAqqC,IAAA71C,EAAAwL,EAAAqqC,QAaAynD,EAAA5gG,OAAA,qBACAmV,OAAA,YAAA,WACA,MAAA,UAAA5L,GACA,MAAAywF,GAAAzwF,GACAA,EAAA9J,QAAA,cAAA,IACA8J,KAYAq3F,EAAA5gG,OAAA,eACAmV,OAAA,OAAA,WACA,MAAA,UAAA5L,EAAA2oB,EAAAtc,GAEA,GAAAyjJ,GAAA,GAAA11J,QAAAuuB,EAAAtc,EAEA,OAAAokF,GAAAzwF,GACA8vJ,EAAAt3J,KAAAwH,GACAA,KAYAq3F,EAAA5gG,OAAA,eACAmV,OAAA,OAAA,WACA,MAAA,UAAA5L,EAAAG,GAEA,GAAA6Q,GAAA7Q,GAAA,KAEA,OAAAswF,GAAAzwF,GACAA,EAAA9J,QAAA,GAAAkE,QAAA,IAAA4W,EAAA,KAAAA,EAAA,KAAA,KAAA,IACAhR,KAYAq3F,EAAA5gG,OAAA,mBACAmV,OAAA,WAAA,WACA,MAAA,UAAA5L,EAAAhL,EAAA0oC,EAAAosH,GAMA,MAJA90J,GAAA+8F,EAAA/8F,GAAAgL,EAAAhL,OAAAA,EACA80J,EAAAA,IAAA,EACApsH,EAAAA,GAAA,IAEA+yD,EAAAzwF,IAAAA,EAAAhL,QAAAA,EAAAgL,EAEAA,EAAAK,UAAA,EAAA,EACAL,EAAAhN,QAAA,IAAAgC,QAAAgL,EAAAhL,OAAAgL,EAAAhN,QAAA,IAAAgC,GACAA,GAAA0oC,KAYA25D,EAAA5gG,OAAA,kBACAmV,QACA0kJ,QAAAnE,EACAoE,SAAApE,IAwBA90D,EAAA5gG,OAAA,+BACAmV,OAAA,sBAAA,UAAA,SAAAq4F,GACA,MAAA,UAAAjkG,GACA,MAAAywF,GAAAzwF,GACAikG,EAAAx7D,mBAAAzoC,GACAA,MAYAq3F,EAAA5gG,OAAA,qBACAmV,OAAA,aAAA,UAAA,SAAAq4F,GACA,MAAA,UAAAjkG,GACA,MAAAywF,GAAAzwF,GACAikG,EAAAusD,UAAAxwJ,GACAA,MAYAq3F,EAAA5gG,OAAA,eACAmV,OAAA,OAAA,WACA,MAAA,UAAA5L,EAAAs5B,EAAAm2H,GACA,MAAAh/D,GAAAzwF,IAAAgyF,EAAA14D,IACAA,EAAAt5B,EAAAyvJ,GAAAn2H,GAAApgC,KAAA,IACA8G,KAcAq3F,EAAA5gG,OAAA,yBACAojG,SAAA,gBAAA,WAEA5mG,KAAAy1G,MAAA,UAAA,aAAA,SAAAzE,EAAApB,GA6BA,QAAA4tD,GAAAC,EAAAnrJ,GACA,QAAAorJ,KACA,GAAAvrJ,KACA,OAAA,UAAAyH,EAAA/Y,GACA,GAAAy9F,EAAAz9F,KAAA62J,EAAA72J,GAAA,CACA,IAAAsR,EAAApS,QAAAc,GAAA,MAAA,YACAsR,GAAA7L,KAAAzF,GAEA,MAAAmwG,IAAAnwG,EAAA,UACAmwG,EAAAj1G,UAAA8E,EAAA,YACAs+F,EAAAt+F,GAAA,SACAA,GAGA,OAAA48J,EAAAjtH,KAAA+6B,UAAAj5D,EAAAorJ,MACAz3J,KAAA,KACAhD,QAAA,KAAA,IAUA,QAAA06J,GAAAlkJ,GACA,GAAAxU,GAAAwU,EAAA4tH,YAAA/D,GACAtlI,GAAAmlI,EAAAl+H,GAAA,SAAA2U,SACAgkJ,GAAAhkJ,WAEAupH,GAAAl+H,GAQA,QAAA44J,KACAC,EAAA,WACAluD,EAAAshB,UACA0sC,OACA,KAWA,QAAAp1J,GAAAw7F,EAAA0R,GACA,GAAAzwG,GAAA++F,EAAAs/B,GAKA,OAJAxkC,GAAAqkC,EAAAl+H,MACA++F,EAAA2c,IAAA,WAAAg9C,GACAx6B,EAAAl+H,OAEAk+H,EAAAl+H,GAAAqB,KAAAovG,GAUA,QAAAqoD,GAAAjiC,EAAAxpH,GACA,GAAAojG,GAAA8nD,EAAA1hC,EAAAxpH,EACA,OAAAsrJ,GAAAloD,GAaA,QAAAsoD,GAAAliC,EAAAxpH,EAAA0xF,EAAArgF,GACA,GAAA+xF,GAAA8nD,EAAA1hC,EAAAxpH,EAUA,OARAsrJ,GAAAloD,GAAA/xF,EAGAw7E,EAAA6E,GACAx7F,EAAAw7F,EAAA0R,GAEAmoD,IAEAl6I,EAvHA,GAAAi6I,MAQAz6B,KAMA26B,EAAA9sD,EAAAjqG,UA4GA,QACAszJ,WAAA0D,EACA7rJ,QAAA8rJ,OAaA55D,EAAA5gG,OAAA,kBAEA,cACA,iBACA,2BACA,cACA,eACA,iBACA,iBACA,eACA,kBACA,gBACA,WACA,WACA,YACA,YACA,aACA,WACA,YACA,YACA,cAEA,eACA,aACA,eACA,aACA,eACA,YACA,kBACA,aACA,mBACA,eACA,YACA,cACA,aACA,kBACA,eACA,eACA,eACA,mBACA,eACA,YACA,WACA,WACA,YACA,gBACA,UACA,UACA,YACA,WACA,cACA,WACA,YAEA,eACA,eACA,eACA,mBACA,iBACA,eACA,mBACA,mBACA,mBACA,iBACA,oBAEA,cACA,iBACA,cAEA,wBAEA/F,OAAAA,OAAA2mG,SCzzEA,WACA,YAKA,SAAAtG,KACA,QAAAC,EAUA,QAAA5lF,GAAAtG,GACA,MAAAA,IAAAA,EAAApU,SAAAoU,EAeA,QAAA2rF,GAAA5vF,GAAA,MAAA,gBAAAA,GAOA,QAAA0vF,GAAAzrF,GACA,GAAA,MAAAA,GAAAsG,EAAAtG,GACA,OAAA,CAGA,IAAA9P,GAAA8P,EAAA9P,MAEA,SAAA,IAAA8P,EAAAqB,WAAAnR,KAIAy7F,EAAA3rF,IAAAkY,MAAA/O,QAAAnJ,IAAA,IAAA9P,GACA,gBAAAA,IAAAA,EAAA,GAAAA,EAAA,IAAA8P,IAcA,QAAAmvF,KACA,MAAAx6F,QAAAk2E,OAAA,MAeA,QAAAg5B,GAAA7jG,EAAA8jG,GACA,GACA/7F,GADAg8F,QAAA/jG,EAcA,OAXA,YAAA+jG,GAAA,UAAAA,GAAA,OAAA/jG,EACA,mBAAA+H,EAAA/H,EAAAosF,WAEArkF,EAAA/H,EAAAosF,YACAp+F,SAAA+Z,IACAA,EAAA/H,EAAAosF,WAAA0X,GAAA7X,MAGAlkF,EAAA/H,EAGA+jG,EAAA,IAAAh8F,EAIA,QAAAqkJ,GAAA/9D,EAAAliD,EAAA40C,GACA,GACA3qF,GAAA2N,EADAsoJ,KAEAC,IACA,KAAAl2J,EAAA,EAAAA,EAAA+1C,EAAAj8C,OAAAkG,IACA,IAAA2N,EAAA,EAAAA,EAAAsqF,EAAAn+F,OAAA6T,IACAsqF,EAAAtqF,GAAAg9E,GAEAsN,EAAAtqF,GAAAg9E,KAAA50C,EAAA/1C,IACAk2J,EAAA73J,KAAA45F,EAAAtqF,IAFAsoJ,EAAA53J,KAAA45F,EAAAtqF,GASA,OAFAuoJ,GAAAA,EAAAljJ,OAAAijJ,GAUA,QAAAh4D,GAAA3/D,GAGA,GAAAnT,GAAAmT,EAAA,GACA4/D,EAAA5/D,EAAAA,EAAAxkC,OAAA,GACAqkG,GAAAhzE,EAEA,GAAA,CAEA,GADAA,EAAAA,EAAArG,aACAqG,EAAA,KACAgzE,GAAA9/F,KAAA8sB,SACAA,IAAA+yE,EAEA,OAAA/B,SAAA9tF,QAAA8vF,GAqKA,QAAAvtF,GAAAC,EAAAC,GACA,MAAAD,EAAAA,EAAAC,KAAA,IAAAD,EAAA5F,WACA,MAAA4F,GA7SA,GAAAilF,GAAA,EAyIAmyD,EAAA,SAAAroD,GACA,MAAAA,GAAA1lG,MAAA,IAGAguJ,EAAA,SAAAtoD,GACA,MAAAA,GAAA1lG,MAAA0lG,EAAA1lG,MAAAJ,OAAA,IAGA0tJ,EAAA,SAAAzrD,EAAAzjG,EAAAmvJ,EAAA9hJ,EAAA+hJ,EAAA/1I,EAAAg2I,EAAA5xG,GAEAgmD,EAAA0rD,GAAA9hJ,EACA+hJ,IAAA3rD,EAAA2rD,GAAA/1I,GACAoqF,EAAAi1C,OAAA14I,EACAyjG,EAAA6rD,OAAA,IAAAtvJ,EACAyjG,EAAA8rD,MAAAvvJ,IAAAqvJ,EAAA,EACA5rD,EAAA+rD,UAAA/rD,EAAA6rD,QAAA7rD,EAAA8rD,OAEA9rD,EAAAgsD,OAAAhsD,EAAAisD,MAAA,KAAA,EAAA1vJ,IAGAy9C,IACAgmD,EAAAo6D,OAAApgH,IAIAqgH,EAAA,SAAA/nJ,EAAA0tF,GACA1tF,EAAArW,KAAA,eAAA+jG,IAGAv4E,EAAA,SAAAy0E,EAAA5pF,GACA,GACArO,GADAlG,EAAAm+F,EAAAn+F,MAEA,IAAA,IAAAA,EACA,OAAA,CAEA,KAAAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IACA,GAAAq2J,EAAAhoJ,EAAA4pF,EAAAj4F,IACA,OAAA,CAGA,QAAA,GAGAlI,EAAA,SAAAmgG,EAAA5pF,GACA,GACArO,GADAlG,EAAAm+F,EAAAn+F,MAEA,IAAA,IAAAA,EACA,QAEA,KAAAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IACA,GAAAq2J,EAAAhoJ,EAAA4pF,EAAAj4F,IACA,MAAAA,EAGA,WAWAs2J,EAAA,SAAAngK,EAAAgD,EAAAqnB,GACA,GACAtsB,GADAsc,EAAAra,EACAwK,QAAA6f,EAEA,IAAArqB,GAAAgD,EACA,MAAA,KAEA,GACA,IAAA,WAAAwH,GAEA,GADAzM,EAAA,IAAAsc,EAAAtc,UAAA,IACA,IAAAsc,EAAAvF,UAAA/W,EAAA8G,QAAA,cAAA,KAAAlD,QAAA0oB,IAAA,EACA,MAAAhQ,OAGA,IAAAA,GAAAgQ,EACA,MAAAhQ,UAIAA,EAAAA,EAAAnT,aAAAmT,GAAArX,GAAA,IAAAqX,EAAAvF,SAEA,OAAA,OAKAsrJ,EAAA,SAAAloJ,GACA,GAAA9X,GACArC,EAAAma,EAAAna,UAAA8G,QAAA,cAAA,KAAA8a,MACAvf,GAAArC,EAAA2J,MAAA,IACA,KAAA,GAAAmC,GAAA,EAAAA,EAAAzJ,EAAAuD,OAAAkG,IACA,MAAA1C,KAAA/G,EAAAyJ,MACAzJ,EAAAsG,OAAAmD,EAAA,GACAA,IAGA,OAAAzJ,IAKAqxC,EAAA,SAAAv5B,EAAAna,GACA,GAAAqC,GAAAggK,EAAAloJ,EACA,OAAA9X,GAAAuB,QAAA5D,SAqCAsiK,EAAA,SAAAnoJ,EAAAooJ,GACA,GAAAC,GACAp+J,EAAAwB,CACA,IAAAuU,EAAAnV,OAAAT,cAAAX,QAAA2+J,EAAAh+J,oBACA,OAAA,CAIA,KAFAi+J,EAAAroJ,EAAAyiB,WACAh3B,EAAA48J,EAAA58J,OACAxB,EAAA,EAAAA,EAAAwB,EAAAxB,IACA,GAAAo+J,EAAAn1I,GAAAjpB,GAAAY,OAAAT,cAAAX,QAAA2+J,EAAAh+J,oBACA,OAAA,CAGA,QAAA,GAWA0hG,EAAAgC,QAAA9tF,QAEAgoJ,EAAAl6D,QAAA1D,OAEAk+D,EAAAx6D,QAAA16E,KAEA7O,EAAAupF,QAAAvpF,OAEAgkJ,EAAAz6D,QAAA5gG,OAAA,0BAMAq7J,GAAAj4D,SAAA,cAAA,WAEA,GAAAsuD,GAAA,KAGA4J,GACAC,SACAC,qBAAA,mBACAC,eAAA,mBACAC,mBAAA,oBACAC,UAAA,aACAC,YAAA,iBAKAC,EAAAT,EAAAE,EAOA9+J,MAAAs/J,iBAAA,SAAA7L,EAAA5hJ,GACA,IAAA4hJ,EACA,KAAA,IAAAz7I,OAAA,8DAEAqnJ,GAAA5L,KACA4L,EAAA5L,OAEA4L,EAAA5L,GAAA54I,EAAAwkJ,EAAA5L,GAAA5hJ,IAOA7R,KAAAu/J,UAAA,SAAA9L,GACAyB,EAAAzB,GAOAzzJ,KAAAy1G,MAAA,UAAA,SAAAm4B,GACA,GAAA4xB,EASA,OAPAA,GADAtK,EACAmK,EAAAnK,GAEAmK,EAAAzxB,EAAA3oI,IAEAu6J,IACAA,EAAAV,EAAA,UAEAU,MAMAX,EAAAv5D,WAAA,kBAAA,WAEA,GAAA7sE,GAAAz4B,IAIAy4B,GAAAk3H,cAAA,KACAl3H,EAAAi3H,gBAAA,KAEAj3H,EAAAgnI,YAAA,EAGAhnI,EAAAinI,mBAAA,aAGAjnI,EAAAknI,MAAA,SAAA16J,GACAwzB,EAAAxzB,GAAAA,GAAA,MAAAnE,KAAAikE,MAAA,IAAAjkE,KAAA8oB,aAIAi1I,EAAAj3D,UAAA,eAAA,SAAA,YAAA,WAAA,WAAA,cAAA,SAAA8H,EAAAtB,EAAA0C,EAAAu1C,EAAAuZ,GAEA,GAAAC,GAAA,mBAEAC,EAAA,qMAOAC,EAAA,yCAEAC,EAAA,2EAIAC,EAAA,wCAEAC,EAAA,kEAEAC,EAAA,iRAOA,QACA9hD,SAAA,MACArlE,SAAA,UAAA,eACAssD,WAAA,kBACA50E,QAAA,SAAA61H,EAAAj/B,GAGAi/B,EAAAnmJ,SAAA,YAQA,IAiCAggK,GACAnB,EACAoB,EACA7hK,EACAuD,EACAxB,EACA+/J,EAGAC,EA1CAC,EAAA,SAAAx8D,GAEA,GAAAvnF,EAmBA,OAfAA,GAFA6qG,EAAAm5C,SAEAr+D,EAAAklB,EAAAm5C,UACAn5C,EAAAhnE,MAEAvkD,SAAAyqC,eAAA8gF,EAAAhnE,OACAk/G,EAAAkB,wBAEAt+D,EAAAo9D,EAAAkB,yBACAlB,EAAAR,qBAEAjjK,SAAAyqC,eAAAg5H,EAAAR,sBAGAjjK,SAAAyqC,eAAAq5H,GAGA77D,IAAAsjB,EAAAm5C,UAAAjB,EAAAkB,yBAEAra,EAAA5pI,GAAAunF,GAGAvnF,GAGA/e,EAAA6oJ,EAAAxtH,WACA4nI,EAAAv+D,EAAA09D,GACAc,EAAAx+D,EAAA29D,GACAc,EAAAz+D,EAAA69D,GAQAT,EAAAI,EACAH,EAAA,mBAAAn4C,GAAAyzB,QA0BA,KAvBAv8I,EAAAggK,EAAAjY,EAAA,IACA/nJ,EAAAR,QAAA,SAAA7B,GACA,sDAAAoJ,KAAApJ,KACAoqJ,EAAApmJ,YAAAhE,GACAwkK,EAAAxgK,YAAA,eACAwgK,EAAAvgK,SAAAjE,IAGA,mBAAAoJ,KAAApJ,KACAoqJ,EAAApmJ,YAAAhE,GACAwkK,EAAAvgK,SAAAjE,MAQA0kK,EAAAr+J,OAAA9E,GAIAqE,EAAArE,EAAAqE,OACAxB,EAAA,EAAAA,EAAAwB,EAAAxB,IACA+/J,EAAA5iK,EAAA8rB,GAAAjpB,IACA+/J,EAAAzwH,SAAA,kBAAAywH,EAAA7/J,KAAA,oBACA6/J,EAAApgK,KAAA,KAAAO,KAAA,WAAA,KAGA8/J,EAAAD,EAAA7/J,KAAA,SACA2jG,QAAA5G,SAAA+iE,IAAA,KAAAA,IACAD,EAAA7/J,KAAA,aAAA8/J,GACAD,EAAAnyH,WAAA,UAoDA,OA/CA,mBAAAm5E,GAAAw5C,aACAV,EAAAh+D,EAAA49D,GAEA14C,EAAAy5C,cACAb,EAAAA,EAAAj9J,QAAA,mBAAAqkH,EAAAy5C,eACAz5C,EAAA05C,iBACAd,EAAAA,EAAAj9J,QAAA,mBAAAqkH,EAAA05C,kBAGAxB,EAAAyB,kBACAf,EAAAA,EAAAj9J,QAAA,mBAAAu8J,EAAAyB,mBACAzB,EAAAP,iBACAiB,EAAAA,EAAAj9J,QAAA,mBAAAu8J,EAAAP,iBAIAA,EAAA78D,EAAA89D,GACAU,EAAAp+J,OAAA49J,GACAS,EAAAr+J,OAAAy8J,IAGA,mBAAA33C,GAAA+4C,YAAAZ,IAEAD,EAAA0B,aACAf,EAAAA,EAAAl9J,QAAA,aAAAu8J,EAAA0B,cACA1B,EAAAL,YACAgB,EAAAA,EAAAl9J,QAAA,aAAAu8J,EAAAL,YAGAK,EAAA2B,eACAhB,EAAAA,EAAAl9J,QAAA,eAAAu8J,EAAA2B,gBACA3B,EAAAL,YACAgB,EAAAA,EAAAl9J,QAAA,eAAAu8J,EAAAJ,cAGAiB,EAAAj+D,EAAA+9D,GACAS,EAAAp+J,OAAA69J,IAIAj+D,EAAAu+D,EAAA,GAAAxqF,cAAA,mBAAA3zE,OAAAg+J,KAEAI,EAAAp+J,OAAAq+J,GAEAta,EAAA/jJ,OAAAm+J,GACApa,EAAA/jJ,OAAAo+J,GAEA,SAAAp8C,EAAAnlE,EAAAolE,EAAAyhC,GAoCA,QAAAkb,GAAApqI,GACAA,GACA2pI,EAAAvgK,SAAA,YACAugK,EAAAlgK,KAAA,WAAA,YACA4gK,EAAAV,EAAAlgK,KAAA,YACAkgK,EAAAlgK,KAAA,WAAA,MACAkvE,GAAA,IAEAgxF,EAAAxgK,YAAA,YACAwgK,EAAAxyH,WAAA,YACAkzH,EACAV,EAAAlgK,KAAA,WAAA4gK,GAEAV,EAAAxyH,WAAA,YAEAwhC,GAAA,GA0HA,QAAA2xF,KACAlB,EAAArnI,WAAAvP,GAAA,GAAA,GAAA5b,MAAA,EACA,IAEArN,GACAukC,EACAy8H,EAJA7jK,EAAAmjK,EAAA9nI,WACAh3B,EAAArE,EAAAqE,MAIA,KAAAxB,EAAA,EAAAA,EAAAwB,EAAAxB,IACAukC,EAAApnC,EAAA8rB,GAAAjpB,GACAukC,EAAA+K,SAAA,kBACA/K,EAAA3kC,YAAA,YAGA8+J,GAAA9+J,YAAA,QACAohK,EAAAC,GAAA,GAEAD,IACA7jK,EAAAyC,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,WA2TA,QAAAqhK,KACA,GACAx5J,GAAAq4J,EADA3kJ,EAAAklJ,EAAA9nI,WAEAh3B,EAAA4Z,EAAA5Z,MACA,KAAAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IAEA,GADAq4J,EAAA3kJ,EAAA6N,GAAAvhB,GACAq4J,EAAAzwH,SAAA,WAAAywH,EAAAzwH,SAAA,mBAAAywH,EAAAzwH,SAAA,aACA,MAAAywH,EAGA,OAAA,MAOA,QAAAoB,GAAAjpJ,GAIA,IAAA,GADAosH,GAFAvuD,EAAA79D,EAAAzb,WACA+E,EAAAu0E,EAAAv0E,OAEAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IAEA,GADA48H,EAAAvuD,EAAAruE,GACA,IAAA48H,EAAA3xH,UAAA,MAAA2xH,EAAA3+E,QAAAxlD,cAAA,CACAmkI,EAAAjuG,OACA,QAKA,QAAA+qI,GAAAl5I,GACA,GAAA4U,GAAAthC,SAAAG,cAAA,MACAmhC,GAAAvgC,WAAA,QAAA,UAAA2rB,EAAA,KAAA,YAAAxiB,KAAA,IACAo3B,EAAAthC,SAAAyD,KAAAyE,YAAAo5B,EACA,IAAAjhC,GAAAihC,EAAAr2B,qBAAA,SAAA,EACA,IAAA5K,GAAAA,EAAAwlK,OAAAxlK,EAAAwlK,MAAAhoH,OAAAx9C,EAAAwlK,MAAAC,SAAA,CACA,GAAAxnJ,MAAAje,EAAAwlK,MAAAhoH,OAAAx9C,EAAAwlK,MAAAC,UAAA,EAEA,OADA9lK,UAAAyD,KAAAoG,YAAAy3B,GACAhjB,EAEA,OAAA,EAGA,QAAAmnJ,GAAAM,GACA,GAAAC,EAQA,IANAA,EADAD,EACAjB,EAAA9nI,WAAAvP,GAAA,GAEAq3I,EAAA9nI,WAAAvP,GAAAq3I,EAAA9nI,WAAAh3B,OAAA,GAIA4/J,EAAA,6BAAA,CACA,GAAA76J,GAAA+5J,EAAA,GAAA1qF,cAAA,4BACA,IAAArvE,EACA,MAAAA,OAIA,KAAA,GAAAmB,GAAA,EAAAA,EAAA44J,EAAA9nI,WAAAh3B,OAAAkG,IAAA,CACA,GAAA+5J,GAAAnB,EAAA9nI,WAAAvP,GAAAvhB,EACA,KAAA+5J,EAAAnyH,SAAA,cAAAmyH,EAAAnyH,SAAA,YACA,MAAAgxH,GAAA9nI,WAAAvP,GAAAvhB,GAAA,GAKA,OAAA85J,EAAAlyH,SAAA,kBAAAkyH,EAAAlyH,SAAA,aAAAkyH,EAAAlyH,SAAA,aAGAiyH,EACAG,EAAAF,EAAA,GAAA,eAEAE,EAAAF,EAAA,GAAA,mBALAA,EAAA,GAgBA,QAAAE,GAAA94E,EAAA59B,GACA,IAAA49B,GAAAt5C,EAAAs5C,EAAA,iBAAA,CAIA,IADA,GAAAnwD,GAAAmwD,GACAnwD,EAAAngB,EAAAmgB,EAAAuyB,KAAAvyB,EAAA9lB,UACA,GAAA28B,EAAA7W,EAAA,mBAAA6W,EAAA7W,EAAA,cAAA6W,EAAA7W,EAAA,aACA,MAAAA,EAGA,OAAA,OAMA,QAAAkpI,GAAA/C,GACA,GAAAM,IAAA9vF,EAAA,CAGA,GAAAwyF,GACAC,EACAzqB,CAGA,IADAwqB,EAAAtB,EAAA,GAAAxjK,iBAAA,kBACA8kK,EAAApgK,OAAA,EAAA,CACAqgK,EAAAC,EAAA7tB,WAIAmD,EAAA5tH,MAAA/O,QAAAonJ,GAAAxD,EAAAwD,KAEA,KAAA,GAAAn6J,GAAA,EAAAA,EAAAk6J,EAAApgK,OAAAkG,IAAA,CACA,GAAAq6J,GAAAlgE,EAAA+/D,EAAAl6J,GACA,KAAAq6J,EAAAzyH,SAAA,cAAAyyH,EAAAzyH,SAAA,aAAA,CAGA,GAAAjiC,GAAArN,CAIAqN,GAAA20J,EAAAD,GAEA,mBAAA10J,KACArN,EAAAR,EAAA43I,EAAA/pI,GACAuxJ,GAAA5+J,OAEAo3I,EAAArxI,KAAAsH,GACA00J,EAAAliK,SAAA,aACA++J,GAAA5+J,QAEAo3I,EAAA7yI,OAAAvE,EAAA,GACA+hK,EAAAniK,YAAA,eAMAkiK,EAAA3tB,cAAAiD,GACAnzB,EAAA+V,UAEAioC,MASA,QAAAC,GAAAH,GACA,GAAA10J,GACA+pI,EAEAp3I,EADA6hK,EAAAC,EAAA7tB,UAKA5mI,GAAA20J,EAAAD,GAEA,mBAAA10J,KACA6xJ,GAGA9nB,EAAA5tH,MAAA/O,QAAAonJ,GAAAxD,EAAAwD,MACA7hK,EAAAR,EAAA43I,EAAA/pI,GACArN,QAEAo3I,EAAArxI,KAAAsH,GACA00J,EAAAliK,SAAA,cAIAu3I,EAAA7yI,OAAAvE,EAAA,GACA+hK,EAAAniK,YAAA,eAKA0gK,EAAA9nI,WAAA54B,YAAA,YACAw3I,EAAA/pI,EACA00J,EAAAliK,SAAA,cAKAiiK,EAAA3tB,cAAAiD,GACAnzB,EAAA+V,UAEAklC,IAEApgH,EAAAxP,SAAA,SACAwP,EAAAljB,eAAA,QAEAkjB,EAAAl/C,YAAA,QACAwgK,EAAA,GAAA/pI,SAEA4rI,IAUA,QAAAD,GAAAD,GACA,GAAAI,EACA,OAAAC,IAEAD,EAAAJ,EAAAriK,KAAA,gBACA0iK,EAAAD,IAEAE,EAAAlT,iBAAAkT,EAAAjT,eACA+S,EAAAJ,EAAAriK,KAAA,gBACAyiK,EAAAE,EAAAlT,kBAAAgT,EAAAE,EAAAjT,gBAEA2S,EAAA7hK,KAAA,cAMA,QAAAoiK,GAAAP,GACA,GAAAt9J,GAAAs9J,EAAApiK,KAAA,IACA,OAAA,KAAA8E,EAAA+zB,WAAAh3B,QAAAiD,EAAA+zB,WAAAvP,GAAA,GAAAqmB,SAAA,cAEA7qC,EAAA,GAAAd,WAAAF,WAAA,GAGAgB,EAAA+zB,WAAAvP,GAAA,GAAA,GAAAxlB,WAAA,GAIA,QAAAw+J,KACA,GAAA7qB,GAAA0qB,EAAA7tB,UACAn1F,GAAAljB,eAAA,SAEA,IAAA2mI,GAAA1gE,EAAAu+D,EAAA,GAAAxqF,cAAA,kBACAisB,GAAAu+D,EAAA,GAAAxqF,cAAA,kBACA,OAAA,mBAAAwhE,IAAA,OAAAA,GAIAgpB,EAAAvgK,SAAA,0BACA0iK,GAAApgK,cAGA+8J,GAAA,IAAA9nB,EAAA51I,QACA4+J,EAAAvgK,SAAA,sBACA0iK,EAAApgK,UAEAi+J,EAAAxgK,YAAA,sBACA2wG,EAAA,WAEA,GACAljG,GACA00J,EACA/hK,EAEAwiK,EAGAj8J,EACAo2B,EACA/6B,EAVA6gK,EAAAnC,EAAA9nI,WAIAh3B,EAAAihK,EAAAjhK,OAEAqkC,KACA68H,IAYA,IAPAxD,GAAA,UAAAh7C,EAAAy+C,mBACAhmI,EAAA,EACAuiI,GAAAh7C,EAAAy+C,qBAAAp8J,EAAA29G,EAAAy+C,mBAAAp8J,MAAA,8BACAo2B,EAAAj8B,SAAA6F,EAAA,GAAA,KAIA,mBAAAo2B,IAAAy6G,EAAA51I,OAAAm7B,EASA,MARA4lI,GAAApgK,aACA88J,EAAA2D,sBACAL,EAAAtgK,OAAA4/F,EAAAo9D,EAAA2D,sBAAAlgK,QAAA,KAAA00I,EAAA51I,UACAy9J,EAAAN,mBACA4D,EAAAtgK,OAAAzG,SAAAyqC,eAAAg5H,EAAAN,mBAAAj8J,QAAA,KAAA00I,EAAA51I,UAEA+gK,EAAAtgK,OAAAzG,SAAAyqC,eAAAmxG,EAAA51I,OAAA,oBAMA,KAAAxB,EAAA,EAAAA,EAAAwB,EAAAxB,IACA+hK,EAAAU,EAAAx5I,GAAAjpB,GACA+hK,EAAAzyH,SAAA,mBAEAjiC,EAAA20J,EAAAD,GAEA7C,EACA11I,MAAA/O,QAAA28H,IAAAlsH,EAAAksH,EAAA/pI,KAGAm1J,EAAAT,EAAA7hK,KAAA,SACAsiK,EACA38H,EAAA9/B,KAAAvK,SAAAyqC,eAAAu8H,KAEA38H,EAAA9/B,KAAAu8J,EAAAP,IACAW,EAAA38J,KAAAg8J,EAAAriK,KAAA,mBAKAq+J,EAAA3mB,EAAA/pI,KACAm1J,EAAAT,EAAA7hK,KAAA,SACAsiK,EACA38H,EAAA9/B,KAAAvK,SAAAyqC,eAAAu8H,KAEA38H,EAAA9/B,KAAAu8J,EAAAP,IACAW,EAAA38J,KAAAg8J,EAAAriK,KAAA,mBAQA,IAAA,IAAAmmC,EAAArkC,OACA+gK,EAAApgK,QACAi+J,EAAAvgK,SAAA,0BACA,IAAA,IAAAgmC,EAAArkC,OACA4+J,EAAAxgK,YAAA,sBAEA2iK,EAAApgK,QAGAP,EADA8gK,EAAA,GACA5c,EAAAjgH,EAAA,IAAA68H,EAAA,IAEA78H,EAAA,GAEA08H,EAAAtgK,OAAAL,OAIA,KAFAw+J,EAAAxgK,YAAA,sBACA2iK,EAAApgK,QACAnC,EAAA,EAAAA,EAAA6lC,EAAArkC,OAAAxB,IAEA4B,EADA8gK,EAAA1iK,GACA8lJ,EAAAjgH,EAAA7lC,IAAA0iK,EAAA1iK,IAEA6lC,EAAA7lC,GAEAuiK,EAAAtgK,OAAAL,GACA5B,EAAA6lC,EAAArkC,OAAA,GACA+gK,EAAAtgK,OAAAzG,SAAAyqC,eAAA,WAWA,QAAA48H,KAEA,GAEA9C,GACAr4J,EAHAk6J,EAAAtB,EAAA3gK,KAAA,MACA6B,EAAAogK,EAAApgK,MAGA,KAAAkG,EAAA,EAAAA,EAAAlG,EAAAkG,IAEA,GADAq4J,EAAA6B,EAAA34I,GAAAvhB,GACAq4J,EAAAzwH,SAAA,kBAAAywH,EAAA7/J,KAAA,iBAAA,CACA4iK,EAAA/C,EAAA,GAAAt2J,YACA,OAIA,GAAA,MAAAzE,KAAAk/G,EAAAv0G,MAAA,CACA,GAAAozJ,GAAAriK,SAAAwjH,EAAAv0G,KAAA,GACA2wJ,GAAAz+J,IAAA,aAAAkhK,EAAAD,EAAA,MACAxC,EAAAz+J,IAAA,aAAA,SAn3BA,GAEAihK,GAEAhC,EACAsB,EALAN,EAAAnc,EAAA,GACA0c,EAAA1c,EAAA,GAEAv2E,GAAA,EAGA4zF,EAAA7zD,EAAAkzD,EAAAY,UACA/D,EAAA,mBAAAh7C,GAAAs2B,SAGA4lB,EAAAv+D,EAAA/iD,EAAA,GAAA82B,cAAA,qBACAyqF,EAAAD,EAAA3nI,OACA6nI,EAAAz+D,EAAAw+D,EAAA,GAAAzqF,cAAA,yBACAiqF,EAAAh+D,EAAAw+D,EAAA,GAAAzqF,cAAA,kBACA8oF,EAAA78D,EAAAy+D,EAAA,GAAA1qF,cAAA,sBACAkqF,EAAAj+D,EAAAw+D,EAAA,GAAAzqF,cAAA,kBAEAysF,GAAAY,WACAb,EAAA,SAAA3+D,EAAAsU,GACA,MAAAirD,GAAAv/D,EAAAsU,KAKAsqD,EAAAjD,MAAAtgH,EAAA5+C,KAAA,OAEAg/J,IACAmD,EAAAnD,YAAA,EAGA4C,EAAAnuB,SAAA,SAAAtmI,GACA,OAAAA,GAAA,IAAAA,EAAA7L,SAqBA,mBAAA0iH,GAAAztF,SACAwtF,EAAAnlB,OAAAolB,EAAAztF,SAAA,SAAAA,GACAoqI,EAAApqI,KAEA,mBAAAytF,GAAAg/C,YACAj/C,EAAAnlB,OAAAolB,EAAAg/C,WAAA,SAAAzsI,GACAoqI,EAAApqI,KASA4rI,EAAAlD,mBAAA,SAAAlgJ,EAAAkkJ,GACA,GACAnjK,GADAojK,KAEAC,GAAA,EAGAlsB,EAAAknB,EAAAyD,EAAAza,YAEA,IAAAlQ,EAAA,CAOA,GAAA3tH,MAAA/O,QAAAwE,IAAAA,EAAAzd,OAAA,EAAA,CACA,GAAA4gK,EACA,IAAApiK,EAAA,EAAAA,EAAAif,EAAAzd,OAAAxB,IACAojK,EAAAr9J,KAAAq8J,EAAAn+C,EAAAhlG,EAAAjf,SAGA,KAAAA,EAAA,EAAAA,EAAAif,EAAAzd,OAAAxB,IACAqiK,EAAAlT,gBACAiU,EAAAr9J,KAAAkZ,EAAAjf,GAAAqiK,EAAAlT,kBACAkT,EAAAjT,eACAgU,EAAAr9J,KAAAkZ,EAAAjf,GAAAqiK,EAAAjT,eAMA,IAAA8P,EAAA,CACA,IAAAl/J,EAAA,EAAAA,EAAAm3I,EAAA31I,OAAAxB,IACAkrB,EAAAk4I,EAAAjsB,EAAAn3I,MACAqjK,GAAA,EACAlsB,EAAA5yI,OAAAvE,EAAA,GACAA,IAIAqjK,KAGAvB,EAAA3tB,cAAAgD,GAEA8qB,SAIA/2I,GAAAk4I,EAAAjsB,KACAA,EAAAisB,EAAA,GAEAtB,EAAA3tB,cAAAgD,GAEA8qB,KAUAkB,GAEAlB,MAOA3B,EAAAjvJ,GAAA,QAAA,SAAA6H,GACA,IAAAk2D,IAIAyyB,EAAA3oF,EAAArb,QAAAyxC,SAAA,mBAAA,CAGA,GACAyyH,GADAf,EAAAhD,EAAA9kJ,EAAArb,OAAAyiK,EAAA,GAAA,gBAGA,IAAA,OAAAU,EAAA,CAEA,GADAe,EAAAlgE,EAAAm/D,GACAe,EAAAzyH,SAAA,YACA,MAEA4yH,GAAAH,MAKA,IAAAuB,GAAA,SAAApqJ,GACA,OAAA8kJ,EAAA9kJ,EAAArb,OAAAihD,EAAAj+C,SAAA,GAAAi+C,EAAA,MACAA,EAAAxP,SAAA,SACAwP,EAAAljB,eAAA,QAEAkjB,EAAAl/C,YAAA,SAGAiuG,GAAAx8F,GAAA,QAAAiyJ,GA0BAlD,EAAA/uJ,GAAA,OAAA,WACAytC,EAAAxP,SAAA,SACAwP,EAAAljB,eAAA,UAGAwkI,EAAA/uJ,GAAA,QAAA,WACA,GAAA2vJ,EACAliH,GAAA3P,YAAA,QACA2P,EAAAxP,SAAA,SAAA,mBAAAwzH,IACAD,IAEA,SAAA3+C,EAAAq8C,YAAAzhH,EAAAxP,SAAA,SACAyxH,IACAlB,EAAArnI,WAAAvP,GAAA,GAAA,GAAAoN,QACA2qI,EAAAC,GAAA,GACAD,IACAV,EAAA9nI,WAAA54B,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,YAEAi/C,EAAAxP,SAAA,UACA0xH,EAAAC,GAAA,GACAD,GACAG,EAAAH,MAMA,SAAA98C,EAAA47C,YAAAZ,GACAY,EAAAngK,KAAA,UAAAspB,GAAA,GAAA5X,GAAA,QAAA,WACAswJ,GAAA,KAEA7B,EAAAngK,KAAA,UAAAspB,GAAA,GAAA5X,GAAA,QAAA,WACAswJ,GAAA,MAIA7B,GACAA,EAAAjgK,SAAA,UAMA,SAAAqkH,EAAAq8C,WACAV,EAAArnI,WAAAnnB,GAAA,QAAA,WAEA,GAIArR,GACAukC,EACAy8H,EANAuC,EAAA1D,EAAArnI,WAAAl4B,MACAob,EAAA,EACAve,EAAAmjK,EAAA9nI,WACAh3B,EAAArE,EAAAqE,MAKA,IAAA+hK,EAAA,CACA,IAAAvjK,EAAA,EAAAA,EAAAwB,EAAAxB,IACAukC,EAAApnC,EAAA8rB,GAAAjpB,GACAukC,EAAA+K,SAAA,mBACA4uH,EAAA35H,EAAA5kC,KAAA,KAAA4jK,IAGAh/H,EAAA3kC,YAAA,aACA8b,KAHA6oB,EAAA1kC,SAAA,aAQA,KAAA6b,EACAgjJ,EAAA7+J,SAAA,QAEA6+J,EAAA9+J,YAAA,YAEA,CACA,IAAAI,EAAA,EAAAA,EAAAwB,EAAAxB,IACAukC,EAAApnC,EAAA8rB,GAAAjpB,GACAukC,EAAA+K,SAAA,kBACA/K,EAAA3kC,YAAA,YAGA8+J,GAAA9+J,YAAA,QAGAohK,EAAAC,GAAA,GAEAD,IACA7jK,EAAAyC,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,aAMAggK,GACAA,EAAAhgK,SAAA,UAOAiiK,EAAAxtB,QAAA,WACA,GACAt0I,GAGAqN,EAJA8pI,EAAA2qB,EAAAza,YAEAob,EAAAnC,EAAA9nI,WACAh3B,EAAAihK,EAAAjhK,MAEA,IAAA,mBAAA21I,IAAA,OAAAA,EAEA,IAAAn3I,EAAA,EAAAA,EAAAwB,EAAAxB,IACAyiK,EAAAx5I,GAAAjpB,GAAAsvC,SAAA,kBACAmzH,EAAAx5I,GAAAjpB,GAAAJ,YAAA,gBAIA,KAAAI,EAAA,EAAAA,EAAAwB,EAAAxB,IACAyiK,EAAAx5I,GAAAjpB,GAAAsvC,SAAA,mBAEAjiC,EAAA20J,EAAAS,EAAAx5I,GAAAjpB,IACAk/J,EACAh0I,EAAAisH,EAAA9pI,GACAo1J,EAAAx5I,GAAAjpB,GAAAH,SAAA,YAEA4iK,EAAAx5I,GAAAjpB,GAAAJ,YAAA,YAGAm+J,EAAA5mB,EAAA9pI,GACAo1J,EAAAx5I,GAAAjpB,GAAAH,SAAA,YAEA4iK,EAAAx5I,GAAAjpB,GAAAJ,YAAA,YAQAqiK,MAIAnjH,EAAAztC,GAAA,UAAA,SAAA6H,GACA,GAAAkoB,GAAAloB,EAAAkoB,OAEA,IAAA,KAAAA,GAAA,KAAAA,GAAA,KAAAA,GAAA,KAAAA,EAAA,CAOA,GADAloB,EAAA8mB,iBACAovC,EAEA,WADAl2D,GAAAunB,iBAGA,IACA+iI,GACAC,EACA1D,EACAiB,EAJA0C,EAAA1F,EAAA9kJ,EAAArb,OAAAihD,EAAA,GAAAshH,EAAA,GAMA,UAAAl8C,EAAAq8C,WACAkD,EAAAzF,EAAA9kJ,EAAArb,OAAAihD,EAAA,GAAA+gH,EAAA,IAEA2D,EAAAxF,EAAA9kJ,EAAArb,OAAAihD,EAAA,GAAAuhH,EAAA,IAGAqD,EAIA,KAAAtiI,GAAA,KAAAA,GAAA,KAAAA,GAAA0d,EAAAxP,SAAA,UAEAp2B,EAAAunB,kBAEAqe,EAAAj/C,SAAA,QAGA,mBAAAijK,IACAD,IAIA,SAAA3+C,EAAAq8C,YACAQ,IACAlB,EAAArnI,WAAAvP,GAAA,GAAA,GAAAoN,QAEA2qI,EAAAC,GAAA,GACAD,IAEAV,EAAA9nI,WAAA54B,YAAA,UAEAiiG,EAAAm/D,GAAAnhK,SAAA,aAIAmhK,EAAAC,GAAA,GACAD,GACAG,EAAAH,KAUAwC,EAEA,KAAApiI,GAEAg/H,EAAA,GAAA/pI,QACAyoB,EAAAxP,SAAA,SACAwP,EAAAljB,eAAA,QAEAkjB,EAAAl/C,YAAA,QACAsZ,EAAAunB,mBAEA,KAAAW,GACAloB,EAAAunB,kBAEAugI,EAAAU,EAAAxoJ,EAAArb,OAAAkH,WAAA,mBACAi8J,EACAG,EAAAH,IAEAA,EAAAC,GAAA,GACAD,GACAG,EAAAH,KAGA,KAAA5/H,GACAloB,EAAAunB,kBAEAugI,EAAAU,EAAAxoJ,EAAArb,OAAAkH,WAAA,eACAi8J,EACAG,EAAAH,IAEAA,EAAAC,GAAA,GACAD,GACAG,EAAAH,KAGA,KAAA5/H,IACAloB,EAAAunB,kBAEAs/H,EAAAl+D,EAAA3oF,EAAArb,OAAAkH,YACAg7J,EAAAzwH,SAAA,mBACA4yH,EAAAnC,GACAb,GACAkB,EAAA,GAAA/pI,UAIAotI,IACA,KAAAriI,GACAg/H,EAAA,GAAA/pI,QACAyoB,EAAAl/C,YAAA,QACAsZ,EAAAunB,mBACA,KAAAW,GAEAloB,EAAAunB,kBAEAs/H,EAAAmB,IACAnB,IACAiB,EAAAU,EAAA3B,EAAA,GAAA,mBACAiB,GACAjB,EAAAngK,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,YAEAmhK,EAAAC,GAAA,GACAD,IACAjB,EAAAngK,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,cAKA,KAAAuhC,GAEAloB,EAAAunB,kBAEAs/H,EAAAmB,IACAnB,IACAiB,EAAAU,EAAA3B,EAAA,GAAA,eACAiB,GACAjB,EAAAngK,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,YAEAmhK,EAAAC,GAAA;AACAD,IACAjB,EAAAngK,YAAA,UACAiiG,EAAAm/D,GAAAnhK,SAAA,cAIA,KAAAuhC,IAEA2+H,EAAAmB,IACAnB,IACAmC,EAAAnC,GACAb,GACAkB,EAAA,GAAA/pI,cAuYA4tF,EAAA7D,IAAA,WAAA,WACAkgD,EAAAzkI,MACAukI,EAAAvkI,MACAgkI,EAAAhkI,KAAAgkI,EAAAhkI,MACAgyE,EAAAhyE,IAAA,QAAAynI,WASAhF,EAAAj3D,UAAA,eAAA,SAAA,SAAA8H,GAGA,GAAAw0D,GAAA,iKAEA,QACA7lD,SAAA,IACAyC,WAAA,UACA1C,SAAA,IACAiD,UAAA,EACAroE,SAAA,eAAA,YACAtoB,QAAA,SAAA61H,EAAAj/B,GAEA,GAAAyF,GAAAzF,EAAAg7C,YACA6B,EAAApoK,SAAAw3B,cAAA,qBAAAw5F,EAAA,KACAjmH,EAAAimH,EAAAjmH,MAAAo9J,EAEA,KAAAp9J,EACA,KAAA,IAAAkR,OAAA,qBAIA,IASAy4I,GACAC,EACAF,EACAD,EAEAxE,EAdAyX,EAAAl8C,EAAA15G,MACA21J,EAAAC,EAAA9zD,EAAA8zD,GAAA,KAEA9T,EAAA5oJ,EAAA,IAAAA,EAAA,GACA6oJ,EAAA7oJ,EAAA,GACAs9J,EAAAt9J,EAAA,GACAu9J,EAAAv9J,EAAA,GAAA4oG,EAAA5oG,EAAA,IAAA,KACAwpJ,EAAAxpJ,EAAA,GAMA6pJ,GAAArtB,IAAA5tB,GACA4C,IAYA,OAVAg4C,GACAC,EAAA7gD,EAAA4gD,IAEAG,EAAA,SAAA72I,EAAAhM,GACA,MAAA8nG,GAAA9nG,IAEA8iJ,EAAA,SAAA92I,GACA,MAAAA,KAGA,SAAA4qG,EAAAnlE,EAAAyiE,EAAAokC,EAAAxhC,GAsEA,QAAA4/C,GAAA5iJ,GACA,GAAAnhB,GAKAqZ,EAAAhM,EACAmjJ,EACAC,EACAC,EACAH,EAIAI,EACArpD,EACA08D,EACA1T,EACA7yG,EACAwmH,EAEAC,EAGAC,EArBAvT,EAAA9xG,EAAA,GAUA+xG,EAAApwD,IAUAxhF,IAOA,IAJAusI,IACA/tG,MAGAs/C,EAAA57E,GACAuvI,EAAAvvI,EACAsvI,EAAAR,GAAAC,MACA,CACAO,EAAAR,GAAAE,EAEAO,IACA,KAAA,GAAA7F,KAAA1pI,GACAA,EAAA6G,eAAA6iI,IAAA,KAAAA,EAAA38I,OAAA,IACAwiJ,EAAA3qJ,KAAA8kJ,EAGA6F,GAAA1vJ,OAKA,IAHAuvJ,EAAAG,EAAAlvJ,OACAmvJ,EAAA,GAAAnnI,OAAA+mI,GAEAvwJ,EAAA,EAAAA,EAAAuwJ,EAAAvwJ,IAqBA,GApBAqZ,EAAA8H,IAAAuvI,EAAA1wJ,EAAA0wJ,EAAA1wJ,GACAqN,EAAA8T,EAAA9H,GACAm3I,EAAAC,EAAAp3I,EAAAhM,EAAArN,GAGAmkK,KACA/U,IACA+U,EAAA/U,GAAA/1I,GAGA8qJ,EAAAhV,GAAA9hJ,EACA4R,EAAAlZ,KAAAo+J,GAEA3Y,IACAwY,EAAAxY,EAAAnyI,EAAAhM,GACAowC,EAAAj+C,QAAAwkK,SAAAA,GACAvmH,EAAA13C,KAAAi+J,IAIA3T,EAAAG,GAEAlpD,EAAA+oD,EAAAG,SACAH,GAAAG,GAGAhF,IACAlkD,EAAA7pD,MAAAumH,GAEA18D,EAAAjuF,IAAAA,EACAiuF,EAAAj6F,MAAAA,EAEAwjJ,EAAAL,GAAAlpD,EACAqpD,EAAA3wJ,GAAAsnG,MACA,CAAA,GAAAupD,EAAAL,GAOA,KALAG,GAAAlzJ,QAAA,SAAA6pG,GACAA,GAAAA,EAAA7D,QACA4sD,EAAA/oD,EAAA5iG,IAAA4iG,KAGA,GAAA7vF,OAAA,4FAGAk5I,GAAA3wJ,IAAA0E,GAAA8rJ,EAAA/sD,MAAAnkG,OAAAsC,MAAAtC,OAAA+Z,IAAAA,EAAAhM,MAAAA,GACAwjJ,EAAAL,IAAA,EACAwT,IACArT,EAAA3wJ,GAAAy9C,MAAAumH,GAMAvmH,GAAAA,EAAAj8C,OAAA,IAEAmvJ,EAAA+M,EAAA/M,EAAAlzG,EAAA,SAIA,KAAA,GAAAqzG,KAAAT,GACA/oD,EAAA+oD,EAAAS,GACAoT,EAAAv+D,EAAA2B,EAAA1lG,OAEAsiK,EAAA5nI,WAAA,gBACA4nI,EAAAhmK,SACAopG,EAAA7D,MAAAyB,UAGA,KAAAllG,EAAA,EAAAA,EAAAuwJ,EAAAvwJ,IACAsnG,EAAAqpD,EAAA3wJ,GACAsnG,EAAA7D,OAIA6sD,EAAAM,EACAjB,EAAAroD,IAAAgpD,GACAzuD,EAAA+uD,GAAA1vJ,MAAAomG,EAAA1lG,OAEAgvJ,EAAAhB,EAAAtoD,GAEA4nD,EAAA5nD,EAAA7D,MAAAzjG,EAAAmvJ,EAAA7nD,EAAAj6F,MAAA+hJ,EAAA9nD,EAAAjuF,IAAAk3I,EAAAjpD,EAAA7pD,QAEA0mE,EAAA,SAAAviH,EAAA6hG,GAEAq6D,EAAAl8J,EAAA6hG,GAEA6D,EAAA7D,MAAAA,CAEA,IAAAmC,GAAAg+D,EAAAngK,WAAA,EACA7B,GAAAA,EAAAJ,UAAAokG,EAEA/D,EAAA+uD,GAAA1vJ,MAAAU,GAGAA,EAAA/B,SAAA,iBAIAwN,EADA+0J,EACAA,EAAA96D,EAAAjuF,IAAAiuF,EAAAj6F,OAEAi6F,EAAAj6F,OAAAi6F,EAAAjuF,IAGAgpJ,EAAAnD,WACA11I,MAAA/O,QAAAqnJ,EAAAza,cAAAn8H,EAAA42I,EAAAza,YAAAh6I,IACAzL,EAAA/B,SAAA,YAGAk+J,EAAA1wJ,EAAAy0J,EAAAza,cACAzlJ,EAAA/B,SAAA,YAIA+wJ,EAAAhrD,EAIA0B,EAAA1lG,MAAAA,EACAivJ,EAAAvpD,EAAA5iG,IAAA4iG,EACA4nD,EAAA5nD,EAAA7D,MAAAzjG,EAAAmvJ,EAAA7nD,EAAAj6F,MAAA+hJ,EAAA9nD,EAAAjuF,IAAAk3I,EAAAjpD,EAAA7pD,SAMAA,IACAwmH,GAAAA,IAAA38D,EAAA7pD,MAGA6pD,EAAA1lG,MAAAhC,YAAA,kBAFA0nG,EAAA1lG,MAAA/B,SAAA,kBAKAokK,EAAA38D,EAAA7pD,MAGA6pD,EAAA1lG,MAAA/B,SAAA,cAIAwwJ,GAAAQ,EAEAwR,EAAAlD,mBAAAlgJ,EAAAkkJ,GAjQA,GAEAf,GACAe,EAHAd,EAAA1c,EAAA,GACAmc,EAAAnc,EAAA,GAGAye,IAEApU,KACAC,EAAA,SAAA52I,EAAAhM,EAAArN,GAOA,MALAovJ,KACAgB,EAAAhB,GAAA/1I,GAEA+2I,EAAAjB,GAAA9hJ,EACA+iJ,EAAA1X,OAAA14I,EACAgwJ,EAAA/rC,EAAAmsC,KAIA0T,IACAtY,EAAA,SAAAnyI,EAAAhM,GAKA,MAJA+hJ,KACAr3C,EAAAq3C,GAAA/1I,GAEA0+F,EAAAo3C,GAAA9hJ,EACAy2J,EAAA7/C,EAAAlM,KAKAq3C,IACAiT,EAAAjT,cAAAA,GAEAD,IACAkT,EAAAlT,gBAAAA,GAGA6T,IACAX,EAAAY,SAAAA,EACAb,EAAA,SAAA/oJ,EAAAhM,GAKA,MAJA+hJ,KACAgV,EAAAhV,GAAA/1I,GAEA+qJ,EAAAjV,GAAA9hJ,EACA21J,EAAA/+C,EAAAmgD,IAcA,IAAA/T,GAAA5vD,GAGA,UAAA8gB,EAAA8iD,WACAlB,GAAA,EACAl/C,EAAAnlB,OAAA+kE,EAAAE,GAAA,KAEAZ,GAAA,EACAl/C,EAAAkG,iBAAA05C,EAAAE,aC9jDAlgE,QACA5gG,OAAA,0BACA2nE,QAAA,2BAAA,SAAA05F,GACAA,EAAAtQ,sBAAA,6FAEAr9I,KAAA,aAAA,WAAA,UAAA,WAAA,mBAAA,SAAA04F,EAAAqmD,EAAAznD,EAAAsC,EAAAg0D,GAojBA,QAAAC,GAAA/mG,GAEA,GAAAgnG,GAAAroK,EAAA,QACAuyC,QAAA,yBAGAvyC,GAAA,UAAAuyC,QAAA,mBAAA/tC,KAAA,eAAAwB,SAAAqiK,GACAroK,EAAA,UAAAuyC,QAAA,gBAAA/tC,KAAA,cAAAwB,SAAAqiK,EAEA,IAAAC,GAAAtoK,EAAAqhE,EAAAZ,OAAA/jC,QAAA,iBACA4rI,GAAA/kK,KAAA,wBAAAsC,OAAAwiK,GA5jBA,GAAA/jJ,GAAA,GAAAlN,KACA67F,GAAAs1D,YAAA,GACAt1D,EAAAl8B,UACAk8B,EAAA93E,WAEA83E,EAAAu1D,cAAA,EAEAv1D,EAAAw1D,iBAEAx1D,EAAAy1D,SAAAjhE,QAAA9tF,QAAA,QAAA7V,KAAA,QAEAmvG,EAAA01D,gBAAA,WACA11D,EAAA21D,eAAA,aAEA,MAAA31D,EAAAy1D,WACAz1D,EAAA01D,gBAAA,WACA11D,EAAA21D,eAAA,aAGA,IAAAC,GAAA51D,EAAAy1D,QACA,OAAAz1D,EAAAy1D,WACAG,EAAA,SAEA,MAAA51D,EAAAy1D,WACAG,EAAA,MAGAV,EAAA94J,IAAA4jG,EAAAy1D,SAEA,IAAAI,GAAA9oK,EAAA4gE,WAAAzD,SAAA0rG,EAQA,QAPAC,EAAAhrG,WAAAm1C,EAAA01D,gBAEA3oK,EAAA4gE,WAAAhhB,YACAkpH,GAGA71D,EAAA81D,QAAA,QACA91D,EAAAy1D,UACA,IAAA,KACAz1D,EAAA81D,QAAA,OACA,MACA,KAAA,KACA91D,EAAA81D,QAAA,OACA,MACA,KAAA,KACA91D,EAAA81D,QAAA,OACA,MACA,KAAA,KACA91D,EAAA81D,QAAA,OACA,MACA,SACA91D,EAAA81D,QAAA,QAmDA,GA/CA91D,EAAA+1D,mBAAA,SAAA7tJ,GACAA,EAAAA,EAAA7U,QAAA,OAAA,OAAAA,QAAA,OAAA,MACA,IAAAqjD,GAAA,GAAAn/C,QAAA,SAAA2Q,EAAA,aACAwS,EAAAg8B,EAAAn5C,KAAApK,SAAA2wE,OACA,OAAA,QAAAppD,EAAA,GAAA+gD,mBAAA/gD,EAAA,GAAArnB,QAAA,MAAA,OAGA2sG,EAAAwlC,QAAA,SAAA34F,EAAAovB,GACA,GAAAloD,GAAA,GAAA5P,MAAA0oC,EAEA,OADA94B,GAAA+7C,QAAA/7C,EAAAwgD,UAAA0H,GACAloD,GAGAisF,EAAAg2D,YAAA,SAAA39F,EAAA49F,GACA,GAAA59F,GAAA,GAAAl0D,MAAAk0D,GACA49F,EAAA,GAAA9xJ,MAAA8xJ,GACAj5I,EAAAi5I,EAAA7xJ,UAAAi0D,EAAAj0D,UACA63D,EAAA/qE,KAAAikE,MAAAn4C,EAAA,OACA2qE,EAAAz2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EACAyrB,EAAAx2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EAAA,GAAA,GAAA0rB,GACAF,EAAAv2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EAAA,GAAA,GAAA,GAAA0rB,EAAA,GAAA,GAAAD,EACA,QAAAzyB,IAAAgH,EAAAi6F,KAAAvuE,EAAAwuE,OAAAzuE,EAAA/sE,OAAA8sE,IAGA+M,QAAAtF,YAAAm3D,EAAAF,UAAA,aACAnmD,EAAAl8B,OAAAuiF,EAAAF,UAAA,WAGAnmD,EAAA+1D,mBAAA,YACA/1D,EAAAl8B,OAAAylB,OAAAyW,EAAA+1D,mBAAA,WAEA/1D,EAAA+1D,mBAAA,eACA/1D,EAAAl8B,OAAArgC,UAAAu8D,EAAA+1D,mBAAA,cAEA/1D,EAAA+1D,mBAAA,UACA/1D,EAAAl8B,OAAAsyF,KAAA/kK,SAAA2uG,EAAA+1D,mBAAA,UAEA/1D,EAAA+1D,mBAAA,UACA/1D,EAAAl8B,OAAAuyF,KAAAr2D,EAAA+1D,mBAAA,SAEA/1D,EAAA+1D,mBAAA,YACA/1D,EAAAl8B,OAAAwyF,OAAAjlK,SAAA2uG,EAAA+1D,mBAAA,YAEA/1D,EAAA+1D,mBAAA,UACA/1D,EAAAl8B,OAAAyyF,KAAAllK,SAAA2uG,EAAA+1D,mBAAA,UAGA/1D,EAAA+1D,mBAAA,UAAA/1D,EAAAl8B,OAAAyyF,MAAAv2D,EAAAl8B,OAAAyyF,KAAA,EAAA,CACA,GAAAC,GAAAx2D,EAAA+1D,mBAAA,SAAA7/J,MAAA,KACAugK,IACA,KAAAp+J,EAAA,EAAAA,EAAA2nG,EAAAl8B,OAAAyyF,KAAAl+J,IACAo+J,EAAAp+J,GAAAhH,SAAAmlK,EAAAn+J,GAGA2nG,GAAAl8B,OAAA4yF,MAAAD,EAKA,GAFApQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAtkB,EAAA,QAAAkzC,SAAA,oBAAA,CAEAu0D,QAAAtF,YAAAm3D,EAAAF,UAAA,cACAnmD,EAAA93E,QAAAm+H,EAAAF,UAAA,YAGA3xD,QAAAtF,YAAA8Q,EAAA93E,QAAAyuI,UACA32D,EAAA93E,QAAAyuI,OAAA,KAIA32D,EAAA+1D,mBAAA,kBACA/1D,EAAA93E,QAAA0uI,UAAA,QAAA52D,EAAA+1D,mBAAA,gBAIA,IAAAc,GAAA72D,EAAA+1D,mBAAA,aACAe,EAAA92D,EAAA+1D,mBAAA,aACAgB,EAAA/2D,EAAA+1D,mBAAA,aACAiB,EAAAh3D,EAAA+1D,mBAAA,cAEAc,GAAAC,GAAAC,GAAAC,KAEAh3D,EAAA93E,QAAA+uI,UAAAj3D,EAAA93E,QAAA+uI,cAEAJ,IACA72D,EAAA93E,QAAA+uI,UAAA,GAAA,QAAAJ,GAEAC,IACA92D,EAAA93E,QAAA+uI,UAAA,GAAA,QAAAH,GAEAC,IACA/2D,EAAA93E,QAAA+uI,UAAA,GAAA,QAAAF,GAEAC,IACAh3D,EAAA93E,QAAA+uI,UAAA,GAAA,QAAAD,GAKA,IAAAE,GAAAl3D,EAAA+1D,mBAAA,aACAoB,EAAAn3D,EAAA+1D,mBAAA,gBACAqB,EAAAp3D,EAAA+1D,mBAAA,eACAsB,EAAAr3D,EAAA+1D,mBAAA,cACAuB,EAAAt3D,EAAA+1D,mBAAA,YACAwB,EAAAv3D,EAAA+1D,mBAAA,iBAEAmB,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,KAEAv3D,EAAA93E,QAAAsvI,OAAAx3D,EAAA93E,QAAAsvI,WAEAN,IACAl3D,EAAA93E,QAAAsvI,OAAAC,KAAA,QAAAP,GAEAC,IACAn3D,EAAA93E,QAAAsvI,OAAAE,QAAA,QAAAP,GAEAC,IACAp3D,EAAA93E,QAAAsvI,OAAAG,KAAA,QAAAP,GAEAC,IACAr3D,EAAA93E,QAAAsvI,OAAAr5E,KAAA,QAAAk5E,GAEAC,IACAt3D,EAAA93E,QAAAsvI,OAAAF,MAAA,QAAAM,YAEAL,IACAv3D,EAAA93E,QAAAsvI,OAAAD,aAAA,QAAAA,GAKA,IAAAM,GAAA73D,EAAA+1D,mBAAA,WACA+B,EAAA93D,EAAA+1D,mBAAA,eAEA8B,GAAAC,KAEA93D,EAAA93E,QAAA6vI,UAAA/3D,EAAA93E,QAAA6vI,cAEAF,IACA73D,EAAA93E,QAAA6vI,UAAAC,MAAA,QAAAH,GAEAC,IACA93D,EAAA93E,QAAA6vI,UAAAE,OAAA,QAAAH,GAKA,IAAAI,GAAAl4D,EAAA+1D,mBAAA,YACAoC,EAAAn4D,EAAA+1D,mBAAA,MACAqC,EAAAp4D,EAAA+1D,mBAAA,OACAsC,EAAAr4D,EAAA+1D,mBAAA,aACAuC,EAAAt4D,EAAA+1D,mBAAA,WACAwC,EAAAv4D,EAAA+1D,mBAAA,oBACAyC,EAAAx4D,EAAA+1D,mBAAA,gBACA0C,EAAAz4D,EAAA+1D,mBAAA,SACA2C,EAAA14D,EAAA+1D,mBAAA,YACA4C,EAAA34D,EAAA+1D,mBAAA,WACA6C,EAAA54D,EAAA+1D,mBAAA,aAEAmC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,KAEA54D,EAAA93E,QAAA2wI,WAAA74D,EAAA93E,QAAA2wI,eAEAX,IACAl4D,EAAA93E,QAAA2wI,WAAAX,SAAA,QAAAA,GAEAC,IACAn4D,EAAA93E,QAAA2wI,WAAAV,GAAA,QAAAA,GAEAC,IACAp4D,EAAA93E,QAAA2wI,WAAAT,IAAA,QAAAA,GAEAC,IACAr4D,EAAA93E,QAAA2wI,WAAAR,QAAA,QAAAA,GAEAC,IACAt4D,EAAA93E,QAAA2wI,WAAAP,SAAA,QAAAA,GAEAC,IACAv4D,EAAA93E,QAAA2wI,WAAAN,cAAA,QAAAA,GAEAC,IACAx4D,EAAA93E,QAAA2wI,WAAAL,KAAA,QAAAA,GAEAC,IACAz4D,EAAA93E,QAAA2wI,WAAAJ,MAAA,QAAAA,GAEAC,IACA14D,EAAA93E,QAAA2wI,WAAAH,OAAA,QAAAA,GAEAC,IACA34D,EAAA93E,QAAA2wI,WAAAF,WAAA,QAAAA,GAEAC,IACA54D,EAAA93E,QAAA2wI,WAAAD,SAAA,QAAAA,IAIAvS,EAAAD,UAAA,UAAApmD,EAAA93E,SAAAk0C,KAAAvuE,OAAAsF,SAAAylF,SAAA5c,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAGAmjF,QAAAtF,YAAAm3D,EAAAl3I,IAAA,WACA6wF,EAAAs1D,YAAA,KAGAt1D,EAAA84D,QAAA,SAAAC,GACA,MAAAA,GAAA,GACA,IAAAA,EAEAA,GAIA/4D,EAAAg5D,cAAA,SAAAxvE,EAAArgE,GACA,MAAA93B,UAAAm4F,GAAAn4F,SAAA83B,GAAA,IAGA62E,EAAAi5D,iBAAA,SAAAtnK,GAEA,GAAAunK,GAAA,EAEA,QAAAvnK,GACA,IAAA,IACAunK,EAAA,YACA,MACA,KAAA,IACAA,EAAA,QACA,MACA,KAAA,IACAA,EAAA,QACA,MACA,KAAA,IACAA,EAAA,gBACA,MACA,KAAA,IACAA,EAAA,gBACA,MACA,KAAA,IACAA,EAAA,wBACA,MACA,SACAA,EAAA,aAIA,MAAAA,IAGAl5D,EAAAm5D,oCAAA,WAEA,GAAAjxI,KAEA,IAAA83E,EAAA+1D,mBAAA,WAAA,CACA,GAAAqD,GAAAp5D,EAAA+1D,mBAAA,WAAA7/J,MAAA,IAEAgyB,GAAAsvI,OAAA4B,EAAA7wG,OAAA,SAAAtmD,EAAAjE,GAEA,MADAiE,GAAAjE,IAAA,EACAiE,OAIA,GAAA+9F,EAAA+1D,mBAAA,QAAA,CACA,GAAAsD,GAAAr5D,EAAA+1D,mBAAA,QAAA7/J,MAAA,IAEAgyB,GAAAqvC,MAAA8hG,EAAA9wG,OAAA,SAAAtmD,EAAAjE,GAEA,MADAiE,GAAAjE,IAAA,EACAiE,OAIA,GAAA+9F,EAAA+1D,mBAAA,aAAA,CACA,GAAAuD,GAAAt5D,EAAA+1D,mBAAA,aAAA7/J,MAAA,IAEAgyB,GAAA9R,WAAAkjJ,EAAA/wG,OAAA,SAAAtmD,EAAAjE,GAEA,MADAiE,GAAAjE,IAAA,EACAiE,OAIA,GAAA+9F,EAAA+1D,mBAAA,eAAA,CACA,GAAAwD,GAAAv5D,EAAA+1D,mBAAA,eAAA7/J,MAAA,IAEAgyB,GAAAsxI,aAAAD,EAAAhxG,OAAA,SAAAtmD,EAAAjE,GAEA,MADAiE,GAAAjE,IAAA,EACAiE,OAQA,OAJAuyF,QAAAtF,YAAAhnE,EAAAyuI,SAAA,OAAAzuI,EAAAyuI,UACAzuI,EAAAyuI,OAAA,KAGAzuI,GAGA83E,EAAAztC,UAAA,SAAAp1D,EAAA+tC,GACAA,EAAAA,GAAA,YACA,IAAAnQ,GAAA59B,EAAAjG,MAAA,UACAmB,EAAA,EAAAohK,IAIA,OAFAvuH,GAAA73C,QAAA,gBAAA,SAAAkzI,GAAAkzB,EAAAlzB,GAAAluI,MAEA,GAAA8L,MAAA42B,EAAA0+H,EAAA,MAAA1+H,EAAA0+H,EAAA,IAAA,EAAA1+H,EAAA0+H,EAAA,MAGAz5D,EAAA05D,eAAA,SAAAC,EAAA7/F,GACA,GAAAd,GAAAgnC,EAAAztC,UAAAuH,GACA8/F,EAAA,IACAC,EAAAF,EAAA,GAAA9sH,IAYA,OAVA2nD,SAAApmG,QAAAurK,EAAA,SAAA13J,EAAA+H,GACA,GAAA8vJ,GAAA95D,EAAAztC,UAAAtwD,EAAA4qC,MACAktH,EAAA7oK,KAAAC,IAAA6nE,EAAA8gG,EAEAF,GAAA1oK,KAAAipE,KAAA4/F,EAAA,SACAH,EAAA1oK,KAAAipE,KAAA4/F,EAAA,OACAF,EAAA53J,EAAA4qC,QAIAgtH,GAGA75D,EAAAg6D,cAAA,SAAAL,EAAAM,EAAAC,GACA,GAAAC,GAAAn6D,EAAAztC,UAAAonG,EAAA,GAAA9sH,MACAutH,EAAAp6D,EAAAztC,UAAAonG,EAAAA,EAAAxnK,OAAA,GAAA06C,MAEAwtH,EAAA,EACAC,EAAA,GAAAn2J,MAAAg2J,EACAG,GAAAzqG,SAAAyqG,EAAA9lG,WAAA6lG,EACA,IAAAE,GAAA,GAAAp2J,MAAAi2J,EACAG,GAAA1qG,SAAA0qG,EAAA/lG,WAAA6lG,GAGAH,GACAntK,EAAA,IAAAktK,GAAAppK,KAAA,mBAAAqpK,GAGAl6D,EAAAw6D,oBAAA,SAAAC,EAAAR,EAAAC,GACAntK,EAAA,2BAAAwD,YAAA,aACA,IAAAmqK,GAAA,EACAC,EAAAtpK,SAAAtE,EAAA,yBAAA4D,MAAA8pK,GAAA,GAEAG,EAAAV,GAAA7oK,SAAAtE,EAAA,SAAA8D,KAAA,oBAEA2jG,SAAAtF,YAAA+qE,KACAY,aAAAZ,GAGA,cAAAY,eACAD,EAAAV,GAAA7oK,SAAAtE,EAAA,eAAA8D,KAAA,sBAGA4pK,EAAAjqK,SAAA,aACA,KAAA,GAAAsqK,GAAAH,EAAAG,EAAAH,EAAAC,EAAA,EAAAE,IACAL,EAAAxwI,WAAArQ,GAAAkhJ,GAAA76H,SAAA,8BAAA,GAAAw6H,EAAAxwI,WAAArQ,GAAAkhJ,GAAA3oK,SACAsoK,EAAAxwI,WAAArQ,GAAAkhJ,GAAAtqK,SAAA,cACAkqK,IAGA,IAAAC,EAAAC,EAAA,EAEA,IAAA,GAAAG,GAAA,EAAAA,EAAAJ,EAAAC,EAAA,EAAAG,IACAN,EAAAjpK,SAAA43B,OAAAD,WAAAvP,GAAAmhJ,GAAA96H,SAAA,8BAAA,GAAAw6H,EAAAjpK,SAAA43B,OAAAD,WAAAvP,GAAAmhJ,GAAA5oK,SACAsoK,EAAAjpK,SAAA43B,OAAAD,WAAAvP,GAAAmhJ,GAAAvqK,SAAA,cACAkqK,IAIA,IAAAC,EAAAC,EAAA,GAEA,IAAA,GAAAI,GAAA,EAAAA,EAAAL,EAAAC,EAAA,GAAAI,IACAP,EAAAjpK,SAAAs4B,UAAAlQ,GAAA,GAAAuP,WAAAvP,GAAAohJ,GAAA/6H,SAAA,8BAAA,GAAAw6H,EAAAjpK,SAAAs4B,UAAAlQ,GAAA,GAAAuP,WAAAvP,GAAAohJ,GAAA7oK,SACAsoK,EAAAjpK,SAAAs4B,UAAAlQ,GAAA,GAAAuP,WAAAvP,GAAAohJ,GAAAxqK,SAAA,cACAkqK,IAIAA,GAAA,GAAAE,IAEA,GAAAH,EAAA7wI,QAAA,8BAAAz3B,OAGApF,EAAA,gCAAAiD,KAAA,SAAAW,GACAA,EAAA,IAAAU,SAAAtE,EAAAqD,MAAAmB,QAAAqpK,EAAAF,IAAA3tK,EAAAqD,MAAA6vC,SAAA,aAAAlzC,EAAAqD,MAAA6vC,SAAA,eACAlzC,EAAAqD,MAAAI,SAAA,gBAIAzD,EAAA,gCAAAiD,KAAA,SAAAW,GACAA,EAAA,IAAAU,SAAAtE,EAAAqD,MAAAmB,QAAAqpK,EAAAF,GAAA3tK,EAAAqD,MAAA6vC,SAAA,8BACAlzC,EAAAqD,MAAAI,SAAA,kBAOAzD,EAAA,QAAAiV,GAAA,YAAA,eAAA,SAAA6H,GACAm2F,EAAAw6D,oBAAAztK,EAAAqD,MAAA6pK,KAGAltK,EAAA,QAAAiV,GAAA,aAAA,eAAA,SAAA6H,GACA9c,EAAA,2BAAAwD,YAAA,cACAxD,EAAA,8BAAA6sB,GAAA,GAAAznB,OAAA,GAAA,GAAApF,EAAA,8BAAA6sB,GAAA,GAAAqmB,SAAA,8BACA+/D,EAAAw6D,oBAAAztK,EAAA,8BAAA6sB,GAAA,GAAAqgJ,IAIA,IAAAgB,IAAA,EAAA,EACAluK,GAAAc,QAAAgC,QAAA,MACAorK,EAAA,KAGA,IAAA7nK,GAAAvF,OAAAsF,SAAAC,SAAAtC,cACAoqK,EAAA9nK,EAAAjD,QAAA,kBAEA6vG,GAAAm7D,aACA5uG,QAAAqyC,EAAA,QAAA07D,EAAAt6D,EAAA21D,gBACAnpG,QAAAoyC,EAAA,QAAA27D,EAAAv6D,EAAA21D,gBACArqG,YAAAszC,EAAA,QAAAu7D,EAAAn6D,EAAA21D,gBACA7qG,SAAA,EACAqB,UAAA,EACAF,iBAAA,EACAC,mBAAA,EACAY,eAAAmuG,EACA5tG,iBAAA,EACAZ,cAAA,SAAA5f,GACA,GAAAuuH,GAAAx8D,EAAA,QAAA/xD,EAAA,cACAwuH,EAAAz8D,EAAA,YAAA+6D,EAAA,WAAAyB,EAAA,IACA,OAAAC,KACA,EAAA,YAAA,MAEA,EAAA,WAAA,KAGA3uG,WAAA,SAAAvvD,EAAAixD,GACAvgE,OAAAsJ,WAAA,WACA,GAAAmkK,GAAAvuK,EAAAqhE,EAAAZ,OAAAl9D,KAAA,gCAAAspB,GAAA,EAEAomF,GAAAw6D,oBAAAc,EAAAvuK,EAAAoQ,GAAAtM,KAAA,MAAAqpK,GAEAgB,GACA/F,EAAA/mG,IAEA,MAEAzB,SAAA,SAAA4uG,EAAAntG,GACAvgE,OAAAsJ,WAAA,WACA+jK,GAGA/F,EAAA/mG,IAEA,IAEAxB,kBAAA,SAAAiI,EAAAD,EAAAxG,GACAvgE,OAAAsJ,WAAA,WACA+jK,GAGA/F,EAAA/mG,IAEA,MAKA4xC,EAAAw7D,iBAAA,SAAA3nI,GACA,MAAAA,GAAAkvG,UAGA/iC,EAAAy7D,cAAA,WA2BA,GA1BAz7D,EAAA07D,kBAEA3uK,EAAA,4BAAAiV,GAAA,QAAA,4BAAA,SAAAvS,GAGAyxG,EAAA,WACA,IAAA1M,QAAAtF,YAAAm3D,EAAAl3I,IAAA,YAAA,CACA,GAAAusJ,GAAArV,EAAAl3I,IAAA,WAAAjZ,MAAA,KAAA6S,OAAAsuE,QACA2oB,GAAA07D,eAAAA,CAEA,IAAAC,GAAAnnE,QAAA9tF,QAAA,wBACAi1J,GAAAnrK,SAAA,YAAAy5B,WAAA15B,YAAA,WACA,IAAAqrK,GAAAD,EAAArrK,KAAA,sBACAsrK,GAAAprK,SAAA,kCAEA,IAAAqrK,GAAArnE,QAAA9tF,QAAA,iDACAm1J,GAAAvrK,KAAA,+BAAAgjB,OACAuoJ,EAAAvrK,KAAA,iCAAAof,OAEAwxF,EAAA,WACA06D,EAAArrK,YAAA,iBACA,OAEA,MAGAikG,QAAAtF,YAAAm3D,EAAAl3I,IAAA,YAAA,CACA,GAAA2sJ,GAAAzV,EAAAl3I,IAAA,WAAAjZ,MAAA,KAAA6S,OAAAsuE,QACA2oB,GAAA07D,eAAAI,QAIA97D,EAAAy7D,gBAeAr4I,OAAA8nB,OAAA,WAEA,IAAA,GADAnrC,GAAA4C,UAAA,GACAtK,EAAA,EAAAA,EAAAsK,UAAAxQ,OAAA,EAAAkG,IAAA,CACA,GAAA40J,GAAA,GAAA11J,QAAA,MAAAc,EAAA,MAAA,KACA0H,GAAA9P,SAAA8P,EAAAA,EAAA1M,QAAA45J,EAAAtqJ,UAAAtK,EAAA,IAAA,GAEA,MAAA0H,OC5kBAy0F,QAAA5gG,OAAA,wBCAA4gG,QAAA5gG,OAAA,4BCAA4gG,QAAA5gG,OAAA,6BCAA4gG,QAAA5gG,OAAA,2BCAA4gG,QAAA5gG,OAAA,6BACA4gG,QAAA5gG,OAAA,4BACA4gG,QAAA5gG,OAAA,0BAEA,IAAAmoK,iBAAAvnE,QAAA5gG,OAAA,gBACA,YACA,UACA,oBACA,oBACA,wBACA,yBACA,uBACA,sBACA,yBACA,wBACA,yBCdAmoK,gBAAAvnE,QAAA5gG,OAAA,eAEAmoK,iBAAAllE,SAAAngG,KAAA,wBAEAqlK,gBAAAxgG,QAAA,sBAAA,SAAAygG,GACAA,EAAAtM,iBAAA,SACAN,qBAAA,UACAC,eAAA,iBACAC,mBAAA,uBACAC,UAAA,YACAC,YAAA,iBAEAwM,EAAArM,UAAA,YtCdAn7D,QAAA5gG,OAAA,yBAAAL,QAAA,gBAAA,QAAA,SAAA2rG,GAEA,OACA+8D,aAAA,WACA,MAAA/8D,GAAA/vF,IAAA,+CAAAnc,WACA,8CuCLAwhG,QAAA5gG,OAAA,yBAAAL,QAAA,mBAAA,KAAA,QAAA,kBAAA,SAAA2sG,EAAAhB,EAAAg9D,GAEA,GAAAr3D,GAAAh3G,OAAAsF,SAAAC,SACA+oK,EAAA,yBAEAhzE,EAAAt7F,OAAAsF,SAAAyvH,SAAA,KAAA/0H,OAAAsF,SAAA0xG,KAAAh3G,OAAAsF,SAAAylF,SAEAwjF,EAAA5nE,QAAA9tF,QAAA,QAAArW,KAAA,OAEAw0G,EAAAhpF,SAAA,UAAAgpF,EAAAhpF,SAAA,aAAAgpF,EAAAhpF,SAAA,WAAAgpF,EAAAhpF,SAAA,kBACAsgJ,EAAA,6BAGA,IAAAE,GAAA,IAEA,QACAC,aAAA,SAAAC,GAEA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAA9mK,GAAA,6BAAAgnK,EAAA,YAAAE,EAAA,sBAAAH,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAC,SAAA,SAAArnK,EAAAknK,EAAAI,GACA,GAAArrC,IACA+qC,mBAAAH,EAAAM,yBAOA,OAJAG,KACAA,GAAA,GAGAz8D,EAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAEAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAA9mK,EAAA,eAAAgnK,EAAA,YAAAE,EAAA,kBAAAI,EAAA,sBAAAP,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAG,eAAA,SAAA30G,GACA,GAAAqpE,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAEAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAAl0G,EAAA,2CAAAo0G,EAAA,sBAAAD,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAI,mBAAA,SAAAxnK,EAAAknK,EAAAO,GACA,GAAAxrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAEAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAA9mK,EAAA,iBAAAynK,EAAA,yBAAAT,EAAA,YAAAE,EAAA,0CAAAH,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAGA,OAAA7f,GAAAu9D,MAGAM,YAAA,SAAAC,EAAAC,EAAAC,EAAAC,EAAAjqK,GAEA,GAAAo+H,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,OACA1uC,IAAAgmK,EAAA,sBAAAE,EAAA,cAAAW,EAAA,gBAAAC,EAAA,iBAAAC,EAAA,eAAAC,EAAA,eAAAjqK,EAAA,sBAAAkpK,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAIAW,cAAA,SAAA9iI,GAEA,GAAAg3F,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAGA,IAAAhsK,GAAAiqC,EAEAmiI,GACA53H,OAAA,OACA1uC,IAAA,4CACA9F,KAAAA,EACAqlB,SAAA,OACAnT,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAIAY,kBAAA,SAAAC,EAAAC,EAAAr1J,EAAAs1J,EAAAC,EAAAC,EAAAnB,EAAAoB,GAEA,GAAArsC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,oBAEA7nE,QAAAtF,YAAAyuE,IAAA,OAAAA,KACAA,EAAA,EAGA,IAAAlB,IACA53H,OAAA,QACA1uC,IAAAgmK,EACA,WAAAmB,EACA,iBAAAC,EACA,eAAAlB,EACA,YAAAE,EACA,cAAA32H,mBAAA19B,GACA,WAAAs1J,EACA,QAAAC,GACAC,EAAA,cAAAA,EAAA,KACAC,EAAA,EAAA,0BAAAA,EAAA,uBAAAA,EAAA,IACA,sBAAAvB,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAmB,aAAA,WAEA,GAAAnB,IACA53H,OAAA,MACA1uC,IAAA,mCACAoM,OAAA,EAGA,OAAA28F,GAAAu9D,IAEAoB,eAAA,SAAAP,EAAAQ,EAAAptH,EAAAqtH,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAA/B,GAEA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAlmK,GAAAgmK,EAAA,WAAAmB,EAAA,+BAAAjB,EAAA,YAAAE,GACA7rH,EAAA,uBAAAA,EAAA,KACAqtH,EAAA,eAAAn4H,mBAAAm4H,GAAA,KACAC,EAAA,cAAAp4H,mBAAAo4H,GAAA,KACAC,EAAA,YAAAr4H,mBAAAq4H,GAAA,KACAC,EAAA,gBAAAt4H,mBAAAs4H,GAAA,KACAC,EAAA,SAAAv4H,mBAAAu4H,GAAA,KACAC,EAAA,YAAAA,EAAA,KACAC,EAAA,UAAAz4H,mBAAAy4H,GAAA,KACAC,EAAA,uBAAAA,EAAA,KACAR,EAAA,kBAAAl4H,mBAAAk4H,GAAA,IACA,sBAAA1B,EAEAK,GACA53H,OAAA,QACA1uC,IAAAA,EACAoM,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGA8B,cAAA,SAAAjB,EAAAC,EAAAiB,EAAAC,EAAAlC,EAAAmC,GAEA,GAAAptC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,oBAEA7nE,QAAAtF,YAAAwvE,IAAA,OAAAA,KACAA,EAAA,EAGA,IAAAjC,IACA53H,OAAA,QACA1uC,IAAAgmK,EAAA,WAAAmB,EAAA,iBAAAC,EAAA,+BAAAlB,EAAA,YAAAE,EAAA,qBAAAiC,EAAA,qBAAAC,EAAA,cAAAC,EAAA,sBAAAtC,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAkC,cAAA,SAAArB,EAAAC,EAAAkB,EAAAlC,GAEA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,QACA1uC,IAAAgmK,EAAA,WAAAmB,EAAA,iBAAAC,EAAA,+BAAAlB,EAAA,YAAAE,EAAA,qBAAAkC,EAAA,sBAAArC,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAmC,YAAA,SAAAvpK,EAAAknK,GAEA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAEAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAA9mK,EAAA,wBAAAgnK,EAAA,YAAAE,EAAA,sBAAAH,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAoC,eAAA,SAAAvkI,EAAA4jG,EAAA4gC,EAAAC,GAEA,GAAAztC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAEAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAlmK,GAAA,6CACA,YAAA4oK,IACA5oK,EAAA,6CAGA,IAAA6oK,IACAjB,UAAAzjI,EAAA0kI,SAAAC,WACAjB,SAAA1jI,EAAA0kI,SAAAE,UACAjB,QAAA3jI,EAAA0kI,SAAAf,QACAC,WAAA5jI,EAAA0kI,SAAAG,YACAhB,KAAA7jI,EAAA0kI,SAAAb,KACAiB,YAAA9kI,EAAA0kI,SAAAK,aACAhB,MAAA/jI,EAAA0kI,SAAAM,aACA1yH,MAAAtS,EAAA0kI,SAAAO,eAGAlvK,GAEAitK,QAAAhjI,EAAAjlC,GACAi0F,UAAAhvD,EAAAklI,WACAn2E,UAAA/uD,EAAAmlI,kBACAC,gBAAAplI,EAAAqlI,iBACA3tK,MAAAsoC,EAAAslI,aACAZ,SAAAA,EACA9gC,OAAAA,EACA4gC,sBAAAA,EACAe,QAAAvlI,EAAAwlI,SACAC,cAAA1D,EACAp0G,KAAA3tB,EAAA2tB,KACA+3G,UAAA72E,EACA82E,cAAA3lI,EAAA2lI,eAGAxD,GACA53H,OAAA,OACA1uC,IAAAA,EACAoM,OAAA,EACAmT,SAAA,OACArlB,KAAAA,EACA+yC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGAyD,oBAAA,SAAAtzH,EAAAmxH,EAAAC,EAAAK,GAEA,GAAAhuK,IAEAu8C,MAAAA,EACAmxH,UAAAA,EACAC,SAAAA,EACAK,MAAAA,GAGA5B,GACA53H,OAAA,OACA1uC,IAAA,oCACAoM,OAAA,EACAmT,SAAA,OACArlB,KAAAA,EACA+yC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,IAEA0D,UAAA,SAAA7C,EAAAf,GACA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAI,IACA53H,OAAA,MACA1uC,IAAAgmK,EAAA,WAAAmB,EAAA,mCAAAjB,EAAA,YAAAE,EAAA,sBAAAH,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGA2D,WAAA,SAAA9C,EAAAf,GACA,GAAAjrC,IACA+qC,mBAAAH,EAAAM,yBAEA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACA,GAAA6sJ,IACA53H,OAAA,OACA1uC,IAAAgmK,EAAA,WAAAmB,EAAA,oCAAAjB,EAAA,YAAAE,EAAA,sBAAAH,EACA75J,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,MAGA4D,SAAA,SAAAh3E,GAEA,GAAAozE,IACA53H,OAAA,MACA1uC,IAAA,iCAAAkzF,EACA9mF,OAAA,EACAmT,SAAA,OACA0tB,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,IAEA6D,eAAA,SAAA/3E,GACA,GAAAk0E,IACA53H,OAAA,MACA1uC,IAAA,mCAAAoyF,EACAhmF,OAAA,EACAmT,SAAA,OACA0tB,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,IAEA8D,YAAA,SAAAC,EAAAt0E,EAAAu0E,GACA,GAAAhE,IACA53H,OAAA,MACA1uC,IAAA,0CACAmxC,QACAo5H,cAAAF,EACAG,QAAAz0E,EACAr/C,KAAA4zH,GAEAl+J,OAAA,EACAmT,SAAA,OACA0tB,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,IAEAmE,gBAAA,SAAAtD,EAAAf,EAAAsE,GAEA,GAAAvvC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GACAysJ,EAAAzsJ,EAAAysJ,kBAEA,IAAAlmK,GAAAgmK,EAAA,WAAAmB,EAAA,mCAAAjB,EAAA,YAAAE,EAAA,kBAAAsE,EAEApE,GACA53H,OAAA,OACA1uC,IAAAA,EACAoM,OAAA,EACA6gC,SACA27E,OAAA,oBAIA,OAAA7f,GAAAu9D,UCjeAjoE,QAAA5gG,OAAA,wBAAAmV,OAAA,cAAA,OAAA,SAAAu3F,GACA,MAAA,UAAA/uG,GACA,MAAA+uG,GAAAwgE,YAAAvvK,OCeAijG,QAAA5gG,OAAA,wBAAAmV,OAAA,WAAA,WACA,MAAA,UAAAxX,EAAAY,EAAA6e,GAOA,MANAuhC,OAAApgD,KACAA,EAAA,IAEAlC,SAAA+gB,IACAA,EAAA,OAEAzf,EAAAY,QAAAA,GAAAZ,EAAAY,OAAA6e,EAAA7e,QAAAA,EACAZ,EAGA6xB,OAAA7xB,GAAAiM,UAAA,EAAArL,EAAA6e,EAAA7e,QAAA6e,KC7BAwjF,QAAA5gG,OAAA,wBAAAmV,OAAA,gBAAA,aAAA,SAAAi3F,GAiTA,QAAA+gE,GAAA/2J,GAEA,GAAAhM,GAAA,EAEA,QAAAgM,GACA,IAAA,OACAhM,EAAA,UACA,MACA,KAAA,UACAA,EAAA,WACA,MACA,KAAA,OACAA,EAAA,WACA,MACA,KAAA,OACAA,EAAA,WACA,MACA,KAAA,QACAA,EAAA,kBACA,MACA,KAAA,eACAA,EAAA,eACA,MACA,SACAA,EAAA,GAIA,MAAAA,GAGA,QAAAgjK,GAAAhjK,GACA,MAAAA,GACA3K,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,KAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,QACAvC,cAnXA,MAAA,UAAAmwK,EAAAC,GAIA,GAAAh5I,GAAAg5I,EAEAl8J,EAAAi8J,KAEA,IAAA/4I,EAAA,CA+CA,GA5CAA,EAAA0uI,YAEA5xJ,EAAAA,EAAA+D,OAAA,SAAA3T,GACA,MAAAA,GAAA+rK,YAAA,KAQAj5I,EAAAk5I,UAEAp8J,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAAk5I,QAGAC,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,MAGAw0I,EAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAAA,GAAA6G,KAGA,IAAA,IAAAw0I,EAAArsJ,OACA,OAAA,CAEA,IAAAivK,GAAAhsK,EAAAksK,aAEApqK,EAAAsnJ,EAAAv1C,KAAA,SAAAh4G,GACA,MAAAmwK,IAAAnwK,IAAA+vK,EAAAI,IAGA,OAAAlqK,MAKAgxB,EAAA+uI,UACA,CACA,GAAA5mK,GAAA63B,EAAA+uI,UAGAoK,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,MAGAw0I,EAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAA9R,UAAA8R,EAAA6G,MAGAw0I,GAAArsJ,OAAA,IAGA6S,EAAAA,EAAA+D,OAAA,SAAA3T,GACA,MAAAopJ,GAAAruJ,QAAAiF,EAAAmsK,SAAA,KAMAr5I,EAAAsvI,SAEAxyJ,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAAsvI,OAEA6J,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,GAAA3Z,KAAA0wK,EAAA/2J,KAIAq3J,GAAAA,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,GAKA,IAAAwgJ,GAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAAA,GAAA9S,MAGA,IAAA,IAAAmuJ,EAAArsJ,OACA,OAAA,CAEA,IAAAqvK,GAAApsK,EAAAosK,MAEAtqK,EAAAsnJ,EAAAv1C,KAAA,SAAAh4G,GACA,MAAAuwK,IAAAvwK,IAAAuwK,EAAAxjK,OAGA,OAAA9G,MAKAgxB,EAAA6vI,YAGA/yJ,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAA6vI,UAGAsJ,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,KAGAq3J,GAAAA,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,GAKA,IAAAyjK,GAAAJ,EAAA1W,MAAA,SAAA/sJ,GAEA,GAAAw2E,GAAAh/E,EAAA2iK,UAAAn6J,EAAAoM,IAEA,UAAAoqE,GAAAA,EAAAp2E,OAAA,MAMA,OAAAyjK,MAKAv5I,EAAA2wI,aAGA7zJ,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAA2wI,WAGAwI,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,KAGAq3J,GAAAA,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,GAKA,IAAAyjK,GAAAJ,EAAA1W,MAAA,SAAA/tF,GAEA,GAAA8kG,GAAAtsK,EAAAyjK,WAAAj8F,EAAA5yD,IAEA,UAAA03J,GAAAA,EAAA1jK,SAAA,IAMA,OAAAyjK,MAOAv5I,EAAAqvC,QAGAvyD,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAAqvC,MAGA8pG,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,GAAA3Z,KAAA2vG,EAAAztC,UAAAvoD,EAAAg2F,EAAA21D,eAAA7kK,kBAGA0tJ,EAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAAA,GAAA9S,MAGA,IAAA,IAAAmuJ,EAAArsJ,OACA,OAAA,CAGA,IAAA+E,GAAAsnJ,EAAAv1C,KAAA,SAAAh4G,GACA,MAAAmE,IAAAnE,EAAAmT,YAAA47F,EAAAztC,UAAAn9D,EAAAusK,eAAAv9J,WAGA,OAAAlN,MAKAgxB,EAAA9R,aAGApR,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAA9R,WAGAirJ,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,MAGAw0I,EAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAAA,GAAA6G,KAGA,IAAA,IAAAw0I,EAAArsJ,OACA,OAAA,CAGA,IAAA+E,GAAAsnJ,EAAAv1C,KAAA,SAAAh4G,GACA,MAAAmE,IAAAnE,IAAAmE,EAAAwsK,cAAAC,gBAGA,OAAA3qK,MAKAgxB,EAAAsxI,eAGAx0J,EAAAA,EAAA+D,OAAA,SAAA3T,GAEA,GAAA/E,GAAA63B,EAAAsxI,aAGA6H,EAAAzqK,OAAA2lB,KAAAlsB,GAAA8E,IAAA,SAAA6U,GACA,OAAAA,IAAAA,EAAAhM,MAAA3N,EAAA2Z,MAGAw0I,EAAA6iB,EAAAt4J,OAAA,SAAA0tC,GACA,MAAAA,GAAAz4C,SAAA,IAGA7I,IAAA,SAAAgO,GACA,MAAAA,GAAA6G,KAGA,IAAA,IAAAw0I,EAAArsJ,OACA,OAAA,CAGA,IAAA+E,GAAAsnJ,EAAAv1C,KAAA,SAAAh4G,GACA,MAAAmE,IAAAnE,IAAAmE,EAAA0sK,iBAGA,OAAA5qK,MAkBA,MAAA8N,OC9SAwvF,QAAA5gG,OAAA,yBAAAL,QAAA,wBAAA,aAAA,QAAA,WAAA,UAAA,KAAA,kBAAA,SAAAysG,EAAAd,EAAAmnD,EAAAznD,EAAAsB,EAAAg8D,GACA,GAAA6F,MAEAl9D,EAAAh3G,OAAAsF,SAAAC,SACA+oK,EAAA,yBAEAC,EAAA5nE,QAAA9tF,QAAA,QAAArW,KAAA,OAEAw0G,EAAAhpF,SAAA,UAAAgpF,EAAAhpF,SAAA,aAAAgpF,EAAAhpF,SAAA,WAAAgpF,EAAAhpF,SAAA,kBACAsgJ,EAAA,6BAGA,IAAAE,GAAA,IAyWA,OAvWA2F,cAAA,SAAAC,GACA,GAAA5iK,GAAA,EACA,KAAA,GAAAhH,KAAA4pK,GACA5iK,GAAA4iK,EAAA5pK,GACAA,EAAAzB,OAAA2lB,KAAA0lJ,GAAA9vK,OAAA,IACAkN,GAAA,IAGA,OAAAA,IAGA6iK,mBAAA,SAAAjgK,GACA,GAAA5C,GAAA,GACAiuB,EAAA,CAQA,OAPAknE,SAAApmG,QAAA6T,EAAA,SAAAjE,EAAArN,GACA0O,GAAA1O,EACA28B,EAAA12B,OAAA2lB,KAAAta,GAAA9P,OAAA,IACAkN,GAAA,KAEAiuB,MAEAjuB,GAGA8iK,aAAA,SAAA9iK,GAsBA,MApBAA,GAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,SAAA,KACAgM,EAAAA,EAAAhM,QAAA,SAAA,KAEAgM,EAAAA,EAAAhM,QAAA,QAAA,MAKA+uK,cAAA,SAAA1C,EAAAr2E,GACA,MAAAq2E,GAAAvvK,QAAA,cAAAuvK,EAAAvvK,QAAA,aAAA,aAAAuvK,IAAAlrE,QAAAtF,YAAA7F,IAAA,MAAAA,EAGAq2E,EAFA,QAMA2C,oBAAA,SAAApgK,GACA,GAAAqgK,GAAA,EAmBA,OAlBA9tE,SAAApmG,QAAA6T,EAAA,SAAAA,EAAAtR,GACA,GAAA,YAAAA,EACA,GAAA6jG,QAAA9F,SAAAzsF,GACA,GAAA,WAAAtR,EAAA,CACA,GAAA4xK,GAAAL,mBAAAjgK,EAEAsgK,GAAAJ,aAAAI,GACAD,EAAAA,EAAA,IAAA3xK,EAAA,IAAA4xK,MAEAD,GAAAA,EAAA,IAAA3xK,EAAA,IAAAqxK,aAAA//J,OAGAA,KACAqgK,EAAAA,EAAA,IAAA3xK,EAAA,IAAAsR,KAKAqgK,GAGAP,EAAAS,UAAA,SAAAC,EAAAC,EAAAC,EAAAC,GACA,GAAApuE,QAAAtF,YAAAm3D,EAAAF,UAAAsc,IAKApc,EAAAD,UAAAqc,EAAAE,EAAAC,OALA,CACA,GAAAC,GAAAxc,EAAAF,UAAAsc,EACAI,GAAAH,GAAAC,EACAtc,EAAAD,UAAAqc,EAAAI,EAAAD,KAMAb,EAAAe,UAAA,SAAAL,EAAAC,GACA,GAAAG,GAAAxc,EAAAF,UAAAsc,EACA,OAAAI,GAAAH,IAGAX,EAAAgB,YAAA,SAAAN,EAAAC,GACA,GAAAG,GAAAxc,EAAAF,UAAAsc,EACA,QAAAjuE,QAAAtF,YAAA2zE,EAAAH,KAGAX,EAAAiB,gBAAA,SAAAz5E,GACA,GAAAkzE,IACA53H,OAAA,MACA1uC,IAAA,0CACAmxC,QAAAiiD,OAAAA,GACAhnF,OAAA,EAGA,OAAA28F,GAAAu9D,IAGAsF,EAAAkB,cAAA,SAAA5tK,EAAAk0F,GACA,GAAAkzE,IACA53H,OAAA,MACA1uC,IAAA,mDACAmxC,QAAAjyC,GAAAA,EAAAk0F,OAAAA,GACAhnF,OAAA,EAGA,OAAA28F,GAAAu9D,IAGAyG,cAAA,WACA,GAAAC,GAAAt1K,OAAAsF,SAAAC,SACAgwK,EAAA,GACApnC,EAAA,EAMA,OAJAonC,GAAA,QAAAD,EAAA9vK,QAAA,OAAA,IAAAA,QAAA,QAAA,IAAAA,QAAA,WAAA,IAAAA,QAAA,WAAA,IAAAA,QAAA,aAAA,IAAAA,QAAA,SAAA,IAEA2oI,EAAA,WAAAonC,GAKAC,eAAA,WACA,GAAAf,GAAA,EAkBA,OAhBA,OAAAjc,EAAAl3I,IAAA,UACAmzJ,GAAA,SAAAjc,EAAAl3I,IAAA,SAGA,MAAAk3I,EAAAl3I,IAAA,WACAmzJ,GAAA,UAAAjc,EAAAl3I,IAAA,UAGA,MAAAk3I,EAAAl3I,IAAA,eACAmzJ,GAAA,cAAAjc,EAAAl3I,IAAA,cAGA,MAAAk3I,EAAAl3I,IAAA,eACAmzJ,GAAA,gBAGAA,GAGAP,EAAAuB,kBAAA,SAAA/5E,EAAAm2E,EAAA6D,GACA,GAAAvnC,GAAA,GACAwnC,EAAA,GAEA/G,GACA53H,OAAA,MACAtiC,OAAA,EAGAk6J,GAAAr5H,SACA27E,OAAA,oBAGAid,EAAAmgC,EAAA,0BAEA3nE,QAAAtF,YAAA3F,IAAA,OAAAA,IACAi6E,GAAA,cAAAj6E,GAEAiL,QAAAtF,YAAAwwE,IAAA,OAAAA,IACA8D,GAAA,oBAAA9D,EAAArsK,QAAA,QAAA,IAAAA,QAAA,OAAA,IAAAA,QAAA,GAAAkE,QAAA,IAAA,KAAA,MAMAi9F,QAAAtF,YAAAq0E,IAAA,OAAAA,IACAC,GAAA,mBAAAD,GAGAC,GAAA,sBAAApH,CAEA,IAAA9qC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAOA,MANAysJ,GAAAzsJ,EAAAysJ,mBAEAmH,GAAA,eAAAnH,EAEAI,EAAAtmK,IAAA6lI,EAAAwnC,EAEAtkE,EAAAu9D,MAIAsF,EAAA0B,UAAA,WACA,GAAAznC,GAAA,GACAwnC,EAAA,GAEAE,EAAArd,EAAAF,UAAA,SAEA3xD,SAAAtF,YAAAw0E,EAAAn6E,SAAA,OAAAm6E,EAAAn6E,SACAi6E,GAAA,WAAAE,EAAAn6E,QAGAiL,QAAAtF,YAAAw0E,EAAAp2J,OAAA,OAAAo2J,EAAAp2J,OACAk2J,GAAA,SAAAE,EAAAp2J,KAAAja,QAAA,QAAA,IAAAA,QAAA,OAAA,IAAAA,QAAA,GAAAkE,QAAA,IAAA,KAAA,MAGAi9F,QAAAtF,YAAAw0E,EAAAC,QAAA,OAAAD,EAAAC,QACAH,GAAA,UAAAE,EAAAC,OAEAnvE,QAAAtF,YAAAw0E,EAAAE,WAAA,OAAAF,EAAAE,WACAJ,GAAA,aAAAE,EAAAE,SAAAvwK,QAAA,GAAAkE,QAAA,IAAA,KAAA,MAGAi9F,QAAAtF,YAAAw0E,EAAAjgI,YAAA,OAAAigI,EAAAjgI,YACA+/H,GAAA,cAAAE,EAAAjgI,WAEA+wD,QAAAtF,YAAAw0E,EAAAG,WAAA,OAAAH,EAAAG,WACAL,GAAA,aAAAE,EAAAG,UAEArvE,QAAAtF,YAAAw0E,EAAApN,SAAA,OAAAoN,EAAApN,SACAkN,GAAA,WAAAE,EAAApN,QAEA9hE,QAAAtF,YAAAw0E,EAAAnN,OAAA,OAAAmN,EAAAnN,OACAiN,GAAA,SAAAE,EAAAnN,OAEA/hE,QAAAtF,YAAAw0E,EAAAhN,QAAA,OAAAgN,EAAAhN,QAAAliE,QAAAtF,YAAAw0E,EAAAnN,OAAA,OAAAmN,EAAAnN,MAAAmN,EAAAnN,KAAA,IACAiN,GAAA,UAAAxB,aAAA0B,EAAAhN,QAEAliE,QAAAtF,YAAA8Q,EAAAy1D,WAAA,OAAAz1D,EAAAy1D,WACA+N,GAAA,aAAAxjE,EAAAy1D,UAGAjhE,QAAAtF,YAAAm3D,EAAAF,UAAA,cACAqd,GAAAnB,oBAAAhc,EAAAF,UAAA,YAGA,IAAAsW,IACA53H,OAAA,MACA1uC,IAAA,GACAoM,OAAA,GAGA+uH,GACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAOA,MANAysJ,GAAAzsJ,EAAAysJ,mBAEArgC,EAAA,uDAAAqgC,EAEAI,EAAAtmK,IAAA6lI,EAAAwnC,EAEAtkE,EAAAu9D,MAIAsF,EAAA1B,SAAA,SAAAsD,GACA,GAAA3nC,GAAA,GACAwnC,EAAA,GACAM,EAAA9B,aAAA2B,EAAAjN,OAEA+F,GACA53H,OAAA,MACAtiC,OAAA,EA6BA,IA1BAk6J,EAAAr5H,SACA27E,OAAA,oBAGAid,EAAAmgC,EAAA,+BAEA3nE,QAAAtF,YAAA8Q,EAAAy1D,WAAA,OAAAz1D,EAAAy1D,WACA+N,GAAA,kBAAAxjE,EAAAy1D,UAGAjhE,QAAAtF,YAAAy0E,EAAAA,QAAA,OAAAA,EAAAA,QACAH,GAAA,sBAAAG,EAAAA,OAGAnvE,QAAAtF,YAAAy0E,EAAAlgI,YAAA,OAAAkgI,EAAAlgI,YACA+/H,GAAA,mBAAAG,EAAAlgI,WAGA+wD,QAAAtF,YAAAy0E,EAAAE,WAAA,OAAAF,EAAAE,WACAL,GAAA,cAAAG,EAAAE,UAGArvE,QAAAtF,YAAAy0E,EAAAI,eAAA,OAAAJ,EAAAI,eACAP,GAAA,iBAAAG,EAAAI,eAGAvvE,QAAAtF,YAAAy0E,EAAArN,SAAA,OAAAqN,EAAArN,OAAA,CAIA,IAAA,GAFA6G,GAAA,KAEA9kK,EAAA,EAAAsrK,EAAArN,OAAAj+J,EAAAA,IAEA8kK,GAAA,OAGA3oE,QAAAtF,YAAAy0E,EAAApN,OAAA,OAAAoN,EAAApN,MAAAoN,EAAApN,KAAA,IACA4G,GAAA,IAAA2G,GAGAN,GAAA,eAAArG,EAGAqG,GAAA,sBAAApH,CAEA,IAAA9qC,IACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAOA,MANAysJ,GAAAzsJ,EAAAysJ,mBAEAmH,GAAA,eAAAnH,EAEAI,EAAAtmK,IAAA6lI,EAAAwnC,EAEAtkE,EAAAu9D,MAIAsF,EAAAiC,oBAAA,WAEA,GAAAvH,IACA53H,OAAA,MACA1uC,IAAA,GACAoM,OAAA,GAGA+uH,GACA+qC,mBAAAH,EAAAM,yBAGA,OAAAt8D,GAAAhnF,IAAAo4G,GAAApmG,KAAA,SAAAtb,GAOA,MANAysJ,GAAAzsJ,EAAAysJ,mBAEArgC,WAAA,uDAAAqgC,EAAA,mBAEAI,EAAAtmK,IAAA6lI,WAEA98B,EAAAu9D,MAIAsF,KCrXAvtE,QAAA5gG,OAAA,yBAAAL,QAAA,gBAAA,QAAA,SAAA2rG,GACA,GAAA+kE,KAcA,OAZAA,GAAAR,UAAA,SAAAS,EAAA5sH,GAEA,GAAAmlH,IACA53H,OAAA,MACA1uC,IAAA,gCACAmxC,QAAAjyC,GAAA6uK,EAAA5sH,MAAAA,GACA/0C,OAAA,EAGA,OAAA28F,GAAAu9D,IAGAwH,KCfAzvE,QAAA5gG,OAAA,wBACAL,QAAA,mBAAA,KAAA,WAAA,eAAA,SAAA2sG,EAAAmmD,EAAA8d,GACA,GAAAC,GAAA,IACA,QAEA5H,uBAAA,SAAA6H,GACAA,EAAAA,IAAA,CAEA,IAAAnwJ,GAAAgsF,EAAA3yE,OAEA,KAAA82I,EAAA,CACA,GAAAC,GAAAje,EAAAl3I,IAAA,eAEA,IAAAm1J,EAIA,MAHAF,GAAAE,EAEApwJ,EAAAqX,QAAA64I,GACAlwJ,EAAAY,QAaA,MATAqvJ,GAAAlI,eACA/wI,KAAA,SAAA/T,GACAitJ,EAAAjtJ,EAAA9mB,KACA6jB,EAAAqX,QAAA64I,IAEA,WACAlwJ,EAAAsX,WAGAtX,EAAAY,aC9BA0/E,QAAA5gG,OAAA,wBACAL,QAAA,gBAAA,aAAA,UAAA,kBAAA,SAAAysG,EAAAoB,EAAA86D,GAEA,OACArhC,YAAA,SAAA1jH,GAGA,MAAAA,EAAA+rB,OAGA88D,EAAAu1D,eAEA2G,EAAAM,wBAAA,GAAAtxI,KAAA,SAAAu0F,GAEAre,EAAAjuG,SAAA0hG,UACA,SAAAxkG,EAAA6yC,GACAl/B,QAAA4T,MAAA,sBAAAvnB,EAAA6yC,KAGA88D,EAAAu1D,cAAA,GAEA,MAAAp+I,EAAA+rB,OAEAl/B,QAAA4T,MAAA,iBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEAv/B,QAAA4T,MAAA,QAAAT,EAAA+rB,OAAA/rB,EAAAosB,iBCzBAixD,QAAA5gG,OAAA,wBAAAL,QAAA,iBAAA,WAAA,SAAA8yJ;AAEA,GAAAn2J,GAAA,IAEA,QACAq0K,cAAA,SAAA9B,EAAAxgK,EAAAuiK,GAEA,GAAAnzJ,GAAA,GAAAlN,MACAq/G,EAAA,GAAAr/G,MAAAkN,EAAAojD,cAAApjD,EAAAmjD,WAAAnjD,EAAAkjD,UAAAiwG,GAEA12K,GACAsuE,KAAA,IACAJ,QAAAwoG,EAAAhhD,EAAAvzH,OAGAo2J,GAAAD,UAAAqc,EAAAxgK,EAAAnU,IAEA22K,cAAA,SAAAhC,GAEA,MADAvyK,GAAAm2J,EAAAF,UAAAsc,IAGAiC,gBAAA,SAAAjC,GACAvyK,EAAA,KACAm2J,EAAAx3J,OAAA4zK,GAAArmG,KAAA,WCvBAo4B,QAAA5gG,OAAA,wBAAAL,QAAA,eAAA,WAEA,GAAAskG,IACA8sE,kBAAA,SAAA1zK,GACA,MAAAujG,SAAAtF,YAAAj+F,IAAA,OAAAA,GAEA8kK,mBAAA,SAAA7tJ,EAAA/R,GACAA,IAAAA,EAAAtI,OAAAsF,SAAA4R,MACAmD,EAAAA,EAAA7U,QAAA,UAAA,OACA,IAAAqjD,GAAA,GAAAn/C,QAAA,OAAA2Q,EAAA,qBACAwS,EAAAg8B,EAAAn5C,KAAApH,EACA,OAAAukB,GACAA,EAAA,GACA+gD,mBAAA/gD,EAAA,GAAArnB,QAAA,MAAA,MADA,GADA,MAIA2uK,aAAA,SAAAC,GACA,GAAA5iK,GAAA,EACA,KAAA,GAAAhH,KAAA4pK,GACA5iK,GAAA4iK,EAAA5pK,GACAA,EAAAzB,OAAA2lB,KAAA0lJ,GAAA9vK,OAAA,IACAkN,GAAA,IAGA,OAAAA,IAEAguC,MAAA,SAAAC,EAAAvzC,EAAAohC,GACAA,EAAAA,GAAA,CAEA,KAAA,GADAh+B,MACA9E,EAAAi1C,EAAAj1C,GAAA0B,EAAA1B,GAAA8iC,EACAh+B,EAAAzG,KAAA2B,EAEA,OAAA8E,IAEAynK,WAAA,SAAA7kK,GACA,MAAA,gBAAAA,GAAA,GACAA,EAAAlB,OAAA,GAAA7G,cAAA+H,EAAAxS,MAAA,IAIA,OAAAsqG,KCvCArD,QAAA5gG,OAAA,qBAAAokG,UAAA,WAAA,WAAA,SAAAy+C,GACA,MAAA,UAAAriD,EAAA1tF,EAAA+K,GACA2iF,EAAA3E,OACA,SAAA2E,GAEA,MAAAA,GAAA8iC,MAAAzlH,EAAAqP,UAEA,SAAA9iB,GAGA0I,EAAAtX,KAAA4O,GAMAy4I,EAAA/vI,EAAAoQ,YAAAs9E,S5BhBAI,QAAA5gG,OAAA,qBAAAokG,UAAA,eAAA,WAAA,SAAAkJ,GACA,OACAuN,SAAA,IACArlE,QAAA,WACAijE,KAAA,SAAAjY,EAAA1tF,EAAA+K,EAAA4qF,GACAA,GAEAjI,EAAA8rD,OAEAh/C,EAAA,WAEAx6F,EAAAlV,SAAAixF,aACArtF,KAAA,EACAqrF,WAAA,EACAC,UAAA,EACAC,YAAA,GACAkB,aAAA,EACAC,YAAA,EACAC,UAAA,EACAC,eAAA,GACAhb,MAAA,EACA8Z,MAAA,EACAC,cAAA,EACAG,SAAA,sCACAC,SAAA,uCACAc,aAEAY,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,EACAC,YAAA,MAIAkC,WAAA,IACA//C,UACA1tC,KAAA,EACAsrF,UAAA,KAIAyB,aAAA,SAAA10D,GAKA,GAAAo3I,GAAA,EACAj4I,EAAA7/B,EAAA0gC,GACAtE,EAAAyD,EAAAzD,UAEAA,GAAAn5B,KAAA,WACA,GAAA80K,GAAA/3K,EAAAqD,MAAAN,QACAg1K,GAAAD,IACAA,EAAAC,KAGAl4I,EAAA98B,OAAA+0K,OAIA,Q6B7DArwE,QAAA5gG,OAAA,qBAAAokG,UAAA,iBAAA,WACA,OACAyW,SAAA,IACApC,KAAA,SAAAjY,EAAAvrF,EAAA4I,IACAA,EAAAszJ,SAAA,KAAAtzJ,EAAA1M,MAAA,MAAA0M,EAAA1M,OACA8D,EAAA7G,GAAA,QAAA,SAAAvS,GACAA,EAAAkhC,uBCNA6jE,QAAA5gG,OAAA,0BAAAokG,UAAA,kBAAA,WACA,OACA5uD,QAAA,UACAijE,KAAA,SAAAjY,EAAA1tF,EAAA+K,EAAA4qF,GACAA,EAAA0qC,SAAArwI,KAAA,SAAAzF,GACA,MAAAI,UAAAJ,EAAA,MAEAorG,EAAAgoC,YAAA3tI,KAAA,SAAAzF,GACA,MAAA,GAAAA,OCRA,IAAA8qK,iBAAAvnE,QAAA5gG,OAAA,oBACAmoK,iBAAArmE,WAAA,uBAAA,aAAA,SAAA,WAAA,UAAA,UAAA,WAAA,uBAAA,eAAA,SAAAsK,EAAA4U,EAAAyxC,EAAAznD,EAAAwC,EAAAF,EAAA8jE,EAAAC,GA8BA,QAAAjD,GAAAC,GACA,GAAA5iK,GAAA,EACA,KAAA,GAAAhH,KAAA4pK,GACA5iK,GAAA4iK,EAAA5pK,GACAA,EAAAzB,OAAA2lB,KAAA0lJ,GAAA9vK,OAAA,IACAkN,GAAA,IAGA,OAAAA,GArCA,GAAAgS,GAAA,GAAAlN,KACAywG,GAAA6hD,YACA7hD,EAAAswD,YACAC,MAAA,SAAAj9J,KAAA,SAAAmG,UAAA,IACA82J,MAAA,SAAAj9J,KAAA,SAAAmG,UAAA,GAGA,IAAA+2J,IAAA,EAEAC,EAAAt4K,EAAA,6DAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,WAGAklH,EAAAv4K,EAAA,uCAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,WAGAmlH,EAAAx4K,EAAA,qCAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,WAGAolH,EAAAz4K,EAAA,8CAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,OAcAw0D,GAAA6wD,YAAA,WACA,MAAAzlE,GAAAl8B,OAAAyyF,KAAA,IAAA/hE,QAAAtF,YAAA8Q,EAAAl8B,OAAAyyF,OACA3hD,EAAA8wD,UACAlxE,QAAA9tF,QAAA,kBAAAlW,SAAA,gBAEA,IAEAgkG,QAAA9tF,QAAA,kBAAAnW,YAAA,gBACA,IAIAqkH,EAAA+wD,WAAA,SAAAn3K,GACAomH,EAAA3kF,QAAAzhC,GAGAomH,EAAAgxD,eAAA,WACApxE,QAAA9tF,QAAA,SAAAinD,WAAA,SAGA,IAAA6mC,QAAA9tF,QAAA,iBAAArW,KAAA,iBACA2vG,EAAAl8B,OAAAylB,OAAAiL,QAAA9tF,QAAA,iBAAArW,KAAA,gBAGAukH,EAAAixD,aAAA,SAAA5jK,GACA+9F,EAAAl8B,OAAA7hE,EAEAuyF,QAAAtF,YAAA8Q,EAAAl8B,OAAAylB,UACAyW,EAAAl8B,OAAAylB,OAAAqrB,EAAAswD,UAAA,GAAAC,OAGA9e,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAGAmjF,QAAApmG,QAAAwmH,EAAAswD,UAAA,SAAAjjK,GACAA,EAAAoM,SAAApM,EAAAkjK,OAAAnlE,EAAAl8B,OAAAylB,SAGAiL,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YAGAm0K,EAAAhC,gBAAAhjE,EAAAl8B,OAAAylB,QAAAr+D,KAAA,SAAA/T,GAGA,GAFAy9F,EAAAkxD,eAAA3uJ,EAAA9mB,KAEA8mB,EAAA9mB,KAAA8B,OAAA,EAAA,CACA,GAAA4zK,GAAAnnE,EAAA,YAAAgW,EAAAkxD,eAAA,sBAAA9lE,EAAAl8B,OAAAx2D,KAAA,IAEA,IAAAknF,QAAAtF,YAAA8Q,EAAAl8B,OAAAx2D,QAAAy4J,EAAA,CACA,GAAAvM,GAAA56D,EAAA,UAAAgW,EAAAkxD,gBAAAE,gBAAA,YAEAxxE,QAAAtF,YAAAsqE,IAAAA,EAAArnK,OAAA,GACA6tG,EAAAl8B,OAAAx2D,KAAAksJ,EAAA,GAAAyM,gBACAjmE,EAAAl8B,OAAAoiG,OAAA1M,EAAA,GAAA2M,gBAEAnmE,EAAAl8B,OAAAx2D,KAAAsnG,EAAAkxD,eAAA,GAAAG,gBACAjmE,EAAAl8B,OAAAoiG,OAAAtxD,EAAAkxD,eAAA,GAAAK,eAIA,GAAA,MAAA3xE,QAAA9tF,QAAA,iBAAArW,KAAA,gBAAA,MAAAmkG,QAAA9tF,QAAA,iBAAArW,KAAA,YAAA,SAAAmkG,QAAA9tF,QAAA,iBAAArW,KAAA,mBAAA,CAGA,GAAAmkG,QAAA9tF,QAAA,iBAAArW,KAAA,oBAAA,MAAAmkG,QAAA9tF,QAAA,iBAAArW,KAAA,gBAAA,MAAAmkG,QAAA9tF,QAAA,iBAAArW,KAAA,WAAA,CACA,GAAA+1K,GAAA5xE,QAAA9tF,QAAA,QAAArW,KAAA,UACAmpK,EAAA56D,EAAA,UAAAgW,EAAAkxD,gBAAAK,cAAAC,GAEA5M,GAAArnK,OAAA,IACA6tG,EAAAl8B,OAAAx2D,KAAAksJ,EAAA,GAAAyM,gBACAjmE,EAAAl8B,OAAAoiG,OAAA1M,EAAA,GAAA2M,eAIA,GAAA,MAAA3xE,QAAA9tF,QAAA,iBAAArW,KAAA,WAAA,CACA,GAAAg2K,GAAA7xE,QAAA9tF,QAAA,iBAAArW,KAAA,aACAmpK,EAAA56D,EAAA,UAAAgW,EAAAkxD,gBAAAK,cAAAE,GAEA7M,GAAArnK,OAAA,IACA6tG,EAAAl8B,OAAAx2D,KAAAksJ,EAAA,GAAAyM,gBACAjmE,EAAAl8B,OAAAoiG,OAAA1M,EAAA,GAAA2M,eAIA,GAAA,MAAA3xE,QAAA9tF,QAAA,iBAAArW,KAAA,eAAA,CACA,GAAAyxK,GAAAttE,QAAA9tF,QAAA,iBAAArW,KAAA,eACAmpK,EAAA56D,EAAA,UAAAgW,EAAAkxD,gBAAAG,gBAAAnE,IAAA,EAEAtI,GAAArnK,OAAA,IACA6tG,EAAAl8B,OAAAx2D,KAAAksJ,EAAA,GAAAyM,gBACAjmE,EAAAl8B,OAAAoiG,OAAA1M,EAAA,GAAA2M,gBAMAG,cAAAtmE,EAAAl8B,OAAAoiG,OAIA7f,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEA6vF,EAAA,WACA0T,EAAA2xD,kBAAAvmE,EAAAl8B,SACA,KA7DAkhG,WA+DA,WACAxwE,QAAA9tF,QAAA,SAAA63B,WAAA,YACA2nB,cAAA,IAIA,IAAAsgH,GAAA,MACA,KAAAhyE,QAAA9tF,QAAA,iBAAArW,KAAA,YACAm2K,EAAAhyE,QAAA9tF,QAAA,iBAAArW,KAAA,WAGAukH,EAAA6xD,oBAAA,SAAAhsJ,EAAAnN,GACA,GAAApF,GAAAs+J,EAAA,MAEAj2E,EAAAqO,EAAA,UAAAnkF,GAAAwrJ,gBAAA34J,IAAA,EAIA,OAHAijF,KACAroF,EAAAqoF,EAAA,GAAAm2E,iBAEAx+J,GAGA0sG,EAAA+xD,kBAAA,SAAAlsJ,EAAAiqB,GACA,GAAAx8B,GAAAs+J,EAAA,MAEA/iI,EAAAm7D,EAAA,UAAAnkF,GAAAmsJ,cAAAliI,IAAA,EAIA,OAHAjB,KACAv7B,EAAAu7B,EAAA,GAAAojI,eAEA3+J,GAGA0sG,EAAAkyD,mBAAA,SAAArsJ,EAAAssJ,EAAAtjI,EAAAujI,EAAAC,GACA,GAAA/+J,GAAAs+J,EAAA,MAEAU,EAAAtoE,EAAA,UAAAnkF,GAAAwhD,KAAA8qG,IAAA,EAKA,OAJAG,KACAh/J,EAAAg/J,EAAA,GAAAC,uBAAA,KAAA,OAAA1jI,EAAAujI,EAAAC,IAGA/+J,GAGA0sG,EAAA2xD,kBAAA,SAAAtkK,GACA+9F,EAAAl8B,OAAA7hE,CAEA,IAAAu3J,GAAA56D,EAAA,UAAAgW,EAAAkxD,gBAAAG,gBAAAjmE,EAAAl8B,OAAAx2D,OAAA,EAEA0yF,GAAAl8B,OAAAoiG,OAAA1M,EAAA,GAAA2M,cACAnmE,EAAAl8B,OAAA8/F,SAAApK,EAAA,GAAA4N,qBACA,IAAAC,GAAA7N,EAAA,GAAA8N,yBACAC,EAAA/N,EAAA,GAAAgO,wBAEAnhB,GAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEA,UAAA2uF,EAAAl8B,OAAAylB,QAAA89E,GAAA,UAAArnE,EAAAl8B,OAAAylB,QAAAg+E,GACA/yE,QAAA9tF,QAAA,cAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,WAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YAEAm0K,EAAAyC,iBAAAznE,EAAAl8B,OAAAx2D,MAAA4d,KAAA,SAAA/T,GACA6oF,EAAAmqB,WAAA,YAAAhzG,MAKA6tJ,EAAA/B,cAAAjjE,EAAAl8B,OAAAoiG,OAAAlmE,EAAAl8B,OAAAylB,QAAAr+D,KAAA,SAAA/T,GACA,GAAA,GAAAA,EAAA9mB,KAAA8B,OACAqiG,QAAA9tF,QAAA,cAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,WAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,gBACA,CACA2jG,QAAA9tF,QAAA,cAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,SAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,SAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,WAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,SAAA63B,WAAA,YAEAyhE,EAAA0nE,mBAAAvwJ,EAAA9mB,IAEA,IAAAs3K,GAAA/oE,EAAA,YAAAgW,EAAA8yD,mBAAA,oBAAA1nE,EAAAl8B,OAAArgC,UAAA,MAEA+wD,QAAAtF,YAAA8Q,EAAAl8B,OAAArgC,YAAAkkI,IACA3nE,EAAAl8B,OAAArgC,UAAAu8D,EAAA0nE,mBAAA,GAAAd,eAGAhyD,EAAAgzD,gBAAA5nE,EAAAl8B,YAMA8wC,EAAAixD,aAAA7lE,EAAAl8B,QAEA8wC,EAAAgzD,gBAAA,SAAA3lK,GACA+9F,EAAAl8B,OAAA7hE,EAEAokJ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEA2zJ,EAAA1B,kBAAAtjE,EAAAl8B,OAAAylB,OAAAyW,EAAAl8B,OAAAx2D,KAAA0yF,EAAAl8B,OAAArgC,WAAAvY,KAAA,SAAA/T,GAOA,GALA,MAAAA,EAAA+rB,SACA88D,EAAA6nE,aAAA,EACA7jK,QAAAvD,KAAA,gCAAA0W,EAAA+rB,OAAA/rB,EAAAosB,aAGA,IAAApsB,EAAA9mB,KAAA8B,QAAA,MAAAglB,EAAA+rB,OACAsxD,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,WAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,gBACA,CACA2jG,QAAA9tF,QAAA,SAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,SAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,WAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,SAAA63B,WAAA,YAEAyhE,EAAA8nE,kBAAA3wJ,EAAA9mB,KAEA2vG,EAAA+nE,QAAAnpE,EAAA,UAAAoB,EAAA8nE,kBAAA,OAEA,IAAAE,GAAAppE,EAAA,YAAAoB,EAAA+nE,QAAA,UAAA12K,SAAA2uG,EAAAl8B,OAAAsyF,MAEA,IAAA5hE,QAAAtF,YAAA8Q,EAAAl8B,OAAAsyF,QAAA4R,EAAA,CACA,GAAAC,GAAArpE,EAAA,YAAAoB,EAAA+nE,QAAA,YAGAE,GACAjoE,EAAAl8B,OAAAsyF,KAAA,EAEAp2D,EAAAl8B,OAAAsyF,KAAAp2D,EAAA+nE,QAAA,GAAA9rG,KAGA24C,EAAAszD,aAAAloE,EAAAl8B,WAlCAkhG,SAoCA,SAAA7tJ,GACAnT,QAAA4T,MAAA,wBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEA0hI,EAAApqC,YAAA1jH,GAEAq9E,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,WAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,SAAA7V,KAAA,WAAA,eAIA+jH,EAAAszD,aAAA,SAAAC,GACA,GAAA,MAAAA,EAAA,CAOA,GANAnoE,EAAAl8B,OAAAqkG,EAEA9hB,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEA2uF,EAAAooE,QAAAxpE,EAAA,SAAAoB,EAAA8nE,mBAAA7rG,KAAA5qE,SAAA2uG,EAAAl8B,OAAAsyF,QAEA5hE,QAAAtF,YAAA8Q,EAAAl8B,OAAAuyF,MACAr2D,EAAAl8B,OAAAuyF,KAAAr2D,EAAAooE,QAAA,GAAAv7H,SACA,CAEA,GAAAw7H,GAAAroE,EAAAl8B,OAAAuyF,IAKA,IAAA,cAAAr2D,EAAA21D,eAAA,CACA,GAAA2S,GAAAtoE,EAAAztC,UAAAytC,EAAAl8B,OAAAuyF,KAAAr2D,EAAA21D,eAAA7kK,cACAu3K,GAAAzpE,EAAA,QAAA0pE,EAAA,cAGA,GAAAjN,GAAAz8D,EAAA,YAAAoB,EAAAooE,QAAA,YAAAC,EAAA,IACAhN,KACAr7D,EAAAl8B,OAAAuyF,KAAAr2D,EAAA05D,eAAA15D,EAAAooE,QAAAC,IAIAzzD,EAAA2zD,YAAAvoE,EAAAl8B,OAAAuyF,QAKAzhD,EAAA2zD,YAAA,SAAA17H,GACAmzD,EAAAl8B,OAAAuyF,KAAAz3D,EAAA,QAAA/xD,EAAAmzD,EAAA21D,eAEA,IAAA0S,GAAAroE,EAAAl8B,OAAAuyF,IAEA,IAAA,cAAAr2D,EAAA21D,eAAA,CACA,GAAA2S,GAAAtoE,EAAAztC,UAAAytC,EAAAl8B,OAAAuyF,KAAAr2D,EAAA21D,eAAA7kK,cACAu3K,GAAAzpE,EAAA,QAAA0pE,EAAA,cAGA,GAAAE,GAAA5pE,EAAA,UAAAoB,EAAA8nE,mBAAA7rG,KAAA5qE,SAAA2uG,EAAAl8B,OAAAsyF,MAAAvpH,KAAAw7H,IAAA,GAEAI,EAAAD,EAAA,GAAArB,sBACAsB,IAAA,QAAAzoE,EAAAl8B,OAAArgC,UAAA,EAAA,EAEAu8D,EAAAl8B,OAAA+/F,SAAA2E,EAAA,GAAAE,UAEAriB,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KACA2uF,EAAAg6D,cAAAh6D,EAAAooE,QAAA,OAAAK,GACA7zD,EAAA+zD,aAAA3oE,EAAAl8B,SAGA8wC,EAAA+zD,aAAA,SAAA1mK,GACA+9F,EAAAl8B,OAAA7hE,EAEAokJ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,MAEAmjF,QAAAtF,YAAA8Q,EAAAl8B,OAAAwyF,SAAA,OAAAt2D,EAAAl8B,OAAAwyF,QAAAt2D,EAAAl8B,OAAAwyF,WACAgP,EAAAvhH,QAAA,QACA6wD,EAAAg0D,eAAA5oE,EAAAl8B,SAEAwhG,EAAAvhH,QAAA,SAIA6wD,EAAAg0D,eAAA,SAAA3mK,GAYA,GAXA+9F,EAAAl8B,OAAA7hE,EAEAokJ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,MAEAmjF,QAAAtF,YAAA8Q,EAAAl8B,OAAAyyF,OAAA,OAAAv2D,EAAAl8B,OAAAyyF,MAAAv2D,EAAAl8B,OAAAyyF,SACAgP,EAAAxhH,QAAA,QACA6wD,EAAAi0D,iBAAA7oE,EAAAl8B,SAEAyhG,EAAAxhH,QAAA,QAGAi8C,EAAAl8B,OAAAyyF,KAAA,IAAA3hD,EAAA8wD,SAAA,CACA,GAAAoD,GAAA,GAAAziB,EAAAl3I,IAAA,mBACA45J,EAAAh8K,EAAA,iDAAAq8B,KAAA,eAAA6W,SAAA,OAEA8oI,GAAAD,GACAzD,EAAAthH,QAAA,YAIAshH,GAAAthH,QAAA,SAIA6wD,EAAAo0D,WAAA,SAAA90C,EAAAl7H,EAAAs0C,GACA4mF,EAAAvjG,iBAEA,SAAA33B,GAEA,mBAAAs0C,GACAj8C,SAAAi8C,GAAAj8C,SAAA2uG,EAAAl8B,OAAAyyF,MACAv2D,EAAAl8B,OAAAyyF,KAAAllK,SAAA2uG,EAAAl8B,OAAAyyF,MAAA,EAGAv2D,EAAAl8B,OAAAyyF,KAAAllK,SAAAi8C,GAIA0yD,EAAAl8B,OAAAyyF,KAAAllK,SAAA2uG,EAAAl8B,OAAAyyF,MAAA,EAGA3hD,EAAAg0D,eAAA5oE,EAAAl8B,QACA8wC,EAAAq0D,YACAr0D,EAAA+wD,WAAA3sK,IAEA,WAAAA,IAEA,mBAAAs0C,GACAj8C,SAAAi8C,GAAAj8C,SAAA2uG,EAAAl8B,OAAAwyF,QACAt2D,EAAAl8B,OAAAwyF,OAAAjlK,SAAA2uG,EAAAl8B,OAAAwyF,QAAA,EAGAt2D,EAAAl8B,OAAAwyF,OAAAjlK,SAAAi8C,GAIA0yD,EAAAl8B,OAAAwyF,OAAAjlK,SAAA2uG,EAAAl8B,OAAAwyF,QAAA,EAGA1hD,EAAA+zD,aAAA3oE,EAAAl8B,QACA8wC,EAAA+wD,WAAA3sK,KAIA47G,EAAAs0D,UAAA,SAAAh1C,EAAAl7H,EAAAe,GACAm6H,EAAAvjG,iBAEA,SAAA33B,GAEA,mBAAAe,GACA1I,SAAA0I,GAAA1I,SAAA2uG,EAAAl8B,OAAAyyF,MACAv2D,EAAAl8B,OAAAyyF,KAAAllK,SAAA2uG,EAAAl8B,OAAAyyF,MAAA,EAGAv2D,EAAAl8B,OAAAyyF,KAAAllK,SAAA0I,GAIAimG,EAAAl8B,OAAAyyF,KAAAllK,SAAA2uG,EAAAl8B,OAAAyyF,MAAA,EAGA3hD,EAAAg0D,eAAA5oE,EAAAl8B,QACA8wC,EAAAq0D,YACAr0D,EAAA+wD,WAAA3sK,IAEA,WAAAA,IAEA,mBAAAe,GACA1I,SAAA0I,GAAA1I,SAAA2uG,EAAAl8B,OAAAwyF,QACAt2D,EAAAl8B,OAAAwyF,OAAAjlK,SAAA2uG,EAAAl8B,OAAAwyF,QAAA,EAGAt2D,EAAAl8B,OAAAwyF,OAAAjlK,SAAA0I,GAIAimG,EAAAl8B,OAAAwyF,OAAAjlK,SAAA2uG,EAAAl8B,OAAAwyF,QAAA,EAGA1hD,EAAA+zD,aAAA3oE,EAAAl8B,QACA8wC,EAAA+wD,WAAA3sK,KAIA47G,EAAAq0D,UAAA,WACAjpE,EAAAl8B,OAAAyyF,KAAA,EACA3hD,EAAA8wD,UAAA,EAEA9wD,EAAA8wD,UAAA,GAIA9wD,EAAAu0D,eAAA,WACA9D,EAAAthH,QAAA,SAGAywC,QAAAtF,YAAA8Q,EAAAl8B,OAAA4yF,SACA12D,EAAAl8B,OAAA4yF,UAGA9hD,EAAAi0D,iBAAA,SAAA5mK,GACA,GAAA+9F,EAAAl8B,OAAAyyF,KAAA3hD,EAAA6hD,SAAAtkK,OACA,IAAA,GAAAkG,GAAAu8G,EAAA6hD,SAAAtkK,OAAAkG,EAAA2nG,EAAAl8B,OAAAyyF,KAAA,EAAAl+J,IACAu8G,EAAA6hD,SAAAvhK,OAAAmD,EAAA,GACAm8F,QAAAtF,YAAA8Q,EAAAl8B,OAAA4yF,cACA12D,GAAAl8B,OAAA4yF,MAAAr+J,OAIA,IAAA2nG,EAAAl8B,OAAAyyF,KAAAv2D,EAAAs1D,YAAA,EACA,IAAA,GAAAj9J,GAAAu8G,EAAA6hD,SAAAtkK,OAAAkG,EAAA2nG,EAAAl8B,OAAAyyF,KAAAl+J,IACAu8G,EAAA6hD,SAAA//J,MAAA+mK,IAAA,KACAjpE,QAAAtF,YAAA8Q,EAAAl8B,OAAA4yF,MAAAr+J,MACA2nG,EAAAl8B,OAAA4yF,MAAAr+J,GAAA,EAMAm8F,SAAAtF,YAAA8Q,EAAAl8B,OAAA4yF,QACA9/J,OAAA2lB,KAAAyjF,EAAAl8B,OAAA4yF,OAAAvkK,OAAAyiH,EAAA6hD,SAAAtkK,SACAyiH,EAAA8wD,UAAA,GAIA9wD,EAAAw0D,WAAAppE,EAAAl8B,SAGA8wC,EAAAw0D,WAAA,SAAAnnK,GACA+9F,EAAAl8B,OAAA7hE,EACAokJ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,IAEA,IAAAg4J,IAAA,CAEA70E,SAAApmG,QAAA4xG,EAAAl8B,OAAA4yF,MAAA,SAAA14J,EAAAgM,IACAwqF,QAAAtF,YAAAlxF,IAAA,OAAAA,GAAAA,EAAA,IAAAA,EAAA,KACAqrK,GAAA,KAGAA,GACA7D,EAAAzhH,QAAA,QAEA+f,KAEA0hG,EAAAzhH,QAAA,SAIA6wD,EAAA00D,UAAA,SAAA7lI,EAAA8lI,EAAAC,EAAAC,GAGA70D,EAAA80D,mBAAArjB,EAAAF,UAAA,sBAGAvxC,EAAA+0D,wBAAAtjB,EAAAF,UAAA,0BAGA,IAAAyjB,GAAA,EACAC,EAAA,EACAC,EAAA,CAEAt1E,SAAAtF,YAAA0lB,EAAA+0D,0BACAn1E,QAAAtF,YAAA0lB,EAAA+0D,wBAAAI,UACAH,EAAAh1D,EAAA+0D,wBAAAI,OAAA,GAAAz8I,MACAu8I,EAAAj1D,EAAA+0D,wBAAAI,OAAA,GAAAz8I,MACAw8I,EAAAl1D,EAAA+0D,wBAAAI,OAAA,GAAAz8I,MAKA,IAAA08I,GAAA,EACAC,EAAA,EACAC,EAAA,CAWA,OATA11E,SAAAtF,YAAA0lB,EAAA80D,qBACAl1E,QAAAtF,YAAA0lB,EAAA80D,mBAAAK,UACAC,EAAAp1D,EAAA80D,mBAAAK,OAAA,GAAAz8I,MACA28I,EAAAr1D,EAAA80D,mBAAAK,OAAA,GAAAz8I,MACA48I,EAAAt1D,EAAA80D,mBAAAK,OAAA,GAAAz8I,UAKA,OAAAmW,GAAA8lI,GAAAK,EAAA,GAAAI,EAAA,SAGA,MAAAvmI,GAAA,MAAAA,IAAA+lI,GAAAK,EAAA,GAAAI,EAAA,OAGA,OAAAxmI,GAAA,MAAAA,GAAA,MAAAA,GAAAgmI,GAAAK,EAAA,GAAAI,EAAA,KAMAt1D,EAAAu1D,cAAA,SAAA1mI,GACA,MAAA,OAAAA,EACA,gBAEA,MAAAA,GAAA,MAAAA,EACA,gBAGA,cAIAmxE,EAAAw1D,iBAAA,SAAA7G,GAKA,GAAA8G,GAAA,CAOA,OANA,OAAA9G,EACA8G,EAAA,EAEA,MAAA9G,GAAA,MAAAA,IACA8G,EAAA,GAEAA,GAGAz1D,EAAA01D,WAAA,SAAA7mI,GACA,GAAApuC,GAAAu/G,EAAAw1D,iBAAA3mI,EAEAmxE,GAAA80D,mBAAArjB,EAAAF,UAAA,0BACAvxC,EAAA80D,mBAAAK,QAAAv1E,QAAAtF,YAAA0lB,EAAA80D,mBAAAK,SAAAv1E,QAAAppF,QAAAwpG,EAAA80D,mBAAAK,QAAAn1D,EAAA80D,mBAAAK,SAAA10K,GAAA,EAAAi4B,MAAA,IAAAj4B,GAAA,EAAAi4B,MAAA,IAAAj4B,GAAA,EAAAi4B,MAAA,IAEAknE,QAAApmG,QAAAwmH,EAAA80D,mBAAAK,OAAA,SAAA9nK,GACAA,EAAAqrB,OAAArrB,EAAA5M,KAAAA,EAAA,EAAA,IAIAgxJ,EAAAD,UAAA,qBAAAxxC,EAAA80D,oBAAAttG,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAujG,EAAA+0D,wBAAAtjB,EAAAF,UAAA,+BACAvxC,EAAA+0D,wBAAAI,QAAAv1E,QAAAtF,YAAA0lB,EAAA+0D,wBAAAI,SAAAv1E,QAAAppF,QAAAwpG,EAAA+0D,wBAAAI,QAAAn1D,EAAA+0D,wBAAAI,SAAA10K,GAAA,EAAAi4B,MAAA,IAAAj4B,GAAA,EAAAi4B,MAAA,IAAAj4B,GAAA,EAAAi4B,MAAA,IAEAknE,QAAApmG,QAAAwmH,EAAA+0D,wBAAAI,OAAA,SAAA9nK,GACAA,EAAAqrB,OAAArrB,EAAA5M,KAAAA,EAAA,EAAA,IAIAgxJ,EAAAD,UAAA,0BAAAxxC,EAAA+0D,yBAAAvtG,KAAA,MAGA,IAAA0H,GAAA,WAEAk8B,EAAAuqE,YAAAvqE,EAAAg5D,cAAAh5D,EAAAl8B,OAAAwyF,OAAAt2D,EAAAl8B,OAAAyyF,OAGAv2D,EAAAuqE,aAAA/1E,QAAA9tF,QAAA,gBAAAvU,QAAAizK,IAIAJ,EAAAvB,YAAAv4I,KAAA,SAAA/T,GACA6oF,EAAAmqB,WAAA,YAAAhzG,KAGAiuJ,GAAA,GAGAxwD,GAAA5sF,OAAA,WACA,GAAA4sF,EAAA41D,aAAA1nC,OAAA,CAEAujB,EAAAlgD,IAAA,kBAAA,GAAA/pC,KAAA,KAEA,IAAAkmG,GAAA,EACA,KAAA9tE,QAAAtF,YAAA8Q,EAAAl8B,UAEAw+F,EAAA,IAEAtiE,EAAAl8B,OAAAylB,SACA+4E,EAAAA,EAAA,UAAAtiE,EAAAl8B,OAAAylB,QAGAyW,EAAAl8B,OAAArgC,YACA6+H,EAAAA,EAAA,cAAAtiE,EAAAl8B,OAAArgC,WAGAu8D,EAAAl8B,OAAAsyF,OACAkM,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAsyF,MAGAp2D,EAAAl8B,OAAAuyF,OACAiM,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAuyF,MAGAr2D,EAAAl8B,OAAAwyF,SACAgM,EAAAA,EAAA,WAAAtiE,EAAAl8B,OAAAwyF,QAGAt2D,EAAAl8B,OAAAyyF,OACA+L,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAyyF,MAGAv2D,EAAAl8B,OAAA4yF,OACAliE,QAAA9F,SAAAsR,EAAAl8B,OAAA4yF,QAAA,CACA,GAAA6L,GAAAP,EAAAhiE,EAAAl8B,OAAA4yF,MACA,MAAA6L,IACAD,EAAAA,EAAA,UAAAC,GAMAnhE,EAAAjuG,SAAA4R,KAAAyvF,QAAA9tF,QAAA,mBAAArW,KAAA,OAAAiyK,OAKAvG,gBAAArmE,WAAA,uBAAA,aAAA,SAAA,WAAA,UAAA,uBAAA,eAAA,WAAA,eAAA,SAAAsK,EAAA4U,EAAAyxC,EAAAznD,EAAAomE,EAAAyF,EAAAvpE,EAAA+jE,GAkOA,QAAAyF,GAAAlhF,EAAArgE,EAAAwhJ,GAOA,IAAA,GALAlwJ,MAEAmwJ,EAAAv5K,SAAAm4F,GAAAn4F,SAAA83B,GACA0hJ,EAAAxsK,WAAAssK,GAAAC,EAEAvyK,EAAA,EAAAA,EAAAmxF,EAAAnxF,IAAA,CACA,GAAA3I,IACAo7K,OAAA,EACA94K,MAAA64K,EACAhwI,OAAAxiC,EAAA,EAEAoiB,GAAA/jB,KAAAhH,GAGA,IAAA,GAAAsW,GAAA,EAAAA,EAAAmjB,EAAAnjB,IAAA,CACA,GAAAlN,IACAgyK,OAAA,EACA94K,MAAA64K,EACAhwI,OAAA70B,EAAA,EAEAyU,GAAA/jB,KAAAoC,GAGA,MAAA2hB,GAmJA,QAAAumJ,GAAAhjK,GACA,MAAAA,GACA3K,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,KAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IACAA,QAAA,IAAA,IAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,SACAA,QAAA,IAAA,SAEAA,QAAA,IAAA,QACAvC,cAGA,QAAAi6K,GAAAC,GACA,GAAAR,GAAAz9K,EAAA,gBAEAc,QAAAo9K,UAAAp9K,OAAAo9K,cACAp9K,OAAAo9K,UAAAv0K,MACAmT,MAAA,eACAqhK,kBAAAtsE,EAAA,QAAAosE,EAAArJ,cAAA,cACAwJ,mBAAAvsE,EAAA,QAAAosE,EAAAI,WAAA,cACAC,WAAAL,EAAA5U,KACAkV,iBAAAN,EAAA/J,QAAA9rK,IAAA,SAAA8rK,GAAA,MAAAA,GAAAv8H,OACA6mI,WAAAf,EAAAn6K,KAAA,oBACAm7K,cAAAhB,EAAAn6K,KAAA,WACAo7K,aAAAT,EAAA1U,OACAoV,eAAAV,EAAAzU,KACAoV,mBAAAt6K,SAAA25K,EAAA1U,QAAAjlK,SAAA25K,EAAAzU,MACAqV,gBAAAZ,EAAAvnI,YAncA,GAAApyB,GAAA,GAAAlN,KAEAywG,GAAAi3D,cAAA,EAEA3qE,EAAA,WACA0T,EAAAi3D,cAAA,GACA,MAGAj3D,EAAAh9F,OAAA,EACAg9F,EAAAk3D,UAAA,KAEAl3D,EAAAo2D,aAEAp2D,EAAAo2D,UAAA5U,KAAAp2D,EAAAl8B,OAAAsyF,KACAxhD,EAAAo2D,UAAA1U,OAAAt2D,EAAAl8B,OAAAwyF,OACA1hD,EAAAo2D,UAAAzU,KAAAv2D,EAAAl8B,OAAAyyF,KACA3hD,EAAAo2D,UAAA3U,KAAAr2D,EAAAl8B,OAAAuyF,KACAzhD,EAAAo2D,UAAAvnI,UAAAu8D,EAAAl8B,OAAArgC,UACAmxE,EAAAo2D,UAAArU,OAAA32D,EAAAl8B,OAAA6yF,OAGAz1D,EAAA,WACAlB,EAAA6nE,eAAA,GACAjzD,EAAAvgB,OAAA,WACAugB,EAAAh9F,OAAA,EACAg9F,EAAAk3D,UAAA,OAGA,KAEAl3D,EAAAm3D,WAAA,SAAAl/H,GACA,GAAAm/H,GAAAptE,EAAA,QAAA/xD,EAAAmzD,EAAA21D,eAEA/gD,GAAAo2D,UAAA3U,KAAA2V,EACAhsE,EAAAl8B,OAAAuyF,KAAA2V,CAEA,IAAAxD,GAAA5pE,EAAA,UAAAoB,EAAA8nE,mBAAA7rG,KAAA5qE,SAAA2uG,EAAAl8B,OAAAsyF,MAAAvpH,KAAAA,IAAA,EAEAmzD,GAAAl8B,OAAA+/F,SAAA2E,EAAA,GAAAE,UAEAriB,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAujG,EAAAq3D,cAAA,EACAr3D,EAAAi3D,cAAA,EAEA3qE,EAAA,WACA0T,EAAAi3D,cAAA,GACA,MAEA7G,EAAAvB,YAAAv4I,KAAA,SAAA/T,GACA6oF,EAAAmqB,WAAA,YAAAhzG,GAAA+0J,kBAAA,OAIAt3D,EAAAu3D,aAAA,SAAAt/H,EAAAu/H,EAAAz7K,GAGA,MAFAk8C,GAAA+xD,EAAA,QAAA/xD,EAAAmzD,EAAA21D,gBAEA9oH,GAAAu/H,EAOA,IAAAC,GAAA,WACA,GAAA/J,GAAA,EACA,KAAA9tE,QAAAtF,YAAA8Q,EAAAl8B,UACAw+F,EAAA,IAEAtiE,EAAAl8B,OAAAylB,SACA+4E,EAAAA,EAAA,UAAAtiE,EAAAl8B,OAAAylB,QAGAyW,EAAAl8B,OAAArgC,YACA6+H,EAAAA,EAAA,cAAAtiE,EAAAl8B,OAAArgC,WAGAu8D,EAAAl8B,OAAAsyF,OACAkM,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAsyF,MAGAp2D,EAAAl8B,OAAAuyF,OACAiM,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAuyF,MAGAr2D,EAAAl8B,OAAAwyF,SACAgM,EAAAA,EAAA,WAAAtiE,EAAAl8B,OAAAwyF,QAGAt2D,EAAAl8B,OAAAyyF,OACA+L,EAAAA,EAAA,SAAAtiE,EAAAl8B,OAAAyyF,MAGAv2D,EAAAl8B,OAAA4yF,OAAA12D,EAAAl8B,OAAAyyF,MAAAv2D,EAAAl8B,OAAAyyF,KAAA,GACA/hE,QAAA9F,SAAAsR,EAAAl8B,OAAA4yF,QAAA,CACA,GAAA6L,GAAAkI,EAAAzI,aAAAhiE,EAAAl8B,OAAA4yF,MACA,MAAA6L,IACAD,EAAAA,EAAA,UAAAC,GAMA3tD,EAAA03D,eAAAhK,GAGAiK,EAAA,SAAAC,GA2BA,QAAAC,KACA,GAAAC,GAAA,EACAC,EAAA5/K,EAAA,gBAAA8C,QACA+8K,EAAA7/K,EAAA,QAAA8C,QACAg9K,EAAA9/K,EAAA,gBAAA8D,KAAA,cACAi8K,EAAAD,EAAA32K,MAAA,IAEA02K,IAAA,MACAF,EAAAI,EAAA,GACAC,UAAAJ,EAAAD,GAEAE,GAAA,KACAF,EAAAI,EAAA,GACAC,UAAAJ,EAAAD,GAEAE,GAAA,KACAF,EAAAI,EAAA,GACAC,UAAAJ,EAAAD,IAGAA,EAAAI,EAAA,GACAC,UAAAJ,EAAAD,EAGA,IAAAM,GAAAD,UAAAE,CAEAlgL,GAAA,qCAAAyF,KAAA3C,MAAAm9K,IACAjgL,EAAA,2CAAAiD,KAAA,WACAjD,EAAAqD,MAAAk4D,WAAAykH,YAKA,IAAAG,GAAA,EAGAA,GADA,cAAAltE,EAAA21D,eACA/gD,EAAAo2D,UAAA3U,KAAAngK,MAAA,KAAAg0B,UAAA7zB,KAAA,KAEAu+G,EAAAo2D,UAAA3U,KAGA1lK,EAAAikH,EAAAo2D,UAAAwB,YAAAr3K,IAAA,SAAAg4K,GAAA,MAAAA,GAAAtgI,OAAA18C,QAAA+8K,EAEA,IAAAE,GAAAL,WAAAp8K,EAAA,EAEAy8K,IAAAL,UAAAhtK,IACAqtK,EAAA,GAGAA,GAAAJ,EAAAD,UAAAL,IACAU,EAAAJ,EAAAD,UAAAL,GAEA3/K,EAAA,qCAAAyF,IAAA,YAAA,eAAA46K,EAAA,OAKA,QAAAC,GAAA59K,EAAAsQ,GACA,GAAAqtK,GAAA,GACAE,EAAAvgL,EAAA,qCAAAyF,IAAA,aACAod,EAAA09J,EAAAp2K,MAAA,cAEAq2K,EAAAr8K,KAAAC,IAAAye,EAAA,GACA,IAAA,GAAAngB,EACA29K,EAAA/7K,SAAAk8K,GAAAl8K,SAAA07K,UAAAhtK,GAEAqtK,GAAAL,UAAA,IACAK,EAAA,OAGA,IAAA,GAAA39K,EAAA,CACA,GAAA+9K,GAAAzgL,EAAA,qCAAA8C,QAAA9C,EAAA,gBAAA8C,OACAu9K,GAAA/7K,SAAAk8K,GAAAl8K,SAAA07K,UAAAhtK,GAEAqtK,GAAAI,EAAAT,UAAA,IACAK,EAAAI,GAGAzgL,EAAA,qCAAAyF,IAAA,YAAA,eAAA46K,EAAA,OAIA,QAAA/+I,GAAAzwB,GACAyvK,EAAAzvK,EAAAmC,GA7GA,GAAAA,GAAAhT,EAAA,gBAAA8D,KAAA,cACAo8K,EAAAT,EAAAr6K,OACAxB,EAAA,CAEA5D,GAAA,iBAAAshC,MAAA,WACA,GAAAjf,GAAAriB,EAAAqD,MAAA6vC,SAAA,OAEA5R,GADAjf,EACA,EAEA,IAGA,IAAAq+J,GACAC,EAAAvhL,SAAAo6E,cAAA,SACAx5E,GAAAc,QAAAmU,GAAA,SAAA,SAAAvS,GACA+I,aAAAi1K,GACAA,EAAAt2K,WAAA,WACAu2K,GAAAvhL,SAAAo6E,cAAA,YACAmnG,EAAAvhL,SAAAo6E,cAAA,UACAkmG,MAEA,OA2FAA,IAEA1/K,EAAA,gBAAA2iB,OA+BAklG,GAAA+4D,kBAAA,SAAAz5C,EAAAyvC,GAEAzvC,EAAAvjG,iBACAujG,EAAA9iG,iBAEA,IAAAvkB,GAAA,GAEA+gK,EAAAp5E,QAAA9tF,QAAAwtH,EAAAhjG,eAAAzH,QAAA,UAAAn5B,KAAA,0BAEAuc,IAAA,0BAEA,KAAA,GAAAxU,GAAA,EAAAA,EAAAsrK,EAAAkK,cAAA17K,OAAAkG,IACAwU,GAAA,mCAAA82J,EAAAkK,cAAAx1K,GAAA,OAEAwU,IAAA,QAEAA,GAAA+gK,EAAAx+K,MAEA,IAAA0+K,GAAA/gL,EAAA,wBAAAuD,KAAA,cACAw9K,IACAA,EAAAh7K,QAAAF,OAAAia,GAGA9f,EAAA,wBAAAgzD,MAAA,SAGA60D,EAAAm5D,OAAA,SAAAC,GACAhJ,EAAAxC,UAAA,SAAA,SAAAwL,GAAA5xG,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,MAGAujG,EAAA7D,IAAA,YAAA,SAAAlnG,EAAAsN,GACA,GAAAq9E,QAAAtF,YAAA/3E,EAAA9mB,OAAA,GAAA8mB,EAAA9mB,KAAA8B,OACA6R,QAAAvD,KAAA,2BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YACAqxE,EAAAh9F,OAAA,EACAg9F,EAAAk3D,UAAA30J,EAAA+rB,OACA0xE,EAAAq5D,cAAA92J,EAAAosB,eACA,CAEAqxE,EAAAo2D,UAAA3U,KAAAr2D,EAAAl8B,OAAAuyF,KAEAzhD,EAAAo2D,UAAA/J,QAAAriE,EAAA,UAAAznF,EAAA9mB,MAAA69K,SAAA,IAAA,GACAt5D,EAAAo2D,UAAAmD,eAAAvvE,EAAA,UAAAznF,EAAA9mB,MAAA69K,SAAA,IAAA,EAEA,IAAAE,GAAA,IACA55E,SAAAtF,YAAA0lB,EAAAo2D,YAAA,OAAAp2D,EAAAo2D,WACAx2E,QAAAtF,YAAA0lB,EAAAo2D,UAAA/J,QAAA,KAAA,OAAArsD,EAAAo2D,UAAA/J,QAAA,KACAmN,EAAAx5D,EAAAo2D,UAAA/J,QAAA,GAAAW,eAIA,OAAAwM,IACAx5D,EAAAo2D,UAAApJ,cAAAhtD,EAAAo2D,UAAA/J,QAAA,GAAAW,cACAhtD,EAAAo2D,UAAArJ,cAAA/sD,EAAAo2D,UAAA/J,QAAA,GAAAU,cACA/sD,EAAAo2D,UAAAI,WAAAx2D,EAAAo2D,UAAA/J,QAAA,GAAAmK,WAKA,IAAAiD,GAAA,GAAAlqK,MAAA,KAAA,EAAA,GACAmqK,EAAA,GAAAnqK,MAAA,KAAA,EAAA,GACAs8J,EAAA,GAAAt8J,MAAAywG,EAAAo2D,UAAArJ,cACA/sD,GAAAo2D,UAAAkD,WAEAzN,EAAA4N,IACAz5D,EAAAo2D,UAAAkD,QAAAA,SAAA,GAGAzN,EAAA6N,IACAj9J,EAAAi9J,EACA15D,EAAAo2D,UAAAkD,QAAAK,UAAA,EAEA35D,EAAAo2D,UAAAkD,QAAAA,SAAA,GAMAt5D,EAAA45D,iBACA,OAAAJ,IACAx5D,EAAA45D,cAAA3V,WAAAjkD,EAAAo2D,UAAA/J,QAAA,GAAApI,WACAjkD,EAAA45D,cAAAzW,UAAAnjD,EAAAo2D,UAAA/J,QAAA,GAAAlJ,WAGAsU,GAEA,IAAAoC,GAAA7vE,EAAA,UAAAgW,EAAAo2D,UAAA/J,QAAA,eACAwN,GAAA7vE,EAAA,OAAA6vE,EAAA,gBACAA,EAAAA,EAAA1lK,OAAAsuE,SAEAmd,QAAAtF,YAAA0lB,EAAAo2D,YAAA,OAAAp2D,EAAAo2D,WACAx2E,QAAAtF,YAAA0lB,EAAAo2D,UAAApJ,gBAAA,OAAAhtD,EAAAo2D,UAAApJ,gBACAhtD,EAAAo2D,UAAApJ,cAAA8M,kBAAA1uE,EAAAg2D,YAAAphD,EAAAo2D,UAAApJ,cAAA+M,uBAAA/5D,EAAAo2D,UAAApJ,cAAAgN,sBACAh6D,EAAAo2D,UAAApJ,cAAAiN,eAAA7uE,EAAAg2D,YAAAphD,EAAAo2D,UAAApJ,cAAAkN,oBAAAl6D,EAAAo2D,UAAApJ,cAAAmN,mBAIA,IAAAC,KACAP,IAAAA,EAAAt8K,OAAA,IAEA68K,EAAAP,EAAAt5K,IAAA,SAAAlE,GACA,OAAA+Y,IAAAg3J,EAAA/vK,GAAA+M,MAAA/M,MAIA2jH,EAAA45D,cAAAS,cAAAD,EAEAp6D,EAAA45D,cAAA5X,UAAAh4D,EAAA,UAAAgW,EAAAo2D,UAAA/J,SAAAE,UAAA,IAAAhvK,OAAA,EAEAyiH,EAAA45D,cAAAvX,WAAA,EAAA,EAAA,EAAA,EAEA,IAAAiC,GAAAl5D,EAAAi5D,iBAAAj5D,EAAA93E,QAAAyuI,OAGA/hD,GAAAo2D,UAAAkE,gBAAAtwE,EAAA,gBAAAgW,EAAAo2D,UAAA/J,QAAArsD,EAAA1sF,SACA0sF,EAAAo2D,UAAAkE,gBAAAtwE,EAAA,WAAAgW,EAAAo2D,UAAAkE,gBAAAhW,GAEAtkD,EAAAo2D,UAAAmE,mBAAAv6D,EAAAo2D,UAAA/J,QAAAl4J,OAAA,SAAA9G,GACA,OAAA2yG,EAAAo2D,UAAAkE,gBAAAE,SAAAntK,KAGAuyF,QAAApmG,QAAAwmH,EAAAo2D,UAAA/J,QAAA,SAAAh/J,GACAA,EAAAotK,QAAA3E,EAAA91D,EAAAo2D,UAAA1U,OAAA1hD,EAAAo2D,UAAAzU,KAAAt0J,EAAAjQ,SAGAwiG,QAAA9tF,QAAA,gBAAAvU,SACApF,EAAA,gBAAAumB,OAEAshG,EAAAo2D,UAAAwB,YAAA5tE,EAAA,UAAAoB,EAAAooE,QAAA,QACAxzD,EAAAo2D,UAAAwB,YAAA5tE,EAAA,WAAAgW,EAAAo2D,UAAAwB,YAAA,QACAD,EAAA33D,EAAAo2D,UAAAwB,aAGA,IAAA8C,GAAAjpB,EAAAl3I,IAAA,UACAqlF,SAAAtF,YAAAogF,KACA16D,EAAAo2D,UAAAuE,UAAAD,GAGAvE,EAAAn2D,EAAAo2D,WAGAp2D,EAAAq3D,cAAA,EACAr3D,EAAAi3D,cAAA,OA+DA9P,gBAAArmE,WAAA,mBAAA,aAAA,SAAA,WAAA,UAAA,WAAA,UAAA,uBAAA,eAAA,SAAAsK,EAAA4U,EAAAyxC,EAAAznD,EAAAsC,EAAAE,EAAA4jE,EAAAC,GA0BA,QAAAjD,GAAAC,GACA,GAAA5iK,GAAA,EACA,KAAA,GAAAhH,KAAA4pK,GACA5iK,GAAA4iK,EAAA5pK,GACAA,EAAAzB,OAAA2lB,KAAA0lJ,GAAA9vK,OAAA,IACAkN,GAAA,IAGA,OAAAA,GAGA,QAAAmwK,GAAA7L,GAIA,IAAA,GAFAxG,GAAA,KAEA9kK,EAAA,EAAAsrK,EAAArN,OAAAj+J,EAAAA,IACA8kK,GAAA,KAMA,QAHA3oE,QAAAtF,YAAAy0E,EAAApN,OAAA,MAAAoN,EAAApN,MAAAoN,EAAApN,KAAA,IACA4G,GAAA,IAAA6E,EAAA2B,EAAAjN,QAEAyG,EAGA,QAAAsS,KACA,GAAAC,GAAArxK,WAAAu2G,EAAA+uD,MAAA+L,YACAC,EAAA/wE,EAAA,OAAAgW,EAAA+uD,MAAAgM,eACAC,EAAAF,EAAAC,EACAE,EAAAj7D,EAAA+uD,MAAAkM,SAAA,EAEAC,EAAAlxE,EAAA,UAAA8wE,EAAA,KAAA,KACAK,EAAAnxE,EAAA,UAAA+wE,EAAA,KAAA,KACAK,EAAApxE,EAAA,UAAAgxE,EAAA,KAAA,IAEAp7E,SAAA9tF,QAAA,mCAAAnV,KAAAu+K,GACAt7E,QAAA9tF,QAAA,4BAAAnW,YAAA,UAEAs/K,GAAAF,EAAA,GAEAn7E,QAAA9tF,QAAA,kCAAAnV,KAAAw+K,GACAv7E,QAAA9tF,QAAA,mBAAAnW,YAAA,UAEAikG,QAAA9tF,QAAA,0CAAAnV,KAAAy+K,GACAx7E,QAAA9tF,QAAA,mCAAAnW,YAAA,UACAikG,QAAA9tF,QAAA,4BAAAlW,SAAA,UAIAgkG,QAAA9tF,QAAA,kCAAA5T,QACA0hG,QAAA9tF,QAAA,mBAAAlW,SAAA,UAEAgkG,QAAA9tF,QAAA,0CAAA5T,QACA0hG,QAAA9tF,QAAA,mCAAAlW,SAAA,UACAgkG,QAAA9tF,QAAA,4BAAAnW,YAAA,SAyZA,QAAA0/K,GAAAJ,EAAAK,GACA,GAAA3/E,GAAAxjG,EAAA,iBAAAsD,KAAA,oBACAszK,EAAA52K,EAAA,iBAAAsD,KAAA,aAEA8/K,EAAAN,EAAAO,cAAA,YAAAx7D,EAAA+uD,MAAArN,OAAA,UACA1hD,GAAA+uD,MAAApN,KAAA,IACA4Z,GAAAv7D,EAAA+uD,MAAApN,KAAA,UAEA4Z,GAAA,WAAAN,EAAA79K,KAGA,IAAAq+K,IACA/gL,MAAAzB,OAAAsF,SAAA4R,KACAszD,UAAAw3G,EAAAS,eACAra,QAAA4Z,EAAAU,YACAroK,KAAAioK,EACAK,YAAA,cAAAjgF,EACAp9F,UACAs9K,QAAA,QACAvoK,KAAAy7J,EACA1F,SACAwS,QAAA,gBACAC,gBAAAngF,IAGAogF,UAAA,SACAC,QACAH,QAAA,QACAvoK,KAAAgoK,EAAAW,kBACA7+K,MAAA69K,EAAA79K,MACA8+K,cAAA,MACAC,aAAA,6BACAC,UAAAnB,EAAAS,eACAn6K,IAAAtI,OAAAsF,SAAA4R,MAIA,OAAAsrK,GAGA,QAAAY,GAAAC,GAEA,IACA,GAAAC,GAAAvwI,KAAAC,MAAA10C,SAAAC,eAAA,kBAAAw6B,WAEAypJ,IAEA,KAAA,GAAAh4K,KAAA64K,GACAA,EAAA74K,GAAA+4K,eAAAF,EAAA74K,GAAA+4K,cAAA1I,WACA2H,EAAA35K,KAAAu5K,EAAAiB,EAAA74K,GAAA+4K,cAAAF,EAAA74K,GAAAg5K,QAEAH,EAAA74K,GAAAi5K,cAAAJ,EAAA74K,GAAAi5K,aAAA5I,WACA2H,EAAA35K,KAAAu5K,EAAAiB,EAAA74K,GAAAi5K,aAAAJ,EAAA74K,GAAAg5K,QAEAH,EAAA74K,GAAAk5K,WAAAL,EAAA74K,GAAAk5K,UAAA7I,WACA2H,EAAA35K,KAAAu5K,EAAAiB,EAAA74K,GAAAk5K,UAAAL,EAAA74K,GAAAg5K,OAMAF,GAAA,GAAAj+B,SACAi+B,EAAA,GAAAj+B,OAAArpI,MAAAwmK,GAGAlkL,SAAAC,eAAA,kBAAAw6B,UAAAga,KAAA+6B,UAAAw1G,GACA,MAAA1hL,GAEA,MADAuU,SAAAvD,KAAA,oCACA,GAIA,QAAAiqK,GAAAlhF,EAAArgE,EAAAwhJ,GAOA,IAAA,GALAlwJ,MAEAmwJ,EAAAv5K,SAAAm4F,GAAAn4F,SAAA83B,GACA0hJ,EAAAxsK,WAAAssK,GAAAC,EAEAvyK,EAAA,EAAAA,EAAAmxF,EAAAnxF,IAAA,CACA,GAAA3I,IACAo7K,OAAA,EACA94K,MAAA64K,EACAhwI,OAAAxiC,EAAA,EAEAoiB,GAAA/jB,KAAAhH,GAGA,IAAA,GAAAsW,GAAA,EAAAA,EAAAmjB,EAAAnjB,IAAA,CACA,GAAAlN,IACAgyK,OAAA,EACA94K,MAAA64K,EACAhwI,OAAA70B,EAAA,EAEAyU,GAAA/jB,KAAAoC,GAGA,MAAA2hB,GAqCA,QAAAswJ,GAAApH,GACA,GAAA6G,GAAAz9K,EAAA,gBAEAc,QAAAo9K,UAAAp9K,OAAAo9K,cACAp9K,OAAAo9K,UAAAv0K,MACAmT,MAAA,eACAqhK,kBAAAvH,EAAAhC,cACAwJ,mBAAAxH,EAAAyH,WACAC,WAAA1H,EAAAvN,KACAkV,iBAAA3H,EAAAA,MACA4H,WAAAf,EAAAn6K,KAAA,oBACAm7K,cAAAhB,EAAAn6K,KAAA,WACAo7K,aAAA9H,EAAArN,OACAoV,eAAA/H,EAAApN,KACAoV,mBAAAhI,EAAA0L,QAAAl9K,OACAy5K,gBAAAjI,EAAAlgI,UACA+tI,YAAAhH,EAAAn6K,KAAA,aACAohL,WACAt4F,QACAu4F,WACAxpK,KAAAsiK,EAAAn6K,KAAA,aACAgF,GAAAsuK,EAAAA,MACA3xK,MAAA2xK,EAAA+L,WACAiC,SAAAnH,EAAAn6K,KAAA,0BAroBA,GAAAsI,IAAA,CAEAuoG,GAAA,WACAlB,EAAA6nE,eAAA,GACAjzD,EAAAvgB,OAAA,WACAugB,EAAA+uD,MAAAiO,WAAA,KAGA,IAEA,IAAAtM,GAAAv4K,EAAA,4CAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,WAGAmlH,EAAAx4K,EAAA,0CAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,WAGAolH,EAAAz4K,EAAA,6CAAAg3D,SACA9zB,QAAA,SACAmwB,UAAA,QA6DA/uC,EAAA,GAAAlN,KACAywG,GAAA+uD,SACA/uD,EAAA+uD,MAAAkK,iBAEAj5D,EAAA6hD,YACA7hD,EAAAswD,YACAC,MAAA,SAAAj9J,KAAA,SAAAmG,UAAA,IACA82J,MAAA,SAAAj9J,KAAA,SAAAmG,UAAA,IAGAumG,EAAA+uD,MAAAuC,OAAAlB,EAAAlC,UAAA,SAAA,UACAluD,EAAA+uD,MAAAlgI,UAAAuhI,EAAAlC,UAAA,SAAA,aACAluD,EAAA+uD,MAAAvN,KAAA4O,EAAAlC,UAAA,SAAA,QACAluD,EAAA+uD,MAAAtN,KAAA2O,EAAAlC,UAAA,SAAA,QACAluD,EAAA+uD,MAAArN,OAAA0O,EAAAlC,UAAA,SAAA,UACAluD,EAAA+uD,MAAApN,KAAAyO,EAAAlC,UAAA,SAAA,QACAluD,EAAA+uD,MAAAjN,MAAAsO,EAAAlC,UAAA,SAAA,SAEAluD,EAAA+uD,MAAAr2J,KAAAknF,QAAA9tF,QAAA,iBAAArW,KAAA,QACAukH,EAAA+uD,MAAAA,MAAAnvE,QAAA9tF,QAAA,iBAAArW,KAAA,SACAukH,EAAA+uD,MAAAuC,OAAA1xE,QAAA9tF,QAAA,iBAAArW,KAAA,UAEA2vG,EAAA+1D,mBAAA,kBACAnhD,EAAA+uD,MAAAI,aAAA/jE,EAAA+1D,mBAAA,kBAGAvhE,QAAAtF,YAAA0lB,EAAA+uD,MAAArN,SAAA,OAAA1hD,EAAA+uD,MAAArN,UACA1hD,EAAA+uD,MAAArN,OAAA,IAGA9hE,QAAAtF,YAAA0lB,EAAA+uD,MAAApN,OAAA,OAAA3hD,EAAA+uD,MAAApN,QACA3hD,EAAA+uD,MAAApN,KAAA,GAGA/hE,QAAA9tF,QAAA,qBAAAvU,SACAyiH,EAAA+uD,MAAAkO,QAAA7M,EAAAlC,UAAA,SAAA,YAGAluD,EAAA6wD,YAAA,WACA,MAAA7wD,GAAA+uD,MAAApN,KAAA,IAAA/hE,QAAAtF,YAAA0lB,EAAA+uD,MAAApN,OAOA3hD,EAAAgxD,eAAA,WACApxE,QAAA9tF,QAAA,eAAAinD,WAAA,SAGAq3G,EAAA/B,cAAAruD,EAAA+uD,MAAAuC,OAAAlmE,EAAAl8B,OAAAylB,QAAAr+D,KAAA,SAAA/T,GAEA,GAAA,GAAAA,EAAA9mB,KAAA8B,OACAqiG,QAAA9tF,QAAA,oBAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,iBAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,gBACA,CACA2jG,QAAA9tF,QAAA,oBAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,eAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,eAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,iBAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,eAAA63B,WAAA,YAEAq2E,EAAAk9D,kBAAA36J,EAAA9mB,IAEA,IAAAs3K,GAAA/oE,EAAA,YAAAgW,EAAAk9D,kBAAA,oBAAAl9D,EAAA+uD,MAAAlgI,UAAA,IAEAkkI,KACA/yD,EAAA+uD,MAAAlgI,UAAAmxE,EAAAk9D,kBAAA,GAAAlL,eAGAhyD,EAAAgzD,gBAAAhzD,EAAA+uD,UAIA/uD,EAAAgzD,gBAAA,SAAA3lK,GACA2yG,EAAA+uD,MAAA1hK,EAEA+iK,EAAA1B,kBAAAtjE,EAAAl8B,OAAAylB,OAAAqrB,EAAA+uD,MAAAr2J,KAAAsnG,EAAA+uD,MAAAlgI,WAAAvY,KAAA,SAAA/T,GAOA,GALA,MAAAA,EAAA+rB,SACA88D,EAAA6nE,aAAA,EACA7jK,QAAAvD,KAAA,0BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,aAGA,IAAApsB,EAAA9mB,KAAA8B,QAAA,MAAAglB,EAAA+rB,OACAsxD,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,iBAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,gBACA,CACA2jG,QAAA9tF,QAAA,eAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,eAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,iBAAA63B,WAAA,YACAi2D,QAAA9tF,QAAA,eAAA63B,WAAA,YAEAq2E,EAAAkzD,kBAAA3wJ,EAAA9mB,KAEAukH,EAAAmzD,QAAAnpE,EAAA,UAAAgW,EAAAkzD,kBAAA,OAEA,IAAAE,GAAAppE,EAAA,YAAAgW,EAAAmzD,QAAA,UAAA12K,SAAAujH,EAAA+uD,MAAAvN,MAEA,IAAA5hE,QAAAtF,YAAA0lB,EAAA+uD,MAAAvN,QAAA4R,EAAA,CACA,GAAAC,GAAArpE,EAAA,YAAAgW,EAAAmzD,QAAA,YAGAE,GACArzD,EAAA+uD,MAAAvN,KAAA,EAEAxhD,EAAA+uD,MAAAvN,KAAAxhD,EAAAmzD,QAAA,GAAA9rG,KAIA+jC,EAAAl8B,OAAAsyF,KAAAxhD,EAAA+uD,MAAAvN,KACA/P,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAujG,EAAAszD,aAAAtzD,EAAA+uD,UAtCAqB,SAwCA,SAAA7tJ,GACAnT,QAAA4T,MAAA,wBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEA0hI,EAAApqC,YAAA1jH,GAEAq9E,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,iBAAA7V,KAAA,WAAA,YACA2jG,QAAA9tF,QAAA,eAAA7V,KAAA,WAAA,eAIA+jH,EAAAszD,aAAA,SAAAjmK,GACA,GAAA,MAAAA,EAAA,CAKA,GAJA2yG,EAAA+uD,MAAA1hK,EAEA2yG,EAAAwzD,QAAAxpE,EAAA,SAAAgW,EAAAkzD,mBAAA7rG,KAAA5qE,SAAAujH,EAAA+uD,MAAAvN,QAEA5hE,QAAAtF,YAAA0lB,EAAA+uD,MAAAtN,MACAzhD,EAAA+uD,MAAAtN,KAAAzhD,EAAAwzD,QAAA,GAAAv7H,SACA,CACA,GAAAw7H,GAAAzzD,EAAA+uD,MAAAtN,IAKA,IAAA,cAAAr2D,EAAA21D,eAAA,CACA,GAAA2S,GAAAtoE,EAAAztC,UAAAqiD,EAAA+uD,MAAAtN,KAAAr2D,EAAA21D,eAAA7kK,cACAu3K,GAAAzpE,EAAA,QAAA0pE,EAAA,cAGA,GAAAjN,GAAAz8D,EAAA,YAAAgW,EAAAwzD,QAAA,YAAAC,EAAA,IACAhN,KACAzmD,EAAA+uD,MAAAtN,KAAAr2D,EAAA05D,eAAA9kD,EAAAwzD,QAAAC,IAIAroE,EAAAl8B,OAAAuyF,KAAAzhD,EAAA+uD,MAAAtN,KACAhQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAujG,EAAA2zD,YAAA3zD,EAAA+uD,MAAAtN,QAIAzhD,EAAA2zD,YAAA,SAAA17H,GACA+nE,EAAA+uD,MAAAtN,KAAAz3D,EAAA,QAAA/xD,EAAAmzD,EAAA21D,gBAEA31D,EAAAl8B,OAAAuyF,KAAAzhD,EAAA+uD,MAAAtN,KACAhQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,IAEA,IAAAg3J,GAAAzzD,EAAA+uD,MAAAtN,IAEA,IAAA,cAAAr2D,EAAA21D,eAAA,CACA,GAAA2S,GAAAtoE,EAAAztC,UAAAqiD,EAAA+uD,MAAAtN,KAAAr2D,EAAA21D,eAAA7kK,cACAu3K,GAAAzpE,EAAA,QAAA0pE,EAAA,cAGA,GAAAE,GAAA5pE,EAAA,UAAAgW,EAAAkzD,mBAAA7rG,KAAA5qE,SAAAujH,EAAA+uD,MAAAvN,MAAAvpH,KAAAw7H,IAAA,GAEAI,EAAAD,EAAA,GAAArB,sBACAsB,IAAA,QAAA7zD,EAAA+uD,MAAAlgI,UAAA,EAAA,EAEAmxE,EAAA+uD,MAAAE,SAAA2E,EAAA,GAAAE,UAEA1oE,EAAAg6D,cAAAplD,EAAAwzD,QAAA,aAAAK,GACA7zD,EAAA+zD,aAAA/zD,EAAA+uD,QAGA/uD,EAAA+zD,aAAA,SAAA1mK,GACA2yG,EAAA+uD,MAAA1hK,GAEAuyF,QAAAtF,YAAA0lB,EAAA+uD,MAAArN,SAAA,OAAA1hD,EAAA+uD,MAAArN,QAAA1hD,EAAA+uD,MAAArN,WACAgP,EAAAvhH,QAAA,QACA6wD,EAAAg0D,eAAAh0D,EAAA+uD,OAEA3jE,EAAAl8B,OAAAwyF,OAAA1hD,EAAA+uD,MAAArN,OACAjQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,MAEAi0J,EAAAvhH,QAAA,SAIA6wD,EAAAg0D,eAAA,SAAA3mK,GACA2yG,EAAA+uD,MAAA1hK,GAEAuyF,QAAAtF,YAAA0lB,EAAA+uD,MAAApN,OAAA,OAAA3hD,EAAA+uD,MAAApN,MAAA3hD,EAAA+uD,MAAApN,SACAgP,EAAAxhH,QAAA,QACA6wD,EAAAi0D,iBAAA7oE,EAAAl8B,QAEAk8B,EAAAl8B,OAAAyyF,KAAA3hD,EAAA+uD,MAAApN,KACAlQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA;IAEAk0J,EAAAxhH,QAAA,SAIAywC,QAAAtF,YAAA0lB,EAAA+uD,MAAAjN,SACA9hD,EAAA+uD,MAAAjN,UAGA9hD,EAAAi0D,iBAAA,SAAA5mK,GACA,GAAA2yG,EAAA+uD,MAAApN,KAAA3hD,EAAA6hD,SAAAtkK,OACA,IAAA,GAAAkG,GAAAu8G,EAAA6hD,SAAAtkK,OAAAkG,EAAAu8G,EAAA+uD,MAAApN,KAAA,EAAAl+J,IACAu8G,EAAA6hD,SAAAvhK,OAAAmD,EAAA,GACAm8F,QAAAtF,YAAA0lB,EAAA+uD,MAAAjN,cACA9hD,GAAA+uD,MAAAjN,MAAAr+J,OAIA,IAAAu8G,EAAA+uD,MAAApN,KAAAv2D,EAAAs1D,YAAA,EACA,IAAA,GAAAj9J,GAAAu8G,EAAA6hD,SAAAtkK,OAAAkG,EAAAu8G,EAAA+uD,MAAApN,KAAAl+J,IACAu8G,EAAA6hD,SAAA//J,MAAA+mK,IAAA,KACAjpE,QAAAtF,YAAA0lB,EAAA+uD,MAAAjN,MAAAr+J,MACAu8G,EAAA+uD,MAAAjN,MAAAr+J,GAAA,EAKAu8G,GAAAw0D,WAAAx0D,EAAA+uD,QAGA/uD,EAAAw0D,WAAA,SAAAnnK,GACA2yG,EAAA+uD,MAAA1hK,EAEAuyF,QAAA9tF,QAAA,qBAAAvU,SACA6tG,EAAAl8B,OAAA+tG,QAAAj9D,EAAA+uD,MAAAkO,QACAxrB,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAGA,IAAAg4J,IAAA,CACA70E,SAAApmG,QAAAwmH,EAAA+uD,MAAAjN,MAAA,SAAA14J,EAAAgM,IACAwqF,QAAAtF,YAAAlxF,IAAA,OAAAA,GAAAA,EAAA,IAAAA,EAAA,KACAqrK,GAAA,KAGAA,GACA7D,EAAAzhH,QAAA,QAEAi8C,EAAAl8B,OAAA4yF,MAAA9hD,EAAA+uD,MAAAjN,MACArQ,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAujG,EAAAyrD,UAAA,IAEAmF,EAAAzhH,QAAA,SAKA6wD,EAAAm9D,aAAA,SAAArJ,EAAAsJ,EAAAjO,EAAA/xK,EAAAigL,EAAApC,GACAj7D,EAAA+uD,MAAAzuI,OAAAwzI,EAAA,IAAAsJ,EACAp9D,EAAA+uD,MAAA+L,WAAA19K,EAGA4iH,EAAA+uD,MAAAgM,cAAAsC,EACAr9D,EAAA+uD,MAAAkM,MAAAA,EAEAJ,IAEA76D,EAAA+uD,MAAA+E,UAAAA,EACA9zD,EAAA+uD,MAAAqO,YAAAA,EACAp9D,EAAA+uD,MAAAI,aAAAA,EAEAnvD,EAAA+uD,MAAA0L,QAAA3E,EAAA91D,EAAA+uD,MAAArN,OAAA1hD,EAAA+uD,MAAApN,KAAA3hD,EAAA+uD,MAAA+L,aAGA96D,EAAAyrD,SAAA,SAAA6R,GAEAA,GAAAv5K,GAEA67F,QAAA9tF,QAAA,4BAAAnW,YAAA,UAGAqkH,EAAA+uD,MAAA4G,YAAAvqE,EAAAg5D,cAAApkD,EAAA+uD,MAAArN,OAAA1hD,EAAA+uD,MAAApN,MACA3hD,EAAA+uD,MAAA4G,cAAA2H,IAAAv5K,IAIAi8G,EAAAi3D,cAAA,EAGA3qE,EAAA,WACA0T,EAAAi3D,cAAA,GACA,MAEA7G,EAAA3E,SAAAzrD,EAAA+uD,MAAA3jE,EAAAl8B,OAAAylB,QAAAr+D,KAAA,SAAA/T,GAqBA,GAnBAy9F,EAAAi3D,cAAA,EAEAj3D,EAAA+uD,MAAAwO,aAAAh7J,EAAA9mB,MAEAmkG,QAAAtF,YAAA0lB,EAAA+uD,MAAAwO,eAAA,OAAAv9D,EAAA+uD,MAAAwO,cAAAv9D,EAAA+uD,MAAAwO,aAAAhgL,OAAA,IAIAyiH,EAAA+uD,MAAAwO,aAAAv9D,EAAA+uD,MAAAwO,aAAAxgL,KAAA,SAAAjC,EAAAkC,GACA,MAAAyM,YAAA3O,EAAA4hL,aAAAt/K,OAAAqM,WAAAzM,EAAA0/K,aAAAt/K,OACA,EACAqM,WAAA3O,EAAA4hL,aAAAt/K,OAAAqM,WAAAzM,EAAA0/K,aAAAt/K,UAEA,KAIA4iH,EAAA+uD,MAAA/B,iBAEAhtD,EAAA+uD,MAAAwO,aAAAhgL,OAAA,EAAA,CACAyiH,EAAA+uD,MAAAyO,qBAAA,GACAx9D,EAAA+uD,MAAA0O,6BAAA,GACAz9D,EAAA+uD,MAAA2O,0BAAA,GAEA19D,EAAA+uD,MAAA4O,oBAAA,GACA39D,EAAA+uD,MAAA6O,4BAAA,GACA59D,EAAA+uD,MAAA8O,yBAAA,GAEA79D,EAAA+uD,MAAA+O,iBAAA,GACA99D,EAAA+uD,MAAAgP,yBAAA,GACA/9D,EAAA+uD,MAAAiP,sBAAA,EAEA,IAAAC,GAAAj+D,EAAA+uD,MAAAwO,aAAA,EA4CA,IA1CAv9D,EAAA+uD,MAAA/B,cAAAl9H,KAAAmuI,EAAAC,eAEAl+D,EAAA+uD,MAAAhC,cAAAkR,EAAAvB,aAAAhB,eACA17D,EAAA+uD,MAAA/B,cAAA+M,uBAAAkE,EAAAE,6BACAn+D,EAAA+uD,MAAA/B,cAAAgN,qBAAAiE,EAAAG,2BACAp+D,EAAA+uD,MAAA/B,cAAAqR,0BAAAJ,EAAAK,gCACAt+D,EAAA+uD,MAAA/B,cAAAuR,8BAAAN,EAAAO,qCACAx+D,EAAA+uD,MAAA/B,cAAAyR,wBAAAR,EAAAS,8BACA1+D,EAAA+uD,MAAA/B,cAAA2R,4BAAAV,EAAAW,mCAEA5+D,EAAA+uD,MAAAyH,WAAAyH,EAAAvB,aAAAf,YACA37D,EAAA+uD,MAAA/B,cAAAkN,oBAAA+D,EAAAY,0BACA7+D,EAAA+uD,MAAA/B,cAAAmN,kBAAA8D,EAAAa,wBACA9+D,EAAA+uD,MAAA/B,cAAA+R,uBAAAd,EAAAe,6BACAh/D,EAAA+uD,MAAA/B,cAAAiS,2BAAAhB,EAAAiB,kCACAl/D,EAAA+uD,MAAA/B,cAAAmS,qBAAAlB,EAAAmB,2BACAp/D,EAAA+uD,MAAA/B,cAAAqS,yBAAApB,EAAAqB,gCAEAt/D,EAAA+uD,MAAA/B,cAAA8M,kBAAA1uE,EAAAg2D,YAAA6c,EAAAE,6BAAAF,EAAAG,4BACAp+D,EAAA+uD,MAAA/B,cAAAiN,eAAA7uE,EAAAg2D,YAAA6c,EAAAY,0BAAAZ,EAAAa,yBAEA9+D,EAAA+uD,MAAAzuI,OAAA29I,EAAAvB,aAAA5I,UAAA,IAAAmK,EAAAxB,MAAAW,YACAp9D,EAAA+uD,MAAA+L,WAAAmD,EAAAvB,aAAAt/K,MACA4iH,EAAA+uD,MAAAgM,cAAAkD,EAAAZ,eACAr9D,EAAA+uD,MAAAkM,MAAAgD,EAAAhD,MAEAj7D,EAAA+uD,MAAA+E,UAAAmK,EAAAvB,aAAA5I,UACA9zD,EAAA+uD,MAAAqO,YAAAa,EAAAxB,MAAAW,YACAp9D,EAAA+uD,MAAAI,aAAA8O,EAAA9O,aAEAnvD,EAAA+uD,MAAAwQ,WAAA3E,EAAA56D,EAAA+uD,OAEA/uD,EAAA+uD,MAAA0L,QAAA3E,EAAA91D,EAAA+uD,MAAArN,OAAA1hD,EAAA+uD,MAAApN,KAAA3hD,EAAA+uD,MAAA+L,YAEAD,IAEAwB,EAAAr8D,EAAA+uD,MAAAwO,cAEApH,EAAAn2D,EAAA+uD,OAEAhrK,GAAA,EAEAqnG,EAAA+1D,mBAAA,UAAA,CACA,GAAAqe,GAAA5/E,QAAA9tF,QAAA,gBACA0tK,GAAA,GAAAhrE,gBAAAnR,MAAA,QAAAo8E,SAAA,YAMAnzE,EAAA,WACA,GAAAjvG,GAAAlF,EAAA,qCAAAsD,KAAA,WACA46F,EAAAuJ,QAAA9tF,QAAA,iDAAA7V,KAAA,OAAAoB,EAEAuiG,SAAAtF,YAAAm3D,EAAAl3I,IAAA,UACA87E,EAAAp6F,KAAA,SAAA,SAGA2jG,SAAA9tF,QAAA,iBAAArW,KAAA,cAEA,OAyGAukH,EAAA+4D,kBAAA,SAAAz5C,EAAAyvC,GAEAzvC,EAAAvjG,iBACAujG,EAAA9iG,iBAEA,IAAAvkB,GAAA,GAEA+gK,EAAA7gL,EAAA,0BAEA8f,IAAA,0BACA,KAAA,GAAAxU,GAAA,EAAAA,EAAAsrK,EAAAkK,cAAA17K,OAAAkG,IACAwU,GAAA,mCAAA82J,EAAAkK,cAAAx1K,GAAA,OAEAwU,IAAA,QAEAA,GAAA+gK,EAAAx+K,MAEA,IAAA0+K,GAAA/gL,EAAA,wBAAAuD,KAAA,cACAw9K,IACAA,EAAAh7K,QAAAF,OAAAia,GAGA9f,EAAA,wBAAAgzD,MAAA,SAGA38B,OAAA8nB,OAAA,WAEA,IAAA,GADAnrC,GAAA4C,UAAA,GACAtK,EAAA,EAAAA,EAAAsK,UAAAxQ,OAAA,EAAAkG,IAAA,CACA,GAAA40J,GAAA,GAAA11J,QAAA,MAAAc,EAAA,MAAA,KACA0H,GAAA9P,SAAA8P,EAAAA,EAAA1M,QAAA45J,EAAAtqJ,UAAAtK,EAAA,IAAA,GAEA,MAAA0H,IAiCA60G,EAAA5sF,OAAA,WACA,GAAA4sF,EAAA0/D,YAAAxxC,OAAA,CAEA,GAAAw/B,GAAA,EACA,KAAA9tE,QAAAtF,YAAA0lB,EAAA+uD,SACArB,EAAA,IAEAtiE,EAAAl8B,OAAAylB,SACA+4E,EAAAA,EAAA,UAAAtiE,EAAAl8B,OAAAylB,QAGAqrB,EAAA+uD,MAAAlgI,YACA6+H,EAAAA,EAAA,cAAA1tD,EAAA+uD,MAAAlgI,WAGAmxE,EAAA+uD,MAAAvN,OACAkM,EAAAA,EAAA,SAAA1tD,EAAA+uD,MAAAvN,MAGAxhD,EAAA+uD,MAAAtN,OACAiM,EAAAA,EAAA,SAAA1tD,EAAA+uD,MAAAtN,MAGAzhD,EAAA+uD,MAAArN,SACAgM,EAAAA,EAAA,WAAA1tD,EAAA+uD,MAAArN,QAGA1hD,EAAA+uD,MAAApN,OACA+L,EAAAA,EAAA,SAAA1tD,EAAA+uD,MAAApN,MAGA3hD,EAAA+uD,MAAAjN,OACAliE,QAAA9F,SAAAkmB,EAAA+uD,MAAAjN,QAAA,CACA,GAAA6L,GAAAP,EAAAptD,EAAA+uD,MAAAjN,MACA,MAAA6L,IACAD,EAAAA,EAAA,UAAAC,GAMAD,GAAA,cAEA,IAAAnsK,IAAAhD,SAAAyvH,SAAA,KAAAzvH,SAAA0xG,KAAA1xG,SAAAylF,UAAAviF,KAAA,GACA+qG,GAAAjuG,SAAA4R,KAAA5O,EAAAmsK,OAMAvG,gBAAArmE,WAAA,oBAAA,aAAA,SAAA,WAAA,UAAA,uBAAA,SAAAsK,EAAA4U,EAAAyxC,EAAAznD,EAAAomE,GACA,GAAA3zJ,GAAA,GAAAlN,KACAywG,GAAAh2G,SAGAohG,EAAA93E,QAAA2pJ,QAAA,EACAxrB,EAAAD,UAAA,UAAApmD,EAAA93E,SAAAk0C,KAAAvuE,OAAAsF,SAAAylF,SAAA5c,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAEAmjF,QAAA9tF,QAAA,uBAAAvU,SACAqiG,QAAAtF,YAAA81E,EAAAlC,UAAA,SAAA,cACA9iE,EAAA93E,QAAA2pJ,QAAA7M,EAAAlC,UAAA,SAAA,WACAzc,EAAAD,UAAA,UAAApmD,EAAA93E,SAAAk0C,KAAAvuE,OAAAsF,SAAAylF,SAAA5c,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,OAKA2uF,EAAA+1D,mBAAA,aACA/1D,EAAA93E,QAAA2pJ,QAAAxgL,SAAA2uG,EAAA+1D,mBAAA,YACA1P,EAAAD,UAAA,UAAApmD,EAAA93E,SAAAk0C,KAAAvuE,OAAAsF,SAAAylF,SAAA5c,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,KAIA,IAAAkjK,GAAAv0E,EAAA93E,QACAssJ,EAAA59K,OAAA2lB,KAAAg4J,GAAAp/K,IAAA,SAAA6U,GACA,OACAA,IAAAA,EACAhM,MAAAu2K,EAAAvqK,KAIA4qG,GAAAh2G,MAAA0uB,MAAA,EAEAknE,QAAApmG,QAAAomL,EAAA,SAAAvyK,EAAAtR,GAGA,WAAAsR,EAAA+H,KAAA,YAAA/H,EAAA+H,KAAA,mBAAA/H,EAAA+H,MAGAwqF,QAAA9F,SAAAzsF,EAAAjE,OACA42G,EAAAh2G,MAAA0uB,OAAA12B,OAAA2lB,KAAAta,EAAAjE,OAAA7L,OAEA8P,EAAAjE,SAAA,GACA42G,EAAAh2G,MAAA0uB,WAIAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UACAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAEAukH,EAAAh2G,MAAA0uB,MAAA,IACAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UACAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,oBAAArW,KAAA,WAGAukH,EAAA+/D,kBAAA,WACA5nL,EAAA,YAAA+yC,YAAA,SAGA80E,EAAAggE,YAAA,WACA7nL,EAAA,YAAA8vC,eAGA+3E,EAAAigE,cAAA,WACAjgE,EAAAh2G,MAAA61K,YAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,QACAukH,EAAAh2G,MAAA0uB,MAAA,EACAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UAEAukH,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UAGAukH,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,SAIAukH,EAAAkgE,oBAAA,WACAlgE,EAAAh2G,MAAA81K,kBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,QACAukH,EAAAh2G,MAAA0uB,MAAA,EACAsnF,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAEAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAGAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,SAIAukH,EAAAmgE,aAAA,WACA/0E,EAAA93E,WACA83E,EAAA93E,QAAAyuI,OAAA,IACA/hD,EAAAogE,cAAAh1E,EAAA93E,UAGA0sF,EAAAogE,cAAA,SAAAC,GACAj1E,EAAA93E,QAAA+sJ,EAEAzgF,QAAA9tF,QAAA,uBAAAvU,SACA6tG,EAAAl8B,OAAA+tG,QAAA7xE,EAAA93E,QAAA2pJ,QACAxrB,EAAAD,UAAA,SAAApmD,EAAAl8B,QAAA1H,KAAA,IAAAJ,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,MAGAmjF,QAAApmG,QAAA6mL,EAAA,SAAAhzK,EAAA+H,GACA,WAAAA,EACAwqF,QAAApmG,QAAA6T,EAAA,SAAAjE,EAAArN,GACAqN,SACAgiG,GAAA93E,QAAAk5I,QAAAzwK,MAIA6jG,QAAA9F,SAAAzsF,IACAuyF,QAAApmG,QAAA6T,EAAA,SAAAjE,EAAArN,GACAqN,SACAgiG,GAAA93E,QAAAle,GAAArZ,KAIAsR,SACA+9F,GAAA93E,QAAAle,KAKA,IAAAuqK,GAAAv0E,EAAA93E,QACAssJ,EAAA59K,OAAA2lB,KAAAg4J,GAAAp/K,IAAA,SAAA6U,GACA,OACAA,IAAAA,EACAhM,MAAAu2K,EAAAvqK,KAIA4qG,GAAAh2G,MAAA0uB,MAAA,EAEAknE,QAAApmG,QAAAomL,EAAA,SAAAvyK,EAAAtR,GAGA,WAAAsR,EAAA+H,KAAA,YAAA/H,EAAA+H,KAAA,mBAAA/H,EAAA+H,MAGAwqF,QAAA9F,SAAAzsF,EAAAjE,OACA42G,EAAAh2G,MAAA0uB,OAAA12B,OAAA2lB,KAAAta,EAAAjE,OAAA7L,OAEA8P,EAAAjE,SAAA,GACA42G,EAAAh2G,MAAA0uB,WAIA+4H,EAAAD,UAAA,UAAApmD,EAAA93E,SAAAk0C,KAAAvuE,OAAAsF,SAAAylF,SAAA5c,QAAAgkC,EAAAwlC,QAAAn0H,EAAA,IAEA,IAAA6nJ,GAAAl5D,EAAAi5D,iBAAAj5D,EAAA93E,QAAAyuI,OAGA/hD,GAAAo2D,UAAAkE,gBAAAtwE,EAAA,gBAAAgW,EAAAo2D,UAAA/J,QAAAjhE,EAAA93E,SACA0sF,EAAAo2D,UAAAkE,gBAAAtwE,EAAA,WAAAgW,EAAAo2D,UAAAkE,gBAAAhW,GAEAtkD,EAAAo2D,UAAAmE,mBAAAv6D,EAAAo2D,UAAA/J,QAAAl4J,OAAA,SAAA9G,GACA,OAAA2yG,EAAAo2D,UAAAkE,gBAAAE,SAAAntK,SAOA85J,gBAAArmE,WAAA,4BAAA,aAAA,SAAA,WAAA,eAAA,SAAAsK,EAAA4U,EAAA1T,EAAAg0E,GAEAtgE,EAAAjoB,UACAioB,EAAA/hC,SAAA,CAEA,IAAAv7B,GAAA,CAEAs9D,GAAAnlB,OAAA,uBAAA,SAAA+pB,EAAAG,GAEA,GAAAuqD,GAAAlkE,EAAA07D,cAEA,OAAAwI,GAAAA,EAAA/xK,OAAA,EACA+iL,EAAAzR,UAAAS,EAAAh6I,UAAA7zB,KAAA,KAAAihD,GAAApsB,KAAA,SAAA/T,GACAy9F,EAAA/hC,SAAA,EACA+hC,EAAAjoB,OAAAx1E,EAAA9mB,KAEA6wG,EAAA,WACA0T,EAAA/hC,SAAA,GACA,OAIA+hC,EAAAjoB,YAKAioB,EAAAugE,YAAA,SAAA5T,EAAA6T,GACA,GAAA7T,GAAAljK,WAAAkjK,EACAA,GAAA,IACAA,EAAA,EAOA,KAAA,GAJA8T,GAAAhkL,SAAAkwK,GACA6T,EAAA,MAAAA,GAAA,IAAAA,EAAAA,EAAA,UAEAr1K,EAAA,GACA1H,EAAA,EAAAA,EAAAg9K,EAAAh9K,IACA0H,GAAA,gBAAAq1K,EAAA,UAEA,OAAAr1K,IAGA60G,EAAA0gE,YAAA,SAAAC,EAAA1lL,EAAAC,GACA,GAAA0lL,GAAAD,CACA,OAAAC,GAAAh4K,UAAA,EAAAg4K,EAAArlL,QAAA,MAAA,oBAAAN,EAAA,WAAAC,EAAA,iBC/gEA,IAAA2lL,KAAAjhF,QAAA5gG,OAAA,oBAEA6hL,KAAA//E,WAAA,wBAAA,SAAA,aAAA,UAAA,WAAA,WAAA,uBAAA,eAAA,SAAAkf,EAAA5U,EAAApB,EAAAsC,EAAAmlD,EAAA2e,EAAAyF,GAuIA,QAAAiL,GAAApuI,GACA,GAAAg7H,GAAA,EA4BA,OA1BA9tE,SAAAtF,YAAA5nD,KACAg7H,EAAA,IAEAA,GAAA,gBAEAh7H,EAAA7D,YACA6+H,EAAAA,EAAA,cAAAh7H,EAAA7D,WAGA6D,EAAA20B,OACAqmG,EAAAA,EAAA,SAAAh7H,EAAA20B,MAGA30B,EAAAuF,OACAy1H,EAAAA,EAAA,SAAA1jE,EAAA,QAAAt3D,EAAAuF,KAAAmzD,EAAA21D,iBAGAruH,EAAAkiD,SACA84E,EAAAA,EAAA,WAAAh7H,EAAAkiD,QAGAliD,EAAAne,WACAm5I,EAAAA,EAAA,SAAAh7H,EAAAne,WAIAm5I,EAGA,QAAAqT,GAAA33K,GACA,GAAAgM,GAAA,GACAqX,EAAA,CAEA,QAAArjB,GACA,IAAA,WACAgM,EAAA,OACAqX,EAAA,CACA,MACA,KAAA,YACArX,EAAA,UACAqX,EAAA,CACA,MACA,KAAA,YACArX,EAAA,OACAqX,EAAA,CACA,MACA,KAAA,YACArX,EAAA,OACAqX,EAAA,CACA,MACA,KAAA,mBACArX,EAAA,QACAqX,EAAA,CACA,MACA,KAAA,gBACArX,EAAA,eACAqX,EAAA,EAIA,OAAArX,EAAAqX,GAGA,QAAAi0J,GAAAC,EAAA1lL,EAAAC,EAAAo7C,GACA,GAAAsqI,GAAAD,CACA,OAAAC,GAAAh4K,UAAA,EAAAg4K,EAAArlL,QAAA,MAAA,WAAA+6C,EAAA,oBAAAr7C,EAAA,WAAAC,EAAA,cAzMA,GAAA8lL,GAAAxlL,IACAwlL,GAAA/iG,SAAA,EACA+iG,EAAAvgK,UAAA,EAGA6rF,EAAA,WACA00E,EAAAvgK,UAAA,GACA,MAEAugK,EAAAN,YAAAA,EAEA1gE,EAAAh9F,OAAA,EACAg9F,EAAAo2D,aACAp2D,EAAAihE,kBAEAjhE,EAAA45D,gBAEA,IAAAc,GAAAjpB,EAAAl3I,IAAA,UACAqlF,SAAAtF,YAAAogF,KACA16D,EAAAo2D,UAAAuE,UAAAD,GAGAtK,EAAAhB,sBAAA94I,KAAA,SAAA/T,GAEA,IAAAq9E,QAAAtF,YAAA/3E,EAAA9mB,OAAA8mB,EAAA9mB,KAAA8B,OAAA,EAAA,CACAyiH,EAAAihE,eAAAjE,WAAA,EACAh9D,EAAAihE,eAAA5U,QAAA9pJ,EAAA9mB,IAGA,IAAAmnK,GAAA54D,EAAA,UAAAgW,EAAAihE,eAAA5U,QAAA,cACAzJ,GAAAA,EAAAriK,IAAA,SAAAC,GAEA,GAAAosK,GAAApsK,EAAAosK,MAEAsU,EAAAH,EAAAnU,EAAAxjK,OACAgM,EAAA8rK,EAAA,EACA,OAAA,KAAA9rK,EACA,MAIAhM,MAAAwjK,EAAAxjK,MACAkK,KAAAs5J,EAAArmB,MACAnxI,IAAAA,EACArY,KAAAmkL,EAAA,MAKAte,EAAAA,EAAAzuJ,OAAAsuE,SAEAmgF,IAEAA,EAAAA,EAAA7lK,KAAA,SAAAjC,EAAAkC,GACA,MAAAlC,GAAAiC,KAAAC,EAAAD,KAAA,OAKA,IAAA4lE,GAAAqnC,EAAA,UAAAgW,EAAAihE,eAAA5U,QAAA,gBACA1pG,GAAAqnC,EAAA,WAAArnC,EAAA,iBACAA,EAAAA,EAAApiE,IAAA,SAAAC,GACA,OACA4I,MAAA5I,EAAAusK,cACAoU,OAAA3gL,EAAA2gL,OACA7tK,KAAA02F,EAAA,QAAAxpG,EAAAusK,cAAA3hE,EAAA21D,gBACA3rJ,IAAA40F,EAAA,QAAAxpG,EAAAusK,cAAA3hE,EAAA21D,kBAKA,IAAAv/I,GAAAwoF,EAAA,UAAAgW,EAAAihE,eAAA5U,QAAA,+BACA7qJ,GAAAwoF,EAAA,WAAAxoF,EAAA,sBACAA,EAAAA,EAAAjhB,IAAA,SAAAC,GACA,OACAsvC,KAAAtvC,EAAAwsK,cAAAC,eACA35J,KAAA9S,EAAAwsK,cAAAoU,UAAA,GAAA5gL,EAAAwsK,cAAAl9H,KAAA,IAAAtvC,EAAAwsK,cAAAqR,0BAAA,MAKA,IAAAzZ,GAAA56D,EAAA,UAAAgW,EAAAihE,eAAA5U,QAAA,kBACAzH,GAAAA,EAAArkK,IAAA,SAAAC,GACA,OACAsvC,KAAAtvC,EAAA0sK,gBACA55J,KAAA9S,EAAA6gL,mBAIArhE,EAAA45D,cAAAhX,OAAAA,EACA5iD,EAAA45D,cAAAj3G,MAAAA,EACAq9C,EAAA45D,cAAAp4J,WAAAA,EACAw+F,EAAA45D,cAAAhV,aAAAA,EAEAhlE,QAAApmG,QAAAwmH,EAAAihE,eAAA5U,QAAA,SAAAiV,GAEA,GAAAC,IACA1yI,UAAAyyI,EAAAtU,cAAAC,eACA5lG,KAAAi6G,EAAAnP,aACAl6H,KAAAqpI,EAAAvU,cACAn4E,OAAA0sF,EAAA1sF,OACArgE,SAAA+sJ,EAAA/sJ,SAGA+sJ,GAAA//K,IAAA+/K,EAAA//K,IAAAu/K,EAAAS,KAGAvhE,EAAA1sF,QAAA83E,EAAAm5D,qCAEA,IAAAD,GAAAl5D,EAAAi5D,iBAAArkD,EAAA1sF,QAAAyuI,OAGA/hD,GAAAihE,eAAA3G,gBAAAtwE,EAAA,gBAAAgW,EAAAihE,eAAA5U,QAAArsD,EAAA1sF,SACA0sF,EAAAihE,eAAA3G,gBAAAtwE,EAAA,WAAAgW,EAAAihE,eAAA3G,gBAAAhW,OAGAtkD,GAAAihE,eAAAjE,WAAA,CAGA1wE,GAAA,WACA00E,EAAA/iG,SAAA,EACA+iG,EAAAvgK,UAAA,GACA,MAEA,SAAAhlB,GACAukH,EAAAh9F,OAAA,EAEAspF,EAAA,WACA00E,EAAA/iG,SAAA,EACA+iG,EAAAvgK,UAAA,GACA,SCtIA,IAAAogK,KAAAjhF,QAAA5gG,OAAA,oBAEA6hL,KAAA//E,WAAA,8BAAA,aAAA,SAAA,WAAA,UAAA,eAAA,SAAAsK,EAAA4U,EAAAyxC,EAAAznD,EAAA6rE,GAEA,GAAAtmK,KACAywG,GAAAh2G,SACAg2G,EAAA1sF,QAAA83E,EAAAm5D,qCAEA,IAAAob,GAAA3/D,EAAA1sF,QACAssJ,EAAA59K,OAAA2lB,KAAAg4J,GAAAp/K,IAAA,SAAA6U,GACA,OACAA,IAAAA,EACAhM,MAAAu2K,EAAAvqK,KAIA4qG,GAAAh2G,MAAA0uB,MAAA,EAEAknE,QAAApmG,QAAAomL,EAAA,SAAAvyK,EAAAtR,GAGA,WAAAsR,EAAA+H,MAGAwqF,QAAA9F,SAAAzsF,EAAAjE,OACA42G,EAAAh2G,MAAA0uB,OAAA12B,OAAA2lB,KAAAta,EAAAjE,OAAA7L,OAEA8P,EAAAjE,SAAA,GACA42G,EAAAh2G,MAAA0uB,WAIAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UACAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAEAukH,EAAAh2G,MAAA0uB,MAAA,IACAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UACAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,oBAAArW,KAAA,WAGAukH,EAAA+/D,kBAAA,WACA5nL,EAAA,YAAA+yC,YAAA,SAGA80E,EAAAggE,YAAA,WACA7nL,EAAA,YAAA8vC,eAGA+3E,EAAAigE,cAAA,WACAjgE,EAAAh2G,MAAA61K,YAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,QACAukH,EAAAh2G,MAAA0uB,MAAA,EACAsnF,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UAEAukH,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,UAGAukH,EAAAh2G,MAAA61K,WAAAjgF,QAAA9tF,QAAA,oBAAArW,KAAA,SAIAukH,EAAAkgE,oBAAA,WACAlgE,EAAAh2G,MAAA81K,kBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,QACAukH,EAAAh2G,MAAA0uB,MAAA,EACAsnF,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAEAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,UAGAukH,EAAAh2G,MAAA81K,iBAAAlgF,QAAA9tF,QAAA,2BAAArW,KAAA,SAIAukH,EAAAmgE,aAAA,WACAngE,EAAA1sF,WACA0sF,EAAA1sF,QAAAyuI,OAAA,IACA/hD,EAAAogE,cAAApgE,EAAA1sF,QAAA,UAGA0sF,EAAAogE,cAAA,SAAAC,EAAAjrK,GACA4qG,EAAA1sF,QAAA+sJ,EAEAzgF,QAAApmG,QAAA6mL,EAAA,SAAAhzK,EAAA+H,GACAwqF,QAAA9F,SAAAzsF,IACAuyF,QAAApmG,QAAA6T,EAAA,SAAAjE,EAAArN,GACAqN,SACA42G,GAAA1sF,QAAAle,GAAArZ,KAIAsR,SACA2yG,GAAA1sF,QAAAle,IAIA,IAAAuqK,GAAA3/D,EAAA1sF,QACAssJ,EAAA59K,OAAA2lB,KAAAg4J,GAAAp/K,IAAA,SAAA6U,GACA,OACAA,IAAAA,EACAhM,MAAAu2K,EAAAvqK,KAIA4qG,GAAAh2G,MAAA0uB,MAAA,EAEAknE,QAAApmG,QAAAomL,EAAA,SAAAvyK,EAAAtR,GAGA,WAAAsR,EAAA+H,MAGAwqF,QAAA9F,SAAAzsF,EAAAjE,OACA42G,EAAAh2G,MAAA0uB,OAAA12B,OAAA2lB,KAAAta,EAAAjE,OAAA7L,OAEA8P,EAAAjE,SAAA,GACA42G,EAAAh2G,MAAA0uB,UAIA,IAAA4rI,GAAAl5D,EAAAi5D,iBAAArkD,EAAA1sF,QAAAyuI,OAGA/hD,GAAAihE,eAAA3G,gBAAAtwE,EAAA,gBAAAgW,EAAAihE,eAAA5U,QAAArsD,EAAA1sF,SACA0sF,EAAAihE,eAAA3G,gBAAAtwE,EAAA,WAAAgW,EAAAihE,eAAA3G,gBAAAhW,MC1HA,IAAAuc,KAAAjhF,QAAA5gG,OAAA,oBAEA6hL,KAAA5+E,SAAAngG,KAAA,kBACA++K,IAAA5+E,SAAAngG,KAAA,mBAEA++K,IAAA//E,WAAA,wBAAA,SAAA,aAAA,WAAA,UAAA,KAAA,OAAA,kBAAA,eAAA,gBAAA,eAAA,SAAAkf,EAAA5U,EAAAkB,EAAAtC,EAAAsB,EAAAI,EAAA81E,EAAA3L,EAAA4L,EAAApR,GA6DA,QAAAtsK,KAEA,GAAA2kK,GAAA,KACAf,EAAA,KACA+Z,EAAA,IAuBA,IArBA7L,EAAA1U,mBAAA,aACAuH,EAAAmN,EAAA1U,mBAAA,YAEA0U,EAAA1U,mBAAA,cACAuH,EAAAmN,EAAA1U,mBAAA,aAGA0U,EAAA1U,mBAAA,aACAwG,EAAAkO,EAAA1U,mBAAA,YAEA0U,EAAA1U,mBAAA,cACAwG,EAAAkO,EAAA1U,mBAAA,aAGA0U,EAAA1U,mBAAA,eACAugB,EAAA7L,EAAA1U,mBAAA,cAEA0U,EAAA1U,mBAAA,gBACAugB,EAAA7L,EAAA1U,mBAAA,gBAGAuH,GAAAgZ,IAAA/Z,EAAA,CACA,GAAAga,GAAAjZ,CACAgZ,KACAC,EAAAD,GAGA5Z,EAAA6Z,EAAAha,OAEA,CACA,GAAAia,GAAAH,EAAA5R,cAAA,YAEA,IAAAjwE,QAAAtF,YAAAsnF,IAAA,OAAAA,EAWAZ,EAAA/iG,SAAA,EACA+iG,EAAAa,WAAA,MAXA,KACAD,EAAAnhL,IAAAmhL,EAAAja,SACAG,EAAA8Z,EAAAnhL,GAAAmhL,EAAAja,SAGA,MAAA1wJ,GACA+pK,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,IASA,QAAA6pF,GAAA6Z,EAAAha,GAEA6Z,EAAA1Z,SAAA6Z,EAAAha,GAAArxI,KAAA,SAAA/T,GAEA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,IAAA,MAAA8mB,EAAA+rB,OACAl/B,QAAAvD,KAAA,2BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YACAqyI,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA3H,cAAA92J,EAAAosB,WAEAqyI,EAAAa,WAAA,MAEA,IAAA,YAAApmL,EAAAqmL,aAAA5lL,cACA8kL,EAAAh+J,OAAA,EACAg+J,EAAA3H,cAAA92J,EAAAosB,WACAqyI,EAAA9J,UAAA,iBAEA8J,EAAAa,WAAA,MACA,CAGAb,EAAAt7I,MAAA/O,EAAAl7B,GACAulL,EAAAt7I,MAAAq8I,EAAAtmL,GACAulL,EAAAgB,WAAAhB,EAAAt7I,MAAAslI,aAEAprE,QAAApmG,QAAAwnL,EAAAt7I,MAAAu8I,aAAA,SAAAC,GACAA,EAAAC,qBACAD,EAAAE,SAAAp4E,EAAA,WAAAk4E,EAAAE,SAAA,YAAA,GAEAF,EAAAnM,WAAAmM,EAAAG,4BAEAH,EAAApZ,WAIAoZ,EAAApZ,UAAA,GAAAv5J,MAAA2yK,EAAApZ,WACAoZ,EAAAI,cAAA,IAJAJ,EAAAI,cAAA,EACAtB,EAAAuB,+BAAA,GAMA3iF,QAAApmG,QAAA0oL,EAAAE,SAAA,SAAAn/E,GAEA,GAAAu/E,GAAAN,EAAAC,kBAAA5hL,IAAA,SAAA4nE,GACA,MAAAA,GAAAs6G,mBACAlnL,QAAA0nG,EAAAw/E,iBACAD,SACAN,EAAAC,kBAAArgL,KAAAmhG,EAIA,IAAAy/E,GAAA1B,EAAA2B,kBAAApiL,IAAA,SAAA4nE,GACA,MAAAA,GAAAs6G,mBACAlnL,QAAA0nG,EAAAw/E,iBACAC,SACA1B,EAAA2B,kBAAA7gL,KAAAmhG,KAKAi/E,EAAAC,kBAAAn4E,EAAA,WAAAk4E,EAAAC,kBAAA,wBAIAnB,EAAA2B,kBAAA34E,EAAA,WAAAg3E,EAAA2B,kBAAA,qBAGA,IAAAC,GAAA54E,EAAA,UAAAg3E,EAAA2B,mBAAAE,WAAA,IAAA,GAAA,EAEAD,KACA5B,EAAA8B,qBAAAF,EAAAH,iBACA/W,KAGA1B,EAAAvuK,EAAAgF,GAAAhF,EAAAyvK,SAEA,IAAA79J,IACA5M,GAAAkhL,EACAha,QAAAA,EACAob,UAAA/B,EAAAt7I,MAAA0kI,SAAAC,WAGAoX,GAAA9R,cAAA,YAAAtiK,GAEA2zK,EAAAa,WAAA,EAEAmB,EAAAhC,EAAAt7I,OAGAs7I,EAAA/iG,SAAA,IAvFAujG,SAyFA,SAAAj/J,GACAnT,QAAA4T,MAAA,yBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEA0hI,EAAApqC,YAAA1jH,GAEAy+J,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA/iG,SAAA,IAIA,QAAA+rF,GAAAtB,EAAAf,GACA6Z,EAAAxX,YAAAtB,EAAAf,GAAArxI,KAAA,SAAA/T,GAEA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,OAAA8mB,EAAA+rB,QACAl/B,QAAAvD,KAAA,4BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YAGAqyI,EAAAiC,SAAAxnL,EAEAulL,EAAAkC,iBAAA,IAVA1B,SAYA,SAAAj/J,GACAnT,QAAA4T,MAAA,0BAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEAqyI,EAAAmC,sBAAA,EACAnC,EAAAkC,iBAAA,IAIA,QAAAnB,GAAAr8I,GAUA,MANAk6D,SAAApmG,QAAAksC,EAAAu8I,aAAA,SAAA50K,GACAuyF,QAAApmG,QAAA6T,EAAA+0K,SAAA,SAAAh5K,EAAAgM,GACAhM,EAAAg6K,OAAAh6K,EAAAqQ,SAAA,MAIAisB,EAGA,QAAA29I,GAAAC,GAEA,GAAA,IAAAA,EAAA/lL,OAAA,CAIA,GAAAgmL,GAAAD,EAAAnvK,OAAA,SAAA9G,GACA,MAAA,IAAAA,EAAAoM,UAAA,GAAApM,EAAAm2K,WAIAC,EAAAz5E,EAAA,SAAAu5E,GAAAC,SAAA,IAGAE,EAAA15E,EAAA,SAAAu5E,GAAA9pK,SAAA,IAGAD,EAAAkqK,EAAA,IAAAD,EAAA,EAEAjqK,IAEA8pK,EAAA,GAAAK,mBAAA,EACAL,EAAA,GAAAM,cAAApqK,EAAAqqK,gBAEAjkF,QAAApmG,QAAA8pL,EAAA,SAAAj2K,GACAA,EAAAy2K,gBAAAtqK,EAAAuqK,iBACA12K,EAAAmlB,SAAA/oB,WAAA4D,EAAA22K,eAAAv6K,WAAA+P,EAAAwqK,mBAKAV,EAAA,GAAAK,mBAAA,EACAL,EAAA,GAAAM,cAAA,IAIAN,EAAA,GAAAW,kBAAAR,EAAAlmL,OAAA,EAGA+lL,EAAA,GAAAY,kBAAAZ,EAAA,GAAAK,mBAGA,QAAAQ,GAAAzb,EAAAwZ,EAAAtY,EAAAC,EAAAuZ,GACApC,EAAAoD,oBAAA,CAEA,IAAA3oL,IAEAitK,QAAAA,EACAC,cAAAuZ,EAAAmC,eACAza,eAAAA,EACAC,eAAAA,EAGA,IAAAuZ,KAAA,GAAA3nL,EAAAktK,eAAAltK,EAAAouK,eACA,CAEA,GAAAya,GAAApC,EAAAE,aACAmC,EAAAD,EAAAnwK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAAA,GAAAv8J,EAAAoM,WACA,GAGA+qK,EAAAF,EAAAnwK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAAAv8J,EAAA02K,mBAAAtnL,SAAAotK,KACA,EAGA2a,KACAA,EAAA/qK,SAAA,EAGA,IAAAgrK,IACA/b,QAAAA,EACAzlE,QAAAuhF,EACAtC,aACAmC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,YAIAx0J,GACA+yE,SACAw/E,iBAAAhmL,SAAAmtK,GACAma,iBAAAtnL,SAAAotK,IAEAqY,aACAmC,eAAAnC,EAAAmC,iBAKA5sK,EAAAuyF,EAAA,UAAAg3E,EAAA2D,mBAAAz0J,GAAA,GAAA,GAGA00J,EAAA56E,EAAA,UAAAg3E,EAAA6D,gBAAA30J,GAAA,GAAA,GAEA40J,GACApc,QAAAjtK,EAAAitK,QACA6b,YAAAA,EACAthF,QAAAwhF,EAAAxhF,QACAi/E,aACAmC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,aAKAE,GAAAE,EAAA7hF,SAEAxrF,IAEAupK,EAAA2D,mBAAAI,EAAA/D,EAAA2D,mBAAAltK,IAGAupK,EAAA6D,gBAAA/iL,KAAAgjL,IAGAA,EAAA7hF,SAEArD,QAAApmG,QAAAwnL,EAAA6D,gBAAA,SAAAx3K,GACAA,EAAAq7J,UAAAoc,EAAApc,SACAr7J,EAAA60K,YAAAmC,iBAAAS,EAAA5C,YAAAmC,gBACAh3K,EAAA41F,QAAAw/E,mBAAAqC,EAAA7hF,QAAAw/E,mBACAp1K,EAAA41F,QAAA6hF,EAAA7hF,eAMA,IAAAmgF,KAAA,EACA,CACA,GAAA4B,GAAA9C,EAAAE,SAAAjuK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAIAob,IAAAA,EAAAznL,OAAA,GAAAs4K,EAAA9F,kBAAAiV,EAAA,GAAAlB,mBACAkB,EAAA,GAAAlB,gBAAA,GAIA,IAAAmB,IACAhiF,SACAw/E,iBAAAhmL,SAAAmtK,GACAma,iBAAAtnL,SAAAotK,IAEAqY,aACAmC,eAAAnC,EAAAmC,iBAKAa,EAAAl7E,EAAA,UAAAg3E,EAAA2D,mBAAAM,GAAA,GAAA,EACAC,KACAlE,EAAA2D,mBAAAI,EAAA/D,EAAA2D,mBAAAO,GAIA,IAAAC,IACAliF,SACAw/E,iBAAAhmL,SAAAmtK,GACAma,iBAAAtnL,SAAAotK,GACApwJ,SAAA,GAEAyoK,aACAmC,eAAAnC,EAAAmC,iBAKAe,EAAAp7E,EAAA,UAAAg3E,EAAA6D,gBAAAM,GAAA,GAAA,EACAC,KACApE,EAAA6D,gBAAAE,EAAA/D,EAAA6D,gBAAAO,IAIA,GAAAC,GAAArE,EAAA2D,mBAAAluK,OAAAuqK,EAAA6D,gBAGA7D,GAAAt7I,MAAAslI,aAAAsa,EAAAD,GAIA,QAAAE,GAAA3b,EAAAwY,EAAAh8I,GAEAg8I,EAAA,GAAA0B,gBAAA,GAGA,QAAA0B,GAAA9c,EAAAwZ,EAAAj/E,EAAA2mE,EAAAC,GAGA,GAFAmX,EAAAoD,oBAAA,EAEAnhF,EAAA,CAEA,GAAAA,EAAAzwE,SACA,MAEA,IAAA,GAAAywE,EAAAxpF,SAAA,CACA,GAAAgsK,IACA/c,QAAAA,EACAzlE,QAAAA,EACAi/E,aACAmC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,WAIA1D,GAAA2D,mBAAA7iL,KAAA2jL,OAIA,CACA,GAAAl9D,IACAtlB,SACAw/E,iBAAAx/E,EAAAw/E,kBAEAP,aACAmC,eAAAnC,EAAAmC,iBAIAqB,EAAA17E,EAAA,UAAAg3E,EAAA2D,mBAAAp8D,GAAA,GAAA,EACAm9D,KACA1E,EAAA2D,mBAAAI,EAAA/D,EAAA2D,mBAAAe,SAIA,CAIA,GAAApB,GAAApC,EAAAE,aACAmC,EAAAD,EAAAnwK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAAA,GAAAv8J,EAAAoM,WACA,GAGA+qK,EAAAF,EAAAnwK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAAAv8J,EAAA02K,mBAAAtnL,SAAAotK,KACA,EAEA,KAAA2a,EACA,MAIAA,KACAA,EAAA/qK,SAAA,EAGA,IAAAgrK,IACA/b,QAAAA,EACAzlE,QAAAuhF,EACAtC,aACAmC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,YAIAiB,GACA1iF,SACAw/E,iBAAAhmL,SAAAmtK,IAEAsY,aACAmC,eAAAI,EAAAvC,YAAAmC,iBAKA5sK,EAAAuyF,EAAA,UAAAg3E,EAAA2D,mBAAAgB,GAAA,GAAA,EAGA,IAAAluK,GAAA8sK,EAGA,CAEA,GAAAO,IACApc,QAAAA,EACA6b,YAAAA,EACAthF,QAAAwhF,EAAAxhF,QACAi/E,aACAmC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,YAIAkB,GACA3iF,SACAw/E,iBAAAhmL,SAAAmtK,IAEAsY,aACAmC,eAAAnC,EAAAmC,iBAKAO,EAAA56E,EAAA,UAAAg3E,EAAA6D,gBAAAe,GAAA,GAAA,IAGAhB,GAAAE,EAAA7hF,QAGAxrF,EAEAmoF,QAAApmG,QAAAwnL,EAAA2D,mBAAA,SAAAt3K,GACAA,EAAAq7J,UAAAoc,EAAApc,SACAr7J,EAAA60K,YAAAmC,iBAAAS,EAAA5C,YAAAmC,gBACAh3K,EAAA41F,QAAAw/E,mBAAAqC,EAAA7hF,QAAAw/E,mBACAp1K,EAAA41F,QAAA6hF,EAAA7hF,WAIA+9E,EAAA6D,gBAAA/iL,KAAAgjL,GAIAA,EAAA7hF,SAEArD,QAAApmG,QAAAwnL,EAAA6D,gBAAA,SAAAx3K,GACAA,EAAAq7J,UAAAoc,EAAApc,SACAr7J,EAAA60K,YAAAmC,iBAAAS,EAAA5C,YAAAmC,gBACAh3K,EAAA41F,QAAAw/E,mBAAAqC,EAAA7hF,QAAAw/E,mBACAp1K,EAAA41F,QAAA6hF,EAAA7hF,eAlDA+9E,GAAA2D,mBAAA7iL,KAAA2iL,EA0DA,IAAAoB,GAAA77E,EAAA,UAAAk4E,EAAAC,mBAAAM,iBAAA7Y,IAAA,GAAA,EACAsY,GAAAC,kBAAA4C,EAAA7C,EAAAC,kBAAA0D,GACA3D,EAAAC,kBAAArgL,KAAA0iL,GACAtC,EAAAC,kBAAAn4E,EAAA,WAAAk4E,EAAAC,kBAAA,qBAEA,IAAA6C,GAAAV,EAAAnwK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,IAGAhqE,SAAApmG,QAAAwrL,EAAA,SAAA33K,GACAA,EAAAy2K,gBAAAja,EACAx8J,EAAAoM,SAAAowJ,IAAAx8J,EAAA02K,iBAAA,EAAA,GAGA,IAAA+B,GAAAd,EAAA7wK,OAAA,SAAA9G,GACA,MAAAA,GAAA02K,mBAAAtnL,SAAAotK,KACA,EAEAic,IACAC,EAAAf,EAAAc,GAIA,GAAAT,GAAArE,EAAA2D,mBAAAluK,OAAAuqK,EAAA6D,gBAEA7D,GAAAt7I,MAAAslI,aAAAsa,EAAAD,GAEAnD,EAAAnM,WAAAiQ,EAAA9D,GAGA,QAAA+D,GAAAvd,EAAAwZ,EAAAtY,EAAAwY,EAAAvY,EAAAC,GACA,GAAA8X,GAAAH,EAAA5R,cAAA,eAIAnH,QAAAA,EACAuC,QAAA2W,EAAA3W,QACAtC,cAAAuZ,EAAAmC,eACAza,eAAAA,EACAC,eAAAA,EACAC,SAAAA,GAGAkX,GAAAkF,iBAAA,EAGA,QAAAC,GAAAlnJ,GAEA,GAAAsS,GAAAtS,EAAAsS,SAAA6xG,YACAjwH,EAAA8L,EAAA9L,SAAAiwH,WAEA,KAAAnkH,EAAAkvG,SAAA,CAIA,GAAA9gI,IACA5M,GAAA8wC,EACAo2H,QAAAx0I,EAGA20I,GAAAz6J,EAAA5M,GAAA4M,EAAAs6J,UAGA,QAAAye,GAAAnnJ,GAEA,GAAAA,EAAAkvG,SAAA,CAEA,GAAAk4C,GAAAzmF,QAAA9tF,QAAA,cAAAmtB,EAAAuuG,MAAA,MAAA9xI,KAAA,4BAKA,aAJA2qL,GACAA,EAAAj0J,SAMA4uJ,EAAA/iG,SAAA,CAIA,KAAA,GAFAqoG,MAEA7/I,EAAA,EAAAA,EAAAu6I,EAAAt7I,MAAAu8I,aAAA1kL,OAAAkpC,IAAA,CACA,GAAAy7I,GAAAlB,EAAAt7I,MAAAu8I,aAAAx7I,GAEA8/I,EAAArE,EAAAsE,uBAAAtE,EAAAuE,oBAAA,KAEAC,GAEArC,eAAAnC,EAAAmC,eACAK,UAAAxC,EAAAwC,UACA9b,OAAAsZ,EAAAtZ,OACAC,IAAAqZ,EAAArZ,IACA8d,eAAAlqL,SAAAylL,EAAA0E,kBAAA,KAGA,IAAAF,EAAAC,iBAAAJ,EACA,CACA,GAAAM,GAAAv7E,EAAA3yE,OAEA6oJ,GAAA/Y,kBAAAuY,EAAAt7I,MAAAjlC,GAAAimL,EAAArC,eAAAqC,EAAAhC,UAAAgC,EAAA9d,OAAA8d,EAAA7d,IAAA,GAAAmY,EAAAt7I,MAAAwlI,SAAAwb,EAAAC,gBAAArwJ,KAAA,SAAA/T,GACAskK,EAAAlwJ,QAAApU,EAAA9mB,OACA,SAAAunB,GACA6jK,EAAAjwJ,OAAA5T,KAGAsjK,EAAAxkL,KAAA+kL,GAGA,IAAA,GAAA17K,GAAA,EAAAA,EAAA+2K,EAAAE,SAAA7kL,OAAA4N,IAAA,CACA,GAAA83F,GAAAi/E,EAAAE,SAAAj3K,GAEAy+J,EAAA3mE,EAAAw/E,iBACA5Y,EAAA5mE,EAAA8gF,iBAEAiB,EAAA9C,EAAAE,SAAAjuK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAmtK,KAGAE,EAAAkb,GAAA,OAAAA,EAAA,GAAA8B,iBAAA9B,EAAA,GAAA8B,iBAAA,IAGA,KAAA7jF,EAAAmgF,QAAAngF,EAAA8jF,WAAAjd,EAAA,CAIA,GAAAruK,IAEAitK,QAAAsY,EAAAt7I,MAAAjlC,GACAwqK,QAAA+V,EAAAt7I,MAAAwlI,SACAvC,cAAAuZ,EAAAmC,eACA5qK,SAAAwpF,EAAAxpF,SACAmwJ,eAAAA,EACAC,eAAAA,EACAC,SAAAA,EAIA,IAAAruK,EAAAge,SACA,CACA,GAAAutK,GAAA17E,EAAA3yE,OAEA6oJ,GAAA7X,cAAAluK,EAAAitK,QAAAjtK,EAAAktK,cAAAltK,EAAAmuK,eAAAnuK,EAAAouK,eAAApuK,EAAAwvK,QAAAxvK,EAAAquK,UAAAxzI,KAAA,SAAA/T,GACAykK,EAAArwJ,QAAApU,EAAA9mB,OACA,SAAAunB,GACAgkK,EAAApwJ,OAAA5T,KAGAsjK,EAAAxkL,KAAAklL,MAKA,IAAA,GAAA9sJ,GAAA,EAAAA,EAAA8mJ,EAAA6D,gBAAAtnL,OAAA28B,IAAA,CACA,GAAA+sJ,GAAAjG,EAAA6D,gBAAA3qJ,GAEAlxB,GAEA0/J,QAAAsY,EAAAt7I,MAAAjlC,GACAwqK,QAAA+V,EAAAt7I,MAAAwlI,SACAgc,mBAAAD,EAAA1C,YAAA0C,EAAA1C,YAAAR,iBAAA,KACApb,cAAAse,EAAA/E,YAAAmC,eACAza,eAAAqd,EAAAhkF,QAAAw/E,iBACA5Y,eAAAod,EAAAhkF,QAAA8gF,iBACAtqK,SAAAwtK,EAAAhkF,QAAAxpF,SACAqwJ,SAAA,MAGAn4B,EAAA3nC,EAAA,UAAAg3E,EAAAt7I,MAAAu8I,cAAAoC,eAAAr7K,EAAA2/J,gBAAA,GAAA,EAEA,IAAAh3B,EAAA,CACA,GAAAw1C,GAAAx1C,EAAAywC,SAAAjuK,OAAA,SAAA9G,GACA,MAAAA,GAAAo1K,mBAAAhmL,SAAAuM,EAAA4gK,iBAGAud,KACAn+K,EAAA8gK,SAAAqd,EAAA,GAAAL,kBAIA,GAAA99K,EAAA4gK,gBAAA5gK,EAAA6gK,eAAA,CAIA,GAAAud,GAAAp+K,EAAAk+K,qBAAAl+K,EAAA6gK,cACA,KAAAud,GAAA,GAAAH,EAAAhkF,QAAAxpF,SAAA,CAGA,GAAAzQ,EAAAk+K,oBAAA,GAAAl+K,EAAAyQ,SACA,CACA,GAAA4tK,GAAA/7E,EAAA3yE,OAGA6oJ,GAAAzX,cAAA/gK,EAAA0/J,QAAA1/J,EAAA2/J,cAAA3/J,EAAA6gK,eAAA7gK,EAAAiiK,SAAA30I,KAAA,SAAA/T,GACA8kK,EAAA1wJ,QAAApU,EAAA9mB,OACA,SAAAunB,GACAqkK,EAAAzwJ,OAAA5T,KAGAsjK,EAAAxkL,KAAAulL,GAIA,GAAA,GAAAr+K,EAAAyQ,SAAA,CACA,GAAA6tK,GAAAh8E,EAAA3yE,OAGA6oJ,GAAA7X,cAAA3gK,EAAA0/J,QAAA1/J,EAAA2/J,cAAA3/J,EAAA4gK,eAAA5gK,EAAA6gK,eAAA7gK,EAAAiiK,QAAAjiK,EAAA8gK,UAAAxzI,KAAA,SAAA/T,GACA+kK,EAAA3wJ,QAAApU,EAAA9mB,OACA,SAAAunB,GACAskK,EAAA1wJ,OAAA5T,KAGAsjK,EAAAxkL,KAAAwlL,MAMA,GAAApnK,GAAAorF,EAAAhnF,OAGAs7E,SAAApmG,QAAA8sL,EAAA,SAAA9lL,GACA0f,EAAAA,EAAAoW,KAAA,WACA,MAAAg2E,GAAA,aACA,OAIApsF,EAAAA,WAAA,WACA8gK,EAAAoD,oBAAA,EACApD,EAAA/iG,SAAA,IAIA,QAAAspG,GAAAtoJ,EAAAqqG,GAIA,GAFAA,EAAAA,GAAA,IAEArqG,EAAAkvG,UAAA7E,GAAA,GAAA,CAIA,GAAA6gC,GAAAvqE,QAAA9tF,QAAA,eAAArW,KAAA,UAEA+lL,GAAAvX,eAAA+W,EAAAt7I,MAAA4jG,EAAA03C,EAAAt7I,MAAA8hJ,6BAAArd,GAAA7zI,KAAA,SAAA/T,GACA,GAAA9mB,GAAA8mB,EAAA9mB,IACAxC,QAAAsF,SAAA4R,KAAA1U,IAFA+lL,SAIA,SAAA/lL,OAKA,QAAAgsL,GAAAxoJ,GAEA,IAAAA,EAAAkvG,SAAA,CAIA,GAAA7E,GAAA1pC,QAAAtF,YAAAr7D,EAAAyoJ,gBAAA,OAAAzoJ,EAAAyoJ,cAAA,KAAAzoJ,EAAAyoJ,cAAAtkC,WACA,IAAA9Z,EAAA,CAIA,GAAA6gC,GAAAvqE,QAAA9tF,QAAA,eAAArW,KAAA,UAEA+lL,GAAAvX,eAAA+W,EAAAt7I,MAAA4jG,EAAA03C,EAAAt7I,MAAA8hJ,6BAAArd,GACA7zI,KAAA,SAAA/T,GACA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,aAAA0uK,EACAlxK,OAAAsF,SAAA4R,KAAA1U,EAEAxC,OAAAsF,SAAA4R,KAAA1U,IAPA+lL,SAUA,SAAA/lL,QAKA,QAAAuqL,GAAA9D,GAEA,GAAAE,GAAAp4E,EAAA,UAAAk4E,EAAAE,UAAA3oK,SAAA,IAAA,GACAkuK,EAAAvF,EAAAzuH,OAAA,SAAA74D,EAAAkC,GACA,GAAA4qL,GAAA5qL,EAAAgnL,aAIA,OAHA,IAAAhnL,EAAAwmL,WACAoE,EAAA5qL,EAAA6qL,qBAEAp+K,WAAA3O,GAAA2O,WAAAm+K,IACA,EACA,OAAAn+K,YAAAy4K,EAAA4F,cAAA,IAAAr+K,WAAAk+K,EAAA,IAGA,QAAAI,GAAA7F,GACA,GAAAloF,EAAAkoF,EAAApZ,WAAA,CACA,GAAApwH,GAAA,GAAAnpC,MAAA,KAAA,GAAA,IACApK,GAAA,GAAAoK,OAAA0zD,SAAA,EAAA,EAAA,EAAA,GACA6lG,EAAA,GAAAv5J,MAAA2yK,EAAApZ,UAEAA,GAAApwH,GAAAowH,EAAA3jK,GACAq8K,EAAA/Y,kBAAAuY,EAAAt7I,MAAAjlC,GAAAyhL,EAAAmC,eAAAnC,EAAAwC,UAAAxC,EAAAtZ,OAAAsZ,EAAArZ,IAAAC,EAAAkY,EAAAt7I,MAAAwlI,SAAAgX,EAAAyE,gBAAArwJ,KAAA,SAAA/T,MAEA2/J,EAAA8F,cAAA,EACA9F,EAAA+F,gBAAA,GAEA/F,EAAA+F,gBAAA,MAGA/F,GAAA8F,cAAA,EAIA,QAAA1C,GAAAlD,GAIA,IAAA,GAFAuF,GAAA,EAEAlkL,EAAA,EAAAA,EAAA2+K,EAAA7kL,OAAAkG,IAAA,CAEA,GAAAjD,GAAA4hL,EAAA3+K,GACAw/F,EAAAziG,EAAAyiG,OAEAA,KACA0kF,GAAAl+K,WAAAw5F,EAAA+gF,cAAA,KAGA,MAAAv6K,YAAAu3K,EAAAgB,WAAA,IAAAv4K,WAAAk+K,EAAA,IAGA,QAAA5C,GAAArpF,EAAAtyF,GACA,GAAAyoB,GAAA6pE,EAAAngG,QAAA6N,EAIA,OAHAyoB,SACA6pE,EAAAp7F,OAAAuxB,EAAA,GAEA6pE,EAGA,QAAAwsF,GAAA9F,EAAAvY,GAGA,GAAA0Z,GAAAnB,EAAAjuK,OAAA,SAAA9G,GACA,MAAAA,GAAA02K,mBAAAla,IAIArwJ,EAAA+pK,EAAApvK,OAAA,SAAA9G,GACA,MAAA,IAAAA,EAAAoM,WACA,EAEAD,IACAusK,EAAA3D,EAAA5oK,GAIA,QAAAusK,GAAA3D,EAAAn/E,GACA,GAAAklF,GAAAtS,EAAAp9H,MAAAwqD,EAAAmlF,iBAAAnlF,EAAAolF,iBAEAjG,GAAA,GAAAkG,UAAAH,CAEA,IAAAI,GAAA1S,EAAA9F,kBAAAqS,EAAA,GAAA0E,kBAAA,KAAArqL,SAAA2lL,EAAA,GAAA0E,iBAGA,QAAAyB,GAAAJ,EAAA5sL,QAAAgtL,SACAA,GAAAtlF,EAAAmlF,kBAAAG,GAAAtlF,EAAAolF,iBAEAjG,EAAA,GAAA0E,iBAAAyB,EAIAnG,EAAA,GAAA0E,iBAAA,OAAA7jF,EAAA8jF,SAAA9jF,EAAA8jF,SAAA9jF,EAAAulF,iBAIA,QAAAC,KACAjH,EAAAjW,UAAAyV,EAAAt7I,MAAAgjJ,SAAA1H,EAAAt7I,MAAAwlI,UACA50I,KAAA,SAAA/T,GACAtpB,OAAA2I,KAAA2gB,EAAA9mB,KAAAg8G,KAAA,WACA,SAAAxgG,MAKA,QAAAu0J,KACAwV,EAAA2H,gBAAAloK,UAAA,EACAugK,EAAA2H,gBAAAl6I,SAAA,EACAuyI,EAAA2H,gBAAA3lK,OAAA,EACAw+J,EAAAhW,WAAAwV,EAAAt7I,MAAAgjJ,SAAA1H,EAAAt7I,MAAAwlI,UACA50I,KAAA,SAAA/T,GACAy+J,EAAA2H,gBAAAloK,UAAA,EACAugK,EAAA2H,gBAAAl6I,SAAA,EACAuyI,EAAA2H,gBAAA3lK,OAAA,GAEA,SAAA/L,GACA+pK,EAAA2H,gBAAAloK,UAAA,EACAugK,EAAA2H,gBAAAl6I,SAAA,EACAuyI,EAAA2H,gBAAA3lK,OAAA,IAIA,QAAA4tH,GAAA34F,EAAAovB,GAEAA,EAAA5qE,SAAA4qE,IAAA,CAEA,IAAAr+D,GAAA,GAAAuG,MAAA0oC,GACA2wI,EAAA5/K,EAAAkyD,QAAAlyD,EAAA22D,UAAA0H,GAEAl8D,EAAA6+F,EAAA,QAAA4+E,EAAA,oBACA,OAAA5Y,GAAA7kK,GAGA,QAAA6kK,GAAA7kK,GACA,MAAA0qK,GAAA7F,WAAA7kK,GAGA,QAAA09K,GAAAnjJ,EAAAw8I,GAEA,GAAAxpJ,GAAA,CAEAknE,SAAApmG,QAAAksC,EAAAu8I,aAAA,SAAAzhL,EAAAzE,GAEA,GAAAwqL,GAAA/lL,EAAAgmL,uBAAAhmL,EAAAimL,oBAAA,IAEAF,KAAA/lL,EAAAomL,iBACAluJ,MAIAA,EAAA,EACAsoJ,EAAA8H,uBAAA,EAGA9H,EAAA8H,uBAAA,EAIA,QAAAnyJ,GAAA+O,GAEA,GAAAqjJ,GAAAlT,EAAA1U,mBAAA,gBAEA4nB,KACA/H,EAAAgI,aACA16I,OAAAy6I,IAKAvH,EAAAvZ,mBAAAviI,EAAAgjJ,SAAAhjJ,EAAAwlI,SAAAxlI,EAAAu8I,aAAA,GAAAoC,gBAAA/tJ,KAAA,SAAA/T,GACA,MAAAA,EAAA+rB,OACAl/B,QAAAvD,KAAA,6BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YAEAqyI,EAAAiI,gBAAA1mK,EAAA9mB,MAIA,IAAAm5F,GAAA,EACArgE,EAAA,CAuCA,OArCAqrE,SAAApmG,QAAAksC,EAAAu8I,aAAA,SAAAzhL,EAAAzE,GAEA,GAAAmtL,GAAAxjJ,EAAAgjJ,SAAAj5K,OAAA,EAAA,GAGA05K,EAAA,OAAAD,GAAA,KAAA,EAAA,GAGA1oL,GAAA4hL,SAAAp4E,EAAA,UAAAxpG,EAAA4hL,SAAA,SAAAn/E,GAEA,GAAA2mE,GAAAntK,SAAAwmG,EAAAw/E,iBAGA,OAAA0G,GAAA5tL,QAAAquK,UAGAppK,EAAA01K,MAAAkT,EAAA5oL,EAAAqoK,KAEAroK,EAAAqoK,KAAA,GACAj0E,IAGArgE,IAGA/zB,EAAAomL,gBAAAyC,EAAA7oL,KAGAklC,EAAA4jJ,cAAA5jJ,EAAAu8I,aAAA,GAAAqH,cACA5jJ,EAAA6jJ,eAAA7jJ,EAAAu8I,aAAA,GAAAsH,eACA7jJ,EAAA8jJ,iBAAA9jJ,EAAAu8I,aAAA,GAAAuH,iBAEA9jJ,EAAAkvD,OAAAA,EACAlvD,EAAAnR,SAAAA,EAEAmR,EAAA2lI,cAAA,aAEA3lI,EAGA,QAAA2jJ,GAAAnH,GACA,GAAAnZ,GAAAmZ,EAAAsE,uBAAAtE,EAAAuE,oBAAA,IAEA,OAAA1d,GAGA,QAAA0gB,GAAA7f,EAAAqY,GAEA,GAAAxrB,GAAA,CAaA,OAXA72D,SAAApmG,QAAAyoL,EAAA,SAAAC,GACA,GAAAE,GAAAp4E,EAAA,SAAAk4E,EAAAE,UAAAK,iBAAA7Y,EAAAnwJ,SAAA,GACAmmF,SAAApmG,QAAA4oL,EAAA,SAAAn/E,GACA,GAAA2kF,GAAA3kF,EAAA+gF,aACA,IAAA/gF,EAAAugF,WACAoE,EAAA3kF,EAAA4kF,qBAEApxB,GAAAhtJ,WAAAm+K,OAIAnxB,EAGA,QAAAizB,GAAAvH,EAAAl/E,GACA,GAAA0mF,GAAA3/E,EAAA,SAAAm4E,GAAAM,iBAAAx/E,EAAAw/E,mBAAA,EACA,OAAAkH,GAGA,QAAA3G,GAAAt9I,GACA4mE,EAAA,WACAlB,EAAAmqB,WAAA,aAAA7vF,IACA,GAGA,QAAAgmI,KACA8V,EAAA9V,eAAAsV,EAAA8B,sBAAAxsJ,KAAA,SAAA/T,GACA,GAAAqnK,GAAArnK,EAAA9mB,IACAulL,GAAA6I,YAAAC,IAAAF,EAAAG,SACA/I,EAAA6I,YAAAjO,YAAAlwE,EAAAwgE,YAAA0d,EAAAhO,eAHA4F,SAKA,cAKA,QAAA4H,GAAAvgB,GACA,MAAAA,IAAA,GAGA,QAAA7uE,GAAA5wF,GACA,aAAAA,IACA,IAAA,SACA,OAAA,CACA,KAAA,SACA,OAAAu0C,MAAApuC,KAAA08B,MAAA7iC,GACA,KAAA,SACA,GAAAA,YAAAmG,MACA,OAAAouC,MAAAv0C,EAAAoG,UAEA,SACA,OAAA,GAjnCA,GAAAwxK,GAAAxlL,IAEAwlL,GAAAgB,WAAA,EAEAhB,EAAAt7I,MAAA,KACAs7I,EAAA/iG,SAAA,EACA+iG,EAAAkC,iBAAA,EACAlC,EAAAmC,sBAAA,EAEAnC,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA,KAEA8J,EAAAiI,gBAAA,KACAjI,EAAA8H,uBAAA,EACA9H,EAAAkF,iBAAA,EAEAlF,EAAAiC,YACAjC,EAAA2D,sBACA3D,EAAA2B,qBACA3B,EAAA6D,mBAEA7D,EAAAa,WAAA,EACAb,EAAAoD,oBAAA,EACApD,EAAAgI,YAAA,KACAhI,EAAAgJ,iBAAA,EACAhJ,EAAAuB,+BAAA,EAEAvB,EAAAqC,YAAAA,EACArC,EAAAkH,cAAAA,EACAlH,EAAAmD,oBAAAA,EACAnD,EAAAuE,WAAAA,EACAvE,EAAAwE,cAAAA,EACAxE,EAAAiF,eAAAA,EACAjF,EAAAtV,eAAAA,EAEAsV,EAAA6I,eAEA7I,EAAAmF,YAAAA,EACAnF,EAAAoF,YAAAA,EACApF,EAAAuG,cAAAA,EACAvG,EAAAyG,oBAAAA,EACAzG,EAAA6H,qBAAAA,EAEA7H,EAAA+G,2BAAAA,EAEA/G,EAAA2H,mBACA3H,EAAAyH,YAAAA,EACAzH,EAAAxV,WAAAA,EAEAwV,EAAApwC,QAAAA,EACAowC,EAAAhR,WAAAA,EAGAgR,EAAAyI,gCAAAA,EAEAzI,EAAA0I,yBAAAA,EAGA3lL,IA2jCAi8G,EAAA7D,IAAA,uBAAA,SAAAlnG,EAAAywB,GACAs7I,EAAAt7I,MAAAA,MC5nCA,IAAAm7I,KAAAjhF,QAAA5gG,OAAA,oBACA6hL,KAAA//E,WAAA,+BAAA,SAAA,aAAA,WAAA,WAAA,UAAA,kBAAA,SAAAkf,EAAA5U,EAAAkB,EAAAmlD,EAAAjlD,EAAAg1E,GAYA,QAAA7qJ,GAAA+O,GA8BA,MA5BAA,GAAAukJ,mBAAA7oB,EAAA17H,EAAAy4I,6BAAAz4I,EAAA04I,4BACA14I,EAAAwkJ,gBAAA9oB,EAAA17H,EAAAm5I,0BAAAn5I,EAAAo5I,yBAEAp5I,EAAA4jJ,cAAA5jJ,EAAAu8I,aAAA,GAAAqH,cACA5jJ,EAAA6jJ,eAAA7jJ,EAAAu8I,aAAA,GAAAsH,eAEA/H,EAAA/V,SAAA/lI,EAAAmlI,mBAAAv0I,KAAA,SAAA/T,GACA,GAAAwsJ,GAAAxsJ,EAAA9mB,KAAA,EAEAiqC,GAAAklI,WAAAmE,EAAAz7J,KACAoyB,EAAAykJ,cAAApb,EAAA1F,QACA3jI,EAAA0kJ,UAAArb,EAAAsb,IACA3kJ,EAAA4kJ,WAAAvb,EAAAxF,KAEA7jI,EAAA8jI,QAAAuF,EAAAwb,mBACA7kJ,EAAAi2D,YAAAozE,EAAAsS,gBACA37I,EAAA8kJ,UAAAzb,EAAA0b,OAAA,GAAAlpL,IACAmkC,EAAAuzI,cAAAlK,EAAAkK,cAEAyR,EAAAhlJ,GAEAs7I,EAAA/iG,SAAA,IAfAujG,SAiBA,SAAAzS,GACAiS,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,IAGAv4C,EAGA,QAAAg7I,GAAAC,EAAA1lL,EAAAC,EAAAo7C,GACA,GAAAsqI,GAAAD,CACA,OAAAC,GAAAh4K,UAAA,EAAAg4K,EAAArlL,QAAA,MAAA,WAAA+6C,EAAA,oBAAAr7C,EAAA,WAAAC,EAAA,cAGA,QAAAwvL,GAAAhlJ,GACA4mE,EAAA,WACAlB,EAAAmqB,WAAA,uBAAA7vF,IACA,GAGA,QAAA07H,GAAA39F,EAAA49F,GACA,GAAA59F,GAAA,GAAAl0D,MAAAk0D,GACA49F,EAAA,GAAA9xJ,MAAA8xJ,GACAj5I,EAAAi5I,EAAA7xJ,UAAAi0D,EAAAj0D,UACA63D,EAAA/qE,KAAAikE,MAAAn4C,EAAA,OACA2qE,EAAAz2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EACAyrB,EAAAx2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EAAA,GAAA,GAAA0rB,GACAF,EAAAv2F,KAAAikE,MAAAn4C,EAAA,MAAA,GAAAi/C,EAAA,GAAA,GAAA,GAAA0rB,EAAA,GAAA,GAAAD,EACA,QAAAzyB,IAAAgH,EAAAi6F,KAAAvuE,EAAAwuE,OAAAzuE,EAAA/sE,OAAA8sE,GA9DA,GAAAmuF,GAAAxlL,IACAwlL,GAAA/iG,SAAA,EACA+iG,EAAAh+J,OAAA,EAEAg+J,EAAAN,YAAAA,EAEA1gE,EAAA7D,IAAA,aAAA,SAAAlnG,EAAA5H,GACA2zK,EAAAt7I,MAAA/O,EAAAtpB,KA0DA2yG,EAAA2qE,OAAA,WACAl5B,EAAAx3J,OAAA,aACAuyG,EAAAjuG,SAAA4R,KAAAq8F,EAAAjuG,SAAA4R,KAAA7O,MAAA,KAAA,MCtEA,IAAAu/K,KAAAjhF,QAAA5gG,OAAA,oBAEA6hL,KAAA5+E,SAAAngG,KAAA,kBACA++K,IAAA5+E,SAAAngG,KAAA;AAEA++K,IAAA//E,WAAA,4BAAA,SAAA,aAAA,WAAA,UAAA,KAAA,kBAAA,eAAA,gBAAA,eAAA,SAAAkf,EAAA5U,EAAAkB,EAAAtC,EAAAsB,EAAAk2E,EAAA3L,EAAA4L,EAAApR,GAuBA,QAAAtsK,KAEA,GAAA6mL,GAAA,IAQA,IALAA,EADA/U,EAAA1U,mBAAA,QACA0U,EAAA1U,mBAAA,QAEAsgB,EAAA5R,cAAA,aAIA,IACA/H,EAAA8iB,GAEA,MAAA3zK,GACA+pK,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,MAGA+iG,GAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,EAIA,QAAA6pF,GAAA8iB,GAEApJ,EAAAxZ,eAAA4iB,GAAAt0J,KAAA,SAAA/T,GAEA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,OAAA8mB,EAAA+rB,QACAl/B,QAAAvD,KAAA,2BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YACAqyI,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA3H,cAAA92J,EAAAosB,WAEAqyI,EAAAa,WAAA,GAEA,YAAApmL,EAAAqmL,aAAA5lL,eACA8kL,EAAAh+J,OAAA,EACAg+J,EAAA3H,cAAA92J,EAAAosB,WACAqyI,EAAA9J,UAAA,iBAEA8J,EAAAa,WAAA,IAIAb,EAAAt7I,MAAA/O,EAAAl7B,GACAulL,EAAAt7I,MAAA2tB,KAAAu3H,EACA5J,EAAAgB,WAAAhB,EAAAt7I,MAAAslI,aAEAyW,EAAA9R,cAAA,YAAAib,GAEA5J,EAAAa,WAAA,EAEAmB,EAAAhC,EAAAt7I,QAGAs7I,EAAA/iG,SAAA,IAhCAujG,SAkCA,SAAAj/J,GACAnT,QAAA4T,MAAA,yBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEA0hI,EAAApqC,YAAA1jH,GAEAy+J,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA/iG,SAAA,IAIA,QAAAspG,GAAAtoJ,EAAAqqG,EAAA4gC,GAIA,GAFA5gC,EAAAA,GAAA,IAEArqG,EAAAkvG,UAAA7E,GAAA,GAAA,CAIA,GAAA6gC,GAAAvqE,QAAA9tF,QAAA,mBAAArW,KAAA,UAEA+lL,GAAAvX,eAAA+W,EAAAt7I,MAAA4jG,EAAA4gC,EAAAC,GAAA7zI,KAAA,SAAA/T,GACA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,aAAA0uK,EACAlxK,OAAAsF,SAAA4R,KAAA1U,EAEAxC,OAAAsF,SAAA4R,KAAA1U,IANA+lL,SASA,SAAA/lL,OAKA,QAAAgsL,GAAAxoJ,EAAAirI,GAEA,IAAAjrI,EAAAkvG,SAAA,CAIA,GAAA7E,GAAA1pC,QAAAtF,YAAAr7D,EAAAyoJ,gBAAA,OAAAzoJ,EAAAyoJ,cAAA,KAAAzoJ,EAAAyoJ,cAAAtkC,WAEA,IAAA9Z,EAAA,CAIA,GAAA6gC,GAAAvqE,QAAA9tF,QAAA,mBAAArW,KAAA,UAEA+lL,GAAAvX,eAAA+W,EAAAt7I,MAAA4jG,EAAA4gC,EAAAC,GACA7zI,KAAA,SAAA/T,GACA,GAAA9mB,GAAA8mB,EAAA9mB,IACAxC,QAAAsF,SAAA4R,KAAA1U,IAHA+lL,SAKA,SAAA/lL,QAKA,QAAAu0K,GAAA7kK,GACA,MAAA0qK,GAAA7F,WAAA7kK,GAGA,QAAAwrB,GAAA+O,GAEA,GAAAqjJ,GAAAlT,EAAA1U,mBAAA,gBAEA4nB,KACA/H,EAAAgI,aACA16I,OAAAy6I,GAIA,IAAAn0F,GAAA,EACArgE,EAAA,CAqBA,OAnBAqrE,SAAApmG,QAAAksC,EAAAu8I,aAAA,SAAAzhL,EAAAzE,GACAyE,EAAAqqL,yBAAAvuL,KAAA6I,IAAA,EAAA3E,EAAAsqL,8BAAAtqL,EAAAuqL,4BACAvqL,EAAAwqL,yBAAA1uL,KAAA6I,IAAA,EAAA3E,EAAA6hL,4BAAA7hL,EAAAuqL,4BAEAvqL,EAAAqoK,KAAA,GACAj0E,IAGArgE,MAIAmR,EAAA4jJ,cAAA5jJ,EAAAu8I,aAAA,GAAAqH,cACA5jJ,EAAA6jJ,eAAA7jJ,EAAAu8I,aAAA,GAAAsH,eACA7jJ,EAAA8jJ,iBAAA9jJ,EAAAu8I,aAAA,GAAAuH,iBAEA9jJ,EAAAkvD,OAAAA,EACAlvD,EAAAnR,SAAAA,EAEAmR,EAGA,QAAAs9I,GAAAt9I,GACA4mE,EAAA,WACAlB,EAAAmqB,WAAA,aAAA7vF,IACA,GAtLA,GAAAs7I,GAAAxlL,IAEAwlL,GAAAgB,WAAA,EAEAhB,EAAAt7I,MAAA,KACAs7I,EAAA/iG,SAAA,EAEA+iG,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA,KAEA8J,EAAAgI,YAAA,KAEAhI,EAAAuG,cAAAA,EACAvG,EAAAyG,oBAAAA,EAEAzG,EAAAhR,WAAAA,CAEA/2K,QAAAsF,SAAAyvH,SAAA,KAAA/0H,OAAAsF,SAAA0xG,KAAAh3G,OAAAsF,SAAAylF,QAEAjgF,KAsKAi8G,EAAA7D,IAAA,uBAAA,SAAAlnG,EAAAywB,GACAs7I,EAAAt7I,MAAAA,MCjMA,IAAAm7I,KAAAjhF,QAAA5gG,OAAA,oBAEA6hL,KAAA5+E,SAAAngG,KAAA,kBACA++K,IAAA5+E,SAAAngG,KAAA,mBAEA++K,IAAA//E,WAAA,qBAAA,SAAA,aAAA,WAAA,UAAA,KAAA,OAAA,kBAAA,eAAA,gBAAA,eAAA,SAAAkf,EAAA5U,EAAAkB,EAAAtC,EAAAsB,EAAAI,EAAA81E,EAAA3L,EAAA4L,EAAApR,GAeA,QAAAtsK,KAEA,GAAA2kK,GAAA,KACAf,EAAA,KACA+Z,EAAA,IAuBA,IArBA7L,EAAA1U,mBAAA,aACAuH,EAAAmN,EAAA1U,mBAAA,YAEA0U,EAAA1U,mBAAA,cACAuH,EAAAmN,EAAA1U,mBAAA,aAGA0U,EAAA1U,mBAAA,aACAwG,EAAAkO,EAAA1U,mBAAA,YAEA0U,EAAA1U,mBAAA,cACAwG,EAAAkO,EAAA1U,mBAAA,aAGA0U,EAAA1U,mBAAA,eACAugB,EAAA7L,EAAA1U,mBAAA,cAEA0U,EAAA1U,mBAAA,gBACAugB,EAAA7L,EAAA1U,mBAAA,gBAGAuH,GAAAgZ,IAAA/Z,EAAA,CACA,GAAAga,GAAAjZ,CACAgZ,KACAC,EAAAD,GAGA5Z,EAAA6Z,EAAAha,OAEA,CACA,GAAAia,GAAAH,EAAA5R,cAAA,YAEA,IAAAjwE,QAAAtF,YAAAsnF,IAAA,OAAAA,EAWAZ,EAAA/iG,SAAA,EACA+iG,EAAAa,WAAA,MAXA,KACAD,EAAAnhL,IAAAmhL,EAAAja,SACAG,EAAA8Z,EAAAnhL,GAAAmhL,EAAAja,SAGA,MAAA1wJ,GACA+pK,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,IASA,QAAA6pF,GAAA6Z,EAAAha,GAEA6Z,EAAA1Z,SAAA6Z,EAAAha,GAAArxI,KAAA,SAAA/T,GAEA,GAAA9mB,GAAA8mB,EAAA9mB,IAEA,IAAA,MAAA8mB,EAAA+rB,OACAl/B,QAAAvD,KAAA,2BAAA0W,EAAA+rB,OAAA/rB,EAAAosB,YACAqyI,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA3H,cAAA92J,EAAAosB,WAEAqyI,EAAAa,WAAA,MAEA,IAAA,YAAApmL,EAAAqmL,aAAA5lL,cACA8kL,EAAAh+J,OAAA,EACAg+J,EAAA3H,cAAA92J,EAAAosB,WACAqyI,EAAA9J,UAAA,iBAEA8J,EAAAa,WAAA,MACA,CACAb,EAAAt7I,MAAA/O,EAAAl7B,EAEA,IAAA4R,IACA5M,GAAAkhL,EACAha,QAAAA,EACAob,UAAA/B,EAAAt7I,MAAA0kI,SAAAC,WAGAoX,GAAA9R,cAAA,YAAAtiK,GAEA2zK,EAAAa,WAAA,EAGAb,EAAA/iG,SAAA,IAhCAujG,SAkCA,SAAAj/J,GACAnT,QAAA4T,MAAA,yBAAAT,EAAA+rB,OAAA/rB,EAAAosB,YAEA0hI,EAAApqC,YAAA1jH,GAEAy+J,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA30J,EAAA+rB,OACA0yI,EAAA/iG,SAAA,IAIA,QAAAkoG,GAAAlnJ,GAEA,GAAAsS,GAAAtS,EAAAsS,SAAA6xG,YACAjwH,EAAA8L,EAAA9L,SAAAiwH,WAEA,KAAAnkH,EAAAkvG,SAAA,CAIA,GAAA9gI,IACA5M,GAAA8wC,EACAo2H,QAAAx0I,EAGA20I,GAAAz6J,EAAA5M,GAAA4M,EAAAs6J,UAGA,QAAAhxI,GAAA+O,GACA,GAAAkvD,GAAA,EACArgE,EAAA,CAkBA,OAhBAqrE,SAAApmG,QAAAksC,EAAAu8I,aAAA,SAAAzhL,EAAAzE,GAEAyE,EAAAqoK,KAAA,GACAj0E,IAGArgE,MAIAmR,EAAAkvD,OAAAA,EACAlvD,EAAAnR,SAAAA,EAEAmR,EAAA+lI,EAAA/lI,GACAA,EAAAimI,EAAAjmI,GAKA,QAAA+lI,GAAA/lI,GAiBA,MAhBA87I,GAAA/V,SAAA/lI,EAAAmlI,mBAAAv0I,KAAA,SAAA/T,GACA,GAAAwsJ,GAAAxsJ,EAAA9mB,KAAA,EAEAiqC,GAAAklI,WAAAmE,EAAAz7J,KACAoyB,EAAA8jI,QAAAuF,EAAAwb,mBACA7kJ,EAAA27I,gBAAAtS,EAAAsS,gBACA37I,EAAAwnI,gBAAA6B,EAAA7B,gBAEA8T,EAAA/iG,SAAA,IARAujG,SAWA,SAAAzS,GACAiS,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,IAGAv4C,EAGA,QAAAimI,GAAAjmI,GAWA,MAVA87I,GAAA7V,YAAAjmI,EAAAwnI,gBAAAxnI,EAAAmlI,kBAAAnlI,EAAAg2I,gBAAAplJ,KAAA,SAAA/T,GACAmjB,EAAAulJ,SAAA1oK,EAAA9mB,KACAulL,EAAA/iG,SAAA,IAFAujG,SAKA,SAAAzS,GACAiS,EAAAh+J,OAAA,EACAg+J,EAAA/iG,SAAA,IAGAv4C,EA1LA,GAAAs7I,GAAAxlL,IAEAwlL,GAAAt7I,MAAA,KACAs7I,EAAA/iG,SAAA,EAEA+iG,EAAAh+J,OAAA,EACAg+J,EAAA9J,UAAA,KAEA8J,EAAAa,WAAA,EACAb,EAAAmF,YAAAA,EAEApiL","file":"scripts.min.js","sourcesContent":["/*\r\n Umbraco Forms - Dependencies Checker\r\n*/\r\n\r\nfunction performDependencyChecks(formId){\r\n\r\n //Only perform check if the global 'Umbraco.Sys' is null/undefined\r\n //If present means we are in backoffice & that this is being rendered as a macro preview\r\n //We do not need to perform this check here\r\n if (typeof Umbraco !== 'undefined' && typeof Umbraco.Sys !== 'undefined'){\r\n return;\r\n } \r\n else {\r\n //Check that a Form ID is passed into the function \r\n if(formId){\r\n \r\n //Select the wrapping div around the form \r\n //umbraco_form_GUID\r\n var umbracoForm = document.getElementById('umbraco_form_' + formId);\r\n \r\n var errorElement = document.createElement('div');\r\n errorElement.className='umbraco-forms missing-library';\r\n errorElement.style.color = '#fff';\r\n errorElement.style.backgroundColor = '#9d261d';\r\n errorElement.style.padding = '15px';\r\n errorElement.style.margin = '10px 0';\r\n var errorMessage = \"\";\r\n \r\n //Ensure umbracoForm is not null\r\n if(umbracoForm) {\r\n \r\n //Check for jQuery\r\n if (typeof jQuery == 'undefined') {\r\n errorMessage = errorMessage + 'jQuery has not been loaded & is required for Umbraco Forms.';\r\n } else {\r\n //These only work if jQuery is present, so it's in the else block\r\n \r\n //Check for jQuery Validation\r\n if(!$.validator) {\r\n errorMessage = errorMessage + '
jQuery Validate has not been loaded & is required for Umbraco Forms.'\r\n }\r\n \r\n //Check for jQuery Validation Unobtrusive\r\n //Only works if jQuery validator has been loaded\r\n if($.validator && !$.validator.unobtrusive) {\r\n errorMessage = errorMessage + '
jQuery Validate Unobtrusive has not been loaded & is required for Umbraco Forms.';\r\n }\r\n }\r\n if(errorMessage !== \"\") {\r\n errorElement.innerHTML = errorMessage + '
See Umbraco Forms Documentation';\r\n umbracoForm.insertBefore(errorElement, umbracoForm.childNodes[0]);\r\n }\r\n }\r\n }\r\n }\r\n}\r\n\r\n","if (document.readyState !== 'loading') {\r\n initLazyLoad();\r\n} else {\r\n document.addEventListener('DOMContentLoaded', function () {\r\n initLazyLoad();\r\n });\r\n}\r\n\r\nfunction initLazyLoad() {\r\n var srcSets = [].slice.call(document.querySelectorAll(\".lazy > source\"));\r\n var srcSetImgs = [].slice.call(document.querySelectorAll(\".lazy > img\"));\r\n\r\n var images = [].slice.call(document.querySelectorAll(\"img.lazyimage\"));\r\n var iframes = [].slice.call(document.querySelectorAll(\"div.lazyiframe\"));\r\n\r\n if (\"IntersectionObserver\" in window) {\r\n\r\n var options = {\r\n rootMargin: '400px'\r\n }\r\n\r\n var srcSetObserver = new IntersectionObserver(function (entries, observer) {\r\n entries.forEach(function (entry) {\r\n if (entry.isIntersecting) {\r\n var srcSet = entry.target;\r\n srcSet.srcset = srcSet.dataset.srcset;\r\n srcSet.parentElement.classList.remove(\"lazy\");\r\n srcSetObserver.unobserve(srcSet);\r\n }\r\n });\r\n }, options);\r\n\r\n var imageObserver = new IntersectionObserver(function (entries, observer) {\r\n entries.forEach(function (entry) {\r\n if (entry.isIntersecting) {\r\n var img = entry.target;\r\n img.src = img.dataset.src;\r\n img.classList.remove(\"lazyimage\");\r\n imageObserver.unobserve(img);\r\n }\r\n });\r\n }, options);\r\n\r\n var iframeObserver = new IntersectionObserver(function (entries, observer) {\r\n entries.forEach(function (entry) {\r\n if (entry.isIntersecting) {\r\n var iframe = entry.target;\r\n iframe.innerHTML = iframe.dataset.html;\r\n iframe.classList.remove(\"lazyiframe\");\r\n iframeObserver.unobserve(iframe);\r\n }\r\n });\r\n }, options);\r\n\r\n srcSets.forEach(function (srcSet) {\r\n srcSetObserver.observe(srcSet);\r\n });\r\n\r\n images.forEach(function (image) {\r\n imageObserver.observe(image);\r\n });\r\n\r\n iframes.forEach(function (iframe) {\r\n iframeObserver.observe(iframe);\r\n });\r\n } else {\r\n // Not supported, load all images immediately\r\n srcSets.forEach(function (srcSet) {\r\n srcSet.parentElement.classList.remove(\"lazy\");\r\n srcSet.src = srcSet.dataset.srcset;\r\n srcSet.nextElementSibling.srcset = srcSet.dataset.srcset;\r\n });\r\n srcSetImgs.forEach(function (image) {\r\n image.src = image.dataset.src;\r\n });\r\n\r\n images.forEach(function (image) {\r\n image.src = image.dataset.src;\r\n });\r\n\r\n iframes.forEach(function (iframe) {\r\n iframe.innerHTML = iframe.dataset.html;\r\n });\r\n }\r\n}\r\n\r\nif (document.querySelector(\".hotel-list-container\")) {\r\n var ourObserver = new MutationObserver(function () {\r\n initLazyLoad();\r\n });\r\n\r\n ourObserver.observe(document.querySelector(\".hotel-list-container\"), { childList: true, subtree: true });\r\n}\r\n","$(window).load(function () {\r\n if ($(\".zopim\").length && typeof $zopim !== 'undefined') {\r\n $zopim(function () {\r\n $zopim.livechat.setOnStatus(bubble);\r\n\r\n function bubble(status) {\r\n if (status == 'offline') {\r\n $(\"#contactbar .zopim-check.office-open\").addClass(\"hidden\");\r\n $(\"#contactbar .zopim-check.office-closed\").removeClass(\"hidden\");\r\n }\r\n }\r\n });\r\n }\r\n});\r\n\r\n$(function () {\r\n\tsvg4everybody(); // run \"SVG for Everybody\", which adds SVG External Content support to all browsers.\r\n\r\n\t$(\"#travel-list\").on(\"click\", \".inquire\", function (e) {\r\n\t\tvar currentUrl = window.location.href;\r\n\r\n\t\tvar hotelElement = $(e.target).parents(\".hotel\");\r\n\r\n\t\tvar hotelCode = hotelElement.data(\"hotelcode\");\r\n\t\tvar hotelName = hotelElement.find(\"h3 a\").attr(\"title\");\r\n\r\n\t\tif (currentUrl.indexOf(\"?\") < 0) {\r\n\t\t\tvar season = $(\"#season\").val();\r\n\t\t\tvar transport = $(\"#transport\").val();\r\n\t\t\tvar days = $(\"#dage\").val();\r\n\t\t\tvar date = $(\"#dato\").val();\r\n\t\t\tvar adults = $(\"#voksne\").val();\r\n\t\t\tvar children = $(\"#born\").val();\r\n\r\n\t\t\tvar agesFields = $(\"input[name=alder]\");\r\n\t\t\tvar ages = \"\";\r\n\t\t\tagesFields.each(function (index, element) {\r\n\t\t\t\tvar is_last_item = (index == (agesFields.length - 1));\r\n\t\t\t\tages += $(this).val();\r\n\t\t\t\tif (!is_last_item) {\r\n\t\t\t\t\tages += \",\";\r\n\t\t\t\t}\r\n\t\t\t});\r\n\r\n\t\t\tcurrentUrl += \"?saeson=\" + season + \"&transport=\" + transport + \"&dage=\" + days + \"&dato=\" + date + \"&voksne=\" + adults + \"&born=\" + children + \"&alder=\" + ages;\r\n\t\t}\r\n\r\n\t\t$('#inquire-form-modal h2').text(hotelName);\r\n\r\n\t\t$('#inquire-form-modal .hidden.search').val(currentUrl);\r\n\t\t$('#inquire-form-modal .hidden.hotel').val(hotelCode);\r\n\r\n\t\t$('#inquire-form-modal').modal();\r\n\r\n\t});\r\n\r\n if ($(\".viewer-image\").length) {\r\n $('.viewer-image').each(function () {\r\n var viewer = new Viewer(this,\r\n {\r\n url: 'data-original',\r\n navbar: 0,\r\n toolbar: 2,\r\n rotatable: 0,\r\n scalable: 0,\r\n movable: 1,\r\n title: 0\r\n });\r\n $(document).on(\"click\", \".viewer-canvas\", function (e) {\r\n if ($(e.target).is('img')) {\r\n e.preventDefault();\r\n return;\r\n }\r\n viewer.hide();\r\n });\r\n });\r\n }\r\n\r\n if ($(\".viewer-gallery\").length) {\r\n $('.viewer-gallery').each(function () {\r\n var viewer = new Viewer(this,\r\n {\r\n url: 'data-original',\r\n navbar: 0,\r\n toolbar: 2,\r\n rotatable: 0,\r\n scalable: 0,\r\n movable: 0,\r\n zoomable: 0,\r\n title: 0\r\n });\r\n\r\n $(document).on(\"click\", \".viewer-canvas\", function (e) {\r\n if ($(e.target).is('img')) {\r\n e.preventDefault();\r\n return;\r\n }\r\n viewer.hide();\r\n });\r\n\r\n $('body').on(\"swiperight\", '.viewer-canvas', function () {\r\n viewer.prev();\r\n });\r\n $('body').on(\"swipeleft\", '.viewer-canvas', function () {\r\n viewer.next();\r\n });\r\n\r\n $(this).on(\"click\", function (e) {\r\n $(\".viewer-container\").append('
')\r\n });\r\n\r\n $(document).on(\"click\", \".viewer-control.prev\", function (e) {\r\n e.preventDefault();\r\n viewer.prev();\r\n });\r\n\r\n $(document).on(\"click\", \".viewer-control.next\", function (e) {\r\n e.preventDefault();\r\n viewer.next();\r\n });\r\n\r\n \r\n });\r\n }\r\n\r\n // collapse contactbar on click outside\r\n $(document).on(\"click\", function (e) {\r\n if ($(e.target).closest(\"#contactbar\").length === 0) {\r\n $(\"#contactbar\").removeClass(\"open\");\r\n $(\"#contactbar .forms\").addClass(\"hidden\");\r\n $(\"#contactbar #buttons .btn\").removeClass(\"active\");\r\n }\r\n });\r\n\r\n // collapse contactbar\r\n $(\"#contactbar .collapse\").on(\"click\", function (e) {\r\n e.preventDefault();\r\n $(\"#contactbar\").removeClass(\"open\");\r\n $(\"#contactbar .forms\").addClass(\"hidden\");\r\n $(\"#contactbar #buttons .btn\").removeClass(\"active\");\r\n });\r\n\r\n // hide contactbar\r\n $(\"#contactbar .remove\").on(\"click\", function (e) {\r\n e.preventDefault();\r\n $(\"#contactbar\").addClass(\"hidden\");\r\n $.cookie('hideContactBar',true, {path: '/'});\r\n });\r\n\r\n // toggle open class on contactbar\r\n $(\"#contactbar #buttons > .btn\").on(\"click\", function (e) {\r\n // only add class if button not if chat button, which show zopim chat\r\n if(!$(this).hasClass(\"zopim\")) {\r\n $(this).hasClass(\"active\") ? $(\"#contactbar\").removeClass(\"open\") : $(\"#contactbar\").addClass(\"open\");\r\n }\r\n });\r\n \r\n $(\"#contactbar .showphone\").on(\"click\", function (e) {\r\n $(\"#contactbar .forms\").not(\"#contactbar .phonelink\").addClass(\"hidden\");\r\n $(\"#buttons .btn\").not(this).removeClass(\"active\");\r\n\r\n $(\"#contactbar .phonelink\").toggleClass(\"hidden\");\r\n $(this).toggleClass(\"active\");\r\n });\r\n\r\n $(\"#contactbar .callus\").on(\"click\", function (e) {\r\n $(\"#contactbar .forms\").not(\"#contactbar .callusform\").addClass(\"hidden\");\r\n $(\"#buttons .btn\").not(this).removeClass(\"active\");\r\n\r\n $(\"#contactbar .callusform\").toggleClass(\"hidden\");\r\n $(this).toggleClass(\"active\");\r\n });\r\n\r\n $(\"#contactbar .callme\").on(\"click\", function (e) {\r\n $(\"#contactbar .forms\").not(\"#contactbar .callmeform\").addClass(\"hidden\");\r\n $(\"#buttons .btn\").not(this).removeClass(\"active\");\r\n\r\n $(\"#contactbar .callmeform\").toggleClass(\"hidden\");\r\n $(this).toggleClass(\"active\");\r\n });\r\n\r\n $(\"#contactbar .mailus\").on(\"click\", function (e) {\r\n $(\"#contactbar .forms\").not(\"#contactbar .mailusform\").addClass(\"hidden\");\r\n $(\"#buttons .btn\").not(this).removeClass(\"active\");\r\n\r\n $(\"#contactbar .mailusform\").toggleClass(\"hidden\");\r\n $(this).toggleClass(\"active\");\r\n });\r\n\r\n if ($(\"#contactbar .contourMessageOnSubmit\").length) {\r\n $(\"#contactbar .contourMessageOnSubmit\").parent(\".forms\").toggleClass(\"hidden\");\r\n }\r\n\r\n //Countdown\r\n $('[data-countdown]').each(function () {\r\n var $this = $(this), finalDate = $(this).data('countdown');\r\n $this.countdown(finalDate, function (event) {\r\n $this.html(event.strftime('%D %H %M %S'));\r\n });\r\n });\r\n \r\n // fix issue when position is absolute/fixed: http://stackoverflow.com/a/31811884\r\n $('.widget-tabs > a[data-toggle=\"tooltip\"], a.widget-collapse[data-toggle=\"tooltip\"]').tooltip({\r\n trigger: 'hover',\r\n container: 'body'\r\n });\t\r\n\r\n // widget favorites\r\n\t$(\"#widget_tab_favorites\").on('click', function (e) {\r\n\t e.preventDefault();\r\n\r\n\t var $this = $(this);\r\n\t $this.siblings().removeClass('selected');\r\n\t $this.addClass('selected');\r\n\r\n\t var body = $(\"body\");\r\n\t var container = $(\".widget-favorites .widget-tabs-box\");\r\n\t if (!container.hasClass(\"open\")) {\r\n\t container.addClass(\"open\");\r\n\t }\r\n\t if (!body.hasClass(\"open-sidebar\")) {\r\n\t body.addClass(\"open-sidebar\");\r\n\t }\r\n\r\n\t $(\".widget-tabs-item\").eq(0).hide();\r\n\t $(\".widget-tabs-item\").eq(1).show();\r\n\t});\r\n\r\n // history/favorites close \r\n\t$(\".widget-tabs-box > a.close\").on('click', function (e) {\r\n\t e.preventDefault();\r\n\r\n\t var $this = $(this);\r\n\t $this.parent().removeClass('open');\r\n\t $(\"body\").removeClass(\"open-sidebar\");\r\n });\r\n\r\n $(\".widget-favorites > a.widget-collapse\").on('click', function (e) {\r\n e.preventDefault();\r\n\r\n var $this = $(this),\r\n $parent = $this.parent();\r\n\r\n $parent.toggleClass('collapsed');\r\n\r\n var titleHide = $this.data(\"title-hide\"),\r\n titleShow = $this.data(\"title-show\");\r\n\r\n if ($parent.hasClass('collapsed')) {\r\n $this.attr(\"title\", titleShow).tooltip('fixTitle').tooltip('show');\r\n }\r\n else {\r\n $this.attr(\"title\", titleHide).tooltip('fixTitle').tooltip('show'); \r\n }\r\n\r\n });\r\n\r\n\t$(\"#frontslider\").carousel();\r\n\r\n\t$('#site').on(\"swiperight\",'.carousel', function(){ \r\n\t\t$(this).carousel('prev');\r\n\t});\r\n\t$('#site').on(\"swipeleft\",'.carousel', function(){ \r\n\t\t$(this).carousel('next');\r\n\t});\r\n\r\n\t$(\"#search button\").click(function (e) {\r\n\t if (!$(\"#search\").hasClass(\"open\")) {\r\n\t e.preventDefault();\r\n\t $(\"#search\").addClass(\"open\");\r\n\t $(\"body\").addClass(\"search-open\");\r\n\t }\r\n\r\n\t $('.search-open').on('click', function (e) {\r\n\t if (e.target !== $(\"#search\") && !$(\"#search\").find(e.target).length) {\r\n\t $(\"#search\").removeClass(\"open\");\r\n\t $(\"body\").removeClass(\"search-open\");\r\n\t }\r\n\t });\r\n\t});\r\n\r\n\t\r\n\r\n // weather forecast show hide on smartphone\r\n\t$(\".collapsed-days .collapsed\").click(function () {\r\n\t $(\".collapsed-days .weather-card\").addClass(\"collapsed\");\r\n\t $(this).removeClass(\"collapsed\");\r\n\t});\r\n \r\n\r\n\t$(\".chat\").click(function () {\r\n\t var chatUrl = $(this).data(\"url\");\r\n\t if (chatUrl != \"\") {\r\n\t window.open(chatUrl, '', 'resizable=yes,location=no,menubar=no,scrollbars=no,status=no,toolbar=no,fullscreen=no,dependent=no,width=650,height=650,left=100,top=100');\r\n\t }\r\n\t}); \r\n\r\n\tsetTimeout(function(){\r\n\t\t$('#travelsearch').affix({\r\n\t\t\toffset: {\r\n\t\t\t\ttop: function () {\r\n var affixHeight = -1;\r\n\r\n if ($(\".frontPage\").length) {\r\n if ($('#front-video').length) {\r\n affixHeight = $('#front-video').height() - $('.navbar').height() - $('#travelsearch').height();\r\n } else {\r\n affixHeight = $('#frontslider').height() - $('.navbar').height() - $('#travelsearch').height();\r\n }\r\n }\r\n\r\n if ($(\".landingpage\").length && $(\".landing-background\").length) {\r\n affixHeight = $(\".landing-background\").height() - $('.navbar').height();\r\n }\r\n\r\n if ($(\".landingpageSlider\").length && $(\"#frontslider\").length) {\r\n affixHeight = $(\"'#frontslider\").height() - $('.navbar').height();\r\n }\r\n\r\n return (affixHeight)\t\t\t\t\t\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t});\r\n\t\tif( $(document).scrollTop() > $(\"frontslider\").height()){\r\n\t\t\t$(\"#payhere\").addClass(\"scroll\");\r\n\t\t} else {\r\n\t\t\t$(\"#payhere\").removeClass(\"scroll\");\r\n\t\t}\r\n\r\n\t\tvar viewportWidth = viewport().width,\r\n\t\t tooltipTrigger = $(\"#travelsearch\").find('.form-children > label');\r\n\r\n // on init\r\n\t\tif (!$(\"#travelsearch\").is(\".affix\") && $(\"body\").hasClass(\"forside\")) {\r\n\t\t tooltipTrigger.on('show.bs.tooltip', function () {\r\n\t\t tooltipTrigger.data('bs.tooltip').options.placement = 'top';\r\n\t\t });\r\n\r\n\t\t tooltipTrigger.on('shown.bs.tooltip', function () {\r\n\t\t $(this).next('.tooltip').css('top', -35 + 'px').css(\"cursor\", \"pointer\");\r\n\t\t });\r\n\t\t}\r\n\t\telse {\r\n\t\t if (viewportWidth > 768) {\r\n\t\t tooltipTrigger.on('show.bs.tooltip', function () {\r\n\t\t tooltipTrigger.data('bs.tooltip').options.placement = 'bottom';\r\n\t\t });\r\n\r\n\t\t tooltipTrigger.on('shown.bs.tooltip', function () {\r\n\t\t $(this).next('.tooltip').css('top', 85 + 'px').css(\"cursor\", \"pointer\");\r\n\t\t });\r\n\t\t } \r\n\t\t}\r\n\r\n // change tooltip position in mobile search\r\n\t\t$(\"#mobileTravelToggle\").on('click', function () {\r\n\t\t tooltipTrigger.on('show.bs.tooltip', function () {\r\n\t\t tooltipTrigger.data('bs.tooltip').options.placement = 'top';\r\n\t\t });\r\n\r\n\t\t // only show/refresh when tooltip already is visible\r\n\t\t if (tooltipTrigger.next('div.tooltip').is(':visible')) {\r\n\t\t tooltipTrigger.tooltip('show');\r\n\t\t }\r\n\t\t});\r\n\r\n\t\t$(\"#travelsearch\").on('affixed-top.bs.affix', function () {\r\n\t\t // http://stackoverflow.com/a/19320293\r\n\r\n\t\t tooltipTrigger.on('show.bs.tooltip', function () {\r\n\t\t tooltipTrigger.data('bs.tooltip').options.placement = 'top';\r\n\t\t });\r\n\r\n\t\t tooltipTrigger.on('shown.bs.tooltip', function () {\r\n\t\t $(this).next('.tooltip').css('top', -35 + 'px');\r\n\t\t });\r\n\r\n\t\t // only show/refresh when tooltip already is visible\r\n\t\t if (tooltipTrigger.next('div.tooltip').is(':visible')) {\r\n\t\t tooltipTrigger.tooltip('show');\r\n\t\t }\r\n\t\t});\r\n\r\n\t\t$(\"#travelsearch\").on('affix.bs.affix', function () {\t\t \r\n\t\t // http://stackoverflow.com/a/19320293\r\n\t\t \r\n\t\t tooltipTrigger.on('show.bs.tooltip', function () {\r\n\t\t tooltipTrigger.data('bs.tooltip').options.placement = 'bottom';\r\n\t\t });\r\n\r\n\t\t tooltipTrigger.on('shown.bs.tooltip', function(){\r\n\t\t $(this).next('.tooltip').css('top', 85 + 'px');\r\n\t\t });\r\n\r\n\t\t // only show/refresh when tooltip already is visible\r\n\t\t if (tooltipTrigger.next('div.tooltip').is(':visible')) {\r\n\t\t tooltipTrigger.tooltip('show');\r\n\t\t }\r\n\t\t});\r\n\r\n\t // hide tooltip on click\r\n\t\t$(document).on(\"click\", 'div.tooltip', function () {\r\n\t\t $(this).tooltip('hide');\r\n\t\t});\r\n\r\n\t}, 500);\r\n\r\n\tif ($(window).width() >= 992) {\r\n\t setTimeout(function () {\r\n\t var mainContainerInner = $(\".maincontainer > .container\").first();\r\n\r\n\t if ($('#travelsearch.affix .alert').is(':visible')) {\r\n\t var searchAlertHeight = $('#travelsearch.affix .alert').outerHeight();\r\n\t mainContainerInner.css(\"margin-top\", searchAlertHeight + \"px\");\r\n\t } else {\r\n\t mainContainerInner.css(\"margin-top\", \"\");\r\n\t }\r\n\r\n\t $(\"#travelsearch select[name=transport]\").on(\"change\", function () {\r\n\t if ($('#travelsearch.affix .alert').is(':visible')) {\r\n\t var searchAlertHeight = $('#travelsearch.affix .alert').outerHeight();\r\n\t mainContainerInner.css(\"margin-top\", searchAlertHeight + \"px\");\r\n\t } else {\r\n\t mainContainerInner.css(\"margin-top\", \"\");\r\n\t }\r\n\t });\r\n\r\n\t // reset margin top, when closing alert\r\n\t $('#travelsearch.affix .alert button.close').on(\"click\", function () {\r\n\t mainContainerInner.css(\"margin-top\", \"\");\r\n\t });\r\n\r\n\t }, 500);\r\n\t}\r\n\r\n\tvar lastScrollTop = 0;\r\n\tfunction travelScroll(){\r\n if ($(window).width() > 991) {\r\n if ($(this).scrollTop() > 100) {\r\n $('.navbar').addClass(\"solid\");\r\n } else {\r\n $('.navbar').removeClass(\"solid\");\r\n }\r\n\r\n\t\t\tvar st = $(this).scrollTop();\r\n\t\t\tif (st > lastScrollTop && $(this).scrollTop() > 100){\r\n\t\t\t\t//DOWN\r\n\t\t\t $('.navbar').addClass(\"scrolled\");\r\n\t\t\t $('#travelsearch-button').addClass(\"scrolled\");\r\n\t\t\t\t$('#travelsearch').removeClass(\"nav-show\");\r\n\t\t\t} else {\r\n\t\t\t\t//UP\r\n\t\t\t $('.navbar').removeClass(\"scrolled\");\r\n\t\t\t $('#travelsearch-button').removeClass(\"scrolled\");\r\n\t\t\t\t$('#travelsearch').addClass(\"nav-show\");\r\n\t\t\t}\r\n\t\t\tlastScrollTop = st;\r\n\t\t}\r\n\t}\r\n\r\n\t$(\"body.hotel, body.parent-is-hotel\").on(\"click\", \"#travelsearch-button\", function () {\r\n\t $(this).addClass(\"open\");\r\n\t $(\"#travelsearch\").addClass(\"open\");\r\n\t});\r\n\r\n\t$(window).scroll(function(event){\r\n\t\ttravelScroll();\r\n\t\tif( $(document).scrollTop() > $(\"frontslider\").height()){\r\n\t\t\t$(\"#payhere\").addClass(\"scroll\");\r\n\t\t} else {\r\n\t\t\t$(\"#payhere\").removeClass(\"scroll\");\r\n\t\t}\r\n\t});\r\n travelScroll();\r\n\r\n\t$('#hotelprice').on(\"change\",'input:radio[name=\"pris_radio\"]', function(){\r\n\t\tvar currentId = $(this).attr('id');\r\n\t\tvar price = $(\"label[for=\"+currentId+\"]\").html();\r\n\t\t$(\"#totalprice\").html(price);\t\r\n\r\n\t\tvar idNumber = $(this).attr(\"id\").substring(6,$(this).attr(\"id\").length);\r\n\t\tbookLink = $(\"#link_\" + idNumber).val();\r\n\t});\r\n\r\n\t$('.hotel-list').on(\"click\",'input:radio[name^=radio_]', function(){\r\n\t\tvar id = $(this).closest(\".hotel\").attr('id');\r\n\t\tvar nr = $(this).attr('id').replace(id,\"\").replace(\"radio_\",\"\").replace(\"_\",\"\");\r\n\r\n\t\t$(\"#pris_ialt_\"+id).html( $(\"#pris_ialt_\"+nr+\"_\"+id+\"_value\").val() );\r\n\r\n\t\tif($(\"#pris_badge_\"+nr+\"_\"+id+\"_value\").val() != \"\"){\r\n\t\t\t$(\"#div_pris_badge_\"+id).removeClass(\"hidden\");\r\n\t\t\t$(\"#div_pris_badge_\"+id).html($(\"#pris_badge_\"+id).val());\r\n\t\t} else {\r\n\t\t\t$(\"#div_pris_badge_\"+id).addClass(\"hidden\");\r\n\r\n\t\t}\r\n\r\n\t\tif ($(\"#pris_badge1500_\" + nr + \"_\" + id + \"_value\").length) {\r\n\t\t $(\"#\" + id + \" .badge1500\").removeClass(\"hide\");\r\n\t\t if ($(\"#pris_badge1500_\" + nr + \"_\" + id + \"_value\").val() == \"0\") {\t \r\n\t\t $(\"#\" + id + \" .badge1500\").addClass(\"hide\");\r\n\t\t } \r\n\t\t}\r\n\r\n\t\tif ($(\"#pris_before_\" + nr + \"_\" + id + \"_value\").val() != \"\") {\r\n\t\t\t$(\"#pris_ialt_\"+id).closest(\"div\").find(\".before\").removeClass(\"hidden\");\r\n\t\t\t$(\"#pris_ialt_\" + id).closest(\"div\").find(\".before\").html($(\"#pris_before_\" + nr + \"_\" + id + \"_value\").val());\r\n\t\t\tif (!$(\"#pris_ialt_\" + id).hasClass(\"offer\")) {\r\n\t\t\t $(\"#pris_ialt_\" + id).addClass(\"offer\");\r\n\t\t\t}\r\n\t\t\t\r\n\t\t} else {\r\n\t\t $(\"#pris_ialt_\" + id).closest(\".row\").find(\".before\").addClass(\"hidden\");\r\n\t\t $(\"#pris_ialt_\" + id).removeClass(\"offer\");\r\n\t\t}\r\n\r\n\t\tif ($(\"#pris_spar_\" + nr + \"_\" + id + \"_value\").val() != \"\") {\r\n\t\t $(\"#pris_ialt_\" + id).closest(\"div\").find(\".save\").removeClass(\"hidden\");\r\n\t\t $(\"#pris_ialt_\" + id).closest(\"div\").find(\".save\").html($(\"#pris_spar_\" + nr + \"_\" + id + \"_value\").val() + \"
\");\r\n\t\t} else {\r\n\t\t $(\"#pris_ialt_\" + id).closest(\".row\").find(\".save\").addClass(\"hidden\");\r\n\t\t}\r\n\r\n\t\t$(\"#pris_org_\"+id).html( $(\"#pris_org_\"+nr+\"_\"+id+\"_value\").val() );\r\n\t\t$(\"#pris_gennemsnit_\"+id).html( $(\"#pris_gennemsnit_\"+nr+\"_\"+id+\"_value\").val() );\r\n\t\t$(\"#pris_info_stk_\"+id).html( $(\"#pris_info_stk_\"+nr+\"_\"+id+\"_value\").val() );\r\n\t\t$(\".popBoxIncludes_\"+id).data(\"html\", \"#priceIncludes_\"+nr+\"_\"+id);\r\n\r\n\t\t$(\".prices_hotel_content_\"+id).find(\".data_right.error\").remove();\r\n\t\t$(\".prices_hotel_content_\"+id).find(\".data_right.hide\").removeClass('hide');\r\n\t});\r\n\r\n\t$('#hotelprice').on(\"click\",'.totaltext .btn',function(){\r\n\t\tif(bookLink == \"\"){\r\n\t\t\tvar idNumber = $('#hotelprice input:radio[name=\"pris_radio\"]:checked').attr(\"id\").substring(6,$('#hotelprice input:radio[name=\"pris_radio\"]:checked').attr(\"id\").length);\r\n\t\t\tbookLink = $(\"#link_\" + idNumber).val();\r\n linket = bookLink;\r\n\t\t} else {\r\n\t\t\tlinket = bookLink;\r\n\t\t}\r\n\r\n\t\tbruger_bredde = window.screen.width;\r\n\t\tbruger_hojde = window.screen.height;\r\n\t\tmvenstre = 10;\r\n\t\tmtop = 10;\r\n\r\n\t\tbredde = parseInt(bruger_bredde*0.9);\r\n\t\thojde = parseInt(bruger_hojde*0.9)-120;\r\n\r\n\t\tif (bredde > 1200){\r\n\t\t\tbredde = 1200;\r\n\t\t\tmvenstre = (bruger_bredde-1200)/2;\r\n\t\t}\r\n\t\tif (bredde < 1000) bredde = 1000;\r\n\t\tif (hojde < 700) hojde = 700;\r\n\r\n\t\tif (bruger_hojde > 1000) mtop = 40;\r\n\t\tbook = window.open(linket,\"book\",\"width=\"+bredde+\",height=\"+hojde+\",left=\"+mvenstre+\",top=\"+mtop+\",scrollbars=1,resizable=1,toolbar=0,menubar=0,status=0\");\r\n\r\n\t\tbook.focus();\r\n\t});\r\n\r\n\t$('#hotel-search').on(\"click\",'.hotelsearchtotal a.book-button',function(e){\r\n\t var bookBtn = $(this);\r\n\t\tif (bookBtn.attr(\"href\") == undefined || bookBtn.attr(\"href\") == \"\") {\r\n\t\t e.preventDefault();\r\n\t\t var bookUrl = $('#hotel-search input:radio:checked').data(\"bookurl\");\r\n\t\t window.open(bookUrl, \"_self\").focus();\r\n\t\t}\r\n\t});\r\n\r\n\t$('.social.share').on(\"click\",'a',function(e){\r\n\t\te.preventDefault();\r\n\t\tvar shareLink = $(this).attr(\"href\");\r\n\t\twindow.open(shareLink,\"_blank\",\"width=640,height=440,location=no,scrollbars=no,menubar=no,status=no,top=0,left=0\").focus();\r\n\t});\r\n\r\n function updateFavoriteHeart() {\r\n var cookie = $.cookie('favorit');\r\n if (cookie && cookie.length > 4) {\r\n $(\"#comparison > a > i\").addClass(\"fas\").removeClass(\"far\");\r\n } else {\r\n $(\"#comparison > a > i\").removeClass(\"fas\").addClass(\"far\");\r\n }\r\n }\r\n\r\n updateFavoriteHeart();\r\n\r\n $(document).on(\"click\", '.hotel-list .favorite-wrapper, .hotel-page .favorite-wrapper', function(e){\r\n\r\n var hotelElem = $(this).closest(\".hotel\"),\r\n favoriteElem = hotelElem.find(\".favorite-wrapper\");\r\n\r\n var favoriteLabel = favoriteElem.find(\".favoritelabel\");\r\n var hotelCode = hotelElem.data('hotelcode');\r\n\r\n var textAdded = favoriteLabel.data(\"added\"),\r\n textNotAdded = favoriteLabel.data(\"notadded\");\r\n\r\n var cookieValue = $.cookie('favorit');\r\n favoriteElem.find(\".favorite\").toggleClass(\"fas\").toggleClass(\"far\");\r\n\r\n if (!cookieValue) {\r\n\t\t\tcookieValue = hotelCode + \"-\";\r\n if (favoriteLabel) {\r\n favoriteLabel.text(textAdded);\r\n\t\t\t}\r\n }\r\n else {\r\n\t\t\tif (cookieValue.indexOf(hotelCode) >= 0) {\r\n cookieValue = cookieValue.replace(hotelCode + \"-\", \"\");\r\n if (favoriteLabel) {\r\n favoriteLabel.text(textNotAdded);\r\n\t\t\t\t}\r\n\t\t\t} else {\r\n\t\t\t\tcookieValue = cookieValue + hotelCode + \"-\";\r\n if (favoriteLabel) {\r\n favoriteLabel.text(textAdded);\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t$.cookie('favorit', cookieValue, { expires: 365, path: '/' });\r\n\r\n\t\tupdateFavoriteHeart();\r\n\t});\r\n\r\n if ($(\".favoritelabel\").length)\r\n {\r\n var cookieValue = $.cookie('favorit');\r\n if (cookieValue)\r\n {\r\n if (cookieValue.indexOf($(\".hotel\").data('hotelcode')) >= 0)\r\n {\r\n\t\t\t\t$(\".favorite\").addClass(\"fas\").removeClass(\"far\");\r\n\t\t\t\t$(\".favoritelabel\").text($(\".favoritelabel\").data(\"added\"));\r\n\t\t\t}\r\n\t\t}\r\n\t}\r\n\r\n\t/*Hide tabs if screen is too small*/\r\n\trealignTabs();\r\n\tvar windowTimer = window.setTimeout(function() {}, 0);\r\n\t$(window).on('resize', function() {\r\n\t\twindow.clearTimeout(windowTimer);\r\n\t\ttimer = window.setTimeout(function() {\r\n\t\t\trealignTabs();\r\n\t\t}, 250);\r\n\t});\r\n\r\n\t/*\r\n\tif(!$(\"#frontBottom\").length){\r\n\t\ttravelScroll();\r\n\t}\r\n\t*/\r\n\r\n\tif ($(\"#destsort\").length) {\r\n\t\tsortDestinations();\r\n\t}\r\n\t$('#destsort input').bind('click', function() {\r\n\t\tsortDestinations();\r\n\t});\r\n\r\n\t//Løser problemer i forhold til slimmage og skjulte billeder der kaldes frem\r\n\r\n\t$('.carousel').on('slide.bs.carousel', function (e) {\r\n\t\t//For at slideren ikke kan \"klaske\" op, når billederne loades\r\n\t\t$(this).height($(this).height());\r\n\t});\r\n\r\n\r\n\t$( window ).resize(function() {\r\n\t\t$('.carousel').removeAttr(\"style\")\r\n\t});\r\n\r\n\r\n\t//Initialize tooltips\r\n\t//$('[data-toggle=\"tooltip\"]').tooltip()\r\n\t$('.hotel-rating[data-toggle=\"tooltip\"], .label[data-toggle=\"tooltip\"], #comparison .fa[data-toggle=\"tooltip\"]').tooltip();\r\n\r\n\t$('a[data-toggle=\"tab\"]').on('shown.bs.tab', function (e) {\r\n\t\tvar scrollY = $(document).scrollTop();\r\n\t\tparent.location.hash = $(this).attr(\"href\");\r\n\t\twindow.scrollTo(0, scrollY);\r\n\t});\r\n\r\n\r\n\t// Image hover effect\r\n $(\".imghover\").hover(function () {\r\n\r\n $(\"source\", this).each(function () {\r\n var imgSrc = $(this).attr(\"srcset\");\r\n var imgHover = $(this).attr(\"data-hover\");\r\n\r\n if (imgHover != \"\") {\r\n $(this).attr(\"srcset\", imgHover);\r\n $(this).attr(\"data-hover\", imgSrc);\r\n }\r\n });\r\n\r\n \r\n var imgHover = $(\"img\", this).attr(\"data-hover\");\r\n var imgSrc = $(\"img\", this).attr(\"src\");\r\n if (imgHover != \"\") {\r\n $(\"img\", this).attr(\"src\", imgHover);\r\n $(\"img\", this).attr(\"data-hover\", imgSrc);\r\n }\r\n\r\n\t\t\r\n }, function () {\r\n $(\"source\", this).each(function () {\r\n var imgSrc = $(this).attr(\"srcset\");\r\n var imgHover = $(this).attr(\"data-hover\");\r\n\r\n if (imgHover != \"\") {\r\n $(this).attr(\"srcset\", imgHover);\r\n $(this).attr(\"data-hover\", imgSrc);\r\n }\r\n });\r\n\r\n\t\tvar imgSrc = $(\"img\",this).attr(\"src\");\r\n\t\tvar imgHover = $(\"img\",this).attr(\"data-hover\");\r\n\t\tif(imgHover != \"\"){\r\n\t\t\t$(\"img\",this).attr(\"src\",imgHover);\r\n\t\t\t$(\"img\",this).attr(\"data-hover\",imgSrc);\r\n\t\t}\r\n\t});\r\n\r\n\r\n\tvar deviceAgent = navigator.userAgent.toLowerCase();\r\n\tvar touch = ('ontouchstart' in window) || window.DocumentTouch && document instanceof DocumentTouch; //Modernizr.touch\r\n\tvar isTouchDevice = touch &&\r\n (deviceAgent.match(/(iphone|ipod|ipad)/) ||\r\n deviceAgent.match(/(android)/) ||\r\n deviceAgent.match(/(iemobile)/) ||\r\n deviceAgent.match(/iphone/i) ||\r\n deviceAgent.match(/ipad/i) ||\r\n deviceAgent.match(/ipod/i) ||\r\n deviceAgent.match(/blackberry/i) ||\r\n deviceAgent.match(/bada/i));\r\n\r\n\tif (isTouchDevice) {\r\n\t // Touch events are supported\r\n\r\n\t // follow link to page, when dropdown menu / sub menu is open\r\n\t $('#mobileMenu li.dropdown a.dropdown-toggle, #navbar li.dropdown a.dropdown-toggle').on('click', function (e) {\r\n\t e.preventDefault();\r\n\t e.stopPropagation();\r\n\r\n\t var $this = $(this);\r\n\t var $parent = $this.parent();\r\n\t $parent.siblings().removeClass('open');\r\n\r\n\t var stateOpen = $parent.hasClass('open');\r\n\r\n\t //setTimeout(function () { \r\n\t // only toggle submenu when submenu not is open,\r\n\t // otherwise follow link to page\r\n\t if (stateOpen) {\r\n\t window.location.href = $this.attr(\"href\");\r\n\t } else {\r\n\t $parent.toggleClass('open');\r\n\t }\r\n\t //}, 0);\r\n\t });\r\n\t}\r\n\r\n\t// Megamenu dynamisk indhold\r\n\t$(\".dropdown.yamm-fw\").hover(function() {\r\n\t\t$(this).find(\".yamm-content\").find(\".dynamic-menu-content\").html(\"\");\r\n\t\tvar basicElement = $(this).find(\".yamm-content\").find(\".dynamic-menu-content\");\r\n\r\n\t\tvar title = \"\";\r\n\t\tvar image = \"\";\r\n\t\tvar text = \"\";\r\n\r\n\t\tif ($(basicElement).data('image') || $(basicElement).data('image')) {\r\n\t\t\ttitle = \"\" + $(this).children(\".dropdown-toggle\").html() + \"\";\r\n\t\t}\r\n\r\n\t\tif($(basicElement).data('image')){\r\n\t\t\timage = \"\";\t\t\r\n\t\t}\r\n\r\n\t\tif ($(basicElement).data('text')) {\r\n\t\t\ttext = basicElement.data('text');\r\n\t\t}\r\n\r\n\t\tvar html = image + title + text;\r\n\t\t$(this).find(\".yamm-content\").find(\".dynamic-menu-content\").html(html);\r\n\t});\r\n\r\n\t$(\".yamm-content .menuitem\").mouseover(function () {\r\n\t\tvar title = \"\";\r\n\t\tvar image = \"\";\r\n\t\tvar text = \"\";\r\n\r\n\t\tif ($(this).data('image') || $(this).data('text')) {\r\n\t\t\ttitle = \"\" + $(this).html() + \"\";\r\n\t\t}\r\n\r\n\t\tif($(this).data('image')){\r\n\t\t\timage = \"\";\r\n\t\t}\r\n\r\n\t\tif ($(this).data('text')) {\r\n\t\t\ttext = $(this).data('text');\r\n\t\t}\r\n\r\n\t\tvar html = image + title + text;\r\n\t\t$(this).closest(\".yamm-content\").find(\".dynamic-menu-content\").html(html);\r\n\r\n\t});\r\n\r\n\r\n\t// Hotel mærkning modals\r\n $(document).on(\"click\",\".hotel-list .hotelLabel, .hotel-page .hotelLabel\", function(){\r\n\t\tvar hotelId = $(this).data('id');\r\n\t\t$.ajax({\r\n\t\t\turl: \"/?altTemplate=HotelMaerkning&id=\"+hotelId,\r\n\t\t\tsuccess: function(result){\r\n\t\t\t\t$(\".hotel-marking-modal\").remove();\r\n\t\t\t\t$(\"body\").append(result);\r\n\t\t\t\t$('.hotel-marking-modal').modal('show');\r\n\t\t\t}\r\n\t\t});\r\n });\r\n\r\n\r\n $('.hotel-list, .hotel-page').on(\"click\",\".own-hotel-bar .fa-info-circle, .ownHotel .fa-info-circle\", function(e){\r\n e.preventDefault();\r\n\t\t$('.own-hotel-modal').modal('show');\r\n\t});\r\n\r\n\r\n\t// Pistekort\r\n var $section = $('#pistemap');\r\n $section.find('.panzoom').panzoom({\r\n $zoomIn: $section.find(\".zoom-in\"),\r\n $zoomOut: $section.find(\".zoom-out\"),\r\n $reset: $section.find(\".reset\"),\r\n startTransform: 'scale(0.5)',\r\n increment: 0.5,\r\n minScale: 0.5,\r\n animate: true,\r\n contain: 'invert'\r\n\t}).panzoom('zoom');\r\n\t$section.find('.panzoom').panzoom().parent().on('mousewheel.focal', function(e){\r\n\t\te.preventDefault();\r\n\t\tvar delta = e.delta || e.originalEvent.wheelDelta;\r\n\t\tvar zoomOut = delta ? delta < 0 : e.originalEvent.deltaY > 0;\r\n\t\t$section.find('.panzoom').panzoom().panzoom('zoom', zoomOut, {\r\n\t\t\tincrement: 0.5,\r\n\t\t\tanimate: true,\r\n\t\t\tminScale: 0.2,\r\n\t\t\tfocal: e\r\n\t\t});\r\n\t});\r\n\r\n\t// Google Maps\r\n\tfunction showMarkers(mgr){\r\n\t\tmgr.show();\r\n }\r\n\r\n\tfunction hideMarkers(mgr){\r\n\t\tmgr.hide();\r\n }\r\n\r\n\t$('#info').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(info);\r\n\t\t}else{\r\n hideMarkers(info);\r\n\t\t}\r\n\t});\r\n\t$('#kabinelift').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(kabinelift);\r\n\t\t}else{\r\n hideMarkers(kabinelift);\r\n\t\t}\r\n\t});\r\n\t$('#slaebelift').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(slaebelift);\r\n\t\t} else {\r\n hideMarkers(slaebelift);\r\n\t\t}\r\n\t});\r\n\t$('#stolelift').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(stolelift);\r\n\t\t} else {\r\n hideMarkers(stolelift);\r\n\t\t}\r\n\t});\r\n\t$('#skole').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(skole);\r\n\t\t} else {\r\n hideMarkers(skole);\r\n\t\t}\r\n\t});\r\n\t$('#udlejning').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(udlejning);\r\n\t\t} else {\r\n hideMarkers(udlejning);\r\n\t\t}\r\n\t});\r\n\t$('#langrend').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(langrend);\r\n\t\t} else {\r\n hideMarkers(langrend);\r\n\t\t}\r\n\t});\r\n\t$('#hotels').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(hotels);\r\n\t\t} else {\r\n hideMarkers(hotels);\r\n\t\t}\r\n\t});\r\n\t$('#currenthotel').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(currenthotel);\r\n\t\t}else{\r\n hideMarkers(currenthotel);\r\n\t\t}\r\n\t});\r\n\t$('#otherhotels').click (function (){\r\n\t\tif($(this).is(':checked')){\r\n showMarkers(otherhotels);\r\n\t\t}else{\r\n hideMarkers(otherhotels);\r\n\t\t}\r\n\t});\r\n\r\n\tvar hash = document.location.hash;\r\n if (hash && $('.nav-tabs').length) {\r\n var hashLocation = $('.nav-tabs a[href=' + hash + ']');\r\n if (hashLocation.length){\r\n hashLocation.tab('show');\r\n\t\t\tinitialize();\r\n\t\t}\r\n\t}\t\r\n\r\n\t// Toggle mobile menu\r\n\t$(\"#mobileToggle\").click(function(){\r\n\r\n\t\t$(\"#travelsearch\").removeClass(\"open\");\r\n\t\t$(\"#mobileTravelToggle\").removeClass(\"open\");\r\n\r\n\t\t$(this).toggleClass(\"open\");\r\n\t\t$(\"html, body, #site\").removeClass(\"open-travel-search\").toggleClass(\"open-menu\");\r\n\t\t$(\"#mobileMenu\").toggleClass(\"open\");\r\n\t});\r\n\r\n\t// Toggle mobile travel\r\n\t$(\".toggleTravel\").click(function(){\r\n\r\n\t\t$(\"#mobileToggle\").removeClass(\"open\");\r\n\t\t$(\"html, body, #site\").removeClass(\"open-menu\");\r\n\t\t$(\"#mobileMenu\").removeClass(\"open\");\r\n\r\n\t\t$(\"#travelsearch\").toggleClass(\"open\");\r\n\t\t$(\"#mobileTravelToggle\").toggleClass(\"open\");\r\n\t\t$(\"html, body, #site\").toggleClass(\"open-travel-search\");\r\n\t});\r\n\r\n\t// Readmore toggle\r\n\t$('#site').on(\"click\",\".readToggle\", function(){\r\n\t\t$(this).closest(\".readMoreContent\").toggleClass(\"open\");\r\n\t\t$(this).children(\".fa\").toggleClass(\"fa-arrow-up fa-arrow-right\");\r\n\t\t$(this).children(\".less\").toggle();\r\n $(this).children(\".more\").toggle();\r\n\t});\r\n\r\n\t// Dropdowns\r\n\t$(\".drop .dropHeader, .drop .dropFooter\").click(function(){\r\n\t\t$(this).closest('.drop').children(\".dropBody\").toggle().toggleClass(\"open\");\r\n\t});\r\n\r\n\t// Hotel Search\r\n\t$('.hotel-search').on(\"click\",\".paymentInfoShowHide\", function(){\r\n\t\t$(\".paymentInfo\").toggleClass(\"hidden\")\r\n\t});\r\n\t$('.hotel-search').on(\"click\",\".price-includes\", function(){\r\n\t\tvar modalId = $('#hotel-search input:radio:checked').attr(\"id\").replace(\"radio_\",\"priceIncludes_\");\r\n\t\tvar modalContent = $(\"#\"+modalId).html();\r\n\t\tif(modalContent != undefined){\r\n\t\t\t$('#price-include-modal').find(\".modal-body\").html(modalContent);\r\n\t\t\t$('#price-include-modal').modal('show');\r\n\t\t}\r\n\t});\r\n\t$('.hotel-list').on(\"click\",\".price-includes\", function(){\r\n\t\tvar modalId = $(this).closest(\".hotel\").attr('id');\r\n\t\tvar modalNr = \"0\";\r\n\r\n\t\tif($(\"[id^=radio_]\").length){\r\n\t\t\tmodalNr = $(this).closest(\".hotel\").find(\"input:radio:checked\").attr(\"id\").replace(modalId,\"\").replace(\"radio_\",\"\").replace(\"_\",\"\");\r\n\t\t} \r\n\t\tvar modalContent = $(\"#priceIncludes_\"+modalNr+\"_\"+modalId).html();\r\n\r\n\t\tif(modalContent != undefined){\r\n\t\t\t$('#price-include-modal').find(\".modal-body\").html(modalContent);\r\n\t\t\t$('#price-include-modal').modal('show');\r\n\t\t}\r\n\t});\r\n\t$('.hotel-search').on(\"change\",\"input\", function(){\r\n\t\tgetHotelBookingInfo($(this).prop('id'));\r\n\t});\r\n\tfunction getHotelBookingInfo(info){\r\n\t\t$(\"#totalprice\").html($(\"#\"+info).data(\"price\"));\r\n\t\t$(\".paymentInfo\").html($(\"#\"+info).data(\"priceinfo\"));\r\n\t\t$(\".price-person\").text($(\"#\"+info).data(\"priceperson\"));\r\n\t}\r\n\r\n\t$('a.hotelpricebutton').click(function() {\r\n\t\tvar target = $(this.hash);\r\n\t\ttarget = target.length ? target : $('[name=' + this.hash.slice(1) +']');\r\n\t\tif (target.length) {\r\n\t\t\t$('html,body').animate({\r\n\t\t\t\tscrollTop: target.offset().top - parseInt($(\".maincontainer\").css(\"marginTop\"))\r\n\t\t\t}, 1000);\r\n\t\t\treturn false;\r\n\t\t}\r\n\t});\r\n\r\n\t// Umbraco Forms\r\n\tif($(\".contour\").length){\r\n\r\n\t\tvar formId = $('input[name=\"FormId\"]').val();\r\n\t\tvar formName = $('input[name=\"FormName\"]').val();\r\n\t}\r\n\r\n // Discount page - Open form modal on success\r\n if ($(\"body.discountlist .umbraco-forms-submitmessage\").length) {\r\n var modalId = $(\".umbraco-forms-submitmessage\").closest(\".modal\").attr(\"id\");\r\n $('#' + modalId).modal('show');\r\n }\r\n\r\n // Stop scroll icon animation on mousedown\r\n $('.mybooking').on(\"touchmove\", \".table-responsive\", function () {\r\n $(\".scroll\").removeClass(\"shake\")\r\n });\r\n\r\n});\r\n\r\nfunction viewport() {\r\n var e = window, a = 'inner';\r\n if (!('innerWidth' in window)) {\r\n a = 'client';\r\n e = document.documentElement || document.body;\r\n }\r\n return { width: e[a + 'Width'], height: e[a + 'Height'] };\r\n}\r\n\r\nfunction listFavoriteCheck(){\r\n\t$(\".hotel-list .hotel\").each(function(){\r\n\t\tif($.cookie('favorit') != undefined){\r\n\t\t\tif($.cookie('favorit').indexOf($(this).data('hotelcode')) >= 0){\r\n\t\t\t\t$(this).find(\".favorite\").removeClass(\"fas\").addClass(\"far\");\r\n\t\t\t}\r\n\t\t}\r\n\t});\r\n}\r\n\r\nfunction sortDestinations(){\r\n\tvar matchPercentage = 0;\r\n\t$('#destsort input:checked').each(function(index) {\r\n\t\tvar datavar = $(this).attr(\"name\").toLowerCase();\r\n\t\tvar calcvar = \"data-calc-\" + $(this).attr(\"name\").toLowerCase();\r\n\t\tvar startvalue = $(this).val();\r\n\t\t$(\".destination\").each(function() {\r\n\t\t\t$(this).attr(calcvar,Math.abs($(this).data(datavar) - startvalue))\r\n\t\t\tvar sumtotal =\tparseInt($(this).attr(\"data-calc-beginners\")) +\r\n\t\t\t\tparseInt($(this).attr(\"data-calc-experienced\")) + \r\n\t\t\t\tparseInt($(this).attr(\"data-calc-childfriendly\")) + \r\n\t\t\t\tparseInt($(this).attr(\"data-calc-activities\")) + \r\n\t\t\t\tparseInt($(this).attr(\"data-calc-afterski\")) + \r\n\t\t\t\tparseInt($(this).attr(\"data-calc-shopping\")) + \r\n\t\t\t\tparseInt($(this).attr(\"data-calc-restaurants\")) +\r\n\t\t\t\tparseInt($(this).attr(\"data-calc-snowboarding\")) +\r\n\t\t\t\tparseInt($(this).attr(\"data-calc-offpiste\")) +\r\n\t\t\t\tparseInt($(this).attr(\"data-calc-coziness\"));\r\n\t\t\t$(this).attr(\"data-calcsum\",sumtotal)\r\n\t\t\tmatchPercentage = Math.round(100 - ((100/30) * sumtotal));\r\n\t\t\t$(this).find(\".match-amount\").text(matchPercentage+\" %\").parent().removeClass(\"hidden\");\r\n\t\t});\r\n\t});\r\n\r\n\tvar ascending = false;\r\n\tvar sorted = $('.destination-sort-list .destination').sort(function(a,b){\r\n\t\treturn (ascending == ($(a).data('calcsum') < $(b).data('calcsum'))) ? 1 : -1;\r\n\t});\r\n\tascending = ascending ? false : true;\r\n\t$('.destination-sort-list').html(sorted);\r\n\t$(\".destination\").each(function() {\r\n\t\t$(this).after(\"
\");\r\n\t});\r\n}\r\n\r\nfunction radio_select(radioId){\r\n\tvar price = $(\"#radio_\"+radioId).data(\"price\");\r\n\t$(\".hotelpricebutton .price\").html(price);\r\n\r\n //update book button href\r\n\tvar bookUrl = $('#hotel-search input:radio:checked').data(\"bookurl\");\r\n\t$(\"#hotel-search .hotelsearchtotal .book-button\").attr(\"href\", bookUrl);\r\n}\r\n\r\nfunction realignTabs() {\r\n\tif($(\".menu-tabs\").length){\r\n\t var totalWidth = $(\".menu-tabs .nav-tabs\").width();\r\n\t var tabsWidth = 70;\r\n\r\n\t // clone hidden dropdown to measure its width\r\n\t var dropdownCopy = $(\".menu-tabs .nav-tabs li.dropdown:first\").clone()\r\n .removeClass(\"hidden\")\r\n .css({ visibility: \"hidden\", display: \"block\", position: \"absolute\" });\r\n\r\n\t $(\".menu-tabs .nav-tabs\").append(dropdownCopy);\r\n\t var dropdownWidth = dropdownCopy.width();\r\n\t if (dropdownWidth <= 0) {\r\n // set default dropdown width\r\n\t dropdownWidth = 100;\r\n\t }\r\n\t dropdownCopy.remove();\r\n\t\t\r\n\t\t$(\".menu-tabs .nav-tabs .dropdown-menu\").empty();\r\n\t\t$(\".menu-tabs .nav-tabs li[role='presentation']\").each(function(index) {\r\n\t\t\t$(this).removeClass(\"hidden\");\r\n\t\t\ttabsWidth = tabsWidth + $(this).width();\r\n\r\n // check if there is space for tabs and dropdown\r\n\t\t\tif (tabsWidth > totalWidth || (totalWidth - tabsWidth) < dropdownWidth) {\r\n\t\t\t\t$(this).clone().appendTo(\".menu-tabs .nav-tabs .dropdown-menu\");\r\n\t\t\t\t$(this).addClass(\"hidden\");\r\n\t\t\t}\r\n\t\t});\r\n\t\tif (tabsWidth > totalWidth || (totalWidth - tabsWidth) < dropdownWidth) {\r\n\t\t\t$(\".menu-tabs .nav-tabs .dropdown\").removeClass(\"hidden\");\r\n\t\t}else{\r\n\t\t\t$(\".menu-tabs .nav-tabs .dropdown\").addClass(\"hidden\");\r\n\t\t}\r\n\t}\r\n}\r\n\r\n$(\".my-booking, #welcome\").on(\"click\", \".logout\", function (e) {\r\n e.preventDefault();\r\n\r\n $.removeCookie(\"mybooking\", { path: '/' });\r\n window.location.href = this.href;\r\n\r\n return false;\r\n});","angular.module('stg.travify.resources').factory('authResource', ['$http', function authResource($http) {\r\n\r\n return {\r\n getAuthToken: function () {\r\n return $http.get(\"/Umbraco/api/Auth/GetAuthTokenAsync?brandId=\" + getBrand(),\r\n 'Could not retrive authorization token');\r\n }\r\n };\r\n}]);\r\n\r\nfunction getBrand() {\r\n var brandId = \"\";\r\n var hostName = window.location.hostname.replace(\"www.\", \"\").replace(\"test.\", \"\").replace(\"staging.\", \"\").replace(\"oerskov.\", \"\").replace(\"umbraco.io\", \"\").replace(\".local\", \"\");\r\n\r\n switch (hostName) {\r\n case \"hojmark.dk\":\r\n brandId = \"6\";\r\n break;\r\n case \"lionalpin.se\":\r\n brandId = \"12\";\r\n break;\r\n case \"lionalpin.no\":\r\n brandId = \"9\";\r\n break;\r\n case \"alpeffecthotels.com\":\r\n brandId = \"13\";\r\n break;\r\n case \"alpeffecthotels.at\":\r\n brandId = \"13\";\r\n break;\r\n case \"skirejser.dk\":\r\n brandId = \"1\";\r\n break;\r\n case \"vinterly.dk\":\r\n brandId = \"11\";\r\n break;\r\n case \"onlineski.dk\":\r\n brandId = \"10\";\r\n break;\r\n default:\r\n brandId = \"\";\r\n }\r\n\r\n return brandId;\r\n}","!function(root, factory) {\n \"function\" == typeof define && define.amd ? // AMD. Register as an anonymous module unless amdModuleId is set\n define([], function() {\n return root.svg4everybody = factory();\n }) : \"object\" == typeof exports ? module.exports = factory() : root.svg4everybody = factory();\n}(this, function() {\n /*! svg4everybody v2.0.3 | github.com/jonathantneal/svg4everybody */\n function embed(svg, target) {\n // if the target exists\n if (target) {\n // create a document fragment to hold the contents of the target\n var fragment = document.createDocumentFragment(), viewBox = !svg.getAttribute(\"viewBox\") && target.getAttribute(\"viewBox\");\n // conditionally set the viewBox on the svg\n viewBox && svg.setAttribute(\"viewBox\", viewBox);\n // copy the contents of the clone into the fragment\n for (// clone the target\n var clone = target.cloneNode(!0); clone.childNodes.length; ) {\n fragment.appendChild(clone.firstChild);\n }\n // append the fragment into the svg\n svg.appendChild(fragment);\n }\n }\n function loadreadystatechange(xhr) {\n // listen to changes in the request\n xhr.onreadystatechange = function() {\n // if the request is ready\n if (4 === xhr.readyState) {\n // get the cached html document\n var cachedDocument = xhr._cachedDocument;\n // ensure the cached html document based on the xhr response\n cachedDocument || (cachedDocument = xhr._cachedDocument = document.implementation.createHTMLDocument(\"\"), \n cachedDocument.body.innerHTML = xhr.responseText, xhr._cachedTarget = {}), // clear the xhr embeds list and embed each item\n xhr._embeds.splice(0).map(function(item) {\n // get the cached target\n var target = xhr._cachedTarget[item.id];\n // ensure the cached target\n target || (target = xhr._cachedTarget[item.id] = cachedDocument.getElementById(item.id)), \n // embed the target into the svg\n embed(item.svg, target);\n });\n }\n }, // test the ready state change immediately\n xhr.onreadystatechange();\n }\n function svg4everybody(rawopts) {\n function oninterval() {\n // while the index exists in the live collection\n for (// get the cached index\n var index = 0; index < uses.length; ) {\n // get the current \n var use = uses[index], svg = use.parentNode;\n if (svg && /svg/i.test(svg.nodeName)) {\n var src = use.getAttribute(\"xlink:href\");\n if (polyfill && (!opts.validate || opts.validate(src, svg, use))) {\n // remove the element\n svg.removeChild(use);\n // parse the src and get the url and id\n var srcSplit = src.split(\"#\"), url = srcSplit.shift(), id = srcSplit.join(\"#\");\n // if the link is external\n if (url.length) {\n // get the cached xhr request\n var xhr = requests[url];\n // ensure the xhr request exists\n xhr || (xhr = requests[url] = new XMLHttpRequest(), xhr.open(\"GET\", url), xhr.send(), \n xhr._embeds = []), // add the svg and id as an item to the xhr embeds list\n xhr._embeds.push({\n svg: svg,\n id: id\n }), // prepare the xhr ready state change event\n loadreadystatechange(xhr);\n } else {\n // embed the local id into the svg\n embed(svg, document.getElementById(id));\n }\n }\n } else {\n // increase the index when the previous value was not \"valid\"\n ++index;\n }\n }\n // continue the interval\n requestAnimationFrame(oninterval, 67);\n }\n var polyfill, opts = Object(rawopts), newerIEUA = /\\bTrident\\/[567]\\b|\\bMSIE (?:9|10)\\.0\\b/, webkitUA = /\\bAppleWebKit\\/(\\d+)\\b/, olderEdgeUA = /\\bEdge\\/12\\.(\\d+)\\b/;\n polyfill = \"polyfill\" in opts ? opts.polyfill : newerIEUA.test(navigator.userAgent) || (navigator.userAgent.match(olderEdgeUA) || [])[1] < 10547 || (navigator.userAgent.match(webkitUA) || [])[1] < 537;\n // create xhr requests object\n var requests = {}, requestAnimationFrame = window.requestAnimationFrame || setTimeout, uses = document.getElementsByTagName(\"use\");\n // conditionally start the interval if the polyfill is active\n polyfill && oninterval();\n }\n return svg4everybody;\n});","/*! picturefill - v3.0.2 - 2016-02-12\n * https://scottjehl.github.io/picturefill/\n * Copyright (c) 2016 https://github.com/scottjehl/picturefill/blob/master/Authors.txt; Licensed MIT\n */\n/*! Gecko-Picture - v1.0\n * https://github.com/scottjehl/picturefill/tree/3.0/src/plugins/gecko-picture\n * Firefox's early picture implementation (prior to FF41) is static and does\n * not react to viewport changes. This tiny module fixes this.\n */\n(function(window) {\n\t/*jshint eqnull:true */\n\tvar ua = navigator.userAgent;\n\n\tif ( window.HTMLPictureElement && ((/ecko/).test(ua) && ua.match(/rv\\:(\\d+)/) && RegExp.$1 < 45) ) {\n\t\taddEventListener(\"resize\", (function() {\n\t\t\tvar timer;\n\n\t\t\tvar dummySrc = document.createElement(\"source\");\n\n\t\t\tvar fixRespimg = function(img) {\n\t\t\t\tvar source, sizes;\n\t\t\t\tvar picture = img.parentNode;\n\n\t\t\t\tif (picture.nodeName.toUpperCase() === \"PICTURE\") {\n\t\t\t\t\tsource = dummySrc.cloneNode();\n\n\t\t\t\t\tpicture.insertBefore(source, picture.firstElementChild);\n\t\t\t\t\tsetTimeout(function() {\n\t\t\t\t\t\tpicture.removeChild(source);\n\t\t\t\t\t});\n\t\t\t\t} else if (!img._pfLastSize || img.offsetWidth > img._pfLastSize) {\n\t\t\t\t\timg._pfLastSize = img.offsetWidth;\n\t\t\t\t\tsizes = img.sizes;\n\t\t\t\t\timg.sizes += \",100vw\";\n\t\t\t\t\tsetTimeout(function() {\n\t\t\t\t\t\timg.sizes = sizes;\n\t\t\t\t\t});\n\t\t\t\t}\n\t\t\t};\n\n\t\t\tvar findPictureImgs = function() {\n\t\t\t\tvar i;\n\t\t\t\tvar imgs = document.querySelectorAll(\"picture > img, img[srcset][sizes]\");\n\t\t\t\tfor (i = 0; i < imgs.length; i++) {\n\t\t\t\t\tfixRespimg(imgs[i]);\n\t\t\t\t}\n\t\t\t};\n\t\t\tvar onResize = function() {\n\t\t\t\tclearTimeout(timer);\n\t\t\t\ttimer = setTimeout(findPictureImgs, 99);\n\t\t\t};\n\t\t\tvar mq = window.matchMedia && matchMedia(\"(orientation: landscape)\");\n\t\t\tvar init = function() {\n\t\t\t\tonResize();\n\n\t\t\t\tif (mq && mq.addListener) {\n\t\t\t\t\tmq.addListener(onResize);\n\t\t\t\t}\n\t\t\t};\n\n\t\t\tdummySrc.srcset = \"data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==\";\n\n\t\t\tif (/^[c|i]|d$/.test(document.readyState || \"\")) {\n\t\t\t\tinit();\n\t\t\t} else {\n\t\t\t\tdocument.addEventListener(\"DOMContentLoaded\", init);\n\t\t\t}\n\n\t\t\treturn onResize;\n\t\t})());\n\t}\n})(window);\n\n/*! Picturefill - v3.0.2\n * http://scottjehl.github.io/picturefill\n * Copyright (c) 2015 https://github.com/scottjehl/picturefill/blob/master/Authors.txt;\n * License: MIT\n */\n\n(function( window, document, undefined ) {\n\t// Enable strict mode\n\t\"use strict\";\n\n\t// HTML shim|v it for old IE (IE9 will still need the HTML video tag workaround)\n\tdocument.createElement( \"picture\" );\n\n\tvar warn, eminpx, alwaysCheckWDescriptor, evalId;\n\t// local object for method references and testing exposure\n\tvar pf = {};\n\tvar isSupportTestReady = false;\n\tvar noop = function() {};\n\tvar image = document.createElement( \"img\" );\n\tvar getImgAttr = image.getAttribute;\n\tvar setImgAttr = image.setAttribute;\n\tvar removeImgAttr = image.removeAttribute;\n\tvar docElem = document.documentElement;\n\tvar types = {};\n\tvar cfg = {\n\t\t//resource selection:\n\t\talgorithm: \"\"\n\t};\n\tvar srcAttr = \"data-pfsrc\";\n\tvar srcsetAttr = srcAttr + \"set\";\n\t// ua sniffing is done for undetectable img loading features,\n\t// to do some non crucial perf optimizations\n\tvar ua = navigator.userAgent;\n\tvar supportAbort = (/rident/).test(ua) || ((/ecko/).test(ua) && ua.match(/rv\\:(\\d+)/) && RegExp.$1 > 35 );\n\tvar curSrcProp = \"currentSrc\";\n\tvar regWDesc = /\\s+\\+?\\d+(e\\d+)?w/;\n\tvar regSize = /(\\([^)]+\\))?\\s*(.+)/;\n\tvar setOptions = window.picturefillCFG;\n\t/**\n\t * Shortcut property for https://w3c.github.io/webappsec/specs/mixedcontent/#restricts-mixed-content ( for easy overriding in tests )\n\t */\n\t// baseStyle also used by getEmValue (i.e.: width: 1em is important)\n\tvar baseStyle = \"position:absolute;left:0;visibility:hidden;display:block;padding:0;border:none;font-size:1em;width:1em;overflow:hidden;clip:rect(0px, 0px, 0px, 0px)\";\n\tvar fsCss = \"font-size:100%!important;\";\n\tvar isVwDirty = true;\n\n\tvar cssCache = {};\n\tvar sizeLengthCache = {};\n\tvar DPR = window.devicePixelRatio;\n\tvar units = {\n\t\tpx: 1,\n\t\t\"in\": 96\n\t};\n\tvar anchor = document.createElement( \"a\" );\n\t/**\n\t * alreadyRun flag used for setOptions. is it true setOptions will reevaluate\n\t * @type {boolean}\n\t */\n\tvar alreadyRun = false;\n\n\t// Reusable, non-\"g\" Regexes\n\n\t// (Don't use \\s, to avoid matching non-breaking space.)\n\tvar regexLeadingSpaces = /^[ \\t\\n\\r\\u000c]+/,\n\t regexLeadingCommasOrSpaces = /^[, \\t\\n\\r\\u000c]+/,\n\t regexLeadingNotSpaces = /^[^ \\t\\n\\r\\u000c]+/,\n\t regexTrailingCommas = /[,]+$/,\n\t regexNonNegativeInteger = /^\\d+$/,\n\n\t // ( Positive or negative or unsigned integers or decimals, without or without exponents.\n\t // Must include at least one digit.\n\t // According to spec tests any decimal point must be followed by a digit.\n\t // No leading plus sign is allowed.)\n\t // https://html.spec.whatwg.org/multipage/infrastructure.html#valid-floating-point-number\n\t regexFloatingPoint = /^-?(?:[0-9]+|[0-9]*\\.[0-9]+)(?:[eE][+-]?[0-9]+)?$/;\n\n\tvar on = function(obj, evt, fn, capture) {\n\t\tif ( obj.addEventListener ) {\n\t\t\tobj.addEventListener(evt, fn, capture || false);\n\t\t} else if ( obj.attachEvent ) {\n\t\t\tobj.attachEvent( \"on\" + evt, fn);\n\t\t}\n\t};\n\n\t/**\n\t * simple memoize function:\n\t */\n\n\tvar memoize = function(fn) {\n\t\tvar cache = {};\n\t\treturn function(input) {\n\t\t\tif ( !(input in cache) ) {\n\t\t\t\tcache[ input ] = fn(input);\n\t\t\t}\n\t\t\treturn cache[ input ];\n\t\t};\n\t};\n\n\t// UTILITY FUNCTIONS\n\n\t// Manual is faster than RegEx\n\t// http://jsperf.com/whitespace-character/5\n\tfunction isSpace(c) {\n\t\treturn (c === \"\\u0020\" || // space\n\t\t c === \"\\u0009\" || // horizontal tab\n\t\t c === \"\\u000A\" || // new line\n\t\t c === \"\\u000C\" || // form feed\n\t\t c === \"\\u000D\"); // carriage return\n\t}\n\n\t/**\n\t * gets a mediaquery and returns a boolean or gets a css length and returns a number\n\t * @param css mediaqueries or css length\n\t * @returns {boolean|number}\n\t *\n\t * based on: https://gist.github.com/jonathantneal/db4f77009b155f083738\n\t */\n\tvar evalCSS = (function() {\n\n\t\tvar regLength = /^([\\d\\.]+)(em|vw|px)$/;\n\t\tvar replace = function() {\n\t\t\tvar args = arguments, index = 0, string = args[0];\n\t\t\twhile (++index in args) {\n\t\t\t\tstring = string.replace(args[index], args[++index]);\n\t\t\t}\n\t\t\treturn string;\n\t\t};\n\n\t\tvar buildStr = memoize(function(css) {\n\n\t\t\treturn \"return \" + replace((css || \"\").toLowerCase(),\n\t\t\t\t// interpret `and`\n\t\t\t\t/\\band\\b/g, \"&&\",\n\n\t\t\t\t// interpret `,`\n\t\t\t\t/,/g, \"||\",\n\n\t\t\t\t// interpret `min-` as >=\n\t\t\t\t/min-([a-z-\\s]+):/g, \"e.$1>=\",\n\n\t\t\t\t// interpret `max-` as <=\n\t\t\t\t/max-([a-z-\\s]+):/g, \"e.$1<=\",\n\n\t\t\t\t//calc value\n\t\t\t\t/calc([^)]+)/g, \"($1)\",\n\n\t\t\t\t// interpret css values\n\t\t\t\t/(\\d+[\\.]*[\\d]*)([a-z]+)/g, \"($1 * e.$2)\",\n\t\t\t\t//make eval less evil\n\t\t\t\t/^(?!(e.[a-z]|[0-9\\.&=|><\\+\\-\\*\\(\\)\\/])).*/ig, \"\"\n\t\t\t) + \";\";\n\t\t});\n\n\t\treturn function(css, length) {\n\t\t\tvar parsedLength;\n\t\t\tif (!(css in cssCache)) {\n\t\t\t\tcssCache[css] = false;\n\t\t\t\tif (length && (parsedLength = css.match( regLength ))) {\n\t\t\t\t\tcssCache[css] = parsedLength[ 1 ] * units[parsedLength[ 2 ]];\n\t\t\t\t} else {\n\t\t\t\t\t/*jshint evil:true */\n\t\t\t\t\ttry{\n\t\t\t\t\t\tcssCache[css] = new Function(\"e\", buildStr(css))(units);\n\t\t\t\t\t} catch(e) {}\n\t\t\t\t\t/*jshint evil:false */\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn cssCache[css];\n\t\t};\n\t})();\n\n\tvar setResolution = function( candidate, sizesattr ) {\n\t\tif ( candidate.w ) { // h = means height: || descriptor.type === 'h' do not handle yet...\n\t\t\tcandidate.cWidth = pf.calcListLength( sizesattr || \"100vw\" );\n\t\t\tcandidate.res = candidate.w / candidate.cWidth ;\n\t\t} else {\n\t\t\tcandidate.res = candidate.d;\n\t\t}\n\t\treturn candidate;\n\t};\n\n\t/**\n\t *\n\t * @param opt\n\t */\n\tvar picturefill = function( opt ) {\n\n\t\tif (!isSupportTestReady) {return;}\n\n\t\tvar elements, i, plen;\n\n\t\tvar options = opt || {};\n\n\t\tif ( options.elements && options.elements.nodeType === 1 ) {\n\t\t\tif ( options.elements.nodeName.toUpperCase() === \"IMG\" ) {\n\t\t\t\toptions.elements = [ options.elements ];\n\t\t\t} else {\n\t\t\t\toptions.context = options.elements;\n\t\t\t\toptions.elements = null;\n\t\t\t}\n\t\t}\n\n\t\telements = options.elements || pf.qsa( (options.context || document), ( options.reevaluate || options.reselect ) ? pf.sel : pf.selShort );\n\n\t\tif ( (plen = elements.length) ) {\n\n\t\t\tpf.setupRun( options );\n\t\t\talreadyRun = true;\n\n\t\t\t// Loop through all elements\n\t\t\tfor ( i = 0; i < plen; i++ ) {\n\t\t\t\tpf.fillImg(elements[ i ], options);\n\t\t\t}\n\n\t\t\tpf.teardownRun( options );\n\t\t}\n\t};\n\n\t/**\n\t * outputs a warning for the developer\n\t * @param {message}\n\t * @type {Function}\n\t */\n\twarn = ( window.console && console.warn ) ?\n\t\tfunction( message ) {\n\t\t\tconsole.warn( message );\n\t\t} :\n\t\tnoop\n\t;\n\n\tif ( !(curSrcProp in image) ) {\n\t\tcurSrcProp = \"src\";\n\t}\n\n\t// Add support for standard mime types.\n\ttypes[ \"image/jpeg\" ] = true;\n\ttypes[ \"image/gif\" ] = true;\n\ttypes[ \"image/png\" ] = true;\n\n\tfunction detectTypeSupport( type, typeUri ) {\n\t\t// based on Modernizr's lossless img-webp test\n\t\t// note: asynchronous\n\t\tvar image = new window.Image();\n\t\timage.onerror = function() {\n\t\t\ttypes[ type ] = false;\n\t\t\tpicturefill();\n\t\t};\n\t\timage.onload = function() {\n\t\t\ttypes[ type ] = image.width === 1;\n\t\t\tpicturefill();\n\t\t};\n\t\timage.src = typeUri;\n\t\treturn \"pending\";\n\t}\n\n\t// test svg support\n\ttypes[ \"image/svg+xml\" ] = document.implementation.hasFeature( \"http://www.w3.org/TR/SVG11/feature#Image\", \"1.1\" );\n\n\t/**\n\t * updates the internal vW property with the current viewport width in px\n\t */\n\tfunction updateMetrics() {\n\n\t\tisVwDirty = false;\n\t\tDPR = window.devicePixelRatio;\n\t\tcssCache = {};\n\t\tsizeLengthCache = {};\n\n\t\tpf.DPR = DPR || 1;\n\n\t\tunits.width = Math.max(window.innerWidth || 0, docElem.clientWidth);\n\t\tunits.height = Math.max(window.innerHeight || 0, docElem.clientHeight);\n\n\t\tunits.vw = units.width / 100;\n\t\tunits.vh = units.height / 100;\n\n\t\tevalId = [ units.height, units.width, DPR ].join(\"-\");\n\n\t\tunits.em = pf.getEmValue();\n\t\tunits.rem = units.em;\n\t}\n\n\tfunction chooseLowRes( lowerValue, higherValue, dprValue, isCached ) {\n\t\tvar bonusFactor, tooMuch, bonus, meanDensity;\n\n\t\t//experimental\n\t\tif (cfg.algorithm === \"saveData\" ){\n\t\t\tif ( lowerValue > 2.7 ) {\n\t\t\t\tmeanDensity = dprValue + 1;\n\t\t\t} else {\n\t\t\t\ttooMuch = higherValue - dprValue;\n\t\t\t\tbonusFactor = Math.pow(lowerValue - 0.6, 1.5);\n\n\t\t\t\tbonus = tooMuch * bonusFactor;\n\n\t\t\t\tif (isCached) {\n\t\t\t\t\tbonus += 0.1 * bonusFactor;\n\t\t\t\t}\n\n\t\t\t\tmeanDensity = lowerValue + bonus;\n\t\t\t}\n\t\t} else {\n\t\t\tmeanDensity = (dprValue > 1) ?\n\t\t\t\tMath.sqrt(lowerValue * higherValue) :\n\t\t\t\tlowerValue;\n\t\t}\n\n\t\treturn meanDensity > dprValue;\n\t}\n\n\tfunction applyBestCandidate( img ) {\n\t\tvar srcSetCandidates;\n\t\tvar matchingSet = pf.getSet( img );\n\t\tvar evaluated = false;\n\t\tif ( matchingSet !== \"pending\" ) {\n\t\t\tevaluated = evalId;\n\t\t\tif ( matchingSet ) {\n\t\t\t\tsrcSetCandidates = pf.setRes( matchingSet );\n\t\t\t\tpf.applySetCandidate( srcSetCandidates, img );\n\t\t\t}\n\t\t}\n\t\timg[ pf.ns ].evaled = evaluated;\n\t}\n\n\tfunction ascendingSort( a, b ) {\n\t\treturn a.res - b.res;\n\t}\n\n\tfunction setSrcToCur( img, src, set ) {\n\t\tvar candidate;\n\t\tif ( !set && src ) {\n\t\t\tset = img[ pf.ns ].sets;\n\t\t\tset = set && set[set.length - 1];\n\t\t}\n\n\t\tcandidate = getCandidateForSrc(src, set);\n\n\t\tif ( candidate ) {\n\t\t\tsrc = pf.makeUrl(src);\n\t\t\timg[ pf.ns ].curSrc = src;\n\t\t\timg[ pf.ns ].curCan = candidate;\n\n\t\t\tif ( !candidate.res ) {\n\t\t\t\tsetResolution( candidate, candidate.set.sizes );\n\t\t\t}\n\t\t}\n\t\treturn candidate;\n\t}\n\n\tfunction getCandidateForSrc( src, set ) {\n\t\tvar i, candidate, candidates;\n\t\tif ( src && set ) {\n\t\t\tcandidates = pf.parseSet( set );\n\t\t\tsrc = pf.makeUrl(src);\n\t\t\tfor ( i = 0; i < candidates.length; i++ ) {\n\t\t\t\tif ( src === pf.makeUrl(candidates[ i ].url) ) {\n\t\t\t\t\tcandidate = candidates[ i ];\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn candidate;\n\t}\n\n\tfunction getAllSourceElements( picture, candidates ) {\n\t\tvar i, len, source, srcset;\n\n\t\t// SPEC mismatch intended for size and perf:\n\t\t// actually only source elements preceding the img should be used\n\t\t// also note: don't use qsa here, because IE8 sometimes doesn't like source as the key part in a selector\n\t\tvar sources = picture.getElementsByTagName( \"source\" );\n\n\t\tfor ( i = 0, len = sources.length; i < len; i++ ) {\n\t\t\tsource = sources[ i ];\n\t\t\tsource[ pf.ns ] = true;\n\t\t\tsrcset = source.getAttribute( \"srcset\" );\n\n\t\t\t// if source does not have a srcset attribute, skip\n\t\t\tif ( srcset ) {\n\t\t\t\tcandidates.push( {\n\t\t\t\t\tsrcset: srcset,\n\t\t\t\t\tmedia: source.getAttribute( \"media\" ),\n\t\t\t\t\ttype: source.getAttribute( \"type\" ),\n\t\t\t\t\tsizes: source.getAttribute( \"sizes\" )\n\t\t\t\t} );\n\t\t\t}\n\t\t}\n\t}\n\n\t/**\n\t * Srcset Parser\n\t * By Alex Bell | MIT License\n\t *\n\t * @returns Array [{url: _, d: _, w: _, h:_, set:_(????)}, ...]\n\t *\n\t * Based super duper closely on the reference algorithm at:\n\t * https://html.spec.whatwg.org/multipage/embedded-content.html#parse-a-srcset-attribute\n\t */\n\n\t// 1. Let input be the value passed to this algorithm.\n\t// (TO-DO : Explain what \"set\" argument is here. Maybe choose a more\n\t// descriptive & more searchable name. Since passing the \"set\" in really has\n\t// nothing to do with parsing proper, I would prefer this assignment eventually\n\t// go in an external fn.)\n\tfunction parseSrcset(input, set) {\n\n\t\tfunction collectCharacters(regEx) {\n\t\t\tvar chars,\n\t\t\t match = regEx.exec(input.substring(pos));\n\t\t\tif (match) {\n\t\t\t\tchars = match[ 0 ];\n\t\t\t\tpos += chars.length;\n\t\t\t\treturn chars;\n\t\t\t}\n\t\t}\n\n\t\tvar inputLength = input.length,\n\t\t url,\n\t\t descriptors,\n\t\t currentDescriptor,\n\t\t state,\n\t\t c,\n\n\t\t // 2. Let position be a pointer into input, initially pointing at the start\n\t\t // of the string.\n\t\t pos = 0,\n\n\t\t // 3. Let candidates be an initially empty source set.\n\t\t candidates = [];\n\n\t\t/**\n\t\t* Adds descriptor properties to a candidate, pushes to the candidates array\n\t\t* @return undefined\n\t\t*/\n\t\t// (Declared outside of the while loop so that it's only created once.\n\t\t// (This fn is defined before it is used, in order to pass JSHINT.\n\t\t// Unfortunately this breaks the sequencing of the spec comments. :/ )\n\t\tfunction parseDescriptors() {\n\n\t\t\t// 9. Descriptor parser: Let error be no.\n\t\t\tvar pError = false,\n\n\t\t\t// 10. Let width be absent.\n\t\t\t// 11. Let density be absent.\n\t\t\t// 12. Let future-compat-h be absent. (We're implementing it now as h)\n\t\t\t w, d, h, i,\n\t\t\t candidate = {},\n\t\t\t desc, lastChar, value, intVal, floatVal;\n\n\t\t\t// 13. For each descriptor in descriptors, run the appropriate set of steps\n\t\t\t// from the following list:\n\t\t\tfor (i = 0 ; i < descriptors.length; i++) {\n\t\t\t\tdesc = descriptors[ i ];\n\n\t\t\t\tlastChar = desc[ desc.length - 1 ];\n\t\t\t\tvalue = desc.substring(0, desc.length - 1);\n\t\t\t\tintVal = parseInt(value, 10);\n\t\t\t\tfloatVal = parseFloat(value);\n\n\t\t\t\t// If the descriptor consists of a valid non-negative integer followed by\n\t\t\t\t// a U+0077 LATIN SMALL LETTER W character\n\t\t\t\tif (regexNonNegativeInteger.test(value) && (lastChar === \"w\")) {\n\n\t\t\t\t\t// If width and density are not both absent, then let error be yes.\n\t\t\t\t\tif (w || d) {pError = true;}\n\n\t\t\t\t\t// Apply the rules for parsing non-negative integers to the descriptor.\n\t\t\t\t\t// If the result is zero, let error be yes.\n\t\t\t\t\t// Otherwise, let width be the result.\n\t\t\t\t\tif (intVal === 0) {pError = true;} else {w = intVal;}\n\n\t\t\t\t// If the descriptor consists of a valid floating-point number followed by\n\t\t\t\t// a U+0078 LATIN SMALL LETTER X character\n\t\t\t\t} else if (regexFloatingPoint.test(value) && (lastChar === \"x\")) {\n\n\t\t\t\t\t// If width, density and future-compat-h are not all absent, then let error\n\t\t\t\t\t// be yes.\n\t\t\t\t\tif (w || d || h) {pError = true;}\n\n\t\t\t\t\t// Apply the rules for parsing floating-point number values to the descriptor.\n\t\t\t\t\t// If the result is less than zero, let error be yes. Otherwise, let density\n\t\t\t\t\t// be the result.\n\t\t\t\t\tif (floatVal < 0) {pError = true;} else {d = floatVal;}\n\n\t\t\t\t// If the descriptor consists of a valid non-negative integer followed by\n\t\t\t\t// a U+0068 LATIN SMALL LETTER H character\n\t\t\t\t} else if (regexNonNegativeInteger.test(value) && (lastChar === \"h\")) {\n\n\t\t\t\t\t// If height and density are not both absent, then let error be yes.\n\t\t\t\t\tif (h || d) {pError = true;}\n\n\t\t\t\t\t// Apply the rules for parsing non-negative integers to the descriptor.\n\t\t\t\t\t// If the result is zero, let error be yes. Otherwise, let future-compat-h\n\t\t\t\t\t// be the result.\n\t\t\t\t\tif (intVal === 0) {pError = true;} else {h = intVal;}\n\n\t\t\t\t// Anything else, Let error be yes.\n\t\t\t\t} else {pError = true;}\n\t\t\t} // (close step 13 for loop)\n\n\t\t\t// 15. If error is still no, then append a new image source to candidates whose\n\t\t\t// URL is url, associated with a width width if not absent and a pixel\n\t\t\t// density density if not absent. Otherwise, there is a parse error.\n\t\t\tif (!pError) {\n\t\t\t\tcandidate.url = url;\n\n\t\t\t\tif (w) { candidate.w = w;}\n\t\t\t\tif (d) { candidate.d = d;}\n\t\t\t\tif (h) { candidate.h = h;}\n\t\t\t\tif (!h && !d && !w) {candidate.d = 1;}\n\t\t\t\tif (candidate.d === 1) {set.has1x = true;}\n\t\t\t\tcandidate.set = set;\n\n\t\t\t\tcandidates.push(candidate);\n\t\t\t}\n\t\t} // (close parseDescriptors fn)\n\n\t\t/**\n\t\t* Tokenizes descriptor properties prior to parsing\n\t\t* Returns undefined.\n\t\t* (Again, this fn is defined before it is used, in order to pass JSHINT.\n\t\t* Unfortunately this breaks the logical sequencing of the spec comments. :/ )\n\t\t*/\n\t\tfunction tokenize() {\n\n\t\t\t// 8.1. Descriptor tokeniser: Skip whitespace\n\t\t\tcollectCharacters(regexLeadingSpaces);\n\n\t\t\t// 8.2. Let current descriptor be the empty string.\n\t\t\tcurrentDescriptor = \"\";\n\n\t\t\t// 8.3. Let state be in descriptor.\n\t\t\tstate = \"in descriptor\";\n\n\t\t\twhile (true) {\n\n\t\t\t\t// 8.4. Let c be the character at position.\n\t\t\t\tc = input.charAt(pos);\n\n\t\t\t\t// Do the following depending on the value of state.\n\t\t\t\t// For the purpose of this step, \"EOF\" is a special character representing\n\t\t\t\t// that position is past the end of input.\n\n\t\t\t\t// In descriptor\n\t\t\t\tif (state === \"in descriptor\") {\n\t\t\t\t\t// Do the following, depending on the value of c:\n\n\t\t\t\t // Space character\n\t\t\t\t // If current descriptor is not empty, append current descriptor to\n\t\t\t\t // descriptors and let current descriptor be the empty string.\n\t\t\t\t // Set state to after descriptor.\n\t\t\t\t\tif (isSpace(c)) {\n\t\t\t\t\t\tif (currentDescriptor) {\n\t\t\t\t\t\t\tdescriptors.push(currentDescriptor);\n\t\t\t\t\t\t\tcurrentDescriptor = \"\";\n\t\t\t\t\t\t\tstate = \"after descriptor\";\n\t\t\t\t\t\t}\n\n\t\t\t\t\t// U+002C COMMA (,)\n\t\t\t\t\t// Advance position to the next character in input. If current descriptor\n\t\t\t\t\t// is not empty, append current descriptor to descriptors. Jump to the step\n\t\t\t\t\t// labeled descriptor parser.\n\t\t\t\t\t} else if (c === \",\") {\n\t\t\t\t\t\tpos += 1;\n\t\t\t\t\t\tif (currentDescriptor) {\n\t\t\t\t\t\t\tdescriptors.push(currentDescriptor);\n\t\t\t\t\t\t}\n\t\t\t\t\t\tparseDescriptors();\n\t\t\t\t\t\treturn;\n\n\t\t\t\t\t// U+0028 LEFT PARENTHESIS (()\n\t\t\t\t\t// Append c to current descriptor. Set state to in parens.\n\t\t\t\t\t} else if (c === \"\\u0028\") {\n\t\t\t\t\t\tcurrentDescriptor = currentDescriptor + c;\n\t\t\t\t\t\tstate = \"in parens\";\n\n\t\t\t\t\t// EOF\n\t\t\t\t\t// If current descriptor is not empty, append current descriptor to\n\t\t\t\t\t// descriptors. Jump to the step labeled descriptor parser.\n\t\t\t\t\t} else if (c === \"\") {\n\t\t\t\t\t\tif (currentDescriptor) {\n\t\t\t\t\t\t\tdescriptors.push(currentDescriptor);\n\t\t\t\t\t\t}\n\t\t\t\t\t\tparseDescriptors();\n\t\t\t\t\t\treturn;\n\n\t\t\t\t\t// Anything else\n\t\t\t\t\t// Append c to current descriptor.\n\t\t\t\t\t} else {\n\t\t\t\t\t\tcurrentDescriptor = currentDescriptor + c;\n\t\t\t\t\t}\n\t\t\t\t// (end \"in descriptor\"\n\n\t\t\t\t// In parens\n\t\t\t\t} else if (state === \"in parens\") {\n\n\t\t\t\t\t// U+0029 RIGHT PARENTHESIS ())\n\t\t\t\t\t// Append c to current descriptor. Set state to in descriptor.\n\t\t\t\t\tif (c === \")\") {\n\t\t\t\t\t\tcurrentDescriptor = currentDescriptor + c;\n\t\t\t\t\t\tstate = \"in descriptor\";\n\n\t\t\t\t\t// EOF\n\t\t\t\t\t// Append current descriptor to descriptors. Jump to the step labeled\n\t\t\t\t\t// descriptor parser.\n\t\t\t\t\t} else if (c === \"\") {\n\t\t\t\t\t\tdescriptors.push(currentDescriptor);\n\t\t\t\t\t\tparseDescriptors();\n\t\t\t\t\t\treturn;\n\n\t\t\t\t\t// Anything else\n\t\t\t\t\t// Append c to current descriptor.\n\t\t\t\t\t} else {\n\t\t\t\t\t\tcurrentDescriptor = currentDescriptor + c;\n\t\t\t\t\t}\n\n\t\t\t\t// After descriptor\n\t\t\t\t} else if (state === \"after descriptor\") {\n\n\t\t\t\t\t// Do the following, depending on the value of c:\n\t\t\t\t\t// Space character: Stay in this state.\n\t\t\t\t\tif (isSpace(c)) {\n\n\t\t\t\t\t// EOF: Jump to the step labeled descriptor parser.\n\t\t\t\t\t} else if (c === \"\") {\n\t\t\t\t\t\tparseDescriptors();\n\t\t\t\t\t\treturn;\n\n\t\t\t\t\t// Anything else\n\t\t\t\t\t// Set state to in descriptor. Set position to the previous character in input.\n\t\t\t\t\t} else {\n\t\t\t\t\t\tstate = \"in descriptor\";\n\t\t\t\t\t\tpos -= 1;\n\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Advance position to the next character in input.\n\t\t\t\tpos += 1;\n\n\t\t\t// Repeat this step.\n\t\t\t} // (close while true loop)\n\t\t}\n\n\t\t// 4. Splitting loop: Collect a sequence of characters that are space\n\t\t// characters or U+002C COMMA characters. If any U+002C COMMA characters\n\t\t// were collected, that is a parse error.\n\t\twhile (true) {\n\t\t\tcollectCharacters(regexLeadingCommasOrSpaces);\n\n\t\t\t// 5. If position is past the end of input, return candidates and abort these steps.\n\t\t\tif (pos >= inputLength) {\n\t\t\t\treturn candidates; // (we're done, this is the sole return path)\n\t\t\t}\n\n\t\t\t// 6. Collect a sequence of characters that are not space characters,\n\t\t\t// and let that be url.\n\t\t\turl = collectCharacters(regexLeadingNotSpaces);\n\n\t\t\t// 7. Let descriptors be a new empty list.\n\t\t\tdescriptors = [];\n\n\t\t\t// 8. If url ends with a U+002C COMMA character (,), follow these substeps:\n\t\t\t//\t\t(1). Remove all trailing U+002C COMMA characters from url. If this removed\n\t\t\t// more than one character, that is a parse error.\n\t\t\tif (url.slice(-1) === \",\") {\n\t\t\t\turl = url.replace(regexTrailingCommas, \"\");\n\t\t\t\t// (Jump ahead to step 9 to skip tokenization and just push the candidate).\n\t\t\t\tparseDescriptors();\n\n\t\t\t//\tOtherwise, follow these substeps:\n\t\t\t} else {\n\t\t\t\ttokenize();\n\t\t\t} // (close else of step 8)\n\n\t\t// 16. Return to the step labeled splitting loop.\n\t\t} // (Close of big while loop.)\n\t}\n\n\t/*\n\t * Sizes Parser\n\t *\n\t * By Alex Bell | MIT License\n\t *\n\t * Non-strict but accurate and lightweight JS Parser for the string value \n\t *\n\t * Reference algorithm at:\n\t * https://html.spec.whatwg.org/multipage/embedded-content.html#parse-a-sizes-attribute\n\t *\n\t * Most comments are copied in directly from the spec\n\t * (except for comments in parens).\n\t *\n\t * Grammar is:\n\t * = # [ , ]? | \n\t * = \n\t * = \n\t * http://www.w3.org/html/wg/drafts/html/master/embedded-content.html#attr-img-sizes\n\t *\n\t * E.g. \"(max-width: 30em) 100vw, (max-width: 50em) 70vw, 100vw\"\n\t * or \"(min-width: 30em), calc(30vw - 15px)\" or just \"30vw\"\n\t *\n\t * Returns the first valid with a media condition that evaluates to true,\n\t * or \"100vw\" if all valid media conditions evaluate to false.\n\t *\n\t */\n\n\tfunction parseSizes(strValue) {\n\n\t\t// (Percentage CSS lengths are not allowed in this case, to avoid confusion:\n\t\t// https://html.spec.whatwg.org/multipage/embedded-content.html#valid-source-size-list\n\t\t// CSS allows a single optional plus or minus sign:\n\t\t// http://www.w3.org/TR/CSS2/syndata.html#numbers\n\t\t// CSS is ASCII case-insensitive:\n\t\t// http://www.w3.org/TR/CSS2/syndata.html#characters )\n\t\t// Spec allows exponential notation for type:\n\t\t// http://dev.w3.org/csswg/css-values/#numbers\n\t\tvar regexCssLengthWithUnits = /^(?:[+-]?[0-9]+|[0-9]*\\.[0-9]+)(?:[eE][+-]?[0-9]+)?(?:ch|cm|em|ex|in|mm|pc|pt|px|rem|vh|vmin|vmax|vw)$/i;\n\n\t\t// (This is a quick and lenient test. Because of optional unlimited-depth internal\n\t\t// grouping parens and strict spacing rules, this could get very complicated.)\n\t\tvar regexCssCalc = /^calc\\((?:[0-9a-z \\.\\+\\-\\*\\/\\(\\)]+)\\)$/i;\n\n\t\tvar i;\n\t\tvar unparsedSizesList;\n\t\tvar unparsedSizesListLength;\n\t\tvar unparsedSize;\n\t\tvar lastComponentValue;\n\t\tvar size;\n\n\t\t// UTILITY FUNCTIONS\n\n\t\t// (Toy CSS parser. The goals here are:\n\t\t// 1) expansive test coverage without the weight of a full CSS parser.\n\t\t// 2) Avoiding regex wherever convenient.\n\t\t// Quick tests: http://jsfiddle.net/gtntL4gr/3/\n\t\t// Returns an array of arrays.)\n\t\tfunction parseComponentValues(str) {\n\t\t\tvar chrctr;\n\t\t\tvar component = \"\";\n\t\t\tvar componentArray = [];\n\t\t\tvar listArray = [];\n\t\t\tvar parenDepth = 0;\n\t\t\tvar pos = 0;\n\t\t\tvar inComment = false;\n\n\t\t\tfunction pushComponent() {\n\t\t\t\tif (component) {\n\t\t\t\t\tcomponentArray.push(component);\n\t\t\t\t\tcomponent = \"\";\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tfunction pushComponentArray() {\n\t\t\t\tif (componentArray[0]) {\n\t\t\t\t\tlistArray.push(componentArray);\n\t\t\t\t\tcomponentArray = [];\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// (Loop forwards from the beginning of the string.)\n\t\t\twhile (true) {\n\t\t\t\tchrctr = str.charAt(pos);\n\n\t\t\t\tif (chrctr === \"\") { // ( End of string reached.)\n\t\t\t\t\tpushComponent();\n\t\t\t\t\tpushComponentArray();\n\t\t\t\t\treturn listArray;\n\t\t\t\t} else if (inComment) {\n\t\t\t\t\tif ((chrctr === \"*\") && (str[pos + 1] === \"/\")) { // (At end of a comment.)\n\t\t\t\t\t\tinComment = false;\n\t\t\t\t\t\tpos += 2;\n\t\t\t\t\t\tpushComponent();\n\t\t\t\t\t\tcontinue;\n\t\t\t\t\t} else {\n\t\t\t\t\t\tpos += 1; // (Skip all characters inside comments.)\n\t\t\t\t\t\tcontinue;\n\t\t\t\t\t}\n\t\t\t\t} else if (isSpace(chrctr)) {\n\t\t\t\t\t// (If previous character in loop was also a space, or if\n\t\t\t\t\t// at the beginning of the string, do not add space char to\n\t\t\t\t\t// component.)\n\t\t\t\t\tif ( (str.charAt(pos - 1) && isSpace( str.charAt(pos - 1) ) ) || !component ) {\n\t\t\t\t\t\tpos += 1;\n\t\t\t\t\t\tcontinue;\n\t\t\t\t\t} else if (parenDepth === 0) {\n\t\t\t\t\t\tpushComponent();\n\t\t\t\t\t\tpos +=1;\n\t\t\t\t\t\tcontinue;\n\t\t\t\t\t} else {\n\t\t\t\t\t\t// (Replace any space character with a plain space for legibility.)\n\t\t\t\t\t\tchrctr = \" \";\n\t\t\t\t\t}\n\t\t\t\t} else if (chrctr === \"(\") {\n\t\t\t\t\tparenDepth += 1;\n\t\t\t\t} else if (chrctr === \")\") {\n\t\t\t\t\tparenDepth -= 1;\n\t\t\t\t} else if (chrctr === \",\") {\n\t\t\t\t\tpushComponent();\n\t\t\t\t\tpushComponentArray();\n\t\t\t\t\tpos += 1;\n\t\t\t\t\tcontinue;\n\t\t\t\t} else if ( (chrctr === \"/\") && (str.charAt(pos + 1) === \"*\") ) {\n\t\t\t\t\tinComment = true;\n\t\t\t\t\tpos += 2;\n\t\t\t\t\tcontinue;\n\t\t\t\t}\n\n\t\t\t\tcomponent = component + chrctr;\n\t\t\t\tpos += 1;\n\t\t\t}\n\t\t}\n\n\t\tfunction isValidNonNegativeSourceSizeValue(s) {\n\t\t\tif (regexCssLengthWithUnits.test(s) && (parseFloat(s) >= 0)) {return true;}\n\t\t\tif (regexCssCalc.test(s)) {return true;}\n\t\t\t// ( http://www.w3.org/TR/CSS2/syndata.html#numbers says:\n\t\t\t// \"-0 is equivalent to 0 and is not a negative number.\" which means that\n\t\t\t// unitless zero and unitless negative zero must be accepted as special cases.)\n\t\t\tif ((s === \"0\") || (s === \"-0\") || (s === \"+0\")) {return true;}\n\t\t\treturn false;\n\t\t}\n\n\t\t// When asked to parse a sizes attribute from an element, parse a\n\t\t// comma-separated list of component values from the value of the element's\n\t\t// sizes attribute (or the empty string, if the attribute is absent), and let\n\t\t// unparsed sizes list be the result.\n\t\t// http://dev.w3.org/csswg/css-syntax/#parse-comma-separated-list-of-component-values\n\n\t\tunparsedSizesList = parseComponentValues(strValue);\n\t\tunparsedSizesListLength = unparsedSizesList.length;\n\n\t\t// For each unparsed size in unparsed sizes list:\n\t\tfor (i = 0; i < unparsedSizesListLength; i++) {\n\t\t\tunparsedSize = unparsedSizesList[i];\n\n\t\t\t// 1. Remove all consecutive s from the end of unparsed size.\n\t\t\t// ( parseComponentValues() already omits spaces outside of parens. )\n\n\t\t\t// If unparsed size is now empty, that is a parse error; continue to the next\n\t\t\t// iteration of this algorithm.\n\t\t\t// ( parseComponentValues() won't push an empty array. )\n\n\t\t\t// 2. If the last component value in unparsed size is a valid non-negative\n\t\t\t// , let size be its value and remove the component value\n\t\t\t// from unparsed size. Any CSS function other than the calc() function is\n\t\t\t// invalid. Otherwise, there is a parse error; continue to the next iteration\n\t\t\t// of this algorithm.\n\t\t\t// http://dev.w3.org/csswg/css-syntax/#parse-component-value\n\t\t\tlastComponentValue = unparsedSize[unparsedSize.length - 1];\n\n\t\t\tif (isValidNonNegativeSourceSizeValue(lastComponentValue)) {\n\t\t\t\tsize = lastComponentValue;\n\t\t\t\tunparsedSize.pop();\n\t\t\t} else {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\t// 3. Remove all consecutive s from the end of unparsed\n\t\t\t// size. If unparsed size is now empty, return size and exit this algorithm.\n\t\t\t// If this was not the last item in unparsed sizes list, that is a parse error.\n\t\t\tif (unparsedSize.length === 0) {\n\t\t\t\treturn size;\n\t\t\t}\n\n\t\t\t// 4. Parse the remaining component values in unparsed size as a\n\t\t\t// . If it does not parse correctly, or it does parse\n\t\t\t// correctly but the evaluates to false, continue to the\n\t\t\t// next iteration of this algorithm.\n\t\t\t// (Parsing all possible compound media conditions in JS is heavy, complicated,\n\t\t\t// and the payoff is unclear. Is there ever an situation where the\n\t\t\t// media condition parses incorrectly but still somehow evaluates to true?\n\t\t\t// Can we just rely on the browser/polyfill to do it?)\n\t\t\tunparsedSize = unparsedSize.join(\" \");\n\t\t\tif (!(pf.matchesMedia( unparsedSize ) ) ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\t// 5. Return size and exit this algorithm.\n\t\t\treturn size;\n\t\t}\n\n\t\t// If the above algorithm exhausts unparsed sizes list without returning a\n\t\t// size value, return 100vw.\n\t\treturn \"100vw\";\n\t}\n\n\t// namespace\n\tpf.ns = (\"pf\" + new Date().getTime()).substr(0, 9);\n\n\t// srcset support test\n\tpf.supSrcset = \"srcset\" in image;\n\tpf.supSizes = \"sizes\" in image;\n\tpf.supPicture = !!window.HTMLPictureElement;\n\n\t// UC browser does claim to support srcset and picture, but not sizes,\n\t// this extended test reveals the browser does support nothing\n\tif (pf.supSrcset && pf.supPicture && !pf.supSizes) {\n\t\t(function(image2) {\n\t\t\timage.srcset = \"data:,a\";\n\t\t\timage2.src = \"data:,a\";\n\t\t\tpf.supSrcset = image.complete === image2.complete;\n\t\t\tpf.supPicture = pf.supSrcset && pf.supPicture;\n\t\t})(document.createElement(\"img\"));\n\t}\n\n\t// Safari9 has basic support for sizes, but does't expose the `sizes` idl attribute\n\tif (pf.supSrcset && !pf.supSizes) {\n\n\t\t(function() {\n\t\t\tvar width2 = \"data:image/gif;base64,R0lGODlhAgABAPAAAP///wAAACH5BAAAAAAALAAAAAACAAEAAAICBAoAOw==\";\n\t\t\tvar width1 = \"data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==\";\n\t\t\tvar img = document.createElement(\"img\");\n\t\t\tvar test = function() {\n\t\t\t\tvar width = img.width;\n\n\t\t\t\tif (width === 2) {\n\t\t\t\t\tpf.supSizes = true;\n\t\t\t\t}\n\n\t\t\t\talwaysCheckWDescriptor = pf.supSrcset && !pf.supSizes;\n\n\t\t\t\tisSupportTestReady = true;\n\t\t\t\t// force async\n\t\t\t\tsetTimeout(picturefill);\n\t\t\t};\n\n\t\t\timg.onload = test;\n\t\t\timg.onerror = test;\n\t\t\timg.setAttribute(\"sizes\", \"9px\");\n\n\t\t\timg.srcset = width1 + \" 1w,\" + width2 + \" 9w\";\n\t\t\timg.src = width1;\n\t\t})();\n\n\t} else {\n\t\tisSupportTestReady = true;\n\t}\n\n\t// using pf.qsa instead of dom traversing does scale much better,\n\t// especially on sites mixing responsive and non-responsive images\n\tpf.selShort = \"picture>img,img[srcset]\";\n\tpf.sel = pf.selShort;\n\tpf.cfg = cfg;\n\n\t/**\n\t * Shortcut property for `devicePixelRatio` ( for easy overriding in tests )\n\t */\n\tpf.DPR = (DPR || 1 );\n\tpf.u = units;\n\n\t// container of supported mime types that one might need to qualify before using\n\tpf.types = types;\n\n\tpf.setSize = noop;\n\n\t/**\n\t * Gets a string and returns the absolute URL\n\t * @param src\n\t * @returns {String} absolute URL\n\t */\n\n\tpf.makeUrl = memoize(function(src) {\n\t\tanchor.href = src;\n\t\treturn anchor.href;\n\t});\n\n\t/**\n\t * Gets a DOM element or document and a selctor and returns the found matches\n\t * Can be extended with jQuery/Sizzle for IE7 support\n\t * @param context\n\t * @param sel\n\t * @returns {NodeList|Array}\n\t */\n\tpf.qsa = function(context, sel) {\n\t\treturn ( \"querySelector\" in context ) ? context.querySelectorAll(sel) : [];\n\t};\n\n\t/**\n\t * Shortcut method for matchMedia ( for easy overriding in tests )\n\t * wether native or pf.mMQ is used will be decided lazy on first call\n\t * @returns {boolean}\n\t */\n\tpf.matchesMedia = function() {\n\t\tif ( window.matchMedia && (matchMedia( \"(min-width: 0.1em)\" ) || {}).matches ) {\n\t\t\tpf.matchesMedia = function( media ) {\n\t\t\t\treturn !media || ( matchMedia( media ).matches );\n\t\t\t};\n\t\t} else {\n\t\t\tpf.matchesMedia = pf.mMQ;\n\t\t}\n\n\t\treturn pf.matchesMedia.apply( this, arguments );\n\t};\n\n\t/**\n\t * A simplified matchMedia implementation for IE8 and IE9\n\t * handles only min-width/max-width with px or em values\n\t * @param media\n\t * @returns {boolean}\n\t */\n\tpf.mMQ = function( media ) {\n\t\treturn media ? evalCSS(media) : true;\n\t};\n\n\t/**\n\t * Returns the calculated length in css pixel from the given sourceSizeValue\n\t * http://dev.w3.org/csswg/css-values-3/#length-value\n\t * intended Spec mismatches:\n\t * * Does not check for invalid use of CSS functions\n\t * * Does handle a computed length of 0 the same as a negative and therefore invalid value\n\t * @param sourceSizeValue\n\t * @returns {Number}\n\t */\n\tpf.calcLength = function( sourceSizeValue ) {\n\n\t\tvar value = evalCSS(sourceSizeValue, true) || false;\n\t\tif (value < 0) {\n\t\t\tvalue = false;\n\t\t}\n\n\t\treturn value;\n\t};\n\n\t/**\n\t * Takes a type string and checks if its supported\n\t */\n\n\tpf.supportsType = function( type ) {\n\t\treturn ( type ) ? types[ type ] : true;\n\t};\n\n\t/**\n\t * Parses a sourceSize into mediaCondition (media) and sourceSizeValue (length)\n\t * @param sourceSizeStr\n\t * @returns {*}\n\t */\n\tpf.parseSize = memoize(function( sourceSizeStr ) {\n\t\tvar match = ( sourceSizeStr || \"\" ).match(regSize);\n\t\treturn {\n\t\t\tmedia: match && match[1],\n\t\t\tlength: match && match[2]\n\t\t};\n\t});\n\n\tpf.parseSet = function( set ) {\n\t\tif ( !set.cands ) {\n\t\t\tset.cands = parseSrcset(set.srcset, set);\n\t\t}\n\t\treturn set.cands;\n\t};\n\n\t/**\n\t * returns 1em in css px for html/body default size\n\t * function taken from respondjs\n\t * @returns {*|number}\n\t */\n\tpf.getEmValue = function() {\n\t\tvar body;\n\t\tif ( !eminpx && (body = document.body) ) {\n\t\t\tvar div = document.createElement( \"div\" ),\n\t\t\t\toriginalHTMLCSS = docElem.style.cssText,\n\t\t\t\toriginalBodyCSS = body.style.cssText;\n\n\t\t\tdiv.style.cssText = baseStyle;\n\n\t\t\t// 1em in a media query is the value of the default font size of the browser\n\t\t\t// reset docElem and body to ensure the correct value is returned\n\t\t\tdocElem.style.cssText = fsCss;\n\t\t\tbody.style.cssText = fsCss;\n\n\t\t\tbody.appendChild( div );\n\t\t\teminpx = div.offsetWidth;\n\t\t\tbody.removeChild( div );\n\n\t\t\t//also update eminpx before returning\n\t\t\teminpx = parseFloat( eminpx, 10 );\n\n\t\t\t// restore the original values\n\t\t\tdocElem.style.cssText = originalHTMLCSS;\n\t\t\tbody.style.cssText = originalBodyCSS;\n\n\t\t}\n\t\treturn eminpx || 16;\n\t};\n\n\t/**\n\t * Takes a string of sizes and returns the width in pixels as a number\n\t */\n\tpf.calcListLength = function( sourceSizeListStr ) {\n\t\t// Split up source size list, ie ( max-width: 30em ) 100%, ( max-width: 50em ) 50%, 33%\n\t\t//\n\t\t// or (min-width:30em) calc(30% - 15px)\n\t\tif ( !(sourceSizeListStr in sizeLengthCache) || cfg.uT ) {\n\t\t\tvar winningLength = pf.calcLength( parseSizes( sourceSizeListStr ) );\n\n\t\t\tsizeLengthCache[ sourceSizeListStr ] = !winningLength ? units.width : winningLength;\n\t\t}\n\n\t\treturn sizeLengthCache[ sourceSizeListStr ];\n\t};\n\n\t/**\n\t * Takes a candidate object with a srcset property in the form of url/\n\t * ex. \"images/pic-medium.png 1x, images/pic-medium-2x.png 2x\" or\n\t * \"images/pic-medium.png 400w, images/pic-medium-2x.png 800w\" or\n\t * \"images/pic-small.png\"\n\t * Get an array of image candidates in the form of\n\t * {url: \"/foo/bar.png\", resolution: 1}\n\t * where resolution is http://dev.w3.org/csswg/css-values-3/#resolution-value\n\t * If sizes is specified, res is calculated\n\t */\n\tpf.setRes = function( set ) {\n\t\tvar candidates;\n\t\tif ( set ) {\n\n\t\t\tcandidates = pf.parseSet( set );\n\n\t\t\tfor ( var i = 0, len = candidates.length; i < len; i++ ) {\n\t\t\t\tsetResolution( candidates[ i ], set.sizes );\n\t\t\t}\n\t\t}\n\t\treturn candidates;\n\t};\n\n\tpf.setRes.res = setResolution;\n\n\tpf.applySetCandidate = function( candidates, img ) {\n\t\tif ( !candidates.length ) {return;}\n\t\tvar candidate,\n\t\t\ti,\n\t\t\tj,\n\t\t\tlength,\n\t\t\tbestCandidate,\n\t\t\tcurSrc,\n\t\t\tcurCan,\n\t\t\tcandidateSrc,\n\t\t\tabortCurSrc;\n\n\t\tvar imageData = img[ pf.ns ];\n\t\tvar dpr = pf.DPR;\n\n\t\tcurSrc = imageData.curSrc || img[curSrcProp];\n\n\t\tcurCan = imageData.curCan || setSrcToCur(img, curSrc, candidates[0].set);\n\n\t\t// if we have a current source, we might either become lazy or give this source some advantage\n\t\tif ( curCan && curCan.set === candidates[ 0 ].set ) {\n\n\t\t\t// if browser can abort image request and the image has a higher pixel density than needed\n\t\t\t// and this image isn't downloaded yet, we skip next part and try to save bandwidth\n\t\t\tabortCurSrc = (supportAbort && !img.complete && curCan.res - 0.1 > dpr);\n\n\t\t\tif ( !abortCurSrc ) {\n\t\t\t\tcurCan.cached = true;\n\n\t\t\t\t// if current candidate is \"best\", \"better\" or \"okay\",\n\t\t\t\t// set it to bestCandidate\n\t\t\t\tif ( curCan.res >= dpr ) {\n\t\t\t\t\tbestCandidate = curCan;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tif ( !bestCandidate ) {\n\n\t\t\tcandidates.sort( ascendingSort );\n\n\t\t\tlength = candidates.length;\n\t\t\tbestCandidate = candidates[ length - 1 ];\n\n\t\t\tfor ( i = 0; i < length; i++ ) {\n\t\t\t\tcandidate = candidates[ i ];\n\t\t\t\tif ( candidate.res >= dpr ) {\n\t\t\t\t\tj = i - 1;\n\n\t\t\t\t\t// we have found the perfect candidate,\n\t\t\t\t\t// but let's improve this a little bit with some assumptions ;-)\n\t\t\t\t\tif (candidates[ j ] &&\n\t\t\t\t\t\t(abortCurSrc || curSrc !== pf.makeUrl( candidate.url )) &&\n\t\t\t\t\t\tchooseLowRes(candidates[ j ].res, candidate.res, dpr, candidates[ j ].cached)) {\n\n\t\t\t\t\t\tbestCandidate = candidates[ j ];\n\n\t\t\t\t\t} else {\n\t\t\t\t\t\tbestCandidate = candidate;\n\t\t\t\t\t}\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tif ( bestCandidate ) {\n\n\t\t\tcandidateSrc = pf.makeUrl( bestCandidate.url );\n\n\t\t\timageData.curSrc = candidateSrc;\n\t\t\timageData.curCan = bestCandidate;\n\n\t\t\tif ( candidateSrc !== curSrc ) {\n\t\t\t\tpf.setSrc( img, bestCandidate );\n\t\t\t}\n\t\t\tpf.setSize( img );\n\t\t}\n\t};\n\n\tpf.setSrc = function( img, bestCandidate ) {\n\t\tvar origWidth;\n\t\timg.src = bestCandidate.url;\n\n\t\t// although this is a specific Safari issue, we don't want to take too much different code paths\n\t\tif ( bestCandidate.set.type === \"image/svg+xml\" ) {\n\t\t\torigWidth = img.style.width;\n\t\t\timg.style.width = (img.offsetWidth + 1) + \"px\";\n\n\t\t\t// next line only should trigger a repaint\n\t\t\t// if... is only done to trick dead code removal\n\t\t\tif ( img.offsetWidth + 1 ) {\n\t\t\t\timg.style.width = origWidth;\n\t\t\t}\n\t\t}\n\t};\n\n\tpf.getSet = function( img ) {\n\t\tvar i, set, supportsType;\n\t\tvar match = false;\n\t\tvar sets = img [ pf.ns ].sets;\n\n\t\tfor ( i = 0; i < sets.length && !match; i++ ) {\n\t\t\tset = sets[i];\n\n\t\t\tif ( !set.srcset || !pf.matchesMedia( set.media ) || !(supportsType = pf.supportsType( set.type )) ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\tif ( supportsType === \"pending\" ) {\n\t\t\t\tset = supportsType;\n\t\t\t}\n\n\t\t\tmatch = set;\n\t\t\tbreak;\n\t\t}\n\n\t\treturn match;\n\t};\n\n\tpf.parseSets = function( element, parent, options ) {\n\t\tvar srcsetAttribute, imageSet, isWDescripor, srcsetParsed;\n\n\t\tvar hasPicture = parent && parent.nodeName.toUpperCase() === \"PICTURE\";\n\t\tvar imageData = element[ pf.ns ];\n\n\t\tif ( imageData.src === undefined || options.src ) {\n\t\t\timageData.src = getImgAttr.call( element, \"src\" );\n\t\t\tif ( imageData.src ) {\n\t\t\t\tsetImgAttr.call( element, srcAttr, imageData.src );\n\t\t\t} else {\n\t\t\t\tremoveImgAttr.call( element, srcAttr );\n\t\t\t}\n\t\t}\n\n\t\tif ( imageData.srcset === undefined || options.srcset || !pf.supSrcset || element.srcset ) {\n\t\t\tsrcsetAttribute = getImgAttr.call( element, \"srcset\" );\n\t\t\timageData.srcset = srcsetAttribute;\n\t\t\tsrcsetParsed = true;\n\t\t}\n\n\t\timageData.sets = [];\n\n\t\tif ( hasPicture ) {\n\t\t\timageData.pic = true;\n\t\t\tgetAllSourceElements( parent, imageData.sets );\n\t\t}\n\n\t\tif ( imageData.srcset ) {\n\t\t\timageSet = {\n\t\t\t\tsrcset: imageData.srcset,\n\t\t\t\tsizes: getImgAttr.call( element, \"sizes\" )\n\t\t\t};\n\n\t\t\timageData.sets.push( imageSet );\n\n\t\t\tisWDescripor = (alwaysCheckWDescriptor || imageData.src) && regWDesc.test(imageData.srcset || \"\");\n\n\t\t\t// add normal src as candidate, if source has no w descriptor\n\t\t\tif ( !isWDescripor && imageData.src && !getCandidateForSrc(imageData.src, imageSet) && !imageSet.has1x ) {\n\t\t\t\timageSet.srcset += \", \" + imageData.src;\n\t\t\t\timageSet.cands.push({\n\t\t\t\t\turl: imageData.src,\n\t\t\t\t\td: 1,\n\t\t\t\t\tset: imageSet\n\t\t\t\t});\n\t\t\t}\n\n\t\t} else if ( imageData.src ) {\n\t\t\timageData.sets.push( {\n\t\t\t\tsrcset: imageData.src,\n\t\t\t\tsizes: null\n\t\t\t} );\n\t\t}\n\n\t\timageData.curCan = null;\n\t\timageData.curSrc = undefined;\n\n\t\t// if img has picture or the srcset was removed or has a srcset and does not support srcset at all\n\t\t// or has a w descriptor (and does not support sizes) set support to false to evaluate\n\t\timageData.supported = !( hasPicture || ( imageSet && !pf.supSrcset ) || (isWDescripor && !pf.supSizes) );\n\n\t\tif ( srcsetParsed && pf.supSrcset && !imageData.supported ) {\n\t\t\tif ( srcsetAttribute ) {\n\t\t\t\tsetImgAttr.call( element, srcsetAttr, srcsetAttribute );\n\t\t\t\telement.srcset = \"\";\n\t\t\t} else {\n\t\t\t\tremoveImgAttr.call( element, srcsetAttr );\n\t\t\t}\n\t\t}\n\n\t\tif (imageData.supported && !imageData.srcset && ((!imageData.src && element.src) || element.src !== pf.makeUrl(imageData.src))) {\n\t\t\tif (imageData.src === null) {\n\t\t\t\telement.removeAttribute(\"src\");\n\t\t\t} else {\n\t\t\t\telement.src = imageData.src;\n\t\t\t}\n\t\t}\n\n\t\timageData.parsed = true;\n\t};\n\n\tpf.fillImg = function(element, options) {\n\t\tvar imageData;\n\t\tvar extreme = options.reselect || options.reevaluate;\n\n\t\t// expando for caching data on the img\n\t\tif ( !element[ pf.ns ] ) {\n\t\t\telement[ pf.ns ] = {};\n\t\t}\n\n\t\timageData = element[ pf.ns ];\n\n\t\t// if the element has already been evaluated, skip it\n\t\t// unless `options.reevaluate` is set to true ( this, for example,\n\t\t// is set to true when running `picturefill` on `resize` ).\n\t\tif ( !extreme && imageData.evaled === evalId ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( !imageData.parsed || options.reevaluate ) {\n\t\t\tpf.parseSets( element, element.parentNode, options );\n\t\t}\n\n\t\tif ( !imageData.supported ) {\n\t\t\tapplyBestCandidate( element );\n\t\t} else {\n\t\t\timageData.evaled = evalId;\n\t\t}\n\t};\n\n\tpf.setupRun = function() {\n\t\tif ( !alreadyRun || isVwDirty || (DPR !== window.devicePixelRatio) ) {\n\t\t\tupdateMetrics();\n\t\t}\n\t};\n\n\t// If picture is supported, well, that's awesome.\n\tif ( pf.supPicture ) {\n\t\tpicturefill = noop;\n\t\tpf.fillImg = noop;\n\t} else {\n\n\t\t // Set up picture polyfill by polling the document\n\t\t(function() {\n\t\t\tvar isDomReady;\n\t\t\tvar regReady = window.attachEvent ? /d$|^c/ : /d$|^c|^i/;\n\n\t\t\tvar run = function() {\n\t\t\t\tvar readyState = document.readyState || \"\";\n\n\t\t\t\ttimerId = setTimeout(run, readyState === \"loading\" ? 200 : 999);\n\t\t\t\tif ( document.body ) {\n\t\t\t\t\tpf.fillImgs();\n\t\t\t\t\tisDomReady = isDomReady || regReady.test(readyState);\n\t\t\t\t\tif ( isDomReady ) {\n\t\t\t\t\t\tclearTimeout( timerId );\n\t\t\t\t\t}\n\n\t\t\t\t}\n\t\t\t};\n\n\t\t\tvar timerId = setTimeout(run, document.body ? 9 : 99);\n\n\t\t\t// Also attach picturefill on resize and readystatechange\n\t\t\t// http://modernjavascript.blogspot.com/2013/08/building-better-debounce.html\n\t\t\tvar debounce = function(func, wait) {\n\t\t\t\tvar timeout, timestamp;\n\t\t\t\tvar later = function() {\n\t\t\t\t\tvar last = (new Date()) - timestamp;\n\n\t\t\t\t\tif (last < wait) {\n\t\t\t\t\t\ttimeout = setTimeout(later, wait - last);\n\t\t\t\t\t} else {\n\t\t\t\t\t\ttimeout = null;\n\t\t\t\t\t\tfunc();\n\t\t\t\t\t}\n\t\t\t\t};\n\n\t\t\t\treturn function() {\n\t\t\t\t\ttimestamp = new Date();\n\n\t\t\t\t\tif (!timeout) {\n\t\t\t\t\t\ttimeout = setTimeout(later, wait);\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t\t};\n\t\t\tvar lastClientWidth = docElem.clientHeight;\n\t\t\tvar onResize = function() {\n\t\t\t\tisVwDirty = Math.max(window.innerWidth || 0, docElem.clientWidth) !== units.width || docElem.clientHeight !== lastClientWidth;\n\t\t\t\tlastClientWidth = docElem.clientHeight;\n\t\t\t\tif ( isVwDirty ) {\n\t\t\t\t\tpf.fillImgs();\n\t\t\t\t}\n\t\t\t};\n\n\t\t\ton( window, \"resize\", debounce(onResize, 99 ) );\n\t\t\ton( document, \"readystatechange\", run );\n\t\t})();\n\t}\n\n\tpf.picturefill = picturefill;\n\t//use this internally for easy monkey patching/performance testing\n\tpf.fillImgs = picturefill;\n\tpf.teardownRun = noop;\n\n\t/* expose methods for testing */\n\tpicturefill._ = pf;\n\n\twindow.picturefillCFG = {\n\t\tpf: pf,\n\t\tpush: function(args) {\n\t\t\tvar name = args.shift();\n\t\t\tif (typeof pf[name] === \"function\") {\n\t\t\t\tpf[name].apply(pf, args);\n\t\t\t} else {\n\t\t\t\tcfg[name] = args[0];\n\t\t\t\tif (alreadyRun) {\n\t\t\t\t\tpf.fillImgs( { reselect: true } );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t};\n\n\twhile (setOptions && setOptions.length) {\n\t\twindow.picturefillCFG.push(setOptions.shift());\n\t}\n\n\t/* expose picturefill */\n\twindow.picturefill = picturefill;\n\n\t/* expose picturefill */\n\tif ( typeof module === \"object\" && typeof module.exports === \"object\" ) {\n\t\t// CommonJS, just export\n\t\tmodule.exports = picturefill;\n\t} else if ( typeof define === \"function\" && define.amd ) {\n\t\t// AMD support\n\t\tdefine( \"picturefill\", function() { return picturefill; } );\n\t}\n\n\t// IE8 evals this sync, so it must be the last thing we do\n\tif ( !pf.supPicture ) {\n\t\ttypes[ \"image/webp\" ] = detectTypeSupport(\"image/webp\", \"data:image/webp;base64,UklGRkoAAABXRUJQVlA4WAoAAAAQAAAAAAAAAAAAQUxQSAwAAAABBxAR/Q9ERP8DAABWUDggGAAAADABAJ0BKgEAAQADADQlpAADcAD++/1QAA==\" );\n\t}\n\n} )( window, document );\n","/*!\n * jQuery JavaScript Library v1.11.3\n * http://jquery.com/\n *\n * Includes Sizzle.js\n * http://sizzlejs.com/\n *\n * Copyright 2005, 2014 jQuery Foundation, Inc. and other contributors\n * Released under the MIT license\n * http://jquery.org/license\n *\n * Date: 2015-04-28T16:19Z\n */\n\n(function( global, factory ) {\n\n\tif ( typeof module === \"object\" && typeof module.exports === \"object\" ) {\n\t\t// For CommonJS and CommonJS-like environments where a proper window is present,\n\t\t// execute the factory and get jQuery\n\t\t// For environments that do not inherently posses a window with a document\n\t\t// (such as Node.js), expose a jQuery-making factory as module.exports\n\t\t// This accentuates the need for the creation of a real window\n\t\t// e.g. var jQuery = require(\"jquery\")(window);\n\t\t// See ticket #14549 for more info\n\t\tmodule.exports = global.document ?\n\t\t\tfactory( global, true ) :\n\t\t\tfunction( w ) {\n\t\t\t\tif ( !w.document ) {\n\t\t\t\t\tthrow new Error( \"jQuery requires a window with a document\" );\n\t\t\t\t}\n\t\t\t\treturn factory( w );\n\t\t\t};\n\t} else {\n\t\tfactory( global );\n\t}\n\n// Pass this if window is not defined yet\n}(typeof window !== \"undefined\" ? window : this, function( window, noGlobal ) {\n\n// Can't do this because several apps including ASP.NET trace\n// the stack via arguments.caller.callee and Firefox dies if\n// you try to trace through \"use strict\" call chains. (#13335)\n// Support: Firefox 18+\n//\n\nvar deletedIds = [];\n\nvar slice = deletedIds.slice;\n\nvar concat = deletedIds.concat;\n\nvar push = deletedIds.push;\n\nvar indexOf = deletedIds.indexOf;\n\nvar class2type = {};\n\nvar toString = class2type.toString;\n\nvar hasOwn = class2type.hasOwnProperty;\n\nvar support = {};\n\n\n\nvar\n\tversion = \"1.11.3\",\n\n\t// Define a local copy of jQuery\n\tjQuery = function( selector, context ) {\n\t\t// The jQuery object is actually just the init constructor 'enhanced'\n\t\t// Need init if jQuery is called (just allow error to be thrown if not included)\n\t\treturn new jQuery.fn.init( selector, context );\n\t},\n\n\t// Support: Android<4.1, IE<9\n\t// Make sure we trim BOM and NBSP\n\trtrim = /^[\\s\\uFEFF\\xA0]+|[\\s\\uFEFF\\xA0]+$/g,\n\n\t// Matches dashed string for camelizing\n\trmsPrefix = /^-ms-/,\n\trdashAlpha = /-([\\da-z])/gi,\n\n\t// Used by jQuery.camelCase as callback to replace()\n\tfcamelCase = function( all, letter ) {\n\t\treturn letter.toUpperCase();\n\t};\n\njQuery.fn = jQuery.prototype = {\n\t// The current version of jQuery being used\n\tjquery: version,\n\n\tconstructor: jQuery,\n\n\t// Start with an empty selector\n\tselector: \"\",\n\n\t// The default length of a jQuery object is 0\n\tlength: 0,\n\n\ttoArray: function() {\n\t\treturn slice.call( this );\n\t},\n\n\t// Get the Nth element in the matched element set OR\n\t// Get the whole matched element set as a clean array\n\tget: function( num ) {\n\t\treturn num != null ?\n\n\t\t\t// Return just the one element from the set\n\t\t\t( num < 0 ? this[ num + this.length ] : this[ num ] ) :\n\n\t\t\t// Return all the elements in a clean array\n\t\t\tslice.call( this );\n\t},\n\n\t// Take an array of elements and push it onto the stack\n\t// (returning the new matched element set)\n\tpushStack: function( elems ) {\n\n\t\t// Build a new jQuery matched element set\n\t\tvar ret = jQuery.merge( this.constructor(), elems );\n\n\t\t// Add the old object onto the stack (as a reference)\n\t\tret.prevObject = this;\n\t\tret.context = this.context;\n\n\t\t// Return the newly-formed element set\n\t\treturn ret;\n\t},\n\n\t// Execute a callback for every element in the matched set.\n\t// (You can seed the arguments with an array of args, but this is\n\t// only used internally.)\n\teach: function( callback, args ) {\n\t\treturn jQuery.each( this, callback, args );\n\t},\n\n\tmap: function( callback ) {\n\t\treturn this.pushStack( jQuery.map(this, function( elem, i ) {\n\t\t\treturn callback.call( elem, i, elem );\n\t\t}));\n\t},\n\n\tslice: function() {\n\t\treturn this.pushStack( slice.apply( this, arguments ) );\n\t},\n\n\tfirst: function() {\n\t\treturn this.eq( 0 );\n\t},\n\n\tlast: function() {\n\t\treturn this.eq( -1 );\n\t},\n\n\teq: function( i ) {\n\t\tvar len = this.length,\n\t\t\tj = +i + ( i < 0 ? len : 0 );\n\t\treturn this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] );\n\t},\n\n\tend: function() {\n\t\treturn this.prevObject || this.constructor(null);\n\t},\n\n\t// For internal use only.\n\t// Behaves like an Array's method, not like a jQuery method.\n\tpush: push,\n\tsort: deletedIds.sort,\n\tsplice: deletedIds.splice\n};\n\njQuery.extend = jQuery.fn.extend = function() {\n\tvar src, copyIsArray, copy, name, options, clone,\n\t\ttarget = arguments[0] || {},\n\t\ti = 1,\n\t\tlength = arguments.length,\n\t\tdeep = false;\n\n\t// Handle a deep copy situation\n\tif ( typeof target === \"boolean\" ) {\n\t\tdeep = target;\n\n\t\t// skip the boolean and the target\n\t\ttarget = arguments[ i ] || {};\n\t\ti++;\n\t}\n\n\t// Handle case when target is a string or something (possible in deep copy)\n\tif ( typeof target !== \"object\" && !jQuery.isFunction(target) ) {\n\t\ttarget = {};\n\t}\n\n\t// extend jQuery itself if only one argument is passed\n\tif ( i === length ) {\n\t\ttarget = this;\n\t\ti--;\n\t}\n\n\tfor ( ; i < length; i++ ) {\n\t\t// Only deal with non-null/undefined values\n\t\tif ( (options = arguments[ i ]) != null ) {\n\t\t\t// Extend the base object\n\t\t\tfor ( name in options ) {\n\t\t\t\tsrc = target[ name ];\n\t\t\t\tcopy = options[ name ];\n\n\t\t\t\t// Prevent never-ending loop\n\t\t\t\tif ( target === copy ) {\n\t\t\t\t\tcontinue;\n\t\t\t\t}\n\n\t\t\t\t// Recurse if we're merging plain objects or arrays\n\t\t\t\tif ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {\n\t\t\t\t\tif ( copyIsArray ) {\n\t\t\t\t\t\tcopyIsArray = false;\n\t\t\t\t\t\tclone = src && jQuery.isArray(src) ? src : [];\n\n\t\t\t\t\t} else {\n\t\t\t\t\t\tclone = src && jQuery.isPlainObject(src) ? src : {};\n\t\t\t\t\t}\n\n\t\t\t\t\t// Never move original objects, clone them\n\t\t\t\t\ttarget[ name ] = jQuery.extend( deep, clone, copy );\n\n\t\t\t\t// Don't bring in undefined values\n\t\t\t\t} else if ( copy !== undefined ) {\n\t\t\t\t\ttarget[ name ] = copy;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Return the modified object\n\treturn target;\n};\n\njQuery.extend({\n\t// Unique for each copy of jQuery on the page\n\texpando: \"jQuery\" + ( version + Math.random() ).replace( /\\D/g, \"\" ),\n\n\t// Assume jQuery is ready without the ready module\n\tisReady: true,\n\n\terror: function( msg ) {\n\t\tthrow new Error( msg );\n\t},\n\n\tnoop: function() {},\n\n\t// See test/unit/core.js for details concerning isFunction.\n\t// Since version 1.3, DOM methods and functions like alert\n\t// aren't supported. They return false on IE (#2968).\n\tisFunction: function( obj ) {\n\t\treturn jQuery.type(obj) === \"function\";\n\t},\n\n\tisArray: Array.isArray || function( obj ) {\n\t\treturn jQuery.type(obj) === \"array\";\n\t},\n\n\tisWindow: function( obj ) {\n\t\t/* jshint eqeqeq: false */\n\t\treturn obj != null && obj == obj.window;\n\t},\n\n\tisNumeric: function( obj ) {\n\t\t// parseFloat NaNs numeric-cast false positives (null|true|false|\"\")\n\t\t// ...but misinterprets leading-number strings, particularly hex literals (\"0x...\")\n\t\t// subtraction forces infinities to NaN\n\t\t// adding 1 corrects loss of precision from parseFloat (#15100)\n\t\treturn !jQuery.isArray( obj ) && (obj - parseFloat( obj ) + 1) >= 0;\n\t},\n\n\tisEmptyObject: function( obj ) {\n\t\tvar name;\n\t\tfor ( name in obj ) {\n\t\t\treturn false;\n\t\t}\n\t\treturn true;\n\t},\n\n\tisPlainObject: function( obj ) {\n\t\tvar key;\n\n\t\t// Must be an Object.\n\t\t// Because of IE, we also have to check the presence of the constructor property.\n\t\t// Make sure that DOM nodes and window objects don't pass through, as well\n\t\tif ( !obj || jQuery.type(obj) !== \"object\" || obj.nodeType || jQuery.isWindow( obj ) ) {\n\t\t\treturn false;\n\t\t}\n\n\t\ttry {\n\t\t\t// Not own constructor property must be Object\n\t\t\tif ( obj.constructor &&\n\t\t\t\t!hasOwn.call(obj, \"constructor\") &&\n\t\t\t\t!hasOwn.call(obj.constructor.prototype, \"isPrototypeOf\") ) {\n\t\t\t\treturn false;\n\t\t\t}\n\t\t} catch ( e ) {\n\t\t\t// IE8,9 Will throw exceptions on certain host objects #9897\n\t\t\treturn false;\n\t\t}\n\n\t\t// Support: IE<9\n\t\t// Handle iteration over inherited properties before own properties.\n\t\tif ( support.ownLast ) {\n\t\t\tfor ( key in obj ) {\n\t\t\t\treturn hasOwn.call( obj, key );\n\t\t\t}\n\t\t}\n\n\t\t// Own properties are enumerated firstly, so to speed up,\n\t\t// if last one is own, then all properties are own.\n\t\tfor ( key in obj ) {}\n\n\t\treturn key === undefined || hasOwn.call( obj, key );\n\t},\n\n\ttype: function( obj ) {\n\t\tif ( obj == null ) {\n\t\t\treturn obj + \"\";\n\t\t}\n\t\treturn typeof obj === \"object\" || typeof obj === \"function\" ?\n\t\t\tclass2type[ toString.call(obj) ] || \"object\" :\n\t\t\ttypeof obj;\n\t},\n\n\t// Evaluates a script in a global context\n\t// Workarounds based on findings by Jim Driscoll\n\t// http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context\n\tglobalEval: function( data ) {\n\t\tif ( data && jQuery.trim( data ) ) {\n\t\t\t// We use execScript on Internet Explorer\n\t\t\t// We use an anonymous function so that context is window\n\t\t\t// rather than jQuery in Firefox\n\t\t\t( window.execScript || function( data ) {\n\t\t\t\twindow[ \"eval\" ].call( window, data );\n\t\t\t} )( data );\n\t\t}\n\t},\n\n\t// Convert dashed to camelCase; used by the css and data modules\n\t// Microsoft forgot to hump their vendor prefix (#9572)\n\tcamelCase: function( string ) {\n\t\treturn string.replace( rmsPrefix, \"ms-\" ).replace( rdashAlpha, fcamelCase );\n\t},\n\n\tnodeName: function( elem, name ) {\n\t\treturn elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();\n\t},\n\n\t// args is for internal usage only\n\teach: function( obj, callback, args ) {\n\t\tvar value,\n\t\t\ti = 0,\n\t\t\tlength = obj.length,\n\t\t\tisArray = isArraylike( obj );\n\n\t\tif ( args ) {\n\t\t\tif ( isArray ) {\n\t\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\t\tvalue = callback.apply( obj[ i ], args );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tfor ( i in obj ) {\n\t\t\t\t\tvalue = callback.apply( obj[ i ], args );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t// A special, fast, case for the most common use of each\n\t\t} else {\n\t\t\tif ( isArray ) {\n\t\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\t\tvalue = callback.call( obj[ i ], i, obj[ i ] );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tfor ( i in obj ) {\n\t\t\t\t\tvalue = callback.call( obj[ i ], i, obj[ i ] );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn obj;\n\t},\n\n\t// Support: Android<4.1, IE<9\n\ttrim: function( text ) {\n\t\treturn text == null ?\n\t\t\t\"\" :\n\t\t\t( text + \"\" ).replace( rtrim, \"\" );\n\t},\n\n\t// results is for internal usage only\n\tmakeArray: function( arr, results ) {\n\t\tvar ret = results || [];\n\n\t\tif ( arr != null ) {\n\t\t\tif ( isArraylike( Object(arr) ) ) {\n\t\t\t\tjQuery.merge( ret,\n\t\t\t\t\ttypeof arr === \"string\" ?\n\t\t\t\t\t[ arr ] : arr\n\t\t\t\t);\n\t\t\t} else {\n\t\t\t\tpush.call( ret, arr );\n\t\t\t}\n\t\t}\n\n\t\treturn ret;\n\t},\n\n\tinArray: function( elem, arr, i ) {\n\t\tvar len;\n\n\t\tif ( arr ) {\n\t\t\tif ( indexOf ) {\n\t\t\t\treturn indexOf.call( arr, elem, i );\n\t\t\t}\n\n\t\t\tlen = arr.length;\n\t\t\ti = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;\n\n\t\t\tfor ( ; i < len; i++ ) {\n\t\t\t\t// Skip accessing in sparse arrays\n\t\t\t\tif ( i in arr && arr[ i ] === elem ) {\n\t\t\t\t\treturn i;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn -1;\n\t},\n\n\tmerge: function( first, second ) {\n\t\tvar len = +second.length,\n\t\t\tj = 0,\n\t\t\ti = first.length;\n\n\t\twhile ( j < len ) {\n\t\t\tfirst[ i++ ] = second[ j++ ];\n\t\t}\n\n\t\t// Support: IE<9\n\t\t// Workaround casting of .length to NaN on otherwise arraylike objects (e.g., NodeLists)\n\t\tif ( len !== len ) {\n\t\t\twhile ( second[j] !== undefined ) {\n\t\t\t\tfirst[ i++ ] = second[ j++ ];\n\t\t\t}\n\t\t}\n\n\t\tfirst.length = i;\n\n\t\treturn first;\n\t},\n\n\tgrep: function( elems, callback, invert ) {\n\t\tvar callbackInverse,\n\t\t\tmatches = [],\n\t\t\ti = 0,\n\t\t\tlength = elems.length,\n\t\t\tcallbackExpect = !invert;\n\n\t\t// Go through the array, only saving the items\n\t\t// that pass the validator function\n\t\tfor ( ; i < length; i++ ) {\n\t\t\tcallbackInverse = !callback( elems[ i ], i );\n\t\t\tif ( callbackInverse !== callbackExpect ) {\n\t\t\t\tmatches.push( elems[ i ] );\n\t\t\t}\n\t\t}\n\n\t\treturn matches;\n\t},\n\n\t// arg is for internal usage only\n\tmap: function( elems, callback, arg ) {\n\t\tvar value,\n\t\t\ti = 0,\n\t\t\tlength = elems.length,\n\t\t\tisArray = isArraylike( elems ),\n\t\t\tret = [];\n\n\t\t// Go through the array, translating each of the items to their new values\n\t\tif ( isArray ) {\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Go through every key on the object,\n\t\t} else {\n\t\t\tfor ( i in elems ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Flatten any nested arrays\n\t\treturn concat.apply( [], ret );\n\t},\n\n\t// A global GUID counter for objects\n\tguid: 1,\n\n\t// Bind a function to a context, optionally partially applying any\n\t// arguments.\n\tproxy: function( fn, context ) {\n\t\tvar args, proxy, tmp;\n\n\t\tif ( typeof context === \"string\" ) {\n\t\t\ttmp = fn[ context ];\n\t\t\tcontext = fn;\n\t\t\tfn = tmp;\n\t\t}\n\n\t\t// Quick check to determine if target is callable, in the spec\n\t\t// this throws a TypeError, but we will just return undefined.\n\t\tif ( !jQuery.isFunction( fn ) ) {\n\t\t\treturn undefined;\n\t\t}\n\n\t\t// Simulated bind\n\t\targs = slice.call( arguments, 2 );\n\t\tproxy = function() {\n\t\t\treturn fn.apply( context || this, args.concat( slice.call( arguments ) ) );\n\t\t};\n\n\t\t// Set the guid of unique handler to the same of original handler, so it can be removed\n\t\tproxy.guid = fn.guid = fn.guid || jQuery.guid++;\n\n\t\treturn proxy;\n\t},\n\n\tnow: function() {\n\t\treturn +( new Date() );\n\t},\n\n\t// jQuery.support is not used in Core but other projects attach their\n\t// properties to it so it needs to exist.\n\tsupport: support\n});\n\n// Populate the class2type map\njQuery.each(\"Boolean Number String Function Array Date RegExp Object Error\".split(\" \"), function(i, name) {\n\tclass2type[ \"[object \" + name + \"]\" ] = name.toLowerCase();\n});\n\nfunction isArraylike( obj ) {\n\n\t// Support: iOS 8.2 (not reproducible in simulator)\n\t// `in` check used to prevent JIT error (gh-2145)\n\t// hasOwn isn't used here due to false negatives\n\t// regarding Nodelist length in IE\n\tvar length = \"length\" in obj && obj.length,\n\t\ttype = jQuery.type( obj );\n\n\tif ( type === \"function\" || jQuery.isWindow( obj ) ) {\n\t\treturn false;\n\t}\n\n\tif ( obj.nodeType === 1 && length ) {\n\t\treturn true;\n\t}\n\n\treturn type === \"array\" || length === 0 ||\n\t\ttypeof length === \"number\" && length > 0 && ( length - 1 ) in obj;\n}\nvar Sizzle =\n/*!\n * Sizzle CSS Selector Engine v2.2.0-pre\n * http://sizzlejs.com/\n *\n * Copyright 2008, 2014 jQuery Foundation, Inc. and other contributors\n * Released under the MIT license\n * http://jquery.org/license\n *\n * Date: 2014-12-16\n */\n(function( window ) {\n\nvar i,\n\tsupport,\n\tExpr,\n\tgetText,\n\tisXML,\n\ttokenize,\n\tcompile,\n\tselect,\n\toutermostContext,\n\tsortInput,\n\thasDuplicate,\n\n\t// Local document vars\n\tsetDocument,\n\tdocument,\n\tdocElem,\n\tdocumentIsHTML,\n\trbuggyQSA,\n\trbuggyMatches,\n\tmatches,\n\tcontains,\n\n\t// Instance-specific data\n\texpando = \"sizzle\" + 1 * new Date(),\n\tpreferredDoc = window.document,\n\tdirruns = 0,\n\tdone = 0,\n\tclassCache = createCache(),\n\ttokenCache = createCache(),\n\tcompilerCache = createCache(),\n\tsortOrder = function( a, b ) {\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t}\n\t\treturn 0;\n\t},\n\n\t// General-purpose constants\n\tMAX_NEGATIVE = 1 << 31,\n\n\t// Instance methods\n\thasOwn = ({}).hasOwnProperty,\n\tarr = [],\n\tpop = arr.pop,\n\tpush_native = arr.push,\n\tpush = arr.push,\n\tslice = arr.slice,\n\t// Use a stripped-down indexOf as it's faster than native\n\t// http://jsperf.com/thor-indexof-vs-for/5\n\tindexOf = function( list, elem ) {\n\t\tvar i = 0,\n\t\t\tlen = list.length;\n\t\tfor ( ; i < len; i++ ) {\n\t\t\tif ( list[i] === elem ) {\n\t\t\t\treturn i;\n\t\t\t}\n\t\t}\n\t\treturn -1;\n\t},\n\n\tbooleans = \"checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped\",\n\n\t// Regular expressions\n\n\t// Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace\n\twhitespace = \"[\\\\x20\\\\t\\\\r\\\\n\\\\f]\",\n\t// http://www.w3.org/TR/css3-syntax/#characters\n\tcharacterEncoding = \"(?:\\\\\\\\.|[\\\\w-]|[^\\\\x00-\\\\xa0])+\",\n\n\t// Loosely modeled on CSS identifier characters\n\t// An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors\n\t// Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier\n\tidentifier = characterEncoding.replace( \"w\", \"w#\" ),\n\n\t// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors\n\tattributes = \"\\\\[\" + whitespace + \"*(\" + characterEncoding + \")(?:\" + whitespace +\n\t\t// Operator (capture 2)\n\t\t\"*([*^$|!~]?=)\" + whitespace +\n\t\t// \"Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]\"\n\t\t\"*(?:'((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\"|(\" + identifier + \"))|)\" + whitespace +\n\t\t\"*\\\\]\",\n\n\tpseudos = \":(\" + characterEncoding + \")(?:\\\\((\" +\n\t\t// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:\n\t\t// 1. quoted (capture 3; capture 4 or capture 5)\n\t\t\"('((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\")|\" +\n\t\t// 2. simple (capture 6)\n\t\t\"((?:\\\\\\\\.|[^\\\\\\\\()[\\\\]]|\" + attributes + \")*)|\" +\n\t\t// 3. anything else (capture 2)\n\t\t\".*\" +\n\t\t\")\\\\)|)\",\n\n\t// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter\n\trwhitespace = new RegExp( whitespace + \"+\", \"g\" ),\n\trtrim = new RegExp( \"^\" + whitespace + \"+|((?:^|[^\\\\\\\\])(?:\\\\\\\\.)*)\" + whitespace + \"+$\", \"g\" ),\n\n\trcomma = new RegExp( \"^\" + whitespace + \"*,\" + whitespace + \"*\" ),\n\trcombinators = new RegExp( \"^\" + whitespace + \"*([>+~]|\" + whitespace + \")\" + whitespace + \"*\" ),\n\n\trattributeQuotes = new RegExp( \"=\" + whitespace + \"*([^\\\\]'\\\"]*?)\" + whitespace + \"*\\\\]\", \"g\" ),\n\n\trpseudo = new RegExp( pseudos ),\n\tridentifier = new RegExp( \"^\" + identifier + \"$\" ),\n\n\tmatchExpr = {\n\t\t\"ID\": new RegExp( \"^#(\" + characterEncoding + \")\" ),\n\t\t\"CLASS\": new RegExp( \"^\\\\.(\" + characterEncoding + \")\" ),\n\t\t\"TAG\": new RegExp( \"^(\" + characterEncoding.replace( \"w\", \"w*\" ) + \")\" ),\n\t\t\"ATTR\": new RegExp( \"^\" + attributes ),\n\t\t\"PSEUDO\": new RegExp( \"^\" + pseudos ),\n\t\t\"CHILD\": new RegExp( \"^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\\\(\" + whitespace +\n\t\t\t\"*(even|odd|(([+-]|)(\\\\d*)n|)\" + whitespace + \"*(?:([+-]|)\" + whitespace +\n\t\t\t\"*(\\\\d+)|))\" + whitespace + \"*\\\\)|)\", \"i\" ),\n\t\t\"bool\": new RegExp( \"^(?:\" + booleans + \")$\", \"i\" ),\n\t\t// For use in libraries implementing .is()\n\t\t// We use this for POS matching in `select`\n\t\t\"needsContext\": new RegExp( \"^\" + whitespace + \"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\\\(\" +\n\t\t\twhitespace + \"*((?:-\\\\d)?\\\\d*)\" + whitespace + \"*\\\\)|)(?=[^-]|$)\", \"i\" )\n\t},\n\n\trinputs = /^(?:input|select|textarea|button)$/i,\n\trheader = /^h\\d$/i,\n\n\trnative = /^[^{]+\\{\\s*\\[native \\w/,\n\n\t// Easily-parseable/retrievable ID or TAG or CLASS selectors\n\trquickExpr = /^(?:#([\\w-]+)|(\\w+)|\\.([\\w-]+))$/,\n\n\trsibling = /[+~]/,\n\trescape = /'|\\\\/g,\n\n\t// CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters\n\trunescape = new RegExp( \"\\\\\\\\([\\\\da-f]{1,6}\" + whitespace + \"?|(\" + whitespace + \")|.)\", \"ig\" ),\n\tfunescape = function( _, escaped, escapedWhitespace ) {\n\t\tvar high = \"0x\" + escaped - 0x10000;\n\t\t// NaN means non-codepoint\n\t\t// Support: Firefox<24\n\t\t// Workaround erroneous numeric interpretation of +\"0x\"\n\t\treturn high !== high || escapedWhitespace ?\n\t\t\tescaped :\n\t\t\thigh < 0 ?\n\t\t\t\t// BMP codepoint\n\t\t\t\tString.fromCharCode( high + 0x10000 ) :\n\t\t\t\t// Supplemental Plane codepoint (surrogate pair)\n\t\t\t\tString.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );\n\t},\n\n\t// Used for iframes\n\t// See setDocument()\n\t// Removing the function wrapper causes a \"Permission Denied\"\n\t// error in IE\n\tunloadHandler = function() {\n\t\tsetDocument();\n\t};\n\n// Optimize for push.apply( _, NodeList )\ntry {\n\tpush.apply(\n\t\t(arr = slice.call( preferredDoc.childNodes )),\n\t\tpreferredDoc.childNodes\n\t);\n\t// Support: Android<4.0\n\t// Detect silently failing push.apply\n\tarr[ preferredDoc.childNodes.length ].nodeType;\n} catch ( e ) {\n\tpush = { apply: arr.length ?\n\n\t\t// Leverage slice if possible\n\t\tfunction( target, els ) {\n\t\t\tpush_native.apply( target, slice.call(els) );\n\t\t} :\n\n\t\t// Support: IE<9\n\t\t// Otherwise append directly\n\t\tfunction( target, els ) {\n\t\t\tvar j = target.length,\n\t\t\t\ti = 0;\n\t\t\t// Can't trust NodeList.length\n\t\t\twhile ( (target[j++] = els[i++]) ) {}\n\t\t\ttarget.length = j - 1;\n\t\t}\n\t};\n}\n\nfunction Sizzle( selector, context, results, seed ) {\n\tvar match, elem, m, nodeType,\n\t\t// QSA vars\n\t\ti, groups, old, nid, newContext, newSelector;\n\n\tif ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {\n\t\tsetDocument( context );\n\t}\n\n\tcontext = context || document;\n\tresults = results || [];\n\tnodeType = context.nodeType;\n\n\tif ( typeof selector !== \"string\" || !selector ||\n\t\tnodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {\n\n\t\treturn results;\n\t}\n\n\tif ( !seed && documentIsHTML ) {\n\n\t\t// Try to shortcut find operations when possible (e.g., not under DocumentFragment)\n\t\tif ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {\n\t\t\t// Speed-up: Sizzle(\"#ID\")\n\t\t\tif ( (m = match[1]) ) {\n\t\t\t\tif ( nodeType === 9 ) {\n\t\t\t\t\telem = context.getElementById( m );\n\t\t\t\t\t// Check parentNode to catch when Blackberry 4.6 returns\n\t\t\t\t\t// nodes that are no longer in the document (jQuery #6963)\n\t\t\t\t\tif ( elem && elem.parentNode ) {\n\t\t\t\t\t\t// Handle the case where IE, Opera, and Webkit return items\n\t\t\t\t\t\t// by name instead of ID\n\t\t\t\t\t\tif ( elem.id === m ) {\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\treturn results;\n\t\t\t\t\t\t}\n\t\t\t\t\t} else {\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\t// Context is not a document\n\t\t\t\t\tif ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&\n\t\t\t\t\t\tcontains( context, elem ) && elem.id === m ) {\n\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t// Speed-up: Sizzle(\"TAG\")\n\t\t\t} else if ( match[2] ) {\n\t\t\t\tpush.apply( results, context.getElementsByTagName( selector ) );\n\t\t\t\treturn results;\n\n\t\t\t// Speed-up: Sizzle(\".CLASS\")\n\t\t\t} else if ( (m = match[3]) && support.getElementsByClassName ) {\n\t\t\t\tpush.apply( results, context.getElementsByClassName( m ) );\n\t\t\t\treturn results;\n\t\t\t}\n\t\t}\n\n\t\t// QSA path\n\t\tif ( support.qsa && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {\n\t\t\tnid = old = expando;\n\t\t\tnewContext = context;\n\t\t\tnewSelector = nodeType !== 1 && selector;\n\n\t\t\t// qSA works strangely on Element-rooted queries\n\t\t\t// We can work around this by specifying an extra ID on the root\n\t\t\t// and working up from there (Thanks to Andrew Dupont for the technique)\n\t\t\t// IE 8 doesn't work on object elements\n\t\t\tif ( nodeType === 1 && context.nodeName.toLowerCase() !== \"object\" ) {\n\t\t\t\tgroups = tokenize( selector );\n\n\t\t\t\tif ( (old = context.getAttribute(\"id\")) ) {\n\t\t\t\t\tnid = old.replace( rescape, \"\\\\$&\" );\n\t\t\t\t} else {\n\t\t\t\t\tcontext.setAttribute( \"id\", nid );\n\t\t\t\t}\n\t\t\t\tnid = \"[id='\" + nid + \"'] \";\n\n\t\t\t\ti = groups.length;\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\tgroups[i] = nid + toSelector( groups[i] );\n\t\t\t\t}\n\t\t\t\tnewContext = rsibling.test( selector ) && testContext( context.parentNode ) || context;\n\t\t\t\tnewSelector = groups.join(\",\");\n\t\t\t}\n\n\t\t\tif ( newSelector ) {\n\t\t\t\ttry {\n\t\t\t\t\tpush.apply( results,\n\t\t\t\t\t\tnewContext.querySelectorAll( newSelector )\n\t\t\t\t\t);\n\t\t\t\t\treturn results;\n\t\t\t\t} catch(qsaError) {\n\t\t\t\t} finally {\n\t\t\t\t\tif ( !old ) {\n\t\t\t\t\t\tcontext.removeAttribute(\"id\");\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// All others\n\treturn select( selector.replace( rtrim, \"$1\" ), context, results, seed );\n}\n\n/**\n * Create key-value caches of limited size\n * @returns {Function(string, Object)} Returns the Object data after storing it on itself with\n *\tproperty name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)\n *\tdeleting the oldest entry\n */\nfunction createCache() {\n\tvar keys = [];\n\n\tfunction cache( key, value ) {\n\t\t// Use (key + \" \") to avoid collision with native prototype properties (see Issue #157)\n\t\tif ( keys.push( key + \" \" ) > Expr.cacheLength ) {\n\t\t\t// Only keep the most recent entries\n\t\t\tdelete cache[ keys.shift() ];\n\t\t}\n\t\treturn (cache[ key + \" \" ] = value);\n\t}\n\treturn cache;\n}\n\n/**\n * Mark a function for special use by Sizzle\n * @param {Function} fn The function to mark\n */\nfunction markFunction( fn ) {\n\tfn[ expando ] = true;\n\treturn fn;\n}\n\n/**\n * Support testing using an element\n * @param {Function} fn Passed the created div and expects a boolean result\n */\nfunction assert( fn ) {\n\tvar div = document.createElement(\"div\");\n\n\ttry {\n\t\treturn !!fn( div );\n\t} catch (e) {\n\t\treturn false;\n\t} finally {\n\t\t// Remove from its parent by default\n\t\tif ( div.parentNode ) {\n\t\t\tdiv.parentNode.removeChild( div );\n\t\t}\n\t\t// release memory in IE\n\t\tdiv = null;\n\t}\n}\n\n/**\n * Adds the same handler for all of the specified attrs\n * @param {String} attrs Pipe-separated list of attributes\n * @param {Function} handler The method that will be applied\n */\nfunction addHandle( attrs, handler ) {\n\tvar arr = attrs.split(\"|\"),\n\t\ti = attrs.length;\n\n\twhile ( i-- ) {\n\t\tExpr.attrHandle[ arr[i] ] = handler;\n\t}\n}\n\n/**\n * Checks document order of two siblings\n * @param {Element} a\n * @param {Element} b\n * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b\n */\nfunction siblingCheck( a, b ) {\n\tvar cur = b && a,\n\t\tdiff = cur && a.nodeType === 1 && b.nodeType === 1 &&\n\t\t\t( ~b.sourceIndex || MAX_NEGATIVE ) -\n\t\t\t( ~a.sourceIndex || MAX_NEGATIVE );\n\n\t// Use IE sourceIndex if available on both nodes\n\tif ( diff ) {\n\t\treturn diff;\n\t}\n\n\t// Check if b follows a\n\tif ( cur ) {\n\t\twhile ( (cur = cur.nextSibling) ) {\n\t\t\tif ( cur === b ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t}\n\t}\n\n\treturn a ? 1 : -1;\n}\n\n/**\n * Returns a function to use in pseudos for input types\n * @param {String} type\n */\nfunction createInputPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn name === \"input\" && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for buttons\n * @param {String} type\n */\nfunction createButtonPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn (name === \"input\" || name === \"button\") && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for positionals\n * @param {Function} fn\n */\nfunction createPositionalPseudo( fn ) {\n\treturn markFunction(function( argument ) {\n\t\targument = +argument;\n\t\treturn markFunction(function( seed, matches ) {\n\t\t\tvar j,\n\t\t\t\tmatchIndexes = fn( [], seed.length, argument ),\n\t\t\t\ti = matchIndexes.length;\n\n\t\t\t// Match elements found at the specified indexes\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( seed[ (j = matchIndexes[i]) ] ) {\n\t\t\t\t\tseed[j] = !(matches[j] = seed[j]);\n\t\t\t\t}\n\t\t\t}\n\t\t});\n\t});\n}\n\n/**\n * Checks a node for validity as a Sizzle context\n * @param {Element|Object=} context\n * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value\n */\nfunction testContext( context ) {\n\treturn context && typeof context.getElementsByTagName !== \"undefined\" && context;\n}\n\n// Expose support vars for convenience\nsupport = Sizzle.support = {};\n\n/**\n * Detects XML nodes\n * @param {Element|Object} elem An element or a document\n * @returns {Boolean} True iff elem is a non-HTML XML node\n */\nisXML = Sizzle.isXML = function( elem ) {\n\t// documentElement is verified for cases where it doesn't yet exist\n\t// (such as loading iframes in IE - #4833)\n\tvar documentElement = elem && (elem.ownerDocument || elem).documentElement;\n\treturn documentElement ? documentElement.nodeName !== \"HTML\" : false;\n};\n\n/**\n * Sets document-related variables once based on the current document\n * @param {Element|Object} [doc] An element or document object to use to set the document\n * @returns {Object} Returns the current document\n */\nsetDocument = Sizzle.setDocument = function( node ) {\n\tvar hasCompare, parent,\n\t\tdoc = node ? node.ownerDocument || node : preferredDoc;\n\n\t// If no document and documentElement is available, return\n\tif ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {\n\t\treturn document;\n\t}\n\n\t// Set our document\n\tdocument = doc;\n\tdocElem = doc.documentElement;\n\tparent = doc.defaultView;\n\n\t// Support: IE>8\n\t// If iframe document is assigned to \"document\" variable and if iframe has been reloaded,\n\t// IE will throw \"permission denied\" error when accessing \"document\" variable, see jQuery #13936\n\t// IE6-8 do not support the defaultView property so parent will be undefined\n\tif ( parent && parent !== parent.top ) {\n\t\t// IE11 does not have attachEvent, so all must suffer\n\t\tif ( parent.addEventListener ) {\n\t\t\tparent.addEventListener( \"unload\", unloadHandler, false );\n\t\t} else if ( parent.attachEvent ) {\n\t\t\tparent.attachEvent( \"onunload\", unloadHandler );\n\t\t}\n\t}\n\n\t/* Support tests\n\t---------------------------------------------------------------------- */\n\tdocumentIsHTML = !isXML( doc );\n\n\t/* Attributes\n\t---------------------------------------------------------------------- */\n\n\t// Support: IE<8\n\t// Verify that getAttribute really returns attributes and not properties\n\t// (excepting IE8 booleans)\n\tsupport.attributes = assert(function( div ) {\n\t\tdiv.className = \"i\";\n\t\treturn !div.getAttribute(\"className\");\n\t});\n\n\t/* getElement(s)By*\n\t---------------------------------------------------------------------- */\n\n\t// Check if getElementsByTagName(\"*\") returns only elements\n\tsupport.getElementsByTagName = assert(function( div ) {\n\t\tdiv.appendChild( doc.createComment(\"\") );\n\t\treturn !div.getElementsByTagName(\"*\").length;\n\t});\n\n\t// Support: IE<9\n\tsupport.getElementsByClassName = rnative.test( doc.getElementsByClassName );\n\n\t// Support: IE<10\n\t// Check if getElementById returns elements by name\n\t// The broken getElementById methods don't pick up programatically-set names,\n\t// so use a roundabout getElementsByName test\n\tsupport.getById = assert(function( div ) {\n\t\tdocElem.appendChild( div ).id = expando;\n\t\treturn !doc.getElementsByName || !doc.getElementsByName( expando ).length;\n\t});\n\n\t// ID find and filter\n\tif ( support.getById ) {\n\t\tExpr.find[\"ID\"] = function( id, context ) {\n\t\t\tif ( typeof context.getElementById !== \"undefined\" && documentIsHTML ) {\n\t\t\t\tvar m = context.getElementById( id );\n\t\t\t\t// Check parentNode to catch when Blackberry 4.6 returns\n\t\t\t\t// nodes that are no longer in the document #6963\n\t\t\t\treturn m && m.parentNode ? [ m ] : [];\n\t\t\t}\n\t\t};\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn elem.getAttribute(\"id\") === attrId;\n\t\t\t};\n\t\t};\n\t} else {\n\t\t// Support: IE6/7\n\t\t// getElementById is not reliable as a find shortcut\n\t\tdelete Expr.find[\"ID\"];\n\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\tvar node = typeof elem.getAttributeNode !== \"undefined\" && elem.getAttributeNode(\"id\");\n\t\t\t\treturn node && node.value === attrId;\n\t\t\t};\n\t\t};\n\t}\n\n\t// Tag\n\tExpr.find[\"TAG\"] = support.getElementsByTagName ?\n\t\tfunction( tag, context ) {\n\t\t\tif ( typeof context.getElementsByTagName !== \"undefined\" ) {\n\t\t\t\treturn context.getElementsByTagName( tag );\n\n\t\t\t// DocumentFragment nodes don't have gEBTN\n\t\t\t} else if ( support.qsa ) {\n\t\t\t\treturn context.querySelectorAll( tag );\n\t\t\t}\n\t\t} :\n\n\t\tfunction( tag, context ) {\n\t\t\tvar elem,\n\t\t\t\ttmp = [],\n\t\t\t\ti = 0,\n\t\t\t\t// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too\n\t\t\t\tresults = context.getElementsByTagName( tag );\n\n\t\t\t// Filter out possible comments\n\t\t\tif ( tag === \"*\" ) {\n\t\t\t\twhile ( (elem = results[i++]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\t\t\ttmp.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\treturn tmp;\n\t\t\t}\n\t\t\treturn results;\n\t\t};\n\n\t// Class\n\tExpr.find[\"CLASS\"] = support.getElementsByClassName && function( className, context ) {\n\t\tif ( documentIsHTML ) {\n\t\t\treturn context.getElementsByClassName( className );\n\t\t}\n\t};\n\n\t/* QSA/matchesSelector\n\t---------------------------------------------------------------------- */\n\n\t// QSA and matchesSelector support\n\n\t// matchesSelector(:active) reports false when true (IE9/Opera 11.5)\n\trbuggyMatches = [];\n\n\t// qSa(:focus) reports false when true (Chrome 21)\n\t// We allow this because of a bug in IE8/9 that throws an error\n\t// whenever `document.activeElement` is accessed on an iframe\n\t// So, we allow :focus to pass through QSA all the time to avoid the IE error\n\t// See http://bugs.jquery.com/ticket/13378\n\trbuggyQSA = [];\n\n\tif ( (support.qsa = rnative.test( doc.querySelectorAll )) ) {\n\t\t// Build QSA regex\n\t\t// Regex strategy adopted from Diego Perini\n\t\tassert(function( div ) {\n\t\t\t// Select is set to empty string on purpose\n\t\t\t// This is to test IE's treatment of not explicitly\n\t\t\t// setting a boolean content attribute,\n\t\t\t// since its presence should be enough\n\t\t\t// http://bugs.jquery.com/ticket/12359\n\t\t\tdocElem.appendChild( div ).innerHTML = \"\" +\n\t\t\t\t\"\";\n\n\t\t\t// Support: IE8, Opera 11-12.16\n\t\t\t// Nothing should be selected when empty strings follow ^= or $= or *=\n\t\t\t// The test attribute must be unknown in Opera but \"safe\" for WinRT\n\t\t\t// http://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section\n\t\t\tif ( div.querySelectorAll(\"[msallowcapture^='']\").length ) {\n\t\t\t\trbuggyQSA.push( \"[*^$]=\" + whitespace + \"*(?:''|\\\"\\\")\" );\n\t\t\t}\n\n\t\t\t// Support: IE8\n\t\t\t// Boolean attributes and \"value\" are not treated correctly\n\t\t\tif ( !div.querySelectorAll(\"[selected]\").length ) {\n\t\t\t\trbuggyQSA.push( \"\\\\[\" + whitespace + \"*(?:value|\" + booleans + \")\" );\n\t\t\t}\n\n\t\t\t// Support: Chrome<29, Android<4.2+, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.7+\n\t\t\tif ( !div.querySelectorAll( \"[id~=\" + expando + \"-]\" ).length ) {\n\t\t\t\trbuggyQSA.push(\"~=\");\n\t\t\t}\n\n\t\t\t// Webkit/Opera - :checked should return selected option elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( !div.querySelectorAll(\":checked\").length ) {\n\t\t\t\trbuggyQSA.push(\":checked\");\n\t\t\t}\n\n\t\t\t// Support: Safari 8+, iOS 8+\n\t\t\t// https://bugs.webkit.org/show_bug.cgi?id=136851\n\t\t\t// In-page `selector#id sibing-combinator selector` fails\n\t\t\tif ( !div.querySelectorAll( \"a#\" + expando + \"+*\" ).length ) {\n\t\t\t\trbuggyQSA.push(\".#.+[+~]\");\n\t\t\t}\n\t\t});\n\n\t\tassert(function( div ) {\n\t\t\t// Support: Windows 8 Native Apps\n\t\t\t// The type and name attributes are restricted during .innerHTML assignment\n\t\t\tvar input = doc.createElement(\"input\");\n\t\t\tinput.setAttribute( \"type\", \"hidden\" );\n\t\t\tdiv.appendChild( input ).setAttribute( \"name\", \"D\" );\n\n\t\t\t// Support: IE8\n\t\t\t// Enforce case-sensitivity of name attribute\n\t\t\tif ( div.querySelectorAll(\"[name=d]\").length ) {\n\t\t\t\trbuggyQSA.push( \"name\" + whitespace + \"*[*^$|!~]?=\" );\n\t\t\t}\n\n\t\t\t// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( !div.querySelectorAll(\":enabled\").length ) {\n\t\t\t\trbuggyQSA.push( \":enabled\", \":disabled\" );\n\t\t\t}\n\n\t\t\t// Opera 10-11 does not throw on post-comma invalid pseudos\n\t\t\tdiv.querySelectorAll(\"*,:x\");\n\t\t\trbuggyQSA.push(\",.*:\");\n\t\t});\n\t}\n\n\tif ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||\n\t\tdocElem.webkitMatchesSelector ||\n\t\tdocElem.mozMatchesSelector ||\n\t\tdocElem.oMatchesSelector ||\n\t\tdocElem.msMatchesSelector) )) ) {\n\n\t\tassert(function( div ) {\n\t\t\t// Check to see if it's possible to do matchesSelector\n\t\t\t// on a disconnected node (IE 9)\n\t\t\tsupport.disconnectedMatch = matches.call( div, \"div\" );\n\n\t\t\t// This should fail with an exception\n\t\t\t// Gecko does not error, returns false instead\n\t\t\tmatches.call( div, \"[s!='']:x\" );\n\t\t\trbuggyMatches.push( \"!=\", pseudos );\n\t\t});\n\t}\n\n\trbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join(\"|\") );\n\trbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join(\"|\") );\n\n\t/* Contains\n\t---------------------------------------------------------------------- */\n\thasCompare = rnative.test( docElem.compareDocumentPosition );\n\n\t// Element contains another\n\t// Purposefully does not implement inclusive descendent\n\t// As in, an element does not contain itself\n\tcontains = hasCompare || rnative.test( docElem.contains ) ?\n\t\tfunction( a, b ) {\n\t\t\tvar adown = a.nodeType === 9 ? a.documentElement : a,\n\t\t\t\tbup = b && b.parentNode;\n\t\t\treturn a === bup || !!( bup && bup.nodeType === 1 && (\n\t\t\t\tadown.contains ?\n\t\t\t\t\tadown.contains( bup ) :\n\t\t\t\t\ta.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16\n\t\t\t));\n\t\t} :\n\t\tfunction( a, b ) {\n\t\t\tif ( b ) {\n\t\t\t\twhile ( (b = b.parentNode) ) {\n\t\t\t\t\tif ( b === a ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn false;\n\t\t};\n\n\t/* Sorting\n\t---------------------------------------------------------------------- */\n\n\t// Document order sorting\n\tsortOrder = hasCompare ?\n\tfunction( a, b ) {\n\n\t\t// Flag for duplicate removal\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\t// Sort on method existence if only one input has compareDocumentPosition\n\t\tvar compare = !a.compareDocumentPosition - !b.compareDocumentPosition;\n\t\tif ( compare ) {\n\t\t\treturn compare;\n\t\t}\n\n\t\t// Calculate position if both inputs belong to the same document\n\t\tcompare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?\n\t\t\ta.compareDocumentPosition( b ) :\n\n\t\t\t// Otherwise we know they are disconnected\n\t\t\t1;\n\n\t\t// Disconnected nodes\n\t\tif ( compare & 1 ||\n\t\t\t(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {\n\n\t\t\t// Choose the first element that is related to our preferred document\n\t\t\tif ( a === doc || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t\tif ( b === doc || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {\n\t\t\t\treturn 1;\n\t\t\t}\n\n\t\t\t// Maintain original order\n\t\t\treturn sortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\t\t}\n\n\t\treturn compare & 4 ? -1 : 1;\n\t} :\n\tfunction( a, b ) {\n\t\t// Exit early if the nodes are identical\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\taup = a.parentNode,\n\t\t\tbup = b.parentNode,\n\t\t\tap = [ a ],\n\t\t\tbp = [ b ];\n\n\t\t// Parentless nodes are either documents or disconnected\n\t\tif ( !aup || !bup ) {\n\t\t\treturn a === doc ? -1 :\n\t\t\t\tb === doc ? 1 :\n\t\t\t\taup ? -1 :\n\t\t\t\tbup ? 1 :\n\t\t\t\tsortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\n\t\t// If the nodes are siblings, we can do a quick check\n\t\t} else if ( aup === bup ) {\n\t\t\treturn siblingCheck( a, b );\n\t\t}\n\n\t\t// Otherwise we need full lists of their ancestors for comparison\n\t\tcur = a;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tap.unshift( cur );\n\t\t}\n\t\tcur = b;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tbp.unshift( cur );\n\t\t}\n\n\t\t// Walk down the tree looking for a discrepancy\n\t\twhile ( ap[i] === bp[i] ) {\n\t\t\ti++;\n\t\t}\n\n\t\treturn i ?\n\t\t\t// Do a sibling check if the nodes have a common ancestor\n\t\t\tsiblingCheck( ap[i], bp[i] ) :\n\n\t\t\t// Otherwise nodes in our document sort first\n\t\t\tap[i] === preferredDoc ? -1 :\n\t\t\tbp[i] === preferredDoc ? 1 :\n\t\t\t0;\n\t};\n\n\treturn doc;\n};\n\nSizzle.matches = function( expr, elements ) {\n\treturn Sizzle( expr, null, null, elements );\n};\n\nSizzle.matchesSelector = function( elem, expr ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\t// Make sure that attribute selectors are quoted\n\texpr = expr.replace( rattributeQuotes, \"='$1']\" );\n\n\tif ( support.matchesSelector && documentIsHTML &&\n\t\t( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&\n\t\t( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {\n\n\t\ttry {\n\t\t\tvar ret = matches.call( elem, expr );\n\n\t\t\t// IE 9's matchesSelector returns false on disconnected nodes\n\t\t\tif ( ret || support.disconnectedMatch ||\n\t\t\t\t\t// As well, disconnected nodes are said to be in a document\n\t\t\t\t\t// fragment in IE 9\n\t\t\t\t\telem.document && elem.document.nodeType !== 11 ) {\n\t\t\t\treturn ret;\n\t\t\t}\n\t\t} catch (e) {}\n\t}\n\n\treturn Sizzle( expr, document, null, [ elem ] ).length > 0;\n};\n\nSizzle.contains = function( context, elem ) {\n\t// Set document vars if needed\n\tif ( ( context.ownerDocument || context ) !== document ) {\n\t\tsetDocument( context );\n\t}\n\treturn contains( context, elem );\n};\n\nSizzle.attr = function( elem, name ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\tvar fn = Expr.attrHandle[ name.toLowerCase() ],\n\t\t// Don't get fooled by Object.prototype properties (jQuery #13807)\n\t\tval = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?\n\t\t\tfn( elem, name, !documentIsHTML ) :\n\t\t\tundefined;\n\n\treturn val !== undefined ?\n\t\tval :\n\t\tsupport.attributes || !documentIsHTML ?\n\t\t\telem.getAttribute( name ) :\n\t\t\t(val = elem.getAttributeNode(name)) && val.specified ?\n\t\t\t\tval.value :\n\t\t\t\tnull;\n};\n\nSizzle.error = function( msg ) {\n\tthrow new Error( \"Syntax error, unrecognized expression: \" + msg );\n};\n\n/**\n * Document sorting and removing duplicates\n * @param {ArrayLike} results\n */\nSizzle.uniqueSort = function( results ) {\n\tvar elem,\n\t\tduplicates = [],\n\t\tj = 0,\n\t\ti = 0;\n\n\t// Unless we *know* we can detect duplicates, assume their presence\n\thasDuplicate = !support.detectDuplicates;\n\tsortInput = !support.sortStable && results.slice( 0 );\n\tresults.sort( sortOrder );\n\n\tif ( hasDuplicate ) {\n\t\twhile ( (elem = results[i++]) ) {\n\t\t\tif ( elem === results[ i ] ) {\n\t\t\t\tj = duplicates.push( i );\n\t\t\t}\n\t\t}\n\t\twhile ( j-- ) {\n\t\t\tresults.splice( duplicates[ j ], 1 );\n\t\t}\n\t}\n\n\t// Clear input after sorting to release objects\n\t// See https://github.com/jquery/sizzle/pull/225\n\tsortInput = null;\n\n\treturn results;\n};\n\n/**\n * Utility function for retrieving the text value of an array of DOM nodes\n * @param {Array|Element} elem\n */\ngetText = Sizzle.getText = function( elem ) {\n\tvar node,\n\t\tret = \"\",\n\t\ti = 0,\n\t\tnodeType = elem.nodeType;\n\n\tif ( !nodeType ) {\n\t\t// If no nodeType, this is expected to be an array\n\t\twhile ( (node = elem[i++]) ) {\n\t\t\t// Do not traverse comment nodes\n\t\t\tret += getText( node );\n\t\t}\n\t} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {\n\t\t// Use textContent for elements\n\t\t// innerText usage removed for consistency of new lines (jQuery #11153)\n\t\tif ( typeof elem.textContent === \"string\" ) {\n\t\t\treturn elem.textContent;\n\t\t} else {\n\t\t\t// Traverse its children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tret += getText( elem );\n\t\t\t}\n\t\t}\n\t} else if ( nodeType === 3 || nodeType === 4 ) {\n\t\treturn elem.nodeValue;\n\t}\n\t// Do not include comment or processing instruction nodes\n\n\treturn ret;\n};\n\nExpr = Sizzle.selectors = {\n\n\t// Can be adjusted by the user\n\tcacheLength: 50,\n\n\tcreatePseudo: markFunction,\n\n\tmatch: matchExpr,\n\n\tattrHandle: {},\n\n\tfind: {},\n\n\trelative: {\n\t\t\">\": { dir: \"parentNode\", first: true },\n\t\t\" \": { dir: \"parentNode\" },\n\t\t\"+\": { dir: \"previousSibling\", first: true },\n\t\t\"~\": { dir: \"previousSibling\" }\n\t},\n\n\tpreFilter: {\n\t\t\"ATTR\": function( match ) {\n\t\t\tmatch[1] = match[1].replace( runescape, funescape );\n\n\t\t\t// Move the given value to match[3] whether quoted or unquoted\n\t\t\tmatch[3] = ( match[3] || match[4] || match[5] || \"\" ).replace( runescape, funescape );\n\n\t\t\tif ( match[2] === \"~=\" ) {\n\t\t\t\tmatch[3] = \" \" + match[3] + \" \";\n\t\t\t}\n\n\t\t\treturn match.slice( 0, 4 );\n\t\t},\n\n\t\t\"CHILD\": function( match ) {\n\t\t\t/* matches from matchExpr[\"CHILD\"]\n\t\t\t\t1 type (only|nth|...)\n\t\t\t\t2 what (child|of-type)\n\t\t\t\t3 argument (even|odd|\\d*|\\d*n([+-]\\d+)?|...)\n\t\t\t\t4 xn-component of xn+y argument ([+-]?\\d*n|)\n\t\t\t\t5 sign of xn-component\n\t\t\t\t6 x of xn-component\n\t\t\t\t7 sign of y-component\n\t\t\t\t8 y of y-component\n\t\t\t*/\n\t\t\tmatch[1] = match[1].toLowerCase();\n\n\t\t\tif ( match[1].slice( 0, 3 ) === \"nth\" ) {\n\t\t\t\t// nth-* requires argument\n\t\t\t\tif ( !match[3] ) {\n\t\t\t\t\tSizzle.error( match[0] );\n\t\t\t\t}\n\n\t\t\t\t// numeric x and y parameters for Expr.filter.CHILD\n\t\t\t\t// remember that false/true cast respectively to 0/1\n\t\t\t\tmatch[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === \"even\" || match[3] === \"odd\" ) );\n\t\t\t\tmatch[5] = +( ( match[7] + match[8] ) || match[3] === \"odd\" );\n\n\t\t\t// other types prohibit arguments\n\t\t\t} else if ( match[3] ) {\n\t\t\t\tSizzle.error( match[0] );\n\t\t\t}\n\n\t\t\treturn match;\n\t\t},\n\n\t\t\"PSEUDO\": function( match ) {\n\t\t\tvar excess,\n\t\t\t\tunquoted = !match[6] && match[2];\n\n\t\t\tif ( matchExpr[\"CHILD\"].test( match[0] ) ) {\n\t\t\t\treturn null;\n\t\t\t}\n\n\t\t\t// Accept quoted arguments as-is\n\t\t\tif ( match[3] ) {\n\t\t\t\tmatch[2] = match[4] || match[5] || \"\";\n\n\t\t\t// Strip excess characters from unquoted arguments\n\t\t\t} else if ( unquoted && rpseudo.test( unquoted ) &&\n\t\t\t\t// Get excess from tokenize (recursively)\n\t\t\t\t(excess = tokenize( unquoted, true )) &&\n\t\t\t\t// advance to the next closing parenthesis\n\t\t\t\t(excess = unquoted.indexOf( \")\", unquoted.length - excess ) - unquoted.length) ) {\n\n\t\t\t\t// excess is a negative index\n\t\t\t\tmatch[0] = match[0].slice( 0, excess );\n\t\t\t\tmatch[2] = unquoted.slice( 0, excess );\n\t\t\t}\n\n\t\t\t// Return only captures needed by the pseudo filter method (type and argument)\n\t\t\treturn match.slice( 0, 3 );\n\t\t}\n\t},\n\n\tfilter: {\n\n\t\t\"TAG\": function( nodeNameSelector ) {\n\t\t\tvar nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn nodeNameSelector === \"*\" ?\n\t\t\t\tfunction() { return true; } :\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn elem.nodeName && elem.nodeName.toLowerCase() === nodeName;\n\t\t\t\t};\n\t\t},\n\n\t\t\"CLASS\": function( className ) {\n\t\t\tvar pattern = classCache[ className + \" \" ];\n\n\t\t\treturn pattern ||\n\t\t\t\t(pattern = new RegExp( \"(^|\" + whitespace + \")\" + className + \"(\" + whitespace + \"|$)\" )) &&\n\t\t\t\tclassCache( className, function( elem ) {\n\t\t\t\t\treturn pattern.test( typeof elem.className === \"string\" && elem.className || typeof elem.getAttribute !== \"undefined\" && elem.getAttribute(\"class\") || \"\" );\n\t\t\t\t});\n\t\t},\n\n\t\t\"ATTR\": function( name, operator, check ) {\n\t\t\treturn function( elem ) {\n\t\t\t\tvar result = Sizzle.attr( elem, name );\n\n\t\t\t\tif ( result == null ) {\n\t\t\t\t\treturn operator === \"!=\";\n\t\t\t\t}\n\t\t\t\tif ( !operator ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\n\t\t\t\tresult += \"\";\n\n\t\t\t\treturn operator === \"=\" ? result === check :\n\t\t\t\t\toperator === \"!=\" ? result !== check :\n\t\t\t\t\toperator === \"^=\" ? check && result.indexOf( check ) === 0 :\n\t\t\t\t\toperator === \"*=\" ? check && result.indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"$=\" ? check && result.slice( -check.length ) === check :\n\t\t\t\t\toperator === \"~=\" ? ( \" \" + result.replace( rwhitespace, \" \" ) + \" \" ).indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"|=\" ? result === check || result.slice( 0, check.length + 1 ) === check + \"-\" :\n\t\t\t\t\tfalse;\n\t\t\t};\n\t\t},\n\n\t\t\"CHILD\": function( type, what, argument, first, last ) {\n\t\t\tvar simple = type.slice( 0, 3 ) !== \"nth\",\n\t\t\t\tforward = type.slice( -4 ) !== \"last\",\n\t\t\t\tofType = what === \"of-type\";\n\n\t\t\treturn first === 1 && last === 0 ?\n\n\t\t\t\t// Shortcut for :nth-*(n)\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn !!elem.parentNode;\n\t\t\t\t} :\n\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tvar cache, outerCache, node, diff, nodeIndex, start,\n\t\t\t\t\t\tdir = simple !== forward ? \"nextSibling\" : \"previousSibling\",\n\t\t\t\t\t\tparent = elem.parentNode,\n\t\t\t\t\t\tname = ofType && elem.nodeName.toLowerCase(),\n\t\t\t\t\t\tuseCache = !xml && !ofType;\n\n\t\t\t\t\tif ( parent ) {\n\n\t\t\t\t\t\t// :(first|last|only)-(child|of-type)\n\t\t\t\t\t\tif ( simple ) {\n\t\t\t\t\t\t\twhile ( dir ) {\n\t\t\t\t\t\t\t\tnode = elem;\n\t\t\t\t\t\t\t\twhile ( (node = node[ dir ]) ) {\n\t\t\t\t\t\t\t\t\tif ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) {\n\t\t\t\t\t\t\t\t\t\treturn false;\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t// Reverse direction for :only-* (if we haven't yet done so)\n\t\t\t\t\t\t\t\tstart = dir = type === \"only\" && !start && \"nextSibling\";\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\tstart = [ forward ? parent.firstChild : parent.lastChild ];\n\n\t\t\t\t\t\t// non-xml :nth-child(...) stores cache data on `parent`\n\t\t\t\t\t\tif ( forward && useCache ) {\n\t\t\t\t\t\t\t// Seek `elem` from a previously-cached index\n\t\t\t\t\t\t\touterCache = parent[ expando ] || (parent[ expando ] = {});\n\t\t\t\t\t\t\tcache = outerCache[ type ] || [];\n\t\t\t\t\t\t\tnodeIndex = cache[0] === dirruns && cache[1];\n\t\t\t\t\t\t\tdiff = cache[0] === dirruns && cache[2];\n\t\t\t\t\t\t\tnode = nodeIndex && parent.childNodes[ nodeIndex ];\n\n\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\n\t\t\t\t\t\t\t\t// Fallback to seeking `elem` from the start\n\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\t// When found, cache indexes on `parent` and break\n\t\t\t\t\t\t\t\tif ( node.nodeType === 1 && ++diff && node === elem ) {\n\t\t\t\t\t\t\t\t\touterCache[ type ] = [ dirruns, nodeIndex, diff ];\n\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Use previously-cached element index if available\n\t\t\t\t\t\t} else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) {\n\t\t\t\t\t\t\tdiff = cache[1];\n\n\t\t\t\t\t\t// xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Use the same loop as above to seek `elem` from the start\n\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\tif ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) {\n\t\t\t\t\t\t\t\t\t// Cache the index of each encountered element\n\t\t\t\t\t\t\t\t\tif ( useCache ) {\n\t\t\t\t\t\t\t\t\t\t(node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ];\n\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\tif ( node === elem ) {\n\t\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Incorporate the offset, then check against cycle size\n\t\t\t\t\t\tdiff -= last;\n\t\t\t\t\t\treturn diff === first || ( diff % first === 0 && diff / first >= 0 );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t},\n\n\t\t\"PSEUDO\": function( pseudo, argument ) {\n\t\t\t// pseudo-class names are case-insensitive\n\t\t\t// http://www.w3.org/TR/selectors/#pseudo-classes\n\t\t\t// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters\n\t\t\t// Remember that setFilters inherits from pseudos\n\t\t\tvar args,\n\t\t\t\tfn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||\n\t\t\t\t\tSizzle.error( \"unsupported pseudo: \" + pseudo );\n\n\t\t\t// The user may use createPseudo to indicate that\n\t\t\t// arguments are needed to create the filter function\n\t\t\t// just as Sizzle does\n\t\t\tif ( fn[ expando ] ) {\n\t\t\t\treturn fn( argument );\n\t\t\t}\n\n\t\t\t// But maintain support for old signatures\n\t\t\tif ( fn.length > 1 ) {\n\t\t\t\targs = [ pseudo, pseudo, \"\", argument ];\n\t\t\t\treturn Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?\n\t\t\t\t\tmarkFunction(function( seed, matches ) {\n\t\t\t\t\t\tvar idx,\n\t\t\t\t\t\t\tmatched = fn( seed, argument ),\n\t\t\t\t\t\t\ti = matched.length;\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tidx = indexOf( seed, matched[i] );\n\t\t\t\t\t\t\tseed[ idx ] = !( matches[ idx ] = matched[i] );\n\t\t\t\t\t\t}\n\t\t\t\t\t}) :\n\t\t\t\t\tfunction( elem ) {\n\t\t\t\t\t\treturn fn( elem, 0, args );\n\t\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn fn;\n\t\t}\n\t},\n\n\tpseudos: {\n\t\t// Potentially complex pseudos\n\t\t\"not\": markFunction(function( selector ) {\n\t\t\t// Trim the selector passed to compile\n\t\t\t// to avoid treating leading and trailing\n\t\t\t// spaces as combinators\n\t\t\tvar input = [],\n\t\t\t\tresults = [],\n\t\t\t\tmatcher = compile( selector.replace( rtrim, \"$1\" ) );\n\n\t\t\treturn matcher[ expando ] ?\n\t\t\t\tmarkFunction(function( seed, matches, context, xml ) {\n\t\t\t\t\tvar elem,\n\t\t\t\t\t\tunmatched = matcher( seed, null, xml, [] ),\n\t\t\t\t\t\ti = seed.length;\n\n\t\t\t\t\t// Match elements unmatched by `matcher`\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = unmatched[i]) ) {\n\t\t\t\t\t\t\tseed[i] = !(matches[i] = elem);\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}) :\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tinput[0] = elem;\n\t\t\t\t\tmatcher( input, null, xml, results );\n\t\t\t\t\t// Don't keep the element (issue #299)\n\t\t\t\t\tinput[0] = null;\n\t\t\t\t\treturn !results.pop();\n\t\t\t\t};\n\t\t}),\n\n\t\t\"has\": markFunction(function( selector ) {\n\t\t\treturn function( elem ) {\n\t\t\t\treturn Sizzle( selector, elem ).length > 0;\n\t\t\t};\n\t\t}),\n\n\t\t\"contains\": markFunction(function( text ) {\n\t\t\ttext = text.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;\n\t\t\t};\n\t\t}),\n\n\t\t// \"Whether an element is represented by a :lang() selector\n\t\t// is based solely on the element's language value\n\t\t// being equal to the identifier C,\n\t\t// or beginning with the identifier C immediately followed by \"-\".\n\t\t// The matching of C against the element's language value is performed case-insensitively.\n\t\t// The identifier C does not have to be a valid language name.\"\n\t\t// http://www.w3.org/TR/selectors/#lang-pseudo\n\t\t\"lang\": markFunction( function( lang ) {\n\t\t\t// lang value must be a valid identifier\n\t\t\tif ( !ridentifier.test(lang || \"\") ) {\n\t\t\t\tSizzle.error( \"unsupported lang: \" + lang );\n\t\t\t}\n\t\t\tlang = lang.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn function( elem ) {\n\t\t\t\tvar elemLang;\n\t\t\t\tdo {\n\t\t\t\t\tif ( (elemLang = documentIsHTML ?\n\t\t\t\t\t\telem.lang :\n\t\t\t\t\t\telem.getAttribute(\"xml:lang\") || elem.getAttribute(\"lang\")) ) {\n\n\t\t\t\t\t\telemLang = elemLang.toLowerCase();\n\t\t\t\t\t\treturn elemLang === lang || elemLang.indexOf( lang + \"-\" ) === 0;\n\t\t\t\t\t}\n\t\t\t\t} while ( (elem = elem.parentNode) && elem.nodeType === 1 );\n\t\t\t\treturn false;\n\t\t\t};\n\t\t}),\n\n\t\t// Miscellaneous\n\t\t\"target\": function( elem ) {\n\t\t\tvar hash = window.location && window.location.hash;\n\t\t\treturn hash && hash.slice( 1 ) === elem.id;\n\t\t},\n\n\t\t\"root\": function( elem ) {\n\t\t\treturn elem === docElem;\n\t\t},\n\n\t\t\"focus\": function( elem ) {\n\t\t\treturn elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);\n\t\t},\n\n\t\t// Boolean properties\n\t\t\"enabled\": function( elem ) {\n\t\t\treturn elem.disabled === false;\n\t\t},\n\n\t\t\"disabled\": function( elem ) {\n\t\t\treturn elem.disabled === true;\n\t\t},\n\n\t\t\"checked\": function( elem ) {\n\t\t\t// In CSS3, :checked should return both checked and selected elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\tvar nodeName = elem.nodeName.toLowerCase();\n\t\t\treturn (nodeName === \"input\" && !!elem.checked) || (nodeName === \"option\" && !!elem.selected);\n\t\t},\n\n\t\t\"selected\": function( elem ) {\n\t\t\t// Accessing this property makes selected-by-default\n\t\t\t// options in Safari work properly\n\t\t\tif ( elem.parentNode ) {\n\t\t\t\telem.parentNode.selectedIndex;\n\t\t\t}\n\n\t\t\treturn elem.selected === true;\n\t\t},\n\n\t\t// Contents\n\t\t\"empty\": function( elem ) {\n\t\t\t// http://www.w3.org/TR/selectors/#empty-pseudo\n\t\t\t// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),\n\t\t\t// but not by others (comment: 8; processing instruction: 7; etc.)\n\t\t\t// nodeType < 6 works because attributes (2) do not appear as children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tif ( elem.nodeType < 6 ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t},\n\n\t\t\"parent\": function( elem ) {\n\t\t\treturn !Expr.pseudos[\"empty\"]( elem );\n\t\t},\n\n\t\t// Element/input types\n\t\t\"header\": function( elem ) {\n\t\t\treturn rheader.test( elem.nodeName );\n\t\t},\n\n\t\t\"input\": function( elem ) {\n\t\t\treturn rinputs.test( elem.nodeName );\n\t\t},\n\n\t\t\"button\": function( elem ) {\n\t\t\tvar name = elem.nodeName.toLowerCase();\n\t\t\treturn name === \"input\" && elem.type === \"button\" || name === \"button\";\n\t\t},\n\n\t\t\"text\": function( elem ) {\n\t\t\tvar attr;\n\t\t\treturn elem.nodeName.toLowerCase() === \"input\" &&\n\t\t\t\telem.type === \"text\" &&\n\n\t\t\t\t// Support: IE<8\n\t\t\t\t// New HTML5 attribute values (e.g., \"search\") appear with elem.type === \"text\"\n\t\t\t\t( (attr = elem.getAttribute(\"type\")) == null || attr.toLowerCase() === \"text\" );\n\t\t},\n\n\t\t// Position-in-collection\n\t\t\"first\": createPositionalPseudo(function() {\n\t\t\treturn [ 0 ];\n\t\t}),\n\n\t\t\"last\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\treturn [ length - 1 ];\n\t\t}),\n\n\t\t\"eq\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\treturn [ argument < 0 ? argument + length : argument ];\n\t\t}),\n\n\t\t\"even\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 0;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"odd\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 1;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"lt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; --i >= 0; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"gt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; ++i < length; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t})\n\t}\n};\n\nExpr.pseudos[\"nth\"] = Expr.pseudos[\"eq\"];\n\n// Add button/input type pseudos\nfor ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {\n\tExpr.pseudos[ i ] = createInputPseudo( i );\n}\nfor ( i in { submit: true, reset: true } ) {\n\tExpr.pseudos[ i ] = createButtonPseudo( i );\n}\n\n// Easy API for creating new setFilters\nfunction setFilters() {}\nsetFilters.prototype = Expr.filters = Expr.pseudos;\nExpr.setFilters = new setFilters();\n\ntokenize = Sizzle.tokenize = function( selector, parseOnly ) {\n\tvar matched, match, tokens, type,\n\t\tsoFar, groups, preFilters,\n\t\tcached = tokenCache[ selector + \" \" ];\n\n\tif ( cached ) {\n\t\treturn parseOnly ? 0 : cached.slice( 0 );\n\t}\n\n\tsoFar = selector;\n\tgroups = [];\n\tpreFilters = Expr.preFilter;\n\n\twhile ( soFar ) {\n\n\t\t// Comma and first run\n\t\tif ( !matched || (match = rcomma.exec( soFar )) ) {\n\t\t\tif ( match ) {\n\t\t\t\t// Don't consume trailing commas as valid\n\t\t\t\tsoFar = soFar.slice( match[0].length ) || soFar;\n\t\t\t}\n\t\t\tgroups.push( (tokens = []) );\n\t\t}\n\n\t\tmatched = false;\n\n\t\t// Combinators\n\t\tif ( (match = rcombinators.exec( soFar )) ) {\n\t\t\tmatched = match.shift();\n\t\t\ttokens.push({\n\t\t\t\tvalue: matched,\n\t\t\t\t// Cast descendant combinators to space\n\t\t\t\ttype: match[0].replace( rtrim, \" \" )\n\t\t\t});\n\t\t\tsoFar = soFar.slice( matched.length );\n\t\t}\n\n\t\t// Filters\n\t\tfor ( type in Expr.filter ) {\n\t\t\tif ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||\n\t\t\t\t(match = preFilters[ type ]( match ))) ) {\n\t\t\t\tmatched = match.shift();\n\t\t\t\ttokens.push({\n\t\t\t\t\tvalue: matched,\n\t\t\t\t\ttype: type,\n\t\t\t\t\tmatches: match\n\t\t\t\t});\n\t\t\t\tsoFar = soFar.slice( matched.length );\n\t\t\t}\n\t\t}\n\n\t\tif ( !matched ) {\n\t\t\tbreak;\n\t\t}\n\t}\n\n\t// Return the length of the invalid excess\n\t// if we're just parsing\n\t// Otherwise, throw an error or return tokens\n\treturn parseOnly ?\n\t\tsoFar.length :\n\t\tsoFar ?\n\t\t\tSizzle.error( selector ) :\n\t\t\t// Cache the tokens\n\t\t\ttokenCache( selector, groups ).slice( 0 );\n};\n\nfunction toSelector( tokens ) {\n\tvar i = 0,\n\t\tlen = tokens.length,\n\t\tselector = \"\";\n\tfor ( ; i < len; i++ ) {\n\t\tselector += tokens[i].value;\n\t}\n\treturn selector;\n}\n\nfunction addCombinator( matcher, combinator, base ) {\n\tvar dir = combinator.dir,\n\t\tcheckNonElements = base && dir === \"parentNode\",\n\t\tdoneName = done++;\n\n\treturn combinator.first ?\n\t\t// Check against closest ancestor/preceding element\n\t\tfunction( elem, context, xml ) {\n\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\treturn matcher( elem, context, xml );\n\t\t\t\t}\n\t\t\t}\n\t\t} :\n\n\t\t// Check against all ancestor/preceding elements\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar oldCache, outerCache,\n\t\t\t\tnewCache = [ dirruns, doneName ];\n\n\t\t\t// We can't set arbitrary data on XML nodes, so they don't benefit from dir caching\n\t\t\tif ( xml ) {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\tif ( matcher( elem, context, xml ) ) {\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\touterCache = elem[ expando ] || (elem[ expando ] = {});\n\t\t\t\t\t\tif ( (oldCache = outerCache[ dir ]) &&\n\t\t\t\t\t\t\toldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {\n\n\t\t\t\t\t\t\t// Assign to newCache so results back-propagate to previous elements\n\t\t\t\t\t\t\treturn (newCache[ 2 ] = oldCache[ 2 ]);\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Reuse newcache so results back-propagate to previous elements\n\t\t\t\t\t\t\touterCache[ dir ] = newCache;\n\n\t\t\t\t\t\t\t// A match means we're done; a fail means we have to keep checking\n\t\t\t\t\t\t\tif ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {\n\t\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t};\n}\n\nfunction elementMatcher( matchers ) {\n\treturn matchers.length > 1 ?\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar i = matchers.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( !matchers[i]( elem, context, xml ) ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t} :\n\t\tmatchers[0];\n}\n\nfunction multipleContexts( selector, contexts, results ) {\n\tvar i = 0,\n\t\tlen = contexts.length;\n\tfor ( ; i < len; i++ ) {\n\t\tSizzle( selector, contexts[i], results );\n\t}\n\treturn results;\n}\n\nfunction condense( unmatched, map, filter, context, xml ) {\n\tvar elem,\n\t\tnewUnmatched = [],\n\t\ti = 0,\n\t\tlen = unmatched.length,\n\t\tmapped = map != null;\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (elem = unmatched[i]) ) {\n\t\t\tif ( !filter || filter( elem, context, xml ) ) {\n\t\t\t\tnewUnmatched.push( elem );\n\t\t\t\tif ( mapped ) {\n\t\t\t\t\tmap.push( i );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn newUnmatched;\n}\n\nfunction setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {\n\tif ( postFilter && !postFilter[ expando ] ) {\n\t\tpostFilter = setMatcher( postFilter );\n\t}\n\tif ( postFinder && !postFinder[ expando ] ) {\n\t\tpostFinder = setMatcher( postFinder, postSelector );\n\t}\n\treturn markFunction(function( seed, results, context, xml ) {\n\t\tvar temp, i, elem,\n\t\t\tpreMap = [],\n\t\t\tpostMap = [],\n\t\t\tpreexisting = results.length,\n\n\t\t\t// Get initial elements from seed or context\n\t\t\telems = seed || multipleContexts( selector || \"*\", context.nodeType ? [ context ] : context, [] ),\n\n\t\t\t// Prefilter to get matcher input, preserving a map for seed-results synchronization\n\t\t\tmatcherIn = preFilter && ( seed || !selector ) ?\n\t\t\t\tcondense( elems, preMap, preFilter, context, xml ) :\n\t\t\t\telems,\n\n\t\t\tmatcherOut = matcher ?\n\t\t\t\t// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,\n\t\t\t\tpostFinder || ( seed ? preFilter : preexisting || postFilter ) ?\n\n\t\t\t\t\t// ...intermediate processing is necessary\n\t\t\t\t\t[] :\n\n\t\t\t\t\t// ...otherwise use results directly\n\t\t\t\t\tresults :\n\t\t\t\tmatcherIn;\n\n\t\t// Find primary matches\n\t\tif ( matcher ) {\n\t\t\tmatcher( matcherIn, matcherOut, context, xml );\n\t\t}\n\n\t\t// Apply postFilter\n\t\tif ( postFilter ) {\n\t\t\ttemp = condense( matcherOut, postMap );\n\t\t\tpostFilter( temp, [], context, xml );\n\n\t\t\t// Un-match failing elements by moving them back to matcherIn\n\t\t\ti = temp.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( (elem = temp[i]) ) {\n\t\t\t\t\tmatcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tif ( seed ) {\n\t\t\tif ( postFinder || preFilter ) {\n\t\t\t\tif ( postFinder ) {\n\t\t\t\t\t// Get the final matcherOut by condensing this intermediate into postFinder contexts\n\t\t\t\t\ttemp = [];\n\t\t\t\t\ti = matcherOut.length;\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = matcherOut[i]) ) {\n\t\t\t\t\t\t\t// Restore matcherIn since elem is not yet a final match\n\t\t\t\t\t\t\ttemp.push( (matcherIn[i] = elem) );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tpostFinder( null, (matcherOut = []), temp, xml );\n\t\t\t\t}\n\n\t\t\t\t// Move matched elements from seed to results to keep them synchronized\n\t\t\t\ti = matcherOut.length;\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\tif ( (elem = matcherOut[i]) &&\n\t\t\t\t\t\t(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {\n\n\t\t\t\t\t\tseed[temp] = !(results[temp] = elem);\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Add elements to results, through postFinder if defined\n\t\t} else {\n\t\t\tmatcherOut = condense(\n\t\t\t\tmatcherOut === results ?\n\t\t\t\t\tmatcherOut.splice( preexisting, matcherOut.length ) :\n\t\t\t\t\tmatcherOut\n\t\t\t);\n\t\t\tif ( postFinder ) {\n\t\t\t\tpostFinder( null, results, matcherOut, xml );\n\t\t\t} else {\n\t\t\t\tpush.apply( results, matcherOut );\n\t\t\t}\n\t\t}\n\t});\n}\n\nfunction matcherFromTokens( tokens ) {\n\tvar checkContext, matcher, j,\n\t\tlen = tokens.length,\n\t\tleadingRelative = Expr.relative[ tokens[0].type ],\n\t\timplicitRelative = leadingRelative || Expr.relative[\" \"],\n\t\ti = leadingRelative ? 1 : 0,\n\n\t\t// The foundational matcher ensures that elements are reachable from top-level context(s)\n\t\tmatchContext = addCombinator( function( elem ) {\n\t\t\treturn elem === checkContext;\n\t\t}, implicitRelative, true ),\n\t\tmatchAnyContext = addCombinator( function( elem ) {\n\t\t\treturn indexOf( checkContext, elem ) > -1;\n\t\t}, implicitRelative, true ),\n\t\tmatchers = [ function( elem, context, xml ) {\n\t\t\tvar ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (\n\t\t\t\t(checkContext = context).nodeType ?\n\t\t\t\t\tmatchContext( elem, context, xml ) :\n\t\t\t\t\tmatchAnyContext( elem, context, xml ) );\n\t\t\t// Avoid hanging onto element (issue #299)\n\t\t\tcheckContext = null;\n\t\t\treturn ret;\n\t\t} ];\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (matcher = Expr.relative[ tokens[i].type ]) ) {\n\t\t\tmatchers = [ addCombinator(elementMatcher( matchers ), matcher) ];\n\t\t} else {\n\t\t\tmatcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );\n\n\t\t\t// Return special upon seeing a positional matcher\n\t\t\tif ( matcher[ expando ] ) {\n\t\t\t\t// Find the next relative operator (if any) for proper handling\n\t\t\t\tj = ++i;\n\t\t\t\tfor ( ; j < len; j++ ) {\n\t\t\t\t\tif ( Expr.relative[ tokens[j].type ] ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn setMatcher(\n\t\t\t\t\ti > 1 && elementMatcher( matchers ),\n\t\t\t\t\ti > 1 && toSelector(\n\t\t\t\t\t\t// If the preceding token was a descendant combinator, insert an implicit any-element `*`\n\t\t\t\t\t\ttokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === \" \" ? \"*\" : \"\" })\n\t\t\t\t\t).replace( rtrim, \"$1\" ),\n\t\t\t\t\tmatcher,\n\t\t\t\t\ti < j && matcherFromTokens( tokens.slice( i, j ) ),\n\t\t\t\t\tj < len && matcherFromTokens( (tokens = tokens.slice( j )) ),\n\t\t\t\t\tj < len && toSelector( tokens )\n\t\t\t\t);\n\t\t\t}\n\t\t\tmatchers.push( matcher );\n\t\t}\n\t}\n\n\treturn elementMatcher( matchers );\n}\n\nfunction matcherFromGroupMatchers( elementMatchers, setMatchers ) {\n\tvar bySet = setMatchers.length > 0,\n\t\tbyElement = elementMatchers.length > 0,\n\t\tsuperMatcher = function( seed, context, xml, results, outermost ) {\n\t\t\tvar elem, j, matcher,\n\t\t\t\tmatchedCount = 0,\n\t\t\t\ti = \"0\",\n\t\t\t\tunmatched = seed && [],\n\t\t\t\tsetMatched = [],\n\t\t\t\tcontextBackup = outermostContext,\n\t\t\t\t// We must always have either seed elements or outermost context\n\t\t\t\telems = seed || byElement && Expr.find[\"TAG\"]( \"*\", outermost ),\n\t\t\t\t// Use integer dirruns iff this is the outermost matcher\n\t\t\t\tdirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),\n\t\t\t\tlen = elems.length;\n\n\t\t\tif ( outermost ) {\n\t\t\t\toutermostContext = context !== document && context;\n\t\t\t}\n\n\t\t\t// Add elements passing elementMatchers directly to results\n\t\t\t// Keep `i` a string if there are no elements so `matchedCount` will be \"00\" below\n\t\t\t// Support: IE<9, Safari\n\t\t\t// Tolerate NodeList properties (IE: \"length\"; Safari: ) matching elements by id\n\t\t\tfor ( ; i !== len && (elem = elems[i]) != null; i++ ) {\n\t\t\t\tif ( byElement && elem ) {\n\t\t\t\t\tj = 0;\n\t\t\t\t\twhile ( (matcher = elementMatchers[j++]) ) {\n\t\t\t\t\t\tif ( matcher( elem, context, xml ) ) {\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tif ( outermost ) {\n\t\t\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Track unmatched elements for set filters\n\t\t\t\tif ( bySet ) {\n\t\t\t\t\t// They will have gone through all possible matchers\n\t\t\t\t\tif ( (elem = !matcher && elem) ) {\n\t\t\t\t\t\tmatchedCount--;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Lengthen the array for every element, matched or not\n\t\t\t\t\tif ( seed ) {\n\t\t\t\t\t\tunmatched.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Apply set filters to unmatched elements\n\t\t\tmatchedCount += i;\n\t\t\tif ( bySet && i !== matchedCount ) {\n\t\t\t\tj = 0;\n\t\t\t\twhile ( (matcher = setMatchers[j++]) ) {\n\t\t\t\t\tmatcher( unmatched, setMatched, context, xml );\n\t\t\t\t}\n\n\t\t\t\tif ( seed ) {\n\t\t\t\t\t// Reintegrate element matches to eliminate the need for sorting\n\t\t\t\t\tif ( matchedCount > 0 ) {\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tif ( !(unmatched[i] || setMatched[i]) ) {\n\t\t\t\t\t\t\t\tsetMatched[i] = pop.call( results );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Discard index placeholder values to get only actual matches\n\t\t\t\t\tsetMatched = condense( setMatched );\n\t\t\t\t}\n\n\t\t\t\t// Add matches to results\n\t\t\t\tpush.apply( results, setMatched );\n\n\t\t\t\t// Seedless set matches succeeding multiple successful matchers stipulate sorting\n\t\t\t\tif ( outermost && !seed && setMatched.length > 0 &&\n\t\t\t\t\t( matchedCount + setMatchers.length ) > 1 ) {\n\n\t\t\t\t\tSizzle.uniqueSort( results );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Override manipulation of globals by nested matchers\n\t\t\tif ( outermost ) {\n\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\toutermostContext = contextBackup;\n\t\t\t}\n\n\t\t\treturn unmatched;\n\t\t};\n\n\treturn bySet ?\n\t\tmarkFunction( superMatcher ) :\n\t\tsuperMatcher;\n}\n\ncompile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {\n\tvar i,\n\t\tsetMatchers = [],\n\t\telementMatchers = [],\n\t\tcached = compilerCache[ selector + \" \" ];\n\n\tif ( !cached ) {\n\t\t// Generate a function of recursive functions that can be used to check each element\n\t\tif ( !match ) {\n\t\t\tmatch = tokenize( selector );\n\t\t}\n\t\ti = match.length;\n\t\twhile ( i-- ) {\n\t\t\tcached = matcherFromTokens( match[i] );\n\t\t\tif ( cached[ expando ] ) {\n\t\t\t\tsetMatchers.push( cached );\n\t\t\t} else {\n\t\t\t\telementMatchers.push( cached );\n\t\t\t}\n\t\t}\n\n\t\t// Cache the compiled function\n\t\tcached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );\n\n\t\t// Save selector and tokenization\n\t\tcached.selector = selector;\n\t}\n\treturn cached;\n};\n\n/**\n * A low-level selection function that works with Sizzle's compiled\n * selector functions\n * @param {String|Function} selector A selector or a pre-compiled\n * selector function built with Sizzle.compile\n * @param {Element} context\n * @param {Array} [results]\n * @param {Array} [seed] A set of elements to match against\n */\nselect = Sizzle.select = function( selector, context, results, seed ) {\n\tvar i, tokens, token, type, find,\n\t\tcompiled = typeof selector === \"function\" && selector,\n\t\tmatch = !seed && tokenize( (selector = compiled.selector || selector) );\n\n\tresults = results || [];\n\n\t// Try to minimize operations if there is no seed and only one group\n\tif ( match.length === 1 ) {\n\n\t\t// Take a shortcut and set the context if the root selector is an ID\n\t\ttokens = match[0] = match[0].slice( 0 );\n\t\tif ( tokens.length > 2 && (token = tokens[0]).type === \"ID\" &&\n\t\t\t\tsupport.getById && context.nodeType === 9 && documentIsHTML &&\n\t\t\t\tExpr.relative[ tokens[1].type ] ) {\n\n\t\t\tcontext = ( Expr.find[\"ID\"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];\n\t\t\tif ( !context ) {\n\t\t\t\treturn results;\n\n\t\t\t// Precompiled matchers will still verify ancestry, so step up a level\n\t\t\t} else if ( compiled ) {\n\t\t\t\tcontext = context.parentNode;\n\t\t\t}\n\n\t\t\tselector = selector.slice( tokens.shift().value.length );\n\t\t}\n\n\t\t// Fetch a seed set for right-to-left matching\n\t\ti = matchExpr[\"needsContext\"].test( selector ) ? 0 : tokens.length;\n\t\twhile ( i-- ) {\n\t\t\ttoken = tokens[i];\n\n\t\t\t// Abort if we hit a combinator\n\t\t\tif ( Expr.relative[ (type = token.type) ] ) {\n\t\t\t\tbreak;\n\t\t\t}\n\t\t\tif ( (find = Expr.find[ type ]) ) {\n\t\t\t\t// Search, expanding context for leading sibling combinators\n\t\t\t\tif ( (seed = find(\n\t\t\t\t\ttoken.matches[0].replace( runescape, funescape ),\n\t\t\t\t\trsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context\n\t\t\t\t)) ) {\n\n\t\t\t\t\t// If seed is empty or no tokens remain, we can return early\n\t\t\t\t\ttokens.splice( i, 1 );\n\t\t\t\t\tselector = seed.length && toSelector( tokens );\n\t\t\t\t\tif ( !selector ) {\n\t\t\t\t\t\tpush.apply( results, seed );\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Compile and execute a filtering function if one is not provided\n\t// Provide `match` to avoid retokenization if we modified the selector above\n\t( compiled || compile( selector, match ) )(\n\t\tseed,\n\t\tcontext,\n\t\t!documentIsHTML,\n\t\tresults,\n\t\trsibling.test( selector ) && testContext( context.parentNode ) || context\n\t);\n\treturn results;\n};\n\n// One-time assignments\n\n// Sort stability\nsupport.sortStable = expando.split(\"\").sort( sortOrder ).join(\"\") === expando;\n\n// Support: Chrome 14-35+\n// Always assume duplicates if they aren't passed to the comparison function\nsupport.detectDuplicates = !!hasDuplicate;\n\n// Initialize against the default document\nsetDocument();\n\n// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)\n// Detached nodes confoundingly follow *each other*\nsupport.sortDetached = assert(function( div1 ) {\n\t// Should return 1, but returns 4 (following)\n\treturn div1.compareDocumentPosition( document.createElement(\"div\") ) & 1;\n});\n\n// Support: IE<8\n// Prevent attribute/property \"interpolation\"\n// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx\nif ( !assert(function( div ) {\n\tdiv.innerHTML = \"\";\n\treturn div.firstChild.getAttribute(\"href\") === \"#\" ;\n}) ) {\n\taddHandle( \"type|href|height|width\", function( elem, name, isXML ) {\n\t\tif ( !isXML ) {\n\t\t\treturn elem.getAttribute( name, name.toLowerCase() === \"type\" ? 1 : 2 );\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use defaultValue in place of getAttribute(\"value\")\nif ( !support.attributes || !assert(function( div ) {\n\tdiv.innerHTML = \"\";\n\tdiv.firstChild.setAttribute( \"value\", \"\" );\n\treturn div.firstChild.getAttribute( \"value\" ) === \"\";\n}) ) {\n\taddHandle( \"value\", function( elem, name, isXML ) {\n\t\tif ( !isXML && elem.nodeName.toLowerCase() === \"input\" ) {\n\t\t\treturn elem.defaultValue;\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use getAttributeNode to fetch booleans when getAttribute lies\nif ( !assert(function( div ) {\n\treturn div.getAttribute(\"disabled\") == null;\n}) ) {\n\taddHandle( booleans, function( elem, name, isXML ) {\n\t\tvar val;\n\t\tif ( !isXML ) {\n\t\t\treturn elem[ name ] === true ? name.toLowerCase() :\n\t\t\t\t\t(val = elem.getAttributeNode( name )) && val.specified ?\n\t\t\t\t\tval.value :\n\t\t\t\tnull;\n\t\t}\n\t});\n}\n\nreturn Sizzle;\n\n})( window );\n\n\n\njQuery.find = Sizzle;\njQuery.expr = Sizzle.selectors;\njQuery.expr[\":\"] = jQuery.expr.pseudos;\njQuery.unique = Sizzle.uniqueSort;\njQuery.text = Sizzle.getText;\njQuery.isXMLDoc = Sizzle.isXML;\njQuery.contains = Sizzle.contains;\n\n\n\nvar rneedsContext = jQuery.expr.match.needsContext;\n\nvar rsingleTag = (/^<(\\w+)\\s*\\/?>(?:<\\/\\1>|)$/);\n\n\n\nvar risSimple = /^.[^:#\\[\\.,]*$/;\n\n// Implement the identical functionality for filter and not\nfunction winnow( elements, qualifier, not ) {\n\tif ( jQuery.isFunction( qualifier ) ) {\n\t\treturn jQuery.grep( elements, function( elem, i ) {\n\t\t\t/* jshint -W018 */\n\t\t\treturn !!qualifier.call( elem, i, elem ) !== not;\n\t\t});\n\n\t}\n\n\tif ( qualifier.nodeType ) {\n\t\treturn jQuery.grep( elements, function( elem ) {\n\t\t\treturn ( elem === qualifier ) !== not;\n\t\t});\n\n\t}\n\n\tif ( typeof qualifier === \"string\" ) {\n\t\tif ( risSimple.test( qualifier ) ) {\n\t\t\treturn jQuery.filter( qualifier, elements, not );\n\t\t}\n\n\t\tqualifier = jQuery.filter( qualifier, elements );\n\t}\n\n\treturn jQuery.grep( elements, function( elem ) {\n\t\treturn ( jQuery.inArray( elem, qualifier ) >= 0 ) !== not;\n\t});\n}\n\njQuery.filter = function( expr, elems, not ) {\n\tvar elem = elems[ 0 ];\n\n\tif ( not ) {\n\t\texpr = \":not(\" + expr + \")\";\n\t}\n\n\treturn elems.length === 1 && elem.nodeType === 1 ?\n\t\tjQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] :\n\t\tjQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {\n\t\t\treturn elem.nodeType === 1;\n\t\t}));\n};\n\njQuery.fn.extend({\n\tfind: function( selector ) {\n\t\tvar i,\n\t\t\tret = [],\n\t\t\tself = this,\n\t\t\tlen = self.length;\n\n\t\tif ( typeof selector !== \"string\" ) {\n\t\t\treturn this.pushStack( jQuery( selector ).filter(function() {\n\t\t\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\t\t\tif ( jQuery.contains( self[ i ], this ) ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}) );\n\t\t}\n\n\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\tjQuery.find( selector, self[ i ], ret );\n\t\t}\n\n\t\t// Needed because $( selector, context ) becomes $( context ).find( selector )\n\t\tret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret );\n\t\tret.selector = this.selector ? this.selector + \" \" + selector : selector;\n\t\treturn ret;\n\t},\n\tfilter: function( selector ) {\n\t\treturn this.pushStack( winnow(this, selector || [], false) );\n\t},\n\tnot: function( selector ) {\n\t\treturn this.pushStack( winnow(this, selector || [], true) );\n\t},\n\tis: function( selector ) {\n\t\treturn !!winnow(\n\t\t\tthis,\n\n\t\t\t// If this is a positional/relative selector, check membership in the returned set\n\t\t\t// so $(\"p:first\").is(\"p:last\") won't return true for a doc with two \"p\".\n\t\t\ttypeof selector === \"string\" && rneedsContext.test( selector ) ?\n\t\t\t\tjQuery( selector ) :\n\t\t\t\tselector || [],\n\t\t\tfalse\n\t\t).length;\n\t}\n});\n\n\n// Initialize a jQuery object\n\n\n// A central reference to the root jQuery(document)\nvar rootjQuery,\n\n\t// Use the correct document accordingly with window argument (sandbox)\n\tdocument = window.document,\n\n\t// A simple way to check for HTML strings\n\t// Prioritize #id over to avoid XSS via location.hash (#9521)\n\t// Strict HTML recognition (#11290: must start with <)\n\trquickExpr = /^(?:\\s*(<[\\w\\W]+>)[^>]*|#([\\w-]*))$/,\n\n\tinit = jQuery.fn.init = function( selector, context ) {\n\t\tvar match, elem;\n\n\t\t// HANDLE: $(\"\"), $(null), $(undefined), $(false)\n\t\tif ( !selector ) {\n\t\t\treturn this;\n\t\t}\n\n\t\t// Handle HTML strings\n\t\tif ( typeof selector === \"string\" ) {\n\t\t\tif ( selector.charAt(0) === \"<\" && selector.charAt( selector.length - 1 ) === \">\" && selector.length >= 3 ) {\n\t\t\t\t// Assume that strings that start and end with <> are HTML and skip the regex check\n\t\t\t\tmatch = [ null, selector, null ];\n\n\t\t\t} else {\n\t\t\t\tmatch = rquickExpr.exec( selector );\n\t\t\t}\n\n\t\t\t// Match html or make sure no context is specified for #id\n\t\t\tif ( match && (match[1] || !context) ) {\n\n\t\t\t\t// HANDLE: $(html) -> $(array)\n\t\t\t\tif ( match[1] ) {\n\t\t\t\t\tcontext = context instanceof jQuery ? context[0] : context;\n\n\t\t\t\t\t// scripts is true for back-compat\n\t\t\t\t\t// Intentionally let the error be thrown if parseHTML is not present\n\t\t\t\t\tjQuery.merge( this, jQuery.parseHTML(\n\t\t\t\t\t\tmatch[1],\n\t\t\t\t\t\tcontext && context.nodeType ? context.ownerDocument || context : document,\n\t\t\t\t\t\ttrue\n\t\t\t\t\t) );\n\n\t\t\t\t\t// HANDLE: $(html, props)\n\t\t\t\t\tif ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {\n\t\t\t\t\t\tfor ( match in context ) {\n\t\t\t\t\t\t\t// Properties of context are called as methods if possible\n\t\t\t\t\t\t\tif ( jQuery.isFunction( this[ match ] ) ) {\n\t\t\t\t\t\t\t\tthis[ match ]( context[ match ] );\n\n\t\t\t\t\t\t\t// ...and otherwise set as attributes\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tthis.attr( match, context[ match ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\treturn this;\n\n\t\t\t\t// HANDLE: $(#id)\n\t\t\t\t} else {\n\t\t\t\t\telem = document.getElementById( match[2] );\n\n\t\t\t\t\t// Check parentNode to catch when Blackberry 4.6 returns\n\t\t\t\t\t// nodes that are no longer in the document #6963\n\t\t\t\t\tif ( elem && elem.parentNode ) {\n\t\t\t\t\t\t// Handle the case where IE and Opera return items\n\t\t\t\t\t\t// by name instead of ID\n\t\t\t\t\t\tif ( elem.id !== match[2] ) {\n\t\t\t\t\t\t\treturn rootjQuery.find( selector );\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Otherwise, we inject the element directly into the jQuery object\n\t\t\t\t\t\tthis.length = 1;\n\t\t\t\t\t\tthis[0] = elem;\n\t\t\t\t\t}\n\n\t\t\t\t\tthis.context = document;\n\t\t\t\t\tthis.selector = selector;\n\t\t\t\t\treturn this;\n\t\t\t\t}\n\n\t\t\t// HANDLE: $(expr, $(...))\n\t\t\t} else if ( !context || context.jquery ) {\n\t\t\t\treturn ( context || rootjQuery ).find( selector );\n\n\t\t\t// HANDLE: $(expr, context)\n\t\t\t// (which is just equivalent to: $(context).find(expr)\n\t\t\t} else {\n\t\t\t\treturn this.constructor( context ).find( selector );\n\t\t\t}\n\n\t\t// HANDLE: $(DOMElement)\n\t\t} else if ( selector.nodeType ) {\n\t\t\tthis.context = this[0] = selector;\n\t\t\tthis.length = 1;\n\t\t\treturn this;\n\n\t\t// HANDLE: $(function)\n\t\t// Shortcut for document ready\n\t\t} else if ( jQuery.isFunction( selector ) ) {\n\t\t\treturn typeof rootjQuery.ready !== \"undefined\" ?\n\t\t\t\trootjQuery.ready( selector ) :\n\t\t\t\t// Execute immediately if ready is not present\n\t\t\t\tselector( jQuery );\n\t\t}\n\n\t\tif ( selector.selector !== undefined ) {\n\t\t\tthis.selector = selector.selector;\n\t\t\tthis.context = selector.context;\n\t\t}\n\n\t\treturn jQuery.makeArray( selector, this );\n\t};\n\n// Give the init function the jQuery prototype for later instantiation\ninit.prototype = jQuery.fn;\n\n// Initialize central reference\nrootjQuery = jQuery( document );\n\n\nvar rparentsprev = /^(?:parents|prev(?:Until|All))/,\n\t// methods guaranteed to produce a unique set when starting from a unique set\n\tguaranteedUnique = {\n\t\tchildren: true,\n\t\tcontents: true,\n\t\tnext: true,\n\t\tprev: true\n\t};\n\njQuery.extend({\n\tdir: function( elem, dir, until ) {\n\t\tvar matched = [],\n\t\t\tcur = elem[ dir ];\n\n\t\twhile ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {\n\t\t\tif ( cur.nodeType === 1 ) {\n\t\t\t\tmatched.push( cur );\n\t\t\t}\n\t\t\tcur = cur[dir];\n\t\t}\n\t\treturn matched;\n\t},\n\n\tsibling: function( n, elem ) {\n\t\tvar r = [];\n\n\t\tfor ( ; n; n = n.nextSibling ) {\n\t\t\tif ( n.nodeType === 1 && n !== elem ) {\n\t\t\t\tr.push( n );\n\t\t\t}\n\t\t}\n\n\t\treturn r;\n\t}\n});\n\njQuery.fn.extend({\n\thas: function( target ) {\n\t\tvar i,\n\t\t\ttargets = jQuery( target, this ),\n\t\t\tlen = targets.length;\n\n\t\treturn this.filter(function() {\n\t\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\t\tif ( jQuery.contains( this, targets[i] ) ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\t\t\t}\n\t\t});\n\t},\n\n\tclosest: function( selectors, context ) {\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\tl = this.length,\n\t\t\tmatched = [],\n\t\t\tpos = rneedsContext.test( selectors ) || typeof selectors !== \"string\" ?\n\t\t\t\tjQuery( selectors, context || this.context ) :\n\t\t\t\t0;\n\n\t\tfor ( ; i < l; i++ ) {\n\t\t\tfor ( cur = this[i]; cur && cur !== context; cur = cur.parentNode ) {\n\t\t\t\t// Always skip document fragments\n\t\t\t\tif ( cur.nodeType < 11 && (pos ?\n\t\t\t\t\tpos.index(cur) > -1 :\n\n\t\t\t\t\t// Don't pass non-elements to Sizzle\n\t\t\t\t\tcur.nodeType === 1 &&\n\t\t\t\t\t\tjQuery.find.matchesSelector(cur, selectors)) ) {\n\n\t\t\t\t\tmatched.push( cur );\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched );\n\t},\n\n\t// Determine the position of an element within\n\t// the matched set of elements\n\tindex: function( elem ) {\n\n\t\t// No argument, return index in parent\n\t\tif ( !elem ) {\n\t\t\treturn ( this[0] && this[0].parentNode ) ? this.first().prevAll().length : -1;\n\t\t}\n\n\t\t// index in selector\n\t\tif ( typeof elem === \"string\" ) {\n\t\t\treturn jQuery.inArray( this[0], jQuery( elem ) );\n\t\t}\n\n\t\t// Locate the position of the desired element\n\t\treturn jQuery.inArray(\n\t\t\t// If it receives a jQuery object, the first element is used\n\t\t\telem.jquery ? elem[0] : elem, this );\n\t},\n\n\tadd: function( selector, context ) {\n\t\treturn this.pushStack(\n\t\t\tjQuery.unique(\n\t\t\t\tjQuery.merge( this.get(), jQuery( selector, context ) )\n\t\t\t)\n\t\t);\n\t},\n\n\taddBack: function( selector ) {\n\t\treturn this.add( selector == null ?\n\t\t\tthis.prevObject : this.prevObject.filter(selector)\n\t\t);\n\t}\n});\n\nfunction sibling( cur, dir ) {\n\tdo {\n\t\tcur = cur[ dir ];\n\t} while ( cur && cur.nodeType !== 1 );\n\n\treturn cur;\n}\n\njQuery.each({\n\tparent: function( elem ) {\n\t\tvar parent = elem.parentNode;\n\t\treturn parent && parent.nodeType !== 11 ? parent : null;\n\t},\n\tparents: function( elem ) {\n\t\treturn jQuery.dir( elem, \"parentNode\" );\n\t},\n\tparentsUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"parentNode\", until );\n\t},\n\tnext: function( elem ) {\n\t\treturn sibling( elem, \"nextSibling\" );\n\t},\n\tprev: function( elem ) {\n\t\treturn sibling( elem, \"previousSibling\" );\n\t},\n\tnextAll: function( elem ) {\n\t\treturn jQuery.dir( elem, \"nextSibling\" );\n\t},\n\tprevAll: function( elem ) {\n\t\treturn jQuery.dir( elem, \"previousSibling\" );\n\t},\n\tnextUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"nextSibling\", until );\n\t},\n\tprevUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"previousSibling\", until );\n\t},\n\tsiblings: function( elem ) {\n\t\treturn jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );\n\t},\n\tchildren: function( elem ) {\n\t\treturn jQuery.sibling( elem.firstChild );\n\t},\n\tcontents: function( elem ) {\n\t\treturn jQuery.nodeName( elem, \"iframe\" ) ?\n\t\t\telem.contentDocument || elem.contentWindow.document :\n\t\t\tjQuery.merge( [], elem.childNodes );\n\t}\n}, function( name, fn ) {\n\tjQuery.fn[ name ] = function( until, selector ) {\n\t\tvar ret = jQuery.map( this, fn, until );\n\n\t\tif ( name.slice( -5 ) !== \"Until\" ) {\n\t\t\tselector = until;\n\t\t}\n\n\t\tif ( selector && typeof selector === \"string\" ) {\n\t\t\tret = jQuery.filter( selector, ret );\n\t\t}\n\n\t\tif ( this.length > 1 ) {\n\t\t\t// Remove duplicates\n\t\t\tif ( !guaranteedUnique[ name ] ) {\n\t\t\t\tret = jQuery.unique( ret );\n\t\t\t}\n\n\t\t\t// Reverse order for parents* and prev-derivatives\n\t\t\tif ( rparentsprev.test( name ) ) {\n\t\t\t\tret = ret.reverse();\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( ret );\n\t};\n});\nvar rnotwhite = (/\\S+/g);\n\n\n\n// String to Object options format cache\nvar optionsCache = {};\n\n// Convert String-formatted options into Object-formatted ones and store in cache\nfunction createOptions( options ) {\n\tvar object = optionsCache[ options ] = {};\n\tjQuery.each( options.match( rnotwhite ) || [], function( _, flag ) {\n\t\tobject[ flag ] = true;\n\t});\n\treturn object;\n}\n\n/*\n * Create a callback list using the following parameters:\n *\n *\toptions: an optional list of space-separated options that will change how\n *\t\t\tthe callback list behaves or a more traditional option object\n *\n * By default a callback list will act like an event callback list and can be\n * \"fired\" multiple times.\n *\n * Possible options:\n *\n *\tonce:\t\t\twill ensure the callback list can only be fired once (like a Deferred)\n *\n *\tmemory:\t\t\twill keep track of previous values and will call any callback added\n *\t\t\t\t\tafter the list has been fired right away with the latest \"memorized\"\n *\t\t\t\t\tvalues (like a Deferred)\n *\n *\tunique:\t\t\twill ensure a callback can only be added once (no duplicate in the list)\n *\n *\tstopOnFalse:\tinterrupt callings when a callback returns false\n *\n */\njQuery.Callbacks = function( options ) {\n\n\t// Convert options from String-formatted to Object-formatted if needed\n\t// (we check in cache first)\n\toptions = typeof options === \"string\" ?\n\t\t( optionsCache[ options ] || createOptions( options ) ) :\n\t\tjQuery.extend( {}, options );\n\n\tvar // Flag to know if list is currently firing\n\t\tfiring,\n\t\t// Last fire value (for non-forgettable lists)\n\t\tmemory,\n\t\t// Flag to know if list was already fired\n\t\tfired,\n\t\t// End of the loop when firing\n\t\tfiringLength,\n\t\t// Index of currently firing callback (modified by remove if needed)\n\t\tfiringIndex,\n\t\t// First callback to fire (used internally by add and fireWith)\n\t\tfiringStart,\n\t\t// Actual callback list\n\t\tlist = [],\n\t\t// Stack of fire calls for repeatable lists\n\t\tstack = !options.once && [],\n\t\t// Fire callbacks\n\t\tfire = function( data ) {\n\t\t\tmemory = options.memory && data;\n\t\t\tfired = true;\n\t\t\tfiringIndex = firingStart || 0;\n\t\t\tfiringStart = 0;\n\t\t\tfiringLength = list.length;\n\t\t\tfiring = true;\n\t\t\tfor ( ; list && firingIndex < firingLength; firingIndex++ ) {\n\t\t\t\tif ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {\n\t\t\t\t\tmemory = false; // To prevent further calls using add\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t\tfiring = false;\n\t\t\tif ( list ) {\n\t\t\t\tif ( stack ) {\n\t\t\t\t\tif ( stack.length ) {\n\t\t\t\t\t\tfire( stack.shift() );\n\t\t\t\t\t}\n\t\t\t\t} else if ( memory ) {\n\t\t\t\t\tlist = [];\n\t\t\t\t} else {\n\t\t\t\t\tself.disable();\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\t// Actual Callbacks object\n\t\tself = {\n\t\t\t// Add a callback or a collection of callbacks to the list\n\t\t\tadd: function() {\n\t\t\t\tif ( list ) {\n\t\t\t\t\t// First, we save the current length\n\t\t\t\t\tvar start = list.length;\n\t\t\t\t\t(function add( args ) {\n\t\t\t\t\t\tjQuery.each( args, function( _, arg ) {\n\t\t\t\t\t\t\tvar type = jQuery.type( arg );\n\t\t\t\t\t\t\tif ( type === \"function\" ) {\n\t\t\t\t\t\t\t\tif ( !options.unique || !self.has( arg ) ) {\n\t\t\t\t\t\t\t\t\tlist.push( arg );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} else if ( arg && arg.length && type !== \"string\" ) {\n\t\t\t\t\t\t\t\t// Inspect recursively\n\t\t\t\t\t\t\t\tadd( arg );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t});\n\t\t\t\t\t})( arguments );\n\t\t\t\t\t// Do we need to add the callbacks to the\n\t\t\t\t\t// current firing batch?\n\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\tfiringLength = list.length;\n\t\t\t\t\t// With memory, if we're not firing then\n\t\t\t\t\t// we should call right away\n\t\t\t\t\t} else if ( memory ) {\n\t\t\t\t\t\tfiringStart = start;\n\t\t\t\t\t\tfire( memory );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Remove a callback from the list\n\t\t\tremove: function() {\n\t\t\t\tif ( list ) {\n\t\t\t\t\tjQuery.each( arguments, function( _, arg ) {\n\t\t\t\t\t\tvar index;\n\t\t\t\t\t\twhile ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {\n\t\t\t\t\t\t\tlist.splice( index, 1 );\n\t\t\t\t\t\t\t// Handle firing indexes\n\t\t\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\t\t\tif ( index <= firingLength ) {\n\t\t\t\t\t\t\t\t\tfiringLength--;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\tif ( index <= firingIndex ) {\n\t\t\t\t\t\t\t\t\tfiringIndex--;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t});\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Check if a given callback is in the list.\n\t\t\t// If no argument is given, return whether or not list has callbacks attached.\n\t\t\thas: function( fn ) {\n\t\t\t\treturn fn ? jQuery.inArray( fn, list ) > -1 : !!( list && list.length );\n\t\t\t},\n\t\t\t// Remove all callbacks from the list\n\t\t\tempty: function() {\n\t\t\t\tlist = [];\n\t\t\t\tfiringLength = 0;\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Have the list do nothing anymore\n\t\t\tdisable: function() {\n\t\t\t\tlist = stack = memory = undefined;\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Is it disabled?\n\t\t\tdisabled: function() {\n\t\t\t\treturn !list;\n\t\t\t},\n\t\t\t// Lock the list in its current state\n\t\t\tlock: function() {\n\t\t\t\tstack = undefined;\n\t\t\t\tif ( !memory ) {\n\t\t\t\t\tself.disable();\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Is it locked?\n\t\t\tlocked: function() {\n\t\t\t\treturn !stack;\n\t\t\t},\n\t\t\t// Call all callbacks with the given context and arguments\n\t\t\tfireWith: function( context, args ) {\n\t\t\t\tif ( list && ( !fired || stack ) ) {\n\t\t\t\t\targs = args || [];\n\t\t\t\t\targs = [ context, args.slice ? args.slice() : args ];\n\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\tstack.push( args );\n\t\t\t\t\t} else {\n\t\t\t\t\t\tfire( args );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Call all the callbacks with the given arguments\n\t\t\tfire: function() {\n\t\t\t\tself.fireWith( this, arguments );\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// To know if the callbacks have already been called at least once\n\t\t\tfired: function() {\n\t\t\t\treturn !!fired;\n\t\t\t}\n\t\t};\n\n\treturn self;\n};\n\n\njQuery.extend({\n\n\tDeferred: function( func ) {\n\t\tvar tuples = [\n\t\t\t\t// action, add listener, listener list, final state\n\t\t\t\t[ \"resolve\", \"done\", jQuery.Callbacks(\"once memory\"), \"resolved\" ],\n\t\t\t\t[ \"reject\", \"fail\", jQuery.Callbacks(\"once memory\"), \"rejected\" ],\n\t\t\t\t[ \"notify\", \"progress\", jQuery.Callbacks(\"memory\") ]\n\t\t\t],\n\t\t\tstate = \"pending\",\n\t\t\tpromise = {\n\t\t\t\tstate: function() {\n\t\t\t\t\treturn state;\n\t\t\t\t},\n\t\t\t\talways: function() {\n\t\t\t\t\tdeferred.done( arguments ).fail( arguments );\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\t\t\t\tthen: function( /* fnDone, fnFail, fnProgress */ ) {\n\t\t\t\t\tvar fns = arguments;\n\t\t\t\t\treturn jQuery.Deferred(function( newDefer ) {\n\t\t\t\t\t\tjQuery.each( tuples, function( i, tuple ) {\n\t\t\t\t\t\t\tvar fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];\n\t\t\t\t\t\t\t// deferred[ done | fail | progress ] for forwarding actions to newDefer\n\t\t\t\t\t\t\tdeferred[ tuple[1] ](function() {\n\t\t\t\t\t\t\t\tvar returned = fn && fn.apply( this, arguments );\n\t\t\t\t\t\t\t\tif ( returned && jQuery.isFunction( returned.promise ) ) {\n\t\t\t\t\t\t\t\t\treturned.promise()\n\t\t\t\t\t\t\t\t\t\t.done( newDefer.resolve )\n\t\t\t\t\t\t\t\t\t\t.fail( newDefer.reject )\n\t\t\t\t\t\t\t\t\t\t.progress( newDefer.notify );\n\t\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\t\tnewDefer[ tuple[ 0 ] + \"With\" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t});\n\t\t\t\t\t\t});\n\t\t\t\t\t\tfns = null;\n\t\t\t\t\t}).promise();\n\t\t\t\t},\n\t\t\t\t// Get a promise for this deferred\n\t\t\t\t// If obj is provided, the promise aspect is added to the object\n\t\t\t\tpromise: function( obj ) {\n\t\t\t\t\treturn obj != null ? jQuery.extend( obj, promise ) : promise;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdeferred = {};\n\n\t\t// Keep pipe for back-compat\n\t\tpromise.pipe = promise.then;\n\n\t\t// Add list-specific methods\n\t\tjQuery.each( tuples, function( i, tuple ) {\n\t\t\tvar list = tuple[ 2 ],\n\t\t\t\tstateString = tuple[ 3 ];\n\n\t\t\t// promise[ done | fail | progress ] = list.add\n\t\t\tpromise[ tuple[1] ] = list.add;\n\n\t\t\t// Handle state\n\t\t\tif ( stateString ) {\n\t\t\t\tlist.add(function() {\n\t\t\t\t\t// state = [ resolved | rejected ]\n\t\t\t\t\tstate = stateString;\n\n\t\t\t\t// [ reject_list | resolve_list ].disable; progress_list.lock\n\t\t\t\t}, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );\n\t\t\t}\n\n\t\t\t// deferred[ resolve | reject | notify ]\n\t\t\tdeferred[ tuple[0] ] = function() {\n\t\t\t\tdeferred[ tuple[0] + \"With\" ]( this === deferred ? promise : this, arguments );\n\t\t\t\treturn this;\n\t\t\t};\n\t\t\tdeferred[ tuple[0] + \"With\" ] = list.fireWith;\n\t\t});\n\n\t\t// Make the deferred a promise\n\t\tpromise.promise( deferred );\n\n\t\t// Call given func if any\n\t\tif ( func ) {\n\t\t\tfunc.call( deferred, deferred );\n\t\t}\n\n\t\t// All done!\n\t\treturn deferred;\n\t},\n\n\t// Deferred helper\n\twhen: function( subordinate /* , ..., subordinateN */ ) {\n\t\tvar i = 0,\n\t\t\tresolveValues = slice.call( arguments ),\n\t\t\tlength = resolveValues.length,\n\n\t\t\t// the count of uncompleted subordinates\n\t\t\tremaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,\n\n\t\t\t// the master Deferred. If resolveValues consist of only a single Deferred, just use that.\n\t\t\tdeferred = remaining === 1 ? subordinate : jQuery.Deferred(),\n\n\t\t\t// Update function for both resolve and progress values\n\t\t\tupdateFunc = function( i, contexts, values ) {\n\t\t\t\treturn function( value ) {\n\t\t\t\t\tcontexts[ i ] = this;\n\t\t\t\t\tvalues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;\n\t\t\t\t\tif ( values === progressValues ) {\n\t\t\t\t\t\tdeferred.notifyWith( contexts, values );\n\n\t\t\t\t\t} else if ( !(--remaining) ) {\n\t\t\t\t\t\tdeferred.resolveWith( contexts, values );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t\t},\n\n\t\t\tprogressValues, progressContexts, resolveContexts;\n\n\t\t// add listeners to Deferred subordinates; treat others as resolved\n\t\tif ( length > 1 ) {\n\t\t\tprogressValues = new Array( length );\n\t\t\tprogressContexts = new Array( length );\n\t\t\tresolveContexts = new Array( length );\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tif ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {\n\t\t\t\t\tresolveValues[ i ].promise()\n\t\t\t\t\t\t.done( updateFunc( i, resolveContexts, resolveValues ) )\n\t\t\t\t\t\t.fail( deferred.reject )\n\t\t\t\t\t\t.progress( updateFunc( i, progressContexts, progressValues ) );\n\t\t\t\t} else {\n\t\t\t\t\t--remaining;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// if we're not waiting on anything, resolve the master\n\t\tif ( !remaining ) {\n\t\t\tdeferred.resolveWith( resolveContexts, resolveValues );\n\t\t}\n\n\t\treturn deferred.promise();\n\t}\n});\n\n\n// The deferred used on DOM ready\nvar readyList;\n\njQuery.fn.ready = function( fn ) {\n\t// Add the callback\n\tjQuery.ready.promise().done( fn );\n\n\treturn this;\n};\n\njQuery.extend({\n\t// Is the DOM ready to be used? Set to true once it occurs.\n\tisReady: false,\n\n\t// A counter to track how many items to wait for before\n\t// the ready event fires. See #6781\n\treadyWait: 1,\n\n\t// Hold (or release) the ready event\n\tholdReady: function( hold ) {\n\t\tif ( hold ) {\n\t\t\tjQuery.readyWait++;\n\t\t} else {\n\t\t\tjQuery.ready( true );\n\t\t}\n\t},\n\n\t// Handle when the DOM is ready\n\tready: function( wait ) {\n\n\t\t// Abort if there are pending holds or we're already ready\n\t\tif ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).\n\t\tif ( !document.body ) {\n\t\t\treturn setTimeout( jQuery.ready );\n\t\t}\n\n\t\t// Remember that the DOM is ready\n\t\tjQuery.isReady = true;\n\n\t\t// If a normal DOM Ready event fired, decrement, and wait if need be\n\t\tif ( wait !== true && --jQuery.readyWait > 0 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// If there are functions bound, to execute\n\t\treadyList.resolveWith( document, [ jQuery ] );\n\n\t\t// Trigger any bound ready events\n\t\tif ( jQuery.fn.triggerHandler ) {\n\t\t\tjQuery( document ).triggerHandler( \"ready\" );\n\t\t\tjQuery( document ).off( \"ready\" );\n\t\t}\n\t}\n});\n\n/**\n * Clean-up method for dom ready events\n */\nfunction detach() {\n\tif ( document.addEventListener ) {\n\t\tdocument.removeEventListener( \"DOMContentLoaded\", completed, false );\n\t\twindow.removeEventListener( \"load\", completed, false );\n\n\t} else {\n\t\tdocument.detachEvent( \"onreadystatechange\", completed );\n\t\twindow.detachEvent( \"onload\", completed );\n\t}\n}\n\n/**\n * The ready event handler and self cleanup method\n */\nfunction completed() {\n\t// readyState === \"complete\" is good enough for us to call the dom ready in oldIE\n\tif ( document.addEventListener || event.type === \"load\" || document.readyState === \"complete\" ) {\n\t\tdetach();\n\t\tjQuery.ready();\n\t}\n}\n\njQuery.ready.promise = function( obj ) {\n\tif ( !readyList ) {\n\n\t\treadyList = jQuery.Deferred();\n\n\t\t// Catch cases where $(document).ready() is called after the browser event has already occurred.\n\t\t// we once tried to use readyState \"interactive\" here, but it caused issues like the one\n\t\t// discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15\n\t\tif ( document.readyState === \"complete\" ) {\n\t\t\t// Handle it asynchronously to allow scripts the opportunity to delay ready\n\t\t\tsetTimeout( jQuery.ready );\n\n\t\t// Standards-based browsers support DOMContentLoaded\n\t\t} else if ( document.addEventListener ) {\n\t\t\t// Use the handy event callback\n\t\t\tdocument.addEventListener( \"DOMContentLoaded\", completed, false );\n\n\t\t\t// A fallback to window.onload, that will always work\n\t\t\twindow.addEventListener( \"load\", completed, false );\n\n\t\t// If IE event model is used\n\t\t} else {\n\t\t\t// Ensure firing before onload, maybe late but safe also for iframes\n\t\t\tdocument.attachEvent( \"onreadystatechange\", completed );\n\n\t\t\t// A fallback to window.onload, that will always work\n\t\t\twindow.attachEvent( \"onload\", completed );\n\n\t\t\t// If IE and not a frame\n\t\t\t// continually check to see if the document is ready\n\t\t\tvar top = false;\n\n\t\t\ttry {\n\t\t\t\ttop = window.frameElement == null && document.documentElement;\n\t\t\t} catch(e) {}\n\n\t\t\tif ( top && top.doScroll ) {\n\t\t\t\t(function doScrollCheck() {\n\t\t\t\t\tif ( !jQuery.isReady ) {\n\n\t\t\t\t\t\ttry {\n\t\t\t\t\t\t\t// Use the trick by Diego Perini\n\t\t\t\t\t\t\t// http://javascript.nwbox.com/IEContentLoaded/\n\t\t\t\t\t\t\ttop.doScroll(\"left\");\n\t\t\t\t\t\t} catch(e) {\n\t\t\t\t\t\t\treturn setTimeout( doScrollCheck, 50 );\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// detach all dom ready events\n\t\t\t\t\t\tdetach();\n\n\t\t\t\t\t\t// and execute any waiting functions\n\t\t\t\t\t\tjQuery.ready();\n\t\t\t\t\t}\n\t\t\t\t})();\n\t\t\t}\n\t\t}\n\t}\n\treturn readyList.promise( obj );\n};\n\n\nvar strundefined = typeof undefined;\n\n\n\n// Support: IE<9\n// Iteration over object's inherited properties before its own\nvar i;\nfor ( i in jQuery( support ) ) {\n\tbreak;\n}\nsupport.ownLast = i !== \"0\";\n\n// Note: most support tests are defined in their respective modules.\n// false until the test is run\nsupport.inlineBlockNeedsLayout = false;\n\n// Execute ASAP in case we need to set body.style.zoom\njQuery(function() {\n\t// Minified: var a,b,c,d\n\tvar val, div, body, container;\n\n\tbody = document.getElementsByTagName( \"body\" )[ 0 ];\n\tif ( !body || !body.style ) {\n\t\t// Return for frameset docs that don't have a body\n\t\treturn;\n\t}\n\n\t// Setup\n\tdiv = document.createElement( \"div\" );\n\tcontainer = document.createElement( \"div\" );\n\tcontainer.style.cssText = \"position:absolute;border:0;width:0;height:0;top:0;left:-9999px\";\n\tbody.appendChild( container ).appendChild( div );\n\n\tif ( typeof div.style.zoom !== strundefined ) {\n\t\t// Support: IE<8\n\t\t// Check if natively block-level elements act like inline-block\n\t\t// elements when setting their display to 'inline' and giving\n\t\t// them layout\n\t\tdiv.style.cssText = \"display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1\";\n\n\t\tsupport.inlineBlockNeedsLayout = val = div.offsetWidth === 3;\n\t\tif ( val ) {\n\t\t\t// Prevent IE 6 from affecting layout for positioned elements #11048\n\t\t\t// Prevent IE from shrinking the body in IE 7 mode #12869\n\t\t\t// Support: IE<8\n\t\t\tbody.style.zoom = 1;\n\t\t}\n\t}\n\n\tbody.removeChild( container );\n});\n\n\n\n\n(function() {\n\tvar div = document.createElement( \"div\" );\n\n\t// Execute the test only if not already executed in another module.\n\tif (support.deleteExpando == null) {\n\t\t// Support: IE<9\n\t\tsupport.deleteExpando = true;\n\t\ttry {\n\t\t\tdelete div.test;\n\t\t} catch( e ) {\n\t\t\tsupport.deleteExpando = false;\n\t\t}\n\t}\n\n\t// Null elements to avoid leaks in IE.\n\tdiv = null;\n})();\n\n\n/**\n * Determines whether an object can have data\n */\njQuery.acceptData = function( elem ) {\n\tvar noData = jQuery.noData[ (elem.nodeName + \" \").toLowerCase() ],\n\t\tnodeType = +elem.nodeType || 1;\n\n\t// Do not set data on non-element DOM nodes because it will not be cleared (#8335).\n\treturn nodeType !== 1 && nodeType !== 9 ?\n\t\tfalse :\n\n\t\t// Nodes accept data unless otherwise specified; rejection can be conditional\n\t\t!noData || noData !== true && elem.getAttribute(\"classid\") === noData;\n};\n\n\nvar rbrace = /^(?:\\{[\\w\\W]*\\}|\\[[\\w\\W]*\\])$/,\n\trmultiDash = /([A-Z])/g;\n\nfunction dataAttr( elem, key, data ) {\n\t// If nothing was found internally, try to fetch any\n\t// data from the HTML5 data-* attribute\n\tif ( data === undefined && elem.nodeType === 1 ) {\n\n\t\tvar name = \"data-\" + key.replace( rmultiDash, \"-$1\" ).toLowerCase();\n\n\t\tdata = elem.getAttribute( name );\n\n\t\tif ( typeof data === \"string\" ) {\n\t\t\ttry {\n\t\t\t\tdata = data === \"true\" ? true :\n\t\t\t\t\tdata === \"false\" ? false :\n\t\t\t\t\tdata === \"null\" ? null :\n\t\t\t\t\t// Only convert to a number if it doesn't change the string\n\t\t\t\t\t+data + \"\" === data ? +data :\n\t\t\t\t\trbrace.test( data ) ? jQuery.parseJSON( data ) :\n\t\t\t\t\tdata;\n\t\t\t} catch( e ) {}\n\n\t\t\t// Make sure we set the data so it isn't changed later\n\t\t\tjQuery.data( elem, key, data );\n\n\t\t} else {\n\t\t\tdata = undefined;\n\t\t}\n\t}\n\n\treturn data;\n}\n\n// checks a cache object for emptiness\nfunction isEmptyDataObject( obj ) {\n\tvar name;\n\tfor ( name in obj ) {\n\n\t\t// if the public data object is empty, the private is still empty\n\t\tif ( name === \"data\" && jQuery.isEmptyObject( obj[name] ) ) {\n\t\t\tcontinue;\n\t\t}\n\t\tif ( name !== \"toJSON\" ) {\n\t\t\treturn false;\n\t\t}\n\t}\n\n\treturn true;\n}\n\nfunction internalData( elem, name, data, pvt /* Internal Use Only */ ) {\n\tif ( !jQuery.acceptData( elem ) ) {\n\t\treturn;\n\t}\n\n\tvar ret, thisCache,\n\t\tinternalKey = jQuery.expando,\n\n\t\t// We have to handle DOM nodes and JS objects differently because IE6-7\n\t\t// can't GC object references properly across the DOM-JS boundary\n\t\tisNode = elem.nodeType,\n\n\t\t// Only DOM nodes need the global jQuery cache; JS object data is\n\t\t// attached directly to the object so GC can occur automatically\n\t\tcache = isNode ? jQuery.cache : elem,\n\n\t\t// Only defining an ID for JS objects if its cache already exists allows\n\t\t// the code to shortcut on the same path as a DOM node with no cache\n\t\tid = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;\n\n\t// Avoid doing any more work than we need to when trying to get data on an\n\t// object that has no data at all\n\tif ( (!id || !cache[id] || (!pvt && !cache[id].data)) && data === undefined && typeof name === \"string\" ) {\n\t\treturn;\n\t}\n\n\tif ( !id ) {\n\t\t// Only DOM nodes need a new unique ID for each element since their data\n\t\t// ends up in the global cache\n\t\tif ( isNode ) {\n\t\t\tid = elem[ internalKey ] = deletedIds.pop() || jQuery.guid++;\n\t\t} else {\n\t\t\tid = internalKey;\n\t\t}\n\t}\n\n\tif ( !cache[ id ] ) {\n\t\t// Avoid exposing jQuery metadata on plain JS objects when the object\n\t\t// is serialized using JSON.stringify\n\t\tcache[ id ] = isNode ? {} : { toJSON: jQuery.noop };\n\t}\n\n\t// An object can be passed to jQuery.data instead of a key/value pair; this gets\n\t// shallow copied over onto the existing cache\n\tif ( typeof name === \"object\" || typeof name === \"function\" ) {\n\t\tif ( pvt ) {\n\t\t\tcache[ id ] = jQuery.extend( cache[ id ], name );\n\t\t} else {\n\t\t\tcache[ id ].data = jQuery.extend( cache[ id ].data, name );\n\t\t}\n\t}\n\n\tthisCache = cache[ id ];\n\n\t// jQuery data() is stored in a separate object inside the object's internal data\n\t// cache in order to avoid key collisions between internal data and user-defined\n\t// data.\n\tif ( !pvt ) {\n\t\tif ( !thisCache.data ) {\n\t\t\tthisCache.data = {};\n\t\t}\n\n\t\tthisCache = thisCache.data;\n\t}\n\n\tif ( data !== undefined ) {\n\t\tthisCache[ jQuery.camelCase( name ) ] = data;\n\t}\n\n\t// Check for both converted-to-camel and non-converted data property names\n\t// If a data property was specified\n\tif ( typeof name === \"string\" ) {\n\n\t\t// First Try to find as-is property data\n\t\tret = thisCache[ name ];\n\n\t\t// Test for null|undefined property data\n\t\tif ( ret == null ) {\n\n\t\t\t// Try to find the camelCased property\n\t\t\tret = thisCache[ jQuery.camelCase( name ) ];\n\t\t}\n\t} else {\n\t\tret = thisCache;\n\t}\n\n\treturn ret;\n}\n\nfunction internalRemoveData( elem, name, pvt ) {\n\tif ( !jQuery.acceptData( elem ) ) {\n\t\treturn;\n\t}\n\n\tvar thisCache, i,\n\t\tisNode = elem.nodeType,\n\n\t\t// See jQuery.data for more information\n\t\tcache = isNode ? jQuery.cache : elem,\n\t\tid = isNode ? elem[ jQuery.expando ] : jQuery.expando;\n\n\t// If there is already no cache entry for this object, there is no\n\t// purpose in continuing\n\tif ( !cache[ id ] ) {\n\t\treturn;\n\t}\n\n\tif ( name ) {\n\n\t\tthisCache = pvt ? cache[ id ] : cache[ id ].data;\n\n\t\tif ( thisCache ) {\n\n\t\t\t// Support array or space separated string names for data keys\n\t\t\tif ( !jQuery.isArray( name ) ) {\n\n\t\t\t\t// try the string as a key before any manipulation\n\t\t\t\tif ( name in thisCache ) {\n\t\t\t\t\tname = [ name ];\n\t\t\t\t} else {\n\n\t\t\t\t\t// split the camel cased version by spaces unless a key with the spaces exists\n\t\t\t\t\tname = jQuery.camelCase( name );\n\t\t\t\t\tif ( name in thisCache ) {\n\t\t\t\t\t\tname = [ name ];\n\t\t\t\t\t} else {\n\t\t\t\t\t\tname = name.split(\" \");\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\t// If \"name\" is an array of keys...\n\t\t\t\t// When data is initially created, via (\"key\", \"val\") signature,\n\t\t\t\t// keys will be converted to camelCase.\n\t\t\t\t// Since there is no way to tell _how_ a key was added, remove\n\t\t\t\t// both plain key and camelCase key. #12786\n\t\t\t\t// This will only penalize the array argument path.\n\t\t\t\tname = name.concat( jQuery.map( name, jQuery.camelCase ) );\n\t\t\t}\n\n\t\t\ti = name.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tdelete thisCache[ name[i] ];\n\t\t\t}\n\n\t\t\t// If there is no data left in the cache, we want to continue\n\t\t\t// and let the cache object itself get destroyed\n\t\t\tif ( pvt ? !isEmptyDataObject(thisCache) : !jQuery.isEmptyObject(thisCache) ) {\n\t\t\t\treturn;\n\t\t\t}\n\t\t}\n\t}\n\n\t// See jQuery.data for more information\n\tif ( !pvt ) {\n\t\tdelete cache[ id ].data;\n\n\t\t// Don't destroy the parent cache unless the internal data object\n\t\t// had been the only thing left in it\n\t\tif ( !isEmptyDataObject( cache[ id ] ) ) {\n\t\t\treturn;\n\t\t}\n\t}\n\n\t// Destroy the cache\n\tif ( isNode ) {\n\t\tjQuery.cleanData( [ elem ], true );\n\n\t// Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)\n\t/* jshint eqeqeq: false */\n\t} else if ( support.deleteExpando || cache != cache.window ) {\n\t\t/* jshint eqeqeq: true */\n\t\tdelete cache[ id ];\n\n\t// When all else fails, null\n\t} else {\n\t\tcache[ id ] = null;\n\t}\n}\n\njQuery.extend({\n\tcache: {},\n\n\t// The following elements (space-suffixed to avoid Object.prototype collisions)\n\t// throw uncatchable exceptions if you attempt to set expando properties\n\tnoData: {\n\t\t\"applet \": true,\n\t\t\"embed \": true,\n\t\t// ...but Flash objects (which have this classid) *can* handle expandos\n\t\t\"object \": \"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000\"\n\t},\n\n\thasData: function( elem ) {\n\t\telem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];\n\t\treturn !!elem && !isEmptyDataObject( elem );\n\t},\n\n\tdata: function( elem, name, data ) {\n\t\treturn internalData( elem, name, data );\n\t},\n\n\tremoveData: function( elem, name ) {\n\t\treturn internalRemoveData( elem, name );\n\t},\n\n\t// For internal use only.\n\t_data: function( elem, name, data ) {\n\t\treturn internalData( elem, name, data, true );\n\t},\n\n\t_removeData: function( elem, name ) {\n\t\treturn internalRemoveData( elem, name, true );\n\t}\n});\n\njQuery.fn.extend({\n\tdata: function( key, value ) {\n\t\tvar i, name, data,\n\t\t\telem = this[0],\n\t\t\tattrs = elem && elem.attributes;\n\n\t\t// Special expections of .data basically thwart jQuery.access,\n\t\t// so implement the relevant behavior ourselves\n\n\t\t// Gets all values\n\t\tif ( key === undefined ) {\n\t\t\tif ( this.length ) {\n\t\t\t\tdata = jQuery.data( elem );\n\n\t\t\t\tif ( elem.nodeType === 1 && !jQuery._data( elem, \"parsedAttrs\" ) ) {\n\t\t\t\t\ti = attrs.length;\n\t\t\t\t\twhile ( i-- ) {\n\n\t\t\t\t\t\t// Support: IE11+\n\t\t\t\t\t\t// The attrs elements can be null (#14894)\n\t\t\t\t\t\tif ( attrs[ i ] ) {\n\t\t\t\t\t\t\tname = attrs[ i ].name;\n\t\t\t\t\t\t\tif ( name.indexOf( \"data-\" ) === 0 ) {\n\t\t\t\t\t\t\t\tname = jQuery.camelCase( name.slice(5) );\n\t\t\t\t\t\t\t\tdataAttr( elem, name, data[ name ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tjQuery._data( elem, \"parsedAttrs\", true );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\treturn data;\n\t\t}\n\n\t\t// Sets multiple values\n\t\tif ( typeof key === \"object\" ) {\n\t\t\treturn this.each(function() {\n\t\t\t\tjQuery.data( this, key );\n\t\t\t});\n\t\t}\n\n\t\treturn arguments.length > 1 ?\n\n\t\t\t// Sets one value\n\t\t\tthis.each(function() {\n\t\t\t\tjQuery.data( this, key, value );\n\t\t\t}) :\n\n\t\t\t// Gets one value\n\t\t\t// Try to fetch any internally stored data first\n\t\t\telem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : undefined;\n\t},\n\n\tremoveData: function( key ) {\n\t\treturn this.each(function() {\n\t\t\tjQuery.removeData( this, key );\n\t\t});\n\t}\n});\n\n\njQuery.extend({\n\tqueue: function( elem, type, data ) {\n\t\tvar queue;\n\n\t\tif ( elem ) {\n\t\t\ttype = ( type || \"fx\" ) + \"queue\";\n\t\t\tqueue = jQuery._data( elem, type );\n\n\t\t\t// Speed up dequeue by getting out quickly if this is just a lookup\n\t\t\tif ( data ) {\n\t\t\t\tif ( !queue || jQuery.isArray(data) ) {\n\t\t\t\t\tqueue = jQuery._data( elem, type, jQuery.makeArray(data) );\n\t\t\t\t} else {\n\t\t\t\t\tqueue.push( data );\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn queue || [];\n\t\t}\n\t},\n\n\tdequeue: function( elem, type ) {\n\t\ttype = type || \"fx\";\n\n\t\tvar queue = jQuery.queue( elem, type ),\n\t\t\tstartLength = queue.length,\n\t\t\tfn = queue.shift(),\n\t\t\thooks = jQuery._queueHooks( elem, type ),\n\t\t\tnext = function() {\n\t\t\t\tjQuery.dequeue( elem, type );\n\t\t\t};\n\n\t\t// If the fx queue is dequeued, always remove the progress sentinel\n\t\tif ( fn === \"inprogress\" ) {\n\t\t\tfn = queue.shift();\n\t\t\tstartLength--;\n\t\t}\n\n\t\tif ( fn ) {\n\n\t\t\t// Add a progress sentinel to prevent the fx queue from being\n\t\t\t// automatically dequeued\n\t\t\tif ( type === \"fx\" ) {\n\t\t\t\tqueue.unshift( \"inprogress\" );\n\t\t\t}\n\n\t\t\t// clear up the last queue stop function\n\t\t\tdelete hooks.stop;\n\t\t\tfn.call( elem, next, hooks );\n\t\t}\n\n\t\tif ( !startLength && hooks ) {\n\t\t\thooks.empty.fire();\n\t\t}\n\t},\n\n\t// not intended for public consumption - generates a queueHooks object, or returns the current one\n\t_queueHooks: function( elem, type ) {\n\t\tvar key = type + \"queueHooks\";\n\t\treturn jQuery._data( elem, key ) || jQuery._data( elem, key, {\n\t\t\tempty: jQuery.Callbacks(\"once memory\").add(function() {\n\t\t\t\tjQuery._removeData( elem, type + \"queue\" );\n\t\t\t\tjQuery._removeData( elem, key );\n\t\t\t})\n\t\t});\n\t}\n});\n\njQuery.fn.extend({\n\tqueue: function( type, data ) {\n\t\tvar setter = 2;\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tdata = type;\n\t\t\ttype = \"fx\";\n\t\t\tsetter--;\n\t\t}\n\n\t\tif ( arguments.length < setter ) {\n\t\t\treturn jQuery.queue( this[0], type );\n\t\t}\n\n\t\treturn data === undefined ?\n\t\t\tthis :\n\t\t\tthis.each(function() {\n\t\t\t\tvar queue = jQuery.queue( this, type, data );\n\n\t\t\t\t// ensure a hooks for this queue\n\t\t\t\tjQuery._queueHooks( this, type );\n\n\t\t\t\tif ( type === \"fx\" && queue[0] !== \"inprogress\" ) {\n\t\t\t\t\tjQuery.dequeue( this, type );\n\t\t\t\t}\n\t\t\t});\n\t},\n\tdequeue: function( type ) {\n\t\treturn this.each(function() {\n\t\t\tjQuery.dequeue( this, type );\n\t\t});\n\t},\n\tclearQueue: function( type ) {\n\t\treturn this.queue( type || \"fx\", [] );\n\t},\n\t// Get a promise resolved when queues of a certain type\n\t// are emptied (fx is the type by default)\n\tpromise: function( type, obj ) {\n\t\tvar tmp,\n\t\t\tcount = 1,\n\t\t\tdefer = jQuery.Deferred(),\n\t\t\telements = this,\n\t\t\ti = this.length,\n\t\t\tresolve = function() {\n\t\t\t\tif ( !( --count ) ) {\n\t\t\t\t\tdefer.resolveWith( elements, [ elements ] );\n\t\t\t\t}\n\t\t\t};\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tobj = type;\n\t\t\ttype = undefined;\n\t\t}\n\t\ttype = type || \"fx\";\n\n\t\twhile ( i-- ) {\n\t\t\ttmp = jQuery._data( elements[ i ], type + \"queueHooks\" );\n\t\t\tif ( tmp && tmp.empty ) {\n\t\t\t\tcount++;\n\t\t\t\ttmp.empty.add( resolve );\n\t\t\t}\n\t\t}\n\t\tresolve();\n\t\treturn defer.promise( obj );\n\t}\n});\nvar pnum = (/[+-]?(?:\\d*\\.|)\\d+(?:[eE][+-]?\\d+|)/).source;\n\nvar cssExpand = [ \"Top\", \"Right\", \"Bottom\", \"Left\" ];\n\nvar isHidden = function( elem, el ) {\n\t\t// isHidden might be called from jQuery#filter function;\n\t\t// in that case, element will be second argument\n\t\telem = el || elem;\n\t\treturn jQuery.css( elem, \"display\" ) === \"none\" || !jQuery.contains( elem.ownerDocument, elem );\n\t};\n\n\n\n// Multifunctional method to get and set values of a collection\n// The value/s can optionally be executed if it's a function\nvar access = jQuery.access = function( elems, fn, key, value, chainable, emptyGet, raw ) {\n\tvar i = 0,\n\t\tlength = elems.length,\n\t\tbulk = key == null;\n\n\t// Sets many values\n\tif ( jQuery.type( key ) === \"object\" ) {\n\t\tchainable = true;\n\t\tfor ( i in key ) {\n\t\t\tjQuery.access( elems, fn, i, key[i], true, emptyGet, raw );\n\t\t}\n\n\t// Sets one value\n\t} else if ( value !== undefined ) {\n\t\tchainable = true;\n\n\t\tif ( !jQuery.isFunction( value ) ) {\n\t\t\traw = true;\n\t\t}\n\n\t\tif ( bulk ) {\n\t\t\t// Bulk operations run against the entire set\n\t\t\tif ( raw ) {\n\t\t\t\tfn.call( elems, value );\n\t\t\t\tfn = null;\n\n\t\t\t// ...except when executing function values\n\t\t\t} else {\n\t\t\t\tbulk = fn;\n\t\t\t\tfn = function( elem, key, value ) {\n\t\t\t\t\treturn bulk.call( jQuery( elem ), value );\n\t\t\t\t};\n\t\t\t}\n\t\t}\n\n\t\tif ( fn ) {\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tfn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) );\n\t\t\t}\n\t\t}\n\t}\n\n\treturn chainable ?\n\t\telems :\n\n\t\t// Gets\n\t\tbulk ?\n\t\t\tfn.call( elems ) :\n\t\t\tlength ? fn( elems[0], key ) : emptyGet;\n};\nvar rcheckableType = (/^(?:checkbox|radio)$/i);\n\n\n\n(function() {\n\t// Minified: var a,b,c\n\tvar input = document.createElement( \"input\" ),\n\t\tdiv = document.createElement( \"div\" ),\n\t\tfragment = document.createDocumentFragment();\n\n\t// Setup\n\tdiv.innerHTML = \"
a\";\n\n\t// IE strips leading whitespace when .innerHTML is used\n\tsupport.leadingWhitespace = div.firstChild.nodeType === 3;\n\n\t// Make sure that tbody elements aren't automatically inserted\n\t// IE will insert them into empty tables\n\tsupport.tbody = !div.getElementsByTagName( \"tbody\" ).length;\n\n\t// Make sure that link elements get serialized correctly by innerHTML\n\t// This requires a wrapper element in IE\n\tsupport.htmlSerialize = !!div.getElementsByTagName( \"link\" ).length;\n\n\t// Makes sure cloning an html5 element does not cause problems\n\t// Where outerHTML is undefined, this still works\n\tsupport.html5Clone =\n\t\tdocument.createElement( \"nav\" ).cloneNode( true ).outerHTML !== \"<:nav>\";\n\n\t// Check if a disconnected checkbox will retain its checked\n\t// value of true after appended to the DOM (IE6/7)\n\tinput.type = \"checkbox\";\n\tinput.checked = true;\n\tfragment.appendChild( input );\n\tsupport.appendChecked = input.checked;\n\n\t// Make sure textarea (and checkbox) defaultValue is properly cloned\n\t// Support: IE6-IE11+\n\tdiv.innerHTML = \"\";\n\tsupport.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;\n\n\t// #11217 - WebKit loses check when the name is after the checked attribute\n\tfragment.appendChild( div );\n\tdiv.innerHTML = \"\";\n\n\t// Support: Safari 5.1, iOS 5.1, Android 4.x, Android 2.3\n\t// old WebKit doesn't clone checked state correctly in fragments\n\tsupport.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;\n\n\t// Support: IE<9\n\t// Opera does not clone events (and typeof div.attachEvent === undefined).\n\t// IE9-10 clones events bound via attachEvent, but they don't trigger with .click()\n\tsupport.noCloneEvent = true;\n\tif ( div.attachEvent ) {\n\t\tdiv.attachEvent( \"onclick\", function() {\n\t\t\tsupport.noCloneEvent = false;\n\t\t});\n\n\t\tdiv.cloneNode( true ).click();\n\t}\n\n\t// Execute the test only if not already executed in another module.\n\tif (support.deleteExpando == null) {\n\t\t// Support: IE<9\n\t\tsupport.deleteExpando = true;\n\t\ttry {\n\t\t\tdelete div.test;\n\t\t} catch( e ) {\n\t\t\tsupport.deleteExpando = false;\n\t\t}\n\t}\n})();\n\n\n(function() {\n\tvar i, eventName,\n\t\tdiv = document.createElement( \"div\" );\n\n\t// Support: IE<9 (lack submit/change bubble), Firefox 23+ (lack focusin event)\n\tfor ( i in { submit: true, change: true, focusin: true }) {\n\t\teventName = \"on\" + i;\n\n\t\tif ( !(support[ i + \"Bubbles\" ] = eventName in window) ) {\n\t\t\t// Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP)\n\t\t\tdiv.setAttribute( eventName, \"t\" );\n\t\t\tsupport[ i + \"Bubbles\" ] = div.attributes[ eventName ].expando === false;\n\t\t}\n\t}\n\n\t// Null elements to avoid leaks in IE.\n\tdiv = null;\n})();\n\n\nvar rformElems = /^(?:input|select|textarea)$/i,\n\trkeyEvent = /^key/,\n\trmouseEvent = /^(?:mouse|pointer|contextmenu)|click/,\n\trfocusMorph = /^(?:focusinfocus|focusoutblur)$/,\n\trtypenamespace = /^([^.]*)(?:\\.(.+)|)$/;\n\nfunction returnTrue() {\n\treturn true;\n}\n\nfunction returnFalse() {\n\treturn false;\n}\n\nfunction safeActiveElement() {\n\ttry {\n\t\treturn document.activeElement;\n\t} catch ( err ) { }\n}\n\n/*\n * Helper functions for managing events -- not part of the public interface.\n * Props to Dean Edwards' addEvent library for many of the ideas.\n */\njQuery.event = {\n\n\tglobal: {},\n\n\tadd: function( elem, types, handler, data, selector ) {\n\t\tvar tmp, events, t, handleObjIn,\n\t\t\tspecial, eventHandle, handleObj,\n\t\t\thandlers, type, namespaces, origType,\n\t\t\telemData = jQuery._data( elem );\n\n\t\t// Don't attach events to noData or text/comment nodes (but allow plain objects)\n\t\tif ( !elemData ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Caller can pass in an object of custom data in lieu of the handler\n\t\tif ( handler.handler ) {\n\t\t\thandleObjIn = handler;\n\t\t\thandler = handleObjIn.handler;\n\t\t\tselector = handleObjIn.selector;\n\t\t}\n\n\t\t// Make sure that the handler has a unique ID, used to find/remove it later\n\t\tif ( !handler.guid ) {\n\t\t\thandler.guid = jQuery.guid++;\n\t\t}\n\n\t\t// Init the element's event structure and main handler, if this is the first\n\t\tif ( !(events = elemData.events) ) {\n\t\t\tevents = elemData.events = {};\n\t\t}\n\t\tif ( !(eventHandle = elemData.handle) ) {\n\t\t\teventHandle = elemData.handle = function( e ) {\n\t\t\t\t// Discard the second event of a jQuery.event.trigger() and\n\t\t\t\t// when an event is called after a page has unloaded\n\t\t\t\treturn typeof jQuery !== strundefined && (!e || jQuery.event.triggered !== e.type) ?\n\t\t\t\t\tjQuery.event.dispatch.apply( eventHandle.elem, arguments ) :\n\t\t\t\t\tundefined;\n\t\t\t};\n\t\t\t// Add elem as a property of the handle fn to prevent a memory leak with IE non-native events\n\t\t\teventHandle.elem = elem;\n\t\t}\n\n\t\t// Handle multiple events separated by a space\n\t\ttypes = ( types || \"\" ).match( rnotwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[t] ) || [];\n\t\t\ttype = origType = tmp[1];\n\t\t\tnamespaces = ( tmp[2] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// There *must* be a type, no attaching namespace-only handlers\n\t\t\tif ( !type ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\t// If event changes its type, use the special event handlers for the changed type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// If selector defined, determine special event api type, otherwise given type\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\n\t\t\t// Update special based on newly reset type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// handleObj is passed to all event handlers\n\t\t\thandleObj = jQuery.extend({\n\t\t\t\ttype: type,\n\t\t\t\torigType: origType,\n\t\t\t\tdata: data,\n\t\t\t\thandler: handler,\n\t\t\t\tguid: handler.guid,\n\t\t\t\tselector: selector,\n\t\t\t\tneedsContext: selector && jQuery.expr.match.needsContext.test( selector ),\n\t\t\t\tnamespace: namespaces.join(\".\")\n\t\t\t}, handleObjIn );\n\n\t\t\t// Init the event handler queue if we're the first\n\t\t\tif ( !(handlers = events[ type ]) ) {\n\t\t\t\thandlers = events[ type ] = [];\n\t\t\t\thandlers.delegateCount = 0;\n\n\t\t\t\t// Only use addEventListener/attachEvent if the special events handler returns false\n\t\t\t\tif ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {\n\t\t\t\t\t// Bind the global event handler to the element\n\t\t\t\t\tif ( elem.addEventListener ) {\n\t\t\t\t\t\telem.addEventListener( type, eventHandle, false );\n\n\t\t\t\t\t} else if ( elem.attachEvent ) {\n\t\t\t\t\t\telem.attachEvent( \"on\" + type, eventHandle );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif ( special.add ) {\n\t\t\t\tspecial.add.call( elem, handleObj );\n\n\t\t\t\tif ( !handleObj.handler.guid ) {\n\t\t\t\t\thandleObj.handler.guid = handler.guid;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Add to the element's handler list, delegates in front\n\t\t\tif ( selector ) {\n\t\t\t\thandlers.splice( handlers.delegateCount++, 0, handleObj );\n\t\t\t} else {\n\t\t\t\thandlers.push( handleObj );\n\t\t\t}\n\n\t\t\t// Keep track of which events have ever been used, for event optimization\n\t\t\tjQuery.event.global[ type ] = true;\n\t\t}\n\n\t\t// Nullify elem to prevent memory leaks in IE\n\t\telem = null;\n\t},\n\n\t// Detach an event or set of events from an element\n\tremove: function( elem, types, handler, selector, mappedTypes ) {\n\t\tvar j, handleObj, tmp,\n\t\t\torigCount, t, events,\n\t\t\tspecial, handlers, type,\n\t\t\tnamespaces, origType,\n\t\t\telemData = jQuery.hasData( elem ) && jQuery._data( elem );\n\n\t\tif ( !elemData || !(events = elemData.events) ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Once for each type.namespace in types; type may be omitted\n\t\ttypes = ( types || \"\" ).match( rnotwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[t] ) || [];\n\t\t\ttype = origType = tmp[1];\n\t\t\tnamespaces = ( tmp[2] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// Unbind all events (on this namespace, if provided) for the element\n\t\t\tif ( !type ) {\n\t\t\t\tfor ( type in events ) {\n\t\t\t\t\tjQuery.event.remove( elem, type + types[ t ], handler, selector, true );\n\t\t\t\t}\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\t\t\thandlers = events[ type ] || [];\n\t\t\ttmp = tmp[2] && new RegExp( \"(^|\\\\.)\" + namespaces.join(\"\\\\.(?:.*\\\\.|)\") + \"(\\\\.|$)\" );\n\n\t\t\t// Remove matching events\n\t\t\torigCount = j = handlers.length;\n\t\t\twhile ( j-- ) {\n\t\t\t\thandleObj = handlers[ j ];\n\n\t\t\t\tif ( ( mappedTypes || origType === handleObj.origType ) &&\n\t\t\t\t\t( !handler || handler.guid === handleObj.guid ) &&\n\t\t\t\t\t( !tmp || tmp.test( handleObj.namespace ) ) &&\n\t\t\t\t\t( !selector || selector === handleObj.selector || selector === \"**\" && handleObj.selector ) ) {\n\t\t\t\t\thandlers.splice( j, 1 );\n\n\t\t\t\t\tif ( handleObj.selector ) {\n\t\t\t\t\t\thandlers.delegateCount--;\n\t\t\t\t\t}\n\t\t\t\t\tif ( special.remove ) {\n\t\t\t\t\t\tspecial.remove.call( elem, handleObj );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Remove generic event handler if we removed something and no more handlers exist\n\t\t\t// (avoids potential for endless recursion during removal of special event handlers)\n\t\t\tif ( origCount && !handlers.length ) {\n\t\t\t\tif ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {\n\t\t\t\t\tjQuery.removeEvent( elem, type, elemData.handle );\n\t\t\t\t}\n\n\t\t\t\tdelete events[ type ];\n\t\t\t}\n\t\t}\n\n\t\t// Remove the expando if it's no longer used\n\t\tif ( jQuery.isEmptyObject( events ) ) {\n\t\t\tdelete elemData.handle;\n\n\t\t\t// removeData also checks for emptiness and clears the expando if empty\n\t\t\t// so use it instead of delete\n\t\t\tjQuery._removeData( elem, \"events\" );\n\t\t}\n\t},\n\n\ttrigger: function( event, data, elem, onlyHandlers ) {\n\t\tvar handle, ontype, cur,\n\t\t\tbubbleType, special, tmp, i,\n\t\t\teventPath = [ elem || document ],\n\t\t\ttype = hasOwn.call( event, \"type\" ) ? event.type : event,\n\t\t\tnamespaces = hasOwn.call( event, \"namespace\" ) ? event.namespace.split(\".\") : [];\n\n\t\tcur = tmp = elem = elem || document;\n\n\t\t// Don't do events on text and comment nodes\n\t\tif ( elem.nodeType === 3 || elem.nodeType === 8 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// focus/blur morphs to focusin/out; ensure we're not firing them right now\n\t\tif ( rfocusMorph.test( type + jQuery.event.triggered ) ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( type.indexOf(\".\") >= 0 ) {\n\t\t\t// Namespaced trigger; create a regexp to match event type in handle()\n\t\t\tnamespaces = type.split(\".\");\n\t\t\ttype = namespaces.shift();\n\t\t\tnamespaces.sort();\n\t\t}\n\t\tontype = type.indexOf(\":\") < 0 && \"on\" + type;\n\n\t\t// Caller can pass in a jQuery.Event object, Object, or just an event type string\n\t\tevent = event[ jQuery.expando ] ?\n\t\t\tevent :\n\t\t\tnew jQuery.Event( type, typeof event === \"object\" && event );\n\n\t\t// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)\n\t\tevent.isTrigger = onlyHandlers ? 2 : 3;\n\t\tevent.namespace = namespaces.join(\".\");\n\t\tevent.namespace_re = event.namespace ?\n\t\t\tnew RegExp( \"(^|\\\\.)\" + namespaces.join(\"\\\\.(?:.*\\\\.|)\") + \"(\\\\.|$)\" ) :\n\t\t\tnull;\n\n\t\t// Clean up the event in case it is being reused\n\t\tevent.result = undefined;\n\t\tif ( !event.target ) {\n\t\t\tevent.target = elem;\n\t\t}\n\n\t\t// Clone any incoming data and prepend the event, creating the handler arg list\n\t\tdata = data == null ?\n\t\t\t[ event ] :\n\t\t\tjQuery.makeArray( data, [ event ] );\n\n\t\t// Allow special events to draw outside the lines\n\t\tspecial = jQuery.event.special[ type ] || {};\n\t\tif ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine event propagation path in advance, per W3C events spec (#9951)\n\t\t// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)\n\t\tif ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {\n\n\t\t\tbubbleType = special.delegateType || type;\n\t\t\tif ( !rfocusMorph.test( bubbleType + type ) ) {\n\t\t\t\tcur = cur.parentNode;\n\t\t\t}\n\t\t\tfor ( ; cur; cur = cur.parentNode ) {\n\t\t\t\teventPath.push( cur );\n\t\t\t\ttmp = cur;\n\t\t\t}\n\n\t\t\t// Only add window if we got to document (e.g., not plain obj or detached DOM)\n\t\t\tif ( tmp === (elem.ownerDocument || document) ) {\n\t\t\t\teventPath.push( tmp.defaultView || tmp.parentWindow || window );\n\t\t\t}\n\t\t}\n\n\t\t// Fire handlers on the event path\n\t\ti = 0;\n\t\twhile ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) {\n\n\t\t\tevent.type = i > 1 ?\n\t\t\t\tbubbleType :\n\t\t\t\tspecial.bindType || type;\n\n\t\t\t// jQuery handler\n\t\t\thandle = ( jQuery._data( cur, \"events\" ) || {} )[ event.type ] && jQuery._data( cur, \"handle\" );\n\t\t\tif ( handle ) {\n\t\t\t\thandle.apply( cur, data );\n\t\t\t}\n\n\t\t\t// Native handler\n\t\t\thandle = ontype && cur[ ontype ];\n\t\t\tif ( handle && handle.apply && jQuery.acceptData( cur ) ) {\n\t\t\t\tevent.result = handle.apply( cur, data );\n\t\t\t\tif ( event.result === false ) {\n\t\t\t\t\tevent.preventDefault();\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tevent.type = type;\n\n\t\t// If nobody prevented the default action, do it now\n\t\tif ( !onlyHandlers && !event.isDefaultPrevented() ) {\n\n\t\t\tif ( (!special._default || special._default.apply( eventPath.pop(), data ) === false) &&\n\t\t\t\tjQuery.acceptData( elem ) ) {\n\n\t\t\t\t// Call a native DOM method on the target with the same name name as the event.\n\t\t\t\t// Can't use an .isFunction() check here because IE6/7 fails that test.\n\t\t\t\t// Don't do default actions on window, that's where global variables be (#6170)\n\t\t\t\tif ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) {\n\n\t\t\t\t\t// Don't re-trigger an onFOO event when we call its FOO() method\n\t\t\t\t\ttmp = elem[ ontype ];\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = null;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Prevent re-triggering of the same event, since we already bubbled it above\n\t\t\t\t\tjQuery.event.triggered = type;\n\t\t\t\t\ttry {\n\t\t\t\t\t\telem[ type ]();\n\t\t\t\t\t} catch ( e ) {\n\t\t\t\t\t\t// IE<9 dies on focus/blur to hidden element (#1486,#12518)\n\t\t\t\t\t\t// only reproducible on winXP IE8 native, not IE9 in IE8 mode\n\t\t\t\t\t}\n\t\t\t\t\tjQuery.event.triggered = undefined;\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = tmp;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\tdispatch: function( event ) {\n\n\t\t// Make a writable jQuery.Event from the native event object\n\t\tevent = jQuery.event.fix( event );\n\n\t\tvar i, ret, handleObj, matched, j,\n\t\t\thandlerQueue = [],\n\t\t\targs = slice.call( arguments ),\n\t\t\thandlers = ( jQuery._data( this, \"events\" ) || {} )[ event.type ] || [],\n\t\t\tspecial = jQuery.event.special[ event.type ] || {};\n\n\t\t// Use the fix-ed jQuery.Event rather than the (read-only) native event\n\t\targs[0] = event;\n\t\tevent.delegateTarget = this;\n\n\t\t// Call the preDispatch hook for the mapped type, and let it bail if desired\n\t\tif ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine handlers\n\t\thandlerQueue = jQuery.event.handlers.call( this, event, handlers );\n\n\t\t// Run delegates first; they may want to stop propagation beneath us\n\t\ti = 0;\n\t\twhile ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) {\n\t\t\tevent.currentTarget = matched.elem;\n\n\t\t\tj = 0;\n\t\t\twhile ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) {\n\n\t\t\t\t// Triggered event must either 1) have no namespace, or\n\t\t\t\t// 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).\n\t\t\t\tif ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) {\n\n\t\t\t\t\tevent.handleObj = handleObj;\n\t\t\t\t\tevent.data = handleObj.data;\n\n\t\t\t\t\tret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )\n\t\t\t\t\t\t\t.apply( matched.elem, args );\n\n\t\t\t\t\tif ( ret !== undefined ) {\n\t\t\t\t\t\tif ( (event.result = ret) === false ) {\n\t\t\t\t\t\t\tevent.preventDefault();\n\t\t\t\t\t\t\tevent.stopPropagation();\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Call the postDispatch hook for the mapped type\n\t\tif ( special.postDispatch ) {\n\t\t\tspecial.postDispatch.call( this, event );\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\thandlers: function( event, handlers ) {\n\t\tvar sel, handleObj, matches, i,\n\t\t\thandlerQueue = [],\n\t\t\tdelegateCount = handlers.delegateCount,\n\t\t\tcur = event.target;\n\n\t\t// Find delegate handlers\n\t\t// Black-hole SVG instance trees (#13180)\n\t\t// Avoid non-left-click bubbling in Firefox (#3861)\n\t\tif ( delegateCount && cur.nodeType && (!event.button || event.type !== \"click\") ) {\n\n\t\t\t/* jshint eqeqeq: false */\n\t\t\tfor ( ; cur != this; cur = cur.parentNode || this ) {\n\t\t\t\t/* jshint eqeqeq: true */\n\n\t\t\t\t// Don't check non-elements (#13208)\n\t\t\t\t// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)\n\t\t\t\tif ( cur.nodeType === 1 && (cur.disabled !== true || event.type !== \"click\") ) {\n\t\t\t\t\tmatches = [];\n\t\t\t\t\tfor ( i = 0; i < delegateCount; i++ ) {\n\t\t\t\t\t\thandleObj = handlers[ i ];\n\n\t\t\t\t\t\t// Don't conflict with Object.prototype properties (#13203)\n\t\t\t\t\t\tsel = handleObj.selector + \" \";\n\n\t\t\t\t\t\tif ( matches[ sel ] === undefined ) {\n\t\t\t\t\t\t\tmatches[ sel ] = handleObj.needsContext ?\n\t\t\t\t\t\t\t\tjQuery( sel, this ).index( cur ) >= 0 :\n\t\t\t\t\t\t\t\tjQuery.find( sel, this, null, [ cur ] ).length;\n\t\t\t\t\t\t}\n\t\t\t\t\t\tif ( matches[ sel ] ) {\n\t\t\t\t\t\t\tmatches.push( handleObj );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tif ( matches.length ) {\n\t\t\t\t\t\thandlerQueue.push({ elem: cur, handlers: matches });\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Add the remaining (directly-bound) handlers\n\t\tif ( delegateCount < handlers.length ) {\n\t\t\thandlerQueue.push({ elem: this, handlers: handlers.slice( delegateCount ) });\n\t\t}\n\n\t\treturn handlerQueue;\n\t},\n\n\tfix: function( event ) {\n\t\tif ( event[ jQuery.expando ] ) {\n\t\t\treturn event;\n\t\t}\n\n\t\t// Create a writable copy of the event object and normalize some properties\n\t\tvar i, prop, copy,\n\t\t\ttype = event.type,\n\t\t\toriginalEvent = event,\n\t\t\tfixHook = this.fixHooks[ type ];\n\n\t\tif ( !fixHook ) {\n\t\t\tthis.fixHooks[ type ] = fixHook =\n\t\t\t\trmouseEvent.test( type ) ? this.mouseHooks :\n\t\t\t\trkeyEvent.test( type ) ? this.keyHooks :\n\t\t\t\t{};\n\t\t}\n\t\tcopy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;\n\n\t\tevent = new jQuery.Event( originalEvent );\n\n\t\ti = copy.length;\n\t\twhile ( i-- ) {\n\t\t\tprop = copy[ i ];\n\t\t\tevent[ prop ] = originalEvent[ prop ];\n\t\t}\n\n\t\t// Support: IE<9\n\t\t// Fix target property (#1925)\n\t\tif ( !event.target ) {\n\t\t\tevent.target = originalEvent.srcElement || document;\n\t\t}\n\n\t\t// Support: Chrome 23+, Safari?\n\t\t// Target should not be a text node (#504, #13143)\n\t\tif ( event.target.nodeType === 3 ) {\n\t\t\tevent.target = event.target.parentNode;\n\t\t}\n\n\t\t// Support: IE<9\n\t\t// For mouse/key events, metaKey==false if it's undefined (#3368, #11328)\n\t\tevent.metaKey = !!event.metaKey;\n\n\t\treturn fixHook.filter ? fixHook.filter( event, originalEvent ) : event;\n\t},\n\n\t// Includes some event props shared by KeyEvent and MouseEvent\n\tprops: \"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which\".split(\" \"),\n\n\tfixHooks: {},\n\n\tkeyHooks: {\n\t\tprops: \"char charCode key keyCode\".split(\" \"),\n\t\tfilter: function( event, original ) {\n\n\t\t\t// Add which for key events\n\t\t\tif ( event.which == null ) {\n\t\t\t\tevent.which = original.charCode != null ? original.charCode : original.keyCode;\n\t\t\t}\n\n\t\t\treturn event;\n\t\t}\n\t},\n\n\tmouseHooks: {\n\t\tprops: \"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement\".split(\" \"),\n\t\tfilter: function( event, original ) {\n\t\t\tvar body, eventDoc, doc,\n\t\t\t\tbutton = original.button,\n\t\t\t\tfromElement = original.fromElement;\n\n\t\t\t// Calculate pageX/Y if missing and clientX/Y available\n\t\t\tif ( event.pageX == null && original.clientX != null ) {\n\t\t\t\teventDoc = event.target.ownerDocument || document;\n\t\t\t\tdoc = eventDoc.documentElement;\n\t\t\t\tbody = eventDoc.body;\n\n\t\t\t\tevent.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );\n\t\t\t\tevent.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );\n\t\t\t}\n\n\t\t\t// Add relatedTarget, if necessary\n\t\t\tif ( !event.relatedTarget && fromElement ) {\n\t\t\t\tevent.relatedTarget = fromElement === event.target ? original.toElement : fromElement;\n\t\t\t}\n\n\t\t\t// Add which for click: 1 === left; 2 === middle; 3 === right\n\t\t\t// Note: button is not normalized, so don't use it\n\t\t\tif ( !event.which && button !== undefined ) {\n\t\t\t\tevent.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );\n\t\t\t}\n\n\t\t\treturn event;\n\t\t}\n\t},\n\n\tspecial: {\n\t\tload: {\n\t\t\t// Prevent triggered image.load events from bubbling to window.load\n\t\t\tnoBubble: true\n\t\t},\n\t\tfocus: {\n\t\t\t// Fire native event if possible so blur/focus sequence is correct\n\t\t\ttrigger: function() {\n\t\t\t\tif ( this !== safeActiveElement() && this.focus ) {\n\t\t\t\t\ttry {\n\t\t\t\t\t\tthis.focus();\n\t\t\t\t\t\treturn false;\n\t\t\t\t\t} catch ( e ) {\n\t\t\t\t\t\t// Support: IE<9\n\t\t\t\t\t\t// If we error on focus to hidden element (#1486, #12518),\n\t\t\t\t\t\t// let .trigger() run the handlers\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t},\n\t\t\tdelegateType: \"focusin\"\n\t\t},\n\t\tblur: {\n\t\t\ttrigger: function() {\n\t\t\t\tif ( this === safeActiveElement() && this.blur ) {\n\t\t\t\t\tthis.blur();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdelegateType: \"focusout\"\n\t\t},\n\t\tclick: {\n\t\t\t// For checkbox, fire native event so checked state will be right\n\t\t\ttrigger: function() {\n\t\t\t\tif ( jQuery.nodeName( this, \"input\" ) && this.type === \"checkbox\" && this.click ) {\n\t\t\t\t\tthis.click();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t},\n\n\t\t\t// For cross-browser consistency, don't fire native .click() on links\n\t\t\t_default: function( event ) {\n\t\t\t\treturn jQuery.nodeName( event.target, \"a\" );\n\t\t\t}\n\t\t},\n\n\t\tbeforeunload: {\n\t\t\tpostDispatch: function( event ) {\n\n\t\t\t\t// Support: Firefox 20+\n\t\t\t\t// Firefox doesn't alert if the returnValue field is not set.\n\t\t\t\tif ( event.result !== undefined && event.originalEvent ) {\n\t\t\t\t\tevent.originalEvent.returnValue = event.result;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\tsimulate: function( type, elem, event, bubble ) {\n\t\t// Piggyback on a donor event to simulate a different one.\n\t\t// Fake originalEvent to avoid donor's stopPropagation, but if the\n\t\t// simulated event prevents default then we do the same on the donor.\n\t\tvar e = jQuery.extend(\n\t\t\tnew jQuery.Event(),\n\t\t\tevent,\n\t\t\t{\n\t\t\t\ttype: type,\n\t\t\t\tisSimulated: true,\n\t\t\t\toriginalEvent: {}\n\t\t\t}\n\t\t);\n\t\tif ( bubble ) {\n\t\t\tjQuery.event.trigger( e, null, elem );\n\t\t} else {\n\t\t\tjQuery.event.dispatch.call( elem, e );\n\t\t}\n\t\tif ( e.isDefaultPrevented() ) {\n\t\t\tevent.preventDefault();\n\t\t}\n\t}\n};\n\njQuery.removeEvent = document.removeEventListener ?\n\tfunction( elem, type, handle ) {\n\t\tif ( elem.removeEventListener ) {\n\t\t\telem.removeEventListener( type, handle, false );\n\t\t}\n\t} :\n\tfunction( elem, type, handle ) {\n\t\tvar name = \"on\" + type;\n\n\t\tif ( elem.detachEvent ) {\n\n\t\t\t// #8545, #7054, preventing memory leaks for custom events in IE6-8\n\t\t\t// detachEvent needed property on element, by name of that event, to properly expose it to GC\n\t\t\tif ( typeof elem[ name ] === strundefined ) {\n\t\t\t\telem[ name ] = null;\n\t\t\t}\n\n\t\t\telem.detachEvent( name, handle );\n\t\t}\n\t};\n\njQuery.Event = function( src, props ) {\n\t// Allow instantiation without the 'new' keyword\n\tif ( !(this instanceof jQuery.Event) ) {\n\t\treturn new jQuery.Event( src, props );\n\t}\n\n\t// Event object\n\tif ( src && src.type ) {\n\t\tthis.originalEvent = src;\n\t\tthis.type = src.type;\n\n\t\t// Events bubbling up the document may have been marked as prevented\n\t\t// by a handler lower down the tree; reflect the correct value.\n\t\tthis.isDefaultPrevented = src.defaultPrevented ||\n\t\t\t\tsrc.defaultPrevented === undefined &&\n\t\t\t\t// Support: IE < 9, Android < 4.0\n\t\t\t\tsrc.returnValue === false ?\n\t\t\treturnTrue :\n\t\t\treturnFalse;\n\n\t// Event type\n\t} else {\n\t\tthis.type = src;\n\t}\n\n\t// Put explicitly provided properties onto the event object\n\tif ( props ) {\n\t\tjQuery.extend( this, props );\n\t}\n\n\t// Create a timestamp if incoming event doesn't have one\n\tthis.timeStamp = src && src.timeStamp || jQuery.now();\n\n\t// Mark it as fixed\n\tthis[ jQuery.expando ] = true;\n};\n\n// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding\n// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html\njQuery.Event.prototype = {\n\tisDefaultPrevented: returnFalse,\n\tisPropagationStopped: returnFalse,\n\tisImmediatePropagationStopped: returnFalse,\n\n\tpreventDefault: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isDefaultPrevented = returnTrue;\n\t\tif ( !e ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// If preventDefault exists, run it on the original event\n\t\tif ( e.preventDefault ) {\n\t\t\te.preventDefault();\n\n\t\t// Support: IE\n\t\t// Otherwise set the returnValue property of the original event to false\n\t\t} else {\n\t\t\te.returnValue = false;\n\t\t}\n\t},\n\tstopPropagation: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isPropagationStopped = returnTrue;\n\t\tif ( !e ) {\n\t\t\treturn;\n\t\t}\n\t\t// If stopPropagation exists, run it on the original event\n\t\tif ( e.stopPropagation ) {\n\t\t\te.stopPropagation();\n\t\t}\n\n\t\t// Support: IE\n\t\t// Set the cancelBubble property of the original event to true\n\t\te.cancelBubble = true;\n\t},\n\tstopImmediatePropagation: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isImmediatePropagationStopped = returnTrue;\n\n\t\tif ( e && e.stopImmediatePropagation ) {\n\t\t\te.stopImmediatePropagation();\n\t\t}\n\n\t\tthis.stopPropagation();\n\t}\n};\n\n// Create mouseenter/leave events using mouseover/out and event-time checks\njQuery.each({\n\tmouseenter: \"mouseover\",\n\tmouseleave: \"mouseout\",\n\tpointerenter: \"pointerover\",\n\tpointerleave: \"pointerout\"\n}, function( orig, fix ) {\n\tjQuery.event.special[ orig ] = {\n\t\tdelegateType: fix,\n\t\tbindType: fix,\n\n\t\thandle: function( event ) {\n\t\t\tvar ret,\n\t\t\t\ttarget = this,\n\t\t\t\trelated = event.relatedTarget,\n\t\t\t\thandleObj = event.handleObj;\n\n\t\t\t// For mousenter/leave call the handler if related is outside the target.\n\t\t\t// NB: No relatedTarget if the mouse left/entered the browser window\n\t\t\tif ( !related || (related !== target && !jQuery.contains( target, related )) ) {\n\t\t\t\tevent.type = handleObj.origType;\n\t\t\t\tret = handleObj.handler.apply( this, arguments );\n\t\t\t\tevent.type = fix;\n\t\t\t}\n\t\t\treturn ret;\n\t\t}\n\t};\n});\n\n// IE submit delegation\nif ( !support.submitBubbles ) {\n\n\tjQuery.event.special.submit = {\n\t\tsetup: function() {\n\t\t\t// Only need this for delegated form submit events\n\t\t\tif ( jQuery.nodeName( this, \"form\" ) ) {\n\t\t\t\treturn false;\n\t\t\t}\n\n\t\t\t// Lazy-add a submit handler when a descendant form may potentially be submitted\n\t\t\tjQuery.event.add( this, \"click._submit keypress._submit\", function( e ) {\n\t\t\t\t// Node name check avoids a VML-related crash in IE (#9807)\n\t\t\t\tvar elem = e.target,\n\t\t\t\t\tform = jQuery.nodeName( elem, \"input\" ) || jQuery.nodeName( elem, \"button\" ) ? elem.form : undefined;\n\t\t\t\tif ( form && !jQuery._data( form, \"submitBubbles\" ) ) {\n\t\t\t\t\tjQuery.event.add( form, \"submit._submit\", function( event ) {\n\t\t\t\t\t\tevent._submit_bubble = true;\n\t\t\t\t\t});\n\t\t\t\t\tjQuery._data( form, \"submitBubbles\", true );\n\t\t\t\t}\n\t\t\t});\n\t\t\t// return undefined since we don't need an event listener\n\t\t},\n\n\t\tpostDispatch: function( event ) {\n\t\t\t// If form was submitted by the user, bubble the event up the tree\n\t\t\tif ( event._submit_bubble ) {\n\t\t\t\tdelete event._submit_bubble;\n\t\t\t\tif ( this.parentNode && !event.isTrigger ) {\n\t\t\t\t\tjQuery.event.simulate( \"submit\", this.parentNode, event, true );\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\n\t\tteardown: function() {\n\t\t\t// Only need this for delegated form submit events\n\t\t\tif ( jQuery.nodeName( this, \"form\" ) ) {\n\t\t\t\treturn false;\n\t\t\t}\n\n\t\t\t// Remove delegated handlers; cleanData eventually reaps submit handlers attached above\n\t\t\tjQuery.event.remove( this, \"._submit\" );\n\t\t}\n\t};\n}\n\n// IE change delegation and checkbox/radio fix\nif ( !support.changeBubbles ) {\n\n\tjQuery.event.special.change = {\n\n\t\tsetup: function() {\n\n\t\t\tif ( rformElems.test( this.nodeName ) ) {\n\t\t\t\t// IE doesn't fire change on a check/radio until blur; trigger it on click\n\t\t\t\t// after a propertychange. Eat the blur-change in special.change.handle.\n\t\t\t\t// This still fires onchange a second time for check/radio after blur.\n\t\t\t\tif ( this.type === \"checkbox\" || this.type === \"radio\" ) {\n\t\t\t\t\tjQuery.event.add( this, \"propertychange._change\", function( event ) {\n\t\t\t\t\t\tif ( event.originalEvent.propertyName === \"checked\" ) {\n\t\t\t\t\t\t\tthis._just_changed = true;\n\t\t\t\t\t\t}\n\t\t\t\t\t});\n\t\t\t\t\tjQuery.event.add( this, \"click._change\", function( event ) {\n\t\t\t\t\t\tif ( this._just_changed && !event.isTrigger ) {\n\t\t\t\t\t\t\tthis._just_changed = false;\n\t\t\t\t\t\t}\n\t\t\t\t\t\t// Allow triggered, simulated change events (#11500)\n\t\t\t\t\t\tjQuery.event.simulate( \"change\", this, event, true );\n\t\t\t\t\t});\n\t\t\t\t}\n\t\t\t\treturn false;\n\t\t\t}\n\t\t\t// Delegated event; lazy-add a change handler on descendant inputs\n\t\t\tjQuery.event.add( this, \"beforeactivate._change\", function( e ) {\n\t\t\t\tvar elem = e.target;\n\n\t\t\t\tif ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, \"changeBubbles\" ) ) {\n\t\t\t\t\tjQuery.event.add( elem, \"change._change\", function( event ) {\n\t\t\t\t\t\tif ( this.parentNode && !event.isSimulated && !event.isTrigger ) {\n\t\t\t\t\t\t\tjQuery.event.simulate( \"change\", this.parentNode, event, true );\n\t\t\t\t\t\t}\n\t\t\t\t\t});\n\t\t\t\t\tjQuery._data( elem, \"changeBubbles\", true );\n\t\t\t\t}\n\t\t\t});\n\t\t},\n\n\t\thandle: function( event ) {\n\t\t\tvar elem = event.target;\n\n\t\t\t// Swallow native change events from checkbox/radio, we already triggered them above\n\t\t\tif ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== \"radio\" && elem.type !== \"checkbox\") ) {\n\t\t\t\treturn event.handleObj.handler.apply( this, arguments );\n\t\t\t}\n\t\t},\n\n\t\tteardown: function() {\n\t\t\tjQuery.event.remove( this, \"._change\" );\n\n\t\t\treturn !rformElems.test( this.nodeName );\n\t\t}\n\t};\n}\n\n// Create \"bubbling\" focus and blur events\nif ( !support.focusinBubbles ) {\n\tjQuery.each({ focus: \"focusin\", blur: \"focusout\" }, function( orig, fix ) {\n\n\t\t// Attach a single capturing handler on the document while someone wants focusin/focusout\n\t\tvar handler = function( event ) {\n\t\t\t\tjQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );\n\t\t\t};\n\n\t\tjQuery.event.special[ fix ] = {\n\t\t\tsetup: function() {\n\t\t\t\tvar doc = this.ownerDocument || this,\n\t\t\t\t\tattaches = jQuery._data( doc, fix );\n\n\t\t\t\tif ( !attaches ) {\n\t\t\t\t\tdoc.addEventListener( orig, handler, true );\n\t\t\t\t}\n\t\t\t\tjQuery._data( doc, fix, ( attaches || 0 ) + 1 );\n\t\t\t},\n\t\t\tteardown: function() {\n\t\t\t\tvar doc = this.ownerDocument || this,\n\t\t\t\t\tattaches = jQuery._data( doc, fix ) - 1;\n\n\t\t\t\tif ( !attaches ) {\n\t\t\t\t\tdoc.removeEventListener( orig, handler, true );\n\t\t\t\t\tjQuery._removeData( doc, fix );\n\t\t\t\t} else {\n\t\t\t\t\tjQuery._data( doc, fix, attaches );\n\t\t\t\t}\n\t\t\t}\n\t\t};\n\t});\n}\n\njQuery.fn.extend({\n\n\ton: function( types, selector, data, fn, /*INTERNAL*/ one ) {\n\t\tvar type, origFn;\n\n\t\t// Types can be a map of types/handlers\n\t\tif ( typeof types === \"object\" ) {\n\t\t\t// ( types-Object, selector, data )\n\t\t\tif ( typeof selector !== \"string\" ) {\n\t\t\t\t// ( types-Object, data )\n\t\t\t\tdata = data || selector;\n\t\t\t\tselector = undefined;\n\t\t\t}\n\t\t\tfor ( type in types ) {\n\t\t\t\tthis.on( type, selector, data, types[ type ], one );\n\t\t\t}\n\t\t\treturn this;\n\t\t}\n\n\t\tif ( data == null && fn == null ) {\n\t\t\t// ( types, fn )\n\t\t\tfn = selector;\n\t\t\tdata = selector = undefined;\n\t\t} else if ( fn == null ) {\n\t\t\tif ( typeof selector === \"string\" ) {\n\t\t\t\t// ( types, selector, fn )\n\t\t\t\tfn = data;\n\t\t\t\tdata = undefined;\n\t\t\t} else {\n\t\t\t\t// ( types, data, fn )\n\t\t\t\tfn = data;\n\t\t\t\tdata = selector;\n\t\t\t\tselector = undefined;\n\t\t\t}\n\t\t}\n\t\tif ( fn === false ) {\n\t\t\tfn = returnFalse;\n\t\t} else if ( !fn ) {\n\t\t\treturn this;\n\t\t}\n\n\t\tif ( one === 1 ) {\n\t\t\torigFn = fn;\n\t\t\tfn = function( event ) {\n\t\t\t\t// Can use an empty set, since event contains the info\n\t\t\t\tjQuery().off( event );\n\t\t\t\treturn origFn.apply( this, arguments );\n\t\t\t};\n\t\t\t// Use same guid so caller can remove using origFn\n\t\t\tfn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );\n\t\t}\n\t\treturn this.each( function() {\n\t\t\tjQuery.event.add( this, types, fn, data, selector );\n\t\t});\n\t},\n\tone: function( types, selector, data, fn ) {\n\t\treturn this.on( types, selector, data, fn, 1 );\n\t},\n\toff: function( types, selector, fn ) {\n\t\tvar handleObj, type;\n\t\tif ( types && types.preventDefault && types.handleObj ) {\n\t\t\t// ( event ) dispatched jQuery.Event\n\t\t\thandleObj = types.handleObj;\n\t\t\tjQuery( types.delegateTarget ).off(\n\t\t\t\thandleObj.namespace ? handleObj.origType + \".\" + handleObj.namespace : handleObj.origType,\n\t\t\t\thandleObj.selector,\n\t\t\t\thandleObj.handler\n\t\t\t);\n\t\t\treturn this;\n\t\t}\n\t\tif ( typeof types === \"object\" ) {\n\t\t\t// ( types-object [, selector] )\n\t\t\tfor ( type in types ) {\n\t\t\t\tthis.off( type, selector, types[ type ] );\n\t\t\t}\n\t\t\treturn this;\n\t\t}\n\t\tif ( selector === false || typeof selector === \"function\" ) {\n\t\t\t// ( types [, fn] )\n\t\t\tfn = selector;\n\t\t\tselector = undefined;\n\t\t}\n\t\tif ( fn === false ) {\n\t\t\tfn = returnFalse;\n\t\t}\n\t\treturn this.each(function() {\n\t\t\tjQuery.event.remove( this, types, fn, selector );\n\t\t});\n\t},\n\n\ttrigger: function( type, data ) {\n\t\treturn this.each(function() {\n\t\t\tjQuery.event.trigger( type, data, this );\n\t\t});\n\t},\n\ttriggerHandler: function( type, data ) {\n\t\tvar elem = this[0];\n\t\tif ( elem ) {\n\t\t\treturn jQuery.event.trigger( type, data, elem, true );\n\t\t}\n\t}\n});\n\n\nfunction createSafeFragment( document ) {\n\tvar list = nodeNames.split( \"|\" ),\n\t\tsafeFrag = document.createDocumentFragment();\n\n\tif ( safeFrag.createElement ) {\n\t\twhile ( list.length ) {\n\t\t\tsafeFrag.createElement(\n\t\t\t\tlist.pop()\n\t\t\t);\n\t\t}\n\t}\n\treturn safeFrag;\n}\n\nvar nodeNames = \"abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|\" +\n\t\t\"header|hgroup|mark|meter|nav|output|progress|section|summary|time|video\",\n\trinlinejQuery = / jQuery\\d+=\"(?:null|\\d+)\"/g,\n\trnoshimcache = new RegExp(\"<(?:\" + nodeNames + \")[\\\\s/>]\", \"i\"),\n\trleadingWhitespace = /^\\s+/,\n\trxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\\w:]+)[^>]*)\\/>/gi,\n\trtagName = /<([\\w:]+)/,\n\trtbody = /\\s*$/g,\n\n\t// We have to close these tags to support XHTML (#13200)\n\twrapMap = {\n\t\toption: [ 1, \"\" ],\n\t\tlegend: [ 1, \"
\", \"
\" ],\n\t\tarea: [ 1, \"\", \"\" ],\n\t\tparam: [ 1, \"\", \"\" ],\n\t\tthead: [ 1, \"\", \"
\" ],\n\t\ttr: [ 2, \"\", \"
\" ],\n\t\tcol: [ 2, \"\", \"
\" ],\n\t\ttd: [ 3, \"\", \"
\" ],\n\n\t\t// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,\n\t\t// unless wrapped in a div with non-breaking characters in front of it.\n\t\t_default: support.htmlSerialize ? [ 0, \"\", \"\" ] : [ 1, \"X
\", \"
\" ]\n\t},\n\tsafeFragment = createSafeFragment( document ),\n\tfragmentDiv = safeFragment.appendChild( document.createElement(\"div\") );\n\nwrapMap.optgroup = wrapMap.option;\nwrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;\nwrapMap.th = wrapMap.td;\n\nfunction getAll( context, tag ) {\n\tvar elems, elem,\n\t\ti = 0,\n\t\tfound = typeof context.getElementsByTagName !== strundefined ? context.getElementsByTagName( tag || \"*\" ) :\n\t\t\ttypeof context.querySelectorAll !== strundefined ? context.querySelectorAll( tag || \"*\" ) :\n\t\t\tundefined;\n\n\tif ( !found ) {\n\t\tfor ( found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++ ) {\n\t\t\tif ( !tag || jQuery.nodeName( elem, tag ) ) {\n\t\t\t\tfound.push( elem );\n\t\t\t} else {\n\t\t\t\tjQuery.merge( found, getAll( elem, tag ) );\n\t\t\t}\n\t\t}\n\t}\n\n\treturn tag === undefined || tag && jQuery.nodeName( context, tag ) ?\n\t\tjQuery.merge( [ context ], found ) :\n\t\tfound;\n}\n\n// Used in buildFragment, fixes the defaultChecked property\nfunction fixDefaultChecked( elem ) {\n\tif ( rcheckableType.test( elem.type ) ) {\n\t\telem.defaultChecked = elem.checked;\n\t}\n}\n\n// Support: IE<8\n// Manipulating tables requires a tbody\nfunction manipulationTarget( elem, content ) {\n\treturn jQuery.nodeName( elem, \"table\" ) &&\n\t\tjQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, \"tr\" ) ?\n\n\t\telem.getElementsByTagName(\"tbody\")[0] ||\n\t\t\telem.appendChild( elem.ownerDocument.createElement(\"tbody\") ) :\n\t\telem;\n}\n\n// Replace/restore the type attribute of script elements for safe DOM manipulation\nfunction disableScript( elem ) {\n\telem.type = (jQuery.find.attr( elem, \"type\" ) !== null) + \"/\" + elem.type;\n\treturn elem;\n}\nfunction restoreScript( elem ) {\n\tvar match = rscriptTypeMasked.exec( elem.type );\n\tif ( match ) {\n\t\telem.type = match[1];\n\t} else {\n\t\telem.removeAttribute(\"type\");\n\t}\n\treturn elem;\n}\n\n// Mark scripts as having already been evaluated\nfunction setGlobalEval( elems, refElements ) {\n\tvar elem,\n\t\ti = 0;\n\tfor ( ; (elem = elems[i]) != null; i++ ) {\n\t\tjQuery._data( elem, \"globalEval\", !refElements || jQuery._data( refElements[i], \"globalEval\" ) );\n\t}\n}\n\nfunction cloneCopyEvent( src, dest ) {\n\n\tif ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {\n\t\treturn;\n\t}\n\n\tvar type, i, l,\n\t\toldData = jQuery._data( src ),\n\t\tcurData = jQuery._data( dest, oldData ),\n\t\tevents = oldData.events;\n\n\tif ( events ) {\n\t\tdelete curData.handle;\n\t\tcurData.events = {};\n\n\t\tfor ( type in events ) {\n\t\t\tfor ( i = 0, l = events[ type ].length; i < l; i++ ) {\n\t\t\t\tjQuery.event.add( dest, type, events[ type ][ i ] );\n\t\t\t}\n\t\t}\n\t}\n\n\t// make the cloned public data object a copy from the original\n\tif ( curData.data ) {\n\t\tcurData.data = jQuery.extend( {}, curData.data );\n\t}\n}\n\nfunction fixCloneNodeIssues( src, dest ) {\n\tvar nodeName, e, data;\n\n\t// We do not need to do anything for non-Elements\n\tif ( dest.nodeType !== 1 ) {\n\t\treturn;\n\t}\n\n\tnodeName = dest.nodeName.toLowerCase();\n\n\t// IE6-8 copies events bound via attachEvent when using cloneNode.\n\tif ( !support.noCloneEvent && dest[ jQuery.expando ] ) {\n\t\tdata = jQuery._data( dest );\n\n\t\tfor ( e in data.events ) {\n\t\t\tjQuery.removeEvent( dest, e, data.handle );\n\t\t}\n\n\t\t// Event data gets referenced instead of copied if the expando gets copied too\n\t\tdest.removeAttribute( jQuery.expando );\n\t}\n\n\t// IE blanks contents when cloning scripts, and tries to evaluate newly-set text\n\tif ( nodeName === \"script\" && dest.text !== src.text ) {\n\t\tdisableScript( dest ).text = src.text;\n\t\trestoreScript( dest );\n\n\t// IE6-10 improperly clones children of object elements using classid.\n\t// IE10 throws NoModificationAllowedError if parent is null, #12132.\n\t} else if ( nodeName === \"object\" ) {\n\t\tif ( dest.parentNode ) {\n\t\t\tdest.outerHTML = src.outerHTML;\n\t\t}\n\n\t\t// This path appears unavoidable for IE9. When cloning an object\n\t\t// element in IE9, the outerHTML strategy above is not sufficient.\n\t\t// If the src has innerHTML and the destination does not,\n\t\t// copy the src.innerHTML into the dest.innerHTML. #10324\n\t\tif ( support.html5Clone && ( src.innerHTML && !jQuery.trim(dest.innerHTML) ) ) {\n\t\t\tdest.innerHTML = src.innerHTML;\n\t\t}\n\n\t} else if ( nodeName === \"input\" && rcheckableType.test( src.type ) ) {\n\t\t// IE6-8 fails to persist the checked state of a cloned checkbox\n\t\t// or radio button. Worse, IE6-7 fail to give the cloned element\n\t\t// a checked appearance if the defaultChecked value isn't also set\n\n\t\tdest.defaultChecked = dest.checked = src.checked;\n\n\t\t// IE6-7 get confused and end up setting the value of a cloned\n\t\t// checkbox/radio button to an empty string instead of \"on\"\n\t\tif ( dest.value !== src.value ) {\n\t\t\tdest.value = src.value;\n\t\t}\n\n\t// IE6-8 fails to return the selected option to the default selected\n\t// state when cloning options\n\t} else if ( nodeName === \"option\" ) {\n\t\tdest.defaultSelected = dest.selected = src.defaultSelected;\n\n\t// IE6-8 fails to set the defaultValue to the correct value when\n\t// cloning other types of input fields\n\t} else if ( nodeName === \"input\" || nodeName === \"textarea\" ) {\n\t\tdest.defaultValue = src.defaultValue;\n\t}\n}\n\njQuery.extend({\n\tclone: function( elem, dataAndEvents, deepDataAndEvents ) {\n\t\tvar destElements, node, clone, i, srcElements,\n\t\t\tinPage = jQuery.contains( elem.ownerDocument, elem );\n\n\t\tif ( support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( \"<\" + elem.nodeName + \">\" ) ) {\n\t\t\tclone = elem.cloneNode( true );\n\n\t\t// IE<=8 does not properly clone detached, unknown element nodes\n\t\t} else {\n\t\t\tfragmentDiv.innerHTML = elem.outerHTML;\n\t\t\tfragmentDiv.removeChild( clone = fragmentDiv.firstChild );\n\t\t}\n\n\t\tif ( (!support.noCloneEvent || !support.noCloneChecked) &&\n\t\t\t\t(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {\n\n\t\t\t// We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2\n\t\t\tdestElements = getAll( clone );\n\t\t\tsrcElements = getAll( elem );\n\n\t\t\t// Fix all IE cloning issues\n\t\t\tfor ( i = 0; (node = srcElements[i]) != null; ++i ) {\n\t\t\t\t// Ensure that the destination node is not null; Fixes #9587\n\t\t\t\tif ( destElements[i] ) {\n\t\t\t\t\tfixCloneNodeIssues( node, destElements[i] );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Copy the events from the original to the clone\n\t\tif ( dataAndEvents ) {\n\t\t\tif ( deepDataAndEvents ) {\n\t\t\t\tsrcElements = srcElements || getAll( elem );\n\t\t\t\tdestElements = destElements || getAll( clone );\n\n\t\t\t\tfor ( i = 0; (node = srcElements[i]) != null; i++ ) {\n\t\t\t\t\tcloneCopyEvent( node, destElements[i] );\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tcloneCopyEvent( elem, clone );\n\t\t\t}\n\t\t}\n\n\t\t// Preserve script evaluation history\n\t\tdestElements = getAll( clone, \"script\" );\n\t\tif ( destElements.length > 0 ) {\n\t\t\tsetGlobalEval( destElements, !inPage && getAll( elem, \"script\" ) );\n\t\t}\n\n\t\tdestElements = srcElements = node = null;\n\n\t\t// Return the cloned set\n\t\treturn clone;\n\t},\n\n\tbuildFragment: function( elems, context, scripts, selection ) {\n\t\tvar j, elem, contains,\n\t\t\ttmp, tag, tbody, wrap,\n\t\t\tl = elems.length,\n\n\t\t\t// Ensure a safe fragment\n\t\t\tsafe = createSafeFragment( context ),\n\n\t\t\tnodes = [],\n\t\t\ti = 0;\n\n\t\tfor ( ; i < l; i++ ) {\n\t\t\telem = elems[ i ];\n\n\t\t\tif ( elem || elem === 0 ) {\n\n\t\t\t\t// Add nodes directly\n\t\t\t\tif ( jQuery.type( elem ) === \"object\" ) {\n\t\t\t\t\tjQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );\n\n\t\t\t\t// Convert non-html into a text node\n\t\t\t\t} else if ( !rhtml.test( elem ) ) {\n\t\t\t\t\tnodes.push( context.createTextNode( elem ) );\n\n\t\t\t\t// Convert html into DOM nodes\n\t\t\t\t} else {\n\t\t\t\t\ttmp = tmp || safe.appendChild( context.createElement(\"div\") );\n\n\t\t\t\t\t// Deserialize a standard representation\n\t\t\t\t\ttag = (rtagName.exec( elem ) || [ \"\", \"\" ])[ 1 ].toLowerCase();\n\t\t\t\t\twrap = wrapMap[ tag ] || wrapMap._default;\n\n\t\t\t\t\ttmp.innerHTML = wrap[1] + elem.replace( rxhtmlTag, \"<$1>\" ) + wrap[2];\n\n\t\t\t\t\t// Descend through wrappers to the right content\n\t\t\t\t\tj = wrap[0];\n\t\t\t\t\twhile ( j-- ) {\n\t\t\t\t\t\ttmp = tmp.lastChild;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Manually add leading whitespace removed by IE\n\t\t\t\t\tif ( !support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {\n\t\t\t\t\t\tnodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[0] ) );\n\t\t\t\t\t}\n\n\t\t\t\t\t// Remove IE's autoinserted from table fragments\n\t\t\t\t\tif ( !support.tbody ) {\n\n\t\t\t\t\t\t// String was a , *may* have spurious \n\t\t\t\t\t\telem = tag === \"table\" && !rtbody.test( elem ) ?\n\t\t\t\t\t\t\ttmp.firstChild :\n\n\t\t\t\t\t\t\t// String was a bare or \n\t\t\t\t\t\t\twrap[1] === \"
\" && !rtbody.test( elem ) ?\n\t\t\t\t\t\t\t\ttmp :\n\t\t\t\t\t\t\t\t0;\n\n\t\t\t\t\t\tj = elem && elem.childNodes.length;\n\t\t\t\t\t\twhile ( j-- ) {\n\t\t\t\t\t\t\tif ( jQuery.nodeName( (tbody = elem.childNodes[j]), \"tbody\" ) && !tbody.childNodes.length ) {\n\t\t\t\t\t\t\t\telem.removeChild( tbody );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\tjQuery.merge( nodes, tmp.childNodes );\n\n\t\t\t\t\t// Fix #12392 for WebKit and IE > 9\n\t\t\t\t\ttmp.textContent = \"\";\n\n\t\t\t\t\t// Fix #12392 for oldIE\n\t\t\t\t\twhile ( tmp.firstChild ) {\n\t\t\t\t\t\ttmp.removeChild( tmp.firstChild );\n\t\t\t\t\t}\n\n\t\t\t\t\t// Remember the top-level container for proper cleanup\n\t\t\t\t\ttmp = safe.lastChild;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Fix #11356: Clear elements from fragment\n\t\tif ( tmp ) {\n\t\t\tsafe.removeChild( tmp );\n\t\t}\n\n\t\t// Reset defaultChecked for any radios and checkboxes\n\t\t// about to be appended to the DOM in IE 6/7 (#8060)\n\t\tif ( !support.appendChecked ) {\n\t\t\tjQuery.grep( getAll( nodes, \"input\" ), fixDefaultChecked );\n\t\t}\n\n\t\ti = 0;\n\t\twhile ( (elem = nodes[ i++ ]) ) {\n\n\t\t\t// #4087 - If origin and destination elements are the same, and this is\n\t\t\t// that element, do not do anything\n\t\t\tif ( selection && jQuery.inArray( elem, selection ) !== -1 ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\tcontains = jQuery.contains( elem.ownerDocument, elem );\n\n\t\t\t// Append to fragment\n\t\t\ttmp = getAll( safe.appendChild( elem ), \"script\" );\n\n\t\t\t// Preserve script evaluation history\n\t\t\tif ( contains ) {\n\t\t\t\tsetGlobalEval( tmp );\n\t\t\t}\n\n\t\t\t// Capture executables\n\t\t\tif ( scripts ) {\n\t\t\t\tj = 0;\n\t\t\t\twhile ( (elem = tmp[ j++ ]) ) {\n\t\t\t\t\tif ( rscriptType.test( elem.type || \"\" ) ) {\n\t\t\t\t\t\tscripts.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\ttmp = null;\n\n\t\treturn safe;\n\t},\n\n\tcleanData: function( elems, /* internal */ acceptData ) {\n\t\tvar elem, type, id, data,\n\t\t\ti = 0,\n\t\t\tinternalKey = jQuery.expando,\n\t\t\tcache = jQuery.cache,\n\t\t\tdeleteExpando = support.deleteExpando,\n\t\t\tspecial = jQuery.event.special;\n\n\t\tfor ( ; (elem = elems[i]) != null; i++ ) {\n\t\t\tif ( acceptData || jQuery.acceptData( elem ) ) {\n\n\t\t\t\tid = elem[ internalKey ];\n\t\t\t\tdata = id && cache[ id ];\n\n\t\t\t\tif ( data ) {\n\t\t\t\t\tif ( data.events ) {\n\t\t\t\t\t\tfor ( type in data.events ) {\n\t\t\t\t\t\t\tif ( special[ type ] ) {\n\t\t\t\t\t\t\t\tjQuery.event.remove( elem, type );\n\n\t\t\t\t\t\t\t// This is a shortcut to avoid jQuery.event.remove's overhead\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tjQuery.removeEvent( elem, type, data.handle );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Remove cache only if it was not already removed by jQuery.event.remove\n\t\t\t\t\tif ( cache[ id ] ) {\n\n\t\t\t\t\t\tdelete cache[ id ];\n\n\t\t\t\t\t\t// IE does not allow us to delete expando properties from nodes,\n\t\t\t\t\t\t// nor does it have a removeAttribute function on Document nodes;\n\t\t\t\t\t\t// we must handle all of these cases\n\t\t\t\t\t\tif ( deleteExpando ) {\n\t\t\t\t\t\t\tdelete elem[ internalKey ];\n\n\t\t\t\t\t\t} else if ( typeof elem.removeAttribute !== strundefined ) {\n\t\t\t\t\t\t\telem.removeAttribute( internalKey );\n\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\telem[ internalKey ] = null;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\tdeletedIds.push( id );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n});\n\njQuery.fn.extend({\n\ttext: function( value ) {\n\t\treturn access( this, function( value ) {\n\t\t\treturn value === undefined ?\n\t\t\t\tjQuery.text( this ) :\n\t\t\t\tthis.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );\n\t\t}, null, value, arguments.length );\n\t},\n\n\tappend: function() {\n\t\treturn this.domManip( arguments, function( elem ) {\n\t\t\tif ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {\n\t\t\t\tvar target = manipulationTarget( this, elem );\n\t\t\t\ttarget.appendChild( elem );\n\t\t\t}\n\t\t});\n\t},\n\n\tprepend: function() {\n\t\treturn this.domManip( arguments, function( elem ) {\n\t\t\tif ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {\n\t\t\t\tvar target = manipulationTarget( this, elem );\n\t\t\t\ttarget.insertBefore( elem, target.firstChild );\n\t\t\t}\n\t\t});\n\t},\n\n\tbefore: function() {\n\t\treturn this.domManip( arguments, function( elem ) {\n\t\t\tif ( this.parentNode ) {\n\t\t\t\tthis.parentNode.insertBefore( elem, this );\n\t\t\t}\n\t\t});\n\t},\n\n\tafter: function() {\n\t\treturn this.domManip( arguments, function( elem ) {\n\t\t\tif ( this.parentNode ) {\n\t\t\t\tthis.parentNode.insertBefore( elem, this.nextSibling );\n\t\t\t}\n\t\t});\n\t},\n\n\tremove: function( selector, keepData /* Internal Use Only */ ) {\n\t\tvar elem,\n\t\t\telems = selector ? jQuery.filter( selector, this ) : this,\n\t\t\ti = 0;\n\n\t\tfor ( ; (elem = elems[i]) != null; i++ ) {\n\n\t\t\tif ( !keepData && elem.nodeType === 1 ) {\n\t\t\t\tjQuery.cleanData( getAll( elem ) );\n\t\t\t}\n\n\t\t\tif ( elem.parentNode ) {\n\t\t\t\tif ( keepData && jQuery.contains( elem.ownerDocument, elem ) ) {\n\t\t\t\t\tsetGlobalEval( getAll( elem, \"script\" ) );\n\t\t\t\t}\n\t\t\t\telem.parentNode.removeChild( elem );\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\tempty: function() {\n\t\tvar elem,\n\t\t\ti = 0;\n\n\t\tfor ( ; (elem = this[i]) != null; i++ ) {\n\t\t\t// Remove element nodes and prevent memory leaks\n\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\tjQuery.cleanData( getAll( elem, false ) );\n\t\t\t}\n\n\t\t\t// Remove any remaining nodes\n\t\t\twhile ( elem.firstChild ) {\n\t\t\t\telem.removeChild( elem.firstChild );\n\t\t\t}\n\n\t\t\t// If this is a select, ensure that it displays empty (#12336)\n\t\t\t// Support: IE<9\n\t\t\tif ( elem.options && jQuery.nodeName( elem, \"select\" ) ) {\n\t\t\t\telem.options.length = 0;\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\tclone: function( dataAndEvents, deepDataAndEvents ) {\n\t\tdataAndEvents = dataAndEvents == null ? false : dataAndEvents;\n\t\tdeepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;\n\n\t\treturn this.map(function() {\n\t\t\treturn jQuery.clone( this, dataAndEvents, deepDataAndEvents );\n\t\t});\n\t},\n\n\thtml: function( value ) {\n\t\treturn access( this, function( value ) {\n\t\t\tvar elem = this[ 0 ] || {},\n\t\t\t\ti = 0,\n\t\t\t\tl = this.length;\n\n\t\t\tif ( value === undefined ) {\n\t\t\t\treturn elem.nodeType === 1 ?\n\t\t\t\t\telem.innerHTML.replace( rinlinejQuery, \"\" ) :\n\t\t\t\t\tundefined;\n\t\t\t}\n\n\t\t\t// See if we can take a shortcut and just use innerHTML\n\t\t\tif ( typeof value === \"string\" && !rnoInnerhtml.test( value ) &&\n\t\t\t\t( support.htmlSerialize || !rnoshimcache.test( value ) ) &&\n\t\t\t\t( support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&\n\t\t\t\t!wrapMap[ (rtagName.exec( value ) || [ \"\", \"\" ])[ 1 ].toLowerCase() ] ) {\n\n\t\t\t\tvalue = value.replace( rxhtmlTag, \"<$1>\" );\n\n\t\t\t\ttry {\n\t\t\t\t\tfor (; i < l; i++ ) {\n\t\t\t\t\t\t// Remove element nodes and prevent memory leaks\n\t\t\t\t\t\telem = this[i] || {};\n\t\t\t\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\t\t\t\tjQuery.cleanData( getAll( elem, false ) );\n\t\t\t\t\t\t\telem.innerHTML = value;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\telem = 0;\n\n\t\t\t\t// If using innerHTML throws an exception, use the fallback method\n\t\t\t\t} catch(e) {}\n\t\t\t}\n\n\t\t\tif ( elem ) {\n\t\t\t\tthis.empty().append( value );\n\t\t\t}\n\t\t}, null, value, arguments.length );\n\t},\n\n\treplaceWith: function() {\n\t\tvar arg = arguments[ 0 ];\n\n\t\t// Make the changes, replacing each context element with the new content\n\t\tthis.domManip( arguments, function( elem ) {\n\t\t\targ = this.parentNode;\n\n\t\t\tjQuery.cleanData( getAll( this ) );\n\n\t\t\tif ( arg ) {\n\t\t\t\targ.replaceChild( elem, this );\n\t\t\t}\n\t\t});\n\n\t\t// Force removal if there was no new content (e.g., from empty arguments)\n\t\treturn arg && (arg.length || arg.nodeType) ? this : this.remove();\n\t},\n\n\tdetach: function( selector ) {\n\t\treturn this.remove( selector, true );\n\t},\n\n\tdomManip: function( args, callback ) {\n\n\t\t// Flatten any nested arrays\n\t\targs = concat.apply( [], args );\n\n\t\tvar first, node, hasScripts,\n\t\t\tscripts, doc, fragment,\n\t\t\ti = 0,\n\t\t\tl = this.length,\n\t\t\tset = this,\n\t\t\tiNoClone = l - 1,\n\t\t\tvalue = args[0],\n\t\t\tisFunction = jQuery.isFunction( value );\n\n\t\t// We can't cloneNode fragments that contain checked, in WebKit\n\t\tif ( isFunction ||\n\t\t\t\t( l > 1 && typeof value === \"string\" &&\n\t\t\t\t\t!support.checkClone && rchecked.test( value ) ) ) {\n\t\t\treturn this.each(function( index ) {\n\t\t\t\tvar self = set.eq( index );\n\t\t\t\tif ( isFunction ) {\n\t\t\t\t\targs[0] = value.call( this, index, self.html() );\n\t\t\t\t}\n\t\t\t\tself.domManip( args, callback );\n\t\t\t});\n\t\t}\n\n\t\tif ( l ) {\n\t\t\tfragment = jQuery.buildFragment( args, this[ 0 ].ownerDocument, false, this );\n\t\t\tfirst = fragment.firstChild;\n\n\t\t\tif ( fragment.childNodes.length === 1 ) {\n\t\t\t\tfragment = first;\n\t\t\t}\n\n\t\t\tif ( first ) {\n\t\t\t\tscripts = jQuery.map( getAll( fragment, \"script\" ), disableScript );\n\t\t\t\thasScripts = scripts.length;\n\n\t\t\t\t// Use the original fragment for the last item instead of the first because it can end up\n\t\t\t\t// being emptied incorrectly in certain situations (#8070).\n\t\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\t\tnode = fragment;\n\n\t\t\t\t\tif ( i !== iNoClone ) {\n\t\t\t\t\t\tnode = jQuery.clone( node, true, true );\n\n\t\t\t\t\t\t// Keep references to cloned scripts for later restoration\n\t\t\t\t\t\tif ( hasScripts ) {\n\t\t\t\t\t\t\tjQuery.merge( scripts, getAll( node, \"script\" ) );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\tcallback.call( this[i], node, i );\n\t\t\t\t}\n\n\t\t\t\tif ( hasScripts ) {\n\t\t\t\t\tdoc = scripts[ scripts.length - 1 ].ownerDocument;\n\n\t\t\t\t\t// Reenable scripts\n\t\t\t\t\tjQuery.map( scripts, restoreScript );\n\n\t\t\t\t\t// Evaluate executable scripts on first document insertion\n\t\t\t\t\tfor ( i = 0; i < hasScripts; i++ ) {\n\t\t\t\t\t\tnode = scripts[ i ];\n\t\t\t\t\t\tif ( rscriptType.test( node.type || \"\" ) &&\n\t\t\t\t\t\t\t!jQuery._data( node, \"globalEval\" ) && jQuery.contains( doc, node ) ) {\n\n\t\t\t\t\t\t\tif ( node.src ) {\n\t\t\t\t\t\t\t\t// Optional AJAX dependency, but won't run scripts if not present\n\t\t\t\t\t\t\t\tif ( jQuery._evalUrl ) {\n\t\t\t\t\t\t\t\t\tjQuery._evalUrl( node.src );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tjQuery.globalEval( ( node.text || node.textContent || node.innerHTML || \"\" ).replace( rcleanScript, \"\" ) );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Fix #11809: Avoid leaking memory\n\t\t\t\tfragment = first = null;\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t}\n});\n\njQuery.each({\n\tappendTo: \"append\",\n\tprependTo: \"prepend\",\n\tinsertBefore: \"before\",\n\tinsertAfter: \"after\",\n\treplaceAll: \"replaceWith\"\n}, function( name, original ) {\n\tjQuery.fn[ name ] = function( selector ) {\n\t\tvar elems,\n\t\t\ti = 0,\n\t\t\tret = [],\n\t\t\tinsert = jQuery( selector ),\n\t\t\tlast = insert.length - 1;\n\n\t\tfor ( ; i <= last; i++ ) {\n\t\t\telems = i === last ? this : this.clone(true);\n\t\t\tjQuery( insert[i] )[ original ]( elems );\n\n\t\t\t// Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()\n\t\t\tpush.apply( ret, elems.get() );\n\t\t}\n\n\t\treturn this.pushStack( ret );\n\t};\n});\n\n\nvar iframe,\n\telemdisplay = {};\n\n/**\n * Retrieve the actual display of a element\n * @param {String} name nodeName of the element\n * @param {Object} doc Document object\n */\n// Called only from within defaultDisplay\nfunction actualDisplay( name, doc ) {\n\tvar style,\n\t\telem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),\n\n\t\t// getDefaultComputedStyle might be reliably used only on attached element\n\t\tdisplay = window.getDefaultComputedStyle && ( style = window.getDefaultComputedStyle( elem[ 0 ] ) ) ?\n\n\t\t\t// Use of this method is a temporary fix (more like optmization) until something better comes along,\n\t\t\t// since it was removed from specification and supported only in FF\n\t\t\tstyle.display : jQuery.css( elem[ 0 ], \"display\" );\n\n\t// We don't have any data stored on the element,\n\t// so use \"detach\" method as fast way to get rid of the element\n\telem.detach();\n\n\treturn display;\n}\n\n/**\n * Try to determine the default display value of an element\n * @param {String} nodeName\n */\nfunction defaultDisplay( nodeName ) {\n\tvar doc = document,\n\t\tdisplay = elemdisplay[ nodeName ];\n\n\tif ( !display ) {\n\t\tdisplay = actualDisplay( nodeName, doc );\n\n\t\t// If the simple way fails, read from inside an iframe\n\t\tif ( display === \"none\" || !display ) {\n\n\t\t\t// Use the already-created iframe if possible\n\t\t\tiframe = (iframe || jQuery( \"',preload:!0,css:{},attr:{scrolling:\"auto\"}},video:{tpl:'',format:\"\",autoStart:!0},defaultType:\"image\",animationEffect:\"zoom\",animationDuration:366,zoomOpacity:\"auto\",transitionEffect:\"fade\",transitionDuration:366,slideClass:\"\",baseClass:\"\",baseTpl:'
 / 
{{buttons}}
{{arrows}}
',spinnerTpl:'
',errorTpl:'

{{ERROR}}

',btnTpl:{download:'',zoom:'',close:'',arrowLeft:'',arrowRight:'',smallBtn:''},parentEl:\"body\",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:\".fancybox-container\",axis:\"y\"},wheel:\"auto\",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return\"image\"===t.type&&\"zoom\"},clickSlide:\"close\",clickOutside:\"close\",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return\"image\"===t.type&&\"toggleControls\"},clickSlide:function(t,e){return\"image\"===t.type?\"toggleControls\":\"close\"},dblclickContent:function(t,e){return\"image\"===t.type&&\"zoom\"},dblclickSlide:function(t,e){return\"image\"===t.type&&\"zoom\"}},lang:\"en\",i18n:{en:{CLOSE:\"Close\",NEXT:\"Next\",PREV:\"Previous\",ERROR:\"The requested content cannot be loaded.
Please try again later.\",PLAY_START:\"Start slideshow\",PLAY_STOP:\"Pause slideshow\",FULL_SCREEN:\"Full screen\",THUMBS:\"Thumbnails\",DOWNLOAD:\"Download\",SHARE:\"Share\",ZOOM:\"Zoom\"},de:{CLOSE:\"Schließen\",NEXT:\"Weiter\",PREV:\"Zurück\",ERROR:\"Die angeforderten Daten konnten nicht geladen werden.
Bitte versuchen Sie es später nochmal.\",PLAY_START:\"Diaschau starten\",PLAY_STOP:\"Diaschau beenden\",FULL_SCREEN:\"Vollbild\",THUMBS:\"Vorschaubilder\",DOWNLOAD:\"Herunterladen\",SHARE:\"Teilen\",ZOOM:\"Vergrößern\"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement(\"fakeelement\"),o={transition:\"transitionend\",OTransition:\"oTransitionEnd\",MozTransition:\"transitionend\",WebkitTransition:\"webkitTransitionEnd\"};for(t in o)if(void 0!==n.style[t])return o[t];return\"transitionend\"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,i;return!(!t||t.ownerDocument!==e)&&(n(\".fancybox-container\").css(\"pointer-events\",\"none\"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},i=e.elementFromPoint(o.x,o.y)===t,n(\".fancybox-container\").css(\"pointer-events\",\"\"),i)},b=function(t,e,o){var i=this;i.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(i.opts=h(i.opts,e)),n.fancybox.isMobile&&(i.opts=h(i.opts,i.opts.mobile)),i.id=i.opts.id||++c,i.currIndex=parseInt(i.opts.index,10)||0,i.prevIndex=null,i.prevPos=null,i.currPos=0,i.firstRun=!0,i.group=[],i.slides={},i.addContent(t),i.group.length&&i.init()};n.extend(b.prototype,{init:function(){var o,i,a=this,s=a.group[a.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n(\"body\").addClass(\"fancybox-active\"),!n.fancybox.getInstance()&&!1!==r.hideScrollbar&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n(\"head\").append('\"),n(\"body\").addClass(\"compensate-for-scrollbar\")),i=\"\",n.each(r.buttons,function(t,e){i+=r.btnTpl[e]||\"\"}),o=n(a.translate(a,r.baseTpl.replace(\"{{buttons}}\",i).replace(\"{{arrows}}\",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr(\"id\",\"fancybox-container-\"+a.id).addClass(r.baseClass).data(\"FancyBox\",a).appendTo(r.parentEl),a.$refs={container:o},[\"bg\",\"inner\",\"infobar\",\"toolbar\",\"stage\",\"caption\",\"navigation\"].forEach(function(t){a.$refs[t]=o.find(\".fancybox-\"+t)}),a.trigger(\"onInit\"),a.activate(),a.jumpTo(a.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\\{\\{(\\w+)\\}\\}/g,function(t,e){return void 0===n[e]?t:n[e]})},addContent:function(t){var e,o=this,i=n.makeArray(t);n.each(i,function(t,e){var i,a,s,r,c,l={},d={};n.isPlainObject(e)?(l=e,d=e.opts||e):\"object\"===n.type(e)&&n(e).length?(i=n(e),d=i.data()||{},d=n.extend(!0,{},d,d.options),d.$orig=i,l.src=o.opts.src||d.src||i.attr(\"href\"),l.type||l.src||(l.type=\"inline\",l.src=e)):l={type:\"html\",src:e+\"\"},l.opts=n.extend(!0,{},o.opts,d),n.isArray(d.buttons)&&(l.opts.buttons=d.buttons),n.fancybox.isMobile&&l.opts.mobile&&(l.opts=h(l.opts,l.opts.mobile)),a=l.type||l.opts.type,r=l.src||\"\",!a&&r&&((s=r.match(/\\.(mp4|mov|ogv|webm)((\\?|#).*)?$/i))?(a=\"video\",l.opts.video.format||(l.opts.video.format=\"video/\"+(\"ogv\"===s[1]?\"ogg\":s[1]))):r.match(/(^data:image\\/[a-z0-9+\\/=]*,)|(\\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\\?|#).*)?$)/i)?a=\"image\":r.match(/\\.(pdf)((\\?|#).*)?$/i)?(a=\"iframe\",l=n.extend(!0,l,{contentType:\"pdf\",opts:{iframe:{preload:!1}}})):\"#\"===r.charAt(0)&&(a=\"inline\")),a?l.type=a:o.trigger(\"objectNeedsType\",l),l.contentType||(l.contentType=n.inArray(l.type,[\"html\",\"inline\",\"ajax\"])>-1?\"html\":l.type),l.index=o.group.length,\"auto\"==l.opts.smallBtn&&(l.opts.smallBtn=n.inArray(l.type,[\"html\",\"inline\",\"ajax\"])>-1),\"auto\"===l.opts.toolbar&&(l.opts.toolbar=!l.opts.smallBtn),l.$thumb=l.opts.$thumb||null,l.opts.$trigger&&l.index===o.opts.index&&(l.$thumb=l.opts.$trigger.find(\"img:first\"),l.$thumb.length&&(l.opts.$orig=l.opts.$trigger)),l.$thumb&&l.$thumb.length||!l.opts.$orig||(l.$thumb=l.opts.$orig.find(\"img:first\")),l.$thumb&&!l.$thumb.length&&(l.$thumb=null),l.thumb=l.opts.thumb||(l.$thumb?l.$thumb[0].src:null),\"function\"===n.type(l.opts.caption)&&(l.opts.caption=l.opts.caption.apply(e,[o,l])),\"function\"===n.type(o.opts.caption)&&(l.opts.caption=o.opts.caption.apply(e,[o,l])),l.opts.caption instanceof n||(l.opts.caption=void 0===l.opts.caption?\"\":l.opts.caption+\"\"),\"ajax\"===l.type&&(c=r.split(/\\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.filter=c.shift())),l.opts.modal&&(l.opts=n.extend(!0,l.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),o.group.push(l)}),Object.keys(o.slides).length&&(o.updateControls(),(e=o.Thumbs)&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on(\"click.fb-close\",\"[data-fancybox-close]\",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on(\"touchstart.fb-prev click.fb-prev\",\"[data-fancybox-prev]\",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on(\"touchstart.fb-next click.fb-next\",\"[data-fancybox-next]\",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on(\"click.fb\",\"[data-fancybox-zoom]\",function(t){e[e.isScaledDown()?\"scaleToActual\":\"scaleToFit\"]()}),s.on(\"orientationchange.fb resize.fb\",function(t){t&&t.originalEvent&&\"resize\"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&\"iframe\"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on(\"keydown.fb\",function(t){var o=n.fancybox?n.fancybox.getInstance():null,i=o.current,a=t.keyCode||t.which;if(9==a)return void(i.opts.trapFocus&&e.focus(t));if(!(!i.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is(\"input,textarea,video,audio,select\")))return 8===a||27===a?(t.preventDefault(),void e.close(t)):37===a||38===a?(t.preventDefault(),void e.previous()):39===a||40===a?(t.preventDefault(),void e.next()):void e.trigger(\"afterKeydown\",t,a)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on(\"mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle\",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){++e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off(\"orientationchange.fb resize.fb\"),r.off(\"keydown.fb .fb-idle\"),this.$refs.container.off(\".fb-close .fb-prev .fb-next\"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var o,i,a,s,r,c,l,d,u,f=this,h=f.group.length;if(!(f.isDragging||f.isClosing||f.isAnimating&&f.firstRun)){if(t=parseInt(t,10),!(a=f.current?f.current.opts.loop:f.opts.loop)&&(t<0||t>=h))return!1;if(o=f.firstRun=!Object.keys(f.slides).length,r=f.current,f.prevIndex=f.currIndex,f.prevPos=f.currPos,s=f.createSlide(t),h>1&&((a||s.index0)&&f.createSlide(t-1)),f.current=s,f.currIndex=s.index,f.currPos=s.pos,f.trigger(\"beforeShow\",o),f.updateControls(),s.forcedDuration=void 0,n.isNumeric(e)?s.forcedDuration=e:e=s.opts[o?\"animationDuration\":\"transitionDuration\"],e=parseInt(e,10),i=f.isMoved(s),s.$slide.addClass(\"fancybox-slide--current\"),o)return s.opts.animationEffect&&e&&f.$refs.container.css(\"transition-duration\",e+\"ms\"),f.$refs.container.addClass(\"fancybox-is-open\").trigger(\"focus\"),f.loadSlide(s),void f.preload(\"image\");c=n.fancybox.getTranslate(r.$slide),l=n.fancybox.getTranslate(f.$refs.stage),n.each(f.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),r.pos!==s.pos&&(r.isComplete=!1),r.$slide.removeClass(\"fancybox-slide--complete fancybox-slide--current\"),i?(u=c.left-(r.pos*c.width+r.pos*r.opts.gutter),n.each(f.slides,function(t,o){o.$slide.removeClass(\"fancybox-animated\").removeClass(function(t,e){return(e.match(/(^|\\s)fancybox-fx-\\S+/g)||[]).join(\" \")});var i=o.pos*c.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:i-l.left+u}),o.pos!==s.pos&&o.$slide.addClass(\"fancybox-slide--\"+(o.pos>s.pos?\"next\":\"previous\")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-s.pos)*c.width+(o.pos-s.pos)*o.opts.gutter},e,function(){o.$slide.css({transform:\"\",opacity:\"\"}).removeClass(\"fancybox-slide--next fancybox-slide--previous\"),o.pos===f.currPos&&f.complete()})})):e&&s.opts.transitionEffect&&(d=\"fancybox-animated fancybox-fx-\"+s.opts.transitionEffect,r.$slide.addClass(\"fancybox-slide--\"+(r.pos>s.pos?\"next\":\"previous\")),n.fancybox.animate(r.$slide,d,e,function(){r.$slide.removeClass(d).removeClass(\"fancybox-slide--next fancybox-slide--previous\")},!1)),s.isLoaded?f.revealContent(s):f.loadSlide(s),f.preload(\"image\")}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('
').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,o){var i,a,s,r,c,l=this,d=l.current,u=d.$content,f=n.fancybox.getTranslate(d.$slide).width,p=n.fancybox.getTranslate(d.$slide).height,h=d.width,g=d.height;l.isAnimating||l.isMoved()||!u||\"image\"!=d.type||!d.isLoaded||d.hasError||(l.isAnimating=!0,n.fancybox.stop(u),t=void 0===t?.5*f:t,e=void 0===e?.5*p:e,i=n.fancybox.getTranslate(u),i.top-=n.fancybox.getTranslate(d.$slide).top,i.left-=n.fancybox.getTranslate(d.$slide).left,r=h/i.width,c=g/i.height,a=.5*f-.5*h,s=.5*p-.5*g,h>f&&(a=i.left*r-(t*r-t),a>0&&(a=0),ap&&(s=i.top*c-(e*c-e),s>0&&(s=0),se-.5&&(l=e),d>o-.5&&(d=o),\"image\"===t.type?(u.top=Math.floor(.5*(o-d))+parseFloat(c.css(\"paddingTop\")),u.left=Math.floor(.5*(e-l))+parseFloat(c.css(\"paddingLeft\"))):\"video\"===t.contentType&&(a=t.opts.width&&t.opts.height?l/d:t.opts.ratio||16/9,d>l/a?d=l/a:l>d*a&&(l=d*a)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,i=t&&t.$content,a=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),i&&(a||s||\"video\"===t.contentType)&&!t.hasError&&(n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger(\"refresh\"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(\".fancybox-button--arrow_right\")).toggleClass(\"compensate-for-scrollbar\",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger(\"onUpdate\",t,e)},centerSlide:function(t){var e=this,o=e.current,i=o.$slide;!e.isClosing&&o&&(i.siblings().css({transform:\"\",opacity:\"\"}),i.parent().children().removeClass(\"fancybox-slide--previous fancybox-slide--next\"),n.fancybox.animate(i,{top:0,left:0,opacity:1},void 0===t?0:t,function(){i.css({transform:\"\",opacity:\"\"}),o.isComplete||e.complete()},!1))},isMoved:function(t){var e,o,i=t||this.current;return!!i&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(i.$slide),!i.$slide.hasClass(\"fancybox-animated\")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,i,a=this,s=a.current,r=a.$refs.container;s&&!a.isClosing&&a.Guestures&&(r.removeClass(\"fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan\"),o=a.canPan(t,e),i=!!o||a.isZoomable(),r.toggleClass(\"fancybox-is-zoomable\",i),n(\"[data-fancybox-zoom]\").prop(\"disabled\",!i),o?r.addClass(\"fancybox-can-pan\"):i&&(\"zoom\"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&\"zoom\"==s.opts.clickContent(s))?r.addClass(\"fancybox-can-zoomIn\"):s.opts.touch&&(s.opts.touch.vertical||a.group.length>1)&&\"video\"!==s.contentType&&r.addClass(\"fancybox-can-swipe\"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&\"image\"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if((t=e.getFitPos(n))&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var o=this,i=!1,a=o.current,s=a.$content;return void 0!==t&&void 0!==e?i=t1.5||Math.abs(a.height-s.height)>1.5)),s},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,!1===a.trigger(\"beforeLoad\",t))return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off(\"refresh\").trigger(\"onReset\").addClass(t.opts.slideClass),e){case\"image\":a.setImage(t);break;case\"iframe\":a.setIframe(t);break;case\"html\":a.setContent(t,t.src||t.content);break;case\"video\":a.setContent(t,t.opts.video.tpl.replace(/\\{\\{src\\}\\}/gi,t.src).replace(\"{{format}}\",t.opts.videoFormat||t.opts.video.format||\"\").replace(\"{{poster}}\",t.thumb||\"\"));break;case\"inline\":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case\"ajax\":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){\"success\"===n&&a.setContent(t,e)},error:function(e,n){e&&\"abort\"!==n&&a.setError(t)}})),o.one(\"onReset\",function(){i.abort()});break;default:a.setError(t)}return!0}},setImage:function(t){var o,i=this;setTimeout(function(){var e=t.$image;i.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||i.showLoading(t)},50),i.checkSrcset(t),t.$content=n('
').addClass(\"fancybox-is-hidden\").appendTo(t.$slide.addClass(\"fancybox-slide--image\")),!1!==t.opts.preload&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement(\"img\"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){i.afterLoad(t)},t.$ghost=n(o).addClass(\"fancybox-image\").appendTo(t.$content).attr(\"src\",t.thumb)),i.setBigImage(t)},checkSrcset:function(e){var n,o,i,a,s=e.opts.srcset||e.opts.image.srcset;if(s){i=t.devicePixelRatio||1,a=t.innerWidth*i,o=s.split(\",\").map(function(t){var e={};return t.trim().split(/\\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);if(0===n)return e.url=t;o&&(e.value=o,e.postfix=t[t.length-1])}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r=a||\"x\"===c.postfix&&c.value>=i){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&\"w\"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,i=e.createElement(\"img\"),a=n(i);t.$image=a.one(\"error\",function(){o.setError(t)}).one(\"load\",function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&(e=t.opts.sizes,e&&\"auto\"!==e||(e=(t.width/t.height>1&&s.width()/s.height()>1?\"100\":Math.round(t.width/t.height*100))+\"vw\"),a.attr(\"sizes\",e).attr(\"srcset\",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass(\"fancybox-image\").attr(\"src\",t.src).appendTo(t.$content),(i.complete||\"complete\"==i.readyState)&&a.naturalWidth&&a.naturalHeight?a.trigger(\"load\"):i.error&&a.trigger(\"error\")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),i=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),i>0&&(t.width=Math.floor(i*e/n),t.height=i)},setIframe:function(t){var e,o=this,i=t.opts.iframe,a=t.$slide;t.$content=n('
').css(i.css).appendTo(a),a.addClass(\"fancybox-slide--\"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\\{rnd\\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(o.showLoading(t),e.on(\"load.fb error.fb\",function(e){this.isReady=1,t.$slide.trigger(\"refresh\"),o.afterLoad(t)}),a.on(\"refresh.fb\",function(){var n,o,s=t.$content,r=i.css.width,c=i.css.height;if(1===e[0].isReady){try{n=e.contents(),o=n.find(\"body\")}catch(t){}o&&o.length&&o.children().length&&(a.css(\"overflow\",\"visible\"),s.css({width:\"100%\",\"max-width\":\"100%\",height:\"9999px\"}),void 0===r&&(r=Math.ceil(Math.max(o[0].clientWidth,o.outerWidth(!0)))),s.css(\"width\",r||\"\").css(\"max-width\",\"\"),void 0===c&&(c=Math.ceil(Math.max(o[0].clientHeight,o.outerHeight(!0)))),s.css(\"height\",c||\"\"),a.css(\"overflow\",\"auto\")),s.removeClass(\"fancybox-is-hidden\")}})):o.afterLoad(t),e.attr(\"src\",t.src),a.one(\"onReset\",function(){try{n(this).find(\"iframe\").hide().unbind().attr(\"src\",\"//about:blank\")}catch(t){}n(this).off(\"refresh.fb\").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass(\"fancybox-content\")||e.parent().hasClass(\"fancybox-content\"))&&e.parents(\".fancybox-slide\").trigger(\"onReset\"),t.$placeholder=n(\"
\").hide().insertAfter(e),e.css(\"display\",\"inline-block\")):t.hasError||(\"string\"===n.type(e)&&(e=n(\"
\").append(n.trim(e)).contents()),t.opts.filter&&(e=n(\"
\").html(e).find(t.opts.filter))),t.$slide.one(\"onReset\",function(){n(this).find(\"video,audio\").trigger(\"pause\"),t.$placeholder&&(t.$placeholder.after(e.removeClass(\"fancybox-content\").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is(\"video,audio\")&&(n(e).addClass(\"fancybox-video\"),n(e).wrap(\"
\"),t.contentType=\"video\",t.opts.width=t.opts.width||n(e).attr(\"width\"),t.opts.height=t.opts.height||n(e).attr(\"height\")),t.$content=t.$slide.children().filter(\"div,form,main,video,audio,article,.fancybox-content\").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner(\"
\").children().first()),t.$content.addClass(\"fancybox-content\"),t.$slide.addClass(\"fancybox-slide--\"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger(\"onReset\").removeClass(\"fancybox-slide--\"+t.contentType).addClass(\"fancybox-slide--error\"),t.contentType=\"html\",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn(\"fast\"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger(\"afterLoad\",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on(\"contextmenu.fb\",function(t){return 2==t.button&&t.preventDefault(),!0}),\"image\"===t.type&&n('
').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass(\"fancybox-caption--separate\",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css(\"padding-bottom\",r||\"\"))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css(\"margin-bottom\",\"\"),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style[\"padding-bottom\"],i=s.$slide.css(\"padding-bottom\"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css(\"padding-bottom\",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css(\"padding-bottom\",o))),s.$content.css(\"margin-bottom\",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?\"animationEffect\":\"transitionEffect\"],i=t.opts[s.firstRun?\"animationDuration\":\"transitionDuration\"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),\"zoom\"===e&&(t.pos===s.currPos&&i&&\"image\"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e=\"fade\"),\"zoom\"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,\"auto\"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass(\"fancybox-is-hidden\"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o=\"fancybox-slide--\"+(t.pos>=s.prevPos?\"next\":\"previous\")+\" fancybox-animated fancybox-fx-\"+e,r.addClass(o).removeClass(\"fancybox-slide--current\"),t.$content.removeClass(\"fancybox-is-hidden\"),p(r),\"image\"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,\"fancybox-slide--current\",i,function(){r.removeClass(o).css({transform:\"\",opacity:\"\"}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass(\"fancybox-is-hidden\"),u||!d||\"image\"!==t.type||t.hasError||t.$content.hide().fadeIn(\"fast\"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css(\"border-top-width\")||0),i=parseFloat(c.css(\"border-right-width\")||0),a=parseFloat(c.css(\"border-bottom-width\")||0),s=parseFloat(c.css(\"border-left-width\")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger(\"onReset\"),e.preload(\"inline\"),p(o.$slide),o.$slide.addClass(\"fancybox-slide--complete\"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger(\"afterShow\"),o.opts.video.autoStart&&o.$slide.find(\"video,audio\").filter(\":visible:first\").trigger(\"play\").one(\"ended\",function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&\"html\"===o.contentType&&(t=o.$content.find(\"input[autofocus]:enabled:visible:first\"),t.length?t.trigger(\"focus\"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=[\"a[href]\",\"area[href]\",'input:not([disabled]):not([type=\"hidden\"]):not([aria-hidden])',\"select:not([disabled]):not([aria-hidden])\",\"textarea:not([disabled]):not([aria-hidden])\",\"button:not([disabled]):not([aria-hidden])\",\"iframe\",\"object\",\"embed\",\"video\",\"audio\",\"[contenteditable]\",'[tabindex]:not([tabindex^=\"-\"])'].join(\",\");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find(\"*:visible\"+(o?\":not(.fancybox-close-small)\":\"\")):s.$refs.container.find(\"*:visible\"),i=i.filter(r).filter(function(){return\"hidden\"!==n(this).css(\"visibility\")&&!n(this).hasClass(\"disabled\")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger(\"focus\")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger(\"focus\"))):s.$refs.container.trigger(\"focus\"))},activate:function(){var t=this;n(\".fancybox-container\").each(function(){var e=n(this).data(\"FancyBox\");e&&e.id!==t.id&&!e.isClosing&&(e.trigger(\"onDeactivate\"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger(\"onActivate\"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger(\"beforeClose\",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass(\"fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated\"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger(\"onReset\").remove(),i&&u.$refs.container.removeClass(\"fancybox-is-open\").addClass(\"fancybox-is-closing\").css(\"transition-duration\",i+\"ms\"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),\"zoom\"!==o||a&&i&&\"image\"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o=\"fade\"),\"zoom\"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,\n\"auto\"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass(\"fancybox-slide--previous\").removeClass(\"fancybox-slide--current\"),\"fancybox-animated fancybox-fx-\"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger(\"onReset\"),s.$refs.container.empty().remove(),s.trigger(\"afterClose\",e),s.current.opts.backFocus&&(r&&r.length&&r.is(\":visible\")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger(\"focus\"),n(\"html, body\").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n(\"body\").removeClass(\"fancybox-active compensate-for-scrollbar\"),n(\"#fancybox-style-noscroll\").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;\"afterClose\"!==t&&a.$refs?a.$refs.container.trigger(t+\".fb\",i):r.trigger(t+\".fb\",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger(\"refresh\"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find(\"[data-fancybox-count]\").html(t.group.length),a.find(\"[data-fancybox-index]\").html(i+1),a.find(\"[data-fancybox-prev]\").prop(\"disabled\",!o.opts.loop&&i<=0),a.find(\"[data-fancybox-next]\").prop(\"disabled\",!o.opts.loop&&i>=t.group.length-1),\"image\"===o.type?a.find(\"[data-fancybox-zoom]\").show().end().find(\"[data-fancybox-download]\").attr(\"href\",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find(\"[data-fancybox-download],[data-fancybox-zoom]\").hide(),n(e.activeElement).is(\":hidden,[disabled]\")&&t.$refs.container.trigger(\"focus\")},hideControls:function(t){var e=this,n=[\"infobar\",\"toolbar\",\"nav\"];!t&&e.current.opts.preventCaptionOverlap||n.push(\"caption\"),this.$refs.container.removeClass(n.map(function(t){return\"fancybox-show-\"+t}).join(\" \")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass(\"fancybox-show-toolbar\",!(!e.toolbar||!e.buttons)).toggleClass(\"fancybox-show-infobar\",!!(e.infobar&&t.group.length>1)).toggleClass(\"fancybox-show-caption\",!!t.$caption).toggleClass(\"fancybox-show-nav\",!!(e.arrows&&t.group.length>1)).toggleClass(\"fancybox-is-modal\",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:\"3.5.7\",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(\".fancybox-is-closing\"):last').data(\"FancyBox\"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&(\"string\"===n.type(t)?e[t].apply(e,o):\"function\"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add(\"body\").off(\"click.fb-start\",\"**\")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement(\"div\");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue(\"transform\")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css(\"opacity\"))})},setTranslate:function(t,e){var n=\"\",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+\"px, \"+(void 0===e.top?t.position().top:e.top)+\"px\",n=this.use3d?\"translate3d(\"+n+\", 0px)\":\"translate(\"+n+\")\"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=\" scale(\"+e.scaleX+\", \"+e.scaleY+\")\":void 0!==e.scaleX&&(n+=\" scaleX(\"+e.scaleX+\")\"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&\"z-index\"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css(\"transition-duration\",\"\"),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css(\"transition-duration\",o+\"ms\"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass(\"fancybox-slide--image\")&&t.parent().addClass(\"fancybox-is-scaling\")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data(\"timer\",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data(\"timer\")),e&&t.trigger(f),t.off(f).css(\"transition-duration\",\"\"),t.parent().removeClass(\"fancybox-is-scaling\"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n(\"body\").off(\"click.fb-start\",e).on(\"click.fb-start\",e,{options:t},i):this.off(\"click.fb-start\").on(\"click.fb-start\",{items:this,options:t},i),this},r.on(\"click.fb-start\",\"[data-fancybox]\",i),r.on(\"click.fb-start\",\"[data-fancybox-trigger]\",function(t){n('[data-fancybox=\"'+n(this).attr(\"data-fancybox-trigger\")+'\"]').eq(n(this).attr(\"data-fancybox-index\")||0).trigger(\"click.fb-start\",{$trigger:n(this)})}),function(){var t=null;r.on(\"mousedown mouseup focus blur\",\".fancybox-button\",function(e){switch(e.type){case\"mousedown\":t=n(this);break;case\"mouseup\":t=null;break;case\"focusin\":n(\".fancybox-button\").removeClass(\"fancybox-focus\"),n(this).is(t)||n(this).is(\"[disabled]\")||n(this).addClass(\"fancybox-focus\");break;case\"focusout\":n(\".fancybox-button\").removeClass(\"fancybox-focus\")}})}()}}(window,document,jQuery),function(t){\"use strict\";var e={youtube:{matcher:/(youtube\\.com|youtu\\.be|youtube\\-nocookie\\.com)\\/(watch\\?(.*&)?v=|v\\/|u\\/|embed\\/?)?(videoseries\\?list=(.*)|[\\w-]{11}|\\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:\"transparent\",enablejsapi:1,html5:1},paramPlace:8,type:\"iframe\",url:\"https://www.youtube-nocookie.com/embed/$4\",thumb:\"https://img.youtube.com/vi/$4/hqdefault.jpg\"},vimeo:{matcher:/^.+vimeo.com\\/(.*\\/)?([\\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:\"iframe\",url:\"//player.vimeo.com/video/$2\"},instagram:{matcher:/(instagr\\.am|instagram\\.com)\\/p\\/([a-zA-Z0-9_\\-]+)\\/?/i,type:\"image\",url:\"//$1/p/$2/media/?size=l\"},gmap_place:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(((maps\\/(place\\/(.*)\\/)?\\@(.*),(\\d+.?\\d+?)z))|(\\?ll=))(.*)?/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/?ll=\"+(t[9]?t[9]+\"&z=\"+Math.floor(t[10])+(t[12]?t[12].replace(/^\\//,\"&\"):\"\"):t[12]+\"\").replace(/\\?/,\"&\")+\"&output=\"+(t[12]&&t[12].indexOf(\"layer=c\")>0?\"svembed\":\"embed\")}},gmap_search:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(maps\\/search\\/)(.*)/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/maps?q=\"+t[5].replace(\"query=\",\"q=\").replace(\"api=1\",\"\")+\"&output=embed\"}}},n=function(e,n,o){if(e)return o=o||\"\",\"object\"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace(\"$\"+t,n||\"\")}),o.length&&(e+=(e.indexOf(\"?\")>0?\"&\":\"?\")+o),e};t(document).on(\"objectNeedsType.fb\",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||\"\",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],\"?\"==d[0]&&(d=d.substring(1)),d=d.split(\"&\");for(var i=0;i1&&(\"youtube\"===n.contentSource||\"vimeo\"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){\"use strict\";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?\"x\"===n?t.x-e.x:\"y\"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role=\"button\"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data(\"selectable\"))return!0;for(var e=0,o=t[0].attributes,i=o.length;ee.clientHeight,a=(\"scroll\"===o||\"auto\"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass(\"fancybox-stage\")||t.is(\"body\"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on(\"touchstart.fb.touch mousedown.fb.touch\",n.proxy(e,\"ontouchstart\"))};d.prototype.destroy=function(){var t=this;t.$container.off(\".fb.touch\"),n(e).off(\".fb.touch\"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h=\"touchstart\"==o.type;if(h&&i.$container.off(\"mousedown.fb.touch\"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is(\"img\")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass(\"fancybox-animated\"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(\".fb.touch\").on(h?\"touchend.fb.touch touchcancel.fb.touch\":\"mouseup.fb.touch mouseleave.fb.touch\",n.proxy(i,\"ontouchend\")).on(h?\"touchmove.fb.touch\":\"mousemove.fb.touch\",n.proxy(i,\"ontouchmove\")),n.fancybox.isMobile&&e.addEventListener(\"scroll\",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(\".fancybox-image\")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(\".fancybox-caption\").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass(\"fancybox-is-grabbing\")),2===i.startPoints.length&&\"image\"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener(\"scroll\",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],\"x\"),e.distanceY=s(e.newPoints[0],e.startPoints[0],\"y\"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)\"x\"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:\"x\"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass(\"fancybox-is-sliding\"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping=\"y\":r.isDragging||!1===s.opts.vertical||\"auto\"===s.opts.vertical&&n(t).width()>800?s.isSwiping=\"x\":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?\"y\":\"x\"),\"y\"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:\"\",opacity:\"\",\"transition-duration\":\"\"}).removeClass(\"fancybox-animated\").removeClass(function(t,e){return(e.match(/(^|\\s)fancybox-fx-\\S+/g)||[]).join(\" \")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&aa?(t=t>0?0:t,t=ts?(e=e>0?0:e,e=e1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,\"y\"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||\"x\"!=t&&\"y\"!=t||o.instance.centerSlide(200),o.$container.removeClass(\"fancybox-is-sliding\")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),rs.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case\"close\":r.close(i.startEvent);break;case\"toggleControls\":r.toggleControls();break;case\"next\":r.next();break;case\"nextOrClose\":r.group.length>1?r.next():r.close(i.startEvent);break;case\"zoom\":\"image\"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is(\"img\")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(\".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container\"))o=\"Outside\";else if(s.is(\".fancybox-slide\"))o=\"Slide\";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o=\"Content\"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f(\"dblclick\"+o)}else i.tapX=d,i.tapY=u,c.opts[\"dblclick\"+o]&&c.opts[\"dblclick\"+o]!==c.opts[\"click\"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f(\"click\"+o)},500):f(\"click\"+o);return this}},n(e).on(\"onActivate.fb\",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on(\"beforeClose.fb\",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){\"use strict\";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:''},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find(\"[data-fancybox-play]\").on(\"click\",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('
').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&\"image\"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger(\"onFullscreenChange\",t),n.$refs.container.toggleClass(\"fancybox-is-fullscreen\",t),n.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").toggleClass(\"fancybox-button--fsenter\",!t).toggleClass(\"fancybox-button--fsexit\",t))})}e(t).on({\"onInit.fb\":function(t,e){var i;if(!n)return void e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on(\"click.fb-fullscreen\",\"[data-fancybox-fullscreen]\",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").hide()},\"afterKeydown.fb\":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},\"beforeClose.fb\":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass(\"fancybox-is-fullscreen\")&&o.exit()}})}(document,jQuery),function(t,e){\"use strict\";var n=\"fancybox-thumbs\";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:''},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:\".fancybox-container\",axis:\"y\"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find(\"[data-fancybox-thumbs]\");for(var i=0,a=n.length;i1));i++);o>1&&e.opts?(e.$button.removeAttr(\"style\").on(\"click\",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('
').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on(\"click\",\"a\",function(){i.jumpTo(e(this).attr(\"data-index\"))})),o.$list||(o.$list=e('
').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||\"image\"!==n.type||(t=n.src),s.push('\")}),o.$list[0].innerHTML=s.join(\"\"),\"x\"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css(\"padding-right\"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass(\"fancybox-thumbs-active\").filter('[data-index=\"'+o.instance.current.index+'\"]').addClass(\"fancybox-thumbs-active\"),n=e.position(),\"y\"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):\"x\"===o.opts.axis&&(n.lefta.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass(\"fancybox-show-thumbs\",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger(\"onThumbsShow\"),t.focus(0)):t.$grid&&t.instance.trigger(\"onThumbsHide\"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({\"onInit.fb\":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},\"beforeShow.fb\":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},\"afterKeydown.fb\":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},\"beforeClose.fb\":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){\"use strict\";function n(t){var e={\"&\":\"&\",\"<\":\"<\",\">\":\">\",'\"':\""\",\"'\":\"'\",\"/\":\"/\",\"`\":\"`\",\"=\":\"=\"};return String(t).replace(/[&<>\"'`=\\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:''},share:{url:function(t,e){return!t.currentHash&&\"inline\"!==e.type&&\"html\"!==e.type&&(e.origSrc||e.src)||window.location},\ntpl:''}}),e(t).on(\"click\",\"[data-fancybox-share]\",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&(\"function\"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\\{\\{media\\}\\}/g,\"image\"===a.type?encodeURIComponent(a.src):\"\").replace(/\\{\\{url\\}\\}/g,encodeURIComponent(t)).replace(/\\{\\{url_raw\\}\\}/g,n(t)).replace(/\\{\\{descr\\}\\}/g,i.$caption?encodeURIComponent(i.$caption.text()):\"\"),e.fancybox.open({src:i.translate(i,o),type:\"html\",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one(\"beforeClose.fb\",function(){t.close(null,0)}),e.$content.find(\".fancybox-share__button\").click(function(){return window.open(this.href,\"Share\",\"width=550, height=450\"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){\"use strict\";function o(){var e=t.location.hash.substr(1),n=e.split(\"-\"),o=n.length>1&&/^\\+?\\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join(\"-\");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){\"\"!==t.gallery&&n(\"[data-fancybox='\"+n.escapeSelector(t.gallery)+\"']\").eq(t.index-1).focus().trigger(\"click.fb-start\")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,\"\"!==(n=e.hash||(e.$orig?e.$orig.data(\"fancybox\")||e.$orig.data(\"fancybox-trigger\"):\"\"))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+\"\").replace(/([\\0-\\x1f\\x7f]|^-?\\d)|^-$|[^\\x80-\\uFFFF\\w-]/g,function(t,e){return e?\"\\0\"===t?\"�\":t.slice(0,-1)+\"\\\\\"+t.charCodeAt(t.length-1).toString(16)+\" \":\"\\\\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({\"onInit.fb\":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},\"beforeShow.fb\":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?\"-\"+(i.index+1):\"\"),t.location.hash!==\"#\"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){\"replaceState\"in t.history?(t.history[s?\"pushState\":\"replaceState\"]({},e.title,t.location.pathname+t.location.search+\"#\"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},\"beforeClose.fb\":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&(\"replaceState\"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||\"\")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on(\"hashchange.fb\",function(){var t=o(),e=null;n.each(n(\".fancybox-container\").get().reverse(),function(t,o){var i=n(o).data(\"FancyBox\");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+\"-\"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):\"\"!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){\"use strict\";var n=(new Date).getTime();e(t).on({\"onInit.fb\":function(t,e,o){e.$refs.stage.on(\"mousewheel DOMMouseScroll wheel MozMousePixelScroll\",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||\"auto\"===o.opts.wheel&&\"image\"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass(\"fancybox-animated\")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?\"next\":\"previous\"]())))})}})}(document,jQuery);","/*!\n * Viewer.js v0.7.2\n * https://github.com/fengyuanchen/viewerjs\n *\n * Copyright (c) 2017 Fengyuan Chen\n * Released under the MIT license\n *\n * Date: 2017-08-19T06:58:08.154Z\n */\n\n!function(e,t){\"object\"==typeof exports&&\"undefined\"!=typeof module?module.exports=t():\"function\"==typeof define&&define.amd?define(t):e.Viewer=t()}(this,function(){\"use strict\";function e(e){return G.call(e).slice(8,-1).toLowerCase()}function t(e){return\"string\"==typeof e}function i(e){return\"number\"==typeof e&&!isNaN(e)}function n(e){return void 0===e}function r(e){return\"object\"===(void 0===e?\"undefined\":B(e))&&null!==e}function a(e){if(!r(e))return!1;try{var t=e.constructor,i=t.prototype;return t&&i&&J.call(i,\"isPrototypeOf\")}catch(e){return!1}}function o(t){return\"function\"===e(t)}function l(t){return Array.isArray?Array.isArray(t):\"array\"===e(t)}function s(e,t){return t=t>=0?t:0,Array.from?Array.from(e).slice(t):Q.call(e,t)}function c(e,t){var i=-1;return t.indexOf?t.indexOf(e):(t.forEach(function(t,n){t===e&&(i=n)}),i)}function u(e){return t(e)&&(e=e.trim?e.trim():e.replace(U,\"1\")),e}function d(e,t){if(e&&o(t)){var n=void 0;if(l(e)||i(e.length)){var a=e.length;for(n=0;n1?t-1:0),n=1;n0){if(Object.assign)return Object.assign.apply(Object,[e].concat(i));i.forEach(function(t){r(t)&&Object.keys(t).forEach(function(i){e[i]=t[i]})})}return e}function f(e,t){for(var i=arguments.length,n=Array(i>2?i-2:0),r=2;r-1}function p(e,t){if(t)if(i(e.length))d(e,function(e){p(e,t)});else if(e.classList)e.classList.add(t);else{var n=u(e.className);n?n.indexOf(t)<0&&(e.className=n+\" \"+t):e.className=t}}function g(e,t){t&&(i(e.length)?d(e,function(e){g(e,t)}):e.classList?e.classList.remove(t):e.className.indexOf(t)>=0&&(e.className=e.className.replace(t,\"\")))}function b(e,t,n){t&&(i(e.length)?d(e,function(e){b(e,t,n)}):n?p(e,t):g(e,t))}function y(e){return e.replace(K,\"$1-$2\").toLowerCase()}function x(e,t){return r(e[t])?e[t]:e.dataset?e.dataset[t]:e.getAttribute(\"data-\"+y(t))}function k(e,t,i){r(i)?e[t]=i:e.dataset?e.dataset[t]=i:e.setAttribute(\"data-\"+y(t),i)}function z(e,t){if(r(e[t]))delete e[t];else if(e.dataset)try{delete e.dataset[t]}catch(i){e.dataset[t]=null}else e.removeAttribute(\"data-\"+y(t))}function D(e,t,i){var n=u(t).split(Z);n.length>1?d(n,function(t){D(e,t,i)}):e.removeEventListener?e.removeEventListener(t,i,!1):e.detachEvent&&e.detachEvent(\"on\"+t,i)}function E(e,t,i,n){var r=u(t).split(Z),a=i;r.length>1?d(r,function(t){E(e,t,i)}):(n&&(i=function(){for(var n=arguments.length,r=Array(n),o=0;o\"'+l+'\"'))}),r.innerHTML=a.join(\"\"),d(C(r,\"img\"),function(t){k(t,\"filled\",!0),E(t,\"load\",f(e.loadImage,e),!0)}),e.items=C(r,\"li\"),i.transition&&E(n,\"viewed\",function(){p(r,\"viewer-transition\")},!0)},renderList:function(e){var t=this,i=e||t.index,n=t.items[i].offsetWidth||30,r=n+1;m(t.list,{width:r*t.length,marginLeft:(t.viewerData.width-n)/2-r*i})},resetList:function(){var e=this;M(e.list),g(e.list,\"viewer-transition\"),m({marginLeft:0})},initImage:function(e){var t=this,i=t.options,n=t.image,r=t.viewerData,a=t.footer.offsetHeight,l=r.width,s=Math.max(r.height-a,a),c=t.imageData||{};O(n,function(n,r){var a=n/r,u=l,d=s;s*a>l?d=l/a:u=s*a;var f={naturalWidth:n,naturalHeight:r,aspectRatio:a,ratio:(u=Math.min(.9*u,n))/n,width:u,height:d=Math.min(.9*d,r),left:(l-u)/2,top:(s-d)/2},m=v({},f);i.rotatable&&(f.rotate=c.rotate||0,m.rotate=0),i.scalable&&(f.scaleX=c.scaleX||1,f.scaleY=c.scaleY||1,m.scaleX=1,m.scaleY=1),t.imageData=f,t.initialImageData=m,o(e)&&e()})},renderImage:function(e){var t=this,i=t.image,n=t.imageData,r=R(n);m(i,{width:n.width,height:n.height,marginLeft:n.left,marginTop:n.top,WebkitTransform:r,msTransform:r,transform:r}),o(e)&&(t.transitioning?E(i,\"transitionend\",e,!0):e())},resetImage:function(){var e=this;e.image&&(X(e.image),e.image=null)}},te=\"undefined\"!=typeof window?window.PointerEvent:null,ie=te?\"pointerdown\":\"touchstart mousedown\",ne=te?\"pointermove\":\"mousemove touchmove\",re=te?\"pointerup pointercancel\":\"touchend touchcancel mouseup\",ae={bind:function(){var e=this,t=e.options,i=e.element,n=e.viewer;o(t.view)&&E(i,\"view\",t.view),o(t.viewed)&&E(i,\"viewed\",t.viewed),E(n,\"click\",e.onClick=f(e.click,e)),E(n,\"wheel mousewheel DOMMouseScroll\",e.onWheel=f(e.wheel,e)),E(n,\"dragstart\",e.onDragstart=f(e.dragstart,e)),E(e.canvas,ie,e.onPointerdown=f(e.pointerdown,e)),E(document,ne,e.onPointermove=f(e.pointermove,e)),E(document,re,e.onPointerup=f(e.pointerup,e)),E(document,\"keydown\",e.onKeydown=f(e.keydown,e)),E(window,\"resize\",e.onResize=f(e.resize,e))},unbind:function(){var e=this,t=e.options,i=e.element,n=e.viewer;o(t.view)&&D(i,\"view\",t.view),o(t.viewed)&&D(i,\"viewed\",t.viewed),D(n,\"click\",e.onClick),D(n,\"wheel mousewheel DOMMouseScroll\",e.onWheel),D(n,\"dragstart\",e.onDragstart),D(e.canvas,ie,e.onPointerdown),D(document,ne,e.onPointermove),D(document,re,e.onPointerup),D(document,\"keydown\",e.onKeydown),D(window,\"resize\",e.onResize)}},oe={start:function(e){var t=this,i=T(e).target;\"img\"===i.tagName.toLowerCase()&&(t.target=i,t.show())},click:function(e){var t=this,i=T(e).target,n=x(i,\"action\"),r=t.imageData;switch(n){case\"mix\":t.played?t.stop():t.options.inline?t.fulled?t.exit():t.full():t.hide();break;case\"view\":t.view(x(i,\"index\"));break;case\"zoom-in\":t.zoom(.1,!0);break;case\"zoom-out\":t.zoom(-.1,!0);break;case\"one-to-one\":t.toggle();break;case\"reset\":t.reset();break;case\"prev\":t.prev();break;case\"play\":t.play();break;case\"next\":t.next();break;case\"rotate-left\":t.rotate(-90);break;case\"rotate-right\":t.rotate(90);break;case\"flip-horizontal\":t.scaleX(-r.scaleX||-1);break;case\"flip-vertical\":t.scaleY(-r.scaleY||-1);break;default:t.played&&t.stop()}},load:function(){var e=this,t=e.options,i=e.image,n=e.index,r=e.viewerData;e.timeout&&(clearTimeout(e.timeout),e.timeout=!1),g(i,\"viewer-invisible\"),i.style.cssText=\"width:0;height:0;margin-left:\"+r.width/2+\"px;margin-top:\"+r.height/2+\"px;max-width:none!important;visibility:visible;\",e.initImage(function(){b(i,\"viewer-transition\",t.transition),b(i,\"viewer-move\",t.movable),e.renderImage(function(){e.viewed=!0,I(e.element,\"viewed\",{originalImage:e.images[n],index:n,image:i})})})},loadImage:function(e){var t=T(e).target,i=t.parentNode,n=i.offsetWidth||30,r=i.offsetHeight||50,a=!!x(t,\"filled\");O(t,function(e,i){var o=e/i,l=n,s=r;r*o>n?a?l=r*o:s=n/o:a?s=n/o:l=r*o,m(t,{width:l,height:s,marginLeft:(n-l)/2,marginTop:(r-s)/2})})},resize:function(){var e=this;e.initContainer(),e.initViewer(),e.renderViewer(),e.renderList(),e.viewed&&e.initImage(function(){e.renderImage()}),e.played&&d(C(e.player,\"img\"),function(t){E(t,\"load\",f(e.loadImage,e),!0),I(t,\"load\")})},wheel:function(e){var t=this,i=T(e);if(t.viewed&&(i.preventDefault(),!t.wheeling)){t.wheeling=!0,setTimeout(function(){t.wheeling=!1},50);var n=Number(t.options.zoomRatio)||.1,r=1;i.deltaY?r=i.deltaY>0?1:-1:i.wheelDelta?r=-i.wheelDelta/120:i.detail&&(r=i.detail>0?1:-1),t.zoom(-r*n,!0,i)}},keydown:function(e){var t=this,i=T(e),n=t.options,r=i.keyCode||i.which||i.charCode;if(t.fulled&&n.keyboard)switch(r){case 27:t.played?t.stop():n.inline?t.fulled&&t.exit():t.hide();break;case 32:t.played&&t.stop();break;case 37:t.prev();break;case 38:i.preventDefault(),t.zoom(n.zoomRatio,!0);break;case 39:t.next();break;case 40:i.preventDefault(),t.zoom(-n.zoomRatio,!0);break;case 48:case 49:(i.ctrlKey||i.shiftKey)&&(i.preventDefault(),t.toggle())}},dragstart:function(e){\"img\"===e.target.tagName.toLowerCase()&&e.preventDefault()},pointerdown:function(e){var t=this,i=t.options,n=t.pointers,r=T(e);if(t.viewed&&!t.transitioning){r.changedTouches?d(r.changedTouches,function(e){n[e.identifier]=q(e)}):n[r.pointerId||0]=q(r);var a=!!i.movable&&\"move\";Object.keys(n).length>1?a=\"zoom\":\"touch\"!==r.pointerType&&\"touchmove\"!==r.type||!t.isSwitchable()||(a=\"switch\"),t.action=a}},pointermove:function(e){var t=this,i=t.options,n=t.pointers,r=T(e),a=t.action,o=t.image;t.viewed&&a&&(r.preventDefault(),r.changedTouches?d(r.changedTouches,function(e){v(n[e.identifier],q(e,!0))}):v(n[r.pointerId||0],q(r,!0)),\"move\"===a&&i.transition&&w(o,\"viewer-transition\")&&g(o,\"viewer-transition\"),t.change(r))},pointerup:function(e){var t=this,i=t.pointers,n=T(e),r=t.action;t.viewed&&(n.changedTouches?d(n.changedTouches,function(e){delete i[e.identifier]}):delete i[n.pointerId||0],r&&(\"move\"===r&&t.options.transition&&p(t.image,\"viewer-transition\"),t.action=!1))}},le={show:function(){var e=this,t=e.options,i=e.element;if(t.inline||e.transitioning)return e;if(e.ready||e.build(),o(t.show)&&E(i,\"show\",t.show,!0),!1===I(i,\"show\"))return e;e.open();var n=e.viewer;return g(n,\"viewer-hide\"),E(i,\"shown\",function(){e.view(e.target?c(e.target,s(e.images)):e.index),e.target=!1},!0),t.transition?(e.transitioning=!0,p(n,\"viewer-transition\"),A(n),E(n,\"transitionend\",f(e.shown,e),!0),p(n,\"viewer-in\")):(p(n,\"viewer-in\"),e.shown()),e},hide:function(){var e=this,t=e.options,i=e.element,n=e.viewer;return t.inline||e.transitioning||!e.visible?e:(o(t.hide)&&E(i,\"hide\",t.hide,!0),!1===I(i,\"hide\")?e:(e.viewed&&t.transition?(e.transitioning=!0,E(e.image,\"transitionend\",function(){E(n,\"transitionend\",f(e.hidden,e),!0),g(n,\"viewer-in\")},!0),e.zoomTo(0,!1,!1,!0)):(g(n,\"viewer-in\"),e.hidden()),e))},view:function(e){var t=this,i=t.element,n=t.title,r=t.canvas;if(e=Number(e)||0,!t.ready||!t.visible||t.played||e<0||e>=t.length||t.viewed&&e===t.index)return t;var a=t.items[e],o=C(a,\"img\")[0],l=x(o,\"originalUrl\"),s=o.getAttribute(\"alt\"),c=document.createElement(\"img\");return c.src=l,c.alt=s,!1===I(i,\"view\",{originalImage:t.images[e],index:e,image:c})?t:(t.image=c,g(t.items[t.index],\"viewer-active\"),p(a,\"viewer-active\"),t.viewed=!1,t.index=e,t.imageData=null,p(c,\"viewer-invisible\"),M(r),N(r,c),t.renderList(),M(n),E(i,\"viewed\",function(){var e=t.imageData;S(n,s+\" (\"+e.naturalWidth+\" × \"+e.naturalHeight+\")\")},!0),c.complete?t.load():(E(c,\"load\",f(t.load,t),!0),t.timeout&&clearTimeout(t.timeout),t.timeout=setTimeout(function(){g(c,\"viewer-invisible\"),t.timeout=!1},1e3)),t)},prev:function(){var e=this;return e.view(Math.max(e.index-1,0)),e},next:function(){var e=this;return e.view(Math.min(e.index+1,e.length-1)),e},move:function(e,t){var i=this,r=i.imageData;return i.moveTo(n(e)?e:r.left+Number(e),n(t)?t:r.top+Number(t)),i},moveTo:function(e,t){var r=this,a=r.imageData;if(n(t)&&(t=e),e=Number(e),t=Number(t),r.viewed&&!r.played&&r.options.movable){var o=!1;i(e)&&(a.left=e,o=!0),i(t)&&(a.top=t,o=!0),o&&r.renderImage()}return r},zoom:function(e,t,i){var n=this,r=n.imageData;return e=Number(e),e=e<0?1/(1-e):1+e,n.zoomTo(r.width*e/r.naturalWidth,t,i),n},zoomTo:function(e,t,n,r){var a=this,o=a.options,l=a.pointers,s=a.imageData;if(e=Math.max(0,e),i(e)&&a.viewed&&!a.played&&(r||o.zoomable)){if(!r){var c=Math.max(.01,o.minZoomRatio),u=Math.min(100,o.maxZoomRatio);e=Math.min(Math.max(e,c),u)}e>.95&&e<1.05&&(e=1);var d=s.naturalWidth*e,v=s.naturalHeight*e;if(n){var f=L(a.viewer),m=l&&Object.keys(l).length?H(l):{pageX:n.pageX,pageY:n.pageY};s.left-=(d-s.width)*((m.pageX-f.left-s.left)/s.width),s.top-=(v-s.height)*((m.pageY-f.top-s.top)/s.height)}else s.left-=(d-s.width)/2,s.top-=(v-s.height)/2;s.width=d,s.height=v,s.ratio=e,a.renderImage(),t&&a.tooltip()}return a},rotate:function(e){var t=this;return t.rotateTo((t.imageData.rotate||0)+Number(e)),t},rotateTo:function(e){var t=this,n=t.imageData;return e=Number(e),i(e)&&t.viewed&&!t.played&&t.options.rotatable&&(n.rotate=e,t.renderImage()),t},scale:function(e,t){var r=this,a=r.imageData;if(n(t)&&(t=e),e=Number(e),t=Number(t),r.viewed&&!r.played&&r.options.scalable){var o=!1;i(e)&&(a.scaleX=e,o=!0),i(t)&&(a.scaleY=t,o=!0),o&&r.renderImage()}return r},scaleX:function(e){var t=this;return t.scale(e,t.imageData.scaleY),t},scaleY:function(e){var t=this;return t.scale(t.imageData.scaleX,e),t},play:function(){var e=this,t=e.options,n=e.player,r=f(e.loadImage,e),a=[],o=0,l=0;if(!e.visible||e.played)return e;if(t.fullscreen&&e.requestFullscreen(),e.played=!0,p(n,\"viewer-show\"),d(e.items,function(e,i){var s=C(e,\"img\")[0],c=document.createElement(\"img\");c.src=x(s,\"originalUrl\"),c.alt=s.getAttribute(\"alt\"),o+=1,p(c,\"viewer-fade\"),b(c,\"viewer-transition\",t.transition),w(e,\"viewer-active\")&&(p(c,\"viewer-in\"),l=i),a.push(c),E(c,\"load\",r,!0),N(n,c)}),i(t.interval)&&t.interval>0){o>1&&function i(){e.playing=setTimeout(function(){g(a[l],\"viewer-in\"),p(a[l=(l+=1)=0?(e.viewed=!1,e.view(Math.max(e.index-(i+1),0))):p(e.items[e.index],\"viewer-active\")}}else e.image=null,e.viewed=!1,e.index=0,e.imageData=null,M(e.canvas),M(e.title);return e},destroy:function(){var e=this,t=e.element;return e.options.inline?e.unbind():(e.visible&&e.unbind(),D(t,\"click\",e.onStart)),e.unbuild(),z(t,\"viewer\"),e}},se={open:function(){var e=this.body;p(e,\"viewer-open\"),e.style.paddingRight=this.scrollbarWidth+\"px\"},close:function(){var e=this.body;g(e,\"viewer-open\"),e.style.paddingRight=0},shown:function(){var e=this,t=e.options,i=e.element;e.transitioning=!1,e.fulled=!0,e.visible=!0,e.render(),e.bind(),o(t.shown)&&E(i,\"shown\",t.shown,!0),I(i,\"shown\")},hidden:function(){var e=this,t=e.options,i=e.element;e.transitioning=!1,e.viewed=!1,e.fulled=!1,e.visible=!1,e.unbind(),e.close(),p(e.viewer,\"viewer-hide\"),e.resetList(),e.resetImage(),o(t.hidden)&&E(i,\"hidden\",t.hidden,!0),I(i,\"hidden\")},requestFullscreen:function(){var e=this,t=document.documentElement;!e.fulled||document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement||(t.requestFullscreen?t.requestFullscreen():t.msRequestFullscreen?t.msRequestFullscreen():t.mozRequestFullScreen?t.mozRequestFullScreen():t.webkitRequestFullscreen&&t.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT))},exitFullscreen:function(){this.fulled&&(document.exitFullscreen?document.exitFullscreen():document.msExitFullscreen?document.msExitFullscreen():document.mozCancelFullScreen?document.mozCancelFullScreen():document.webkitExitFullscreen&&document.webkitExitFullscreen())},change:function(e){var t=this,i=t.pointers,n=i[Object.keys(i)[0]],r=n.endX-n.startX,a=n.endY-n.startY;switch(t.action){case\"move\":t.move(r,a);break;case\"zoom\":t.zoom(j(i),!1,e);break;case\"switch\":t.action=\"switched\",Math.abs(r)>Math.abs(a)&&(r>1?t.prev():r<-1&&t.next())}d(i,function(e){e.startX=e.endX,e.startY=e.endY})},isSwitchable:function(){var e=this,t=e.imageData,i=e.viewerData;return e.length>1&&t.left>=0&&t.top>=0&&t.width<=i.width&&t.height<=i.height}},ce=function(){function e(e,t){for(var i=0;i
    ';var a=Y(r,\"viewer-container\")[0],o=Y(a,\"viewer-title\")[0],l=Y(a,\"viewer-toolbar\")[0],s=Y(a,\"viewer-navbar\")[0],c=Y(a,\"viewer-button\")[0];if(e.parent=n,e.viewer=a,e.title=o,e.toolbar=l,e.navbar=s,e.button=c,e.canvas=Y(a,\"viewer-canvas\")[0],e.footer=Y(a,\"viewer-footer\")[0],e.tooltipBox=Y(a,\"viewer-tooltip\")[0],e.player=Y(a,\"viewer-player\")[0],e.list=Y(a,\"viewer-list\")[0],p(o,t.title?W(t.title):\"viewer-hide\"),p(l,t.toolbar?W(t.toolbar):\"viewer-hide\"),p(s,t.navbar?W(t.navbar):\"viewer-hide\"),b(c,\"viewer-hide\",!t.button),b(l.querySelector(\".viewer-one-to-one\"),\"viewer-invisible\",!t.zoomable),b(l.querySelectorAll('li[class*=\"zoom\"]'),\"viewer-invisible\",!t.zoomable),b(l.querySelectorAll('li[class*=\"flip\"]'),\"viewer-invisible\",!t.scalable),!t.rotatable){var u=l.querySelectorAll('li[class*=\"rotate\"]');p(u,\"viewer-invisible\"),N(l,u)}t.inline?(p(c,\"viewer-fullscreen\"),m(a,{zIndex:t.zIndexInline}),\"static\"===h(n).position&&m(n,{position:\"relative\"}),n.insertBefore(a,i.nextSibling)):(p(c,\"viewer-close\"),p(a,\"viewer-fixed\"),p(a,\"viewer-fade\"),p(a,\"viewer-hide\"),m(a,{zIndex:t.zIndex}),document.body.appendChild(a)),t.inline&&(e.render(),e.bind(),e.visible=!0),e.ready=!0,I(i,\"ready\")}}},{key:\"unbuild\",value:function(){var e=this;e.ready&&(e.ready=!1,X(e.viewer))}}],[{key:\"noConflict\",value:function(){return window.Viewer=de,e}},{key:\"setDefaults\",value:function(e){v(V,a(e)&&e)}}]),e}();return v(ve.prototype,ee),v(ve.prototype,ae),v(ve.prototype,oe),v(ve.prototype,le),v(ve.prototype,se),\"undefined\"!=typeof window&&(de=window.Viewer,window.Viewer=ve),ve});","angular.module(\"travelsearch.core\").directive('lightslider', ['$timeout', function ($timeout) {\r\n return {\r\n restrict: 'A',\r\n require: '?ngModel',\r\n link: function (scope, element, attrs, ngModel) {\r\n if (!ngModel) return;\r\n\r\n if (scope.$last) { \r\n\r\n $timeout(function () {\r\n // ng-repeat is completed\r\n element.parent().lightSlider({\r\n item: 3,\r\n autoWidth: false,\r\n slideMove: 3,\r\n slideMargin: 30,\r\n enableTouch: true,\r\n enableDrag: false,\r\n freeMove: true,\r\n swipeThreshold: 40,\r\n loop: false,\r\n auto: false,\r\n pauseOnHover: false,\r\n prevHtml: '',\r\n nextHtml: '',\r\n responsive: [\r\n {\r\n breakpoint: 991,\r\n settings: {\r\n item: 2,\r\n slideMove: 1,\r\n slideMargin: 30\r\n }\r\n },\r\n {\r\n breakpoint: 600,\r\n settings: {\r\n item: 1,\r\n slideMove: 1\r\n }\r\n }\r\n ],\r\n onSliderLoad: function (el) {\r\n\r\n // workaround to ensure container set height matching largest height of children\r\n // https://github.com/sachinchoolur/lightslider/issues/271\r\n\r\n var maxHeight = 0,\r\n container = $(el),\r\n children = container.children();\r\n\r\n children.each(function () {\r\n var childHeight = $(this).height();\r\n if (childHeight > maxHeight) {\r\n maxHeight = childHeight;\r\n }\r\n });\r\n container.height(maxHeight);\r\n }\r\n });\r\n\r\n }, 0);\r\n }\r\n }\r\n };\r\n}]);","/*!\n * The Final Countdown for jQuery v2.2.0 (http://hilios.github.io/jQuery.countdown/)\n * Copyright (c) 2016 Edson Hilios\n * \n * Permission is hereby granted, free of charge, to any person obtaining a copy of\n * this software and associated documentation files (the \"Software\"), to deal in\n * the Software without restriction, including without limitation the rights to\n * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of\n * the Software, and to permit persons to whom the Software is furnished to do so,\n * subject to the following conditions:\n * \n * The above copyright notice and this permission notice shall be included in all\n * copies or substantial portions of the Software.\n * \n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS\n * FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR\n * COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER\n * IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN\n * CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n */\n!function(a){\"use strict\";\"function\"==typeof define&&define.amd?define([\"jquery\"],a):a(jQuery)}(function(a){\"use strict\";function b(a){if(a instanceof Date)return a;if(String(a).match(g))return String(a).match(/^[0-9]*$/)&&(a=Number(a)),String(a).match(/\\-/)&&(a=String(a).replace(/\\-/g,\"/\")),new Date(a);throw new Error(\"Couldn't cast `\"+a+\"` to a date object.\")}function c(a){var b=a.toString().replace(/([.?*+^$[\\]\\\\(){}|-])/g,\"\\\\$1\");return new RegExp(b)}function d(a){return function(b){var d=b.match(/%(-|!)?[A-Z]{1}(:[^;]+;)?/gi);if(d)for(var f=0,g=d.length;f1?c:d}var f=[],g=[],h={precision:100,elapse:!1,defer:!1};g.push(/^[0-9]*$/.source),g.push(/([0-9]{1,2}\\/){2}[0-9]{4}( [0-9]{1,2}(:[0-9]{2}){2})?/.source),g.push(/[0-9]{4}([\\/\\-][0-9]{1,2}){2}( [0-9]{1,2}(:[0-9]{2}){2})?/.source),g=new RegExp(g.join(\"|\"));var i={Y:\"years\",m:\"months\",n:\"daysToMonth\",d:\"daysToWeek\",w:\"weeks\",W:\"weeksToMonth\",H:\"hours\",M:\"minutes\",S:\"seconds\",D:\"totalDays\",I:\"totalHours\",N:\"totalMinutes\",T:\"totalSeconds\"},j=function(b,c,d){this.el=b,this.$el=a(b),this.interval=null,this.offset={},this.options=a.extend({},h),this.instanceNumber=f.length,f.push(this),this.$el.data(\"countdown-instance\",this.instanceNumber),d&&(\"function\"==typeof d?(this.$el.on(\"update.countdown\",d),this.$el.on(\"stoped.countdown\",d),this.$el.on(\"finish.countdown\",d)):this.options=a.extend({},h,d)),this.setFinalDate(c),this.options.defer===!1&&this.start()};a.extend(j.prototype,{start:function(){null!==this.interval&&clearInterval(this.interval);var a=this;this.update(),this.interval=setInterval(function(){a.update.call(a)},this.options.precision)},stop:function(){clearInterval(this.interval),this.interval=null,this.dispatchEvent(\"stoped\")},toggle:function(){this.interval?this.stop():this.start()},pause:function(){this.stop()},resume:function(){this.start()},remove:function(){this.stop.call(this),f[this.instanceNumber]=null,delete this.$el.data().countdownInstance},setFinalDate:function(a){this.finalDate=b(a)},update:function(){if(0===this.$el.closest(\"html\").length)return void this.remove();var b,c=void 0!==a._data(this.el,\"events\"),d=new Date;b=this.finalDate.getTime()-d.getTime(),b=Math.ceil(b/1e3),b=!this.options.elapse&&b<0?0:Math.abs(b),this.totalSecsLeft!==b&&c&&(this.totalSecsLeft=b,this.elapsed=d>=this.finalDate,this.offset={seconds:this.totalSecsLeft%60,minutes:Math.floor(this.totalSecsLeft/60)%60,hours:Math.floor(this.totalSecsLeft/60/60)%24,days:Math.floor(this.totalSecsLeft/60/60/24)%7,daysToWeek:Math.floor(this.totalSecsLeft/60/60/24)%7,daysToMonth:Math.floor(this.totalSecsLeft/60/60/24%30.4368),weeks:Math.floor(this.totalSecsLeft/60/60/24/7),weeksToMonth:Math.floor(this.totalSecsLeft/60/60/24/7)%4,months:Math.floor(this.totalSecsLeft/60/60/24/30.4368),years:Math.abs(this.finalDate.getFullYear()-d.getFullYear()),totalDays:Math.floor(this.totalSecsLeft/60/60/24),totalHours:Math.floor(this.totalSecsLeft/60/60),totalMinutes:Math.floor(this.totalSecsLeft/60),totalSeconds:this.totalSecsLeft},this.options.elapse||0!==this.totalSecsLeft?this.dispatchEvent(\"update\"):(this.stop(),this.dispatchEvent(\"finish\")))},dispatchEvent:function(b){var c=a.Event(b+\".countdown\");c.finalDate=this.finalDate,c.elapsed=this.elapsed,c.offset=a.extend({},this.offset),c.strftime=d(this.offset),this.$el.trigger(c)}}),a.fn.countdown=function(){var b=Array.prototype.slice.call(arguments,0);return this.each(function(){var c=a(this).data(\"countdown-instance\");if(void 0!==c){var d=f[c],e=b[0];j.prototype.hasOwnProperty(e)?d[e].apply(d,b.slice(1)):null===String(e).match(/^[$A-Z_][0-9A-Z_$]*$/i)?(d.setFinalDate.call(d,e),d.start()):a.error(\"Method %s does not exist on jQuery.countdown\".replace(/\\%s/gi,e))}else new j(this,b[0],b[1])})}});","$(function () {\r\n $('body').on('hidden.bs.modal', '.modal', function () {\r\n $(this).removeData('bs.modal');\r\n });\r\n\r\n\r\n $(document).on(\"click\", \".view-service-details\", function () {\r\n var serviceId = $(this).data('id');\r\n\r\n $('#serviceDetailsDialog .modal-body').load(\"/Umbraco/Surface/Service/GetService?id=\" + serviceId, function (response, status, xhr) {\r\n //$(\"#serviceDetailsDialog\").find(\".modal-body\").html(response.data);\r\n\r\n $(\"#serviceDetailsDialog\").modal(\"show\");\r\n });\r\n });\r\n});","$(function () {\r\n\r\n $(\".image-gallery\").lightSlider({\r\n item: 6,\r\n loop: false,\r\n enableTouch: true,\r\n enableDrag: true,\r\n freeMove: true,\r\n swipeThreshold: 40,\r\n slideMove: 2,\r\n slideMargin: 6,\r\n addClass: 'image-gallery-slider',\r\n prevHtml: '',\r\n nextHtml: '',\r\n easing: 'cubic-bezier(0.25, 0, 0.25, 1)',\r\n speed: 600,\r\n controls: true,\r\n pager: false,\r\n responsive: [\r\n {\r\n breakpoint: 900,\r\n settings: {\r\n item: 5,\r\n slideMove: 1\r\n }\r\n },\r\n {\r\n breakpoint: 800,\r\n settings: {\r\n item: 4,\r\n slideMove: 1\r\n }\r\n },\r\n {\r\n breakpoint: 600,\r\n settings: {\r\n item: 3,\r\n slideMove: 1\r\n }\r\n },\r\n {\r\n breakpoint: 480,\r\n settings: {\r\n item: 2,\r\n slideMove: 1\r\n }\r\n }\r\n ]\r\n });\r\n\r\n});","/**\n * @license AngularJS v1.4.2\n * (c) 2010-2015 Google, Inc. http://angularjs.org\n * License: MIT\n */\n(function(window, document, undefined) {'use strict';\n\n/**\n * @description\n *\n * This object provides a utility for producing rich Error messages within\n * Angular. It can be called as follows:\n *\n * var exampleMinErr = minErr('example');\n * throw exampleMinErr('one', 'This {0} is {1}', foo, bar);\n *\n * The above creates an instance of minErr in the example namespace. The\n * resulting error will have a namespaced error code of example.one. The\n * resulting error will replace {0} with the value of foo, and {1} with the\n * value of bar. The object is not restricted in the number of arguments it can\n * take.\n *\n * If fewer arguments are specified than necessary for interpolation, the extra\n * interpolation markers will be preserved in the final string.\n *\n * Since data will be parsed statically during a build step, some restrictions\n * are applied with respect to how minErr instances are created and called.\n * Instances should have names of the form namespaceMinErr for a minErr created\n * using minErr('namespace') . Error codes, namespaces and template strings\n * should all be static strings, not variables or general expressions.\n *\n * @param {string} module The namespace to use for the new minErr instance.\n * @param {function} ErrorConstructor Custom error constructor to be instantiated when returning\n * error from returned function, for cases when a particular type of error is useful.\n * @returns {function(code:string, template:string, ...templateArgs): Error} minErr instance\n */\n\nfunction minErr(module, ErrorConstructor) {\n ErrorConstructor = ErrorConstructor || Error;\n return function() {\n var SKIP_INDEXES = 2;\n\n var templateArgs = arguments,\n code = templateArgs[0],\n message = '[' + (module ? module + ':' : '') + code + '] ',\n template = templateArgs[1],\n paramPrefix, i;\n\n message += template.replace(/\\{\\d+\\}/g, function(match) {\n var index = +match.slice(1, -1),\n shiftedIndex = index + SKIP_INDEXES;\n\n if (shiftedIndex < templateArgs.length) {\n return toDebugString(templateArgs[shiftedIndex]);\n }\n\n return match;\n });\n\n message += '\\nhttp://errors.angularjs.org/1.4.2/' +\n (module ? module + '/' : '') + code;\n\n for (i = SKIP_INDEXES, paramPrefix = '?'; i < templateArgs.length; i++, paramPrefix = '&') {\n message += paramPrefix + 'p' + (i - SKIP_INDEXES) + '=' +\n encodeURIComponent(toDebugString(templateArgs[i]));\n }\n\n return new ErrorConstructor(message);\n };\n}\n\n/* We need to tell jshint what variables are being exported */\n/* global angular: true,\n msie: true,\n jqLite: true,\n jQuery: true,\n slice: true,\n splice: true,\n push: true,\n toString: true,\n ngMinErr: true,\n angularModule: true,\n uid: true,\n REGEX_STRING_REGEXP: true,\n VALIDITY_STATE_PROPERTY: true,\n\n lowercase: true,\n uppercase: true,\n manualLowercase: true,\n manualUppercase: true,\n nodeName_: true,\n isArrayLike: true,\n forEach: true,\n forEachSorted: true,\n reverseParams: true,\n nextUid: true,\n setHashKey: true,\n extend: true,\n toInt: true,\n inherit: true,\n merge: true,\n noop: true,\n identity: true,\n valueFn: true,\n isUndefined: true,\n isDefined: true,\n isObject: true,\n isBlankObject: true,\n isString: true,\n isNumber: true,\n isDate: true,\n isArray: true,\n isFunction: true,\n isRegExp: true,\n isWindow: true,\n isScope: true,\n isFile: true,\n isFormData: true,\n isBlob: true,\n isBoolean: true,\n isPromiseLike: true,\n trim: true,\n escapeForRegexp: true,\n isElement: true,\n makeMap: true,\n includes: true,\n arrayRemove: true,\n copy: true,\n shallowCopy: true,\n equals: true,\n csp: true,\n jq: true,\n concat: true,\n sliceArgs: true,\n bind: true,\n toJsonReplacer: true,\n toJson: true,\n fromJson: true,\n convertTimezoneToLocal: true,\n timezoneToOffset: true,\n startingTag: true,\n tryDecodeURIComponent: true,\n parseKeyValue: true,\n toKeyValue: true,\n encodeUriSegment: true,\n encodeUriQuery: true,\n angularInit: true,\n bootstrap: true,\n getTestability: true,\n snake_case: true,\n bindJQuery: true,\n assertArg: true,\n assertArgFn: true,\n assertNotHasOwnProperty: true,\n getter: true,\n getBlockNodes: true,\n hasOwnProperty: true,\n createMap: true,\n\n NODE_TYPE_ELEMENT: true,\n NODE_TYPE_ATTRIBUTE: true,\n NODE_TYPE_TEXT: true,\n NODE_TYPE_COMMENT: true,\n NODE_TYPE_DOCUMENT: true,\n NODE_TYPE_DOCUMENT_FRAGMENT: true,\n*/\n\n////////////////////////////////////\n\n/**\n * @ngdoc module\n * @name ng\n * @module ng\n * @description\n *\n * # ng (core module)\n * The ng module is loaded by default when an AngularJS application is started. The module itself\n * contains the essential components for an AngularJS application to function. The table below\n * lists a high level breakdown of each of the services/factories, filters, directives and testing\n * components available within this core module.\n *\n *
    \n */\n\nvar REGEX_STRING_REGEXP = /^\\/(.+)\\/([a-z]*)$/;\n\n// The name of a form control's ValidityState property.\n// This is used so that it's possible for internal tests to create mock ValidityStates.\nvar VALIDITY_STATE_PROPERTY = 'validity';\n\n/**\n * @ngdoc function\n * @name angular.lowercase\n * @module ng\n * @kind function\n *\n * @description Converts the specified string to lowercase.\n * @param {string} string String to be converted to lowercase.\n * @returns {string} Lowercased string.\n */\nvar lowercase = function(string) {return isString(string) ? string.toLowerCase() : string;};\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\n\n/**\n * @ngdoc function\n * @name angular.uppercase\n * @module ng\n * @kind function\n *\n * @description Converts the specified string to uppercase.\n * @param {string} string String to be converted to uppercase.\n * @returns {string} Uppercased string.\n */\nvar uppercase = function(string) {return isString(string) ? string.toUpperCase() : string;};\n\n\nvar manualLowercase = function(s) {\n /* jshint bitwise: false */\n return isString(s)\n ? s.replace(/[A-Z]/g, function(ch) {return String.fromCharCode(ch.charCodeAt(0) | 32);})\n : s;\n};\nvar manualUppercase = function(s) {\n /* jshint bitwise: false */\n return isString(s)\n ? s.replace(/[a-z]/g, function(ch) {return String.fromCharCode(ch.charCodeAt(0) & ~32);})\n : s;\n};\n\n\n// String#toLowerCase and String#toUpperCase don't produce correct results in browsers with Turkish\n// locale, for this reason we need to detect this case and redefine lowercase/uppercase methods\n// with correct but slower alternatives.\nif ('i' !== 'I'.toLowerCase()) {\n lowercase = manualLowercase;\n uppercase = manualUppercase;\n}\n\n\nvar\n msie, // holds major version number for IE, or NaN if UA is not IE.\n jqLite, // delay binding since jQuery could be loaded after us.\n jQuery, // delay binding\n slice = [].slice,\n splice = [].splice,\n push = [].push,\n toString = Object.prototype.toString,\n getPrototypeOf = Object.getPrototypeOf,\n ngMinErr = minErr('ng'),\n\n /** @name angular */\n angular = window.angular || (window.angular = {}),\n angularModule,\n uid = 0;\n\n/**\n * documentMode is an IE-only property\n * http://msdn.microsoft.com/en-us/library/ie/cc196988(v=vs.85).aspx\n */\nmsie = document.documentMode;\n\n\n/**\n * @private\n * @param {*} obj\n * @return {boolean} Returns true if `obj` is an array or array-like object (NodeList, Arguments,\n * String ...)\n */\nfunction isArrayLike(obj) {\n if (obj == null || isWindow(obj)) {\n return false;\n }\n\n // Support: iOS 8.2 (not reproducible in simulator)\n // \"length\" in obj used to prevent JIT error (gh-11508)\n var length = \"length\" in Object(obj) && obj.length;\n\n if (obj.nodeType === NODE_TYPE_ELEMENT && length) {\n return true;\n }\n\n return isString(obj) || isArray(obj) || length === 0 ||\n typeof length === 'number' && length > 0 && (length - 1) in obj;\n}\n\n/**\n * @ngdoc function\n * @name angular.forEach\n * @module ng\n * @kind function\n *\n * @description\n * Invokes the `iterator` function once for each item in `obj` collection, which can be either an\n * object or an array. The `iterator` function is invoked with `iterator(value, key, obj)`, where `value`\n * is the value of an object property or an array element, `key` is the object property key or\n * array element index and obj is the `obj` itself. Specifying a `context` for the function is optional.\n *\n * It is worth noting that `.forEach` does not iterate over inherited properties because it filters\n * using the `hasOwnProperty` method.\n *\n * Unlike ES262's\n * [Array.prototype.forEach](http://www.ecma-international.org/ecma-262/5.1/#sec-15.4.4.18),\n * Providing 'undefined' or 'null' values for `obj` will not throw a TypeError, but rather just\n * return the value provided.\n *\n ```js\n var values = {name: 'misko', gender: 'male'};\n var log = [];\n angular.forEach(values, function(value, key) {\n this.push(key + ': ' + value);\n }, log);\n expect(log).toEqual(['name: misko', 'gender: male']);\n ```\n *\n * @param {Object|Array} obj Object to iterate over.\n * @param {Function} iterator Iterator function.\n * @param {Object=} context Object to become context (`this`) for the iterator function.\n * @returns {Object|Array} Reference to `obj`.\n */\n\nfunction forEach(obj, iterator, context) {\n var key, length;\n if (obj) {\n if (isFunction(obj)) {\n for (key in obj) {\n // Need to check if hasOwnProperty exists,\n // as on IE8 the result of querySelectorAll is an object without a hasOwnProperty function\n if (key != 'prototype' && key != 'length' && key != 'name' && (!obj.hasOwnProperty || obj.hasOwnProperty(key))) {\n iterator.call(context, obj[key], key, obj);\n }\n }\n } else if (isArray(obj) || isArrayLike(obj)) {\n var isPrimitive = typeof obj !== 'object';\n for (key = 0, length = obj.length; key < length; key++) {\n if (isPrimitive || key in obj) {\n iterator.call(context, obj[key], key, obj);\n }\n }\n } else if (obj.forEach && obj.forEach !== forEach) {\n obj.forEach(iterator, context, obj);\n } else if (isBlankObject(obj)) {\n // createMap() fast path --- Safe to avoid hasOwnProperty check because prototype chain is empty\n for (key in obj) {\n iterator.call(context, obj[key], key, obj);\n }\n } else if (typeof obj.hasOwnProperty === 'function') {\n // Slow path for objects inheriting Object.prototype, hasOwnProperty check needed\n for (key in obj) {\n if (obj.hasOwnProperty(key)) {\n iterator.call(context, obj[key], key, obj);\n }\n }\n } else {\n // Slow path for objects which do not have a method `hasOwnProperty`\n for (key in obj) {\n if (hasOwnProperty.call(obj, key)) {\n iterator.call(context, obj[key], key, obj);\n }\n }\n }\n }\n return obj;\n}\n\nfunction forEachSorted(obj, iterator, context) {\n var keys = Object.keys(obj).sort();\n for (var i = 0; i < keys.length; i++) {\n iterator.call(context, obj[keys[i]], keys[i]);\n }\n return keys;\n}\n\n\n/**\n * when using forEach the params are value, key, but it is often useful to have key, value.\n * @param {function(string, *)} iteratorFn\n * @returns {function(*, string)}\n */\nfunction reverseParams(iteratorFn) {\n return function(value, key) { iteratorFn(key, value); };\n}\n\n/**\n * A consistent way of creating unique IDs in angular.\n *\n * Using simple numbers allows us to generate 28.6 million unique ids per second for 10 years before\n * we hit number precision issues in JavaScript.\n *\n * Math.pow(2,53) / 60 / 60 / 24 / 365 / 10 = 28.6M\n *\n * @returns {number} an unique alpha-numeric string\n */\nfunction nextUid() {\n return ++uid;\n}\n\n\n/**\n * Set or clear the hashkey for an object.\n * @param obj object\n * @param h the hashkey (!truthy to delete the hashkey)\n */\nfunction setHashKey(obj, h) {\n if (h) {\n obj.$$hashKey = h;\n } else {\n delete obj.$$hashKey;\n }\n}\n\n\nfunction baseExtend(dst, objs, deep) {\n var h = dst.$$hashKey;\n\n for (var i = 0, ii = objs.length; i < ii; ++i) {\n var obj = objs[i];\n if (!isObject(obj) && !isFunction(obj)) continue;\n var keys = Object.keys(obj);\n for (var j = 0, jj = keys.length; j < jj; j++) {\n var key = keys[j];\n var src = obj[key];\n\n if (deep && isObject(src)) {\n if (isDate(src)) {\n dst[key] = new Date(src.valueOf());\n } else {\n if (!isObject(dst[key])) dst[key] = isArray(src) ? [] : {};\n baseExtend(dst[key], [src], true);\n }\n } else {\n dst[key] = src;\n }\n }\n }\n\n setHashKey(dst, h);\n return dst;\n}\n\n/**\n * @ngdoc function\n * @name angular.extend\n * @module ng\n * @kind function\n *\n * @description\n * Extends the destination object `dst` by copying own enumerable properties from the `src` object(s)\n * to `dst`. You can specify multiple `src` objects. If you want to preserve original objects, you can do so\n * by passing an empty object as the target: `var object = angular.extend({}, object1, object2)`.\n *\n * **Note:** Keep in mind that `angular.extend` does not support recursive merge (deep copy). Use\n * {@link angular.merge} for this.\n *\n * @param {Object} dst Destination object.\n * @param {...Object} src Source object(s).\n * @returns {Object} Reference to `dst`.\n */\nfunction extend(dst) {\n return baseExtend(dst, slice.call(arguments, 1), false);\n}\n\n\n/**\n* @ngdoc function\n* @name angular.merge\n* @module ng\n* @kind function\n*\n* @description\n* Deeply extends the destination object `dst` by copying own enumerable properties from the `src` object(s)\n* to `dst`. You can specify multiple `src` objects. If you want to preserve original objects, you can do so\n* by passing an empty object as the target: `var object = angular.merge({}, object1, object2)`.\n*\n* Unlike {@link angular.extend extend()}, `merge()` recursively descends into object properties of source\n* objects, performing a deep copy.\n*\n* @param {Object} dst Destination object.\n* @param {...Object} src Source object(s).\n* @returns {Object} Reference to `dst`.\n*/\nfunction merge(dst) {\n return baseExtend(dst, slice.call(arguments, 1), true);\n}\n\n\n\nfunction toInt(str) {\n return parseInt(str, 10);\n}\n\n\nfunction inherit(parent, extra) {\n return extend(Object.create(parent), extra);\n}\n\n/**\n * @ngdoc function\n * @name angular.noop\n * @module ng\n * @kind function\n *\n * @description\n * A function that performs no operations. This function can be useful when writing code in the\n * functional style.\n ```js\n function foo(callback) {\n var result = calculateResult();\n (callback || angular.noop)(result);\n }\n ```\n */\nfunction noop() {}\nnoop.$inject = [];\n\n\n/**\n * @ngdoc function\n * @name angular.identity\n * @module ng\n * @kind function\n *\n * @description\n * A function that returns its first argument. This function is useful when writing code in the\n * functional style.\n *\n ```js\n function transformer(transformationFn, value) {\n return (transformationFn || angular.identity)(value);\n };\n ```\n * @param {*} value to be returned.\n * @returns {*} the value passed in.\n */\nfunction identity($) {return $;}\nidentity.$inject = [];\n\n\nfunction valueFn(value) {return function() {return value;};}\n\nfunction hasCustomToString(obj) {\n return isFunction(obj.toString) && obj.toString !== Object.prototype.toString;\n}\n\n\n/**\n * @ngdoc function\n * @name angular.isUndefined\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is undefined.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is undefined.\n */\nfunction isUndefined(value) {return typeof value === 'undefined';}\n\n\n/**\n * @ngdoc function\n * @name angular.isDefined\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is defined.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is defined.\n */\nfunction isDefined(value) {return typeof value !== 'undefined';}\n\n\n/**\n * @ngdoc function\n * @name angular.isObject\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is an `Object`. Unlike `typeof` in JavaScript, `null`s are not\n * considered to be objects. Note that JavaScript arrays are objects.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is an `Object` but not `null`.\n */\nfunction isObject(value) {\n // http://jsperf.com/isobject4\n return value !== null && typeof value === 'object';\n}\n\n\n/**\n * Determine if a value is an object with a null prototype\n *\n * @returns {boolean} True if `value` is an `Object` with a null prototype\n */\nfunction isBlankObject(value) {\n return value !== null && typeof value === 'object' && !getPrototypeOf(value);\n}\n\n\n/**\n * @ngdoc function\n * @name angular.isString\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is a `String`.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is a `String`.\n */\nfunction isString(value) {return typeof value === 'string';}\n\n\n/**\n * @ngdoc function\n * @name angular.isNumber\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is a `Number`.\n *\n * This includes the \"special\" numbers `NaN`, `+Infinity` and `-Infinity`.\n *\n * If you wish to exclude these then you can use the native\n * [`isFinite'](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/isFinite)\n * method.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is a `Number`.\n */\nfunction isNumber(value) {return typeof value === 'number';}\n\n\n/**\n * @ngdoc function\n * @name angular.isDate\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a value is a date.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is a `Date`.\n */\nfunction isDate(value) {\n return toString.call(value) === '[object Date]';\n}\n\n\n/**\n * @ngdoc function\n * @name angular.isArray\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is an `Array`.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is an `Array`.\n */\nvar isArray = Array.isArray;\n\n/**\n * @ngdoc function\n * @name angular.isFunction\n * @module ng\n * @kind function\n *\n * @description\n * Determines if a reference is a `Function`.\n *\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is a `Function`.\n */\nfunction isFunction(value) {return typeof value === 'function';}\n\n\n/**\n * Determines if a value is a regular expression object.\n *\n * @private\n * @param {*} value Reference to check.\n * @returns {boolean} True if `value` is a `RegExp`.\n */\nfunction isRegExp(value) {\n return toString.call(value) === '[object RegExp]';\n}\n\n\n/**\n * Checks if `obj` is a window object.\n *\n * @private\n * @param {*} obj Object to check\n * @returns {boolean} True if `obj` is a window obj.\n */\nfunction isWindow(obj) {\n return obj && obj.window === obj;\n}\n\n\nfunction isScope(obj) {\n return obj && obj.$evalAsync && obj.$watch;\n}\n\n\nfunction isFile(obj) {\n return toString.call(obj) === '[object File]';\n}\n\n\nfunction isFormData(obj) {\n return toString.call(obj) === '[object FormData]';\n}\n\n\nfunction isBlob(obj) {\n return toString.call(obj) === '[object Blob]';\n}\n\n\nfunction isBoolean(value) {\n return typeof value === 'boolean';\n}\n\n\nfunction isPromiseLike(obj) {\n return obj && isFunction(obj.then);\n}\n\n\nvar TYPED_ARRAY_REGEXP = /^\\[object (Uint8(Clamped)?)|(Uint16)|(Uint32)|(Int8)|(Int16)|(Int32)|(Float(32)|(64))Array\\]$/;\nfunction isTypedArray(value) {\n return TYPED_ARRAY_REGEXP.test(toString.call(value));\n}\n\n\nvar trim = function(value) {\n return isString(value) ? value.trim() : value;\n};\n\n// Copied from:\n// http://docs.closure-library.googlecode.com/git/local_closure_goog_string_string.js.source.html#line1021\n// Prereq: s is a string.\nvar escapeForRegexp = function(s) {\n return s.replace(/([-()\\[\\]{}+?*.$\\^|,:#= 0) {\n array.splice(index, 1);\n }\n return index;\n}\n\n/**\n * @ngdoc function\n * @name angular.copy\n * @module ng\n * @kind function\n *\n * @description\n * Creates a deep copy of `source`, which should be an object or an array.\n *\n * * If no destination is supplied, a copy of the object or array is created.\n * * If a destination is provided, all of its elements (for arrays) or properties (for objects)\n * are deleted and then all elements/properties from the source are copied to it.\n * * If `source` is not an object or array (inc. `null` and `undefined`), `source` is returned.\n * * If `source` is identical to 'destination' an exception will be thrown.\n *\n * @param {*} source The source that will be used to make a copy.\n * Can be any type, including primitives, `null`, and `undefined`.\n * @param {(Object|Array)=} destination Destination into which the source is copied. If\n * provided, must be of the same type as `source`.\n * @returns {*} The copy or updated `destination`, if `destination` was specified.\n *\n * @example\n \n \n
    \n
    \n Name:
    \n E-mail:
    \n Gender: male\n female
    \n \n \n \n
    form = {{user | json}}
    \n
    master = {{master | json}}
    \n
    \n\n \n
    \n
    \n */\nfunction copy(source, destination, stackSource, stackDest) {\n if (isWindow(source) || isScope(source)) {\n throw ngMinErr('cpws',\n \"Can't copy! Making copies of Window or Scope instances is not supported.\");\n }\n if (isTypedArray(destination)) {\n throw ngMinErr('cpta',\n \"Can't copy! TypedArray destination cannot be mutated.\");\n }\n\n if (!destination) {\n destination = source;\n if (isObject(source)) {\n var index;\n if (stackSource && (index = stackSource.indexOf(source)) !== -1) {\n return stackDest[index];\n }\n\n // TypedArray, Date and RegExp have specific copy functionality and must be\n // pushed onto the stack before returning.\n // Array and other objects create the base object and recurse to copy child\n // objects. The array/object will be pushed onto the stack when recursed.\n if (isArray(source)) {\n return copy(source, [], stackSource, stackDest);\n } else if (isTypedArray(source)) {\n destination = new source.constructor(source);\n } else if (isDate(source)) {\n destination = new Date(source.getTime());\n } else if (isRegExp(source)) {\n destination = new RegExp(source.source, source.toString().match(/[^\\/]*$/)[0]);\n destination.lastIndex = source.lastIndex;\n } else {\n var emptyObject = Object.create(getPrototypeOf(source));\n return copy(source, emptyObject, stackSource, stackDest);\n }\n\n if (stackDest) {\n stackSource.push(source);\n stackDest.push(destination);\n }\n }\n } else {\n if (source === destination) throw ngMinErr('cpi',\n \"Can't copy! Source and destination are identical.\");\n\n stackSource = stackSource || [];\n stackDest = stackDest || [];\n\n if (isObject(source)) {\n stackSource.push(source);\n stackDest.push(destination);\n }\n\n var result, key;\n if (isArray(source)) {\n destination.length = 0;\n for (var i = 0; i < source.length; i++) {\n destination.push(copy(source[i], null, stackSource, stackDest));\n }\n } else {\n var h = destination.$$hashKey;\n if (isArray(destination)) {\n destination.length = 0;\n } else {\n forEach(destination, function(value, key) {\n delete destination[key];\n });\n }\n if (isBlankObject(source)) {\n // createMap() fast path --- Safe to avoid hasOwnProperty check because prototype chain is empty\n for (key in source) {\n destination[key] = copy(source[key], null, stackSource, stackDest);\n }\n } else if (source && typeof source.hasOwnProperty === 'function') {\n // Slow path, which must rely on hasOwnProperty\n for (key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = copy(source[key], null, stackSource, stackDest);\n }\n }\n } else {\n // Slowest path --- hasOwnProperty can't be called as a method\n for (key in source) {\n if (hasOwnProperty.call(source, key)) {\n destination[key] = copy(source[key], null, stackSource, stackDest);\n }\n }\n }\n setHashKey(destination,h);\n }\n }\n return destination;\n}\n\n/**\n * Creates a shallow copy of an object, an array or a primitive.\n *\n * Assumes that there are no proto properties for objects.\n */\nfunction shallowCopy(src, dst) {\n if (isArray(src)) {\n dst = dst || [];\n\n for (var i = 0, ii = src.length; i < ii; i++) {\n dst[i] = src[i];\n }\n } else if (isObject(src)) {\n dst = dst || {};\n\n for (var key in src) {\n if (!(key.charAt(0) === '$' && key.charAt(1) === '$')) {\n dst[key] = src[key];\n }\n }\n }\n\n return dst || src;\n}\n\n\n/**\n * @ngdoc function\n * @name angular.equals\n * @module ng\n * @kind function\n *\n * @description\n * Determines if two objects or two values are equivalent. Supports value types, regular\n * expressions, arrays and objects.\n *\n * Two objects or values are considered equivalent if at least one of the following is true:\n *\n * * Both objects or values pass `===` comparison.\n * * Both objects or values are of the same type and all of their properties are equal by\n * comparing them with `angular.equals`.\n * * Both values are NaN. (In JavaScript, NaN == NaN => false. But we consider two NaN as equal)\n * * Both values represent the same regular expression (In JavaScript,\n * /abc/ == /abc/ => false. But we consider two regular expressions as equal when their textual\n * representation matches).\n *\n * During a property comparison, properties of `function` type and properties with names\n * that begin with `$` are ignored.\n *\n * Scope and DOMWindow objects are being compared only by identify (`===`).\n *\n * @param {*} o1 Object or value to compare.\n * @param {*} o2 Object or value to compare.\n * @returns {boolean} True if arguments are equal.\n */\nfunction equals(o1, o2) {\n if (o1 === o2) return true;\n if (o1 === null || o2 === null) return false;\n if (o1 !== o1 && o2 !== o2) return true; // NaN === NaN\n var t1 = typeof o1, t2 = typeof o2, length, key, keySet;\n if (t1 == t2) {\n if (t1 == 'object') {\n if (isArray(o1)) {\n if (!isArray(o2)) return false;\n if ((length = o1.length) == o2.length) {\n for (key = 0; key < length; key++) {\n if (!equals(o1[key], o2[key])) return false;\n }\n return true;\n }\n } else if (isDate(o1)) {\n if (!isDate(o2)) return false;\n return equals(o1.getTime(), o2.getTime());\n } else if (isRegExp(o1)) {\n return isRegExp(o2) ? o1.toString() == o2.toString() : false;\n } else {\n if (isScope(o1) || isScope(o2) || isWindow(o1) || isWindow(o2) ||\n isArray(o2) || isDate(o2) || isRegExp(o2)) return false;\n keySet = createMap();\n for (key in o1) {\n if (key.charAt(0) === '$' || isFunction(o1[key])) continue;\n if (!equals(o1[key], o2[key])) return false;\n keySet[key] = true;\n }\n for (key in o2) {\n if (!(key in keySet) &&\n key.charAt(0) !== '$' &&\n o2[key] !== undefined &&\n !isFunction(o2[key])) return false;\n }\n return true;\n }\n }\n }\n return false;\n}\n\nvar csp = function() {\n if (isDefined(csp.isActive_)) return csp.isActive_;\n\n var active = !!(document.querySelector('[ng-csp]') ||\n document.querySelector('[data-ng-csp]'));\n\n if (!active) {\n try {\n /* jshint -W031, -W054 */\n new Function('');\n /* jshint +W031, +W054 */\n } catch (e) {\n active = true;\n }\n }\n\n return (csp.isActive_ = active);\n};\n\n/**\n * @ngdoc directive\n * @module ng\n * @name ngJq\n *\n * @element ANY\n * @param {string=} ngJq the name of the library available under `window`\n * to be used for angular.element\n * @description\n * Use this directive to force the angular.element library. This should be\n * used to force either jqLite by leaving ng-jq blank or setting the name of\n * the jquery variable under window (eg. jQuery).\n *\n * Since angular looks for this directive when it is loaded (doesn't wait for the\n * DOMContentLoaded event), it must be placed on an element that comes before the script\n * which loads angular. Also, only the first instance of `ng-jq` will be used and all\n * others ignored.\n *\n * @example\n * This example shows how to force jqLite using the `ngJq` directive to the `html` tag.\n ```html\n \n \n ...\n ...\n \n ```\n * @example\n * This example shows how to use a jQuery based library of a different name.\n * The library name must be available at the top most 'window'.\n ```html\n \n \n ...\n ...\n \n ```\n */\nvar jq = function() {\n if (isDefined(jq.name_)) return jq.name_;\n var el;\n var i, ii = ngAttrPrefixes.length, prefix, name;\n for (i = 0; i < ii; ++i) {\n prefix = ngAttrPrefixes[i];\n if (el = document.querySelector('[' + prefix.replace(':', '\\\\:') + 'jq]')) {\n name = el.getAttribute(prefix + 'jq');\n break;\n }\n }\n\n return (jq.name_ = name);\n};\n\nfunction concat(array1, array2, index) {\n return array1.concat(slice.call(array2, index));\n}\n\nfunction sliceArgs(args, startIndex) {\n return slice.call(args, startIndex || 0);\n}\n\n\n/* jshint -W101 */\n/**\n * @ngdoc function\n * @name angular.bind\n * @module ng\n * @kind function\n *\n * @description\n * Returns a function which calls function `fn` bound to `self` (`self` becomes the `this` for\n * `fn`). You can supply optional `args` that are prebound to the function. This feature is also\n * known as [partial application](http://en.wikipedia.org/wiki/Partial_application), as\n * distinguished from [function currying](http://en.wikipedia.org/wiki/Currying#Contrast_with_partial_function_application).\n *\n * @param {Object} self Context which `fn` should be evaluated in.\n * @param {function()} fn Function to be bound.\n * @param {...*} args Optional arguments to be prebound to the `fn` function call.\n * @returns {function()} Function that wraps the `fn` with all the specified bindings.\n */\n/* jshint +W101 */\nfunction bind(self, fn) {\n var curryArgs = arguments.length > 2 ? sliceArgs(arguments, 2) : [];\n if (isFunction(fn) && !(fn instanceof RegExp)) {\n return curryArgs.length\n ? function() {\n return arguments.length\n ? fn.apply(self, concat(curryArgs, arguments, 0))\n : fn.apply(self, curryArgs);\n }\n : function() {\n return arguments.length\n ? fn.apply(self, arguments)\n : fn.call(self);\n };\n } else {\n // in IE, native methods are not functions so they cannot be bound (note: they don't need to be)\n return fn;\n }\n}\n\n\nfunction toJsonReplacer(key, value) {\n var val = value;\n\n if (typeof key === 'string' && key.charAt(0) === '$' && key.charAt(1) === '$') {\n val = undefined;\n } else if (isWindow(value)) {\n val = '$WINDOW';\n } else if (value && document === value) {\n val = '$DOCUMENT';\n } else if (isScope(value)) {\n val = '$SCOPE';\n }\n\n return val;\n}\n\n\n/**\n * @ngdoc function\n * @name angular.toJson\n * @module ng\n * @kind function\n *\n * @description\n * Serializes input into a JSON-formatted string. Properties with leading $$ characters will be\n * stripped since angular uses this notation internally.\n *\n * @param {Object|Array|Date|string|number} obj Input to be serialized into JSON.\n * @param {boolean|number} [pretty=2] If set to true, the JSON output will contain newlines and whitespace.\n * If set to an integer, the JSON output will contain that many spaces per indentation.\n * @returns {string|undefined} JSON-ified string representing `obj`.\n */\nfunction toJson(obj, pretty) {\n if (typeof obj === 'undefined') return undefined;\n if (!isNumber(pretty)) {\n pretty = pretty ? 2 : null;\n }\n return JSON.stringify(obj, toJsonReplacer, pretty);\n}\n\n\n/**\n * @ngdoc function\n * @name angular.fromJson\n * @module ng\n * @kind function\n *\n * @description\n * Deserializes a JSON string.\n *\n * @param {string} json JSON string to deserialize.\n * @returns {Object|Array|string|number} Deserialized JSON string.\n */\nfunction fromJson(json) {\n return isString(json)\n ? JSON.parse(json)\n : json;\n}\n\n\nfunction timezoneToOffset(timezone, fallback) {\n var requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\n\n\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\n\n\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n reverse = reverse ? -1 : 1;\n var timezoneOffset = timezoneToOffset(timezone, date.getTimezoneOffset());\n return addDateMinutes(date, reverse * (timezoneOffset - date.getTimezoneOffset()));\n}\n\n\n/**\n * @returns {string} Returns the string representation of the element.\n */\nfunction startingTag(element) {\n element = jqLite(element).clone();\n try {\n // turns out IE does not let you set .html() on elements which\n // are not allowed to have children. So we just ignore it.\n element.empty();\n } catch (e) {}\n var elemHtml = jqLite('
    ').append(element).html();\n try {\n return element[0].nodeType === NODE_TYPE_TEXT ? lowercase(elemHtml) :\n elemHtml.\n match(/^(<[^>]+>)/)[1].\n replace(/^<([\\w\\-]+)/, function(match, nodeName) { return '<' + lowercase(nodeName); });\n } catch (e) {\n return lowercase(elemHtml);\n }\n\n}\n\n\n/////////////////////////////////////////////////\n\n/**\n * Tries to decode the URI component without throwing an exception.\n *\n * @private\n * @param str value potential URI component to check.\n * @returns {boolean} True if `value` can be decoded\n * with the decodeURIComponent function.\n */\nfunction tryDecodeURIComponent(value) {\n try {\n return decodeURIComponent(value);\n } catch (e) {\n // Ignore any invalid uri component\n }\n}\n\n\n/**\n * Parses an escaped url query string into key-value pairs.\n * @returns {Object.}\n */\nfunction parseKeyValue(/**string*/keyValue) {\n var obj = {}, key_value, key;\n forEach((keyValue || \"\").split('&'), function(keyValue) {\n if (keyValue) {\n key_value = keyValue.replace(/\\+/g,'%20').split('=');\n key = tryDecodeURIComponent(key_value[0]);\n if (isDefined(key)) {\n var val = isDefined(key_value[1]) ? tryDecodeURIComponent(key_value[1]) : true;\n if (!hasOwnProperty.call(obj, key)) {\n obj[key] = val;\n } else if (isArray(obj[key])) {\n obj[key].push(val);\n } else {\n obj[key] = [obj[key],val];\n }\n }\n }\n });\n return obj;\n}\n\nfunction toKeyValue(obj) {\n var parts = [];\n forEach(obj, function(value, key) {\n if (isArray(value)) {\n forEach(value, function(arrayValue) {\n parts.push(encodeUriQuery(key, true) +\n (arrayValue === true ? '' : '=' + encodeUriQuery(arrayValue, true)));\n });\n } else {\n parts.push(encodeUriQuery(key, true) +\n (value === true ? '' : '=' + encodeUriQuery(value, true)));\n }\n });\n return parts.length ? parts.join('&') : '';\n}\n\n\n/**\n * We need our custom method because encodeURIComponent is too aggressive and doesn't follow\n * http://www.ietf.org/rfc/rfc3986.txt with regards to the character set (pchar) allowed in path\n * segments:\n * segment = *pchar\n * pchar = unreserved / pct-encoded / sub-delims / \":\" / \"@\"\n * pct-encoded = \"%\" HEXDIG HEXDIG\n * unreserved = ALPHA / DIGIT / \"-\" / \".\" / \"_\" / \"~\"\n * sub-delims = \"!\" / \"$\" / \"&\" / \"'\" / \"(\" / \")\"\n * / \"*\" / \"+\" / \",\" / \";\" / \"=\"\n */\nfunction encodeUriSegment(val) {\n return encodeUriQuery(val, true).\n replace(/%26/gi, '&').\n replace(/%3D/gi, '=').\n replace(/%2B/gi, '+');\n}\n\n\n/**\n * This method is intended for encoding *key* or *value* parts of query component. We need a custom\n * method because encodeURIComponent is too aggressive and encodes stuff that doesn't have to be\n * encoded per http://tools.ietf.org/html/rfc3986:\n * query = *( pchar / \"/\" / \"?\" )\n * pchar = unreserved / pct-encoded / sub-delims / \":\" / \"@\"\n * unreserved = ALPHA / DIGIT / \"-\" / \".\" / \"_\" / \"~\"\n * pct-encoded = \"%\" HEXDIG HEXDIG\n * sub-delims = \"!\" / \"$\" / \"&\" / \"'\" / \"(\" / \")\"\n * / \"*\" / \"+\" / \",\" / \";\" / \"=\"\n */\nfunction encodeUriQuery(val, pctEncodeSpaces) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%3B/gi, ';').\n replace(/%20/g, (pctEncodeSpaces ? '%20' : '+'));\n}\n\nvar ngAttrPrefixes = ['ng-', 'data-ng-', 'ng:', 'x-ng-'];\n\nfunction getNgAttribute(element, ngAttr) {\n var attr, i, ii = ngAttrPrefixes.length;\n for (i = 0; i < ii; ++i) {\n attr = ngAttrPrefixes[i] + ngAttr;\n if (isString(attr = element.getAttribute(attr))) {\n return attr;\n }\n }\n return null;\n}\n\n/**\n * @ngdoc directive\n * @name ngApp\n * @module ng\n *\n * @element ANY\n * @param {angular.Module} ngApp an optional application\n * {@link angular.module module} name to load.\n * @param {boolean=} ngStrictDi if this attribute is present on the app element, the injector will be\n * created in \"strict-di\" mode. This means that the application will fail to invoke functions which\n * do not use explicit function annotation (and are thus unsuitable for minification), as described\n * in {@link guide/di the Dependency Injection guide}, and useful debugging info will assist in\n * tracking down the root of these bugs.\n *\n * @description\n *\n * Use this directive to **auto-bootstrap** an AngularJS application. The `ngApp` directive\n * designates the **root element** of the application and is typically placed near the root element\n * of the page - e.g. on the `` or `` tags.\n *\n * Only one AngularJS application can be auto-bootstrapped per HTML document. The first `ngApp`\n * found in the document will be used to define the root element to auto-bootstrap as an\n * application. To run multiple applications in an HTML document you must manually bootstrap them using\n * {@link angular.bootstrap} instead. AngularJS applications cannot be nested within each other.\n *\n * You can specify an **AngularJS module** to be used as the root module for the application. This\n * module will be loaded into the {@link auto.$injector} when the application is bootstrapped. It\n * should contain the application code needed or have dependencies on other modules that will\n * contain the code. See {@link angular.module} for more information.\n *\n * In the example below if the `ngApp` directive were not placed on the `html` element then the\n * document would not be compiled, the `AppController` would not be instantiated and the `{{ a+b }}`\n * would not be resolved to `3`.\n *\n * `ngApp` is the easiest, and most common way to bootstrap an application.\n *\n \n \n
    \n I can add: {{a}} + {{b}} = {{ a+b }}\n
    \n
    \n \n angular.module('ngAppDemo', []).controller('ngAppDemoController', function($scope) {\n $scope.a = 1;\n $scope.b = 2;\n });\n \n
    \n *\n * Using `ngStrictDi`, you would see something like this:\n *\n \n \n
    \n
    \n I can add: {{a}} + {{b}} = {{ a+b }}\n\n

    This renders because the controller does not fail to\n instantiate, by using explicit annotation style (see\n script.js for details)\n

    \n
    \n\n
    \n Name:
    \n Hello, {{name}}!\n\n

    This renders because the controller does not fail to\n instantiate, by using explicit annotation style\n (see script.js for details)\n

    \n
    \n\n
    \n I can add: {{a}} + {{b}} = {{ a+b }}\n\n

    The controller could not be instantiated, due to relying\n on automatic function annotations (which are disabled in\n strict mode). As such, the content of this section is not\n interpolated, and there should be an error in your web console.\n

    \n
    \n
    \n
    \n \n angular.module('ngAppStrictDemo', [])\n // BadController will fail to instantiate, due to relying on automatic function annotation,\n // rather than an explicit annotation\n .controller('BadController', function($scope) {\n $scope.a = 1;\n $scope.b = 2;\n })\n // Unlike BadController, GoodController1 and GoodController2 will not fail to be instantiated,\n // due to using explicit annotations using the array style and $inject property, respectively.\n .controller('GoodController1', ['$scope', function($scope) {\n $scope.a = 1;\n $scope.b = 2;\n }])\n .controller('GoodController2', GoodController2);\n function GoodController2($scope) {\n $scope.name = \"World\";\n }\n GoodController2.$inject = ['$scope'];\n \n \n div[ng-controller] {\n margin-bottom: 1em;\n -webkit-border-radius: 4px;\n border-radius: 4px;\n border: 1px solid;\n padding: .5em;\n }\n div[ng-controller^=Good] {\n border-color: #d6e9c6;\n background-color: #dff0d8;\n color: #3c763d;\n }\n div[ng-controller^=Bad] {\n border-color: #ebccd1;\n background-color: #f2dede;\n color: #a94442;\n margin-bottom: 0;\n }\n \n
    \n */\nfunction angularInit(element, bootstrap) {\n var appElement,\n module,\n config = {};\n\n // The element `element` has priority over any other element\n forEach(ngAttrPrefixes, function(prefix) {\n var name = prefix + 'app';\n\n if (!appElement && element.hasAttribute && element.hasAttribute(name)) {\n appElement = element;\n module = element.getAttribute(name);\n }\n });\n forEach(ngAttrPrefixes, function(prefix) {\n var name = prefix + 'app';\n var candidate;\n\n if (!appElement && (candidate = element.querySelector('[' + name.replace(':', '\\\\:') + ']'))) {\n appElement = candidate;\n module = candidate.getAttribute(name);\n }\n });\n if (appElement) {\n config.strictDi = getNgAttribute(appElement, \"strict-di\") !== null;\n bootstrap(appElement, module ? [module] : [], config);\n }\n}\n\n/**\n * @ngdoc function\n * @name angular.bootstrap\n * @module ng\n * @description\n * Use this function to manually start up angular application.\n *\n * See: {@link guide/bootstrap Bootstrap}\n *\n * Note that Protractor based end-to-end tests cannot use this function to bootstrap manually.\n * They must use {@link ng.directive:ngApp ngApp}.\n *\n * Angular will detect if it has been loaded into the browser more than once and only allow the\n * first loaded script to be bootstrapped and will report a warning to the browser console for\n * each of the subsequent scripts. This prevents strange results in applications, where otherwise\n * multiple instances of Angular try to work on the DOM.\n *\n * ```html\n * \n * \n * \n *
    \n * {{greeting}}\n *
    \n *\n * \n * \n * \n * \n * ```\n *\n * @param {DOMElement} element DOM element which is the root of angular application.\n * @param {Array=} modules an array of modules to load into the application.\n * Each item in the array should be the name of a predefined module or a (DI annotated)\n * function that will be invoked by the injector as a `config` block.\n * See: {@link angular.module modules}\n * @param {Object=} config an object for defining configuration options for the application. The\n * following keys are supported:\n *\n * * `strictDi` - disable automatic function annotation for the application. This is meant to\n * assist in finding bugs which break minified code. Defaults to `false`.\n *\n * @returns {auto.$injector} Returns the newly created injector for this app.\n */\nfunction bootstrap(element, modules, config) {\n if (!isObject(config)) config = {};\n var defaultConfig = {\n strictDi: false\n };\n config = extend(defaultConfig, config);\n var doBootstrap = function() {\n element = jqLite(element);\n\n if (element.injector()) {\n var tag = (element[0] === document) ? 'document' : startingTag(element);\n //Encode angle brackets to prevent input from being sanitized to empty string #8683\n throw ngMinErr(\n 'btstrpd',\n \"App Already Bootstrapped with this Element '{0}'\",\n tag.replace(//,'>'));\n }\n\n modules = modules || [];\n modules.unshift(['$provide', function($provide) {\n $provide.value('$rootElement', element);\n }]);\n\n if (config.debugInfoEnabled) {\n // Pushing so that this overrides `debugInfoEnabled` setting defined in user's `modules`.\n modules.push(['$compileProvider', function($compileProvider) {\n $compileProvider.debugInfoEnabled(true);\n }]);\n }\n\n modules.unshift('ng');\n var injector = createInjector(modules, config.strictDi);\n injector.invoke(['$rootScope', '$rootElement', '$compile', '$injector',\n function bootstrapApply(scope, element, compile, injector) {\n scope.$apply(function() {\n element.data('$injector', injector);\n compile(element)(scope);\n });\n }]\n );\n return injector;\n };\n\n var NG_ENABLE_DEBUG_INFO = /^NG_ENABLE_DEBUG_INFO!/;\n var NG_DEFER_BOOTSTRAP = /^NG_DEFER_BOOTSTRAP!/;\n\n if (window && NG_ENABLE_DEBUG_INFO.test(window.name)) {\n config.debugInfoEnabled = true;\n window.name = window.name.replace(NG_ENABLE_DEBUG_INFO, '');\n }\n\n if (window && !NG_DEFER_BOOTSTRAP.test(window.name)) {\n return doBootstrap();\n }\n\n window.name = window.name.replace(NG_DEFER_BOOTSTRAP, '');\n angular.resumeBootstrap = function(extraModules) {\n forEach(extraModules, function(module) {\n modules.push(module);\n });\n return doBootstrap();\n };\n\n if (isFunction(angular.resumeDeferredBootstrap)) {\n angular.resumeDeferredBootstrap();\n }\n}\n\n/**\n * @ngdoc function\n * @name angular.reloadWithDebugInfo\n * @module ng\n * @description\n * Use this function to reload the current application with debug information turned on.\n * This takes precedence over a call to `$compileProvider.debugInfoEnabled(false)`.\n *\n * See {@link ng.$compileProvider#debugInfoEnabled} for more.\n */\nfunction reloadWithDebugInfo() {\n window.name = 'NG_ENABLE_DEBUG_INFO!' + window.name;\n window.location.reload();\n}\n\n/**\n * @name angular.getTestability\n * @module ng\n * @description\n * Get the testability service for the instance of Angular on the given\n * element.\n * @param {DOMElement} element DOM element which is the root of angular application.\n */\nfunction getTestability(rootElement) {\n var injector = angular.element(rootElement).injector();\n if (!injector) {\n throw ngMinErr('test',\n 'no injector found for element argument to getTestability');\n }\n return injector.get('$$testability');\n}\n\nvar SNAKE_CASE_REGEXP = /[A-Z]/g;\nfunction snake_case(name, separator) {\n separator = separator || '_';\n return name.replace(SNAKE_CASE_REGEXP, function(letter, pos) {\n return (pos ? separator : '') + letter.toLowerCase();\n });\n}\n\nvar bindJQueryFired = false;\nvar skipDestroyOnNextJQueryCleanData;\nfunction bindJQuery() {\n var originalCleanData;\n\n if (bindJQueryFired) {\n return;\n }\n\n // bind to jQuery if present;\n var jqName = jq();\n jQuery = window.jQuery; // use default jQuery.\n if (isDefined(jqName)) { // `ngJq` present\n jQuery = jqName === null ? undefined : window[jqName]; // if empty; use jqLite. if not empty, use jQuery specified by `ngJq`.\n }\n\n // Use jQuery if it exists with proper functionality, otherwise default to us.\n // Angular 1.2+ requires jQuery 1.7+ for on()/off() support.\n // Angular 1.3+ technically requires at least jQuery 2.1+ but it may work with older\n // versions. It will not work for sure with jQuery <1.7, though.\n if (jQuery && jQuery.fn.on) {\n jqLite = jQuery;\n extend(jQuery.fn, {\n scope: JQLitePrototype.scope,\n isolateScope: JQLitePrototype.isolateScope,\n controller: JQLitePrototype.controller,\n injector: JQLitePrototype.injector,\n inheritedData: JQLitePrototype.inheritedData\n });\n\n // All nodes removed from the DOM via various jQuery APIs like .remove()\n // are passed through jQuery.cleanData. Monkey-patch this method to fire\n // the $destroy event on all removed nodes.\n originalCleanData = jQuery.cleanData;\n jQuery.cleanData = function(elems) {\n var events;\n if (!skipDestroyOnNextJQueryCleanData) {\n for (var i = 0, elem; (elem = elems[i]) != null; i++) {\n events = jQuery._data(elem, \"events\");\n if (events && events.$destroy) {\n jQuery(elem).triggerHandler('$destroy');\n }\n }\n } else {\n skipDestroyOnNextJQueryCleanData = false;\n }\n originalCleanData(elems);\n };\n } else {\n jqLite = JQLite;\n }\n\n angular.element = jqLite;\n\n // Prevent double-proxying.\n bindJQueryFired = true;\n}\n\n/**\n * throw error if the argument is falsy.\n */\nfunction assertArg(arg, name, reason) {\n if (!arg) {\n throw ngMinErr('areq', \"Argument '{0}' is {1}\", (name || '?'), (reason || \"required\"));\n }\n return arg;\n}\n\nfunction assertArgFn(arg, name, acceptArrayAnnotation) {\n if (acceptArrayAnnotation && isArray(arg)) {\n arg = arg[arg.length - 1];\n }\n\n assertArg(isFunction(arg), name, 'not a function, got ' +\n (arg && typeof arg === 'object' ? arg.constructor.name || 'Object' : typeof arg));\n return arg;\n}\n\n/**\n * throw error if the name given is hasOwnProperty\n * @param {String} name the name to test\n * @param {String} context the context in which the name is used, such as module or directive\n */\nfunction assertNotHasOwnProperty(name, context) {\n if (name === 'hasOwnProperty') {\n throw ngMinErr('badname', \"hasOwnProperty is not a valid {0} name\", context);\n }\n}\n\n/**\n * Return the value accessible from the object by path. Any undefined traversals are ignored\n * @param {Object} obj starting object\n * @param {String} path path to traverse\n * @param {boolean} [bindFnToScope=true]\n * @returns {Object} value as accessible by path\n */\n//TODO(misko): this function needs to be removed\nfunction getter(obj, path, bindFnToScope) {\n if (!path) return obj;\n var keys = path.split('.');\n var key;\n var lastInstance = obj;\n var len = keys.length;\n\n for (var i = 0; i < len; i++) {\n key = keys[i];\n if (obj) {\n obj = (lastInstance = obj)[key];\n }\n }\n if (!bindFnToScope && isFunction(obj)) {\n return bind(lastInstance, obj);\n }\n return obj;\n}\n\n/**\n * Return the DOM siblings between the first and last node in the given array.\n * @param {Array} array like object\n * @returns {jqLite} jqLite collection containing the nodes\n */\nfunction getBlockNodes(nodes) {\n // TODO(perf): just check if all items in `nodes` are siblings and if they are return the original\n // collection, otherwise update the original collection.\n var node = nodes[0];\n var endNode = nodes[nodes.length - 1];\n var blockNodes = [node];\n\n do {\n node = node.nextSibling;\n if (!node) break;\n blockNodes.push(node);\n } while (node !== endNode);\n\n return jqLite(blockNodes);\n}\n\n\n/**\n * Creates a new object without a prototype. This object is useful for lookup without having to\n * guard against prototypically inherited properties via hasOwnProperty.\n *\n * Related micro-benchmarks:\n * - http://jsperf.com/object-create2\n * - http://jsperf.com/proto-map-lookup/2\n * - http://jsperf.com/for-in-vs-object-keys2\n *\n * @returns {Object}\n */\nfunction createMap() {\n return Object.create(null);\n}\n\nvar NODE_TYPE_ELEMENT = 1;\nvar NODE_TYPE_ATTRIBUTE = 2;\nvar NODE_TYPE_TEXT = 3;\nvar NODE_TYPE_COMMENT = 8;\nvar NODE_TYPE_DOCUMENT = 9;\nvar NODE_TYPE_DOCUMENT_FRAGMENT = 11;\n\n/**\n * @ngdoc type\n * @name angular.Module\n * @module ng\n * @description\n *\n * Interface for configuring angular {@link angular.module modules}.\n */\n\nfunction setupModuleLoader(window) {\n\n var $injectorMinErr = minErr('$injector');\n var ngMinErr = minErr('ng');\n\n function ensure(obj, name, factory) {\n return obj[name] || (obj[name] = factory());\n }\n\n var angular = ensure(window, 'angular', Object);\n\n // We need to expose `angular.$$minErr` to modules such as `ngResource` that reference it during bootstrap\n angular.$$minErr = angular.$$minErr || minErr;\n\n return ensure(angular, 'module', function() {\n /** @type {Object.} */\n var modules = {};\n\n /**\n * @ngdoc function\n * @name angular.module\n * @module ng\n * @description\n *\n * The `angular.module` is a global place for creating, registering and retrieving Angular\n * modules.\n * All modules (angular core or 3rd party) that should be available to an application must be\n * registered using this mechanism.\n *\n * When passed two or more arguments, a new module is created. If passed only one argument, an\n * existing module (the name passed as the first argument to `module`) is retrieved.\n *\n *\n * # Module\n *\n * A module is a collection of services, directives, controllers, filters, and configuration information.\n * `angular.module` is used to configure the {@link auto.$injector $injector}.\n *\n * ```js\n * // Create a new module\n * var myModule = angular.module('myModule', []);\n *\n * // register a new service\n * myModule.value('appName', 'MyCoolApp');\n *\n * // configure existing services inside initialization blocks.\n * myModule.config(['$locationProvider', function($locationProvider) {\n * // Configure existing providers\n * $locationProvider.hashPrefix('!');\n * }]);\n * ```\n *\n * Then you can create an injector and load your modules like this:\n *\n * ```js\n * var injector = angular.injector(['ng', 'myModule'])\n * ```\n *\n * However it's more likely that you'll just use\n * {@link ng.directive:ngApp ngApp} or\n * {@link angular.bootstrap} to simplify this process for you.\n *\n * @param {!string} name The name of the module to create or retrieve.\n * @param {!Array.=} requires If specified then new module is being created. If\n * unspecified then the module is being retrieved for further configuration.\n * @param {Function=} configFn Optional configuration function for the module. Same as\n * {@link angular.Module#config Module#config()}.\n * @returns {module} new module with the {@link angular.Module} api.\n */\n return function module(name, requires, configFn) {\n var assertNotHasOwnProperty = function(name, context) {\n if (name === 'hasOwnProperty') {\n throw ngMinErr('badname', 'hasOwnProperty is not a valid {0} name', context);\n }\n };\n\n assertNotHasOwnProperty(name, 'module');\n if (requires && modules.hasOwnProperty(name)) {\n modules[name] = null;\n }\n return ensure(modules, name, function() {\n if (!requires) {\n throw $injectorMinErr('nomod', \"Module '{0}' is not available! You either misspelled \" +\n \"the module name or forgot to load it. If registering a module ensure that you \" +\n \"specify the dependencies as the second argument.\", name);\n }\n\n /** @type {!Array.>} */\n var invokeQueue = [];\n\n /** @type {!Array.} */\n var configBlocks = [];\n\n /** @type {!Array.} */\n var runBlocks = [];\n\n var config = invokeLater('$injector', 'invoke', 'push', configBlocks);\n\n /** @type {angular.Module} */\n var moduleInstance = {\n // Private state\n _invokeQueue: invokeQueue,\n _configBlocks: configBlocks,\n _runBlocks: runBlocks,\n\n /**\n * @ngdoc property\n * @name angular.Module#requires\n * @module ng\n *\n * @description\n * Holds the list of modules which the injector will load before the current module is\n * loaded.\n */\n requires: requires,\n\n /**\n * @ngdoc property\n * @name angular.Module#name\n * @module ng\n *\n * @description\n * Name of the module.\n */\n name: name,\n\n\n /**\n * @ngdoc method\n * @name angular.Module#provider\n * @module ng\n * @param {string} name service name\n * @param {Function} providerType Construction function for creating new instance of the\n * service.\n * @description\n * See {@link auto.$provide#provider $provide.provider()}.\n */\n provider: invokeLaterAndSetModuleName('$provide', 'provider'),\n\n /**\n * @ngdoc method\n * @name angular.Module#factory\n * @module ng\n * @param {string} name service name\n * @param {Function} providerFunction Function for creating new instance of the service.\n * @description\n * See {@link auto.$provide#factory $provide.factory()}.\n */\n factory: invokeLaterAndSetModuleName('$provide', 'factory'),\n\n /**\n * @ngdoc method\n * @name angular.Module#service\n * @module ng\n * @param {string} name service name\n * @param {Function} constructor A constructor function that will be instantiated.\n * @description\n * See {@link auto.$provide#service $provide.service()}.\n */\n service: invokeLaterAndSetModuleName('$provide', 'service'),\n\n /**\n * @ngdoc method\n * @name angular.Module#value\n * @module ng\n * @param {string} name service name\n * @param {*} object Service instance object.\n * @description\n * See {@link auto.$provide#value $provide.value()}.\n */\n value: invokeLater('$provide', 'value'),\n\n /**\n * @ngdoc method\n * @name angular.Module#constant\n * @module ng\n * @param {string} name constant name\n * @param {*} object Constant value.\n * @description\n * Because the constant are fixed, they get applied before other provide methods.\n * See {@link auto.$provide#constant $provide.constant()}.\n */\n constant: invokeLater('$provide', 'constant', 'unshift'),\n\n /**\n * @ngdoc method\n * @name angular.Module#decorator\n * @module ng\n * @param {string} The name of the service to decorate.\n * @param {Function} This function will be invoked when the service needs to be\n * instantiated and should return the decorated service instance.\n * @description\n * See {@link auto.$provide#decorator $provide.decorator()}.\n */\n decorator: invokeLaterAndSetModuleName('$provide', 'decorator'),\n\n /**\n * @ngdoc method\n * @name angular.Module#animation\n * @module ng\n * @param {string} name animation name\n * @param {Function} animationFactory Factory function for creating new instance of an\n * animation.\n * @description\n *\n * **NOTE**: animations take effect only if the **ngAnimate** module is loaded.\n *\n *\n * Defines an animation hook that can be later used with\n * {@link $animate $animate} service and directives that use this service.\n *\n * ```js\n * module.animation('.animation-name', function($inject1, $inject2) {\n * return {\n * eventName : function(element, done) {\n * //code to run the animation\n * //once complete, then run done()\n * return function cancellationFunction(element) {\n * //code to cancel the animation\n * }\n * }\n * }\n * })\n * ```\n *\n * See {@link ng.$animateProvider#register $animateProvider.register()} and\n * {@link ngAnimate ngAnimate module} for more information.\n */\n animation: invokeLaterAndSetModuleName('$animateProvider', 'register'),\n\n /**\n * @ngdoc method\n * @name angular.Module#filter\n * @module ng\n * @param {string} name Filter name - this must be a valid angular expression identifier\n * @param {Function} filterFactory Factory function for creating new instance of filter.\n * @description\n * See {@link ng.$filterProvider#register $filterProvider.register()}.\n *\n *
    \n * **Note:** Filter names must be valid angular {@link expression} identifiers, such as `uppercase` or `orderBy`.\n * Names with special characters, such as hyphens and dots, are not allowed. If you wish to namespace\n * your filters, then you can use capitalization (`myappSubsectionFilterx`) or underscores\n * (`myapp_subsection_filterx`).\n *
    \n */\n filter: invokeLaterAndSetModuleName('$filterProvider', 'register'),\n\n /**\n * @ngdoc method\n * @name angular.Module#controller\n * @module ng\n * @param {string|Object} name Controller name, or an object map of controllers where the\n * keys are the names and the values are the constructors.\n * @param {Function} constructor Controller constructor function.\n * @description\n * See {@link ng.$controllerProvider#register $controllerProvider.register()}.\n */\n controller: invokeLaterAndSetModuleName('$controllerProvider', 'register'),\n\n /**\n * @ngdoc method\n * @name angular.Module#directive\n * @module ng\n * @param {string|Object} name Directive name, or an object map of directives where the\n * keys are the names and the values are the factories.\n * @param {Function} directiveFactory Factory function for creating new instance of\n * directives.\n * @description\n * See {@link ng.$compileProvider#directive $compileProvider.directive()}.\n */\n directive: invokeLaterAndSetModuleName('$compileProvider', 'directive'),\n\n /**\n * @ngdoc method\n * @name angular.Module#config\n * @module ng\n * @param {Function} configFn Execute this function on module load. Useful for service\n * configuration.\n * @description\n * Use this method to register work which needs to be performed on module loading.\n * For more about how to configure services, see\n * {@link providers#provider-recipe Provider Recipe}.\n */\n config: config,\n\n /**\n * @ngdoc method\n * @name angular.Module#run\n * @module ng\n * @param {Function} initializationFn Execute this function after injector creation.\n * Useful for application initialization.\n * @description\n * Use this method to register work which should be performed when the injector is done\n * loading all modules.\n */\n run: function(block) {\n runBlocks.push(block);\n return this;\n }\n };\n\n if (configFn) {\n config(configFn);\n }\n\n return moduleInstance;\n\n /**\n * @param {string} provider\n * @param {string} method\n * @param {String=} insertMethod\n * @returns {angular.Module}\n */\n function invokeLater(provider, method, insertMethod, queue) {\n if (!queue) queue = invokeQueue;\n return function() {\n queue[insertMethod || 'push']([provider, method, arguments]);\n return moduleInstance;\n };\n }\n\n /**\n * @param {string} provider\n * @param {string} method\n * @returns {angular.Module}\n */\n function invokeLaterAndSetModuleName(provider, method) {\n return function(recipeName, factoryFunction) {\n if (factoryFunction && isFunction(factoryFunction)) factoryFunction.$$moduleName = name;\n invokeQueue.push([provider, method, arguments]);\n return moduleInstance;\n };\n }\n });\n };\n });\n\n}\n\n/* global: toDebugString: true */\n\nfunction serializeObject(obj) {\n var seen = [];\n\n return JSON.stringify(obj, function(key, val) {\n val = toJsonReplacer(key, val);\n if (isObject(val)) {\n\n if (seen.indexOf(val) >= 0) return '<>';\n\n seen.push(val);\n }\n return val;\n });\n}\n\nfunction toDebugString(obj) {\n if (typeof obj === 'function') {\n return obj.toString().replace(/ \\{[\\s\\S]*$/, '');\n } else if (typeof obj === 'undefined') {\n return 'undefined';\n } else if (typeof obj !== 'string') {\n return serializeObject(obj);\n }\n return obj;\n}\n\n/* global angularModule: true,\n version: true,\n\n $LocaleProvider,\n $CompileProvider,\n\n htmlAnchorDirective,\n inputDirective,\n inputDirective,\n formDirective,\n scriptDirective,\n selectDirective,\n styleDirective,\n optionDirective,\n ngBindDirective,\n ngBindHtmlDirective,\n ngBindTemplateDirective,\n ngClassDirective,\n ngClassEvenDirective,\n ngClassOddDirective,\n ngCspDirective,\n ngCloakDirective,\n ngControllerDirective,\n ngFormDirective,\n ngHideDirective,\n ngIfDirective,\n ngIncludeDirective,\n ngIncludeFillContentDirective,\n ngInitDirective,\n ngNonBindableDirective,\n ngPluralizeDirective,\n ngRepeatDirective,\n ngShowDirective,\n ngStyleDirective,\n ngSwitchDirective,\n ngSwitchWhenDirective,\n ngSwitchDefaultDirective,\n ngOptionsDirective,\n ngTranscludeDirective,\n ngModelDirective,\n ngListDirective,\n ngChangeDirective,\n patternDirective,\n patternDirective,\n requiredDirective,\n requiredDirective,\n minlengthDirective,\n minlengthDirective,\n maxlengthDirective,\n maxlengthDirective,\n ngValueDirective,\n ngModelOptionsDirective,\n ngAttributeAliasDirectives,\n ngEventDirectives,\n\n $AnchorScrollProvider,\n $AnimateProvider,\n $$CoreAnimateQueueProvider,\n $$CoreAnimateRunnerProvider,\n $BrowserProvider,\n $CacheFactoryProvider,\n $ControllerProvider,\n $DocumentProvider,\n $ExceptionHandlerProvider,\n $FilterProvider,\n $InterpolateProvider,\n $IntervalProvider,\n $$HashMapProvider,\n $HttpProvider,\n $HttpParamSerializerProvider,\n $HttpParamSerializerJQLikeProvider,\n $HttpBackendProvider,\n $LocationProvider,\n $LogProvider,\n $ParseProvider,\n $RootScopeProvider,\n $QProvider,\n $$QProvider,\n $$SanitizeUriProvider,\n $SceProvider,\n $SceDelegateProvider,\n $SnifferProvider,\n $TemplateCacheProvider,\n $TemplateRequestProvider,\n $$TestabilityProvider,\n $TimeoutProvider,\n $$RAFProvider,\n $$AsyncCallbackProvider,\n $WindowProvider,\n $$jqLiteProvider,\n $$CookieReaderProvider\n*/\n\n\n/**\n * @ngdoc object\n * @name angular.version\n * @module ng\n * @description\n * An object that contains information about the current AngularJS version. This object has the\n * following properties:\n *\n * - `full` – `{string}` – Full version string, such as \"0.9.18\".\n * - `major` – `{number}` – Major version number, such as \"0\".\n * - `minor` – `{number}` – Minor version number, such as \"9\".\n * - `dot` – `{number}` – Dot version number, such as \"18\".\n * - `codeName` – `{string}` – Code name of the release, such as \"jiggling-armfat\".\n */\nvar version = {\n full: '1.4.2', // all of these placeholder strings will be replaced by grunt's\n major: 1, // package task\n minor: 4,\n dot: 2,\n codeName: 'nebular-readjustment'\n};\n\n\nfunction publishExternalAPI(angular) {\n extend(angular, {\n 'bootstrap': bootstrap,\n 'copy': copy,\n 'extend': extend,\n 'merge': merge,\n 'equals': equals,\n 'element': jqLite,\n 'forEach': forEach,\n 'injector': createInjector,\n 'noop': noop,\n 'bind': bind,\n 'toJson': toJson,\n 'fromJson': fromJson,\n 'identity': identity,\n 'isUndefined': isUndefined,\n 'isDefined': isDefined,\n 'isString': isString,\n 'isFunction': isFunction,\n 'isObject': isObject,\n 'isNumber': isNumber,\n 'isElement': isElement,\n 'isArray': isArray,\n 'version': version,\n 'isDate': isDate,\n 'lowercase': lowercase,\n 'uppercase': uppercase,\n 'callbacks': {counter: 0},\n 'getTestability': getTestability,\n '$$minErr': minErr,\n '$$csp': csp,\n 'reloadWithDebugInfo': reloadWithDebugInfo\n });\n\n angularModule = setupModuleLoader(window);\n try {\n angularModule('ngLocale');\n } catch (e) {\n angularModule('ngLocale', []).provider('$locale', $LocaleProvider);\n }\n\n angularModule('ng', ['ngLocale'], ['$provide',\n function ngModule($provide) {\n // $$sanitizeUriProvider needs to be before $compileProvider as it is used by it.\n $provide.provider({\n $$sanitizeUri: $$SanitizeUriProvider\n });\n $provide.provider('$compile', $CompileProvider).\n directive({\n a: htmlAnchorDirective,\n input: inputDirective,\n textarea: inputDirective,\n form: formDirective,\n script: scriptDirective,\n select: selectDirective,\n style: styleDirective,\n option: optionDirective,\n ngBind: ngBindDirective,\n ngBindHtml: ngBindHtmlDirective,\n ngBindTemplate: ngBindTemplateDirective,\n ngClass: ngClassDirective,\n ngClassEven: ngClassEvenDirective,\n ngClassOdd: ngClassOddDirective,\n ngCloak: ngCloakDirective,\n ngController: ngControllerDirective,\n ngForm: ngFormDirective,\n ngHide: ngHideDirective,\n ngIf: ngIfDirective,\n ngInclude: ngIncludeDirective,\n ngInit: ngInitDirective,\n ngNonBindable: ngNonBindableDirective,\n ngPluralize: ngPluralizeDirective,\n ngRepeat: ngRepeatDirective,\n ngShow: ngShowDirective,\n ngStyle: ngStyleDirective,\n ngSwitch: ngSwitchDirective,\n ngSwitchWhen: ngSwitchWhenDirective,\n ngSwitchDefault: ngSwitchDefaultDirective,\n ngOptions: ngOptionsDirective,\n ngTransclude: ngTranscludeDirective,\n ngModel: ngModelDirective,\n ngList: ngListDirective,\n ngChange: ngChangeDirective,\n pattern: patternDirective,\n ngPattern: patternDirective,\n required: requiredDirective,\n ngRequired: requiredDirective,\n minlength: minlengthDirective,\n ngMinlength: minlengthDirective,\n maxlength: maxlengthDirective,\n ngMaxlength: maxlengthDirective,\n ngValue: ngValueDirective,\n ngModelOptions: ngModelOptionsDirective\n }).\n directive({\n ngInclude: ngIncludeFillContentDirective\n }).\n directive(ngAttributeAliasDirectives).\n directive(ngEventDirectives);\n $provide.provider({\n $anchorScroll: $AnchorScrollProvider,\n $animate: $AnimateProvider,\n $$animateQueue: $$CoreAnimateQueueProvider,\n $$AnimateRunner: $$CoreAnimateRunnerProvider,\n $browser: $BrowserProvider,\n $cacheFactory: $CacheFactoryProvider,\n $controller: $ControllerProvider,\n $document: $DocumentProvider,\n $exceptionHandler: $ExceptionHandlerProvider,\n $filter: $FilterProvider,\n $interpolate: $InterpolateProvider,\n $interval: $IntervalProvider,\n $http: $HttpProvider,\n $httpParamSerializer: $HttpParamSerializerProvider,\n $httpParamSerializerJQLike: $HttpParamSerializerJQLikeProvider,\n $httpBackend: $HttpBackendProvider,\n $location: $LocationProvider,\n $log: $LogProvider,\n $parse: $ParseProvider,\n $rootScope: $RootScopeProvider,\n $q: $QProvider,\n $$q: $$QProvider,\n $sce: $SceProvider,\n $sceDelegate: $SceDelegateProvider,\n $sniffer: $SnifferProvider,\n $templateCache: $TemplateCacheProvider,\n $templateRequest: $TemplateRequestProvider,\n $$testability: $$TestabilityProvider,\n $timeout: $TimeoutProvider,\n $window: $WindowProvider,\n $$rAF: $$RAFProvider,\n $$asyncCallback: $$AsyncCallbackProvider,\n $$jqLite: $$jqLiteProvider,\n $$HashMap: $$HashMapProvider,\n $$cookieReader: $$CookieReaderProvider\n });\n }\n ]);\n}\n\n/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\n * Any commits to this file should be reviewed with security in mind. *\n * Changes to this file can potentially create security vulnerabilities. *\n * An approval from 2 Core members with history of modifying *\n * this file is required. *\n * *\n * Does the change somehow allow for arbitrary javascript to be executed? *\n * Or allows for someone to change the prototype of built-in objects? *\n * Or gives undesired access to variables likes document or window? *\n * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */\n\n/* global JQLitePrototype: true,\n addEventListenerFn: true,\n removeEventListenerFn: true,\n BOOLEAN_ATTR: true,\n ALIASED_ATTR: true,\n*/\n\n//////////////////////////////////\n//JQLite\n//////////////////////////////////\n\n/**\n * @ngdoc function\n * @name angular.element\n * @module ng\n * @kind function\n *\n * @description\n * Wraps a raw DOM element or HTML string as a [jQuery](http://jquery.com) element.\n *\n * If jQuery is available, `angular.element` is an alias for the\n * [jQuery](http://api.jquery.com/jQuery/) function. If jQuery is not available, `angular.element`\n * delegates to Angular's built-in subset of jQuery, called \"jQuery lite\" or \"jqLite.\"\n *\n *
    jqLite is a tiny, API-compatible subset of jQuery that allows\n * Angular to manipulate the DOM in a cross-browser compatible way. **jqLite** implements only the most\n * commonly needed functionality with the goal of having a very small footprint.
    \n *\n * To use `jQuery`, simply ensure it is loaded before the `angular.js` file.\n *\n *
    **Note:** all element references in Angular are always wrapped with jQuery or\n * jqLite; they are never raw DOM references.
    \n *\n * ## Angular's jqLite\n * jqLite provides only the following jQuery methods:\n *\n * - [`addClass()`](http://api.jquery.com/addClass/)\n * - [`after()`](http://api.jquery.com/after/)\n * - [`append()`](http://api.jquery.com/append/)\n * - [`attr()`](http://api.jquery.com/attr/) - Does not support functions as parameters\n * - [`bind()`](http://api.jquery.com/bind/) - Does not support namespaces, selectors or eventData\n * - [`children()`](http://api.jquery.com/children/) - Does not support selectors\n * - [`clone()`](http://api.jquery.com/clone/)\n * - [`contents()`](http://api.jquery.com/contents/)\n * - [`css()`](http://api.jquery.com/css/) - Only retrieves inline-styles, does not call `getComputedStyle()`. As a setter, does not convert numbers to strings or append 'px'.\n * - [`data()`](http://api.jquery.com/data/)\n * - [`detach()`](http://api.jquery.com/detach/)\n * - [`empty()`](http://api.jquery.com/empty/)\n * - [`eq()`](http://api.jquery.com/eq/)\n * - [`find()`](http://api.jquery.com/find/) - Limited to lookups by tag name\n * - [`hasClass()`](http://api.jquery.com/hasClass/)\n * - [`html()`](http://api.jquery.com/html/)\n * - [`next()`](http://api.jquery.com/next/) - Does not support selectors\n * - [`on()`](http://api.jquery.com/on/) - Does not support namespaces, selectors or eventData\n * - [`off()`](http://api.jquery.com/off/) - Does not support namespaces or selectors\n * - [`one()`](http://api.jquery.com/one/) - Does not support namespaces or selectors\n * - [`parent()`](http://api.jquery.com/parent/) - Does not support selectors\n * - [`prepend()`](http://api.jquery.com/prepend/)\n * - [`prop()`](http://api.jquery.com/prop/)\n * - [`ready()`](http://api.jquery.com/ready/)\n * - [`remove()`](http://api.jquery.com/remove/)\n * - [`removeAttr()`](http://api.jquery.com/removeAttr/)\n * - [`removeClass()`](http://api.jquery.com/removeClass/)\n * - [`removeData()`](http://api.jquery.com/removeData/)\n * - [`replaceWith()`](http://api.jquery.com/replaceWith/)\n * - [`text()`](http://api.jquery.com/text/)\n * - [`toggleClass()`](http://api.jquery.com/toggleClass/)\n * - [`triggerHandler()`](http://api.jquery.com/triggerHandler/) - Passes a dummy event object to handlers.\n * - [`unbind()`](http://api.jquery.com/unbind/) - Does not support namespaces\n * - [`val()`](http://api.jquery.com/val/)\n * - [`wrap()`](http://api.jquery.com/wrap/)\n *\n * ## jQuery/jqLite Extras\n * Angular also provides the following additional methods and events to both jQuery and jqLite:\n *\n * ### Events\n * - `$destroy` - AngularJS intercepts all jqLite/jQuery's DOM destruction apis and fires this event\n * on all DOM nodes being removed. This can be used to clean up any 3rd party bindings to the DOM\n * element before it is removed.\n *\n * ### Methods\n * - `controller(name)` - retrieves the controller of the current element or its parent. By default\n * retrieves controller associated with the `ngController` directive. If `name` is provided as\n * camelCase directive name, then the controller for this directive will be retrieved (e.g.\n * `'ngModel'`).\n * - `injector()` - retrieves the injector of the current element or its parent.\n * - `scope()` - retrieves the {@link ng.$rootScope.Scope scope} of the current\n * element or its parent. Requires {@link guide/production#disabling-debug-data Debug Data} to\n * be enabled.\n * - `isolateScope()` - retrieves an isolate {@link ng.$rootScope.Scope scope} if one is attached directly to the\n * current element. This getter should be used only on elements that contain a directive which starts a new isolate\n * scope. Calling `scope()` on this element always returns the original non-isolate scope.\n * Requires {@link guide/production#disabling-debug-data Debug Data} to be enabled.\n * - `inheritedData()` - same as `data()`, but walks up the DOM until a value is found or the top\n * parent element is reached.\n *\n * @param {string|DOMElement} element HTML string or DOMElement to be wrapped into jQuery.\n * @returns {Object} jQuery object.\n */\n\nJQLite.expando = 'ng339';\n\nvar jqCache = JQLite.cache = {},\n jqId = 1,\n addEventListenerFn = function(element, type, fn) {\n element.addEventListener(type, fn, false);\n },\n removeEventListenerFn = function(element, type, fn) {\n element.removeEventListener(type, fn, false);\n };\n\n/*\n * !!! This is an undocumented \"private\" function !!!\n */\nJQLite._data = function(node) {\n //jQuery always returns an object on cache miss\n return this.cache[node[this.expando]] || {};\n};\n\nfunction jqNextId() { return ++jqId; }\n\n\nvar SPECIAL_CHARS_REGEXP = /([\\:\\-\\_]+(.))/g;\nvar MOZ_HACK_REGEXP = /^moz([A-Z])/;\nvar MOUSE_EVENT_MAP= { mouseleave: \"mouseout\", mouseenter: \"mouseover\"};\nvar jqLiteMinErr = minErr('jqLite');\n\n/**\n * Converts snake_case to camelCase.\n * Also there is special case for Moz prefix starting with upper case letter.\n * @param name Name to normalize\n */\nfunction camelCase(name) {\n return name.\n replace(SPECIAL_CHARS_REGEXP, function(_, separator, letter, offset) {\n return offset ? letter.toUpperCase() : letter;\n }).\n replace(MOZ_HACK_REGEXP, 'Moz$1');\n}\n\nvar SINGLE_TAG_REGEXP = /^<(\\w+)\\s*\\/?>(?:<\\/\\1>|)$/;\nvar HTML_REGEXP = /<|&#?\\w+;/;\nvar TAG_NAME_REGEXP = /<([\\w:]+)/;\nvar XHTML_TAG_REGEXP = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\\w:]+)[^>]*)\\/>/gi;\n\nvar wrapMap = {\n 'option': [1, ''],\n\n 'thead': [1, '
    ', '
    '],\n 'col': [2, '', '
    '],\n 'tr': [2, '', '
    '],\n 'td': [3, '', '
    '],\n '_default': [0, \"\", \"\"]\n};\n\nwrapMap.optgroup = wrapMap.option;\nwrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;\nwrapMap.th = wrapMap.td;\n\n\nfunction jqLiteIsTextNode(html) {\n return !HTML_REGEXP.test(html);\n}\n\nfunction jqLiteAcceptsData(node) {\n // The window object can accept data but has no nodeType\n // Otherwise we are only interested in elements (1) and documents (9)\n var nodeType = node.nodeType;\n return nodeType === NODE_TYPE_ELEMENT || !nodeType || nodeType === NODE_TYPE_DOCUMENT;\n}\n\nfunction jqLiteHasData(node) {\n for (var key in jqCache[node.ng339]) {\n return true;\n }\n return false;\n}\n\nfunction jqLiteBuildFragment(html, context) {\n var tmp, tag, wrap,\n fragment = context.createDocumentFragment(),\n nodes = [], i;\n\n if (jqLiteIsTextNode(html)) {\n // Convert non-html into a text node\n nodes.push(context.createTextNode(html));\n } else {\n // Convert html into DOM nodes\n tmp = tmp || fragment.appendChild(context.createElement(\"div\"));\n tag = (TAG_NAME_REGEXP.exec(html) || [\"\", \"\"])[1].toLowerCase();\n wrap = wrapMap[tag] || wrapMap._default;\n tmp.innerHTML = wrap[1] + html.replace(XHTML_TAG_REGEXP, \"<$1>\") + wrap[2];\n\n // Descend through wrappers to the right content\n i = wrap[0];\n while (i--) {\n tmp = tmp.lastChild;\n }\n\n nodes = concat(nodes, tmp.childNodes);\n\n tmp = fragment.firstChild;\n tmp.textContent = \"\";\n }\n\n // Remove wrapper from fragment\n fragment.textContent = \"\";\n fragment.innerHTML = \"\"; // Clear inner HTML\n forEach(nodes, function(node) {\n fragment.appendChild(node);\n });\n\n return fragment;\n}\n\nfunction jqLiteParseHTML(html, context) {\n context = context || document;\n var parsed;\n\n if ((parsed = SINGLE_TAG_REGEXP.exec(html))) {\n return [context.createElement(parsed[1])];\n }\n\n if ((parsed = jqLiteBuildFragment(html, context))) {\n return parsed.childNodes;\n }\n\n return [];\n}\n\n/////////////////////////////////////////////\nfunction JQLite(element) {\n if (element instanceof JQLite) {\n return element;\n }\n\n var argIsString;\n\n if (isString(element)) {\n element = trim(element);\n argIsString = true;\n }\n if (!(this instanceof JQLite)) {\n if (argIsString && element.charAt(0) != '<') {\n throw jqLiteMinErr('nosel', 'Looking up elements via selectors is not supported by jqLite! See: http://docs.angularjs.org/api/angular.element');\n }\n return new JQLite(element);\n }\n\n if (argIsString) {\n jqLiteAddNodes(this, jqLiteParseHTML(element));\n } else {\n jqLiteAddNodes(this, element);\n }\n}\n\nfunction jqLiteClone(element) {\n return element.cloneNode(true);\n}\n\nfunction jqLiteDealoc(element, onlyDescendants) {\n if (!onlyDescendants) jqLiteRemoveData(element);\n\n if (element.querySelectorAll) {\n var descendants = element.querySelectorAll('*');\n for (var i = 0, l = descendants.length; i < l; i++) {\n jqLiteRemoveData(descendants[i]);\n }\n }\n}\n\nfunction jqLiteOff(element, type, fn, unsupported) {\n if (isDefined(unsupported)) throw jqLiteMinErr('offargs', 'jqLite#off() does not support the `selector` argument');\n\n var expandoStore = jqLiteExpandoStore(element);\n var events = expandoStore && expandoStore.events;\n var handle = expandoStore && expandoStore.handle;\n\n if (!handle) return; //no listeners registered\n\n if (!type) {\n for (type in events) {\n if (type !== '$destroy') {\n removeEventListenerFn(element, type, handle);\n }\n delete events[type];\n }\n } else {\n forEach(type.split(' '), function(type) {\n if (isDefined(fn)) {\n var listenerFns = events[type];\n arrayRemove(listenerFns || [], fn);\n if (listenerFns && listenerFns.length > 0) {\n return;\n }\n }\n\n removeEventListenerFn(element, type, handle);\n delete events[type];\n });\n }\n}\n\nfunction jqLiteRemoveData(element, name) {\n var expandoId = element.ng339;\n var expandoStore = expandoId && jqCache[expandoId];\n\n if (expandoStore) {\n if (name) {\n delete expandoStore.data[name];\n return;\n }\n\n if (expandoStore.handle) {\n if (expandoStore.events.$destroy) {\n expandoStore.handle({}, '$destroy');\n }\n jqLiteOff(element);\n }\n delete jqCache[expandoId];\n element.ng339 = undefined; // don't delete DOM expandos. IE and Chrome don't like it\n }\n}\n\n\nfunction jqLiteExpandoStore(element, createIfNecessary) {\n var expandoId = element.ng339,\n expandoStore = expandoId && jqCache[expandoId];\n\n if (createIfNecessary && !expandoStore) {\n element.ng339 = expandoId = jqNextId();\n expandoStore = jqCache[expandoId] = {events: {}, data: {}, handle: undefined};\n }\n\n return expandoStore;\n}\n\n\nfunction jqLiteData(element, key, value) {\n if (jqLiteAcceptsData(element)) {\n\n var isSimpleSetter = isDefined(value);\n var isSimpleGetter = !isSimpleSetter && key && !isObject(key);\n var massGetter = !key;\n var expandoStore = jqLiteExpandoStore(element, !isSimpleGetter);\n var data = expandoStore && expandoStore.data;\n\n if (isSimpleSetter) { // data('key', value)\n data[key] = value;\n } else {\n if (massGetter) { // data()\n return data;\n } else {\n if (isSimpleGetter) { // data('key')\n // don't force creation of expandoStore if it doesn't exist yet\n return data && data[key];\n } else { // mass-setter: data({key1: val1, key2: val2})\n extend(data, key);\n }\n }\n }\n }\n}\n\nfunction jqLiteHasClass(element, selector) {\n if (!element.getAttribute) return false;\n return ((\" \" + (element.getAttribute('class') || '') + \" \").replace(/[\\n\\t]/g, \" \").\n indexOf(\" \" + selector + \" \") > -1);\n}\n\nfunction jqLiteRemoveClass(element, cssClasses) {\n if (cssClasses && element.setAttribute) {\n forEach(cssClasses.split(' '), function(cssClass) {\n element.setAttribute('class', trim(\n (\" \" + (element.getAttribute('class') || '') + \" \")\n .replace(/[\\n\\t]/g, \" \")\n .replace(\" \" + trim(cssClass) + \" \", \" \"))\n );\n });\n }\n}\n\nfunction jqLiteAddClass(element, cssClasses) {\n if (cssClasses && element.setAttribute) {\n var existingClasses = (' ' + (element.getAttribute('class') || '') + ' ')\n .replace(/[\\n\\t]/g, \" \");\n\n forEach(cssClasses.split(' '), function(cssClass) {\n cssClass = trim(cssClass);\n if (existingClasses.indexOf(' ' + cssClass + ' ') === -1) {\n existingClasses += cssClass + ' ';\n }\n });\n\n element.setAttribute('class', trim(existingClasses));\n }\n}\n\n\nfunction jqLiteAddNodes(root, elements) {\n // THIS CODE IS VERY HOT. Don't make changes without benchmarking.\n\n if (elements) {\n\n // if a Node (the most common case)\n if (elements.nodeType) {\n root[root.length++] = elements;\n } else {\n var length = elements.length;\n\n // if an Array or NodeList and not a Window\n if (typeof length === 'number' && elements.window !== elements) {\n if (length) {\n for (var i = 0; i < length; i++) {\n root[root.length++] = elements[i];\n }\n }\n } else {\n root[root.length++] = elements;\n }\n }\n }\n}\n\n\nfunction jqLiteController(element, name) {\n return jqLiteInheritedData(element, '$' + (name || 'ngController') + 'Controller');\n}\n\nfunction jqLiteInheritedData(element, name, value) {\n // if element is the document object work with the html element instead\n // this makes $(document).scope() possible\n if (element.nodeType == NODE_TYPE_DOCUMENT) {\n element = element.documentElement;\n }\n var names = isArray(name) ? name : [name];\n\n while (element) {\n for (var i = 0, ii = names.length; i < ii; i++) {\n if ((value = jqLite.data(element, names[i])) !== undefined) return value;\n }\n\n // If dealing with a document fragment node with a host element, and no parent, use the host\n // element as the parent. This enables directives within a Shadow DOM or polyfilled Shadow DOM\n // to lookup parent controllers.\n element = element.parentNode || (element.nodeType === NODE_TYPE_DOCUMENT_FRAGMENT && element.host);\n }\n}\n\nfunction jqLiteEmpty(element) {\n jqLiteDealoc(element, true);\n while (element.firstChild) {\n element.removeChild(element.firstChild);\n }\n}\n\nfunction jqLiteRemove(element, keepData) {\n if (!keepData) jqLiteDealoc(element);\n var parent = element.parentNode;\n if (parent) parent.removeChild(element);\n}\n\n\nfunction jqLiteDocumentLoaded(action, win) {\n win = win || window;\n if (win.document.readyState === 'complete') {\n // Force the action to be run async for consistent behaviour\n // from the action's point of view\n // i.e. it will definitely not be in a $apply\n win.setTimeout(action);\n } else {\n // No need to unbind this handler as load is only ever called once\n jqLite(win).on('load', action);\n }\n}\n\n//////////////////////////////////////////\n// Functions which are declared directly.\n//////////////////////////////////////////\nvar JQLitePrototype = JQLite.prototype = {\n ready: function(fn) {\n var fired = false;\n\n function trigger() {\n if (fired) return;\n fired = true;\n fn();\n }\n\n // check if document is already loaded\n if (document.readyState === 'complete') {\n setTimeout(trigger);\n } else {\n this.on('DOMContentLoaded', trigger); // works for modern browsers and IE9\n // we can not use jqLite since we are not done loading and jQuery could be loaded later.\n // jshint -W064\n JQLite(window).on('load', trigger); // fallback to window.onload for others\n // jshint +W064\n }\n },\n toString: function() {\n var value = [];\n forEach(this, function(e) { value.push('' + e);});\n return '[' + value.join(', ') + ']';\n },\n\n eq: function(index) {\n return (index >= 0) ? jqLite(this[index]) : jqLite(this[this.length + index]);\n },\n\n length: 0,\n push: push,\n sort: [].sort,\n splice: [].splice\n};\n\n//////////////////////////////////////////\n// Functions iterating getter/setters.\n// these functions return self on setter and\n// value on get.\n//////////////////////////////////////////\nvar BOOLEAN_ATTR = {};\nforEach('multiple,selected,checked,disabled,readOnly,required,open'.split(','), function(value) {\n BOOLEAN_ATTR[lowercase(value)] = value;\n});\nvar BOOLEAN_ELEMENTS = {};\nforEach('input,select,option,textarea,button,form,details'.split(','), function(value) {\n BOOLEAN_ELEMENTS[value] = true;\n});\nvar ALIASED_ATTR = {\n 'ngMinlength': 'minlength',\n 'ngMaxlength': 'maxlength',\n 'ngMin': 'min',\n 'ngMax': 'max',\n 'ngPattern': 'pattern'\n};\n\nfunction getBooleanAttrName(element, name) {\n // check dom last since we will most likely fail on name\n var booleanAttr = BOOLEAN_ATTR[name.toLowerCase()];\n\n // booleanAttr is here twice to minimize DOM access\n return booleanAttr && BOOLEAN_ELEMENTS[nodeName_(element)] && booleanAttr;\n}\n\nfunction getAliasedAttrName(element, name) {\n var nodeName = element.nodeName;\n return (nodeName === 'INPUT' || nodeName === 'TEXTAREA') && ALIASED_ATTR[name];\n}\n\nforEach({\n data: jqLiteData,\n removeData: jqLiteRemoveData,\n hasData: jqLiteHasData\n}, function(fn, name) {\n JQLite[name] = fn;\n});\n\nforEach({\n data: jqLiteData,\n inheritedData: jqLiteInheritedData,\n\n scope: function(element) {\n // Can't use jqLiteData here directly so we stay compatible with jQuery!\n return jqLite.data(element, '$scope') || jqLiteInheritedData(element.parentNode || element, ['$isolateScope', '$scope']);\n },\n\n isolateScope: function(element) {\n // Can't use jqLiteData here directly so we stay compatible with jQuery!\n return jqLite.data(element, '$isolateScope') || jqLite.data(element, '$isolateScopeNoTemplate');\n },\n\n controller: jqLiteController,\n\n injector: function(element) {\n return jqLiteInheritedData(element, '$injector');\n },\n\n removeAttr: function(element, name) {\n element.removeAttribute(name);\n },\n\n hasClass: jqLiteHasClass,\n\n css: function(element, name, value) {\n name = camelCase(name);\n\n if (isDefined(value)) {\n element.style[name] = value;\n } else {\n return element.style[name];\n }\n },\n\n attr: function(element, name, value) {\n var nodeType = element.nodeType;\n if (nodeType === NODE_TYPE_TEXT || nodeType === NODE_TYPE_ATTRIBUTE || nodeType === NODE_TYPE_COMMENT) {\n return;\n }\n var lowercasedName = lowercase(name);\n if (BOOLEAN_ATTR[lowercasedName]) {\n if (isDefined(value)) {\n if (!!value) {\n element[name] = true;\n element.setAttribute(name, lowercasedName);\n } else {\n element[name] = false;\n element.removeAttribute(lowercasedName);\n }\n } else {\n return (element[name] ||\n (element.attributes.getNamedItem(name) || noop).specified)\n ? lowercasedName\n : undefined;\n }\n } else if (isDefined(value)) {\n element.setAttribute(name, value);\n } else if (element.getAttribute) {\n // the extra argument \"2\" is to get the right thing for a.href in IE, see jQuery code\n // some elements (e.g. Document) don't have get attribute, so return undefined\n var ret = element.getAttribute(name, 2);\n // normalize non-existing attributes to undefined (as jQuery)\n return ret === null ? undefined : ret;\n }\n },\n\n prop: function(element, name, value) {\n if (isDefined(value)) {\n element[name] = value;\n } else {\n return element[name];\n }\n },\n\n text: (function() {\n getText.$dv = '';\n return getText;\n\n function getText(element, value) {\n if (isUndefined(value)) {\n var nodeType = element.nodeType;\n return (nodeType === NODE_TYPE_ELEMENT || nodeType === NODE_TYPE_TEXT) ? element.textContent : '';\n }\n element.textContent = value;\n }\n })(),\n\n val: function(element, value) {\n if (isUndefined(value)) {\n if (element.multiple && nodeName_(element) === 'select') {\n var result = [];\n forEach(element.options, function(option) {\n if (option.selected) {\n result.push(option.value || option.text);\n }\n });\n return result.length === 0 ? null : result;\n }\n return element.value;\n }\n element.value = value;\n },\n\n html: function(element, value) {\n if (isUndefined(value)) {\n return element.innerHTML;\n }\n jqLiteDealoc(element, true);\n element.innerHTML = value;\n },\n\n empty: jqLiteEmpty\n}, function(fn, name) {\n /**\n * Properties: writes return selection, reads return first value\n */\n JQLite.prototype[name] = function(arg1, arg2) {\n var i, key;\n var nodeCount = this.length;\n\n // jqLiteHasClass has only two arguments, but is a getter-only fn, so we need to special-case it\n // in a way that survives minification.\n // jqLiteEmpty takes no arguments but is a setter.\n if (fn !== jqLiteEmpty &&\n (((fn.length == 2 && (fn !== jqLiteHasClass && fn !== jqLiteController)) ? arg1 : arg2) === undefined)) {\n if (isObject(arg1)) {\n\n // we are a write, but the object properties are the key/values\n for (i = 0; i < nodeCount; i++) {\n if (fn === jqLiteData) {\n // data() takes the whole object in jQuery\n fn(this[i], arg1);\n } else {\n for (key in arg1) {\n fn(this[i], key, arg1[key]);\n }\n }\n }\n // return self for chaining\n return this;\n } else {\n // we are a read, so read the first child.\n // TODO: do we still need this?\n var value = fn.$dv;\n // Only if we have $dv do we iterate over all, otherwise it is just the first element.\n var jj = (value === undefined) ? Math.min(nodeCount, 1) : nodeCount;\n for (var j = 0; j < jj; j++) {\n var nodeValue = fn(this[j], arg1, arg2);\n value = value ? value + nodeValue : nodeValue;\n }\n return value;\n }\n } else {\n // we are a write, so apply to all children\n for (i = 0; i < nodeCount; i++) {\n fn(this[i], arg1, arg2);\n }\n // return self for chaining\n return this;\n }\n };\n});\n\nfunction createEventHandler(element, events) {\n var eventHandler = function(event, type) {\n // jQuery specific api\n event.isDefaultPrevented = function() {\n return event.defaultPrevented;\n };\n\n var eventFns = events[type || event.type];\n var eventFnsLength = eventFns ? eventFns.length : 0;\n\n if (!eventFnsLength) return;\n\n if (isUndefined(event.immediatePropagationStopped)) {\n var originalStopImmediatePropagation = event.stopImmediatePropagation;\n event.stopImmediatePropagation = function() {\n event.immediatePropagationStopped = true;\n\n if (event.stopPropagation) {\n event.stopPropagation();\n }\n\n if (originalStopImmediatePropagation) {\n originalStopImmediatePropagation.call(event);\n }\n };\n }\n\n event.isImmediatePropagationStopped = function() {\n return event.immediatePropagationStopped === true;\n };\n\n // Copy event handlers in case event handlers array is modified during execution.\n if ((eventFnsLength > 1)) {\n eventFns = shallowCopy(eventFns);\n }\n\n for (var i = 0; i < eventFnsLength; i++) {\n if (!event.isImmediatePropagationStopped()) {\n eventFns[i].call(element, event);\n }\n }\n };\n\n // TODO: this is a hack for angularMocks/clearDataCache that makes it possible to deregister all\n // events on `element`\n eventHandler.elem = element;\n return eventHandler;\n}\n\n//////////////////////////////////////////\n// Functions iterating traversal.\n// These functions chain results into a single\n// selector.\n//////////////////////////////////////////\nforEach({\n removeData: jqLiteRemoveData,\n\n on: function jqLiteOn(element, type, fn, unsupported) {\n if (isDefined(unsupported)) throw jqLiteMinErr('onargs', 'jqLite#on() does not support the `selector` or `eventData` parameters');\n\n // Do not add event handlers to non-elements because they will not be cleaned up.\n if (!jqLiteAcceptsData(element)) {\n return;\n }\n\n var expandoStore = jqLiteExpandoStore(element, true);\n var events = expandoStore.events;\n var handle = expandoStore.handle;\n\n if (!handle) {\n handle = expandoStore.handle = createEventHandler(element, events);\n }\n\n // http://jsperf.com/string-indexof-vs-split\n var types = type.indexOf(' ') >= 0 ? type.split(' ') : [type];\n var i = types.length;\n\n while (i--) {\n type = types[i];\n var eventFns = events[type];\n\n if (!eventFns) {\n events[type] = [];\n\n if (type === 'mouseenter' || type === 'mouseleave') {\n // Refer to jQuery's implementation of mouseenter & mouseleave\n // Read about mouseenter and mouseleave:\n // http://www.quirksmode.org/js/events_mouse.html#link8\n\n jqLiteOn(element, MOUSE_EVENT_MAP[type], function(event) {\n var target = this, related = event.relatedTarget;\n // For mousenter/leave call the handler if related is outside the target.\n // NB: No relatedTarget if the mouse left/entered the browser window\n if (!related || (related !== target && !target.contains(related))) {\n handle(event, type);\n }\n });\n\n } else {\n if (type !== '$destroy') {\n addEventListenerFn(element, type, handle);\n }\n }\n eventFns = events[type];\n }\n eventFns.push(fn);\n }\n },\n\n off: jqLiteOff,\n\n one: function(element, type, fn) {\n element = jqLite(element);\n\n //add the listener twice so that when it is called\n //you can remove the original function and still be\n //able to call element.off(ev, fn) normally\n element.on(type, function onFn() {\n element.off(type, fn);\n element.off(type, onFn);\n });\n element.on(type, fn);\n },\n\n replaceWith: function(element, replaceNode) {\n var index, parent = element.parentNode;\n jqLiteDealoc(element);\n forEach(new JQLite(replaceNode), function(node) {\n if (index) {\n parent.insertBefore(node, index.nextSibling);\n } else {\n parent.replaceChild(node, element);\n }\n index = node;\n });\n },\n\n children: function(element) {\n var children = [];\n forEach(element.childNodes, function(element) {\n if (element.nodeType === NODE_TYPE_ELEMENT) {\n children.push(element);\n }\n });\n return children;\n },\n\n contents: function(element) {\n return element.contentDocument || element.childNodes || [];\n },\n\n append: function(element, node) {\n var nodeType = element.nodeType;\n if (nodeType !== NODE_TYPE_ELEMENT && nodeType !== NODE_TYPE_DOCUMENT_FRAGMENT) return;\n\n node = new JQLite(node);\n\n for (var i = 0, ii = node.length; i < ii; i++) {\n var child = node[i];\n element.appendChild(child);\n }\n },\n\n prepend: function(element, node) {\n if (element.nodeType === NODE_TYPE_ELEMENT) {\n var index = element.firstChild;\n forEach(new JQLite(node), function(child) {\n element.insertBefore(child, index);\n });\n }\n },\n\n wrap: function(element, wrapNode) {\n wrapNode = jqLite(wrapNode).eq(0).clone()[0];\n var parent = element.parentNode;\n if (parent) {\n parent.replaceChild(wrapNode, element);\n }\n wrapNode.appendChild(element);\n },\n\n remove: jqLiteRemove,\n\n detach: function(element) {\n jqLiteRemove(element, true);\n },\n\n after: function(element, newElement) {\n var index = element, parent = element.parentNode;\n newElement = new JQLite(newElement);\n\n for (var i = 0, ii = newElement.length; i < ii; i++) {\n var node = newElement[i];\n parent.insertBefore(node, index.nextSibling);\n index = node;\n }\n },\n\n addClass: jqLiteAddClass,\n removeClass: jqLiteRemoveClass,\n\n toggleClass: function(element, selector, condition) {\n if (selector) {\n forEach(selector.split(' '), function(className) {\n var classCondition = condition;\n if (isUndefined(classCondition)) {\n classCondition = !jqLiteHasClass(element, className);\n }\n (classCondition ? jqLiteAddClass : jqLiteRemoveClass)(element, className);\n });\n }\n },\n\n parent: function(element) {\n var parent = element.parentNode;\n return parent && parent.nodeType !== NODE_TYPE_DOCUMENT_FRAGMENT ? parent : null;\n },\n\n next: function(element) {\n return element.nextElementSibling;\n },\n\n find: function(element, selector) {\n if (element.getElementsByTagName) {\n return element.getElementsByTagName(selector);\n } else {\n return [];\n }\n },\n\n clone: jqLiteClone,\n\n triggerHandler: function(element, event, extraParameters) {\n\n var dummyEvent, eventFnsCopy, handlerArgs;\n var eventName = event.type || event;\n var expandoStore = jqLiteExpandoStore(element);\n var events = expandoStore && expandoStore.events;\n var eventFns = events && events[eventName];\n\n if (eventFns) {\n // Create a dummy event to pass to the handlers\n dummyEvent = {\n preventDefault: function() { this.defaultPrevented = true; },\n isDefaultPrevented: function() { return this.defaultPrevented === true; },\n stopImmediatePropagation: function() { this.immediatePropagationStopped = true; },\n isImmediatePropagationStopped: function() { return this.immediatePropagationStopped === true; },\n stopPropagation: noop,\n type: eventName,\n target: element\n };\n\n // If a custom event was provided then extend our dummy event with it\n if (event.type) {\n dummyEvent = extend(dummyEvent, event);\n }\n\n // Copy event handlers in case event handlers array is modified during execution.\n eventFnsCopy = shallowCopy(eventFns);\n handlerArgs = extraParameters ? [dummyEvent].concat(extraParameters) : [dummyEvent];\n\n forEach(eventFnsCopy, function(fn) {\n if (!dummyEvent.isImmediatePropagationStopped()) {\n fn.apply(element, handlerArgs);\n }\n });\n }\n }\n}, function(fn, name) {\n /**\n * chaining functions\n */\n JQLite.prototype[name] = function(arg1, arg2, arg3) {\n var value;\n\n for (var i = 0, ii = this.length; i < ii; i++) {\n if (isUndefined(value)) {\n value = fn(this[i], arg1, arg2, arg3);\n if (isDefined(value)) {\n // any function which returns a value needs to be wrapped\n value = jqLite(value);\n }\n } else {\n jqLiteAddNodes(value, fn(this[i], arg1, arg2, arg3));\n }\n }\n return isDefined(value) ? value : this;\n };\n\n // bind legacy bind/unbind to on/off\n JQLite.prototype.bind = JQLite.prototype.on;\n JQLite.prototype.unbind = JQLite.prototype.off;\n});\n\n\n// Provider for private $$jqLite service\nfunction $$jqLiteProvider() {\n this.$get = function $$jqLite() {\n return extend(JQLite, {\n hasClass: function(node, classes) {\n if (node.attr) node = node[0];\n return jqLiteHasClass(node, classes);\n },\n addClass: function(node, classes) {\n if (node.attr) node = node[0];\n return jqLiteAddClass(node, classes);\n },\n removeClass: function(node, classes) {\n if (node.attr) node = node[0];\n return jqLiteRemoveClass(node, classes);\n }\n });\n };\n}\n\n/**\n * Computes a hash of an 'obj'.\n * Hash of a:\n * string is string\n * number is number as string\n * object is either result of calling $$hashKey function on the object or uniquely generated id,\n * that is also assigned to the $$hashKey property of the object.\n *\n * @param obj\n * @returns {string} hash string such that the same input will have the same hash string.\n * The resulting string key is in 'type:hashKey' format.\n */\nfunction hashKey(obj, nextUidFn) {\n var key = obj && obj.$$hashKey;\n\n if (key) {\n if (typeof key === 'function') {\n key = obj.$$hashKey();\n }\n return key;\n }\n\n var objType = typeof obj;\n if (objType == 'function' || (objType == 'object' && obj !== null)) {\n key = obj.$$hashKey = objType + ':' + (nextUidFn || nextUid)();\n } else {\n key = objType + ':' + obj;\n }\n\n return key;\n}\n\n/**\n * HashMap which can use objects as keys\n */\nfunction HashMap(array, isolatedUid) {\n if (isolatedUid) {\n var uid = 0;\n this.nextUid = function() {\n return ++uid;\n };\n }\n forEach(array, this.put, this);\n}\nHashMap.prototype = {\n /**\n * Store key value pair\n * @param key key to store can be any type\n * @param value value to store can be any type\n */\n put: function(key, value) {\n this[hashKey(key, this.nextUid)] = value;\n },\n\n /**\n * @param key\n * @returns {Object} the value for the key\n */\n get: function(key) {\n return this[hashKey(key, this.nextUid)];\n },\n\n /**\n * Remove the key/value pair\n * @param key\n */\n remove: function(key) {\n var value = this[key = hashKey(key, this.nextUid)];\n delete this[key];\n return value;\n }\n};\n\nvar $$HashMapProvider = [function() {\n this.$get = [function() {\n return HashMap;\n }];\n}];\n\n/**\n * @ngdoc function\n * @module ng\n * @name angular.injector\n * @kind function\n *\n * @description\n * Creates an injector object that can be used for retrieving services as well as for\n * dependency injection (see {@link guide/di dependency injection}).\n *\n * @param {Array.} modules A list of module functions or their aliases. See\n * {@link angular.module}. The `ng` module must be explicitly added.\n * @param {boolean=} [strictDi=false] Whether the injector should be in strict mode, which\n * disallows argument name annotation inference.\n * @returns {injector} Injector object. See {@link auto.$injector $injector}.\n *\n * @example\n * Typical usage\n * ```js\n * // create an injector\n * var $injector = angular.injector(['ng']);\n *\n * // use the injector to kick off your application\n * // use the type inference to auto inject arguments, or use implicit injection\n * $injector.invoke(function($rootScope, $compile, $document) {\n * $compile($document)($rootScope);\n * $rootScope.$digest();\n * });\n * ```\n *\n * Sometimes you want to get access to the injector of a currently running Angular app\n * from outside Angular. Perhaps, you want to inject and compile some markup after the\n * application has been bootstrapped. You can do this using the extra `injector()` added\n * to JQuery/jqLite elements. See {@link angular.element}.\n *\n * *This is fairly rare but could be the case if a third party library is injecting the\n * markup.*\n *\n * In the following example a new block of HTML containing a `ng-controller`\n * directive is added to the end of the document body by JQuery. We then compile and link\n * it into the current AngularJS scope.\n *\n * ```js\n * var $div = $('
    {{content.label}}
    ');\n * $(document.body).append($div);\n *\n * angular.element(document).injector().invoke(function($compile) {\n * var scope = angular.element($div).scope();\n * $compile($div)(scope);\n * });\n * ```\n */\n\n\n/**\n * @ngdoc module\n * @name auto\n * @description\n *\n * Implicit module which gets automatically added to each {@link auto.$injector $injector}.\n */\n\nvar FN_ARGS = /^function\\s*[^\\(]*\\(\\s*([^\\)]*)\\)/m;\nvar FN_ARG_SPLIT = /,/;\nvar FN_ARG = /^\\s*(_?)(\\S+?)\\1\\s*$/;\nvar STRIP_COMMENTS = /((\\/\\/.*$)|(\\/\\*[\\s\\S]*?\\*\\/))/mg;\nvar $injectorMinErr = minErr('$injector');\n\nfunction anonFn(fn) {\n // For anonymous functions, showing at the very least the function signature can help in\n // debugging.\n var fnText = fn.toString().replace(STRIP_COMMENTS, ''),\n args = fnText.match(FN_ARGS);\n if (args) {\n return 'function(' + (args[1] || '').replace(/[\\s\\r\\n]+/, ' ') + ')';\n }\n return 'fn';\n}\n\nfunction annotate(fn, strictDi, name) {\n var $inject,\n fnText,\n argDecl,\n last;\n\n if (typeof fn === 'function') {\n if (!($inject = fn.$inject)) {\n $inject = [];\n if (fn.length) {\n if (strictDi) {\n if (!isString(name) || !name) {\n name = fn.name || anonFn(fn);\n }\n throw $injectorMinErr('strictdi',\n '{0} is not using explicit annotation and cannot be invoked in strict mode', name);\n }\n fnText = fn.toString().replace(STRIP_COMMENTS, '');\n argDecl = fnText.match(FN_ARGS);\n forEach(argDecl[1].split(FN_ARG_SPLIT), function(arg) {\n arg.replace(FN_ARG, function(all, underscore, name) {\n $inject.push(name);\n });\n });\n }\n fn.$inject = $inject;\n }\n } else if (isArray(fn)) {\n last = fn.length - 1;\n assertArgFn(fn[last], 'fn');\n $inject = fn.slice(0, last);\n } else {\n assertArgFn(fn, 'fn', true);\n }\n return $inject;\n}\n\n///////////////////////////////////////\n\n/**\n * @ngdoc service\n * @name $injector\n *\n * @description\n *\n * `$injector` is used to retrieve object instances as defined by\n * {@link auto.$provide provider}, instantiate types, invoke methods,\n * and load modules.\n *\n * The following always holds true:\n *\n * ```js\n * var $injector = angular.injector();\n * expect($injector.get('$injector')).toBe($injector);\n * expect($injector.invoke(function($injector) {\n * return $injector;\n * })).toBe($injector);\n * ```\n *\n * # Injection Function Annotation\n *\n * JavaScript does not have annotations, and annotations are needed for dependency injection. The\n * following are all valid ways of annotating function with injection arguments and are equivalent.\n *\n * ```js\n * // inferred (only works if code not minified/obfuscated)\n * $injector.invoke(function(serviceA){});\n *\n * // annotated\n * function explicit(serviceA) {};\n * explicit.$inject = ['serviceA'];\n * $injector.invoke(explicit);\n *\n * // inline\n * $injector.invoke(['serviceA', function(serviceA){}]);\n * ```\n *\n * ## Inference\n *\n * In JavaScript calling `toString()` on a function returns the function definition. The definition\n * can then be parsed and the function arguments can be extracted. This method of discovering\n * annotations is disallowed when the injector is in strict mode.\n * *NOTE:* This does not work with minification, and obfuscation tools since these tools change the\n * argument names.\n *\n * ## `$inject` Annotation\n * By adding an `$inject` property onto a function the injection parameters can be specified.\n *\n * ## Inline\n * As an array of injection names, where the last item in the array is the function to call.\n */\n\n/**\n * @ngdoc method\n * @name $injector#get\n *\n * @description\n * Return an instance of the service.\n *\n * @param {string} name The name of the instance to retrieve.\n * @param {string=} caller An optional string to provide the origin of the function call for error messages.\n * @return {*} The instance.\n */\n\n/**\n * @ngdoc method\n * @name $injector#invoke\n *\n * @description\n * Invoke the method and supply the method arguments from the `$injector`.\n *\n * @param {Function|Array.} fn The injectable function to invoke. Function parameters are\n * injected according to the {@link guide/di $inject Annotation} rules.\n * @param {Object=} self The `this` for the invoked method.\n * @param {Object=} locals Optional object. If preset then any argument names are read from this\n * object first, before the `$injector` is consulted.\n * @returns {*} the value returned by the invoked `fn` function.\n */\n\n/**\n * @ngdoc method\n * @name $injector#has\n *\n * @description\n * Allows the user to query if the particular service exists.\n *\n * @param {string} name Name of the service to query.\n * @returns {boolean} `true` if injector has given service.\n */\n\n/**\n * @ngdoc method\n * @name $injector#instantiate\n * @description\n * Create a new instance of JS type. The method takes a constructor function, invokes the new\n * operator, and supplies all of the arguments to the constructor function as specified by the\n * constructor annotation.\n *\n * @param {Function} Type Annotated constructor function.\n * @param {Object=} locals Optional object. If preset then any argument names are read from this\n * object first, before the `$injector` is consulted.\n * @returns {Object} new instance of `Type`.\n */\n\n/**\n * @ngdoc method\n * @name $injector#annotate\n *\n * @description\n * Returns an array of service names which the function is requesting for injection. This API is\n * used by the injector to determine which services need to be injected into the function when the\n * function is invoked. There are three ways in which the function can be annotated with the needed\n * dependencies.\n *\n * # Argument names\n *\n * The simplest form is to extract the dependencies from the arguments of the function. This is done\n * by converting the function into a string using `toString()` method and extracting the argument\n * names.\n * ```js\n * // Given\n * function MyController($scope, $route) {\n * // ...\n * }\n *\n * // Then\n * expect(injector.annotate(MyController)).toEqual(['$scope', '$route']);\n * ```\n *\n * You can disallow this method by using strict injection mode.\n *\n * This method does not work with code minification / obfuscation. For this reason the following\n * annotation strategies are supported.\n *\n * # The `$inject` property\n *\n * If a function has an `$inject` property and its value is an array of strings, then the strings\n * represent names of services to be injected into the function.\n * ```js\n * // Given\n * var MyController = function(obfuscatedScope, obfuscatedRoute) {\n * // ...\n * }\n * // Define function dependencies\n * MyController['$inject'] = ['$scope', '$route'];\n *\n * // Then\n * expect(injector.annotate(MyController)).toEqual(['$scope', '$route']);\n * ```\n *\n * # The array notation\n *\n * It is often desirable to inline Injected functions and that's when setting the `$inject` property\n * is very inconvenient. In these situations using the array notation to specify the dependencies in\n * a way that survives minification is a better choice:\n *\n * ```js\n * // We wish to write this (not minification / obfuscation safe)\n * injector.invoke(function($compile, $rootScope) {\n * // ...\n * });\n *\n * // We are forced to write break inlining\n * var tmpFn = function(obfuscatedCompile, obfuscatedRootScope) {\n * // ...\n * };\n * tmpFn.$inject = ['$compile', '$rootScope'];\n * injector.invoke(tmpFn);\n *\n * // To better support inline function the inline annotation is supported\n * injector.invoke(['$compile', '$rootScope', function(obfCompile, obfRootScope) {\n * // ...\n * }]);\n *\n * // Therefore\n * expect(injector.annotate(\n * ['$compile', '$rootScope', function(obfus_$compile, obfus_$rootScope) {}])\n * ).toEqual(['$compile', '$rootScope']);\n * ```\n *\n * @param {Function|Array.} fn Function for which dependent service names need to\n * be retrieved as described above.\n *\n * @param {boolean=} [strictDi=false] Disallow argument name annotation inference.\n *\n * @returns {Array.} The names of the services which the function requires.\n */\n\n\n\n\n/**\n * @ngdoc service\n * @name $provide\n *\n * @description\n *\n * The {@link auto.$provide $provide} service has a number of methods for registering components\n * with the {@link auto.$injector $injector}. Many of these functions are also exposed on\n * {@link angular.Module}.\n *\n * An Angular **service** is a singleton object created by a **service factory**. These **service\n * factories** are functions which, in turn, are created by a **service provider**.\n * The **service providers** are constructor functions. When instantiated they must contain a\n * property called `$get`, which holds the **service factory** function.\n *\n * When you request a service, the {@link auto.$injector $injector} is responsible for finding the\n * correct **service provider**, instantiating it and then calling its `$get` **service factory**\n * function to get the instance of the **service**.\n *\n * Often services have no configuration options and there is no need to add methods to the service\n * provider. The provider will be no more than a constructor function with a `$get` property. For\n * these cases the {@link auto.$provide $provide} service has additional helper methods to register\n * services without specifying a provider.\n *\n * * {@link auto.$provide#provider provider(provider)} - registers a **service provider** with the\n * {@link auto.$injector $injector}\n * * {@link auto.$provide#constant constant(obj)} - registers a value/object that can be accessed by\n * providers and services.\n * * {@link auto.$provide#value value(obj)} - registers a value/object that can only be accessed by\n * services, not providers.\n * * {@link auto.$provide#factory factory(fn)} - registers a service **factory function**, `fn`,\n * that will be wrapped in a **service provider** object, whose `$get` property will contain the\n * given factory function.\n * * {@link auto.$provide#service service(class)} - registers a **constructor function**, `class`\n * that will be wrapped in a **service provider** object, whose `$get` property will instantiate\n * a new object using the given constructor function.\n *\n * See the individual methods for more information and examples.\n */\n\n/**\n * @ngdoc method\n * @name $provide#provider\n * @description\n *\n * Register a **provider function** with the {@link auto.$injector $injector}. Provider functions\n * are constructor functions, whose instances are responsible for \"providing\" a factory for a\n * service.\n *\n * Service provider names start with the name of the service they provide followed by `Provider`.\n * For example, the {@link ng.$log $log} service has a provider called\n * {@link ng.$logProvider $logProvider}.\n *\n * Service provider objects can have additional methods which allow configuration of the provider\n * and its service. Importantly, you can configure what kind of service is created by the `$get`\n * method, or how that service will act. For example, the {@link ng.$logProvider $logProvider} has a\n * method {@link ng.$logProvider#debugEnabled debugEnabled}\n * which lets you specify whether the {@link ng.$log $log} service will log debug messages to the\n * console or not.\n *\n * @param {string} name The name of the instance. NOTE: the provider will be available under `name +\n 'Provider'` key.\n * @param {(Object|function())} provider If the provider is:\n *\n * - `Object`: then it should have a `$get` method. The `$get` method will be invoked using\n * {@link auto.$injector#invoke $injector.invoke()} when an instance needs to be created.\n * - `Constructor`: a new instance of the provider will be created using\n * {@link auto.$injector#instantiate $injector.instantiate()}, then treated as `object`.\n *\n * @returns {Object} registered provider instance\n\n * @example\n *\n * The following example shows how to create a simple event tracking service and register it using\n * {@link auto.$provide#provider $provide.provider()}.\n *\n * ```js\n * // Define the eventTracker provider\n * function EventTrackerProvider() {\n * var trackingUrl = '/track';\n *\n * // A provider method for configuring where the tracked events should been saved\n * this.setTrackingUrl = function(url) {\n * trackingUrl = url;\n * };\n *\n * // The service factory function\n * this.$get = ['$http', function($http) {\n * var trackedEvents = {};\n * return {\n * // Call this to track an event\n * event: function(event) {\n * var count = trackedEvents[event] || 0;\n * count += 1;\n * trackedEvents[event] = count;\n * return count;\n * },\n * // Call this to save the tracked events to the trackingUrl\n * save: function() {\n * $http.post(trackingUrl, trackedEvents);\n * }\n * };\n * }];\n * }\n *\n * describe('eventTracker', function() {\n * var postSpy;\n *\n * beforeEach(module(function($provide) {\n * // Register the eventTracker provider\n * $provide.provider('eventTracker', EventTrackerProvider);\n * }));\n *\n * beforeEach(module(function(eventTrackerProvider) {\n * // Configure eventTracker provider\n * eventTrackerProvider.setTrackingUrl('/custom-track');\n * }));\n *\n * it('tracks events', inject(function(eventTracker) {\n * expect(eventTracker.event('login')).toEqual(1);\n * expect(eventTracker.event('login')).toEqual(2);\n * }));\n *\n * it('saves to the tracking url', inject(function(eventTracker, $http) {\n * postSpy = spyOn($http, 'post');\n * eventTracker.event('login');\n * eventTracker.save();\n * expect(postSpy).toHaveBeenCalled();\n * expect(postSpy.mostRecentCall.args[0]).not.toEqual('/track');\n * expect(postSpy.mostRecentCall.args[0]).toEqual('/custom-track');\n * expect(postSpy.mostRecentCall.args[1]).toEqual({ 'login': 1 });\n * }));\n * });\n * ```\n */\n\n/**\n * @ngdoc method\n * @name $provide#factory\n * @description\n *\n * Register a **service factory**, which will be called to return the service instance.\n * This is short for registering a service where its provider consists of only a `$get` property,\n * which is the given service factory function.\n * You should use {@link auto.$provide#factory $provide.factory(getFn)} if you do not need to\n * configure your service in a provider.\n *\n * @param {string} name The name of the instance.\n * @param {Function|Array.} $getFn The injectable $getFn for the instance creation.\n * Internally this is a short hand for `$provide.provider(name, {$get: $getFn})`.\n * @returns {Object} registered provider instance\n *\n * @example\n * Here is an example of registering a service\n * ```js\n * $provide.factory('ping', ['$http', function($http) {\n * return function ping() {\n * return $http.send('/ping');\n * };\n * }]);\n * ```\n * You would then inject and use this service like this:\n * ```js\n * someModule.controller('Ctrl', ['ping', function(ping) {\n * ping();\n * }]);\n * ```\n */\n\n\n/**\n * @ngdoc method\n * @name $provide#service\n * @description\n *\n * Register a **service constructor**, which will be invoked with `new` to create the service\n * instance.\n * This is short for registering a service where its provider's `$get` property is the service\n * constructor function that will be used to instantiate the service instance.\n *\n * You should use {@link auto.$provide#service $provide.service(class)} if you define your service\n * as a type/class.\n *\n * @param {string} name The name of the instance.\n * @param {Function|Array.} constructor An injectable class (constructor function)\n * that will be instantiated.\n * @returns {Object} registered provider instance\n *\n * @example\n * Here is an example of registering a service using\n * {@link auto.$provide#service $provide.service(class)}.\n * ```js\n * var Ping = function($http) {\n * this.$http = $http;\n * };\n *\n * Ping.$inject = ['$http'];\n *\n * Ping.prototype.send = function() {\n * return this.$http.get('/ping');\n * };\n * $provide.service('ping', Ping);\n * ```\n * You would then inject and use this service like this:\n * ```js\n * someModule.controller('Ctrl', ['ping', function(ping) {\n * ping.send();\n * }]);\n * ```\n */\n\n\n/**\n * @ngdoc method\n * @name $provide#value\n * @description\n *\n * Register a **value service** with the {@link auto.$injector $injector}, such as a string, a\n * number, an array, an object or a function. This is short for registering a service where its\n * provider's `$get` property is a factory function that takes no arguments and returns the **value\n * service**.\n *\n * Value services are similar to constant services, except that they cannot be injected into a\n * module configuration function (see {@link angular.Module#config}) but they can be overridden by\n * an Angular\n * {@link auto.$provide#decorator decorator}.\n *\n * @param {string} name The name of the instance.\n * @param {*} value The value.\n * @returns {Object} registered provider instance\n *\n * @example\n * Here are some examples of creating value services.\n * ```js\n * $provide.value('ADMIN_USER', 'admin');\n *\n * $provide.value('RoleLookup', { admin: 0, writer: 1, reader: 2 });\n *\n * $provide.value('halfOf', function(value) {\n * return value / 2;\n * });\n * ```\n */\n\n\n/**\n * @ngdoc method\n * @name $provide#constant\n * @description\n *\n * Register a **constant service**, such as a string, a number, an array, an object or a function,\n * with the {@link auto.$injector $injector}. Unlike {@link auto.$provide#value value} it can be\n * injected into a module configuration function (see {@link angular.Module#config}) and it cannot\n * be overridden by an Angular {@link auto.$provide#decorator decorator}.\n *\n * @param {string} name The name of the constant.\n * @param {*} value The constant value.\n * @returns {Object} registered instance\n *\n * @example\n * Here a some examples of creating constants:\n * ```js\n * $provide.constant('SHARD_HEIGHT', 306);\n *\n * $provide.constant('MY_COLOURS', ['red', 'blue', 'grey']);\n *\n * $provide.constant('double', function(value) {\n * return value * 2;\n * });\n * ```\n */\n\n\n/**\n * @ngdoc method\n * @name $provide#decorator\n * @description\n *\n * Register a **service decorator** with the {@link auto.$injector $injector}. A service decorator\n * intercepts the creation of a service, allowing it to override or modify the behaviour of the\n * service. The object returned by the decorator may be the original service, or a new service\n * object which replaces or wraps and delegates to the original service.\n *\n * @param {string} name The name of the service to decorate.\n * @param {Function|Array.} decorator This function will be invoked when the service needs to be\n * instantiated and should return the decorated service instance. The function is called using\n * the {@link auto.$injector#invoke injector.invoke} method and is therefore fully injectable.\n * Local injection arguments:\n *\n * * `$delegate` - The original service instance, which can be monkey patched, configured,\n * decorated or delegated to.\n *\n * @example\n * Here we decorate the {@link ng.$log $log} service to convert warnings to errors by intercepting\n * calls to {@link ng.$log#error $log.warn()}.\n * ```js\n * $provide.decorator('$log', ['$delegate', function($delegate) {\n * $delegate.warn = $delegate.error;\n * return $delegate;\n * }]);\n * ```\n */\n\n\nfunction createInjector(modulesToLoad, strictDi) {\n strictDi = (strictDi === true);\n var INSTANTIATING = {},\n providerSuffix = 'Provider',\n path = [],\n loadedModules = new HashMap([], true),\n providerCache = {\n $provide: {\n provider: supportObject(provider),\n factory: supportObject(factory),\n service: supportObject(service),\n value: supportObject(value),\n constant: supportObject(constant),\n decorator: decorator\n }\n },\n providerInjector = (providerCache.$injector =\n createInternalInjector(providerCache, function(serviceName, caller) {\n if (angular.isString(caller)) {\n path.push(caller);\n }\n throw $injectorMinErr('unpr', \"Unknown provider: {0}\", path.join(' <- '));\n })),\n instanceCache = {},\n instanceInjector = (instanceCache.$injector =\n createInternalInjector(instanceCache, function(serviceName, caller) {\n var provider = providerInjector.get(serviceName + providerSuffix, caller);\n return instanceInjector.invoke(provider.$get, provider, undefined, serviceName);\n }));\n\n\n forEach(loadModules(modulesToLoad), function(fn) { if (fn) instanceInjector.invoke(fn); });\n\n return instanceInjector;\n\n ////////////////////////////////////\n // $provider\n ////////////////////////////////////\n\n function supportObject(delegate) {\n return function(key, value) {\n if (isObject(key)) {\n forEach(key, reverseParams(delegate));\n } else {\n return delegate(key, value);\n }\n };\n }\n\n function provider(name, provider_) {\n assertNotHasOwnProperty(name, 'service');\n if (isFunction(provider_) || isArray(provider_)) {\n provider_ = providerInjector.instantiate(provider_);\n }\n if (!provider_.$get) {\n throw $injectorMinErr('pget', \"Provider '{0}' must define $get factory method.\", name);\n }\n return providerCache[name + providerSuffix] = provider_;\n }\n\n function enforceReturnValue(name, factory) {\n return function enforcedReturnValue() {\n var result = instanceInjector.invoke(factory, this);\n if (isUndefined(result)) {\n throw $injectorMinErr('undef', \"Provider '{0}' must return a value from $get factory method.\", name);\n }\n return result;\n };\n }\n\n function factory(name, factoryFn, enforce) {\n return provider(name, {\n $get: enforce !== false ? enforceReturnValue(name, factoryFn) : factoryFn\n });\n }\n\n function service(name, constructor) {\n return factory(name, ['$injector', function($injector) {\n return $injector.instantiate(constructor);\n }]);\n }\n\n function value(name, val) { return factory(name, valueFn(val), false); }\n\n function constant(name, value) {\n assertNotHasOwnProperty(name, 'constant');\n providerCache[name] = value;\n instanceCache[name] = value;\n }\n\n function decorator(serviceName, decorFn) {\n var origProvider = providerInjector.get(serviceName + providerSuffix),\n orig$get = origProvider.$get;\n\n origProvider.$get = function() {\n var origInstance = instanceInjector.invoke(orig$get, origProvider);\n return instanceInjector.invoke(decorFn, null, {$delegate: origInstance});\n };\n }\n\n ////////////////////////////////////\n // Module Loading\n ////////////////////////////////////\n function loadModules(modulesToLoad) {\n var runBlocks = [], moduleFn;\n forEach(modulesToLoad, function(module) {\n if (loadedModules.get(module)) return;\n loadedModules.put(module, true);\n\n function runInvokeQueue(queue) {\n var i, ii;\n for (i = 0, ii = queue.length; i < ii; i++) {\n var invokeArgs = queue[i],\n provider = providerInjector.get(invokeArgs[0]);\n\n provider[invokeArgs[1]].apply(provider, invokeArgs[2]);\n }\n }\n\n try {\n if (isString(module)) {\n moduleFn = angularModule(module);\n runBlocks = runBlocks.concat(loadModules(moduleFn.requires)).concat(moduleFn._runBlocks);\n runInvokeQueue(moduleFn._invokeQueue);\n runInvokeQueue(moduleFn._configBlocks);\n } else if (isFunction(module)) {\n runBlocks.push(providerInjector.invoke(module));\n } else if (isArray(module)) {\n runBlocks.push(providerInjector.invoke(module));\n } else {\n assertArgFn(module, 'module');\n }\n } catch (e) {\n if (isArray(module)) {\n module = module[module.length - 1];\n }\n if (e.message && e.stack && e.stack.indexOf(e.message) == -1) {\n // Safari & FF's stack traces don't contain error.message content\n // unlike those of Chrome and IE\n // So if stack doesn't contain message, we create a new string that contains both.\n // Since error.stack is read-only in Safari, I'm overriding e and not e.stack here.\n /* jshint -W022 */\n e = e.message + '\\n' + e.stack;\n }\n throw $injectorMinErr('modulerr', \"Failed to instantiate module {0} due to:\\n{1}\",\n module, e.stack || e.message || e);\n }\n });\n return runBlocks;\n }\n\n ////////////////////////////////////\n // internal Injector\n ////////////////////////////////////\n\n function createInternalInjector(cache, factory) {\n\n function getService(serviceName, caller) {\n if (cache.hasOwnProperty(serviceName)) {\n if (cache[serviceName] === INSTANTIATING) {\n throw $injectorMinErr('cdep', 'Circular dependency found: {0}',\n serviceName + ' <- ' + path.join(' <- '));\n }\n return cache[serviceName];\n } else {\n try {\n path.unshift(serviceName);\n cache[serviceName] = INSTANTIATING;\n return cache[serviceName] = factory(serviceName, caller);\n } catch (err) {\n if (cache[serviceName] === INSTANTIATING) {\n delete cache[serviceName];\n }\n throw err;\n } finally {\n path.shift();\n }\n }\n }\n\n function invoke(fn, self, locals, serviceName) {\n if (typeof locals === 'string') {\n serviceName = locals;\n locals = null;\n }\n\n var args = [],\n $inject = createInjector.$$annotate(fn, strictDi, serviceName),\n length, i,\n key;\n\n for (i = 0, length = $inject.length; i < length; i++) {\n key = $inject[i];\n if (typeof key !== 'string') {\n throw $injectorMinErr('itkn',\n 'Incorrect injection token! Expected service name as string, got {0}', key);\n }\n args.push(\n locals && locals.hasOwnProperty(key)\n ? locals[key]\n : getService(key, serviceName)\n );\n }\n if (isArray(fn)) {\n fn = fn[length];\n }\n\n // http://jsperf.com/angularjs-invoke-apply-vs-switch\n // #5388\n return fn.apply(self, args);\n }\n\n function instantiate(Type, locals, serviceName) {\n // Check if Type is annotated and use just the given function at n-1 as parameter\n // e.g. someModule.factory('greeter', ['$window', function(renamed$window) {}]);\n // Object creation: http://jsperf.com/create-constructor/2\n var instance = Object.create((isArray(Type) ? Type[Type.length - 1] : Type).prototype || null);\n var returnedValue = invoke(Type, instance, locals, serviceName);\n\n return isObject(returnedValue) || isFunction(returnedValue) ? returnedValue : instance;\n }\n\n return {\n invoke: invoke,\n instantiate: instantiate,\n get: getService,\n annotate: createInjector.$$annotate,\n has: function(name) {\n return providerCache.hasOwnProperty(name + providerSuffix) || cache.hasOwnProperty(name);\n }\n };\n }\n}\n\ncreateInjector.$$annotate = annotate;\n\n/**\n * @ngdoc provider\n * @name $anchorScrollProvider\n *\n * @description\n * Use `$anchorScrollProvider` to disable automatic scrolling whenever\n * {@link ng.$location#hash $location.hash()} changes.\n */\nfunction $AnchorScrollProvider() {\n\n var autoScrollingEnabled = true;\n\n /**\n * @ngdoc method\n * @name $anchorScrollProvider#disableAutoScrolling\n *\n * @description\n * By default, {@link ng.$anchorScroll $anchorScroll()} will automatically detect changes to\n * {@link ng.$location#hash $location.hash()} and scroll to the element matching the new hash.
    \n * Use this method to disable automatic scrolling.\n *\n * If automatic scrolling is disabled, one must explicitly call\n * {@link ng.$anchorScroll $anchorScroll()} in order to scroll to the element related to the\n * current hash.\n */\n this.disableAutoScrolling = function() {\n autoScrollingEnabled = false;\n };\n\n /**\n * @ngdoc service\n * @name $anchorScroll\n * @kind function\n * @requires $window\n * @requires $location\n * @requires $rootScope\n *\n * @description\n * When called, it scrolls to the element related to the specified `hash` or (if omitted) to the\n * current value of {@link ng.$location#hash $location.hash()}, according to the rules specified\n * in the\n * [HTML5 spec](http://dev.w3.org/html5/spec/Overview.html#the-indicated-part-of-the-document).\n *\n * It also watches the {@link ng.$location#hash $location.hash()} and automatically scrolls to\n * match any anchor whenever it changes. This can be disabled by calling\n * {@link ng.$anchorScrollProvider#disableAutoScrolling $anchorScrollProvider.disableAutoScrolling()}.\n *\n * Additionally, you can use its {@link ng.$anchorScroll#yOffset yOffset} property to specify a\n * vertical scroll-offset (either fixed or dynamic).\n *\n * @param {string=} hash The hash specifying the element to scroll to. If omitted, the value of\n * {@link ng.$location#hash $location.hash()} will be used.\n *\n * @property {(number|function|jqLite)} yOffset\n * If set, specifies a vertical scroll-offset. This is often useful when there are fixed\n * positioned elements at the top of the page, such as navbars, headers etc.\n *\n * `yOffset` can be specified in various ways:\n * - **number**: A fixed number of pixels to be used as offset.

    \n * - **function**: A getter function called everytime `$anchorScroll()` is executed. Must return\n * a number representing the offset (in pixels).

    \n * - **jqLite**: A jqLite/jQuery element to be used for specifying the offset. The distance from\n * the top of the page to the element's bottom will be used as offset.
    \n * **Note**: The element will be taken into account only as long as its `position` is set to\n * `fixed`. This option is useful, when dealing with responsive navbars/headers that adjust\n * their height and/or positioning according to the viewport's size.\n *\n *
    \n *
    \n * In order for `yOffset` to work properly, scrolling should take place on the document's root and\n * not some child element.\n *
    \n *\n * @example\n \n \n
    \n Go to bottom\n You're at the bottom!\n
    \n
    \n \n angular.module('anchorScrollExample', [])\n .controller('ScrollController', ['$scope', '$location', '$anchorScroll',\n function ($scope, $location, $anchorScroll) {\n $scope.gotoBottom = function() {\n // set the location.hash to the id of\n // the element you wish to scroll to.\n $location.hash('bottom');\n\n // call $anchorScroll()\n $anchorScroll();\n };\n }]);\n \n \n #scrollArea {\n height: 280px;\n overflow: auto;\n }\n\n #bottom {\n display: block;\n margin-top: 2000px;\n }\n \n
    \n *\n *
    \n * The example below illustrates the use of a vertical scroll-offset (specified as a fixed value).\n * See {@link ng.$anchorScroll#yOffset $anchorScroll.yOffset} for more details.\n *\n * @example\n \n \n \n
    \n Anchor {{x}} of 5\n
    \n
    \n \n angular.module('anchorScrollOffsetExample', [])\n .run(['$anchorScroll', function($anchorScroll) {\n $anchorScroll.yOffset = 50; // always scroll by 50 extra pixels\n }])\n .controller('headerCtrl', ['$anchorScroll', '$location', '$scope',\n function ($anchorScroll, $location, $scope) {\n $scope.gotoAnchor = function(x) {\n var newHash = 'anchor' + x;\n if ($location.hash() !== newHash) {\n // set the $location.hash to `newHash` and\n // $anchorScroll will automatically scroll to it\n $location.hash('anchor' + x);\n } else {\n // call $anchorScroll() explicitly,\n // since $location.hash hasn't changed\n $anchorScroll();\n }\n };\n }\n ]);\n \n \n body {\n padding-top: 50px;\n }\n\n .anchor {\n border: 2px dashed DarkOrchid;\n padding: 10px 10px 200px 10px;\n }\n\n .fixed-header {\n background-color: rgba(0, 0, 0, 0.2);\n height: 50px;\n position: fixed;\n top: 0; left: 0; right: 0;\n }\n\n .fixed-header > a {\n display: inline-block;\n margin: 5px 15px;\n }\n \n
    \n */\n this.$get = ['$window', '$location', '$rootScope', function($window, $location, $rootScope) {\n var document = $window.document;\n\n // Helper function to get first anchor from a NodeList\n // (using `Array#some()` instead of `angular#forEach()` since it's more performant\n // and working in all supported browsers.)\n function getFirstAnchor(list) {\n var result = null;\n Array.prototype.some.call(list, function(element) {\n if (nodeName_(element) === 'a') {\n result = element;\n return true;\n }\n });\n return result;\n }\n\n function getYOffset() {\n\n var offset = scroll.yOffset;\n\n if (isFunction(offset)) {\n offset = offset();\n } else if (isElement(offset)) {\n var elem = offset[0];\n var style = $window.getComputedStyle(elem);\n if (style.position !== 'fixed') {\n offset = 0;\n } else {\n offset = elem.getBoundingClientRect().bottom;\n }\n } else if (!isNumber(offset)) {\n offset = 0;\n }\n\n return offset;\n }\n\n function scrollTo(elem) {\n if (elem) {\n elem.scrollIntoView();\n\n var offset = getYOffset();\n\n if (offset) {\n // `offset` is the number of pixels we should scroll UP in order to align `elem` properly.\n // This is true ONLY if the call to `elem.scrollIntoView()` initially aligns `elem` at the\n // top of the viewport.\n //\n // IF the number of pixels from the top of `elem` to the end of the page's content is less\n // than the height of the viewport, then `elem.scrollIntoView()` will align the `elem` some\n // way down the page.\n //\n // This is often the case for elements near the bottom of the page.\n //\n // In such cases we do not need to scroll the whole `offset` up, just the difference between\n // the top of the element and the offset, which is enough to align the top of `elem` at the\n // desired position.\n var elemTop = elem.getBoundingClientRect().top;\n $window.scrollBy(0, elemTop - offset);\n }\n } else {\n $window.scrollTo(0, 0);\n }\n }\n\n function scroll(hash) {\n hash = isString(hash) ? hash : $location.hash();\n var elm;\n\n // empty hash, scroll to the top of the page\n if (!hash) scrollTo(null);\n\n // element with given id\n else if ((elm = document.getElementById(hash))) scrollTo(elm);\n\n // first anchor with given name :-D\n else if ((elm = getFirstAnchor(document.getElementsByName(hash)))) scrollTo(elm);\n\n // no element and hash == 'top', scroll to the top of the page\n else if (hash === 'top') scrollTo(null);\n }\n\n // does not scroll when user clicks on anchor link that is currently on\n // (no url change, no $location.hash() change), browser native does scroll\n if (autoScrollingEnabled) {\n $rootScope.$watch(function autoScrollWatch() {return $location.hash();},\n function autoScrollWatchAction(newVal, oldVal) {\n // skip the initial scroll if $location.hash is empty\n if (newVal === oldVal && newVal === '') return;\n\n jqLiteDocumentLoaded(function() {\n $rootScope.$evalAsync(scroll);\n });\n });\n }\n\n return scroll;\n }];\n}\n\nvar $animateMinErr = minErr('$animate');\nvar ELEMENT_NODE = 1;\nvar NG_ANIMATE_CLASSNAME = 'ng-animate';\n\nfunction mergeClasses(a,b) {\n if (!a && !b) return '';\n if (!a) return b;\n if (!b) return a;\n if (isArray(a)) a = a.join(' ');\n if (isArray(b)) b = b.join(' ');\n return a + ' ' + b;\n}\n\nfunction extractElementNode(element) {\n for (var i = 0; i < element.length; i++) {\n var elm = element[i];\n if (elm.nodeType === ELEMENT_NODE) {\n return elm;\n }\n }\n}\n\nfunction splitClasses(classes) {\n if (isString(classes)) {\n classes = classes.split(' ');\n }\n\n // Use createMap() to prevent class assumptions involving property names in\n // Object.prototype\n var obj = createMap();\n forEach(classes, function(klass) {\n // sometimes the split leaves empty string values\n // incase extra spaces were applied to the options\n if (klass.length) {\n obj[klass] = true;\n }\n });\n return obj;\n}\n\n// if any other type of options value besides an Object value is\n// passed into the $animate.method() animation then this helper code\n// will be run which will ignore it. While this patch is not the\n// greatest solution to this, a lot of existing plugins depend on\n// $animate to either call the callback (< 1.2) or return a promise\n// that can be changed. This helper function ensures that the options\n// are wiped clean incase a callback function is provided.\nfunction prepareAnimateOptions(options) {\n return isObject(options)\n ? options\n : {};\n}\n\nvar $$CoreAnimateRunnerProvider = function() {\n this.$get = ['$q', '$$rAF', function($q, $$rAF) {\n function AnimateRunner() {}\n AnimateRunner.all = noop;\n AnimateRunner.chain = noop;\n AnimateRunner.prototype = {\n end: noop,\n cancel: noop,\n resume: noop,\n pause: noop,\n complete: noop,\n then: function(pass, fail) {\n return $q(function(resolve) {\n $$rAF(function() {\n resolve();\n });\n }).then(pass, fail);\n }\n };\n return AnimateRunner;\n }];\n};\n\n// this is prefixed with Core since it conflicts with\n// the animateQueueProvider defined in ngAnimate/animateQueue.js\nvar $$CoreAnimateQueueProvider = function() {\n var postDigestQueue = new HashMap();\n var postDigestElements = [];\n\n this.$get = ['$$AnimateRunner', '$rootScope',\n function($$AnimateRunner, $rootScope) {\n return {\n enabled: noop,\n on: noop,\n off: noop,\n pin: noop,\n\n push: function(element, event, options, domOperation) {\n domOperation && domOperation();\n\n options = options || {};\n options.from && element.css(options.from);\n options.to && element.css(options.to);\n\n if (options.addClass || options.removeClass) {\n addRemoveClassesPostDigest(element, options.addClass, options.removeClass);\n }\n\n return new $$AnimateRunner(); // jshint ignore:line\n }\n };\n\n function addRemoveClassesPostDigest(element, add, remove) {\n var data = postDigestQueue.get(element);\n var classVal;\n\n if (!data) {\n postDigestQueue.put(element, data = {});\n postDigestElements.push(element);\n }\n\n if (add) {\n forEach(add.split(' '), function(className) {\n if (className) {\n data[className] = true;\n }\n });\n }\n\n if (remove) {\n forEach(remove.split(' '), function(className) {\n if (className) {\n data[className] = false;\n }\n });\n }\n\n if (postDigestElements.length > 1) return;\n\n $rootScope.$$postDigest(function() {\n forEach(postDigestElements, function(element) {\n var data = postDigestQueue.get(element);\n if (data) {\n var existing = splitClasses(element.attr('class'));\n var toAdd = '';\n var toRemove = '';\n forEach(data, function(status, className) {\n var hasClass = !!existing[className];\n if (status !== hasClass) {\n if (status) {\n toAdd += (toAdd.length ? ' ' : '') + className;\n } else {\n toRemove += (toRemove.length ? ' ' : '') + className;\n }\n }\n });\n\n forEach(element, function(elm) {\n toAdd && jqLiteAddClass(elm, toAdd);\n toRemove && jqLiteRemoveClass(elm, toRemove);\n });\n postDigestQueue.remove(element);\n }\n });\n\n postDigestElements.length = 0;\n });\n }\n }];\n};\n\n/**\n * @ngdoc provider\n * @name $animateProvider\n *\n * @description\n * Default implementation of $animate that doesn't perform any animations, instead just\n * synchronously performs DOM updates and resolves the returned runner promise.\n *\n * In order to enable animations the `ngAnimate` module has to be loaded.\n *\n * To see the functional implementation check out `src/ngAnimate/animate.js`.\n */\nvar $AnimateProvider = ['$provide', function($provide) {\n var provider = this;\n\n this.$$registeredAnimations = Object.create(null);\n\n /**\n * @ngdoc method\n * @name $animateProvider#register\n *\n * @description\n * Registers a new injectable animation factory function. The factory function produces the\n * animation object which contains callback functions for each event that is expected to be\n * animated.\n *\n * * `eventFn`: `function(element, ... , doneFunction, options)`\n * The element to animate, the `doneFunction` and the options fed into the animation. Depending\n * on the type of animation additional arguments will be injected into the animation function. The\n * list below explains the function signatures for the different animation methods:\n *\n * - setClass: function(element, addedClasses, removedClasses, doneFunction, options)\n * - addClass: function(element, addedClasses, doneFunction, options)\n * - removeClass: function(element, removedClasses, doneFunction, options)\n * - enter, leave, move: function(element, doneFunction, options)\n * - animate: function(element, fromStyles, toStyles, doneFunction, options)\n *\n * Make sure to trigger the `doneFunction` once the animation is fully complete.\n *\n * ```js\n * return {\n * //enter, leave, move signature\n * eventFn : function(element, done, options) {\n * //code to run the animation\n * //once complete, then run done()\n * return function endFunction(wasCancelled) {\n * //code to cancel the animation\n * }\n * }\n * }\n * ```\n *\n * @param {string} name The name of the animation (this is what the class-based CSS value will be compared to).\n * @param {Function} factory The factory function that will be executed to return the animation\n * object.\n */\n this.register = function(name, factory) {\n if (name && name.charAt(0) !== '.') {\n throw $animateMinErr('notcsel', \"Expecting class selector starting with '.' got '{0}'.\", name);\n }\n\n var key = name + '-animation';\n provider.$$registeredAnimations[name.substr(1)] = key;\n $provide.factory(key, factory);\n };\n\n /**\n * @ngdoc method\n * @name $animateProvider#classNameFilter\n *\n * @description\n * Sets and/or returns the CSS class regular expression that is checked when performing\n * an animation. Upon bootstrap the classNameFilter value is not set at all and will\n * therefore enable $animate to attempt to perform an animation on any element that is triggered.\n * When setting the `classNameFilter` value, animations will only be performed on elements\n * that successfully match the filter expression. This in turn can boost performance\n * for low-powered devices as well as applications containing a lot of structural operations.\n * @param {RegExp=} expression The className expression which will be checked against all animations\n * @return {RegExp} The current CSS className expression value. If null then there is no expression value\n */\n this.classNameFilter = function(expression) {\n if (arguments.length === 1) {\n this.$$classNameFilter = (expression instanceof RegExp) ? expression : null;\n if (this.$$classNameFilter) {\n var reservedRegex = new RegExp(\"(\\\\s+|\\\\/)\" + NG_ANIMATE_CLASSNAME + \"(\\\\s+|\\\\/)\");\n if (reservedRegex.test(this.$$classNameFilter.toString())) {\n throw $animateMinErr('nongcls','$animateProvider.classNameFilter(regex) prohibits accepting a regex value which matches/contains the \"{0}\" CSS class.', NG_ANIMATE_CLASSNAME);\n\n }\n }\n }\n return this.$$classNameFilter;\n };\n\n this.$get = ['$$animateQueue', function($$animateQueue) {\n function domInsert(element, parentElement, afterElement) {\n // if for some reason the previous element was removed\n // from the dom sometime before this code runs then let's\n // just stick to using the parent element as the anchor\n if (afterElement) {\n var afterNode = extractElementNode(afterElement);\n if (afterNode && !afterNode.parentNode && !afterNode.previousElementSibling) {\n afterElement = null;\n }\n }\n afterElement ? afterElement.after(element) : parentElement.prepend(element);\n }\n\n /**\n * @ngdoc service\n * @name $animate\n * @description The $animate service exposes a series of DOM utility methods that provide support\n * for animation hooks. The default behavior is the application of DOM operations, however,\n * when an animation is detected (and animations are enabled), $animate will do the heavy lifting\n * to ensure that animation runs with the triggered DOM operation.\n *\n * By default $animate doesn't trigger an animations. This is because the `ngAnimate` module isn't\n * included and only when it is active then the animation hooks that `$animate` triggers will be\n * functional. Once active then all structural `ng-` directives will trigger animations as they perform\n * their DOM-related operations (enter, leave and move). Other directives such as `ngClass`,\n * `ngShow`, `ngHide` and `ngMessages` also provide support for animations.\n *\n * It is recommended that the`$animate` service is always used when executing DOM-related procedures within directives.\n *\n * To learn more about enabling animation support, click here to visit the\n * {@link ngAnimate ngAnimate module page}.\n */\n return {\n // we don't call it directly since non-existant arguments may\n // be interpreted as null within the sub enabled function\n\n /**\n *\n * @ngdoc method\n * @name $animate#on\n * @kind function\n * @description Sets up an event listener to fire whenever the animation event (enter, leave, move, etc...)\n * has fired on the given element or among any of its children. Once the listener is fired, the provided callback\n * is fired with the following params:\n *\n * ```js\n * $animate.on('enter', container,\n * function callback(element, phase) {\n * // cool we detected an enter animation within the container\n * }\n * );\n * ```\n *\n * @param {string} event the animation event that will be captured (e.g. enter, leave, move, addClass, removeClass, etc...)\n * @param {DOMElement} container the container element that will capture each of the animation events that are fired on itself\n * as well as among its children\n * @param {Function} callback the callback function that will be fired when the listener is triggered\n *\n * The arguments present in the callback function are:\n * * `element` - The captured DOM element that the animation was fired on.\n * * `phase` - The phase of the animation. The two possible phases are **start** (when the animation starts) and **close** (when it ends).\n */\n on: $$animateQueue.on,\n\n /**\n *\n * @ngdoc method\n * @name $animate#off\n * @kind function\n * @description Deregisters an event listener based on the event which has been associated with the provided element. This method\n * can be used in three different ways depending on the arguments:\n *\n * ```js\n * // remove all the animation event listeners listening for `enter`\n * $animate.off('enter');\n *\n * // remove all the animation event listeners listening for `enter` on the given element and its children\n * $animate.off('enter', container);\n *\n * // remove the event listener function provided by `listenerFn` that is set\n * // to listen for `enter` on the given `element` as well as its children\n * $animate.off('enter', container, callback);\n * ```\n *\n * @param {string} event the animation event (e.g. enter, leave, move, addClass, removeClass, etc...)\n * @param {DOMElement=} container the container element the event listener was placed on\n * @param {Function=} callback the callback function that was registered as the listener\n */\n off: $$animateQueue.off,\n\n /**\n * @ngdoc method\n * @name $animate#pin\n * @kind function\n * @description Associates the provided element with a host parent element to allow the element to be animated even if it exists\n * outside of the DOM structure of the Angular application. By doing so, any animation triggered via `$animate` can be issued on the\n * element despite being outside the realm of the application or within another application. Say for example if the application\n * was bootstrapped on an element that is somewhere inside of the `` tag, but we wanted to allow for an element to be situated\n * as a direct child of `document.body`, then this can be achieved by pinning the element via `$animate.pin(element)`. Keep in mind\n * that calling `$animate.pin(element, parentElement)` will not actually insert into the DOM anywhere; it will just create the association.\n *\n * Note that this feature is only active when the `ngAnimate` module is used.\n *\n * @param {DOMElement} element the external element that will be pinned\n * @param {DOMElement} parentElement the host parent element that will be associated with the external element\n */\n pin: $$animateQueue.pin,\n\n /**\n *\n * @ngdoc method\n * @name $animate#enabled\n * @kind function\n * @description Used to get and set whether animations are enabled or not on the entire application or on an element and its children. This\n * function can be called in four ways:\n *\n * ```js\n * // returns true or false\n * $animate.enabled();\n *\n * // changes the enabled state for all animations\n * $animate.enabled(false);\n * $animate.enabled(true);\n *\n * // returns true or false if animations are enabled for an element\n * $animate.enabled(element);\n *\n * // changes the enabled state for an element and its children\n * $animate.enabled(element, true);\n * $animate.enabled(element, false);\n * ```\n *\n * @param {DOMElement=} element the element that will be considered for checking/setting the enabled state\n * @param {boolean=} enabled whether or not the animations will be enabled for the element\n *\n * @return {boolean} whether or not animations are enabled\n */\n enabled: $$animateQueue.enabled,\n\n /**\n * @ngdoc method\n * @name $animate#cancel\n * @kind function\n * @description Cancels the provided animation.\n *\n * @param {Promise} animationPromise The animation promise that is returned when an animation is started.\n */\n cancel: function(runner) {\n runner.end && runner.end();\n },\n\n /**\n *\n * @ngdoc method\n * @name $animate#enter\n * @kind function\n * @description Inserts the element into the DOM either after the `after` element (if provided) or\n * as the first child within the `parent` element and then triggers an animation.\n * A promise is returned that will be resolved during the next digest once the animation\n * has completed.\n *\n * @param {DOMElement} element the element which will be inserted into the DOM\n * @param {DOMElement} parent the parent element which will append the element as\n * a child (so long as the after element is not present)\n * @param {DOMElement=} after the sibling element after which the element will be appended\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n enter: function(element, parent, after, options) {\n parent = parent && jqLite(parent);\n after = after && jqLite(after);\n parent = parent || after.parent();\n domInsert(element, parent, after);\n return $$animateQueue.push(element, 'enter', prepareAnimateOptions(options));\n },\n\n /**\n *\n * @ngdoc method\n * @name $animate#move\n * @kind function\n * @description Inserts (moves) the element into its new position in the DOM either after\n * the `after` element (if provided) or as the first child within the `parent` element\n * and then triggers an animation. A promise is returned that will be resolved\n * during the next digest once the animation has completed.\n *\n * @param {DOMElement} element the element which will be moved into the new DOM position\n * @param {DOMElement} parent the parent element which will append the element as\n * a child (so long as the after element is not present)\n * @param {DOMElement=} after the sibling element after which the element will be appended\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n move: function(element, parent, after, options) {\n parent = parent && jqLite(parent);\n after = after && jqLite(after);\n parent = parent || after.parent();\n domInsert(element, parent, after);\n return $$animateQueue.push(element, 'move', prepareAnimateOptions(options));\n },\n\n /**\n * @ngdoc method\n * @name $animate#leave\n * @kind function\n * @description Triggers an animation and then removes the element from the DOM.\n * When the function is called a promise is returned that will be resolved during the next\n * digest once the animation has completed.\n *\n * @param {DOMElement} element the element which will be removed from the DOM\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n leave: function(element, options) {\n return $$animateQueue.push(element, 'leave', prepareAnimateOptions(options), function() {\n element.remove();\n });\n },\n\n /**\n * @ngdoc method\n * @name $animate#addClass\n * @kind function\n *\n * @description Triggers an addClass animation surrounding the addition of the provided CSS class(es). Upon\n * execution, the addClass operation will only be handled after the next digest and it will not trigger an\n * animation if element already contains the CSS class or if the class is removed at a later step.\n * Note that class-based animations are treated differently compared to structural animations\n * (like enter, move and leave) since the CSS classes may be added/removed at different points\n * depending if CSS or JavaScript animations are used.\n *\n * @param {DOMElement} element the element which the CSS classes will be applied to\n * @param {string} className the CSS class(es) that will be added (multiple classes are separated via spaces)\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n addClass: function(element, className, options) {\n options = prepareAnimateOptions(options);\n options.addClass = mergeClasses(options.addclass, className);\n return $$animateQueue.push(element, 'addClass', options);\n },\n\n /**\n * @ngdoc method\n * @name $animate#removeClass\n * @kind function\n *\n * @description Triggers a removeClass animation surrounding the removal of the provided CSS class(es). Upon\n * execution, the removeClass operation will only be handled after the next digest and it will not trigger an\n * animation if element does not contain the CSS class or if the class is added at a later step.\n * Note that class-based animations are treated differently compared to structural animations\n * (like enter, move and leave) since the CSS classes may be added/removed at different points\n * depending if CSS or JavaScript animations are used.\n *\n * @param {DOMElement} element the element which the CSS classes will be applied to\n * @param {string} className the CSS class(es) that will be removed (multiple classes are separated via spaces)\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n removeClass: function(element, className, options) {\n options = prepareAnimateOptions(options);\n options.removeClass = mergeClasses(options.removeClass, className);\n return $$animateQueue.push(element, 'removeClass', options);\n },\n\n /**\n * @ngdoc method\n * @name $animate#setClass\n * @kind function\n *\n * @description Performs both the addition and removal of a CSS classes on an element and (during the process)\n * triggers an animation surrounding the class addition/removal. Much like `$animate.addClass` and\n * `$animate.removeClass`, `setClass` will only evaluate the classes being added/removed once a digest has\n * passed. Note that class-based animations are treated differently compared to structural animations\n * (like enter, move and leave) since the CSS classes may be added/removed at different points\n * depending if CSS or JavaScript animations are used.\n *\n * @param {DOMElement} element the element which the CSS classes will be applied to\n * @param {string} add the CSS class(es) that will be added (multiple classes are separated via spaces)\n * @param {string} remove the CSS class(es) that will be removed (multiple classes are separated via spaces)\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n setClass: function(element, add, remove, options) {\n options = prepareAnimateOptions(options);\n options.addClass = mergeClasses(options.addClass, add);\n options.removeClass = mergeClasses(options.removeClass, remove);\n return $$animateQueue.push(element, 'setClass', options);\n },\n\n /**\n * @ngdoc method\n * @name $animate#animate\n * @kind function\n *\n * @description Performs an inline animation on the element which applies the provided to and from CSS styles to the element.\n * If any detected CSS transition, keyframe or JavaScript matches the provided className value then the animation will take\n * on the provided styles. For example, if a transition animation is set for the given className then the provided from and\n * to styles will be applied alongside the given transition. If a JavaScript animation is detected then the provided styles\n * will be given in as function paramters into the `animate` method (or as apart of the `options` parameter).\n *\n * @param {DOMElement} element the element which the CSS styles will be applied to\n * @param {object} from the from (starting) CSS styles that will be applied to the element and across the animation.\n * @param {object} to the to (destination) CSS styles that will be applied to the element and across the animation.\n * @param {string=} className an optional CSS class that will be applied to the element for the duration of the animation. If\n * this value is left as empty then a CSS class of `ng-inline-animate` will be applied to the element.\n * (Note that if no animation is detected then this value will not be appplied to the element.)\n * @param {object=} options an optional collection of options/styles that will be applied to the element\n *\n * @return {Promise} the animation callback promise\n */\n animate: function(element, from, to, className, options) {\n options = prepareAnimateOptions(options);\n options.from = options.from ? extend(options.from, from) : from;\n options.to = options.to ? extend(options.to, to) : to;\n\n className = className || 'ng-inline-animate';\n options.tempClasses = mergeClasses(options.tempClasses, className);\n return $$animateQueue.push(element, 'animate', options);\n }\n };\n }];\n}];\n\nfunction $$AsyncCallbackProvider() {\n this.$get = ['$$rAF', '$timeout', function($$rAF, $timeout) {\n return $$rAF.supported\n ? function(fn) { return $$rAF(fn); }\n : function(fn) {\n return $timeout(fn, 0, false);\n };\n }];\n}\n\n/* global stripHash: true */\n\n/**\n * ! This is a private undocumented service !\n *\n * @name $browser\n * @requires $log\n * @description\n * This object has two goals:\n *\n * - hide all the global state in the browser caused by the window object\n * - abstract away all the browser specific features and inconsistencies\n *\n * For tests we provide {@link ngMock.$browser mock implementation} of the `$browser`\n * service, which can be used for convenient testing of the application without the interaction with\n * the real browser apis.\n */\n/**\n * @param {object} window The global window object.\n * @param {object} document jQuery wrapped document.\n * @param {object} $log window.console or an object with the same interface.\n * @param {object} $sniffer $sniffer service\n */\nfunction Browser(window, document, $log, $sniffer) {\n var self = this,\n rawDocument = document[0],\n location = window.location,\n history = window.history,\n setTimeout = window.setTimeout,\n clearTimeout = window.clearTimeout,\n pendingDeferIds = {};\n\n self.isMock = false;\n\n var outstandingRequestCount = 0;\n var outstandingRequestCallbacks = [];\n\n // TODO(vojta): remove this temporary api\n self.$$completeOutstandingRequest = completeOutstandingRequest;\n self.$$incOutstandingRequestCount = function() { outstandingRequestCount++; };\n\n /**\n * Executes the `fn` function(supports currying) and decrements the `outstandingRequestCallbacks`\n * counter. If the counter reaches 0, all the `outstandingRequestCallbacks` are executed.\n */\n function completeOutstandingRequest(fn) {\n try {\n fn.apply(null, sliceArgs(arguments, 1));\n } finally {\n outstandingRequestCount--;\n if (outstandingRequestCount === 0) {\n while (outstandingRequestCallbacks.length) {\n try {\n outstandingRequestCallbacks.pop()();\n } catch (e) {\n $log.error(e);\n }\n }\n }\n }\n }\n\n function getHash(url) {\n var index = url.indexOf('#');\n return index === -1 ? '' : url.substr(index);\n }\n\n /**\n * @private\n * Note: this method is used only by scenario runner\n * TODO(vojta): prefix this method with $$ ?\n * @param {function()} callback Function that will be called when no outstanding request\n */\n self.notifyWhenNoOutstandingRequests = function(callback) {\n if (outstandingRequestCount === 0) {\n callback();\n } else {\n outstandingRequestCallbacks.push(callback);\n }\n };\n\n //////////////////////////////////////////////////////////////\n // URL API\n //////////////////////////////////////////////////////////////\n\n var cachedState, lastHistoryState,\n lastBrowserUrl = location.href,\n baseElement = document.find('base'),\n reloadLocation = null;\n\n cacheState();\n lastHistoryState = cachedState;\n\n /**\n * @name $browser#url\n *\n * @description\n * GETTER:\n * Without any argument, this method just returns current value of location.href.\n *\n * SETTER:\n * With at least one argument, this method sets url to new value.\n * If html5 history api supported, pushState/replaceState is used, otherwise\n * location.href/location.replace is used.\n * Returns its own instance to allow chaining\n *\n * NOTE: this api is intended for use only by the $location service. Please use the\n * {@link ng.$location $location service} to change url.\n *\n * @param {string} url New url (when used as setter)\n * @param {boolean=} replace Should new url replace current history record?\n * @param {object=} state object to use with pushState/replaceState\n */\n self.url = function(url, replace, state) {\n // In modern browsers `history.state` is `null` by default; treating it separately\n // from `undefined` would cause `$browser.url('/foo')` to change `history.state`\n // to undefined via `pushState`. Instead, let's change `undefined` to `null` here.\n if (isUndefined(state)) {\n state = null;\n }\n\n // Android Browser BFCache causes location, history reference to become stale.\n if (location !== window.location) location = window.location;\n if (history !== window.history) history = window.history;\n\n // setter\n if (url) {\n var sameState = lastHistoryState === state;\n\n // Don't change anything if previous and current URLs and states match. This also prevents\n // IE<10 from getting into redirect loop when in LocationHashbangInHtml5Url mode.\n // See https://github.com/angular/angular.js/commit/ffb2701\n if (lastBrowserUrl === url && (!$sniffer.history || sameState)) {\n return self;\n }\n var sameBase = lastBrowserUrl && stripHash(lastBrowserUrl) === stripHash(url);\n lastBrowserUrl = url;\n lastHistoryState = state;\n // Don't use history API if only the hash changed\n // due to a bug in IE10/IE11 which leads\n // to not firing a `hashchange` nor `popstate` event\n // in some cases (see #9143).\n if ($sniffer.history && (!sameBase || !sameState)) {\n history[replace ? 'replaceState' : 'pushState'](state, '', url);\n cacheState();\n // Do the assignment again so that those two variables are referentially identical.\n lastHistoryState = cachedState;\n } else {\n if (!sameBase || reloadLocation) {\n reloadLocation = url;\n }\n if (replace) {\n location.replace(url);\n } else if (!sameBase) {\n location.href = url;\n } else {\n location.hash = getHash(url);\n }\n }\n return self;\n // getter\n } else {\n // - reloadLocation is needed as browsers don't allow to read out\n // the new location.href if a reload happened.\n // - the replacement is a workaround for https://bugzilla.mozilla.org/show_bug.cgi?id=407172\n return reloadLocation || location.href.replace(/%27/g,\"'\");\n }\n };\n\n /**\n * @name $browser#state\n *\n * @description\n * This method is a getter.\n *\n * Return history.state or null if history.state is undefined.\n *\n * @returns {object} state\n */\n self.state = function() {\n return cachedState;\n };\n\n var urlChangeListeners = [],\n urlChangeInit = false;\n\n function cacheStateAndFireUrlChange() {\n cacheState();\n fireUrlChange();\n }\n\n function getCurrentState() {\n try {\n return history.state;\n } catch (e) {\n // MSIE can reportedly throw when there is no state (UNCONFIRMED).\n }\n }\n\n // This variable should be used *only* inside the cacheState function.\n var lastCachedState = null;\n function cacheState() {\n // This should be the only place in $browser where `history.state` is read.\n cachedState = getCurrentState();\n cachedState = isUndefined(cachedState) ? null : cachedState;\n\n // Prevent callbacks fo fire twice if both hashchange & popstate were fired.\n if (equals(cachedState, lastCachedState)) {\n cachedState = lastCachedState;\n }\n lastCachedState = cachedState;\n }\n\n function fireUrlChange() {\n if (lastBrowserUrl === self.url() && lastHistoryState === cachedState) {\n return;\n }\n\n lastBrowserUrl = self.url();\n lastHistoryState = cachedState;\n forEach(urlChangeListeners, function(listener) {\n listener(self.url(), cachedState);\n });\n }\n\n /**\n * @name $browser#onUrlChange\n *\n * @description\n * Register callback function that will be called, when url changes.\n *\n * It's only called when the url is changed from outside of angular:\n * - user types different url into address bar\n * - user clicks on history (forward/back) button\n * - user clicks on a link\n *\n * It's not called when url is changed by $browser.url() method\n *\n * The listener gets called with new url as parameter.\n *\n * NOTE: this api is intended for use only by the $location service. Please use the\n * {@link ng.$location $location service} to monitor url changes in angular apps.\n *\n * @param {function(string)} listener Listener function to be called when url changes.\n * @return {function(string)} Returns the registered listener fn - handy if the fn is anonymous.\n */\n self.onUrlChange = function(callback) {\n // TODO(vojta): refactor to use node's syntax for events\n if (!urlChangeInit) {\n // We listen on both (hashchange/popstate) when available, as some browsers (e.g. Opera)\n // don't fire popstate when user change the address bar and don't fire hashchange when url\n // changed by push/replaceState\n\n // html5 history api - popstate event\n if ($sniffer.history) jqLite(window).on('popstate', cacheStateAndFireUrlChange);\n // hashchange event\n jqLite(window).on('hashchange', cacheStateAndFireUrlChange);\n\n urlChangeInit = true;\n }\n\n urlChangeListeners.push(callback);\n return callback;\n };\n\n /**\n * @private\n * Remove popstate and hashchange handler from window.\n *\n * NOTE: this api is intended for use only by $rootScope.\n */\n self.$$applicationDestroyed = function() {\n jqLite(window).off('hashchange popstate', cacheStateAndFireUrlChange);\n };\n\n /**\n * Checks whether the url has changed outside of Angular.\n * Needs to be exported to be able to check for changes that have been done in sync,\n * as hashchange/popstate events fire in async.\n */\n self.$$checkUrlChange = fireUrlChange;\n\n //////////////////////////////////////////////////////////////\n // Misc API\n //////////////////////////////////////////////////////////////\n\n /**\n * @name $browser#baseHref\n *\n * @description\n * Returns current \n * (always relative - without domain)\n *\n * @returns {string} The current base href\n */\n self.baseHref = function() {\n var href = baseElement.attr('href');\n return href ? href.replace(/^(https?\\:)?\\/\\/[^\\/]*/, '') : '';\n };\n\n /**\n * @name $browser#defer\n * @param {function()} fn A function, who's execution should be deferred.\n * @param {number=} [delay=0] of milliseconds to defer the function execution.\n * @returns {*} DeferId that can be used to cancel the task via `$browser.defer.cancel()`.\n *\n * @description\n * Executes a fn asynchronously via `setTimeout(fn, delay)`.\n *\n * Unlike when calling `setTimeout` directly, in test this function is mocked and instead of using\n * `setTimeout` in tests, the fns are queued in an array, which can be programmatically flushed\n * via `$browser.defer.flush()`.\n *\n */\n self.defer = function(fn, delay) {\n var timeoutId;\n outstandingRequestCount++;\n timeoutId = setTimeout(function() {\n delete pendingDeferIds[timeoutId];\n completeOutstandingRequest(fn);\n }, delay || 0);\n pendingDeferIds[timeoutId] = true;\n return timeoutId;\n };\n\n\n /**\n * @name $browser#defer.cancel\n *\n * @description\n * Cancels a deferred task identified with `deferId`.\n *\n * @param {*} deferId Token returned by the `$browser.defer` function.\n * @returns {boolean} Returns `true` if the task hasn't executed yet and was successfully\n * canceled.\n */\n self.defer.cancel = function(deferId) {\n if (pendingDeferIds[deferId]) {\n delete pendingDeferIds[deferId];\n clearTimeout(deferId);\n completeOutstandingRequest(noop);\n return true;\n }\n return false;\n };\n\n}\n\nfunction $BrowserProvider() {\n this.$get = ['$window', '$log', '$sniffer', '$document',\n function($window, $log, $sniffer, $document) {\n return new Browser($window, $document, $log, $sniffer);\n }];\n}\n\n/**\n * @ngdoc service\n * @name $cacheFactory\n *\n * @description\n * Factory that constructs {@link $cacheFactory.Cache Cache} objects and gives access to\n * them.\n *\n * ```js\n *\n * var cache = $cacheFactory('cacheId');\n * expect($cacheFactory.get('cacheId')).toBe(cache);\n * expect($cacheFactory.get('noSuchCacheId')).not.toBeDefined();\n *\n * cache.put(\"key\", \"value\");\n * cache.put(\"another key\", \"another value\");\n *\n * // We've specified no options on creation\n * expect(cache.info()).toEqual({id: 'cacheId', size: 2});\n *\n * ```\n *\n *\n * @param {string} cacheId Name or id of the newly created cache.\n * @param {object=} options Options object that specifies the cache behavior. Properties:\n *\n * - `{number=}` `capacity` — turns the cache into LRU cache.\n *\n * @returns {object} Newly created cache object with the following set of methods:\n *\n * - `{object}` `info()` — Returns id, size, and options of cache.\n * - `{{*}}` `put({string} key, {*} value)` — Puts a new key-value pair into the cache and returns\n * it.\n * - `{{*}}` `get({string} key)` — Returns cached value for `key` or undefined for cache miss.\n * - `{void}` `remove({string} key)` — Removes a key-value pair from the cache.\n * - `{void}` `removeAll()` — Removes all cached values.\n * - `{void}` `destroy()` — Removes references to this cache from $cacheFactory.\n *\n * @example\n \n \n
    \n \n \n \n\n

    Cached Values

    \n
    \n \n : \n \n
    \n\n

    Cache Info

    \n
    \n \n : \n \n
    \n
    \n
    \n \n angular.module('cacheExampleApp', []).\n controller('CacheController', ['$scope', '$cacheFactory', function($scope, $cacheFactory) {\n $scope.keys = [];\n $scope.cache = $cacheFactory('cacheId');\n $scope.put = function(key, value) {\n if ($scope.cache.get(key) === undefined) {\n $scope.keys.push(key);\n }\n $scope.cache.put(key, value === undefined ? null : value);\n };\n }]);\n \n \n p {\n margin: 10px 0 3px;\n }\n \n
    \n */\nfunction $CacheFactoryProvider() {\n\n this.$get = function() {\n var caches = {};\n\n function cacheFactory(cacheId, options) {\n if (cacheId in caches) {\n throw minErr('$cacheFactory')('iid', \"CacheId '{0}' is already taken!\", cacheId);\n }\n\n var size = 0,\n stats = extend({}, options, {id: cacheId}),\n data = {},\n capacity = (options && options.capacity) || Number.MAX_VALUE,\n lruHash = {},\n freshEnd = null,\n staleEnd = null;\n\n /**\n * @ngdoc type\n * @name $cacheFactory.Cache\n *\n * @description\n * A cache object used to store and retrieve data, primarily used by\n * {@link $http $http} and the {@link ng.directive:script script} directive to cache\n * templates and other data.\n *\n * ```js\n * angular.module('superCache')\n * .factory('superCache', ['$cacheFactory', function($cacheFactory) {\n * return $cacheFactory('super-cache');\n * }]);\n * ```\n *\n * Example test:\n *\n * ```js\n * it('should behave like a cache', inject(function(superCache) {\n * superCache.put('key', 'value');\n * superCache.put('another key', 'another value');\n *\n * expect(superCache.info()).toEqual({\n * id: 'super-cache',\n * size: 2\n * });\n *\n * superCache.remove('another key');\n * expect(superCache.get('another key')).toBeUndefined();\n *\n * superCache.removeAll();\n * expect(superCache.info()).toEqual({\n * id: 'super-cache',\n * size: 0\n * });\n * }));\n * ```\n */\n return caches[cacheId] = {\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#put\n * @kind function\n *\n * @description\n * Inserts a named entry into the {@link $cacheFactory.Cache Cache} object to be\n * retrieved later, and incrementing the size of the cache if the key was not already\n * present in the cache. If behaving like an LRU cache, it will also remove stale\n * entries from the set.\n *\n * It will not insert undefined values into the cache.\n *\n * @param {string} key the key under which the cached data is stored.\n * @param {*} value the value to store alongside the key. If it is undefined, the key\n * will not be stored.\n * @returns {*} the value stored.\n */\n put: function(key, value) {\n if (isUndefined(value)) return;\n if (capacity < Number.MAX_VALUE) {\n var lruEntry = lruHash[key] || (lruHash[key] = {key: key});\n\n refresh(lruEntry);\n }\n\n if (!(key in data)) size++;\n data[key] = value;\n\n if (size > capacity) {\n this.remove(staleEnd.key);\n }\n\n return value;\n },\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#get\n * @kind function\n *\n * @description\n * Retrieves named data stored in the {@link $cacheFactory.Cache Cache} object.\n *\n * @param {string} key the key of the data to be retrieved\n * @returns {*} the value stored.\n */\n get: function(key) {\n if (capacity < Number.MAX_VALUE) {\n var lruEntry = lruHash[key];\n\n if (!lruEntry) return;\n\n refresh(lruEntry);\n }\n\n return data[key];\n },\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#remove\n * @kind function\n *\n * @description\n * Removes an entry from the {@link $cacheFactory.Cache Cache} object.\n *\n * @param {string} key the key of the entry to be removed\n */\n remove: function(key) {\n if (capacity < Number.MAX_VALUE) {\n var lruEntry = lruHash[key];\n\n if (!lruEntry) return;\n\n if (lruEntry == freshEnd) freshEnd = lruEntry.p;\n if (lruEntry == staleEnd) staleEnd = lruEntry.n;\n link(lruEntry.n,lruEntry.p);\n\n delete lruHash[key];\n }\n\n delete data[key];\n size--;\n },\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#removeAll\n * @kind function\n *\n * @description\n * Clears the cache object of any entries.\n */\n removeAll: function() {\n data = {};\n size = 0;\n lruHash = {};\n freshEnd = staleEnd = null;\n },\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#destroy\n * @kind function\n *\n * @description\n * Destroys the {@link $cacheFactory.Cache Cache} object entirely,\n * removing it from the {@link $cacheFactory $cacheFactory} set.\n */\n destroy: function() {\n data = null;\n stats = null;\n lruHash = null;\n delete caches[cacheId];\n },\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory.Cache#info\n * @kind function\n *\n * @description\n * Retrieve information regarding a particular {@link $cacheFactory.Cache Cache}.\n *\n * @returns {object} an object with the following properties:\n *
      \n *
    • **id**: the id of the cache instance
    • \n *
    • **size**: the number of entries kept in the cache instance
    • \n *
    • **...**: any additional properties from the options object when creating the\n * cache.
    • \n *
    \n */\n info: function() {\n return extend({}, stats, {size: size});\n }\n };\n\n\n /**\n * makes the `entry` the freshEnd of the LRU linked list\n */\n function refresh(entry) {\n if (entry != freshEnd) {\n if (!staleEnd) {\n staleEnd = entry;\n } else if (staleEnd == entry) {\n staleEnd = entry.n;\n }\n\n link(entry.n, entry.p);\n link(entry, freshEnd);\n freshEnd = entry;\n freshEnd.n = null;\n }\n }\n\n\n /**\n * bidirectionally links two entries of the LRU linked list\n */\n function link(nextEntry, prevEntry) {\n if (nextEntry != prevEntry) {\n if (nextEntry) nextEntry.p = prevEntry; //p stands for previous, 'prev' didn't minify\n if (prevEntry) prevEntry.n = nextEntry; //n stands for next, 'next' didn't minify\n }\n }\n }\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory#info\n *\n * @description\n * Get information about all the caches that have been created\n *\n * @returns {Object} - key-value map of `cacheId` to the result of calling `cache#info`\n */\n cacheFactory.info = function() {\n var info = {};\n forEach(caches, function(cache, cacheId) {\n info[cacheId] = cache.info();\n });\n return info;\n };\n\n\n /**\n * @ngdoc method\n * @name $cacheFactory#get\n *\n * @description\n * Get access to a cache object by the `cacheId` used when it was created.\n *\n * @param {string} cacheId Name or id of a cache to access.\n * @returns {object} Cache object identified by the cacheId or undefined if no such cache.\n */\n cacheFactory.get = function(cacheId) {\n return caches[cacheId];\n };\n\n\n return cacheFactory;\n };\n}\n\n/**\n * @ngdoc service\n * @name $templateCache\n *\n * @description\n * The first time a template is used, it is loaded in the template cache for quick retrieval. You\n * can load templates directly into the cache in a `script` tag, or by consuming the\n * `$templateCache` service directly.\n *\n * Adding via the `script` tag:\n *\n * ```html\n * \n * ```\n *\n * **Note:** the `script` tag containing the template does not need to be included in the `head` of\n * the document, but it must be a descendent of the {@link ng.$rootElement $rootElement} (IE,\n * element with ng-app attribute), otherwise the template will be ignored.\n *\n * Adding via the `$templateCache` service:\n *\n * ```js\n * var myApp = angular.module('myApp', []);\n * myApp.run(function($templateCache) {\n * $templateCache.put('templateId.html', 'This is the content of the template');\n * });\n * ```\n *\n * To retrieve the template later, simply use it in your HTML:\n * ```html\n *
    \n * ```\n *\n * or get it via Javascript:\n * ```js\n * $templateCache.get('templateId.html')\n * ```\n *\n * See {@link ng.$cacheFactory $cacheFactory}.\n *\n */\nfunction $TemplateCacheProvider() {\n this.$get = ['$cacheFactory', function($cacheFactory) {\n return $cacheFactory('templates');\n }];\n}\n\n/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\n * Any commits to this file should be reviewed with security in mind. *\n * Changes to this file can potentially create security vulnerabilities. *\n * An approval from 2 Core members with history of modifying *\n * this file is required. *\n * *\n * Does the change somehow allow for arbitrary javascript to be executed? *\n * Or allows for someone to change the prototype of built-in objects? *\n * Or gives undesired access to variables likes document or window? *\n * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */\n\n/* ! VARIABLE/FUNCTION NAMING CONVENTIONS THAT APPLY TO THIS FILE!\n *\n * DOM-related variables:\n *\n * - \"node\" - DOM Node\n * - \"element\" - DOM Element or Node\n * - \"$node\" or \"$element\" - jqLite-wrapped node or element\n *\n *\n * Compiler related stuff:\n *\n * - \"linkFn\" - linking fn of a single directive\n * - \"nodeLinkFn\" - function that aggregates all linking fns for a particular node\n * - \"childLinkFn\" - function that aggregates all linking fns for child nodes of a particular node\n * - \"compositeLinkFn\" - function that aggregates all linking fns for a compilation root (nodeList)\n */\n\n\n/**\n * @ngdoc service\n * @name $compile\n * @kind function\n *\n * @description\n * Compiles an HTML string or DOM into a template and produces a template function, which\n * can then be used to link {@link ng.$rootScope.Scope `scope`} and the template together.\n *\n * The compilation is a process of walking the DOM tree and matching DOM elements to\n * {@link ng.$compileProvider#directive directives}.\n *\n *
    \n * **Note:** This document is an in-depth reference of all directive options.\n * For a gentle introduction to directives with examples of common use cases,\n * see the {@link guide/directive directive guide}.\n *
    \n *\n * ## Comprehensive Directive API\n *\n * There are many different options for a directive.\n *\n * The difference resides in the return value of the factory function.\n * You can either return a \"Directive Definition Object\" (see below) that defines the directive properties,\n * or just the `postLink` function (all other properties will have the default values).\n *\n *
    \n * **Best Practice:** It's recommended to use the \"directive definition object\" form.\n *
    \n *\n * Here's an example directive declared with a Directive Definition Object:\n *\n * ```js\n * var myModule = angular.module(...);\n *\n * myModule.directive('directiveName', function factory(injectables) {\n * var directiveDefinitionObject = {\n * priority: 0,\n * template: '
    ', // or // function(tElement, tAttrs) { ... },\n * // or\n * // templateUrl: 'directive.html', // or // function(tElement, tAttrs) { ... },\n * transclude: false,\n * restrict: 'A',\n * templateNamespace: 'html',\n * scope: false,\n * controller: function($scope, $element, $attrs, $transclude, otherInjectables) { ... },\n * controllerAs: 'stringIdentifier',\n * bindToController: false,\n * require: 'siblingDirectiveName', // or // ['^parentDirectiveName', '?optionalDirectiveName', '?^optionalParent'],\n * compile: function compile(tElement, tAttrs, transclude) {\n * return {\n * pre: function preLink(scope, iElement, iAttrs, controller) { ... },\n * post: function postLink(scope, iElement, iAttrs, controller) { ... }\n * }\n * // or\n * // return function postLink( ... ) { ... }\n * },\n * // or\n * // link: {\n * // pre: function preLink(scope, iElement, iAttrs, controller) { ... },\n * // post: function postLink(scope, iElement, iAttrs, controller) { ... }\n * // }\n * // or\n * // link: function postLink( ... ) { ... }\n * };\n * return directiveDefinitionObject;\n * });\n * ```\n *\n *
    \n * **Note:** Any unspecified options will use the default value. You can see the default values below.\n *
    \n *\n * Therefore the above can be simplified as:\n *\n * ```js\n * var myModule = angular.module(...);\n *\n * myModule.directive('directiveName', function factory(injectables) {\n * var directiveDefinitionObject = {\n * link: function postLink(scope, iElement, iAttrs) { ... }\n * };\n * return directiveDefinitionObject;\n * // or\n * // return function postLink(scope, iElement, iAttrs) { ... }\n * });\n * ```\n *\n *\n *\n * ### Directive Definition Object\n *\n * The directive definition object provides instructions to the {@link ng.$compile\n * compiler}. The attributes are:\n *\n * #### `multiElement`\n * When this property is set to true, the HTML compiler will collect DOM nodes between\n * nodes with the attributes `directive-name-start` and `directive-name-end`, and group them\n * together as the directive elements. It is recommended that this feature be used on directives\n * which are not strictly behavioural (such as {@link ngClick}), and which\n * do not manipulate or replace child nodes (such as {@link ngInclude}).\n *\n * #### `priority`\n * When there are multiple directives defined on a single DOM element, sometimes it\n * is necessary to specify the order in which the directives are applied. The `priority` is used\n * to sort the directives before their `compile` functions get called. Priority is defined as a\n * number. Directives with greater numerical `priority` are compiled first. Pre-link functions\n * are also run in priority order, but post-link functions are run in reverse order. The order\n * of directives with the same priority is undefined. The default priority is `0`.\n *\n * #### `terminal`\n * If set to true then the current `priority` will be the last set of directives\n * which will execute (any directives at the current priority will still execute\n * as the order of execution on same `priority` is undefined). Note that expressions\n * and other directives used in the directive's template will also be excluded from execution.\n *\n * #### `scope`\n * **If set to `true`,** then a new scope will be created for this directive. If multiple directives on the\n * same element request a new scope, only one new scope is created. The new scope rule does not\n * apply for the root of the template since the root of the template always gets a new scope.\n *\n * **If set to `{}` (object hash),** then a new \"isolate\" scope is created. The 'isolate' scope differs from\n * normal scope in that it does not prototypically inherit from the parent scope. This is useful\n * when creating reusable components, which should not accidentally read or modify data in the\n * parent scope.\n *\n * The 'isolate' scope takes an object hash which defines a set of local scope properties\n * derived from the parent scope. These local properties are useful for aliasing values for\n * templates. Locals definition is a hash of local scope property to its source:\n *\n * * `@` or `@attr` - bind a local scope property to the value of DOM attribute. The result is\n * always a string since DOM attributes are strings. If no `attr` name is specified then the\n * attribute name is assumed to be the same as the local name.\n * Given `` and widget definition\n * of `scope: { localName:'@myAttr' }`, then widget scope property `localName` will reflect\n * the interpolated value of `hello {{name}}`. As the `name` attribute changes so will the\n * `localName` property on the widget scope. The `name` is read from the parent scope (not\n * component scope).\n *\n * * `=` or `=attr` - set up bi-directional binding between a local scope property and the\n * parent scope property of name defined via the value of the `attr` attribute. If no `attr`\n * name is specified then the attribute name is assumed to be the same as the local name.\n * Given `` and widget definition of\n * `scope: { localModel:'=myAttr' }`, then widget scope property `localModel` will reflect the\n * value of `parentModel` on the parent scope. Any changes to `parentModel` will be reflected\n * in `localModel` and any changes in `localModel` will reflect in `parentModel`. If the parent\n * scope property doesn't exist, it will throw a NON_ASSIGNABLE_MODEL_EXPRESSION exception. You\n * can avoid this behavior using `=?` or `=?attr` in order to flag the property as optional. If\n * you want to shallow watch for changes (i.e. $watchCollection instead of $watch) you can use\n * `=*` or `=*attr` (`=*?` or `=*?attr` if the property is optional).\n *\n * * `&` or `&attr` - provides a way to execute an expression in the context of the parent scope.\n * If no `attr` name is specified then the attribute name is assumed to be the same as the\n * local name. Given `` and widget definition of\n * `scope: { localFn:'&myAttr' }`, then isolate scope property `localFn` will point to\n * a function wrapper for the `count = count + value` expression. Often it's desirable to\n * pass data from the isolated scope via an expression to the parent scope, this can be\n * done by passing a map of local variable names and values into the expression wrapper fn.\n * For example, if the expression is `increment(amount)` then we can specify the amount value\n * by calling the `localFn` as `localFn({amount: 22})`.\n *\n *\n * #### `bindToController`\n * When an isolate scope is used for a component (see above), and `controllerAs` is used, `bindToController: true` will\n * allow a component to have its properties bound to the controller, rather than to scope. When the controller\n * is instantiated, the initial values of the isolate scope bindings are already available.\n *\n * #### `controller`\n * Controller constructor function. The controller is instantiated before the\n * pre-linking phase and it is shared with other directives (see\n * `require` attribute). This allows the directives to communicate with each other and augment\n * each other's behavior. The controller is injectable (and supports bracket notation) with the following locals:\n *\n * * `$scope` - Current scope associated with the element\n * * `$element` - Current element\n * * `$attrs` - Current attributes object for the element\n * * `$transclude` - A transclude linking function pre-bound to the correct transclusion scope:\n * `function([scope], cloneLinkingFn, futureParentElement)`.\n * * `scope`: optional argument to override the scope.\n * * `cloneLinkingFn`: optional argument to create clones of the original transcluded content.\n * * `futureParentElement`:\n * * defines the parent to which the `cloneLinkingFn` will add the cloned elements.\n * * default: `$element.parent()` resp. `$element` for `transclude:'element'` resp. `transclude:true`.\n * * only needed for transcludes that are allowed to contain non html elements (e.g. SVG elements)\n * and when the `cloneLinkinFn` is passed,\n * as those elements need to created and cloned in a special way when they are defined outside their\n * usual containers (e.g. like ``).\n * * See also the `directive.templateNamespace` property.\n *\n *\n * #### `require`\n * Require another directive and inject its controller as the fourth argument to the linking function. The\n * `require` takes a string name (or array of strings) of the directive(s) to pass in. If an array is used, the\n * injected argument will be an array in corresponding order. If no such directive can be\n * found, or if the directive does not have a controller, then an error is raised (unless no link function\n * is specified, in which case error checking is skipped). The name can be prefixed with:\n *\n * * (no prefix) - Locate the required controller on the current element. Throw an error if not found.\n * * `?` - Attempt to locate the required controller or pass `null` to the `link` fn if not found.\n * * `^` - Locate the required controller by searching the element and its parents. Throw an error if not found.\n * * `^^` - Locate the required controller by searching the element's parents. Throw an error if not found.\n * * `?^` - Attempt to locate the required controller by searching the element and its parents or pass\n * `null` to the `link` fn if not found.\n * * `?^^` - Attempt to locate the required controller by searching the element's parents, or pass\n * `null` to the `link` fn if not found.\n *\n *\n * #### `controllerAs`\n * Identifier name for a reference to the controller in the directive's scope.\n * This allows the controller to be referenced from the directive template. The directive\n * needs to define a scope for this configuration to be used. Useful in the case when\n * directive is used as component.\n *\n *\n * #### `restrict`\n * String of subset of `EACM` which restricts the directive to a specific directive\n * declaration style. If omitted, the defaults (elements and attributes) are used.\n *\n * * `E` - Element name (default): ``\n * * `A` - Attribute (default): `
    `\n * * `C` - Class: `
    `\n * * `M` - Comment: ``\n *\n *\n * #### `templateNamespace`\n * String representing the document type used by the markup in the template.\n * AngularJS needs this information as those elements need to be created and cloned\n * in a special way when they are defined outside their usual containers like `` and ``.\n *\n * * `html` - All root nodes in the template are HTML. Root nodes may also be\n * top-level elements such as `` or ``.\n * * `svg` - The root nodes in the template are SVG elements (excluding ``).\n * * `math` - The root nodes in the template are MathML elements (excluding ``).\n *\n * If no `templateNamespace` is specified, then the namespace is considered to be `html`.\n *\n * #### `template`\n * HTML markup that may:\n * * Replace the contents of the directive's element (default).\n * * Replace the directive's element itself (if `replace` is true - DEPRECATED).\n * * Wrap the contents of the directive's element (if `transclude` is true).\n *\n * Value may be:\n *\n * * A string. For example `
    {{delete_str}}
    `.\n * * A function which takes two arguments `tElement` and `tAttrs` (described in the `compile`\n * function api below) and returns a string value.\n *\n *\n * #### `templateUrl`\n * This is similar to `template` but the template is loaded from the specified URL, asynchronously.\n *\n * Because template loading is asynchronous the compiler will suspend compilation of directives on that element\n * for later when the template has been resolved. In the meantime it will continue to compile and link\n * sibling and parent elements as though this element had not contained any directives.\n *\n * The compiler does not suspend the entire compilation to wait for templates to be loaded because this\n * would result in the whole app \"stalling\" until all templates are loaded asynchronously - even in the\n * case when only one deeply nested directive has `templateUrl`.\n *\n * Template loading is asynchronous even if the template has been preloaded into the {@link $templateCache}\n *\n * You can specify `templateUrl` as a string representing the URL or as a function which takes two\n * arguments `tElement` and `tAttrs` (described in the `compile` function api below) and returns\n * a string value representing the url. In either case, the template URL is passed through {@link\n * $sce#getTrustedResourceUrl $sce.getTrustedResourceUrl}.\n *\n *\n * #### `replace` ([*DEPRECATED*!], will be removed in next major release - i.e. v2.0)\n * specify what the template should replace. Defaults to `false`.\n *\n * * `true` - the template will replace the directive's element.\n * * `false` - the template will replace the contents of the directive's element.\n *\n * The replacement process migrates all of the attributes / classes from the old element to the new\n * one. See the {@link guide/directive#template-expanding-directive\n * Directives Guide} for an example.\n *\n * There are very few scenarios where element replacement is required for the application function,\n * the main one being reusable custom components that are used within SVG contexts\n * (because SVG doesn't work with custom elements in the DOM tree).\n *\n * #### `transclude`\n * Extract the contents of the element where the directive appears and make it available to the directive.\n * The contents are compiled and provided to the directive as a **transclusion function**. See the\n * {@link $compile#transclusion Transclusion} section below.\n *\n * There are two kinds of transclusion depending upon whether you want to transclude just the contents of the\n * directive's element or the entire element:\n *\n * * `true` - transclude the content (i.e. the child nodes) of the directive's element.\n * * `'element'` - transclude the whole of the directive's element including any directives on this\n * element that defined at a lower priority than this directive. When used, the `template`\n * property is ignored.\n *\n *\n * #### `compile`\n *\n * ```js\n * function compile(tElement, tAttrs, transclude) { ... }\n * ```\n *\n * The compile function deals with transforming the template DOM. Since most directives do not do\n * template transformation, it is not used often. The compile function takes the following arguments:\n *\n * * `tElement` - template element - The element where the directive has been declared. It is\n * safe to do template transformation on the element and child elements only.\n *\n * * `tAttrs` - template attributes - Normalized list of attributes declared on this element shared\n * between all directive compile functions.\n *\n * * `transclude` - [*DEPRECATED*!] A transclude linking function: `function(scope, cloneLinkingFn)`\n *\n *
    \n * **Note:** The template instance and the link instance may be different objects if the template has\n * been cloned. For this reason it is **not** safe to do anything other than DOM transformations that\n * apply to all cloned DOM nodes within the compile function. Specifically, DOM listener registration\n * should be done in a linking function rather than in a compile function.\n *
    \n\n *
    \n * **Note:** The compile function cannot handle directives that recursively use themselves in their\n * own templates or compile functions. Compiling these directives results in an infinite loop and a\n * stack overflow errors.\n *\n * This can be avoided by manually using $compile in the postLink function to imperatively compile\n * a directive's template instead of relying on automatic template compilation via `template` or\n * `templateUrl` declaration or manual compilation inside the compile function.\n *
    \n *\n *
    \n * **Note:** The `transclude` function that is passed to the compile function is deprecated, as it\n * e.g. does not know about the right outer scope. Please use the transclude function that is passed\n * to the link function instead.\n *
    \n\n * A compile function can have a return value which can be either a function or an object.\n *\n * * returning a (post-link) function - is equivalent to registering the linking function via the\n * `link` property of the config object when the compile function is empty.\n *\n * * returning an object with function(s) registered via `pre` and `post` properties - allows you to\n * control when a linking function should be called during the linking phase. See info about\n * pre-linking and post-linking functions below.\n *\n *\n * #### `link`\n * This property is used only if the `compile` property is not defined.\n *\n * ```js\n * function link(scope, iElement, iAttrs, controller, transcludeFn) { ... }\n * ```\n *\n * The link function is responsible for registering DOM listeners as well as updating the DOM. It is\n * executed after the template has been cloned. This is where most of the directive logic will be\n * put.\n *\n * * `scope` - {@link ng.$rootScope.Scope Scope} - The scope to be used by the\n * directive for registering {@link ng.$rootScope.Scope#$watch watches}.\n *\n * * `iElement` - instance element - The element where the directive is to be used. It is safe to\n * manipulate the children of the element only in `postLink` function since the children have\n * already been linked.\n *\n * * `iAttrs` - instance attributes - Normalized list of attributes declared on this element shared\n * between all directive linking functions.\n *\n * * `controller` - the directive's required controller instance(s) - Instances are shared\n * among all directives, which allows the directives to use the controllers as a communication\n * channel. The exact value depends on the directive's `require` property:\n * * no controller(s) required: the directive's own controller, or `undefined` if it doesn't have one\n * * `string`: the controller instance\n * * `array`: array of controller instances\n *\n * If a required controller cannot be found, and it is optional, the instance is `null`,\n * otherwise the {@link error:$compile:ctreq Missing Required Controller} error is thrown.\n *\n * Note that you can also require the directive's own controller - it will be made available like\n * like any other controller.\n *\n * * `transcludeFn` - A transclude linking function pre-bound to the correct transclusion scope.\n * This is the same as the `$transclude`\n * parameter of directive controllers, see there for details.\n * `function([scope], cloneLinkingFn, futureParentElement)`.\n *\n * #### Pre-linking function\n *\n * Executed before the child elements are linked. Not safe to do DOM transformation since the\n * compiler linking function will fail to locate the correct elements for linking.\n *\n * #### Post-linking function\n *\n * Executed after the child elements are linked.\n *\n * Note that child elements that contain `templateUrl` directives will not have been compiled\n * and linked since they are waiting for their template to load asynchronously and their own\n * compilation and linking has been suspended until that occurs.\n *\n * It is safe to do DOM transformation in the post-linking function on elements that are not waiting\n * for their async templates to be resolved.\n *\n *\n * ### Transclusion\n *\n * Transclusion is the process of extracting a collection of DOM element from one part of the DOM and\n * copying them to another part of the DOM, while maintaining their connection to the original AngularJS\n * scope from where they were taken.\n *\n * Transclusion is used (often with {@link ngTransclude}) to insert the\n * original contents of a directive's element into a specified place in the template of the directive.\n * The benefit of transclusion, over simply moving the DOM elements manually, is that the transcluded\n * content has access to the properties on the scope from which it was taken, even if the directive\n * has isolated scope.\n * See the {@link guide/directive#creating-a-directive-that-wraps-other-elements Directives Guide}.\n *\n * This makes it possible for the widget to have private state for its template, while the transcluded\n * content has access to its originating scope.\n *\n *
    \n * **Note:** When testing an element transclude directive you must not place the directive at the root of the\n * DOM fragment that is being compiled. See {@link guide/unit-testing#testing-transclusion-directives\n * Testing Transclusion Directives}.\n *
    \n *\n * #### Transclusion Functions\n *\n * When a directive requests transclusion, the compiler extracts its contents and provides a **transclusion\n * function** to the directive's `link` function and `controller`. This transclusion function is a special\n * **linking function** that will return the compiled contents linked to a new transclusion scope.\n *\n *
    \n * If you are just using {@link ngTransclude} then you don't need to worry about this function, since\n * ngTransclude will deal with it for us.\n *
    \n *\n * If you want to manually control the insertion and removal of the transcluded content in your directive\n * then you must use this transclude function. When you call a transclude function it returns a a jqLite/JQuery\n * object that contains the compiled DOM, which is linked to the correct transclusion scope.\n *\n * When you call a transclusion function you can pass in a **clone attach function**. This function accepts\n * two parameters, `function(clone, scope) { ... }`, where the `clone` is a fresh compiled copy of your transcluded\n * content and the `scope` is the newly created transclusion scope, to which the clone is bound.\n *\n *
    \n * **Best Practice**: Always provide a `cloneFn` (clone attach function) when you call a translude function\n * since you then get a fresh clone of the original DOM and also have access to the new transclusion scope.\n *
    \n *\n * It is normal practice to attach your transcluded content (`clone`) to the DOM inside your **clone\n * attach function**:\n *\n * ```js\n * var transcludedContent, transclusionScope;\n *\n * $transclude(function(clone, scope) {\n * element.append(clone);\n * transcludedContent = clone;\n * transclusionScope = scope;\n * });\n * ```\n *\n * Later, if you want to remove the transcluded content from your DOM then you should also destroy the\n * associated transclusion scope:\n *\n * ```js\n * transcludedContent.remove();\n * transclusionScope.$destroy();\n * ```\n *\n *
    \n * **Best Practice**: if you intend to add and remove transcluded content manually in your directive\n * (by calling the transclude function to get the DOM and calling `element.remove()` to remove it),\n * then you are also responsible for calling `$destroy` on the transclusion scope.\n *
    \n *\n * The built-in DOM manipulation directives, such as {@link ngIf}, {@link ngSwitch} and {@link ngRepeat}\n * automatically destroy their transluded clones as necessary so you do not need to worry about this if\n * you are simply using {@link ngTransclude} to inject the transclusion into your directive.\n *\n *\n * #### Transclusion Scopes\n *\n * When you call a transclude function it returns a DOM fragment that is pre-bound to a **transclusion\n * scope**. This scope is special, in that it is a child of the directive's scope (and so gets destroyed\n * when the directive's scope gets destroyed) but it inherits the properties of the scope from which it\n * was taken.\n *\n * For example consider a directive that uses transclusion and isolated scope. The DOM hierarchy might look\n * like this:\n *\n * ```html\n *
    \n *
    \n *
    \n *
    \n *
    \n *
    \n * ```\n *\n * The `$parent` scope hierarchy will look like this:\n *\n * ```\n * - $rootScope\n * - isolate\n * - transclusion\n * ```\n *\n * but the scopes will inherit prototypically from different scopes to their `$parent`.\n *\n * ```\n * - $rootScope\n * - transclusion\n * - isolate\n * ```\n *\n *\n * ### Attributes\n *\n * The {@link ng.$compile.directive.Attributes Attributes} object - passed as a parameter in the\n * `link()` or `compile()` functions. It has a variety of uses.\n *\n * accessing *Normalized attribute names:*\n * Directives like 'ngBind' can be expressed in many ways: 'ng:bind', `data-ng-bind`, or 'x-ng-bind'.\n * the attributes object allows for normalized access to\n * the attributes.\n *\n * * *Directive inter-communication:* All directives share the same instance of the attributes\n * object which allows the directives to use the attributes object as inter directive\n * communication.\n *\n * * *Supports interpolation:* Interpolation attributes are assigned to the attribute object\n * allowing other directives to read the interpolated value.\n *\n * * *Observing interpolated attributes:* Use `$observe` to observe the value changes of attributes\n * that contain interpolation (e.g. `src=\"{{bar}}\"`). Not only is this very efficient but it's also\n * the only way to easily get the actual value because during the linking phase the interpolation\n * hasn't been evaluated yet and so the value is at this time set to `undefined`.\n *\n * ```js\n * function linkingFn(scope, elm, attrs, ctrl) {\n * // get the attribute value\n * console.log(attrs.ngModel);\n *\n * // change the attribute\n * attrs.$set('ngModel', 'new value');\n *\n * // observe changes to interpolated attribute\n * attrs.$observe('ngModel', function(value) {\n * console.log('ngModel has changed value to ' + value);\n * });\n * }\n * ```\n *\n * ## Example\n *\n *
    \n * **Note**: Typically directives are registered with `module.directive`. The example below is\n * to illustrate how `$compile` works.\n *
    \n *\n \n \n \n
    \n
    \n
    \n
    \n
    \n
    \n \n it('should auto compile', function() {\n var textarea = $('textarea');\n var output = $('div[compile]');\n // The initial state reads 'Hello Angular'.\n expect(output.getText()).toBe('Hello Angular');\n textarea.clear();\n textarea.sendKeys('{{name}}!');\n expect(output.getText()).toBe('Angular!');\n });\n \n
    \n\n *\n *\n * @param {string|DOMElement} element Element or HTML string to compile into a template function.\n * @param {function(angular.Scope, cloneAttachFn=)} transclude function available to directives - DEPRECATED.\n *\n *
    \n * **Note:** Passing a `transclude` function to the $compile function is deprecated, as it\n * e.g. will not use the right outer scope. Please pass the transclude function as a\n * `parentBoundTranscludeFn` to the link function instead.\n *
    \n *\n * @param {number} maxPriority only apply directives lower than given priority (Only effects the\n * root element(s), not their children)\n * @returns {function(scope, cloneAttachFn=, options=)} a link function which is used to bind template\n * (a DOM element/tree) to a scope. Where:\n *\n * * `scope` - A {@link ng.$rootScope.Scope Scope} to bind to.\n * * `cloneAttachFn` - If `cloneAttachFn` is provided, then the link function will clone the\n * `template` and call the `cloneAttachFn` function allowing the caller to attach the\n * cloned elements to the DOM document at the appropriate place. The `cloneAttachFn` is\n * called as:
    `cloneAttachFn(clonedElement, scope)` where:\n *\n * * `clonedElement` - is a clone of the original `element` passed into the compiler.\n * * `scope` - is the current scope with which the linking function is working with.\n *\n * * `options` - An optional object hash with linking options. If `options` is provided, then the following\n * keys may be used to control linking behavior:\n *\n * * `parentBoundTranscludeFn` - the transclude function made available to\n * directives; if given, it will be passed through to the link functions of\n * directives found in `element` during compilation.\n * * `transcludeControllers` - an object hash with keys that map controller names\n * to controller instances; if given, it will make the controllers\n * available to directives.\n * * `futureParentElement` - defines the parent to which the `cloneAttachFn` will add\n * the cloned elements; only needed for transcludes that are allowed to contain non html\n * elements (e.g. SVG elements). See also the directive.controller property.\n *\n * Calling the linking function returns the element of the template. It is either the original\n * element passed in, or the clone of the element if the `cloneAttachFn` is provided.\n *\n * After linking the view is not updated until after a call to $digest which typically is done by\n * Angular automatically.\n *\n * If you need access to the bound view, there are two ways to do it:\n *\n * - If you are not asking the linking function to clone the template, create the DOM element(s)\n * before you send them to the compiler and keep this reference around.\n * ```js\n * var element = $compile('

    {{total}}

    ')(scope);\n * ```\n *\n * - if on the other hand, you need the element to be cloned, the view reference from the original\n * example would not point to the clone, but rather to the original template that was cloned. In\n * this case, you can access the clone via the cloneAttachFn:\n * ```js\n * var templateElement = angular.element('

    {{total}}

    '),\n * scope = ....;\n *\n * var clonedElement = $compile(templateElement)(scope, function(clonedElement, scope) {\n * //attach the clone to DOM document at the right place\n * });\n *\n * //now we have reference to the cloned DOM via `clonedElement`\n * ```\n *\n *\n * For information on how the compiler works, see the\n * {@link guide/compiler Angular HTML Compiler} section of the Developer Guide.\n */\n\nvar $compileMinErr = minErr('$compile');\n\n/**\n * @ngdoc provider\n * @name $compileProvider\n *\n * @description\n */\n$CompileProvider.$inject = ['$provide', '$$sanitizeUriProvider'];\nfunction $CompileProvider($provide, $$sanitizeUriProvider) {\n var hasDirectives = {},\n Suffix = 'Directive',\n COMMENT_DIRECTIVE_REGEXP = /^\\s*directive\\:\\s*([\\w\\-]+)\\s+(.*)$/,\n CLASS_DIRECTIVE_REGEXP = /(([\\w\\-]+)(?:\\:([^;]+))?;?)/,\n ALL_OR_NOTHING_ATTRS = makeMap('ngSrc,ngSrcset,src,srcset'),\n REQUIRE_PREFIX_REGEXP = /^(?:(\\^\\^?)?(\\?)?(\\^\\^?)?)?/;\n\n // Ref: http://developers.whatwg.org/webappapis.html#event-handler-idl-attributes\n // The assumption is that future DOM event attribute names will begin with\n // 'on' and be composed of only English letters.\n var EVENT_HANDLER_ATTR_REGEXP = /^(on[a-z]+|formaction)$/;\n\n function parseIsolateBindings(scope, directiveName, isController) {\n var LOCAL_REGEXP = /^\\s*([@&]|=(\\*?))(\\??)\\s*(\\w*)\\s*$/;\n\n var bindings = {};\n\n forEach(scope, function(definition, scopeName) {\n var match = definition.match(LOCAL_REGEXP);\n\n if (!match) {\n throw $compileMinErr('iscp',\n \"Invalid {3} for directive '{0}'.\" +\n \" Definition: {... {1}: '{2}' ...}\",\n directiveName, scopeName, definition,\n (isController ? \"controller bindings definition\" :\n \"isolate scope definition\"));\n }\n\n bindings[scopeName] = {\n mode: match[1][0],\n collection: match[2] === '*',\n optional: match[3] === '?',\n attrName: match[4] || scopeName\n };\n });\n\n return bindings;\n }\n\n function parseDirectiveBindings(directive, directiveName) {\n var bindings = {\n isolateScope: null,\n bindToController: null\n };\n if (isObject(directive.scope)) {\n if (directive.bindToController === true) {\n bindings.bindToController = parseIsolateBindings(directive.scope,\n directiveName, true);\n bindings.isolateScope = {};\n } else {\n bindings.isolateScope = parseIsolateBindings(directive.scope,\n directiveName, false);\n }\n }\n if (isObject(directive.bindToController)) {\n bindings.bindToController =\n parseIsolateBindings(directive.bindToController, directiveName, true);\n }\n if (isObject(bindings.bindToController)) {\n var controller = directive.controller;\n var controllerAs = directive.controllerAs;\n if (!controller) {\n // There is no controller, there may or may not be a controllerAs property\n throw $compileMinErr('noctrl',\n \"Cannot bind to controller without directive '{0}'s controller.\",\n directiveName);\n } else if (!identifierForController(controller, controllerAs)) {\n // There is a controller, but no identifier or controllerAs property\n throw $compileMinErr('noident',\n \"Cannot bind to controller without identifier for directive '{0}'.\",\n directiveName);\n }\n }\n return bindings;\n }\n\n function assertValidDirectiveName(name) {\n var letter = name.charAt(0);\n if (!letter || letter !== lowercase(letter)) {\n throw $compileMinErr('baddir', \"Directive name '{0}' is invalid. The first character must be a lowercase letter\", name);\n }\n if (name !== name.trim()) {\n throw $compileMinErr('baddir',\n \"Directive name '{0}' is invalid. The name should not contain leading or trailing whitespaces\",\n name);\n }\n }\n\n /**\n * @ngdoc method\n * @name $compileProvider#directive\n * @kind function\n *\n * @description\n * Register a new directive with the compiler.\n *\n * @param {string|Object} name Name of the directive in camel-case (i.e. ngBind which\n * will match as ng-bind), or an object map of directives where the keys are the\n * names and the values are the factories.\n * @param {Function|Array} directiveFactory An injectable directive factory function. See\n * {@link guide/directive} for more info.\n * @returns {ng.$compileProvider} Self for chaining.\n */\n this.directive = function registerDirective(name, directiveFactory) {\n assertNotHasOwnProperty(name, 'directive');\n if (isString(name)) {\n assertValidDirectiveName(name);\n assertArg(directiveFactory, 'directiveFactory');\n if (!hasDirectives.hasOwnProperty(name)) {\n hasDirectives[name] = [];\n $provide.factory(name + Suffix, ['$injector', '$exceptionHandler',\n function($injector, $exceptionHandler) {\n var directives = [];\n forEach(hasDirectives[name], function(directiveFactory, index) {\n try {\n var directive = $injector.invoke(directiveFactory);\n if (isFunction(directive)) {\n directive = { compile: valueFn(directive) };\n } else if (!directive.compile && directive.link) {\n directive.compile = valueFn(directive.link);\n }\n directive.priority = directive.priority || 0;\n directive.index = index;\n directive.name = directive.name || name;\n directive.require = directive.require || (directive.controller && directive.name);\n directive.restrict = directive.restrict || 'EA';\n var bindings = directive.$$bindings =\n parseDirectiveBindings(directive, directive.name);\n if (isObject(bindings.isolateScope)) {\n directive.$$isolateBindings = bindings.isolateScope;\n }\n directive.$$moduleName = directiveFactory.$$moduleName;\n directives.push(directive);\n } catch (e) {\n $exceptionHandler(e);\n }\n });\n return directives;\n }]);\n }\n hasDirectives[name].push(directiveFactory);\n } else {\n forEach(name, reverseParams(registerDirective));\n }\n return this;\n };\n\n\n /**\n * @ngdoc method\n * @name $compileProvider#aHrefSanitizationWhitelist\n * @kind function\n *\n * @description\n * Retrieves or overrides the default regular expression that is used for whitelisting of safe\n * urls during a[href] sanitization.\n *\n * The sanitization is a security measure aimed at preventing XSS attacks via html links.\n *\n * Any url about to be assigned to a[href] via data-binding is first normalized and turned into\n * an absolute url. Afterwards, the url is matched against the `aHrefSanitizationWhitelist`\n * regular expression. If a match is found, the original url is written into the dom. Otherwise,\n * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM.\n *\n * @param {RegExp=} regexp New regexp to whitelist urls with.\n * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for\n * chaining otherwise.\n */\n this.aHrefSanitizationWhitelist = function(regexp) {\n if (isDefined(regexp)) {\n $$sanitizeUriProvider.aHrefSanitizationWhitelist(regexp);\n return this;\n } else {\n return $$sanitizeUriProvider.aHrefSanitizationWhitelist();\n }\n };\n\n\n /**\n * @ngdoc method\n * @name $compileProvider#imgSrcSanitizationWhitelist\n * @kind function\n *\n * @description\n * Retrieves or overrides the default regular expression that is used for whitelisting of safe\n * urls during img[src] sanitization.\n *\n * The sanitization is a security measure aimed at prevent XSS attacks via html links.\n *\n * Any url about to be assigned to img[src] via data-binding is first normalized and turned into\n * an absolute url. Afterwards, the url is matched against the `imgSrcSanitizationWhitelist`\n * regular expression. If a match is found, the original url is written into the dom. Otherwise,\n * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM.\n *\n * @param {RegExp=} regexp New regexp to whitelist urls with.\n * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for\n * chaining otherwise.\n */\n this.imgSrcSanitizationWhitelist = function(regexp) {\n if (isDefined(regexp)) {\n $$sanitizeUriProvider.imgSrcSanitizationWhitelist(regexp);\n return this;\n } else {\n return $$sanitizeUriProvider.imgSrcSanitizationWhitelist();\n }\n };\n\n /**\n * @ngdoc method\n * @name $compileProvider#debugInfoEnabled\n *\n * @param {boolean=} enabled update the debugInfoEnabled state if provided, otherwise just return the\n * current debugInfoEnabled state\n * @returns {*} current value if used as getter or itself (chaining) if used as setter\n *\n * @kind function\n *\n * @description\n * Call this method to enable/disable various debug runtime information in the compiler such as adding\n * binding information and a reference to the current scope on to DOM elements.\n * If enabled, the compiler will add the following to DOM elements that have been bound to the scope\n * * `ng-binding` CSS class\n * * `$binding` data property containing an array of the binding expressions\n *\n * You may want to disable this in production for a significant performance boost. See\n * {@link guide/production#disabling-debug-data Disabling Debug Data} for more.\n *\n * The default value is true.\n */\n var debugInfoEnabled = true;\n this.debugInfoEnabled = function(enabled) {\n if (isDefined(enabled)) {\n debugInfoEnabled = enabled;\n return this;\n }\n return debugInfoEnabled;\n };\n\n this.$get = [\n '$injector', '$interpolate', '$exceptionHandler', '$templateRequest', '$parse',\n '$controller', '$rootScope', '$document', '$sce', '$animate', '$$sanitizeUri',\n function($injector, $interpolate, $exceptionHandler, $templateRequest, $parse,\n $controller, $rootScope, $document, $sce, $animate, $$sanitizeUri) {\n\n var Attributes = function(element, attributesToCopy) {\n if (attributesToCopy) {\n var keys = Object.keys(attributesToCopy);\n var i, l, key;\n\n for (i = 0, l = keys.length; i < l; i++) {\n key = keys[i];\n this[key] = attributesToCopy[key];\n }\n } else {\n this.$attr = {};\n }\n\n this.$$element = element;\n };\n\n Attributes.prototype = {\n /**\n * @ngdoc method\n * @name $compile.directive.Attributes#$normalize\n * @kind function\n *\n * @description\n * Converts an attribute name (e.g. dash/colon/underscore-delimited string, optionally prefixed with `x-` or\n * `data-`) to its normalized, camelCase form.\n *\n * Also there is special case for Moz prefix starting with upper case letter.\n *\n * For further information check out the guide on {@link guide/directive#matching-directives Matching Directives}\n *\n * @param {string} name Name to normalize\n */\n $normalize: directiveNormalize,\n\n\n /**\n * @ngdoc method\n * @name $compile.directive.Attributes#$addClass\n * @kind function\n *\n * @description\n * Adds the CSS class value specified by the classVal parameter to the element. If animations\n * are enabled then an animation will be triggered for the class addition.\n *\n * @param {string} classVal The className value that will be added to the element\n */\n $addClass: function(classVal) {\n if (classVal && classVal.length > 0) {\n $animate.addClass(this.$$element, classVal);\n }\n },\n\n /**\n * @ngdoc method\n * @name $compile.directive.Attributes#$removeClass\n * @kind function\n *\n * @description\n * Removes the CSS class value specified by the classVal parameter from the element. If\n * animations are enabled then an animation will be triggered for the class removal.\n *\n * @param {string} classVal The className value that will be removed from the element\n */\n $removeClass: function(classVal) {\n if (classVal && classVal.length > 0) {\n $animate.removeClass(this.$$element, classVal);\n }\n },\n\n /**\n * @ngdoc method\n * @name $compile.directive.Attributes#$updateClass\n * @kind function\n *\n * @description\n * Adds and removes the appropriate CSS class values to the element based on the difference\n * between the new and old CSS class values (specified as newClasses and oldClasses).\n *\n * @param {string} newClasses The current CSS className value\n * @param {string} oldClasses The former CSS className value\n */\n $updateClass: function(newClasses, oldClasses) {\n var toAdd = tokenDifference(newClasses, oldClasses);\n if (toAdd && toAdd.length) {\n $animate.addClass(this.$$element, toAdd);\n }\n\n var toRemove = tokenDifference(oldClasses, newClasses);\n if (toRemove && toRemove.length) {\n $animate.removeClass(this.$$element, toRemove);\n }\n },\n\n /**\n * Set a normalized attribute on the element in a way such that all directives\n * can share the attribute. This function properly handles boolean attributes.\n * @param {string} key Normalized key. (ie ngAttribute)\n * @param {string|boolean} value The value to set. If `null` attribute will be deleted.\n * @param {boolean=} writeAttr If false, does not write the value to DOM element attribute.\n * Defaults to true.\n * @param {string=} attrName Optional none normalized name. Defaults to key.\n */\n $set: function(key, value, writeAttr, attrName) {\n // TODO: decide whether or not to throw an error if \"class\"\n //is set through this function since it may cause $updateClass to\n //become unstable.\n\n var node = this.$$element[0],\n booleanKey = getBooleanAttrName(node, key),\n aliasedKey = getAliasedAttrName(node, key),\n observer = key,\n nodeName;\n\n if (booleanKey) {\n this.$$element.prop(key, value);\n attrName = booleanKey;\n } else if (aliasedKey) {\n this[aliasedKey] = value;\n observer = aliasedKey;\n }\n\n this[key] = value;\n\n // translate normalized key to actual key\n if (attrName) {\n this.$attr[key] = attrName;\n } else {\n attrName = this.$attr[key];\n if (!attrName) {\n this.$attr[key] = attrName = snake_case(key, '-');\n }\n }\n\n nodeName = nodeName_(this.$$element);\n\n if ((nodeName === 'a' && key === 'href') ||\n (nodeName === 'img' && key === 'src')) {\n // sanitize a[href] and img[src] values\n this[key] = value = $$sanitizeUri(value, key === 'src');\n } else if (nodeName === 'img' && key === 'srcset') {\n // sanitize img[srcset] values\n var result = \"\";\n\n // first check if there are spaces because it's not the same pattern\n var trimmedSrcset = trim(value);\n // ( 999x ,| 999w ,| ,|, )\n var srcPattern = /(\\s+\\d+x\\s*,|\\s+\\d+w\\s*,|\\s+,|,\\s+)/;\n var pattern = /\\s/.test(trimmedSrcset) ? srcPattern : /(,)/;\n\n // split srcset into tuple of uri and descriptor except for the last item\n var rawUris = trimmedSrcset.split(pattern);\n\n // for each tuples\n var nbrUrisWith2parts = Math.floor(rawUris.length / 2);\n for (var i = 0; i < nbrUrisWith2parts; i++) {\n var innerIdx = i * 2;\n // sanitize the uri\n result += $$sanitizeUri(trim(rawUris[innerIdx]), true);\n // add the descriptor\n result += (\" \" + trim(rawUris[innerIdx + 1]));\n }\n\n // split the last item into uri and descriptor\n var lastTuple = trim(rawUris[i * 2]).split(/\\s/);\n\n // sanitize the last uri\n result += $$sanitizeUri(trim(lastTuple[0]), true);\n\n // and add the last descriptor if any\n if (lastTuple.length === 2) {\n result += (\" \" + trim(lastTuple[1]));\n }\n this[key] = value = result;\n }\n\n if (writeAttr !== false) {\n if (value === null || value === undefined) {\n this.$$element.removeAttr(attrName);\n } else {\n this.$$element.attr(attrName, value);\n }\n }\n\n // fire observers\n var $$observers = this.$$observers;\n $$observers && forEach($$observers[observer], function(fn) {\n try {\n fn(value);\n } catch (e) {\n $exceptionHandler(e);\n }\n });\n },\n\n\n /**\n * @ngdoc method\n * @name $compile.directive.Attributes#$observe\n * @kind function\n *\n * @description\n * Observes an interpolated attribute.\n *\n * The observer function will be invoked once during the next `$digest` following\n * compilation. The observer is then invoked whenever the interpolated value\n * changes.\n *\n * @param {string} key Normalized key. (ie ngAttribute) .\n * @param {function(interpolatedValue)} fn Function that will be called whenever\n the interpolated value of the attribute changes.\n * See the {@link guide/directive#text-and-attribute-bindings Directives} guide for more info.\n * @returns {function()} Returns a deregistration function for this observer.\n */\n $observe: function(key, fn) {\n var attrs = this,\n $$observers = (attrs.$$observers || (attrs.$$observers = createMap())),\n listeners = ($$observers[key] || ($$observers[key] = []));\n\n listeners.push(fn);\n $rootScope.$evalAsync(function() {\n if (!listeners.$$inter && attrs.hasOwnProperty(key)) {\n // no one registered attribute interpolation function, so lets call it manually\n fn(attrs[key]);\n }\n });\n\n return function() {\n arrayRemove(listeners, fn);\n };\n }\n };\n\n\n function safeAddClass($element, className) {\n try {\n $element.addClass(className);\n } catch (e) {\n // ignore, since it means that we are trying to set class on\n // SVG element, where class name is read-only.\n }\n }\n\n\n var startSymbol = $interpolate.startSymbol(),\n endSymbol = $interpolate.endSymbol(),\n denormalizeTemplate = (startSymbol == '{{' || endSymbol == '}}')\n ? identity\n : function denormalizeTemplate(template) {\n return template.replace(/\\{\\{/g, startSymbol).replace(/}}/g, endSymbol);\n },\n NG_ATTR_BINDING = /^ngAttr[A-Z]/;\n\n compile.$$addBindingInfo = debugInfoEnabled ? function $$addBindingInfo($element, binding) {\n var bindings = $element.data('$binding') || [];\n\n if (isArray(binding)) {\n bindings = bindings.concat(binding);\n } else {\n bindings.push(binding);\n }\n\n $element.data('$binding', bindings);\n } : noop;\n\n compile.$$addBindingClass = debugInfoEnabled ? function $$addBindingClass($element) {\n safeAddClass($element, 'ng-binding');\n } : noop;\n\n compile.$$addScopeInfo = debugInfoEnabled ? function $$addScopeInfo($element, scope, isolated, noTemplate) {\n var dataName = isolated ? (noTemplate ? '$isolateScopeNoTemplate' : '$isolateScope') : '$scope';\n $element.data(dataName, scope);\n } : noop;\n\n compile.$$addScopeClass = debugInfoEnabled ? function $$addScopeClass($element, isolated) {\n safeAddClass($element, isolated ? 'ng-isolate-scope' : 'ng-scope');\n } : noop;\n\n return compile;\n\n //================================\n\n function compile($compileNodes, transcludeFn, maxPriority, ignoreDirective,\n previousCompileContext) {\n if (!($compileNodes instanceof jqLite)) {\n // jquery always rewraps, whereas we need to preserve the original selector so that we can\n // modify it.\n $compileNodes = jqLite($compileNodes);\n }\n // We can not compile top level text elements since text nodes can be merged and we will\n // not be able to attach scope data to them, so we will wrap them in \n forEach($compileNodes, function(node, index) {\n if (node.nodeType == NODE_TYPE_TEXT && node.nodeValue.match(/\\S+/) /* non-empty */ ) {\n $compileNodes[index] = jqLite(node).wrap('').parent()[0];\n }\n });\n var compositeLinkFn =\n compileNodes($compileNodes, transcludeFn, $compileNodes,\n maxPriority, ignoreDirective, previousCompileContext);\n compile.$$addScopeClass($compileNodes);\n var namespace = null;\n return function publicLinkFn(scope, cloneConnectFn, options) {\n assertArg(scope, 'scope');\n\n options = options || {};\n var parentBoundTranscludeFn = options.parentBoundTranscludeFn,\n transcludeControllers = options.transcludeControllers,\n futureParentElement = options.futureParentElement;\n\n // When `parentBoundTranscludeFn` is passed, it is a\n // `controllersBoundTransclude` function (it was previously passed\n // as `transclude` to directive.link) so we must unwrap it to get\n // its `boundTranscludeFn`\n if (parentBoundTranscludeFn && parentBoundTranscludeFn.$$boundTransclude) {\n parentBoundTranscludeFn = parentBoundTranscludeFn.$$boundTransclude;\n }\n\n if (!namespace) {\n namespace = detectNamespaceForChildElements(futureParentElement);\n }\n var $linkNode;\n if (namespace !== 'html') {\n // When using a directive with replace:true and templateUrl the $compileNodes\n // (or a child element inside of them)\n // might change, so we need to recreate the namespace adapted compileNodes\n // for call to the link function.\n // Note: This will already clone the nodes...\n $linkNode = jqLite(\n wrapTemplate(namespace, jqLite('
    ').append($compileNodes).html())\n );\n } else if (cloneConnectFn) {\n // important!!: we must call our jqLite.clone() since the jQuery one is trying to be smart\n // and sometimes changes the structure of the DOM.\n $linkNode = JQLitePrototype.clone.call($compileNodes);\n } else {\n $linkNode = $compileNodes;\n }\n\n if (transcludeControllers) {\n for (var controllerName in transcludeControllers) {\n $linkNode.data('$' + controllerName + 'Controller', transcludeControllers[controllerName].instance);\n }\n }\n\n compile.$$addScopeInfo($linkNode, scope);\n\n if (cloneConnectFn) cloneConnectFn($linkNode, scope);\n if (compositeLinkFn) compositeLinkFn(scope, $linkNode, $linkNode, parentBoundTranscludeFn);\n return $linkNode;\n };\n }\n\n function detectNamespaceForChildElements(parentElement) {\n // TODO: Make this detect MathML as well...\n var node = parentElement && parentElement[0];\n if (!node) {\n return 'html';\n } else {\n return nodeName_(node) !== 'foreignobject' && node.toString().match(/SVG/) ? 'svg' : 'html';\n }\n }\n\n /**\n * Compile function matches each node in nodeList against the directives. Once all directives\n * for a particular node are collected their compile functions are executed. The compile\n * functions return values - the linking functions - are combined into a composite linking\n * function, which is the a linking function for the node.\n *\n * @param {NodeList} nodeList an array of nodes or NodeList to compile\n * @param {function(angular.Scope, cloneAttachFn=)} transcludeFn A linking function, where the\n * scope argument is auto-generated to the new child of the transcluded parent scope.\n * @param {DOMElement=} $rootElement If the nodeList is the root of the compilation tree then\n * the rootElement must be set the jqLite collection of the compile root. This is\n * needed so that the jqLite collection items can be replaced with widgets.\n * @param {number=} maxPriority Max directive priority.\n * @returns {Function} A composite linking function of all of the matched directives or null.\n */\n function compileNodes(nodeList, transcludeFn, $rootElement, maxPriority, ignoreDirective,\n previousCompileContext) {\n var linkFns = [],\n attrs, directives, nodeLinkFn, childNodes, childLinkFn, linkFnFound, nodeLinkFnFound;\n\n for (var i = 0; i < nodeList.length; i++) {\n attrs = new Attributes();\n\n // we must always refer to nodeList[i] since the nodes can be replaced underneath us.\n directives = collectDirectives(nodeList[i], [], attrs, i === 0 ? maxPriority : undefined,\n ignoreDirective);\n\n nodeLinkFn = (directives.length)\n ? applyDirectivesToNode(directives, nodeList[i], attrs, transcludeFn, $rootElement,\n null, [], [], previousCompileContext)\n : null;\n\n if (nodeLinkFn && nodeLinkFn.scope) {\n compile.$$addScopeClass(attrs.$$element);\n }\n\n childLinkFn = (nodeLinkFn && nodeLinkFn.terminal ||\n !(childNodes = nodeList[i].childNodes) ||\n !childNodes.length)\n ? null\n : compileNodes(childNodes,\n nodeLinkFn ? (\n (nodeLinkFn.transcludeOnThisElement || !nodeLinkFn.templateOnThisElement)\n && nodeLinkFn.transclude) : transcludeFn);\n\n if (nodeLinkFn || childLinkFn) {\n linkFns.push(i, nodeLinkFn, childLinkFn);\n linkFnFound = true;\n nodeLinkFnFound = nodeLinkFnFound || nodeLinkFn;\n }\n\n //use the previous context only for the first element in the virtual group\n previousCompileContext = null;\n }\n\n // return a linking function if we have found anything, null otherwise\n return linkFnFound ? compositeLinkFn : null;\n\n function compositeLinkFn(scope, nodeList, $rootElement, parentBoundTranscludeFn) {\n var nodeLinkFn, childLinkFn, node, childScope, i, ii, idx, childBoundTranscludeFn;\n var stableNodeList;\n\n\n if (nodeLinkFnFound) {\n // copy nodeList so that if a nodeLinkFn removes or adds an element at this DOM level our\n // offsets don't get screwed up\n var nodeListLength = nodeList.length;\n stableNodeList = new Array(nodeListLength);\n\n // create a sparse array by only copying the elements which have a linkFn\n for (i = 0; i < linkFns.length; i+=3) {\n idx = linkFns[i];\n stableNodeList[idx] = nodeList[idx];\n }\n } else {\n stableNodeList = nodeList;\n }\n\n for (i = 0, ii = linkFns.length; i < ii;) {\n node = stableNodeList[linkFns[i++]];\n nodeLinkFn = linkFns[i++];\n childLinkFn = linkFns[i++];\n\n if (nodeLinkFn) {\n if (nodeLinkFn.scope) {\n childScope = scope.$new();\n compile.$$addScopeInfo(jqLite(node), childScope);\n var destroyBindings = nodeLinkFn.$$destroyBindings;\n if (destroyBindings) {\n nodeLinkFn.$$destroyBindings = null;\n childScope.$on('$destroyed', destroyBindings);\n }\n } else {\n childScope = scope;\n }\n\n if (nodeLinkFn.transcludeOnThisElement) {\n childBoundTranscludeFn = createBoundTranscludeFn(\n scope, nodeLinkFn.transclude, parentBoundTranscludeFn);\n\n } else if (!nodeLinkFn.templateOnThisElement && parentBoundTranscludeFn) {\n childBoundTranscludeFn = parentBoundTranscludeFn;\n\n } else if (!parentBoundTranscludeFn && transcludeFn) {\n childBoundTranscludeFn = createBoundTranscludeFn(scope, transcludeFn);\n\n } else {\n childBoundTranscludeFn = null;\n }\n\n nodeLinkFn(childLinkFn, childScope, node, $rootElement, childBoundTranscludeFn,\n nodeLinkFn);\n\n } else if (childLinkFn) {\n childLinkFn(scope, node.childNodes, undefined, parentBoundTranscludeFn);\n }\n }\n }\n }\n\n function createBoundTranscludeFn(scope, transcludeFn, previousBoundTranscludeFn) {\n\n var boundTranscludeFn = function(transcludedScope, cloneFn, controllers, futureParentElement, containingScope) {\n\n if (!transcludedScope) {\n transcludedScope = scope.$new(false, containingScope);\n transcludedScope.$$transcluded = true;\n }\n\n return transcludeFn(transcludedScope, cloneFn, {\n parentBoundTranscludeFn: previousBoundTranscludeFn,\n transcludeControllers: controllers,\n futureParentElement: futureParentElement\n });\n };\n\n return boundTranscludeFn;\n }\n\n /**\n * Looks for directives on the given node and adds them to the directive collection which is\n * sorted.\n *\n * @param node Node to search.\n * @param directives An array to which the directives are added to. This array is sorted before\n * the function returns.\n * @param attrs The shared attrs object which is used to populate the normalized attributes.\n * @param {number=} maxPriority Max directive priority.\n */\n function collectDirectives(node, directives, attrs, maxPriority, ignoreDirective) {\n var nodeType = node.nodeType,\n attrsMap = attrs.$attr,\n match,\n className;\n\n switch (nodeType) {\n case NODE_TYPE_ELEMENT: /* Element */\n // use the node name: \n addDirective(directives,\n directiveNormalize(nodeName_(node)), 'E', maxPriority, ignoreDirective);\n\n // iterate over the attributes\n for (var attr, name, nName, ngAttrName, value, isNgAttr, nAttrs = node.attributes,\n j = 0, jj = nAttrs && nAttrs.length; j < jj; j++) {\n var attrStartName = false;\n var attrEndName = false;\n\n attr = nAttrs[j];\n name = attr.name;\n value = trim(attr.value);\n\n // support ngAttr attribute binding\n ngAttrName = directiveNormalize(name);\n if (isNgAttr = NG_ATTR_BINDING.test(ngAttrName)) {\n name = name.replace(PREFIX_REGEXP, '')\n .substr(8).replace(/_(.)/g, function(match, letter) {\n return letter.toUpperCase();\n });\n }\n\n var directiveNName = ngAttrName.replace(/(Start|End)$/, '');\n if (directiveIsMultiElement(directiveNName)) {\n if (ngAttrName === directiveNName + 'Start') {\n attrStartName = name;\n attrEndName = name.substr(0, name.length - 5) + 'end';\n name = name.substr(0, name.length - 6);\n }\n }\n\n nName = directiveNormalize(name.toLowerCase());\n attrsMap[nName] = name;\n if (isNgAttr || !attrs.hasOwnProperty(nName)) {\n attrs[nName] = value;\n if (getBooleanAttrName(node, nName)) {\n attrs[nName] = true; // presence means true\n }\n }\n addAttrInterpolateDirective(node, directives, value, nName, isNgAttr);\n addDirective(directives, nName, 'A', maxPriority, ignoreDirective, attrStartName,\n attrEndName);\n }\n\n // use class as directive\n className = node.className;\n if (isObject(className)) {\n // Maybe SVGAnimatedString\n className = className.animVal;\n }\n if (isString(className) && className !== '') {\n while (match = CLASS_DIRECTIVE_REGEXP.exec(className)) {\n nName = directiveNormalize(match[2]);\n if (addDirective(directives, nName, 'C', maxPriority, ignoreDirective)) {\n attrs[nName] = trim(match[3]);\n }\n className = className.substr(match.index + match[0].length);\n }\n }\n break;\n case NODE_TYPE_TEXT: /* Text Node */\n if (msie === 11) {\n // Workaround for #11781\n while (node.parentNode && node.nextSibling && node.nextSibling.nodeType === NODE_TYPE_TEXT) {\n node.nodeValue = node.nodeValue + node.nextSibling.nodeValue;\n node.parentNode.removeChild(node.nextSibling);\n }\n }\n addTextInterpolateDirective(directives, node.nodeValue);\n break;\n case NODE_TYPE_COMMENT: /* Comment */\n try {\n match = COMMENT_DIRECTIVE_REGEXP.exec(node.nodeValue);\n if (match) {\n nName = directiveNormalize(match[1]);\n if (addDirective(directives, nName, 'M', maxPriority, ignoreDirective)) {\n attrs[nName] = trim(match[2]);\n }\n }\n } catch (e) {\n // turns out that under some circumstances IE9 throws errors when one attempts to read\n // comment's node value.\n // Just ignore it and continue. (Can't seem to reproduce in test case.)\n }\n break;\n }\n\n directives.sort(byPriority);\n return directives;\n }\n\n /**\n * Given a node with an directive-start it collects all of the siblings until it finds\n * directive-end.\n * @param node\n * @param attrStart\n * @param attrEnd\n * @returns {*}\n */\n function groupScan(node, attrStart, attrEnd) {\n var nodes = [];\n var depth = 0;\n if (attrStart && node.hasAttribute && node.hasAttribute(attrStart)) {\n do {\n if (!node) {\n throw $compileMinErr('uterdir',\n \"Unterminated attribute, found '{0}' but no matching '{1}' found.\",\n attrStart, attrEnd);\n }\n if (node.nodeType == NODE_TYPE_ELEMENT) {\n if (node.hasAttribute(attrStart)) depth++;\n if (node.hasAttribute(attrEnd)) depth--;\n }\n nodes.push(node);\n node = node.nextSibling;\n } while (depth > 0);\n } else {\n nodes.push(node);\n }\n\n return jqLite(nodes);\n }\n\n /**\n * Wrapper for linking function which converts normal linking function into a grouped\n * linking function.\n * @param linkFn\n * @param attrStart\n * @param attrEnd\n * @returns {Function}\n */\n function groupElementsLinkFnWrapper(linkFn, attrStart, attrEnd) {\n return function(scope, element, attrs, controllers, transcludeFn) {\n element = groupScan(element[0], attrStart, attrEnd);\n return linkFn(scope, element, attrs, controllers, transcludeFn);\n };\n }\n\n /**\n * Once the directives have been collected, their compile functions are executed. This method\n * is responsible for inlining directive templates as well as terminating the application\n * of the directives if the terminal directive has been reached.\n *\n * @param {Array} directives Array of collected directives to execute their compile function.\n * this needs to be pre-sorted by priority order.\n * @param {Node} compileNode The raw DOM node to apply the compile functions to\n * @param {Object} templateAttrs The shared attribute function\n * @param {function(angular.Scope, cloneAttachFn=)} transcludeFn A linking function, where the\n * scope argument is auto-generated to the new\n * child of the transcluded parent scope.\n * @param {JQLite} jqCollection If we are working on the root of the compile tree then this\n * argument has the root jqLite array so that we can replace nodes\n * on it.\n * @param {Object=} originalReplaceDirective An optional directive that will be ignored when\n * compiling the transclusion.\n * @param {Array.} preLinkFns\n * @param {Array.} postLinkFns\n * @param {Object} previousCompileContext Context used for previous compilation of the current\n * node\n * @returns {Function} linkFn\n */\n function applyDirectivesToNode(directives, compileNode, templateAttrs, transcludeFn,\n jqCollection, originalReplaceDirective, preLinkFns, postLinkFns,\n previousCompileContext) {\n previousCompileContext = previousCompileContext || {};\n\n var terminalPriority = -Number.MAX_VALUE,\n newScopeDirective = previousCompileContext.newScopeDirective,\n controllerDirectives = previousCompileContext.controllerDirectives,\n newIsolateScopeDirective = previousCompileContext.newIsolateScopeDirective,\n templateDirective = previousCompileContext.templateDirective,\n nonTlbTranscludeDirective = previousCompileContext.nonTlbTranscludeDirective,\n hasTranscludeDirective = false,\n hasTemplate = false,\n hasElementTranscludeDirective = previousCompileContext.hasElementTranscludeDirective,\n $compileNode = templateAttrs.$$element = jqLite(compileNode),\n directive,\n directiveName,\n $template,\n replaceDirective = originalReplaceDirective,\n childTranscludeFn = transcludeFn,\n linkFn,\n directiveValue;\n\n // executes all directives on the current element\n for (var i = 0, ii = directives.length; i < ii; i++) {\n directive = directives[i];\n var attrStart = directive.$$start;\n var attrEnd = directive.$$end;\n\n // collect multiblock sections\n if (attrStart) {\n $compileNode = groupScan(compileNode, attrStart, attrEnd);\n }\n $template = undefined;\n\n if (terminalPriority > directive.priority) {\n break; // prevent further processing of directives\n }\n\n if (directiveValue = directive.scope) {\n\n // skip the check for directives with async templates, we'll check the derived sync\n // directive when the template arrives\n if (!directive.templateUrl) {\n if (isObject(directiveValue)) {\n // This directive is trying to add an isolated scope.\n // Check that there is no scope of any kind already\n assertNoDuplicate('new/isolated scope', newIsolateScopeDirective || newScopeDirective,\n directive, $compileNode);\n newIsolateScopeDirective = directive;\n } else {\n // This directive is trying to add a child scope.\n // Check that there is no isolated scope already\n assertNoDuplicate('new/isolated scope', newIsolateScopeDirective, directive,\n $compileNode);\n }\n }\n\n newScopeDirective = newScopeDirective || directive;\n }\n\n directiveName = directive.name;\n\n if (!directive.templateUrl && directive.controller) {\n directiveValue = directive.controller;\n controllerDirectives = controllerDirectives || createMap();\n assertNoDuplicate(\"'\" + directiveName + \"' controller\",\n controllerDirectives[directiveName], directive, $compileNode);\n controllerDirectives[directiveName] = directive;\n }\n\n if (directiveValue = directive.transclude) {\n hasTranscludeDirective = true;\n\n // Special case ngIf and ngRepeat so that we don't complain about duplicate transclusion.\n // This option should only be used by directives that know how to safely handle element transclusion,\n // where the transcluded nodes are added or replaced after linking.\n if (!directive.$$tlb) {\n assertNoDuplicate('transclusion', nonTlbTranscludeDirective, directive, $compileNode);\n nonTlbTranscludeDirective = directive;\n }\n\n if (directiveValue == 'element') {\n hasElementTranscludeDirective = true;\n terminalPriority = directive.priority;\n $template = $compileNode;\n $compileNode = templateAttrs.$$element =\n jqLite(document.createComment(' ' + directiveName + ': ' +\n templateAttrs[directiveName] + ' '));\n compileNode = $compileNode[0];\n replaceWith(jqCollection, sliceArgs($template), compileNode);\n\n childTranscludeFn = compile($template, transcludeFn, terminalPriority,\n replaceDirective && replaceDirective.name, {\n // Don't pass in:\n // - controllerDirectives - otherwise we'll create duplicates controllers\n // - newIsolateScopeDirective or templateDirective - combining templates with\n // element transclusion doesn't make sense.\n //\n // We need only nonTlbTranscludeDirective so that we prevent putting transclusion\n // on the same element more than once.\n nonTlbTranscludeDirective: nonTlbTranscludeDirective\n });\n } else {\n $template = jqLite(jqLiteClone(compileNode)).contents();\n $compileNode.empty(); // clear contents\n childTranscludeFn = compile($template, transcludeFn);\n }\n }\n\n if (directive.template) {\n hasTemplate = true;\n assertNoDuplicate('template', templateDirective, directive, $compileNode);\n templateDirective = directive;\n\n directiveValue = (isFunction(directive.template))\n ? directive.template($compileNode, templateAttrs)\n : directive.template;\n\n directiveValue = denormalizeTemplate(directiveValue);\n\n if (directive.replace) {\n replaceDirective = directive;\n if (jqLiteIsTextNode(directiveValue)) {\n $template = [];\n } else {\n $template = removeComments(wrapTemplate(directive.templateNamespace, trim(directiveValue)));\n }\n compileNode = $template[0];\n\n if ($template.length != 1 || compileNode.nodeType !== NODE_TYPE_ELEMENT) {\n throw $compileMinErr('tplrt',\n \"Template for directive '{0}' must have exactly one root element. {1}\",\n directiveName, '');\n }\n\n replaceWith(jqCollection, $compileNode, compileNode);\n\n var newTemplateAttrs = {$attr: {}};\n\n // combine directives from the original node and from the template:\n // - take the array of directives for this element\n // - split it into two parts, those that already applied (processed) and those that weren't (unprocessed)\n // - collect directives from the template and sort them by priority\n // - combine directives as: processed + template + unprocessed\n var templateDirectives = collectDirectives(compileNode, [], newTemplateAttrs);\n var unprocessedDirectives = directives.splice(i + 1, directives.length - (i + 1));\n\n if (newIsolateScopeDirective) {\n markDirectivesAsIsolate(templateDirectives);\n }\n directives = directives.concat(templateDirectives).concat(unprocessedDirectives);\n mergeTemplateAttributes(templateAttrs, newTemplateAttrs);\n\n ii = directives.length;\n } else {\n $compileNode.html(directiveValue);\n }\n }\n\n if (directive.templateUrl) {\n hasTemplate = true;\n assertNoDuplicate('template', templateDirective, directive, $compileNode);\n templateDirective = directive;\n\n if (directive.replace) {\n replaceDirective = directive;\n }\n\n nodeLinkFn = compileTemplateUrl(directives.splice(i, directives.length - i), $compileNode,\n templateAttrs, jqCollection, hasTranscludeDirective && childTranscludeFn, preLinkFns, postLinkFns, {\n controllerDirectives: controllerDirectives,\n newScopeDirective: (newScopeDirective !== directive) && newScopeDirective,\n newIsolateScopeDirective: newIsolateScopeDirective,\n templateDirective: templateDirective,\n nonTlbTranscludeDirective: nonTlbTranscludeDirective\n });\n ii = directives.length;\n } else if (directive.compile) {\n try {\n linkFn = directive.compile($compileNode, templateAttrs, childTranscludeFn);\n if (isFunction(linkFn)) {\n addLinkFns(null, linkFn, attrStart, attrEnd);\n } else if (linkFn) {\n addLinkFns(linkFn.pre, linkFn.post, attrStart, attrEnd);\n }\n } catch (e) {\n $exceptionHandler(e, startingTag($compileNode));\n }\n }\n\n if (directive.terminal) {\n nodeLinkFn.terminal = true;\n terminalPriority = Math.max(terminalPriority, directive.priority);\n }\n\n }\n\n nodeLinkFn.scope = newScopeDirective && newScopeDirective.scope === true;\n nodeLinkFn.transcludeOnThisElement = hasTranscludeDirective;\n nodeLinkFn.templateOnThisElement = hasTemplate;\n nodeLinkFn.transclude = childTranscludeFn;\n\n previousCompileContext.hasElementTranscludeDirective = hasElementTranscludeDirective;\n\n // might be normal or delayed nodeLinkFn depending on if templateUrl is present\n return nodeLinkFn;\n\n ////////////////////\n\n function addLinkFns(pre, post, attrStart, attrEnd) {\n if (pre) {\n if (attrStart) pre = groupElementsLinkFnWrapper(pre, attrStart, attrEnd);\n pre.require = directive.require;\n pre.directiveName = directiveName;\n if (newIsolateScopeDirective === directive || directive.$$isolateScope) {\n pre = cloneAndAnnotateFn(pre, {isolateScope: true});\n }\n preLinkFns.push(pre);\n }\n if (post) {\n if (attrStart) post = groupElementsLinkFnWrapper(post, attrStart, attrEnd);\n post.require = directive.require;\n post.directiveName = directiveName;\n if (newIsolateScopeDirective === directive || directive.$$isolateScope) {\n post = cloneAndAnnotateFn(post, {isolateScope: true});\n }\n postLinkFns.push(post);\n }\n }\n\n\n function getControllers(directiveName, require, $element, elementControllers) {\n var value;\n\n if (isString(require)) {\n var match = require.match(REQUIRE_PREFIX_REGEXP);\n var name = require.substring(match[0].length);\n var inheritType = match[1] || match[3];\n var optional = match[2] === '?';\n\n //If only parents then start at the parent element\n if (inheritType === '^^') {\n $element = $element.parent();\n //Otherwise attempt getting the controller from elementControllers in case\n //the element is transcluded (and has no data) and to avoid .data if possible\n } else {\n value = elementControllers && elementControllers[name];\n value = value && value.instance;\n }\n\n if (!value) {\n var dataName = '$' + name + 'Controller';\n value = inheritType ? $element.inheritedData(dataName) : $element.data(dataName);\n }\n\n if (!value && !optional) {\n throw $compileMinErr('ctreq',\n \"Controller '{0}', required by directive '{1}', can't be found!\",\n name, directiveName);\n }\n } else if (isArray(require)) {\n value = [];\n for (var i = 0, ii = require.length; i < ii; i++) {\n value[i] = getControllers(directiveName, require[i], $element, elementControllers);\n }\n }\n\n return value || null;\n }\n\n function setupControllers($element, attrs, transcludeFn, controllerDirectives, isolateScope, scope) {\n var elementControllers = createMap();\n for (var controllerKey in controllerDirectives) {\n var directive = controllerDirectives[controllerKey];\n var locals = {\n $scope: directive === newIsolateScopeDirective || directive.$$isolateScope ? isolateScope : scope,\n $element: $element,\n $attrs: attrs,\n $transclude: transcludeFn\n };\n\n var controller = directive.controller;\n if (controller == '@') {\n controller = attrs[directive.name];\n }\n\n var controllerInstance = $controller(controller, locals, true, directive.controllerAs);\n\n // For directives with element transclusion the element is a comment,\n // but jQuery .data doesn't support attaching data to comment nodes as it's hard to\n // clean up (http://bugs.jquery.com/ticket/8335).\n // Instead, we save the controllers for the element in a local hash and attach to .data\n // later, once we have the actual element.\n elementControllers[directive.name] = controllerInstance;\n if (!hasElementTranscludeDirective) {\n $element.data('$' + directive.name + 'Controller', controllerInstance.instance);\n }\n }\n return elementControllers;\n }\n\n function nodeLinkFn(childLinkFn, scope, linkNode, $rootElement, boundTranscludeFn,\n thisLinkFn) {\n var i, ii, linkFn, controller, isolateScope, elementControllers, transcludeFn, $element,\n attrs;\n\n if (compileNode === linkNode) {\n attrs = templateAttrs;\n $element = templateAttrs.$$element;\n } else {\n $element = jqLite(linkNode);\n attrs = new Attributes($element, templateAttrs);\n }\n\n if (newIsolateScopeDirective) {\n isolateScope = scope.$new(true);\n }\n\n if (boundTranscludeFn) {\n // track `boundTranscludeFn` so it can be unwrapped if `transcludeFn`\n // is later passed as `parentBoundTranscludeFn` to `publicLinkFn`\n transcludeFn = controllersBoundTransclude;\n transcludeFn.$$boundTransclude = boundTranscludeFn;\n }\n\n if (controllerDirectives) {\n elementControllers = setupControllers($element, attrs, transcludeFn, controllerDirectives, isolateScope, scope);\n }\n\n if (newIsolateScopeDirective) {\n // Initialize isolate scope bindings for new isolate scope directive.\n compile.$$addScopeInfo($element, isolateScope, true, !(templateDirective && (templateDirective === newIsolateScopeDirective ||\n templateDirective === newIsolateScopeDirective.$$originalDirective)));\n compile.$$addScopeClass($element, true);\n isolateScope.$$isolateBindings =\n newIsolateScopeDirective.$$isolateBindings;\n initializeDirectiveBindings(scope, attrs, isolateScope,\n isolateScope.$$isolateBindings,\n newIsolateScopeDirective, isolateScope);\n }\n if (elementControllers) {\n // Initialize bindToController bindings for new/isolate scopes\n var scopeDirective = newIsolateScopeDirective || newScopeDirective;\n var bindings;\n var controllerForBindings;\n if (scopeDirective && elementControllers[scopeDirective.name]) {\n bindings = scopeDirective.$$bindings.bindToController;\n controller = elementControllers[scopeDirective.name];\n\n if (controller && controller.identifier && bindings) {\n controllerForBindings = controller;\n thisLinkFn.$$destroyBindings =\n initializeDirectiveBindings(scope, attrs, controller.instance,\n bindings, scopeDirective);\n }\n }\n for (i in elementControllers) {\n controller = elementControllers[i];\n var controllerResult = controller();\n\n if (controllerResult !== controller.instance) {\n // If the controller constructor has a return value, overwrite the instance\n // from setupControllers and update the element data\n controller.instance = controllerResult;\n $element.data('$' + i + 'Controller', controllerResult);\n if (controller === controllerForBindings) {\n // Remove and re-install bindToController bindings\n thisLinkFn.$$destroyBindings();\n thisLinkFn.$$destroyBindings =\n initializeDirectiveBindings(scope, attrs, controllerResult, bindings, scopeDirective);\n }\n }\n }\n }\n\n // PRELINKING\n for (i = 0, ii = preLinkFns.length; i < ii; i++) {\n linkFn = preLinkFns[i];\n invokeLinkFn(linkFn,\n linkFn.isolateScope ? isolateScope : scope,\n $element,\n attrs,\n linkFn.require && getControllers(linkFn.directiveName, linkFn.require, $element, elementControllers),\n transcludeFn\n );\n }\n\n // RECURSION\n // We only pass the isolate scope, if the isolate directive has a template,\n // otherwise the child elements do not belong to the isolate directive.\n var scopeToChild = scope;\n if (newIsolateScopeDirective && (newIsolateScopeDirective.template || newIsolateScopeDirective.templateUrl === null)) {\n scopeToChild = isolateScope;\n }\n childLinkFn && childLinkFn(scopeToChild, linkNode.childNodes, undefined, boundTranscludeFn);\n\n // POSTLINKING\n for (i = postLinkFns.length - 1; i >= 0; i--) {\n linkFn = postLinkFns[i];\n invokeLinkFn(linkFn,\n linkFn.isolateScope ? isolateScope : scope,\n $element,\n attrs,\n linkFn.require && getControllers(linkFn.directiveName, linkFn.require, $element, elementControllers),\n transcludeFn\n );\n }\n\n // This is the function that is injected as `$transclude`.\n // Note: all arguments are optional!\n function controllersBoundTransclude(scope, cloneAttachFn, futureParentElement) {\n var transcludeControllers;\n\n // No scope passed in:\n if (!isScope(scope)) {\n futureParentElement = cloneAttachFn;\n cloneAttachFn = scope;\n scope = undefined;\n }\n\n if (hasElementTranscludeDirective) {\n transcludeControllers = elementControllers;\n }\n if (!futureParentElement) {\n futureParentElement = hasElementTranscludeDirective ? $element.parent() : $element;\n }\n return boundTranscludeFn(scope, cloneAttachFn, transcludeControllers, futureParentElement, scopeToChild);\n }\n }\n }\n\n function markDirectivesAsIsolate(directives) {\n // mark all directives as needing isolate scope.\n for (var j = 0, jj = directives.length; j < jj; j++) {\n directives[j] = inherit(directives[j], {$$isolateScope: true});\n }\n }\n\n /**\n * looks up the directive and decorates it with exception handling and proper parameters. We\n * call this the boundDirective.\n *\n * @param {string} name name of the directive to look up.\n * @param {string} location The directive must be found in specific format.\n * String containing any of theses characters:\n *\n * * `E`: element name\n * * `A': attribute\n * * `C`: class\n * * `M`: comment\n * @returns {boolean} true if directive was added.\n */\n function addDirective(tDirectives, name, location, maxPriority, ignoreDirective, startAttrName,\n endAttrName) {\n if (name === ignoreDirective) return null;\n var match = null;\n if (hasDirectives.hasOwnProperty(name)) {\n for (var directive, directives = $injector.get(name + Suffix),\n i = 0, ii = directives.length; i < ii; i++) {\n try {\n directive = directives[i];\n if ((maxPriority === undefined || maxPriority > directive.priority) &&\n directive.restrict.indexOf(location) != -1) {\n if (startAttrName) {\n directive = inherit(directive, {$$start: startAttrName, $$end: endAttrName});\n }\n tDirectives.push(directive);\n match = directive;\n }\n } catch (e) { $exceptionHandler(e); }\n }\n }\n return match;\n }\n\n\n /**\n * looks up the directive and returns true if it is a multi-element directive,\n * and therefore requires DOM nodes between -start and -end markers to be grouped\n * together.\n *\n * @param {string} name name of the directive to look up.\n * @returns true if directive was registered as multi-element.\n */\n function directiveIsMultiElement(name) {\n if (hasDirectives.hasOwnProperty(name)) {\n for (var directive, directives = $injector.get(name + Suffix),\n i = 0, ii = directives.length; i < ii; i++) {\n directive = directives[i];\n if (directive.multiElement) {\n return true;\n }\n }\n }\n return false;\n }\n\n /**\n * When the element is replaced with HTML template then the new attributes\n * on the template need to be merged with the existing attributes in the DOM.\n * The desired effect is to have both of the attributes present.\n *\n * @param {object} dst destination attributes (original DOM)\n * @param {object} src source attributes (from the directive template)\n */\n function mergeTemplateAttributes(dst, src) {\n var srcAttr = src.$attr,\n dstAttr = dst.$attr,\n $element = dst.$$element;\n\n // reapply the old attributes to the new element\n forEach(dst, function(value, key) {\n if (key.charAt(0) != '$') {\n if (src[key] && src[key] !== value) {\n value += (key === 'style' ? ';' : ' ') + src[key];\n }\n dst.$set(key, value, true, srcAttr[key]);\n }\n });\n\n // copy the new attributes on the old attrs object\n forEach(src, function(value, key) {\n if (key == 'class') {\n safeAddClass($element, value);\n dst['class'] = (dst['class'] ? dst['class'] + ' ' : '') + value;\n } else if (key == 'style') {\n $element.attr('style', $element.attr('style') + ';' + value);\n dst['style'] = (dst['style'] ? dst['style'] + ';' : '') + value;\n // `dst` will never contain hasOwnProperty as DOM parser won't let it.\n // You will get an \"InvalidCharacterError: DOM Exception 5\" error if you\n // have an attribute like \"has-own-property\" or \"data-has-own-property\", etc.\n } else if (key.charAt(0) != '$' && !dst.hasOwnProperty(key)) {\n dst[key] = value;\n dstAttr[key] = srcAttr[key];\n }\n });\n }\n\n\n function compileTemplateUrl(directives, $compileNode, tAttrs,\n $rootElement, childTranscludeFn, preLinkFns, postLinkFns, previousCompileContext) {\n var linkQueue = [],\n afterTemplateNodeLinkFn,\n afterTemplateChildLinkFn,\n beforeTemplateCompileNode = $compileNode[0],\n origAsyncDirective = directives.shift(),\n derivedSyncDirective = inherit(origAsyncDirective, {\n templateUrl: null, transclude: null, replace: null, $$originalDirective: origAsyncDirective\n }),\n templateUrl = (isFunction(origAsyncDirective.templateUrl))\n ? origAsyncDirective.templateUrl($compileNode, tAttrs)\n : origAsyncDirective.templateUrl,\n templateNamespace = origAsyncDirective.templateNamespace;\n\n $compileNode.empty();\n\n $templateRequest(templateUrl)\n .then(function(content) {\n var compileNode, tempTemplateAttrs, $template, childBoundTranscludeFn;\n\n content = denormalizeTemplate(content);\n\n if (origAsyncDirective.replace) {\n if (jqLiteIsTextNode(content)) {\n $template = [];\n } else {\n $template = removeComments(wrapTemplate(templateNamespace, trim(content)));\n }\n compileNode = $template[0];\n\n if ($template.length != 1 || compileNode.nodeType !== NODE_TYPE_ELEMENT) {\n throw $compileMinErr('tplrt',\n \"Template for directive '{0}' must have exactly one root element. {1}\",\n origAsyncDirective.name, templateUrl);\n }\n\n tempTemplateAttrs = {$attr: {}};\n replaceWith($rootElement, $compileNode, compileNode);\n var templateDirectives = collectDirectives(compileNode, [], tempTemplateAttrs);\n\n if (isObject(origAsyncDirective.scope)) {\n markDirectivesAsIsolate(templateDirectives);\n }\n directives = templateDirectives.concat(directives);\n mergeTemplateAttributes(tAttrs, tempTemplateAttrs);\n } else {\n compileNode = beforeTemplateCompileNode;\n $compileNode.html(content);\n }\n\n directives.unshift(derivedSyncDirective);\n\n afterTemplateNodeLinkFn = applyDirectivesToNode(directives, compileNode, tAttrs,\n childTranscludeFn, $compileNode, origAsyncDirective, preLinkFns, postLinkFns,\n previousCompileContext);\n forEach($rootElement, function(node, i) {\n if (node == compileNode) {\n $rootElement[i] = $compileNode[0];\n }\n });\n afterTemplateChildLinkFn = compileNodes($compileNode[0].childNodes, childTranscludeFn);\n\n while (linkQueue.length) {\n var scope = linkQueue.shift(),\n beforeTemplateLinkNode = linkQueue.shift(),\n linkRootElement = linkQueue.shift(),\n boundTranscludeFn = linkQueue.shift(),\n linkNode = $compileNode[0];\n\n if (scope.$$destroyed) continue;\n\n if (beforeTemplateLinkNode !== beforeTemplateCompileNode) {\n var oldClasses = beforeTemplateLinkNode.className;\n\n if (!(previousCompileContext.hasElementTranscludeDirective &&\n origAsyncDirective.replace)) {\n // it was cloned therefore we have to clone as well.\n linkNode = jqLiteClone(compileNode);\n }\n replaceWith(linkRootElement, jqLite(beforeTemplateLinkNode), linkNode);\n\n // Copy in CSS classes from original node\n safeAddClass(jqLite(linkNode), oldClasses);\n }\n if (afterTemplateNodeLinkFn.transcludeOnThisElement) {\n childBoundTranscludeFn = createBoundTranscludeFn(scope, afterTemplateNodeLinkFn.transclude, boundTranscludeFn);\n } else {\n childBoundTranscludeFn = boundTranscludeFn;\n }\n afterTemplateNodeLinkFn(afterTemplateChildLinkFn, scope, linkNode, $rootElement,\n childBoundTranscludeFn, afterTemplateNodeLinkFn);\n }\n linkQueue = null;\n });\n\n return function delayedNodeLinkFn(ignoreChildLinkFn, scope, node, rootElement, boundTranscludeFn) {\n var childBoundTranscludeFn = boundTranscludeFn;\n if (scope.$$destroyed) return;\n if (linkQueue) {\n linkQueue.push(scope,\n node,\n rootElement,\n childBoundTranscludeFn);\n } else {\n if (afterTemplateNodeLinkFn.transcludeOnThisElement) {\n childBoundTranscludeFn = createBoundTranscludeFn(scope, afterTemplateNodeLinkFn.transclude, boundTranscludeFn);\n }\n afterTemplateNodeLinkFn(afterTemplateChildLinkFn, scope, node, rootElement, childBoundTranscludeFn,\n afterTemplateNodeLinkFn);\n }\n };\n }\n\n\n /**\n * Sorting function for bound directives.\n */\n function byPriority(a, b) {\n var diff = b.priority - a.priority;\n if (diff !== 0) return diff;\n if (a.name !== b.name) return (a.name < b.name) ? -1 : 1;\n return a.index - b.index;\n }\n\n function assertNoDuplicate(what, previousDirective, directive, element) {\n\n function wrapModuleNameIfDefined(moduleName) {\n return moduleName ?\n (' (module: ' + moduleName + ')') :\n '';\n }\n\n if (previousDirective) {\n throw $compileMinErr('multidir', 'Multiple directives [{0}{1}, {2}{3}] asking for {4} on: {5}',\n previousDirective.name, wrapModuleNameIfDefined(previousDirective.$$moduleName),\n directive.name, wrapModuleNameIfDefined(directive.$$moduleName), what, startingTag(element));\n }\n }\n\n\n function addTextInterpolateDirective(directives, text) {\n var interpolateFn = $interpolate(text, true);\n if (interpolateFn) {\n directives.push({\n priority: 0,\n compile: function textInterpolateCompileFn(templateNode) {\n var templateNodeParent = templateNode.parent(),\n hasCompileParent = !!templateNodeParent.length;\n\n // When transcluding a template that has bindings in the root\n // we don't have a parent and thus need to add the class during linking fn.\n if (hasCompileParent) compile.$$addBindingClass(templateNodeParent);\n\n return function textInterpolateLinkFn(scope, node) {\n var parent = node.parent();\n if (!hasCompileParent) compile.$$addBindingClass(parent);\n compile.$$addBindingInfo(parent, interpolateFn.expressions);\n scope.$watch(interpolateFn, function interpolateFnWatchAction(value) {\n node[0].nodeValue = value;\n });\n };\n }\n });\n }\n }\n\n\n function wrapTemplate(type, template) {\n type = lowercase(type || 'html');\n switch (type) {\n case 'svg':\n case 'math':\n var wrapper = document.createElement('div');\n wrapper.innerHTML = '<' + type + '>' + template + '';\n return wrapper.childNodes[0].childNodes;\n default:\n return template;\n }\n }\n\n\n function getTrustedContext(node, attrNormalizedName) {\n if (attrNormalizedName == \"srcdoc\") {\n return $sce.HTML;\n }\n var tag = nodeName_(node);\n // maction[xlink:href] can source SVG. It's not limited to .\n if (attrNormalizedName == \"xlinkHref\" ||\n (tag == \"form\" && attrNormalizedName == \"action\") ||\n (tag != \"img\" && (attrNormalizedName == \"src\" ||\n attrNormalizedName == \"ngSrc\"))) {\n return $sce.RESOURCE_URL;\n }\n }\n\n\n function addAttrInterpolateDirective(node, directives, value, name, allOrNothing) {\n var trustedContext = getTrustedContext(node, name);\n allOrNothing = ALL_OR_NOTHING_ATTRS[name] || allOrNothing;\n\n var interpolateFn = $interpolate(value, true, trustedContext, allOrNothing);\n\n // no interpolation found -> ignore\n if (!interpolateFn) return;\n\n\n if (name === \"multiple\" && nodeName_(node) === \"select\") {\n throw $compileMinErr(\"selmulti\",\n \"Binding to the 'multiple' attribute is not supported. Element: {0}\",\n startingTag(node));\n }\n\n directives.push({\n priority: 100,\n compile: function() {\n return {\n pre: function attrInterpolatePreLinkFn(scope, element, attr) {\n var $$observers = (attr.$$observers || (attr.$$observers = {}));\n\n if (EVENT_HANDLER_ATTR_REGEXP.test(name)) {\n throw $compileMinErr('nodomevents',\n \"Interpolations for HTML DOM event attributes are disallowed. Please use the \" +\n \"ng- versions (such as ng-click instead of onclick) instead.\");\n }\n\n // If the attribute has changed since last $interpolate()ed\n var newValue = attr[name];\n if (newValue !== value) {\n // we need to interpolate again since the attribute value has been updated\n // (e.g. by another directive's compile function)\n // ensure unset/empty values make interpolateFn falsy\n interpolateFn = newValue && $interpolate(newValue, true, trustedContext, allOrNothing);\n value = newValue;\n }\n\n // if attribute was updated so that there is no interpolation going on we don't want to\n // register any observers\n if (!interpolateFn) return;\n\n // initialize attr object so that it's ready in case we need the value for isolate\n // scope initialization, otherwise the value would not be available from isolate\n // directive's linking fn during linking phase\n attr[name] = interpolateFn(scope);\n\n ($$observers[name] || ($$observers[name] = [])).$$inter = true;\n (attr.$$observers && attr.$$observers[name].$$scope || scope).\n $watch(interpolateFn, function interpolateFnWatchAction(newValue, oldValue) {\n //special case for class attribute addition + removal\n //so that class changes can tap into the animation\n //hooks provided by the $animate service. Be sure to\n //skip animations when the first digest occurs (when\n //both the new and the old values are the same) since\n //the CSS classes are the non-interpolated values\n if (name === 'class' && newValue != oldValue) {\n attr.$updateClass(newValue, oldValue);\n } else {\n attr.$set(name, newValue);\n }\n });\n }\n };\n }\n });\n }\n\n\n /**\n * This is a special jqLite.replaceWith, which can replace items which\n * have no parents, provided that the containing jqLite collection is provided.\n *\n * @param {JqLite=} $rootElement The root of the compile tree. Used so that we can replace nodes\n * in the root of the tree.\n * @param {JqLite} elementsToRemove The jqLite element which we are going to replace. We keep\n * the shell, but replace its DOM node reference.\n * @param {Node} newNode The new DOM node.\n */\n function replaceWith($rootElement, elementsToRemove, newNode) {\n var firstElementToRemove = elementsToRemove[0],\n removeCount = elementsToRemove.length,\n parent = firstElementToRemove.parentNode,\n i, ii;\n\n if ($rootElement) {\n for (i = 0, ii = $rootElement.length; i < ii; i++) {\n if ($rootElement[i] == firstElementToRemove) {\n $rootElement[i++] = newNode;\n for (var j = i, j2 = j + removeCount - 1,\n jj = $rootElement.length;\n j < jj; j++, j2++) {\n if (j2 < jj) {\n $rootElement[j] = $rootElement[j2];\n } else {\n delete $rootElement[j];\n }\n }\n $rootElement.length -= removeCount - 1;\n\n // If the replaced element is also the jQuery .context then replace it\n // .context is a deprecated jQuery api, so we should set it only when jQuery set it\n // http://api.jquery.com/context/\n if ($rootElement.context === firstElementToRemove) {\n $rootElement.context = newNode;\n }\n break;\n }\n }\n }\n\n if (parent) {\n parent.replaceChild(newNode, firstElementToRemove);\n }\n\n // TODO(perf): what's this document fragment for? is it needed? can we at least reuse it?\n var fragment = document.createDocumentFragment();\n fragment.appendChild(firstElementToRemove);\n\n if (jqLite.hasData(firstElementToRemove)) {\n // Copy over user data (that includes Angular's $scope etc.). Don't copy private\n // data here because there's no public interface in jQuery to do that and copying over\n // event listeners (which is the main use of private data) wouldn't work anyway.\n jqLite(newNode).data(jqLite(firstElementToRemove).data());\n\n // Remove data of the replaced element. We cannot just call .remove()\n // on the element it since that would deallocate scope that is needed\n // for the new node. Instead, remove the data \"manually\".\n if (!jQuery) {\n delete jqLite.cache[firstElementToRemove[jqLite.expando]];\n } else {\n // jQuery 2.x doesn't expose the data storage. Use jQuery.cleanData to clean up after\n // the replaced element. The cleanData version monkey-patched by Angular would cause\n // the scope to be trashed and we do need the very same scope to work with the new\n // element. However, we cannot just cache the non-patched version and use it here as\n // that would break if another library patches the method after Angular does (one\n // example is jQuery UI). Instead, set a flag indicating scope destroying should be\n // skipped this one time.\n skipDestroyOnNextJQueryCleanData = true;\n jQuery.cleanData([firstElementToRemove]);\n }\n }\n\n for (var k = 1, kk = elementsToRemove.length; k < kk; k++) {\n var element = elementsToRemove[k];\n jqLite(element).remove(); // must do this way to clean up expando\n fragment.appendChild(element);\n delete elementsToRemove[k];\n }\n\n elementsToRemove[0] = newNode;\n elementsToRemove.length = 1;\n }\n\n\n function cloneAndAnnotateFn(fn, annotation) {\n return extend(function() { return fn.apply(null, arguments); }, fn, annotation);\n }\n\n\n function invokeLinkFn(linkFn, scope, $element, attrs, controllers, transcludeFn) {\n try {\n linkFn(scope, $element, attrs, controllers, transcludeFn);\n } catch (e) {\n $exceptionHandler(e, startingTag($element));\n }\n }\n\n\n // Set up $watches for isolate scope and controller bindings. This process\n // only occurs for isolate scopes and new scopes with controllerAs.\n function initializeDirectiveBindings(scope, attrs, destination, bindings,\n directive, newScope) {\n var onNewScopeDestroyed;\n forEach(bindings, function(definition, scopeName) {\n var attrName = definition.attrName,\n optional = definition.optional,\n mode = definition.mode, // @, =, or &\n lastValue,\n parentGet, parentSet, compare;\n\n if (!hasOwnProperty.call(attrs, attrName)) {\n // In the case of user defined a binding with the same name as a method in Object.prototype but didn't set\n // the corresponding attribute. We need to make sure subsequent code won't access to the prototype function\n attrs[attrName] = undefined;\n }\n\n switch (mode) {\n\n case '@':\n if (!attrs[attrName] && !optional) {\n destination[scopeName] = undefined;\n }\n\n attrs.$observe(attrName, function(value) {\n destination[scopeName] = value;\n });\n attrs.$$observers[attrName].$$scope = scope;\n if (attrs[attrName]) {\n // If the attribute has been provided then we trigger an interpolation to ensure\n // the value is there for use in the link fn\n destination[scopeName] = $interpolate(attrs[attrName])(scope);\n }\n break;\n\n case '=':\n if (optional && !attrs[attrName]) {\n return;\n }\n parentGet = $parse(attrs[attrName]);\n\n if (parentGet.literal) {\n compare = equals;\n } else {\n compare = function(a, b) { return a === b || (a !== a && b !== b); };\n }\n parentSet = parentGet.assign || function() {\n // reset the change, or we will throw this exception on every $digest\n lastValue = destination[scopeName] = parentGet(scope);\n throw $compileMinErr('nonassign',\n \"Expression '{0}' used with directive '{1}' is non-assignable!\",\n attrs[attrName], directive.name);\n };\n lastValue = destination[scopeName] = parentGet(scope);\n var parentValueWatch = function parentValueWatch(parentValue) {\n if (!compare(parentValue, destination[scopeName])) {\n // we are out of sync and need to copy\n if (!compare(parentValue, lastValue)) {\n // parent changed and it has precedence\n destination[scopeName] = parentValue;\n } else {\n // if the parent can be assigned then do so\n parentSet(scope, parentValue = destination[scopeName]);\n }\n }\n return lastValue = parentValue;\n };\n parentValueWatch.$stateful = true;\n var unwatch;\n if (definition.collection) {\n unwatch = scope.$watchCollection(attrs[attrName], parentValueWatch);\n } else {\n unwatch = scope.$watch($parse(attrs[attrName], parentValueWatch), null, parentGet.literal);\n }\n onNewScopeDestroyed = (onNewScopeDestroyed || []);\n onNewScopeDestroyed.push(unwatch);\n break;\n\n case '&':\n parentGet = $parse(attrs[attrName]);\n\n // Don't assign noop to destination if expression is not valid\n if (parentGet === noop && optional) break;\n\n destination[scopeName] = function(locals) {\n return parentGet(scope, locals);\n };\n break;\n }\n });\n var destroyBindings = onNewScopeDestroyed ? function destroyBindings() {\n for (var i = 0, ii = onNewScopeDestroyed.length; i < ii; ++i) {\n onNewScopeDestroyed[i]();\n }\n } : noop;\n if (newScope && destroyBindings !== noop) {\n newScope.$on('$destroy', destroyBindings);\n return noop;\n }\n return destroyBindings;\n }\n }];\n}\n\nvar PREFIX_REGEXP = /^((?:x|data)[\\:\\-_])/i;\n/**\n * Converts all accepted directives format into proper directive name.\n * @param name Name to normalize\n */\nfunction directiveNormalize(name) {\n return camelCase(name.replace(PREFIX_REGEXP, ''));\n}\n\n/**\n * @ngdoc type\n * @name $compile.directive.Attributes\n *\n * @description\n * A shared object between directive compile / linking functions which contains normalized DOM\n * element attributes. The values reflect current binding state `{{ }}`. The normalization is\n * needed since all of these are treated as equivalent in Angular:\n *\n * ```\n * \n * ```\n */\n\n/**\n * @ngdoc property\n * @name $compile.directive.Attributes#$attr\n *\n * @description\n * A map of DOM element attribute names to the normalized name. This is\n * needed to do reverse lookup from normalized name back to actual name.\n */\n\n\n/**\n * @ngdoc method\n * @name $compile.directive.Attributes#$set\n * @kind function\n *\n * @description\n * Set DOM element attribute value.\n *\n *\n * @param {string} name Normalized element attribute name of the property to modify. The name is\n * reverse-translated using the {@link ng.$compile.directive.Attributes#$attr $attr}\n * property to the original name.\n * @param {string} value Value to set the attribute to. The value can be an interpolated string.\n */\n\n\n\n/**\n * Closure compiler type information\n */\n\nfunction nodesetLinkingFn(\n /* angular.Scope */ scope,\n /* NodeList */ nodeList,\n /* Element */ rootElement,\n /* function(Function) */ boundTranscludeFn\n) {}\n\nfunction directiveLinkingFn(\n /* nodesetLinkingFn */ nodesetLinkingFn,\n /* angular.Scope */ scope,\n /* Node */ node,\n /* Element */ rootElement,\n /* function(Function) */ boundTranscludeFn\n) {}\n\nfunction tokenDifference(str1, str2) {\n var values = '',\n tokens1 = str1.split(/\\s+/),\n tokens2 = str2.split(/\\s+/);\n\n outer:\n for (var i = 0; i < tokens1.length; i++) {\n var token = tokens1[i];\n for (var j = 0; j < tokens2.length; j++) {\n if (token == tokens2[j]) continue outer;\n }\n values += (values.length > 0 ? ' ' : '') + token;\n }\n return values;\n}\n\nfunction removeComments(jqNodes) {\n jqNodes = jqLite(jqNodes);\n var i = jqNodes.length;\n\n if (i <= 1) {\n return jqNodes;\n }\n\n while (i--) {\n var node = jqNodes[i];\n if (node.nodeType === NODE_TYPE_COMMENT) {\n splice.call(jqNodes, i, 1);\n }\n }\n return jqNodes;\n}\n\nvar $controllerMinErr = minErr('$controller');\n\n\nvar CNTRL_REG = /^(\\S+)(\\s+as\\s+(\\w+))?$/;\nfunction identifierForController(controller, ident) {\n if (ident && isString(ident)) return ident;\n if (isString(controller)) {\n var match = CNTRL_REG.exec(controller);\n if (match) return match[3];\n }\n}\n\n\n/**\n * @ngdoc provider\n * @name $controllerProvider\n * @description\n * The {@link ng.$controller $controller service} is used by Angular to create new\n * controllers.\n *\n * This provider allows controller registration via the\n * {@link ng.$controllerProvider#register register} method.\n */\nfunction $ControllerProvider() {\n var controllers = {},\n globals = false;\n\n /**\n * @ngdoc method\n * @name $controllerProvider#register\n * @param {string|Object} name Controller name, or an object map of controllers where the keys are\n * the names and the values are the constructors.\n * @param {Function|Array} constructor Controller constructor fn (optionally decorated with DI\n * annotations in the array notation).\n */\n this.register = function(name, constructor) {\n assertNotHasOwnProperty(name, 'controller');\n if (isObject(name)) {\n extend(controllers, name);\n } else {\n controllers[name] = constructor;\n }\n };\n\n /**\n * @ngdoc method\n * @name $controllerProvider#allowGlobals\n * @description If called, allows `$controller` to find controller constructors on `window`\n */\n this.allowGlobals = function() {\n globals = true;\n };\n\n\n this.$get = ['$injector', '$window', function($injector, $window) {\n\n /**\n * @ngdoc service\n * @name $controller\n * @requires $injector\n *\n * @param {Function|string} constructor If called with a function then it's considered to be the\n * controller constructor function. Otherwise it's considered to be a string which is used\n * to retrieve the controller constructor using the following steps:\n *\n * * check if a controller with given name is registered via `$controllerProvider`\n * * check if evaluating the string on the current scope returns a constructor\n * * if $controllerProvider#allowGlobals, check `window[constructor]` on the global\n * `window` object (not recommended)\n *\n * The string can use the `controller as property` syntax, where the controller instance is published\n * as the specified property on the `scope`; the `scope` must be injected into `locals` param for this\n * to work correctly.\n *\n * @param {Object} locals Injection locals for Controller.\n * @return {Object} Instance of given controller.\n *\n * @description\n * `$controller` service is responsible for instantiating controllers.\n *\n * It's just a simple call to {@link auto.$injector $injector}, but extracted into\n * a service, so that one can override this service with [BC version](https://gist.github.com/1649788).\n */\n return function(expression, locals, later, ident) {\n // PRIVATE API:\n // param `later` --- indicates that the controller's constructor is invoked at a later time.\n // If true, $controller will allocate the object with the correct\n // prototype chain, but will not invoke the controller until a returned\n // callback is invoked.\n // param `ident` --- An optional label which overrides the label parsed from the controller\n // expression, if any.\n var instance, match, constructor, identifier;\n later = later === true;\n if (ident && isString(ident)) {\n identifier = ident;\n }\n\n if (isString(expression)) {\n match = expression.match(CNTRL_REG);\n if (!match) {\n throw $controllerMinErr('ctrlfmt',\n \"Badly formed controller string '{0}'. \" +\n \"Must match `__name__ as __id__` or `__name__`.\", expression);\n }\n constructor = match[1],\n identifier = identifier || match[3];\n expression = controllers.hasOwnProperty(constructor)\n ? controllers[constructor]\n : getter(locals.$scope, constructor, true) ||\n (globals ? getter($window, constructor, true) : undefined);\n\n assertArgFn(expression, constructor, true);\n }\n\n if (later) {\n // Instantiate controller later:\n // This machinery is used to create an instance of the object before calling the\n // controller's constructor itself.\n //\n // This allows properties to be added to the controller before the constructor is\n // invoked. Primarily, this is used for isolate scope bindings in $compile.\n //\n // This feature is not intended for use by applications, and is thus not documented\n // publicly.\n // Object creation: http://jsperf.com/create-constructor/2\n var controllerPrototype = (isArray(expression) ?\n expression[expression.length - 1] : expression).prototype;\n instance = Object.create(controllerPrototype || null);\n\n if (identifier) {\n addIdentifier(locals, identifier, instance, constructor || expression.name);\n }\n\n var instantiate;\n return instantiate = extend(function() {\n var result = $injector.invoke(expression, instance, locals, constructor);\n if (result !== instance && (isObject(result) || isFunction(result))) {\n instance = result;\n if (identifier) {\n // If result changed, re-assign controllerAs value to scope.\n addIdentifier(locals, identifier, instance, constructor || expression.name);\n }\n }\n return instance;\n }, {\n instance: instance,\n identifier: identifier\n });\n }\n\n instance = $injector.instantiate(expression, locals, constructor);\n\n if (identifier) {\n addIdentifier(locals, identifier, instance, constructor || expression.name);\n }\n\n return instance;\n };\n\n function addIdentifier(locals, identifier, instance, name) {\n if (!(locals && isObject(locals.$scope))) {\n throw minErr('$controller')('noscp',\n \"Cannot export controller '{0}' as '{1}'! No $scope object provided via `locals`.\",\n name, identifier);\n }\n\n locals.$scope[identifier] = instance;\n }\n }];\n}\n\n/**\n * @ngdoc service\n * @name $document\n * @requires $window\n *\n * @description\n * A {@link angular.element jQuery or jqLite} wrapper for the browser's `window.document` object.\n *\n * @example\n \n \n
    \n

    $document title:

    \n

    window.document title:

    \n
    \n
    \n \n angular.module('documentExample', [])\n .controller('ExampleController', ['$scope', '$document', function($scope, $document) {\n $scope.title = $document[0].title;\n $scope.windowTitle = angular.element(window.document)[0].title;\n }]);\n \n
    \n */\nfunction $DocumentProvider() {\n this.$get = ['$window', function(window) {\n return jqLite(window.document);\n }];\n}\n\n/**\n * @ngdoc service\n * @name $exceptionHandler\n * @requires ng.$log\n *\n * @description\n * Any uncaught exception in angular expressions is delegated to this service.\n * The default implementation simply delegates to `$log.error` which logs it into\n * the browser console.\n *\n * In unit tests, if `angular-mocks.js` is loaded, this service is overridden by\n * {@link ngMock.$exceptionHandler mock $exceptionHandler} which aids in testing.\n *\n * ## Example:\n *\n * ```js\n * angular.module('exceptionOverride', []).factory('$exceptionHandler', function() {\n * return function(exception, cause) {\n * exception.message += ' (caused by \"' + cause + '\")';\n * throw exception;\n * };\n * });\n * ```\n *\n * This example will override the normal action of `$exceptionHandler`, to make angular\n * exceptions fail hard when they happen, instead of just logging to the console.\n *\n *
    \n * Note, that code executed in event-listeners (even those registered using jqLite's `on`/`bind`\n * methods) does not delegate exceptions to the {@link ng.$exceptionHandler $exceptionHandler}\n * (unless executed during a digest).\n *\n * If you wish, you can manually delegate exceptions, e.g.\n * `try { ... } catch(e) { $exceptionHandler(e); }`\n *\n * @param {Error} exception Exception associated with the error.\n * @param {string=} cause optional information about the context in which\n * the error was thrown.\n *\n */\nfunction $ExceptionHandlerProvider() {\n this.$get = ['$log', function($log) {\n return function(exception, cause) {\n $log.error.apply($log, arguments);\n };\n }];\n}\n\nvar APPLICATION_JSON = 'application/json';\nvar CONTENT_TYPE_APPLICATION_JSON = {'Content-Type': APPLICATION_JSON + ';charset=utf-8'};\nvar JSON_START = /^\\[|^\\{(?!\\{)/;\nvar JSON_ENDS = {\n '[': /]$/,\n '{': /}$/\n};\nvar JSON_PROTECTION_PREFIX = /^\\)\\]\\}',?\\n/;\n\nfunction serializeValue(v) {\n if (isObject(v)) {\n return isDate(v) ? v.toISOString() : toJson(v);\n }\n return v;\n}\n\n\nfunction $HttpParamSerializerProvider() {\n /**\n * @ngdoc service\n * @name $httpParamSerializer\n * @description\n *\n * Default {@link $http `$http`} params serializer that converts objects to strings\n * according to the following rules:\n *\n * * `{'foo': 'bar'}` results in `foo=bar`\n * * `{'foo': Date.now()}` results in `foo=2015-04-01T09%3A50%3A49.262Z` (`toISOString()` and encoded representation of a Date object)\n * * `{'foo': ['bar', 'baz']}` results in `foo=bar&foo=baz` (repeated key for each array element)\n * * `{'foo': {'bar':'baz'}}` results in `foo=%7B%22bar%22%3A%22baz%22%7D\"` (stringified and encoded representation of an object)\n *\n * Note that serializer will sort the request parameters alphabetically.\n * */\n\n this.$get = function() {\n return function ngParamSerializer(params) {\n if (!params) return '';\n var parts = [];\n forEachSorted(params, function(value, key) {\n if (value === null || isUndefined(value)) return;\n if (isArray(value)) {\n forEach(value, function(v, k) {\n parts.push(encodeUriQuery(key) + '=' + encodeUriQuery(serializeValue(v)));\n });\n } else {\n parts.push(encodeUriQuery(key) + '=' + encodeUriQuery(serializeValue(value)));\n }\n });\n\n return parts.join('&');\n };\n };\n}\n\nfunction $HttpParamSerializerJQLikeProvider() {\n /**\n * @ngdoc service\n * @name $httpParamSerializerJQLike\n * @description\n *\n * Alternative {@link $http `$http`} params serializer that follows\n * jQuery's [`param()`](http://api.jquery.com/jquery.param/) method logic.\n * The serializer will also sort the params alphabetically.\n *\n * To use it for serializing `$http` request parameters, set it as the `paramSerializer` property:\n *\n * ```js\n * $http({\n * url: myUrl,\n * method: 'GET',\n * params: myParams,\n * paramSerializer: '$httpParamSerializerJQLike'\n * });\n * ```\n *\n * It is also possible to set it as the default `paramSerializer` in the\n * {@link $httpProvider#defaults `$httpProvider`}.\n *\n * Additionally, you can inject the serializer and use it explicitly, for example to serialize\n * form data for submission:\n *\n * ```js\n * .controller(function($http, $httpParamSerializerJQLike) {\n * //...\n *\n * $http({\n * url: myUrl,\n * method: 'POST',\n * data: $httpParamSerializerJQLike(myData),\n * headers: {\n * 'Content-Type': 'application/x-www-form-urlencoded'\n * }\n * });\n *\n * });\n * ```\n *\n * */\n this.$get = function() {\n return function jQueryLikeParamSerializer(params) {\n if (!params) return '';\n var parts = [];\n serialize(params, '', true);\n return parts.join('&');\n\n function serialize(toSerialize, prefix, topLevel) {\n if (toSerialize === null || isUndefined(toSerialize)) return;\n if (isArray(toSerialize)) {\n forEach(toSerialize, function(value) {\n serialize(value, prefix + '[]');\n });\n } else if (isObject(toSerialize) && !isDate(toSerialize)) {\n forEachSorted(toSerialize, function(value, key) {\n serialize(value, prefix +\n (topLevel ? '' : '[') +\n key +\n (topLevel ? '' : ']'));\n });\n } else {\n parts.push(encodeUriQuery(prefix) + '=' + encodeUriQuery(serializeValue(toSerialize)));\n }\n }\n };\n };\n}\n\nfunction defaultHttpResponseTransform(data, headers) {\n if (isString(data)) {\n // Strip json vulnerability protection prefix and trim whitespace\n var tempData = data.replace(JSON_PROTECTION_PREFIX, '').trim();\n\n if (tempData) {\n var contentType = headers('Content-Type');\n if ((contentType && (contentType.indexOf(APPLICATION_JSON) === 0)) || isJsonLike(tempData)) {\n data = fromJson(tempData);\n }\n }\n }\n\n return data;\n}\n\nfunction isJsonLike(str) {\n var jsonStart = str.match(JSON_START);\n return jsonStart && JSON_ENDS[jsonStart[0]].test(str);\n}\n\n/**\n * Parse headers into key value object\n *\n * @param {string} headers Raw headers as a string\n * @returns {Object} Parsed headers as key value object\n */\nfunction parseHeaders(headers) {\n var parsed = createMap(), i;\n\n function fillInParsed(key, val) {\n if (key) {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n\n if (isString(headers)) {\n forEach(headers.split('\\n'), function(line) {\n i = line.indexOf(':');\n fillInParsed(lowercase(trim(line.substr(0, i))), trim(line.substr(i + 1)));\n });\n } else if (isObject(headers)) {\n forEach(headers, function(headerVal, headerKey) {\n fillInParsed(lowercase(headerKey), trim(headerVal));\n });\n }\n\n return parsed;\n}\n\n\n/**\n * Returns a function that provides access to parsed headers.\n *\n * Headers are lazy parsed when first requested.\n * @see parseHeaders\n *\n * @param {(string|Object)} headers Headers to provide access to.\n * @returns {function(string=)} Returns a getter function which if called with:\n *\n * - if called with single an argument returns a single header value or null\n * - if called with no arguments returns an object containing all headers.\n */\nfunction headersGetter(headers) {\n var headersObj;\n\n return function(name) {\n if (!headersObj) headersObj = parseHeaders(headers);\n\n if (name) {\n var value = headersObj[lowercase(name)];\n if (value === void 0) {\n value = null;\n }\n return value;\n }\n\n return headersObj;\n };\n}\n\n\n/**\n * Chain all given functions\n *\n * This function is used for both request and response transforming\n *\n * @param {*} data Data to transform.\n * @param {function(string=)} headers HTTP headers getter fn.\n * @param {number} status HTTP status code of the response.\n * @param {(Function|Array.)} fns Function or an array of functions.\n * @returns {*} Transformed data.\n */\nfunction transformData(data, headers, status, fns) {\n if (isFunction(fns)) {\n return fns(data, headers, status);\n }\n\n forEach(fns, function(fn) {\n data = fn(data, headers, status);\n });\n\n return data;\n}\n\n\nfunction isSuccess(status) {\n return 200 <= status && status < 300;\n}\n\n\n/**\n * @ngdoc provider\n * @name $httpProvider\n * @description\n * Use `$httpProvider` to change the default behavior of the {@link ng.$http $http} service.\n * */\nfunction $HttpProvider() {\n /**\n * @ngdoc property\n * @name $httpProvider#defaults\n * @description\n *\n * Object containing default values for all {@link ng.$http $http} requests.\n *\n * - **`defaults.cache`** - {Object} - an object built with {@link ng.$cacheFactory `$cacheFactory`}\n * that will provide the cache for all requests who set their `cache` property to `true`.\n * If you set the `defaults.cache = false` then only requests that specify their own custom\n * cache object will be cached. See {@link $http#caching $http Caching} for more information.\n *\n * - **`defaults.xsrfCookieName`** - {string} - Name of cookie containing the XSRF token.\n * Defaults value is `'XSRF-TOKEN'`.\n *\n * - **`defaults.xsrfHeaderName`** - {string} - Name of HTTP header to populate with the\n * XSRF token. Defaults value is `'X-XSRF-TOKEN'`.\n *\n * - **`defaults.headers`** - {Object} - Default headers for all $http requests.\n * Refer to {@link ng.$http#setting-http-headers $http} for documentation on\n * setting default headers.\n * - **`defaults.headers.common`**\n * - **`defaults.headers.post`**\n * - **`defaults.headers.put`**\n * - **`defaults.headers.patch`**\n *\n *\n * - **`defaults.paramSerializer`** - `{string|function(Object):string}` - A function\n * used to the prepare string representation of request parameters (specified as an object).\n * If specified as string, it is interpreted as a function registered with the {@link auto.$injector $injector}.\n * Defaults to {@link ng.$httpParamSerializer $httpParamSerializer}.\n *\n **/\n var defaults = this.defaults = {\n // transform incoming response data\n transformResponse: [defaultHttpResponseTransform],\n\n // transform outgoing request data\n transformRequest: [function(d) {\n return isObject(d) && !isFile(d) && !isBlob(d) && !isFormData(d) ? toJson(d) : d;\n }],\n\n // default headers\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n },\n post: shallowCopy(CONTENT_TYPE_APPLICATION_JSON),\n put: shallowCopy(CONTENT_TYPE_APPLICATION_JSON),\n patch: shallowCopy(CONTENT_TYPE_APPLICATION_JSON)\n },\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n paramSerializer: '$httpParamSerializer'\n };\n\n var useApplyAsync = false;\n /**\n * @ngdoc method\n * @name $httpProvider#useApplyAsync\n * @description\n *\n * Configure $http service to combine processing of multiple http responses received at around\n * the same time via {@link ng.$rootScope.Scope#$applyAsync $rootScope.$applyAsync}. This can result in\n * significant performance improvement for bigger applications that make many HTTP requests\n * concurrently (common during application bootstrap).\n *\n * Defaults to false. If no value is specified, returns the current configured value.\n *\n * @param {boolean=} value If true, when requests are loaded, they will schedule a deferred\n * \"apply\" on the next tick, giving time for subsequent requests in a roughly ~10ms window\n * to load and share the same digest cycle.\n *\n * @returns {boolean|Object} If a value is specified, returns the $httpProvider for chaining.\n * otherwise, returns the current configured value.\n **/\n this.useApplyAsync = function(value) {\n if (isDefined(value)) {\n useApplyAsync = !!value;\n return this;\n }\n return useApplyAsync;\n };\n\n /**\n * @ngdoc property\n * @name $httpProvider#interceptors\n * @description\n *\n * Array containing service factories for all synchronous or asynchronous {@link ng.$http $http}\n * pre-processing of request or postprocessing of responses.\n *\n * These service factories are ordered by request, i.e. they are applied in the same order as the\n * array, on request, but reverse order, on response.\n *\n * {@link ng.$http#interceptors Interceptors detailed info}\n **/\n var interceptorFactories = this.interceptors = [];\n\n this.$get = ['$httpBackend', '$$cookieReader', '$cacheFactory', '$rootScope', '$q', '$injector',\n function($httpBackend, $$cookieReader, $cacheFactory, $rootScope, $q, $injector) {\n\n var defaultCache = $cacheFactory('$http');\n\n /**\n * Make sure that default param serializer is exposed as a function\n */\n defaults.paramSerializer = isString(defaults.paramSerializer) ?\n $injector.get(defaults.paramSerializer) : defaults.paramSerializer;\n\n /**\n * Interceptors stored in reverse order. Inner interceptors before outer interceptors.\n * The reversal is needed so that we can build up the interception chain around the\n * server request.\n */\n var reversedInterceptors = [];\n\n forEach(interceptorFactories, function(interceptorFactory) {\n reversedInterceptors.unshift(isString(interceptorFactory)\n ? $injector.get(interceptorFactory) : $injector.invoke(interceptorFactory));\n });\n\n /**\n * @ngdoc service\n * @kind function\n * @name $http\n * @requires ng.$httpBackend\n * @requires $cacheFactory\n * @requires $rootScope\n * @requires $q\n * @requires $injector\n *\n * @description\n * The `$http` service is a core Angular service that facilitates communication with the remote\n * HTTP servers via the browser's [XMLHttpRequest](https://developer.mozilla.org/en/xmlhttprequest)\n * object or via [JSONP](http://en.wikipedia.org/wiki/JSONP).\n *\n * For unit testing applications that use `$http` service, see\n * {@link ngMock.$httpBackend $httpBackend mock}.\n *\n * For a higher level of abstraction, please check out the {@link ngResource.$resource\n * $resource} service.\n *\n * The $http API is based on the {@link ng.$q deferred/promise APIs} exposed by\n * the $q service. While for simple usage patterns this doesn't matter much, for advanced usage\n * it is important to familiarize yourself with these APIs and the guarantees they provide.\n *\n *\n * ## General usage\n * The `$http` service is a function which takes a single argument — a configuration object —\n * that is used to generate an HTTP request and returns a {@link ng.$q promise}\n * with two $http specific methods: `success` and `error`.\n *\n * ```js\n * // Simple GET request example :\n * $http.get('/someUrl').\n * success(function(data, status, headers, config) {\n * // this callback will be called asynchronously\n * // when the response is available\n * }).\n * error(function(data, status, headers, config) {\n * // called asynchronously if an error occurs\n * // or server returns response with an error status.\n * });\n * ```\n *\n * ```js\n * // Simple POST request example (passing data) :\n * $http.post('/someUrl', {msg:'hello word!'}).\n * success(function(data, status, headers, config) {\n * // this callback will be called asynchronously\n * // when the response is available\n * }).\n * error(function(data, status, headers, config) {\n * // called asynchronously if an error occurs\n * // or server returns response with an error status.\n * });\n * ```\n *\n *\n * Since the returned value of calling the $http function is a `promise`, you can also use\n * the `then` method to register callbacks, and these callbacks will receive a single argument –\n * an object representing the response. See the API signature and type info below for more\n * details.\n *\n * A response status code between 200 and 299 is considered a success status and\n * will result in the success callback being called. Note that if the response is a redirect,\n * XMLHttpRequest will transparently follow it, meaning that the error callback will not be\n * called for such responses.\n *\n * ## Writing Unit Tests that use $http\n * When unit testing (using {@link ngMock ngMock}), it is necessary to call\n * {@link ngMock.$httpBackend#flush $httpBackend.flush()} to flush each pending\n * request using trained responses.\n *\n * ```\n * $httpBackend.expectGET(...);\n * $http.get(...);\n * $httpBackend.flush();\n * ```\n *\n * ## Shortcut methods\n *\n * Shortcut methods are also available. All shortcut methods require passing in the URL, and\n * request data must be passed in for POST/PUT requests.\n *\n * ```js\n * $http.get('/someUrl').success(successCallback);\n * $http.post('/someUrl', data).success(successCallback);\n * ```\n *\n * Complete list of shortcut methods:\n *\n * - {@link ng.$http#get $http.get}\n * - {@link ng.$http#head $http.head}\n * - {@link ng.$http#post $http.post}\n * - {@link ng.$http#put $http.put}\n * - {@link ng.$http#delete $http.delete}\n * - {@link ng.$http#jsonp $http.jsonp}\n * - {@link ng.$http#patch $http.patch}\n *\n *\n * ## Setting HTTP Headers\n *\n * The $http service will automatically add certain HTTP headers to all requests. These defaults\n * can be fully configured by accessing the `$httpProvider.defaults.headers` configuration\n * object, which currently contains this default configuration:\n *\n * - `$httpProvider.defaults.headers.common` (headers that are common for all requests):\n * - `Accept: application/json, text/plain, * / *`\n * - `$httpProvider.defaults.headers.post`: (header defaults for POST requests)\n * - `Content-Type: application/json`\n * - `$httpProvider.defaults.headers.put` (header defaults for PUT requests)\n * - `Content-Type: application/json`\n *\n * To add or overwrite these defaults, simply add or remove a property from these configuration\n * objects. To add headers for an HTTP method other than POST or PUT, simply add a new object\n * with the lowercased HTTP method name as the key, e.g.\n * `$httpProvider.defaults.headers.get = { 'My-Header' : 'value' }`.\n *\n * The defaults can also be set at runtime via the `$http.defaults` object in the same\n * fashion. For example:\n *\n * ```\n * module.run(function($http) {\n * $http.defaults.headers.common.Authorization = 'Basic YmVlcDpib29w'\n * });\n * ```\n *\n * In addition, you can supply a `headers` property in the config object passed when\n * calling `$http(config)`, which overrides the defaults without changing them globally.\n *\n * To explicitly remove a header automatically added via $httpProvider.defaults.headers on a per request basis,\n * Use the `headers` property, setting the desired header to `undefined`. For example:\n *\n * ```js\n * var req = {\n * method: 'POST',\n * url: 'http://example.com',\n * headers: {\n * 'Content-Type': undefined\n * },\n * data: { test: 'test' }\n * }\n *\n * $http(req).success(function(){...}).error(function(){...});\n * ```\n *\n * ## Transforming Requests and Responses\n *\n * Both requests and responses can be transformed using transformation functions: `transformRequest`\n * and `transformResponse`. These properties can be a single function that returns\n * the transformed value (`function(data, headersGetter, status)`) or an array of such transformation functions,\n * which allows you to `push` or `unshift` a new transformation function into the transformation chain.\n *\n * ### Default Transformations\n *\n * The `$httpProvider` provider and `$http` service expose `defaults.transformRequest` and\n * `defaults.transformResponse` properties. If a request does not provide its own transformations\n * then these will be applied.\n *\n * You can augment or replace the default transformations by modifying these properties by adding to or\n * replacing the array.\n *\n * Angular provides the following default transformations:\n *\n * Request transformations (`$httpProvider.defaults.transformRequest` and `$http.defaults.transformRequest`):\n *\n * - If the `data` property of the request configuration object contains an object, serialize it\n * into JSON format.\n *\n * Response transformations (`$httpProvider.defaults.transformResponse` and `$http.defaults.transformResponse`):\n *\n * - If XSRF prefix is detected, strip it (see Security Considerations section below).\n * - If JSON response is detected, deserialize it using a JSON parser.\n *\n *\n * ### Overriding the Default Transformations Per Request\n *\n * If you wish override the request/response transformations only for a single request then provide\n * `transformRequest` and/or `transformResponse` properties on the configuration object passed\n * into `$http`.\n *\n * Note that if you provide these properties on the config object the default transformations will be\n * overwritten. If you wish to augment the default transformations then you must include them in your\n * local transformation array.\n *\n * The following code demonstrates adding a new response transformation to be run after the default response\n * transformations have been run.\n *\n * ```js\n * function appendTransform(defaults, transform) {\n *\n * // We can't guarantee that the default transformation is an array\n * defaults = angular.isArray(defaults) ? defaults : [defaults];\n *\n * // Append the new transformation to the defaults\n * return defaults.concat(transform);\n * }\n *\n * $http({\n * url: '...',\n * method: 'GET',\n * transformResponse: appendTransform($http.defaults.transformResponse, function(value) {\n * return doTransform(value);\n * })\n * });\n * ```\n *\n *\n * ## Caching\n *\n * To enable caching, set the request configuration `cache` property to `true` (to use default\n * cache) or to a custom cache object (built with {@link ng.$cacheFactory `$cacheFactory`}).\n * When the cache is enabled, `$http` stores the response from the server in the specified\n * cache. The next time the same request is made, the response is served from the cache without\n * sending a request to the server.\n *\n * Note that even if the response is served from cache, delivery of the data is asynchronous in\n * the same way that real requests are.\n *\n * If there are multiple GET requests for the same URL that should be cached using the same\n * cache, but the cache is not populated yet, only one request to the server will be made and\n * the remaining requests will be fulfilled using the response from the first request.\n *\n * You can change the default cache to a new object (built with\n * {@link ng.$cacheFactory `$cacheFactory`}) by updating the\n * {@link ng.$http#defaults `$http.defaults.cache`} property. All requests who set\n * their `cache` property to `true` will now use this cache object.\n *\n * If you set the default cache to `false` then only requests that specify their own custom\n * cache object will be cached.\n *\n * ## Interceptors\n *\n * Before you start creating interceptors, be sure to understand the\n * {@link ng.$q $q and deferred/promise APIs}.\n *\n * For purposes of global error handling, authentication, or any kind of synchronous or\n * asynchronous pre-processing of request or postprocessing of responses, it is desirable to be\n * able to intercept requests before they are handed to the server and\n * responses before they are handed over to the application code that\n * initiated these requests. The interceptors leverage the {@link ng.$q\n * promise APIs} to fulfill this need for both synchronous and asynchronous pre-processing.\n *\n * The interceptors are service factories that are registered with the `$httpProvider` by\n * adding them to the `$httpProvider.interceptors` array. The factory is called and\n * injected with dependencies (if specified) and returns the interceptor.\n *\n * There are two kinds of interceptors (and two kinds of rejection interceptors):\n *\n * * `request`: interceptors get called with a http `config` object. The function is free to\n * modify the `config` object or create a new one. The function needs to return the `config`\n * object directly, or a promise containing the `config` or a new `config` object.\n * * `requestError`: interceptor gets called when a previous interceptor threw an error or\n * resolved with a rejection.\n * * `response`: interceptors get called with http `response` object. The function is free to\n * modify the `response` object or create a new one. The function needs to return the `response`\n * object directly, or as a promise containing the `response` or a new `response` object.\n * * `responseError`: interceptor gets called when a previous interceptor threw an error or\n * resolved with a rejection.\n *\n *\n * ```js\n * // register the interceptor as a service\n * $provide.factory('myHttpInterceptor', function($q, dependency1, dependency2) {\n * return {\n * // optional method\n * 'request': function(config) {\n * // do something on success\n * return config;\n * },\n *\n * // optional method\n * 'requestError': function(rejection) {\n * // do something on error\n * if (canRecover(rejection)) {\n * return responseOrNewPromise\n * }\n * return $q.reject(rejection);\n * },\n *\n *\n *\n * // optional method\n * 'response': function(response) {\n * // do something on success\n * return response;\n * },\n *\n * // optional method\n * 'responseError': function(rejection) {\n * // do something on error\n * if (canRecover(rejection)) {\n * return responseOrNewPromise\n * }\n * return $q.reject(rejection);\n * }\n * };\n * });\n *\n * $httpProvider.interceptors.push('myHttpInterceptor');\n *\n *\n * // alternatively, register the interceptor via an anonymous factory\n * $httpProvider.interceptors.push(function($q, dependency1, dependency2) {\n * return {\n * 'request': function(config) {\n * // same as above\n * },\n *\n * 'response': function(response) {\n * // same as above\n * }\n * };\n * });\n * ```\n *\n * ## Security Considerations\n *\n * When designing web applications, consider security threats from:\n *\n * - [JSON vulnerability](http://haacked.com/archive/2008/11/20/anatomy-of-a-subtle-json-vulnerability.aspx)\n * - [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery)\n *\n * Both server and the client must cooperate in order to eliminate these threats. Angular comes\n * pre-configured with strategies that address these issues, but for this to work backend server\n * cooperation is required.\n *\n * ### JSON Vulnerability Protection\n *\n * A [JSON vulnerability](http://haacked.com/archive/2008/11/20/anatomy-of-a-subtle-json-vulnerability.aspx)\n * allows third party website to turn your JSON resource URL into\n * [JSONP](http://en.wikipedia.org/wiki/JSONP) request under some conditions. To\n * counter this your server can prefix all JSON requests with following string `\")]}',\\n\"`.\n * Angular will automatically strip the prefix before processing it as JSON.\n *\n * For example if your server needs to return:\n * ```js\n * ['one','two']\n * ```\n *\n * which is vulnerable to attack, your server can return:\n * ```js\n * )]}',\n * ['one','two']\n * ```\n *\n * Angular will strip the prefix, before processing the JSON.\n *\n *\n * ### Cross Site Request Forgery (XSRF) Protection\n *\n * [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) is a technique by which\n * an unauthorized site can gain your user's private data. Angular provides a mechanism\n * to counter XSRF. When performing XHR requests, the $http service reads a token from a cookie\n * (by default, `XSRF-TOKEN`) and sets it as an HTTP header (`X-XSRF-TOKEN`). Since only\n * JavaScript that runs on your domain could read the cookie, your server can be assured that\n * the XHR came from JavaScript running on your domain. The header will not be set for\n * cross-domain requests.\n *\n * To take advantage of this, your server needs to set a token in a JavaScript readable session\n * cookie called `XSRF-TOKEN` on the first HTTP GET request. On subsequent XHR requests the\n * server can verify that the cookie matches `X-XSRF-TOKEN` HTTP header, and therefore be sure\n * that only JavaScript running on your domain could have sent the request. The token must be\n * unique for each user and must be verifiable by the server (to prevent the JavaScript from\n * making up its own tokens). We recommend that the token is a digest of your site's\n * authentication cookie with a [salt](https://en.wikipedia.org/wiki/Salt_(cryptography))\n * for added security.\n *\n * The name of the headers can be specified using the xsrfHeaderName and xsrfCookieName\n * properties of either $httpProvider.defaults at config-time, $http.defaults at run-time,\n * or the per-request config object.\n *\n * In order to prevent collisions in environments where multiple Angular apps share the\n * same domain or subdomain, we recommend that each application uses unique cookie name.\n *\n *\n * @param {object} config Object describing the request to be made and how it should be\n * processed. The object has following properties:\n *\n * - **method** – `{string}` – HTTP method (e.g. 'GET', 'POST', etc)\n * - **url** – `{string}` – Absolute or relative URL of the resource that is being requested.\n * - **params** – `{Object.}` – Map of strings or objects which will be serialized\n * with the `paramSerializer` and appended as GET parameters.\n * - **data** – `{string|Object}` – Data to be sent as the request message data.\n * - **headers** – `{Object}` – Map of strings or functions which return strings representing\n * HTTP headers to send to the server. If the return value of a function is null, the\n * header will not be sent. Functions accept a config object as an argument.\n * - **xsrfHeaderName** – `{string}` – Name of HTTP header to populate with the XSRF token.\n * - **xsrfCookieName** – `{string}` – Name of cookie containing the XSRF token.\n * - **transformRequest** –\n * `{function(data, headersGetter)|Array.}` –\n * transform function or an array of such functions. The transform function takes the http\n * request body and headers and returns its transformed (typically serialized) version.\n * See {@link ng.$http#overriding-the-default-transformations-per-request\n * Overriding the Default Transformations}\n * - **transformResponse** –\n * `{function(data, headersGetter, status)|Array.}` –\n * transform function or an array of such functions. The transform function takes the http\n * response body, headers and status and returns its transformed (typically deserialized) version.\n * See {@link ng.$http#overriding-the-default-transformations-per-request\n * Overriding the Default TransformationjqLiks}\n * - **paramSerializer** - `{string|function(Object):string}` - A function used to\n * prepare the string representation of request parameters (specified as an object).\n * If specified as string, it is interpreted as function registered with the\n * {@link $injector $injector}, which means you can create your own serializer\n * by registering it as a {@link auto.$provide#service service}.\n * The default serializer is the {@link $httpParamSerializer $httpParamSerializer};\n * alternatively, you can use the {@link $httpParamSerializerJQLike $httpParamSerializerJQLike}\n * - **cache** – `{boolean|Cache}` – If true, a default $http cache will be used to cache the\n * GET request, otherwise if a cache instance built with\n * {@link ng.$cacheFactory $cacheFactory}, this cache will be used for\n * caching.\n * - **timeout** – `{number|Promise}` – timeout in milliseconds, or {@link ng.$q promise}\n * that should abort the request when resolved.\n * - **withCredentials** - `{boolean}` - whether to set the `withCredentials` flag on the\n * XHR object. See [requests with credentials](https://developer.mozilla.org/docs/Web/HTTP/Access_control_CORS#Requests_with_credentials)\n * for more information.\n * - **responseType** - `{string}` - see\n * [XMLHttpRequest.responseType](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest#xmlhttprequest-responsetype).\n *\n * @returns {HttpPromise} Returns a {@link ng.$q promise} object with the\n * standard `then` method and two http specific methods: `success` and `error`. The `then`\n * method takes two arguments a success and an error callback which will be called with a\n * response object. The `success` and `error` methods take a single argument - a function that\n * will be called when the request succeeds or fails respectively. The arguments passed into\n * these functions are destructured representation of the response object passed into the\n * `then` method. The response object has these properties:\n *\n * - **data** – `{string|Object}` – The response body transformed with the transform\n * functions.\n * - **status** – `{number}` – HTTP status code of the response.\n * - **headers** – `{function([headerName])}` – Header getter function.\n * - **config** – `{Object}` – The configuration object that was used to generate the request.\n * - **statusText** – `{string}` – HTTP status text of the response.\n *\n * @property {Array.} pendingRequests Array of config objects for currently pending\n * requests. This is primarily meant to be used for debugging purposes.\n *\n *\n * @example\n\n\n
    \n \n \n
    \n \n \n \n
    http status code: {{status}}
    \n
    http response data: {{data}}
    \n
    \n
    \n\n angular.module('httpExample', [])\n .controller('FetchController', ['$scope', '$http', '$templateCache',\n function($scope, $http, $templateCache) {\n $scope.method = 'GET';\n $scope.url = 'http-hello.html';\n\n $scope.fetch = function() {\n $scope.code = null;\n $scope.response = null;\n\n $http({method: $scope.method, url: $scope.url, cache: $templateCache}).\n success(function(data, status) {\n $scope.status = status;\n $scope.data = data;\n }).\n error(function(data, status) {\n $scope.data = data || \"Request failed\";\n $scope.status = status;\n });\n };\n\n $scope.updateModel = function(method, url) {\n $scope.method = method;\n $scope.url = url;\n };\n }]);\n\n\n Hello, $http!\n\n\n var status = element(by.binding('status'));\n var data = element(by.binding('data'));\n var fetchBtn = element(by.id('fetchbtn'));\n var sampleGetBtn = element(by.id('samplegetbtn'));\n var sampleJsonpBtn = element(by.id('samplejsonpbtn'));\n var invalidJsonpBtn = element(by.id('invalidjsonpbtn'));\n\n it('should make an xhr GET request', function() {\n sampleGetBtn.click();\n fetchBtn.click();\n expect(status.getText()).toMatch('200');\n expect(data.getText()).toMatch(/Hello, \\$http!/);\n });\n\n// Commented out due to flakes. See https://github.com/angular/angular.js/issues/9185\n// it('should make a JSONP request to angularjs.org', function() {\n// sampleJsonpBtn.click();\n// fetchBtn.click();\n// expect(status.getText()).toMatch('200');\n// expect(data.getText()).toMatch(/Super Hero!/);\n// });\n\n it('should make JSONP request to invalid URL and invoke the error handler',\n function() {\n invalidJsonpBtn.click();\n fetchBtn.click();\n expect(status.getText()).toMatch('0');\n expect(data.getText()).toMatch('Request failed');\n });\n\n
    \n */\n function $http(requestConfig) {\n\n if (!angular.isObject(requestConfig)) {\n throw minErr('$http')('badreq', 'Http request configuration must be an object. Received: {0}', requestConfig);\n }\n\n var config = extend({\n method: 'get',\n transformRequest: defaults.transformRequest,\n transformResponse: defaults.transformResponse,\n paramSerializer: defaults.paramSerializer\n }, requestConfig);\n\n config.headers = mergeHeaders(requestConfig);\n config.method = uppercase(config.method);\n config.paramSerializer = isString(config.paramSerializer) ?\n $injector.get(config.paramSerializer) : config.paramSerializer;\n\n var serverRequest = function(config) {\n var headers = config.headers;\n var reqData = transformData(config.data, headersGetter(headers), undefined, config.transformRequest);\n\n // strip content-type if data is undefined\n if (isUndefined(reqData)) {\n forEach(headers, function(value, header) {\n if (lowercase(header) === 'content-type') {\n delete headers[header];\n }\n });\n }\n\n if (isUndefined(config.withCredentials) && !isUndefined(defaults.withCredentials)) {\n config.withCredentials = defaults.withCredentials;\n }\n\n // send request\n return sendReq(config, reqData).then(transformResponse, transformResponse);\n };\n\n var chain = [serverRequest, undefined];\n var promise = $q.when(config);\n\n // apply interceptors\n forEach(reversedInterceptors, function(interceptor) {\n if (interceptor.request || interceptor.requestError) {\n chain.unshift(interceptor.request, interceptor.requestError);\n }\n if (interceptor.response || interceptor.responseError) {\n chain.push(interceptor.response, interceptor.responseError);\n }\n });\n\n while (chain.length) {\n var thenFn = chain.shift();\n var rejectFn = chain.shift();\n\n promise = promise.then(thenFn, rejectFn);\n }\n\n promise.success = function(fn) {\n assertArgFn(fn, 'fn');\n\n promise.then(function(response) {\n fn(response.data, response.status, response.headers, config);\n });\n return promise;\n };\n\n promise.error = function(fn) {\n assertArgFn(fn, 'fn');\n\n promise.then(null, function(response) {\n fn(response.data, response.status, response.headers, config);\n });\n return promise;\n };\n\n return promise;\n\n function transformResponse(response) {\n // make a copy since the response must be cacheable\n var resp = extend({}, response);\n if (!response.data) {\n resp.data = response.data;\n } else {\n resp.data = transformData(response.data, response.headers, response.status, config.transformResponse);\n }\n return (isSuccess(response.status))\n ? resp\n : $q.reject(resp);\n }\n\n function executeHeaderFns(headers, config) {\n var headerContent, processedHeaders = {};\n\n forEach(headers, function(headerFn, header) {\n if (isFunction(headerFn)) {\n headerContent = headerFn(config);\n if (headerContent != null) {\n processedHeaders[header] = headerContent;\n }\n } else {\n processedHeaders[header] = headerFn;\n }\n });\n\n return processedHeaders;\n }\n\n function mergeHeaders(config) {\n var defHeaders = defaults.headers,\n reqHeaders = extend({}, config.headers),\n defHeaderName, lowercaseDefHeaderName, reqHeaderName;\n\n defHeaders = extend({}, defHeaders.common, defHeaders[lowercase(config.method)]);\n\n // using for-in instead of forEach to avoid unecessary iteration after header has been found\n defaultHeadersIteration:\n for (defHeaderName in defHeaders) {\n lowercaseDefHeaderName = lowercase(defHeaderName);\n\n for (reqHeaderName in reqHeaders) {\n if (lowercase(reqHeaderName) === lowercaseDefHeaderName) {\n continue defaultHeadersIteration;\n }\n }\n\n reqHeaders[defHeaderName] = defHeaders[defHeaderName];\n }\n\n // execute if header value is a function for merged headers\n return executeHeaderFns(reqHeaders, shallowCopy(config));\n }\n }\n\n $http.pendingRequests = [];\n\n /**\n * @ngdoc method\n * @name $http#get\n *\n * @description\n * Shortcut method to perform `GET` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n\n /**\n * @ngdoc method\n * @name $http#delete\n *\n * @description\n * Shortcut method to perform `DELETE` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n\n /**\n * @ngdoc method\n * @name $http#head\n *\n * @description\n * Shortcut method to perform `HEAD` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n\n /**\n * @ngdoc method\n * @name $http#jsonp\n *\n * @description\n * Shortcut method to perform `JSONP` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request.\n * The name of the callback should be the string `JSON_CALLBACK`.\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n createShortMethods('get', 'delete', 'head', 'jsonp');\n\n /**\n * @ngdoc method\n * @name $http#post\n *\n * @description\n * Shortcut method to perform `POST` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {*} data Request content\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n\n /**\n * @ngdoc method\n * @name $http#put\n *\n * @description\n * Shortcut method to perform `PUT` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {*} data Request content\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n\n /**\n * @ngdoc method\n * @name $http#patch\n *\n * @description\n * Shortcut method to perform `PATCH` request.\n *\n * @param {string} url Relative or absolute URL specifying the destination of the request\n * @param {*} data Request content\n * @param {Object=} config Optional configuration object\n * @returns {HttpPromise} Future object\n */\n createShortMethodsWithData('post', 'put', 'patch');\n\n /**\n * @ngdoc property\n * @name $http#defaults\n *\n * @description\n * Runtime equivalent of the `$httpProvider.defaults` property. Allows configuration of\n * default headers, withCredentials as well as request and response transformations.\n *\n * See \"Setting HTTP Headers\" and \"Transforming Requests and Responses\" sections above.\n */\n $http.defaults = defaults;\n\n\n return $http;\n\n\n function createShortMethods(names) {\n forEach(arguments, function(name) {\n $http[name] = function(url, config) {\n return $http(extend({}, config || {}, {\n method: name,\n url: url\n }));\n };\n });\n }\n\n\n function createShortMethodsWithData(name) {\n forEach(arguments, function(name) {\n $http[name] = function(url, data, config) {\n return $http(extend({}, config || {}, {\n method: name,\n url: url,\n data: data\n }));\n };\n });\n }\n\n\n /**\n * Makes the request.\n *\n * !!! ACCESSES CLOSURE VARS:\n * $httpBackend, defaults, $log, $rootScope, defaultCache, $http.pendingRequests\n */\n function sendReq(config, reqData) {\n var deferred = $q.defer(),\n promise = deferred.promise,\n cache,\n cachedResp,\n reqHeaders = config.headers,\n url = buildUrl(config.url, config.paramSerializer(config.params));\n\n $http.pendingRequests.push(config);\n promise.then(removePendingReq, removePendingReq);\n\n\n if ((config.cache || defaults.cache) && config.cache !== false &&\n (config.method === 'GET' || config.method === 'JSONP')) {\n cache = isObject(config.cache) ? config.cache\n : isObject(defaults.cache) ? defaults.cache\n : defaultCache;\n }\n\n if (cache) {\n cachedResp = cache.get(url);\n if (isDefined(cachedResp)) {\n if (isPromiseLike(cachedResp)) {\n // cached request has already been sent, but there is no response yet\n cachedResp.then(resolvePromiseWithResult, resolvePromiseWithResult);\n } else {\n // serving from cache\n if (isArray(cachedResp)) {\n resolvePromise(cachedResp[1], cachedResp[0], shallowCopy(cachedResp[2]), cachedResp[3]);\n } else {\n resolvePromise(cachedResp, 200, {}, 'OK');\n }\n }\n } else {\n // put the promise for the non-transformed response into cache as a placeholder\n cache.put(url, promise);\n }\n }\n\n\n // if we won't have the response in cache, set the xsrf headers and\n // send the request to the backend\n if (isUndefined(cachedResp)) {\n var xsrfValue = urlIsSameOrigin(config.url)\n ? $$cookieReader()[config.xsrfCookieName || defaults.xsrfCookieName]\n : undefined;\n if (xsrfValue) {\n reqHeaders[(config.xsrfHeaderName || defaults.xsrfHeaderName)] = xsrfValue;\n }\n\n $httpBackend(config.method, url, reqData, done, reqHeaders, config.timeout,\n config.withCredentials, config.responseType);\n }\n\n return promise;\n\n\n /**\n * Callback registered to $httpBackend():\n * - caches the response if desired\n * - resolves the raw $http promise\n * - calls $apply\n */\n function done(status, response, headersString, statusText) {\n if (cache) {\n if (isSuccess(status)) {\n cache.put(url, [status, response, parseHeaders(headersString), statusText]);\n } else {\n // remove promise from the cache\n cache.remove(url);\n }\n }\n\n function resolveHttpPromise() {\n resolvePromise(response, status, headersString, statusText);\n }\n\n if (useApplyAsync) {\n $rootScope.$applyAsync(resolveHttpPromise);\n } else {\n resolveHttpPromise();\n if (!$rootScope.$$phase) $rootScope.$apply();\n }\n }\n\n\n /**\n * Resolves the raw $http promise.\n */\n function resolvePromise(response, status, headers, statusText) {\n // normalize internal statuses to 0\n status = Math.max(status, 0);\n\n (isSuccess(status) ? deferred.resolve : deferred.reject)({\n data: response,\n status: status,\n headers: headersGetter(headers),\n config: config,\n statusText: statusText\n });\n }\n\n function resolvePromiseWithResult(result) {\n resolvePromise(result.data, result.status, shallowCopy(result.headers()), result.statusText);\n }\n\n function removePendingReq() {\n var idx = $http.pendingRequests.indexOf(config);\n if (idx !== -1) $http.pendingRequests.splice(idx, 1);\n }\n }\n\n\n function buildUrl(url, serializedParams) {\n if (serializedParams.length > 0) {\n url += ((url.indexOf('?') == -1) ? '?' : '&') + serializedParams;\n }\n return url;\n }\n }];\n}\n\nfunction createXhr() {\n return new window.XMLHttpRequest();\n}\n\n/**\n * @ngdoc service\n * @name $httpBackend\n * @requires $window\n * @requires $document\n *\n * @description\n * HTTP backend used by the {@link ng.$http service} that delegates to\n * XMLHttpRequest object or JSONP and deals with browser incompatibilities.\n *\n * You should never need to use this service directly, instead use the higher-level abstractions:\n * {@link ng.$http $http} or {@link ngResource.$resource $resource}.\n *\n * During testing this implementation is swapped with {@link ngMock.$httpBackend mock\n * $httpBackend} which can be trained with responses.\n */\nfunction $HttpBackendProvider() {\n this.$get = ['$browser', '$window', '$document', function($browser, $window, $document) {\n return createHttpBackend($browser, createXhr, $browser.defer, $window.angular.callbacks, $document[0]);\n }];\n}\n\nfunction createHttpBackend($browser, createXhr, $browserDefer, callbacks, rawDocument) {\n // TODO(vojta): fix the signature\n return function(method, url, post, callback, headers, timeout, withCredentials, responseType) {\n $browser.$$incOutstandingRequestCount();\n url = url || $browser.url();\n\n if (lowercase(method) == 'jsonp') {\n var callbackId = '_' + (callbacks.counter++).toString(36);\n callbacks[callbackId] = function(data) {\n callbacks[callbackId].data = data;\n callbacks[callbackId].called = true;\n };\n\n var jsonpDone = jsonpReq(url.replace('JSON_CALLBACK', 'angular.callbacks.' + callbackId),\n callbackId, function(status, text) {\n completeRequest(callback, status, callbacks[callbackId].data, \"\", text);\n callbacks[callbackId] = noop;\n });\n } else {\n\n var xhr = createXhr();\n\n xhr.open(method, url, true);\n forEach(headers, function(value, key) {\n if (isDefined(value)) {\n xhr.setRequestHeader(key, value);\n }\n });\n\n xhr.onload = function requestLoaded() {\n var statusText = xhr.statusText || '';\n\n // responseText is the old-school way of retrieving response (supported by IE8 & 9)\n // response/responseType properties were introduced in XHR Level2 spec (supported by IE10)\n var response = ('response' in xhr) ? xhr.response : xhr.responseText;\n\n // normalize IE9 bug (http://bugs.jquery.com/ticket/1450)\n var status = xhr.status === 1223 ? 204 : xhr.status;\n\n // fix status code when it is 0 (0 status is undocumented).\n // Occurs when accessing file resources or on Android 4.1 stock browser\n // while retrieving files from application cache.\n if (status === 0) {\n status = response ? 200 : urlResolve(url).protocol == 'file' ? 404 : 0;\n }\n\n completeRequest(callback,\n status,\n response,\n xhr.getAllResponseHeaders(),\n statusText);\n };\n\n var requestError = function() {\n // The response is always empty\n // See https://xhr.spec.whatwg.org/#request-error-steps and https://fetch.spec.whatwg.org/#concept-network-error\n completeRequest(callback, -1, null, null, '');\n };\n\n xhr.onerror = requestError;\n xhr.onabort = requestError;\n\n if (withCredentials) {\n xhr.withCredentials = true;\n }\n\n if (responseType) {\n try {\n xhr.responseType = responseType;\n } catch (e) {\n // WebKit added support for the json responseType value on 09/03/2013\n // https://bugs.webkit.org/show_bug.cgi?id=73648. Versions of Safari prior to 7 are\n // known to throw when setting the value \"json\" as the response type. Other older\n // browsers implementing the responseType\n //\n // The json response type can be ignored if not supported, because JSON payloads are\n // parsed on the client-side regardless.\n if (responseType !== 'json') {\n throw e;\n }\n }\n }\n\n xhr.send(post);\n }\n\n if (timeout > 0) {\n var timeoutId = $browserDefer(timeoutRequest, timeout);\n } else if (isPromiseLike(timeout)) {\n timeout.then(timeoutRequest);\n }\n\n\n function timeoutRequest() {\n jsonpDone && jsonpDone();\n xhr && xhr.abort();\n }\n\n function completeRequest(callback, status, response, headersString, statusText) {\n // cancel timeout and subsequent timeout promise resolution\n if (timeoutId !== undefined) {\n $browserDefer.cancel(timeoutId);\n }\n jsonpDone = xhr = null;\n\n callback(status, response, headersString, statusText);\n $browser.$$completeOutstandingRequest(noop);\n }\n };\n\n function jsonpReq(url, callbackId, done) {\n // we can't use jQuery/jqLite here because jQuery does crazy stuff with script elements, e.g.:\n // - fetches local scripts via XHR and evals them\n // - adds and immediately removes script elements from the document\n var script = rawDocument.createElement('script'), callback = null;\n script.type = \"text/javascript\";\n script.src = url;\n script.async = true;\n\n callback = function(event) {\n removeEventListenerFn(script, \"load\", callback);\n removeEventListenerFn(script, \"error\", callback);\n rawDocument.body.removeChild(script);\n script = null;\n var status = -1;\n var text = \"unknown\";\n\n if (event) {\n if (event.type === \"load\" && !callbacks[callbackId].called) {\n event = { type: \"error\" };\n }\n text = event.type;\n status = event.type === \"error\" ? 404 : 200;\n }\n\n if (done) {\n done(status, text);\n }\n };\n\n addEventListenerFn(script, \"load\", callback);\n addEventListenerFn(script, \"error\", callback);\n rawDocument.body.appendChild(script);\n return callback;\n }\n}\n\nvar $interpolateMinErr = angular.$interpolateMinErr = minErr('$interpolate');\n$interpolateMinErr.throwNoconcat = function(text) {\n throw $interpolateMinErr('noconcat',\n \"Error while interpolating: {0}\\nStrict Contextual Escaping disallows \" +\n \"interpolations that concatenate multiple expressions when a trusted value is \" +\n \"required. See http://docs.angularjs.org/api/ng.$sce\", text);\n};\n\n$interpolateMinErr.interr = function(text, err) {\n return $interpolateMinErr('interr', \"Can't interpolate: {0}\\n{1}\", text, err.toString());\n};\n\n/**\n * @ngdoc provider\n * @name $interpolateProvider\n *\n * @description\n *\n * Used for configuring the interpolation markup. Defaults to `{{` and `}}`.\n *\n * @example\n\n\n\n
    \n //demo.label//\n
    \n
    \n\n it('should interpolate binding with custom symbols', function() {\n expect(element(by.binding('demo.label')).getText()).toBe('This binding is brought you by // interpolation symbols.');\n });\n\n
    \n */\nfunction $InterpolateProvider() {\n var startSymbol = '{{';\n var endSymbol = '}}';\n\n /**\n * @ngdoc method\n * @name $interpolateProvider#startSymbol\n * @description\n * Symbol to denote start of expression in the interpolated string. Defaults to `{{`.\n *\n * @param {string=} value new value to set the starting symbol to.\n * @returns {string|self} Returns the symbol when used as getter and self if used as setter.\n */\n this.startSymbol = function(value) {\n if (value) {\n startSymbol = value;\n return this;\n } else {\n return startSymbol;\n }\n };\n\n /**\n * @ngdoc method\n * @name $interpolateProvider#endSymbol\n * @description\n * Symbol to denote the end of expression in the interpolated string. Defaults to `}}`.\n *\n * @param {string=} value new value to set the ending symbol to.\n * @returns {string|self} Returns the symbol when used as getter and self if used as setter.\n */\n this.endSymbol = function(value) {\n if (value) {\n endSymbol = value;\n return this;\n } else {\n return endSymbol;\n }\n };\n\n\n this.$get = ['$parse', '$exceptionHandler', '$sce', function($parse, $exceptionHandler, $sce) {\n var startSymbolLength = startSymbol.length,\n endSymbolLength = endSymbol.length,\n escapedStartRegexp = new RegExp(startSymbol.replace(/./g, escape), 'g'),\n escapedEndRegexp = new RegExp(endSymbol.replace(/./g, escape), 'g');\n\n function escape(ch) {\n return '\\\\\\\\\\\\' + ch;\n }\n\n function unescapeText(text) {\n return text.replace(escapedStartRegexp, startSymbol).\n replace(escapedEndRegexp, endSymbol);\n }\n\n function stringify(value) {\n if (value == null) { // null || undefined\n return '';\n }\n switch (typeof value) {\n case 'string':\n break;\n case 'number':\n value = '' + value;\n break;\n default:\n value = toJson(value);\n }\n\n return value;\n }\n\n /**\n * @ngdoc service\n * @name $interpolate\n * @kind function\n *\n * @requires $parse\n * @requires $sce\n *\n * @description\n *\n * Compiles a string with markup into an interpolation function. This service is used by the\n * HTML {@link ng.$compile $compile} service for data binding. See\n * {@link ng.$interpolateProvider $interpolateProvider} for configuring the\n * interpolation markup.\n *\n *\n * ```js\n * var $interpolate = ...; // injected\n * var exp = $interpolate('Hello {{name | uppercase}}!');\n * expect(exp({name:'Angular'}).toEqual('Hello ANGULAR!');\n * ```\n *\n * `$interpolate` takes an optional fourth argument, `allOrNothing`. If `allOrNothing` is\n * `true`, the interpolation function will return `undefined` unless all embedded expressions\n * evaluate to a value other than `undefined`.\n *\n * ```js\n * var $interpolate = ...; // injected\n * var context = {greeting: 'Hello', name: undefined };\n *\n * // default \"forgiving\" mode\n * var exp = $interpolate('{{greeting}} {{name}}!');\n * expect(exp(context)).toEqual('Hello !');\n *\n * // \"allOrNothing\" mode\n * exp = $interpolate('{{greeting}} {{name}}!', false, null, true);\n * expect(exp(context)).toBeUndefined();\n * context.name = 'Angular';\n * expect(exp(context)).toEqual('Hello Angular!');\n * ```\n *\n * `allOrNothing` is useful for interpolating URLs. `ngSrc` and `ngSrcset` use this behavior.\n *\n * ####Escaped Interpolation\n * $interpolate provides a mechanism for escaping interpolation markers. Start and end markers\n * can be escaped by preceding each of their characters with a REVERSE SOLIDUS U+005C (backslash).\n * It will be rendered as a regular start/end marker, and will not be interpreted as an expression\n * or binding.\n *\n * This enables web-servers to prevent script injection attacks and defacing attacks, to some\n * degree, while also enabling code examples to work without relying on the\n * {@link ng.directive:ngNonBindable ngNonBindable} directive.\n *\n * **For security purposes, it is strongly encouraged that web servers escape user-supplied data,\n * replacing angle brackets (<, >) with &lt; and &gt; respectively, and replacing all\n * interpolation start/end markers with their escaped counterparts.**\n *\n * Escaped interpolation markers are only replaced with the actual interpolation markers in rendered\n * output when the $interpolate service processes the text. So, for HTML elements interpolated\n * by {@link ng.$compile $compile}, or otherwise interpolated with the `mustHaveExpression` parameter\n * set to `true`, the interpolated text must contain an unescaped interpolation expression. As such,\n * this is typically useful only when user-data is used in rendering a template from the server, or\n * when otherwise untrusted data is used by a directive.\n *\n * \n * \n *
    \n *

    {{apptitle}}: \\{\\{ username = \"defaced value\"; \\}\\}\n *

    \n *

    {{username}} attempts to inject code which will deface the\n * application, but fails to accomplish their task, because the server has correctly\n * escaped the interpolation start/end markers with REVERSE SOLIDUS U+005C (backslash)\n * characters.

    \n *

    Instead, the result of the attempted script injection is visible, and can be removed\n * from the database by an administrator.

    \n *
    \n *
    \n *
    \n *\n * @param {string} text The text with markup to interpolate.\n * @param {boolean=} mustHaveExpression if set to true then the interpolation string must have\n * embedded expression in order to return an interpolation function. Strings with no\n * embedded expression will return null for the interpolation function.\n * @param {string=} trustedContext when provided, the returned function passes the interpolated\n * result through {@link ng.$sce#getTrusted $sce.getTrusted(interpolatedResult,\n * trustedContext)} before returning it. Refer to the {@link ng.$sce $sce} service that\n * provides Strict Contextual Escaping for details.\n * @param {boolean=} allOrNothing if `true`, then the returned function returns undefined\n * unless all embedded expressions evaluate to a value other than `undefined`.\n * @returns {function(context)} an interpolation function which is used to compute the\n * interpolated string. The function has these parameters:\n *\n * - `context`: evaluation context for all expressions embedded in the interpolated text\n */\n function $interpolate(text, mustHaveExpression, trustedContext, allOrNothing) {\n allOrNothing = !!allOrNothing;\n var startIndex,\n endIndex,\n index = 0,\n expressions = [],\n parseFns = [],\n textLength = text.length,\n exp,\n concat = [],\n expressionPositions = [];\n\n while (index < textLength) {\n if (((startIndex = text.indexOf(startSymbol, index)) != -1) &&\n ((endIndex = text.indexOf(endSymbol, startIndex + startSymbolLength)) != -1)) {\n if (index !== startIndex) {\n concat.push(unescapeText(text.substring(index, startIndex)));\n }\n exp = text.substring(startIndex + startSymbolLength, endIndex);\n expressions.push(exp);\n parseFns.push($parse(exp, parseStringifyInterceptor));\n index = endIndex + endSymbolLength;\n expressionPositions.push(concat.length);\n concat.push('');\n } else {\n // we did not find an interpolation, so we have to add the remainder to the separators array\n if (index !== textLength) {\n concat.push(unescapeText(text.substring(index)));\n }\n break;\n }\n }\n\n // Concatenating expressions makes it hard to reason about whether some combination of\n // concatenated values are unsafe to use and could easily lead to XSS. By requiring that a\n // single expression be used for iframe[src], object[src], etc., we ensure that the value\n // that's used is assigned or constructed by some JS code somewhere that is more testable or\n // make it obvious that you bound the value to some user controlled value. This helps reduce\n // the load when auditing for XSS issues.\n if (trustedContext && concat.length > 1) {\n $interpolateMinErr.throwNoconcat(text);\n }\n\n if (!mustHaveExpression || expressions.length) {\n var compute = function(values) {\n for (var i = 0, ii = expressions.length; i < ii; i++) {\n if (allOrNothing && isUndefined(values[i])) return;\n concat[expressionPositions[i]] = values[i];\n }\n return concat.join('');\n };\n\n var getValue = function(value) {\n return trustedContext ?\n $sce.getTrusted(trustedContext, value) :\n $sce.valueOf(value);\n };\n\n return extend(function interpolationFn(context) {\n var i = 0;\n var ii = expressions.length;\n var values = new Array(ii);\n\n try {\n for (; i < ii; i++) {\n values[i] = parseFns[i](context);\n }\n\n return compute(values);\n } catch (err) {\n $exceptionHandler($interpolateMinErr.interr(text, err));\n }\n\n }, {\n // all of these properties are undocumented for now\n exp: text, //just for compatibility with regular watchers created via $watch\n expressions: expressions,\n $$watchDelegate: function(scope, listener) {\n var lastValue;\n return scope.$watchGroup(parseFns, function interpolateFnWatcher(values, oldValues) {\n var currValue = compute(values);\n if (isFunction(listener)) {\n listener.call(this, currValue, values !== oldValues ? lastValue : currValue, scope);\n }\n lastValue = currValue;\n });\n }\n });\n }\n\n function parseStringifyInterceptor(value) {\n try {\n value = getValue(value);\n return allOrNothing && !isDefined(value) ? value : stringify(value);\n } catch (err) {\n $exceptionHandler($interpolateMinErr.interr(text, err));\n }\n }\n }\n\n\n /**\n * @ngdoc method\n * @name $interpolate#startSymbol\n * @description\n * Symbol to denote the start of expression in the interpolated string. Defaults to `{{`.\n *\n * Use {@link ng.$interpolateProvider#startSymbol `$interpolateProvider.startSymbol`} to change\n * the symbol.\n *\n * @returns {string} start symbol.\n */\n $interpolate.startSymbol = function() {\n return startSymbol;\n };\n\n\n /**\n * @ngdoc method\n * @name $interpolate#endSymbol\n * @description\n * Symbol to denote the end of expression in the interpolated string. Defaults to `}}`.\n *\n * Use {@link ng.$interpolateProvider#endSymbol `$interpolateProvider.endSymbol`} to change\n * the symbol.\n *\n * @returns {string} end symbol.\n */\n $interpolate.endSymbol = function() {\n return endSymbol;\n };\n\n return $interpolate;\n }];\n}\n\nfunction $IntervalProvider() {\n this.$get = ['$rootScope', '$window', '$q', '$$q',\n function($rootScope, $window, $q, $$q) {\n var intervals = {};\n\n\n /**\n * @ngdoc service\n * @name $interval\n *\n * @description\n * Angular's wrapper for `window.setInterval`. The `fn` function is executed every `delay`\n * milliseconds.\n *\n * The return value of registering an interval function is a promise. This promise will be\n * notified upon each tick of the interval, and will be resolved after `count` iterations, or\n * run indefinitely if `count` is not defined. The value of the notification will be the\n * number of iterations that have run.\n * To cancel an interval, call `$interval.cancel(promise)`.\n *\n * In tests you can use {@link ngMock.$interval#flush `$interval.flush(millis)`} to\n * move forward by `millis` milliseconds and trigger any functions scheduled to run in that\n * time.\n *\n *
    \n * **Note**: Intervals created by this service must be explicitly destroyed when you are finished\n * with them. In particular they are not automatically destroyed when a controller's scope or a\n * directive's element are destroyed.\n * You should take this into consideration and make sure to always cancel the interval at the\n * appropriate moment. See the example below for more details on how and when to do this.\n *
    \n *\n * @param {function()} fn A function that should be called repeatedly.\n * @param {number} delay Number of milliseconds between each function call.\n * @param {number=} [count=0] Number of times to repeat. If not set, or 0, will repeat\n * indefinitely.\n * @param {boolean=} [invokeApply=true] If set to `false` skips model dirty checking, otherwise\n * will invoke `fn` within the {@link ng.$rootScope.Scope#$apply $apply} block.\n * @param {...*=} Pass additional parameters to the executed function.\n * @returns {promise} A promise which will be notified on each iteration.\n *\n * @example\n * \n * \n * \n *\n *
    \n *
    \n *
    \n * Current time is: \n *
    \n * Blood 1 : {{blood_1}}\n * Blood 2 : {{blood_2}}\n * \n * \n * \n *
    \n *
    \n *\n *
    \n *
    \n */\n function interval(fn, delay, count, invokeApply) {\n var hasParams = arguments.length > 4,\n args = hasParams ? sliceArgs(arguments, 4) : [],\n setInterval = $window.setInterval,\n clearInterval = $window.clearInterval,\n iteration = 0,\n skipApply = (isDefined(invokeApply) && !invokeApply),\n deferred = (skipApply ? $$q : $q).defer(),\n promise = deferred.promise;\n\n count = isDefined(count) ? count : 0;\n\n promise.then(null, null, (!hasParams) ? fn : function() {\n fn.apply(null, args);\n });\n\n promise.$$intervalId = setInterval(function tick() {\n deferred.notify(iteration++);\n\n if (count > 0 && iteration >= count) {\n deferred.resolve(iteration);\n clearInterval(promise.$$intervalId);\n delete intervals[promise.$$intervalId];\n }\n\n if (!skipApply) $rootScope.$apply();\n\n }, delay);\n\n intervals[promise.$$intervalId] = deferred;\n\n return promise;\n }\n\n\n /**\n * @ngdoc method\n * @name $interval#cancel\n *\n * @description\n * Cancels a task associated with the `promise`.\n *\n * @param {promise} promise returned by the `$interval` function.\n * @returns {boolean} Returns `true` if the task was successfully canceled.\n */\n interval.cancel = function(promise) {\n if (promise && promise.$$intervalId in intervals) {\n intervals[promise.$$intervalId].reject('canceled');\n $window.clearInterval(promise.$$intervalId);\n delete intervals[promise.$$intervalId];\n return true;\n }\n return false;\n };\n\n return interval;\n }];\n}\n\n/**\n * @ngdoc service\n * @name $locale\n *\n * @description\n * $locale service provides localization rules for various Angular components. As of right now the\n * only public api is:\n *\n * * `id` – `{string}` – locale id formatted as `languageId-countryId` (e.g. `en-us`)\n */\nfunction $LocaleProvider() {\n this.$get = function() {\n return {\n id: 'en-us',\n\n NUMBER_FORMATS: {\n DECIMAL_SEP: '.',\n GROUP_SEP: ',',\n PATTERNS: [\n { // Decimal Pattern\n minInt: 1,\n minFrac: 0,\n maxFrac: 3,\n posPre: '',\n posSuf: '',\n negPre: '-',\n negSuf: '',\n gSize: 3,\n lgSize: 3\n },{ //Currency Pattern\n minInt: 1,\n minFrac: 2,\n maxFrac: 2,\n posPre: '\\u00A4',\n posSuf: '',\n negPre: '(\\u00A4',\n negSuf: ')',\n gSize: 3,\n lgSize: 3\n }\n ],\n CURRENCY_SYM: '$'\n },\n\n DATETIME_FORMATS: {\n MONTH:\n 'January,February,March,April,May,June,July,August,September,October,November,December'\n .split(','),\n SHORTMONTH: 'Jan,Feb,Mar,Apr,May,Jun,Jul,Aug,Sep,Oct,Nov,Dec'.split(','),\n DAY: 'Sunday,Monday,Tuesday,Wednesday,Thursday,Friday,Saturday'.split(','),\n SHORTDAY: 'Sun,Mon,Tue,Wed,Thu,Fri,Sat'.split(','),\n AMPMS: ['AM','PM'],\n medium: 'MMM d, y h:mm:ss a',\n 'short': 'M/d/yy h:mm a',\n fullDate: 'EEEE, MMMM d, y',\n longDate: 'MMMM d, y',\n mediumDate: 'MMM d, y',\n shortDate: 'M/d/yy',\n mediumTime: 'h:mm:ss a',\n shortTime: 'h:mm a',\n ERANAMES: [\n \"Before Christ\",\n \"Anno Domini\"\n ],\n ERAS: [\n \"BC\",\n \"AD\"\n ]\n },\n\n pluralCat: function(num) {\n if (num === 1) {\n return 'one';\n }\n return 'other';\n }\n };\n };\n}\n\nvar PATH_MATCH = /^([^\\?#]*)(\\?([^#]*))?(#(.*))?$/,\n DEFAULT_PORTS = {'http': 80, 'https': 443, 'ftp': 21};\nvar $locationMinErr = minErr('$location');\n\n\n/**\n * Encode path using encodeUriSegment, ignoring forward slashes\n *\n * @param {string} path Path to encode\n * @returns {string}\n */\nfunction encodePath(path) {\n var segments = path.split('/'),\n i = segments.length;\n\n while (i--) {\n segments[i] = encodeUriSegment(segments[i]);\n }\n\n return segments.join('/');\n}\n\nfunction parseAbsoluteUrl(absoluteUrl, locationObj) {\n var parsedUrl = urlResolve(absoluteUrl);\n\n locationObj.$$protocol = parsedUrl.protocol;\n locationObj.$$host = parsedUrl.hostname;\n locationObj.$$port = toInt(parsedUrl.port) || DEFAULT_PORTS[parsedUrl.protocol] || null;\n}\n\n\nfunction parseAppUrl(relativeUrl, locationObj) {\n var prefixed = (relativeUrl.charAt(0) !== '/');\n if (prefixed) {\n relativeUrl = '/' + relativeUrl;\n }\n var match = urlResolve(relativeUrl);\n locationObj.$$path = decodeURIComponent(prefixed && match.pathname.charAt(0) === '/' ?\n match.pathname.substring(1) : match.pathname);\n locationObj.$$search = parseKeyValue(match.search);\n locationObj.$$hash = decodeURIComponent(match.hash);\n\n // make sure path starts with '/';\n if (locationObj.$$path && locationObj.$$path.charAt(0) != '/') {\n locationObj.$$path = '/' + locationObj.$$path;\n }\n}\n\n\n/**\n *\n * @param {string} begin\n * @param {string} whole\n * @returns {string} returns text from whole after begin or undefined if it does not begin with\n * expected string.\n */\nfunction beginsWith(begin, whole) {\n if (whole.indexOf(begin) === 0) {\n return whole.substr(begin.length);\n }\n}\n\n\nfunction stripHash(url) {\n var index = url.indexOf('#');\n return index == -1 ? url : url.substr(0, index);\n}\n\nfunction trimEmptyHash(url) {\n return url.replace(/(#.+)|#$/, '$1');\n}\n\n\nfunction stripFile(url) {\n return url.substr(0, stripHash(url).lastIndexOf('/') + 1);\n}\n\n/* return the server only (scheme://host:port) */\nfunction serverBase(url) {\n return url.substring(0, url.indexOf('/', url.indexOf('//') + 2));\n}\n\n\n/**\n * LocationHtml5Url represents an url\n * This object is exposed as $location service when HTML5 mode is enabled and supported\n *\n * @constructor\n * @param {string} appBase application base URL\n * @param {string} basePrefix url path prefix\n */\nfunction LocationHtml5Url(appBase, basePrefix) {\n this.$$html5 = true;\n basePrefix = basePrefix || '';\n var appBaseNoFile = stripFile(appBase);\n parseAbsoluteUrl(appBase, this);\n\n\n /**\n * Parse given html5 (regular) url string into properties\n * @param {string} url HTML5 url\n * @private\n */\n this.$$parse = function(url) {\n var pathUrl = beginsWith(appBaseNoFile, url);\n if (!isString(pathUrl)) {\n throw $locationMinErr('ipthprfx', 'Invalid url \"{0}\", missing path prefix \"{1}\".', url,\n appBaseNoFile);\n }\n\n parseAppUrl(pathUrl, this);\n\n if (!this.$$path) {\n this.$$path = '/';\n }\n\n this.$$compose();\n };\n\n /**\n * Compose url and update `absUrl` property\n * @private\n */\n this.$$compose = function() {\n var search = toKeyValue(this.$$search),\n hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : '';\n\n this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash;\n this.$$absUrl = appBaseNoFile + this.$$url.substr(1); // first char is always '/'\n };\n\n this.$$parseLinkUrl = function(url, relHref) {\n if (relHref && relHref[0] === '#') {\n // special case for links to hash fragments:\n // keep the old url and only replace the hash fragment\n this.hash(relHref.slice(1));\n return true;\n }\n var appUrl, prevAppUrl;\n var rewrittenUrl;\n\n if ((appUrl = beginsWith(appBase, url)) !== undefined) {\n prevAppUrl = appUrl;\n if ((appUrl = beginsWith(basePrefix, appUrl)) !== undefined) {\n rewrittenUrl = appBaseNoFile + (beginsWith('/', appUrl) || appUrl);\n } else {\n rewrittenUrl = appBase + prevAppUrl;\n }\n } else if ((appUrl = beginsWith(appBaseNoFile, url)) !== undefined) {\n rewrittenUrl = appBaseNoFile + appUrl;\n } else if (appBaseNoFile == url + '/') {\n rewrittenUrl = appBaseNoFile;\n }\n if (rewrittenUrl) {\n this.$$parse(rewrittenUrl);\n }\n return !!rewrittenUrl;\n };\n}\n\n\n/**\n * LocationHashbangUrl represents url\n * This object is exposed as $location service when developer doesn't opt into html5 mode.\n * It also serves as the base class for html5 mode fallback on legacy browsers.\n *\n * @constructor\n * @param {string} appBase application base URL\n * @param {string} hashPrefix hashbang prefix\n */\nfunction LocationHashbangUrl(appBase, hashPrefix) {\n var appBaseNoFile = stripFile(appBase);\n\n parseAbsoluteUrl(appBase, this);\n\n\n /**\n * Parse given hashbang url into properties\n * @param {string} url Hashbang url\n * @private\n */\n this.$$parse = function(url) {\n var withoutBaseUrl = beginsWith(appBase, url) || beginsWith(appBaseNoFile, url);\n var withoutHashUrl;\n\n if (!isUndefined(withoutBaseUrl) && withoutBaseUrl.charAt(0) === '#') {\n\n // The rest of the url starts with a hash so we have\n // got either a hashbang path or a plain hash fragment\n withoutHashUrl = beginsWith(hashPrefix, withoutBaseUrl);\n if (isUndefined(withoutHashUrl)) {\n // There was no hashbang prefix so we just have a hash fragment\n withoutHashUrl = withoutBaseUrl;\n }\n\n } else {\n // There was no hashbang path nor hash fragment:\n // If we are in HTML5 mode we use what is left as the path;\n // Otherwise we ignore what is left\n if (this.$$html5) {\n withoutHashUrl = withoutBaseUrl;\n } else {\n withoutHashUrl = '';\n if (isUndefined(withoutBaseUrl)) {\n appBase = url;\n this.replace();\n }\n }\n }\n\n parseAppUrl(withoutHashUrl, this);\n\n this.$$path = removeWindowsDriveName(this.$$path, withoutHashUrl, appBase);\n\n this.$$compose();\n\n /*\n * In Windows, on an anchor node on documents loaded from\n * the filesystem, the browser will return a pathname\n * prefixed with the drive name ('/C:/path') when a\n * pathname without a drive is set:\n * * a.setAttribute('href', '/foo')\n * * a.pathname === '/C:/foo' //true\n *\n * Inside of Angular, we're always using pathnames that\n * do not include drive names for routing.\n */\n function removeWindowsDriveName(path, url, base) {\n /*\n Matches paths for file protocol on windows,\n such as /C:/foo/bar, and captures only /foo/bar.\n */\n var windowsFilePathExp = /^\\/[A-Z]:(\\/.*)/;\n\n var firstPathSegmentMatch;\n\n //Get the relative path from the input URL.\n if (url.indexOf(base) === 0) {\n url = url.replace(base, '');\n }\n\n // The input URL intentionally contains a first path segment that ends with a colon.\n if (windowsFilePathExp.exec(url)) {\n return path;\n }\n\n firstPathSegmentMatch = windowsFilePathExp.exec(path);\n return firstPathSegmentMatch ? firstPathSegmentMatch[1] : path;\n }\n };\n\n /**\n * Compose hashbang url and update `absUrl` property\n * @private\n */\n this.$$compose = function() {\n var search = toKeyValue(this.$$search),\n hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : '';\n\n this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash;\n this.$$absUrl = appBase + (this.$$url ? hashPrefix + this.$$url : '');\n };\n\n this.$$parseLinkUrl = function(url, relHref) {\n if (stripHash(appBase) == stripHash(url)) {\n this.$$parse(url);\n return true;\n }\n return false;\n };\n}\n\n\n/**\n * LocationHashbangUrl represents url\n * This object is exposed as $location service when html5 history api is enabled but the browser\n * does not support it.\n *\n * @constructor\n * @param {string} appBase application base URL\n * @param {string} hashPrefix hashbang prefix\n */\nfunction LocationHashbangInHtml5Url(appBase, hashPrefix) {\n this.$$html5 = true;\n LocationHashbangUrl.apply(this, arguments);\n\n var appBaseNoFile = stripFile(appBase);\n\n this.$$parseLinkUrl = function(url, relHref) {\n if (relHref && relHref[0] === '#') {\n // special case for links to hash fragments:\n // keep the old url and only replace the hash fragment\n this.hash(relHref.slice(1));\n return true;\n }\n\n var rewrittenUrl;\n var appUrl;\n\n if (appBase == stripHash(url)) {\n rewrittenUrl = url;\n } else if ((appUrl = beginsWith(appBaseNoFile, url))) {\n rewrittenUrl = appBase + hashPrefix + appUrl;\n } else if (appBaseNoFile === url + '/') {\n rewrittenUrl = appBaseNoFile;\n }\n if (rewrittenUrl) {\n this.$$parse(rewrittenUrl);\n }\n return !!rewrittenUrl;\n };\n\n this.$$compose = function() {\n var search = toKeyValue(this.$$search),\n hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : '';\n\n this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash;\n // include hashPrefix in $$absUrl when $$url is empty so IE8 & 9 do not reload page because of removal of '#'\n this.$$absUrl = appBase + hashPrefix + this.$$url;\n };\n\n}\n\n\nvar locationPrototype = {\n\n /**\n * Are we in html5 mode?\n * @private\n */\n $$html5: false,\n\n /**\n * Has any change been replacing?\n * @private\n */\n $$replace: false,\n\n /**\n * @ngdoc method\n * @name $location#absUrl\n *\n * @description\n * This method is getter only.\n *\n * Return full url representation with all segments encoded according to rules specified in\n * [RFC 3986](http://www.ietf.org/rfc/rfc3986.txt).\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var absUrl = $location.absUrl();\n * // => \"http://example.com/#/some/path?foo=bar&baz=xoxo\"\n * ```\n *\n * @return {string} full url\n */\n absUrl: locationGetter('$$absUrl'),\n\n /**\n * @ngdoc method\n * @name $location#url\n *\n * @description\n * This method is getter / setter.\n *\n * Return url (e.g. `/path?a=b#hash`) when called without any parameter.\n *\n * Change path, search and hash, when called with parameter and return `$location`.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var url = $location.url();\n * // => \"/some/path?foo=bar&baz=xoxo\"\n * ```\n *\n * @param {string=} url New url without base prefix (e.g. `/path?a=b#hash`)\n * @return {string} url\n */\n url: function(url) {\n if (isUndefined(url)) {\n return this.$$url;\n }\n\n var match = PATH_MATCH.exec(url);\n if (match[1] || url === '') this.path(decodeURIComponent(match[1]));\n if (match[2] || match[1] || url === '') this.search(match[3] || '');\n this.hash(match[5] || '');\n\n return this;\n },\n\n /**\n * @ngdoc method\n * @name $location#protocol\n *\n * @description\n * This method is getter only.\n *\n * Return protocol of current url.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var protocol = $location.protocol();\n * // => \"http\"\n * ```\n *\n * @return {string} protocol of current url\n */\n protocol: locationGetter('$$protocol'),\n\n /**\n * @ngdoc method\n * @name $location#host\n *\n * @description\n * This method is getter only.\n *\n * Return host of current url.\n *\n * Note: compared to the non-angular version `location.host` which returns `hostname:port`, this returns the `hostname` portion only.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var host = $location.host();\n * // => \"example.com\"\n *\n * // given url http://user:password@example.com:8080/#/some/path?foo=bar&baz=xoxo\n * host = $location.host();\n * // => \"example.com\"\n * host = location.host;\n * // => \"example.com:8080\"\n * ```\n *\n * @return {string} host of current url.\n */\n host: locationGetter('$$host'),\n\n /**\n * @ngdoc method\n * @name $location#port\n *\n * @description\n * This method is getter only.\n *\n * Return port of current url.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var port = $location.port();\n * // => 80\n * ```\n *\n * @return {Number} port\n */\n port: locationGetter('$$port'),\n\n /**\n * @ngdoc method\n * @name $location#path\n *\n * @description\n * This method is getter / setter.\n *\n * Return path of current url when called without any parameter.\n *\n * Change path when called with parameter and return `$location`.\n *\n * Note: Path should always begin with forward slash (/), this method will add the forward slash\n * if it is missing.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var path = $location.path();\n * // => \"/some/path\"\n * ```\n *\n * @param {(string|number)=} path New path\n * @return {string} path\n */\n path: locationGetterSetter('$$path', function(path) {\n path = path !== null ? path.toString() : '';\n return path.charAt(0) == '/' ? path : '/' + path;\n }),\n\n /**\n * @ngdoc method\n * @name $location#search\n *\n * @description\n * This method is getter / setter.\n *\n * Return search part (as object) of current url when called without any parameter.\n *\n * Change search part when called with parameter and return `$location`.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo\n * var searchObject = $location.search();\n * // => {foo: 'bar', baz: 'xoxo'}\n *\n * // set foo to 'yipee'\n * $location.search('foo', 'yipee');\n * // $location.search() => {foo: 'yipee', baz: 'xoxo'}\n * ```\n *\n * @param {string|Object.|Object.>} search New search params - string or\n * hash object.\n *\n * When called with a single argument the method acts as a setter, setting the `search` component\n * of `$location` to the specified value.\n *\n * If the argument is a hash object containing an array of values, these values will be encoded\n * as duplicate search parameters in the url.\n *\n * @param {(string|Number|Array|boolean)=} paramValue If `search` is a string or number, then `paramValue`\n * will override only a single search property.\n *\n * If `paramValue` is an array, it will override the property of the `search` component of\n * `$location` specified via the first argument.\n *\n * If `paramValue` is `null`, the property specified via the first argument will be deleted.\n *\n * If `paramValue` is `true`, the property specified via the first argument will be added with no\n * value nor trailing equal sign.\n *\n * @return {Object} If called with no arguments returns the parsed `search` object. If called with\n * one or more arguments returns `$location` object itself.\n */\n search: function(search, paramValue) {\n switch (arguments.length) {\n case 0:\n return this.$$search;\n case 1:\n if (isString(search) || isNumber(search)) {\n search = search.toString();\n this.$$search = parseKeyValue(search);\n } else if (isObject(search)) {\n search = copy(search, {});\n // remove object undefined or null properties\n forEach(search, function(value, key) {\n if (value == null) delete search[key];\n });\n\n this.$$search = search;\n } else {\n throw $locationMinErr('isrcharg',\n 'The first argument of the `$location#search()` call must be a string or an object.');\n }\n break;\n default:\n if (isUndefined(paramValue) || paramValue === null) {\n delete this.$$search[search];\n } else {\n this.$$search[search] = paramValue;\n }\n }\n\n this.$$compose();\n return this;\n },\n\n /**\n * @ngdoc method\n * @name $location#hash\n *\n * @description\n * This method is getter / setter.\n *\n * Return hash fragment when called without any parameter.\n *\n * Change hash fragment when called with parameter and return `$location`.\n *\n *\n * ```js\n * // given url http://example.com/#/some/path?foo=bar&baz=xoxo#hashValue\n * var hash = $location.hash();\n * // => \"hashValue\"\n * ```\n *\n * @param {(string|number)=} hash New hash fragment\n * @return {string} hash\n */\n hash: locationGetterSetter('$$hash', function(hash) {\n return hash !== null ? hash.toString() : '';\n }),\n\n /**\n * @ngdoc method\n * @name $location#replace\n *\n * @description\n * If called, all changes to $location during current `$digest` will be replacing current history\n * record, instead of adding new one.\n */\n replace: function() {\n this.$$replace = true;\n return this;\n }\n};\n\nforEach([LocationHashbangInHtml5Url, LocationHashbangUrl, LocationHtml5Url], function(Location) {\n Location.prototype = Object.create(locationPrototype);\n\n /**\n * @ngdoc method\n * @name $location#state\n *\n * @description\n * This method is getter / setter.\n *\n * Return the history state object when called without any parameter.\n *\n * Change the history state object when called with one parameter and return `$location`.\n * The state object is later passed to `pushState` or `replaceState`.\n *\n * NOTE: This method is supported only in HTML5 mode and only in browsers supporting\n * the HTML5 History API (i.e. methods `pushState` and `replaceState`). If you need to support\n * older browsers (like IE9 or Android < 4.0), don't use this method.\n *\n * @param {object=} state State object for pushState or replaceState\n * @return {object} state\n */\n Location.prototype.state = function(state) {\n if (!arguments.length) {\n return this.$$state;\n }\n\n if (Location !== LocationHtml5Url || !this.$$html5) {\n throw $locationMinErr('nostate', 'History API state support is available only ' +\n 'in HTML5 mode and only in browsers supporting HTML5 History API');\n }\n // The user might modify `stateObject` after invoking `$location.state(stateObject)`\n // but we're changing the $$state reference to $browser.state() during the $digest\n // so the modification window is narrow.\n this.$$state = isUndefined(state) ? null : state;\n\n return this;\n };\n});\n\n\nfunction locationGetter(property) {\n return function() {\n return this[property];\n };\n}\n\n\nfunction locationGetterSetter(property, preprocess) {\n return function(value) {\n if (isUndefined(value)) {\n return this[property];\n }\n\n this[property] = preprocess(value);\n this.$$compose();\n\n return this;\n };\n}\n\n\n/**\n * @ngdoc service\n * @name $location\n *\n * @requires $rootElement\n *\n * @description\n * The $location service parses the URL in the browser address bar (based on the\n * [window.location](https://developer.mozilla.org/en/window.location)) and makes the URL\n * available to your application. Changes to the URL in the address bar are reflected into\n * $location service and changes to $location are reflected into the browser address bar.\n *\n * **The $location service:**\n *\n * - Exposes the current URL in the browser address bar, so you can\n * - Watch and observe the URL.\n * - Change the URL.\n * - Synchronizes the URL with the browser when the user\n * - Changes the address bar.\n * - Clicks the back or forward button (or clicks a History link).\n * - Clicks on a link.\n * - Represents the URL object as a set of methods (protocol, host, port, path, search, hash).\n *\n * For more information see {@link guide/$location Developer Guide: Using $location}\n */\n\n/**\n * @ngdoc provider\n * @name $locationProvider\n * @description\n * Use the `$locationProvider` to configure how the application deep linking paths are stored.\n */\nfunction $LocationProvider() {\n var hashPrefix = '',\n html5Mode = {\n enabled: false,\n requireBase: true,\n rewriteLinks: true\n };\n\n /**\n * @ngdoc method\n * @name $locationProvider#hashPrefix\n * @description\n * @param {string=} prefix Prefix for hash part (containing path and search)\n * @returns {*} current value if used as getter or itself (chaining) if used as setter\n */\n this.hashPrefix = function(prefix) {\n if (isDefined(prefix)) {\n hashPrefix = prefix;\n return this;\n } else {\n return hashPrefix;\n }\n };\n\n /**\n * @ngdoc method\n * @name $locationProvider#html5Mode\n * @description\n * @param {(boolean|Object)=} mode If boolean, sets `html5Mode.enabled` to value.\n * If object, sets `enabled`, `requireBase` and `rewriteLinks` to respective values. Supported\n * properties:\n * - **enabled** – `{boolean}` – (default: false) If true, will rely on `history.pushState` to\n * change urls where supported. Will fall back to hash-prefixed paths in browsers that do not\n * support `pushState`.\n * - **requireBase** - `{boolean}` - (default: `true`) When html5Mode is enabled, specifies\n * whether or not a tag is required to be present. If `enabled` and `requireBase` are\n * true, and a base tag is not present, an error will be thrown when `$location` is injected.\n * See the {@link guide/$location $location guide for more information}\n * - **rewriteLinks** - `{boolean}` - (default: `true`) When html5Mode is enabled,\n * enables/disables url rewriting for relative links.\n *\n * @returns {Object} html5Mode object if used as getter or itself (chaining) if used as setter\n */\n this.html5Mode = function(mode) {\n if (isBoolean(mode)) {\n html5Mode.enabled = mode;\n return this;\n } else if (isObject(mode)) {\n\n if (isBoolean(mode.enabled)) {\n html5Mode.enabled = mode.enabled;\n }\n\n if (isBoolean(mode.requireBase)) {\n html5Mode.requireBase = mode.requireBase;\n }\n\n if (isBoolean(mode.rewriteLinks)) {\n html5Mode.rewriteLinks = mode.rewriteLinks;\n }\n\n return this;\n } else {\n return html5Mode;\n }\n };\n\n /**\n * @ngdoc event\n * @name $location#$locationChangeStart\n * @eventType broadcast on root scope\n * @description\n * Broadcasted before a URL will change.\n *\n * This change can be prevented by calling\n * `preventDefault` method of the event. See {@link ng.$rootScope.Scope#$on} for more\n * details about event object. Upon successful change\n * {@link ng.$location#$locationChangeSuccess $locationChangeSuccess} is fired.\n *\n * The `newState` and `oldState` parameters may be defined only in HTML5 mode and when\n * the browser supports the HTML5 History API.\n *\n * @param {Object} angularEvent Synthetic event object.\n * @param {string} newUrl New URL\n * @param {string=} oldUrl URL that was before it was changed.\n * @param {string=} newState New history state object\n * @param {string=} oldState History state object that was before it was changed.\n */\n\n /**\n * @ngdoc event\n * @name $location#$locationChangeSuccess\n * @eventType broadcast on root scope\n * @description\n * Broadcasted after a URL was changed.\n *\n * The `newState` and `oldState` parameters may be defined only in HTML5 mode and when\n * the browser supports the HTML5 History API.\n *\n * @param {Object} angularEvent Synthetic event object.\n * @param {string} newUrl New URL\n * @param {string=} oldUrl URL that was before it was changed.\n * @param {string=} newState New history state object\n * @param {string=} oldState History state object that was before it was changed.\n */\n\n this.$get = ['$rootScope', '$browser', '$sniffer', '$rootElement', '$window',\n function($rootScope, $browser, $sniffer, $rootElement, $window) {\n var $location,\n LocationMode,\n baseHref = $browser.baseHref(), // if base[href] is undefined, it defaults to ''\n initialUrl = $browser.url(),\n appBase;\n\n if (html5Mode.enabled) {\n if (!baseHref && html5Mode.requireBase) {\n throw $locationMinErr('nobase',\n \"$location in HTML5 mode requires a tag to be present!\");\n }\n appBase = serverBase(initialUrl) + (baseHref || '/');\n LocationMode = $sniffer.history ? LocationHtml5Url : LocationHashbangInHtml5Url;\n } else {\n appBase = stripHash(initialUrl);\n LocationMode = LocationHashbangUrl;\n }\n $location = new LocationMode(appBase, '#' + hashPrefix);\n $location.$$parseLinkUrl(initialUrl, initialUrl);\n\n $location.$$state = $browser.state();\n\n var IGNORE_URI_REGEXP = /^\\s*(javascript|mailto):/i;\n\n function setBrowserUrlWithFallback(url, replace, state) {\n var oldUrl = $location.url();\n var oldState = $location.$$state;\n try {\n $browser.url(url, replace, state);\n\n // Make sure $location.state() returns referentially identical (not just deeply equal)\n // state object; this makes possible quick checking if the state changed in the digest\n // loop. Checking deep equality would be too expensive.\n $location.$$state = $browser.state();\n } catch (e) {\n // Restore old values if pushState fails\n $location.url(oldUrl);\n $location.$$state = oldState;\n\n throw e;\n }\n }\n\n $rootElement.on('click', function(event) {\n // TODO(vojta): rewrite link when opening in new tab/window (in legacy browser)\n // currently we open nice url link and redirect then\n\n if (!html5Mode.rewriteLinks || event.ctrlKey || event.metaKey || event.shiftKey || event.which == 2 || event.button == 2) return;\n\n var elm = jqLite(event.target);\n\n // traverse the DOM up to find first A tag\n while (nodeName_(elm[0]) !== 'a') {\n // ignore rewriting if no A tag (reached root element, or no parent - removed from document)\n if (elm[0] === $rootElement[0] || !(elm = elm.parent())[0]) return;\n }\n\n var absHref = elm.prop('href');\n // get the actual href attribute - see\n // http://msdn.microsoft.com/en-us/library/ie/dd347148(v=vs.85).aspx\n var relHref = elm.attr('href') || elm.attr('xlink:href');\n\n if (isObject(absHref) && absHref.toString() === '[object SVGAnimatedString]') {\n // SVGAnimatedString.animVal should be identical to SVGAnimatedString.baseVal, unless during\n // an animation.\n absHref = urlResolve(absHref.animVal).href;\n }\n\n // Ignore when url is started with javascript: or mailto:\n if (IGNORE_URI_REGEXP.test(absHref)) return;\n\n if (absHref && !elm.attr('target') && !event.isDefaultPrevented()) {\n if ($location.$$parseLinkUrl(absHref, relHref)) {\n // We do a preventDefault for all urls that are part of the angular application,\n // in html5mode and also without, so that we are able to abort navigation without\n // getting double entries in the location history.\n event.preventDefault();\n // update location manually\n if ($location.absUrl() != $browser.url()) {\n $rootScope.$apply();\n // hack to work around FF6 bug 684208 when scenario runner clicks on links\n $window.angular['ff-684208-preventDefault'] = true;\n }\n }\n }\n });\n\n\n // rewrite hashbang url <> html5 url\n if (trimEmptyHash($location.absUrl()) != trimEmptyHash(initialUrl)) {\n $browser.url($location.absUrl(), true);\n }\n\n var initializing = true;\n\n // update $location when $browser url changes\n $browser.onUrlChange(function(newUrl, newState) {\n $rootScope.$evalAsync(function() {\n var oldUrl = $location.absUrl();\n var oldState = $location.$$state;\n var defaultPrevented;\n\n $location.$$parse(newUrl);\n $location.$$state = newState;\n\n defaultPrevented = $rootScope.$broadcast('$locationChangeStart', newUrl, oldUrl,\n newState, oldState).defaultPrevented;\n\n // if the location was changed by a `$locationChangeStart` handler then stop\n // processing this location change\n if ($location.absUrl() !== newUrl) return;\n\n if (defaultPrevented) {\n $location.$$parse(oldUrl);\n $location.$$state = oldState;\n setBrowserUrlWithFallback(oldUrl, false, oldState);\n } else {\n initializing = false;\n afterLocationChange(oldUrl, oldState);\n }\n });\n if (!$rootScope.$$phase) $rootScope.$digest();\n });\n\n // update browser\n $rootScope.$watch(function $locationWatch() {\n var oldUrl = trimEmptyHash($browser.url());\n var newUrl = trimEmptyHash($location.absUrl());\n var oldState = $browser.state();\n var currentReplace = $location.$$replace;\n var urlOrStateChanged = oldUrl !== newUrl ||\n ($location.$$html5 && $sniffer.history && oldState !== $location.$$state);\n\n if (initializing || urlOrStateChanged) {\n initializing = false;\n\n $rootScope.$evalAsync(function() {\n var newUrl = $location.absUrl();\n var defaultPrevented = $rootScope.$broadcast('$locationChangeStart', newUrl, oldUrl,\n $location.$$state, oldState).defaultPrevented;\n\n // if the location was changed by a `$locationChangeStart` handler then stop\n // processing this location change\n if ($location.absUrl() !== newUrl) return;\n\n if (defaultPrevented) {\n $location.$$parse(oldUrl);\n $location.$$state = oldState;\n } else {\n if (urlOrStateChanged) {\n setBrowserUrlWithFallback(newUrl, currentReplace,\n oldState === $location.$$state ? null : $location.$$state);\n }\n afterLocationChange(oldUrl, oldState);\n }\n });\n }\n\n $location.$$replace = false;\n\n // we don't need to return anything because $evalAsync will make the digest loop dirty when\n // there is a change\n });\n\n return $location;\n\n function afterLocationChange(oldUrl, oldState) {\n $rootScope.$broadcast('$locationChangeSuccess', $location.absUrl(), oldUrl,\n $location.$$state, oldState);\n }\n}];\n}\n\n/**\n * @ngdoc service\n * @name $log\n * @requires $window\n *\n * @description\n * Simple service for logging. Default implementation safely writes the message\n * into the browser's console (if present).\n *\n * The main purpose of this service is to simplify debugging and troubleshooting.\n *\n * The default is to log `debug` messages. You can use\n * {@link ng.$logProvider ng.$logProvider#debugEnabled} to change this.\n *\n * @example\n \n \n angular.module('logExample', [])\n .controller('LogController', ['$scope', '$log', function($scope, $log) {\n $scope.$log = $log;\n $scope.message = 'Hello World!';\n }]);\n \n \n
    \n

    Reload this page with open console, enter text and hit the log button...

    \n \n \n \n \n \n \n
    \n
    \n
    \n */\n\n/**\n * @ngdoc provider\n * @name $logProvider\n * @description\n * Use the `$logProvider` to configure how the application logs messages\n */\nfunction $LogProvider() {\n var debug = true,\n self = this;\n\n /**\n * @ngdoc method\n * @name $logProvider#debugEnabled\n * @description\n * @param {boolean=} flag enable or disable debug level messages\n * @returns {*} current value if used as getter or itself (chaining) if used as setter\n */\n this.debugEnabled = function(flag) {\n if (isDefined(flag)) {\n debug = flag;\n return this;\n } else {\n return debug;\n }\n };\n\n this.$get = ['$window', function($window) {\n return {\n /**\n * @ngdoc method\n * @name $log#log\n *\n * @description\n * Write a log message\n */\n log: consoleLog('log'),\n\n /**\n * @ngdoc method\n * @name $log#info\n *\n * @description\n * Write an information message\n */\n info: consoleLog('info'),\n\n /**\n * @ngdoc method\n * @name $log#warn\n *\n * @description\n * Write a warning message\n */\n warn: consoleLog('warn'),\n\n /**\n * @ngdoc method\n * @name $log#error\n *\n * @description\n * Write an error message\n */\n error: consoleLog('error'),\n\n /**\n * @ngdoc method\n * @name $log#debug\n *\n * @description\n * Write a debug message\n */\n debug: (function() {\n var fn = consoleLog('debug');\n\n return function() {\n if (debug) {\n fn.apply(self, arguments);\n }\n };\n }())\n };\n\n function formatError(arg) {\n if (arg instanceof Error) {\n if (arg.stack) {\n arg = (arg.message && arg.stack.indexOf(arg.message) === -1)\n ? 'Error: ' + arg.message + '\\n' + arg.stack\n : arg.stack;\n } else if (arg.sourceURL) {\n arg = arg.message + '\\n' + arg.sourceURL + ':' + arg.line;\n }\n }\n return arg;\n }\n\n function consoleLog(type) {\n var console = $window.console || {},\n logFn = console[type] || console.log || noop,\n hasApply = false;\n\n // Note: reading logFn.apply throws an error in IE11 in IE8 document mode.\n // The reason behind this is that console.log has type \"object\" in IE8...\n try {\n hasApply = !!logFn.apply;\n } catch (e) {}\n\n if (hasApply) {\n return function() {\n var args = [];\n forEach(arguments, function(arg) {\n args.push(formatError(arg));\n });\n return logFn.apply(console, args);\n };\n }\n\n // we are IE which either doesn't have window.console => this is noop and we do nothing,\n // or we are IE where console.log doesn't have apply so we log at least first 2 args\n return function(arg1, arg2) {\n logFn(arg1, arg2 == null ? '' : arg2);\n };\n }\n }];\n}\n\n/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\n * Any commits to this file should be reviewed with security in mind. *\n * Changes to this file can potentially create security vulnerabilities. *\n * An approval from 2 Core members with history of modifying *\n * this file is required. *\n * *\n * Does the change somehow allow for arbitrary javascript to be executed? *\n * Or allows for someone to change the prototype of built-in objects? *\n * Or gives undesired access to variables likes document or window? *\n * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */\n\nvar $parseMinErr = minErr('$parse');\n\n// Sandboxing Angular Expressions\n// ------------------------------\n// Angular expressions are generally considered safe because these expressions only have direct\n// access to `$scope` and locals. However, one can obtain the ability to execute arbitrary JS code by\n// obtaining a reference to native JS functions such as the Function constructor.\n//\n// As an example, consider the following Angular expression:\n//\n// {}.toString.constructor('alert(\"evil JS code\")')\n//\n// This sandboxing technique is not perfect and doesn't aim to be. The goal is to prevent exploits\n// against the expression language, but not to prevent exploits that were enabled by exposing\n// sensitive JavaScript or browser APIs on Scope. Exposing such objects on a Scope is never a good\n// practice and therefore we are not even trying to protect against interaction with an object\n// explicitly exposed in this way.\n//\n// In general, it is not possible to access a Window object from an angular expression unless a\n// window or some DOM object that has a reference to window is published onto a Scope.\n// Similarly we prevent invocations of function known to be dangerous, as well as assignments to\n// native objects.\n//\n// See https://docs.angularjs.org/guide/security\n\n\nfunction ensureSafeMemberName(name, fullExpression) {\n if (name === \"__defineGetter__\" || name === \"__defineSetter__\"\n || name === \"__lookupGetter__\" || name === \"__lookupSetter__\"\n || name === \"__proto__\") {\n throw $parseMinErr('isecfld',\n 'Attempting to access a disallowed field in Angular expressions! '\n + 'Expression: {0}', fullExpression);\n }\n return name;\n}\n\nfunction ensureSafeObject(obj, fullExpression) {\n // nifty check if obj is Function that is fast and works across iframes and other contexts\n if (obj) {\n if (obj.constructor === obj) {\n throw $parseMinErr('isecfn',\n 'Referencing Function in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n } else if (// isWindow(obj)\n obj.window === obj) {\n throw $parseMinErr('isecwindow',\n 'Referencing the Window in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n } else if (// isElement(obj)\n obj.children && (obj.nodeName || (obj.prop && obj.attr && obj.find))) {\n throw $parseMinErr('isecdom',\n 'Referencing DOM nodes in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n } else if (// block Object so that we can't get hold of dangerous Object.* methods\n obj === Object) {\n throw $parseMinErr('isecobj',\n 'Referencing Object in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n }\n }\n return obj;\n}\n\nvar CALL = Function.prototype.call;\nvar APPLY = Function.prototype.apply;\nvar BIND = Function.prototype.bind;\n\nfunction ensureSafeFunction(obj, fullExpression) {\n if (obj) {\n if (obj.constructor === obj) {\n throw $parseMinErr('isecfn',\n 'Referencing Function in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n } else if (obj === CALL || obj === APPLY || obj === BIND) {\n throw $parseMinErr('isecff',\n 'Referencing call, apply or bind in Angular expressions is disallowed! Expression: {0}',\n fullExpression);\n }\n }\n}\n\nvar OPERATORS = createMap();\nforEach('+ - * / % === !== == != < > <= >= && || ! = |'.split(' '), function(operator) { OPERATORS[operator] = true; });\nvar ESCAPE = {\"n\":\"\\n\", \"f\":\"\\f\", \"r\":\"\\r\", \"t\":\"\\t\", \"v\":\"\\v\", \"'\":\"'\", '\"':'\"'};\n\n\n/////////////////////////////////////////\n\n\n/**\n * @constructor\n */\nvar Lexer = function(options) {\n this.options = options;\n};\n\nLexer.prototype = {\n constructor: Lexer,\n\n lex: function(text) {\n this.text = text;\n this.index = 0;\n this.tokens = [];\n\n while (this.index < this.text.length) {\n var ch = this.text.charAt(this.index);\n if (ch === '\"' || ch === \"'\") {\n this.readString(ch);\n } else if (this.isNumber(ch) || ch === '.' && this.isNumber(this.peek())) {\n this.readNumber();\n } else if (this.isIdent(ch)) {\n this.readIdent();\n } else if (this.is(ch, '(){}[].,;:?')) {\n this.tokens.push({index: this.index, text: ch});\n this.index++;\n } else if (this.isWhitespace(ch)) {\n this.index++;\n } else {\n var ch2 = ch + this.peek();\n var ch3 = ch2 + this.peek(2);\n var op1 = OPERATORS[ch];\n var op2 = OPERATORS[ch2];\n var op3 = OPERATORS[ch3];\n if (op1 || op2 || op3) {\n var token = op3 ? ch3 : (op2 ? ch2 : ch);\n this.tokens.push({index: this.index, text: token, operator: true});\n this.index += token.length;\n } else {\n this.throwError('Unexpected next character ', this.index, this.index + 1);\n }\n }\n }\n return this.tokens;\n },\n\n is: function(ch, chars) {\n return chars.indexOf(ch) !== -1;\n },\n\n peek: function(i) {\n var num = i || 1;\n return (this.index + num < this.text.length) ? this.text.charAt(this.index + num) : false;\n },\n\n isNumber: function(ch) {\n return ('0' <= ch && ch <= '9') && typeof ch === \"string\";\n },\n\n isWhitespace: function(ch) {\n // IE treats non-breaking space as \\u00A0\n return (ch === ' ' || ch === '\\r' || ch === '\\t' ||\n ch === '\\n' || ch === '\\v' || ch === '\\u00A0');\n },\n\n isIdent: function(ch) {\n return ('a' <= ch && ch <= 'z' ||\n 'A' <= ch && ch <= 'Z' ||\n '_' === ch || ch === '$');\n },\n\n isExpOperator: function(ch) {\n return (ch === '-' || ch === '+' || this.isNumber(ch));\n },\n\n throwError: function(error, start, end) {\n end = end || this.index;\n var colStr = (isDefined(start)\n ? 's ' + start + '-' + this.index + ' [' + this.text.substring(start, end) + ']'\n : ' ' + end);\n throw $parseMinErr('lexerr', 'Lexer Error: {0} at column{1} in expression [{2}].',\n error, colStr, this.text);\n },\n\n readNumber: function() {\n var number = '';\n var start = this.index;\n while (this.index < this.text.length) {\n var ch = lowercase(this.text.charAt(this.index));\n if (ch == '.' || this.isNumber(ch)) {\n number += ch;\n } else {\n var peekCh = this.peek();\n if (ch == 'e' && this.isExpOperator(peekCh)) {\n number += ch;\n } else if (this.isExpOperator(ch) &&\n peekCh && this.isNumber(peekCh) &&\n number.charAt(number.length - 1) == 'e') {\n number += ch;\n } else if (this.isExpOperator(ch) &&\n (!peekCh || !this.isNumber(peekCh)) &&\n number.charAt(number.length - 1) == 'e') {\n this.throwError('Invalid exponent');\n } else {\n break;\n }\n }\n this.index++;\n }\n this.tokens.push({\n index: start,\n text: number,\n constant: true,\n value: Number(number)\n });\n },\n\n readIdent: function() {\n var start = this.index;\n while (this.index < this.text.length) {\n var ch = this.text.charAt(this.index);\n if (!(this.isIdent(ch) || this.isNumber(ch))) {\n break;\n }\n this.index++;\n }\n this.tokens.push({\n index: start,\n text: this.text.slice(start, this.index),\n identifier: true\n });\n },\n\n readString: function(quote) {\n var start = this.index;\n this.index++;\n var string = '';\n var rawString = quote;\n var escape = false;\n while (this.index < this.text.length) {\n var ch = this.text.charAt(this.index);\n rawString += ch;\n if (escape) {\n if (ch === 'u') {\n var hex = this.text.substring(this.index + 1, this.index + 5);\n if (!hex.match(/[\\da-f]{4}/i)) {\n this.throwError('Invalid unicode escape [\\\\u' + hex + ']');\n }\n this.index += 4;\n string += String.fromCharCode(parseInt(hex, 16));\n } else {\n var rep = ESCAPE[ch];\n string = string + (rep || ch);\n }\n escape = false;\n } else if (ch === '\\\\') {\n escape = true;\n } else if (ch === quote) {\n this.index++;\n this.tokens.push({\n index: start,\n text: rawString,\n constant: true,\n value: string\n });\n return;\n } else {\n string += ch;\n }\n this.index++;\n }\n this.throwError('Unterminated quote', start);\n }\n};\n\nvar AST = function(lexer, options) {\n this.lexer = lexer;\n this.options = options;\n};\n\nAST.Program = 'Program';\nAST.ExpressionStatement = 'ExpressionStatement';\nAST.AssignmentExpression = 'AssignmentExpression';\nAST.ConditionalExpression = 'ConditionalExpression';\nAST.LogicalExpression = 'LogicalExpression';\nAST.BinaryExpression = 'BinaryExpression';\nAST.UnaryExpression = 'UnaryExpression';\nAST.CallExpression = 'CallExpression';\nAST.MemberExpression = 'MemberExpression';\nAST.Identifier = 'Identifier';\nAST.Literal = 'Literal';\nAST.ArrayExpression = 'ArrayExpression';\nAST.Property = 'Property';\nAST.ObjectExpression = 'ObjectExpression';\nAST.ThisExpression = 'ThisExpression';\n\n// Internal use only\nAST.NGValueParameter = 'NGValueParameter';\n\nAST.prototype = {\n ast: function(text) {\n this.text = text;\n this.tokens = this.lexer.lex(text);\n\n var value = this.program();\n\n if (this.tokens.length !== 0) {\n this.throwError('is an unexpected token', this.tokens[0]);\n }\n\n return value;\n },\n\n program: function() {\n var body = [];\n while (true) {\n if (this.tokens.length > 0 && !this.peek('}', ')', ';', ']'))\n body.push(this.expressionStatement());\n if (!this.expect(';')) {\n return { type: AST.Program, body: body};\n }\n }\n },\n\n expressionStatement: function() {\n return { type: AST.ExpressionStatement, expression: this.filterChain() };\n },\n\n filterChain: function() {\n var left = this.expression();\n var token;\n while ((token = this.expect('|'))) {\n left = this.filter(left);\n }\n return left;\n },\n\n expression: function() {\n return this.assignment();\n },\n\n assignment: function() {\n var result = this.ternary();\n if (this.expect('=')) {\n result = { type: AST.AssignmentExpression, left: result, right: this.assignment(), operator: '='};\n }\n return result;\n },\n\n ternary: function() {\n var test = this.logicalOR();\n var alternate;\n var consequent;\n if (this.expect('?')) {\n alternate = this.expression();\n if (this.consume(':')) {\n consequent = this.expression();\n return { type: AST.ConditionalExpression, test: test, alternate: alternate, consequent: consequent};\n }\n }\n return test;\n },\n\n logicalOR: function() {\n var left = this.logicalAND();\n while (this.expect('||')) {\n left = { type: AST.LogicalExpression, operator: '||', left: left, right: this.logicalAND() };\n }\n return left;\n },\n\n logicalAND: function() {\n var left = this.equality();\n while (this.expect('&&')) {\n left = { type: AST.LogicalExpression, operator: '&&', left: left, right: this.equality()};\n }\n return left;\n },\n\n equality: function() {\n var left = this.relational();\n var token;\n while ((token = this.expect('==','!=','===','!=='))) {\n left = { type: AST.BinaryExpression, operator: token.text, left: left, right: this.relational() };\n }\n return left;\n },\n\n relational: function() {\n var left = this.additive();\n var token;\n while ((token = this.expect('<', '>', '<=', '>='))) {\n left = { type: AST.BinaryExpression, operator: token.text, left: left, right: this.additive() };\n }\n return left;\n },\n\n additive: function() {\n var left = this.multiplicative();\n var token;\n while ((token = this.expect('+','-'))) {\n left = { type: AST.BinaryExpression, operator: token.text, left: left, right: this.multiplicative() };\n }\n return left;\n },\n\n multiplicative: function() {\n var left = this.unary();\n var token;\n while ((token = this.expect('*','/','%'))) {\n left = { type: AST.BinaryExpression, operator: token.text, left: left, right: this.unary() };\n }\n return left;\n },\n\n unary: function() {\n var token;\n if ((token = this.expect('+', '-', '!'))) {\n return { type: AST.UnaryExpression, operator: token.text, prefix: true, argument: this.unary() };\n } else {\n return this.primary();\n }\n },\n\n primary: function() {\n var primary;\n if (this.expect('(')) {\n primary = this.filterChain();\n this.consume(')');\n } else if (this.expect('[')) {\n primary = this.arrayDeclaration();\n } else if (this.expect('{')) {\n primary = this.object();\n } else if (this.constants.hasOwnProperty(this.peek().text)) {\n primary = copy(this.constants[this.consume().text]);\n } else if (this.peek().identifier) {\n primary = this.identifier();\n } else if (this.peek().constant) {\n primary = this.constant();\n } else {\n this.throwError('not a primary expression', this.peek());\n }\n\n var next;\n while ((next = this.expect('(', '[', '.'))) {\n if (next.text === '(') {\n primary = {type: AST.CallExpression, callee: primary, arguments: this.parseArguments() };\n this.consume(')');\n } else if (next.text === '[') {\n primary = { type: AST.MemberExpression, object: primary, property: this.expression(), computed: true };\n this.consume(']');\n } else if (next.text === '.') {\n primary = { type: AST.MemberExpression, object: primary, property: this.identifier(), computed: false };\n } else {\n this.throwError('IMPOSSIBLE');\n }\n }\n return primary;\n },\n\n filter: function(baseExpression) {\n var args = [baseExpression];\n var result = {type: AST.CallExpression, callee: this.identifier(), arguments: args, filter: true};\n\n while (this.expect(':')) {\n args.push(this.expression());\n }\n\n return result;\n },\n\n parseArguments: function() {\n var args = [];\n if (this.peekToken().text !== ')') {\n do {\n args.push(this.expression());\n } while (this.expect(','));\n }\n return args;\n },\n\n identifier: function() {\n var token = this.consume();\n if (!token.identifier) {\n this.throwError('is not a valid identifier', token);\n }\n return { type: AST.Identifier, name: token.text };\n },\n\n constant: function() {\n // TODO check that it is a constant\n return { type: AST.Literal, value: this.consume().value };\n },\n\n arrayDeclaration: function() {\n var elements = [];\n if (this.peekToken().text !== ']') {\n do {\n if (this.peek(']')) {\n // Support trailing commas per ES5.1.\n break;\n }\n elements.push(this.expression());\n } while (this.expect(','));\n }\n this.consume(']');\n\n return { type: AST.ArrayExpression, elements: elements };\n },\n\n object: function() {\n var properties = [], property;\n if (this.peekToken().text !== '}') {\n do {\n if (this.peek('}')) {\n // Support trailing commas per ES5.1.\n break;\n }\n property = {type: AST.Property, kind: 'init'};\n if (this.peek().constant) {\n property.key = this.constant();\n } else if (this.peek().identifier) {\n property.key = this.identifier();\n } else {\n this.throwError(\"invalid key\", this.peek());\n }\n this.consume(':');\n property.value = this.expression();\n properties.push(property);\n } while (this.expect(','));\n }\n this.consume('}');\n\n return {type: AST.ObjectExpression, properties: properties };\n },\n\n throwError: function(msg, token) {\n throw $parseMinErr('syntax',\n 'Syntax Error: Token \\'{0}\\' {1} at column {2} of the expression [{3}] starting at [{4}].',\n token.text, msg, (token.index + 1), this.text, this.text.substring(token.index));\n },\n\n consume: function(e1) {\n if (this.tokens.length === 0) {\n throw $parseMinErr('ueoe', 'Unexpected end of expression: {0}', this.text);\n }\n\n var token = this.expect(e1);\n if (!token) {\n this.throwError('is unexpected, expecting [' + e1 + ']', this.peek());\n }\n return token;\n },\n\n peekToken: function() {\n if (this.tokens.length === 0) {\n throw $parseMinErr('ueoe', 'Unexpected end of expression: {0}', this.text);\n }\n return this.tokens[0];\n },\n\n peek: function(e1, e2, e3, e4) {\n return this.peekAhead(0, e1, e2, e3, e4);\n },\n\n peekAhead: function(i, e1, e2, e3, e4) {\n if (this.tokens.length > i) {\n var token = this.tokens[i];\n var t = token.text;\n if (t === e1 || t === e2 || t === e3 || t === e4 ||\n (!e1 && !e2 && !e3 && !e4)) {\n return token;\n }\n }\n return false;\n },\n\n expect: function(e1, e2, e3, e4) {\n var token = this.peek(e1, e2, e3, e4);\n if (token) {\n this.tokens.shift();\n return token;\n }\n return false;\n },\n\n\n /* `undefined` is not a constant, it is an identifier,\n * but using it as an identifier is not supported\n */\n constants: {\n 'true': { type: AST.Literal, value: true },\n 'false': { type: AST.Literal, value: false },\n 'null': { type: AST.Literal, value: null },\n 'undefined': {type: AST.Literal, value: undefined },\n 'this': {type: AST.ThisExpression }\n }\n};\n\nfunction ifDefined(v, d) {\n return typeof v !== 'undefined' ? v : d;\n}\n\nfunction plusFn(l, r) {\n if (typeof l === 'undefined') return r;\n if (typeof r === 'undefined') return l;\n return l + r;\n}\n\nfunction isStateless($filter, filterName) {\n var fn = $filter(filterName);\n return !fn.$stateful;\n}\n\nfunction findConstantAndWatchExpressions(ast, $filter) {\n var allConstants;\n var argsToWatch;\n switch (ast.type) {\n case AST.Program:\n allConstants = true;\n forEach(ast.body, function(expr) {\n findConstantAndWatchExpressions(expr.expression, $filter);\n allConstants = allConstants && expr.expression.constant;\n });\n ast.constant = allConstants;\n break;\n case AST.Literal:\n ast.constant = true;\n ast.toWatch = [];\n break;\n case AST.UnaryExpression:\n findConstantAndWatchExpressions(ast.argument, $filter);\n ast.constant = ast.argument.constant;\n ast.toWatch = ast.argument.toWatch;\n break;\n case AST.BinaryExpression:\n findConstantAndWatchExpressions(ast.left, $filter);\n findConstantAndWatchExpressions(ast.right, $filter);\n ast.constant = ast.left.constant && ast.right.constant;\n ast.toWatch = ast.left.toWatch.concat(ast.right.toWatch);\n break;\n case AST.LogicalExpression:\n findConstantAndWatchExpressions(ast.left, $filter);\n findConstantAndWatchExpressions(ast.right, $filter);\n ast.constant = ast.left.constant && ast.right.constant;\n ast.toWatch = ast.constant ? [] : [ast];\n break;\n case AST.ConditionalExpression:\n findConstantAndWatchExpressions(ast.test, $filter);\n findConstantAndWatchExpressions(ast.alternate, $filter);\n findConstantAndWatchExpressions(ast.consequent, $filter);\n ast.constant = ast.test.constant && ast.alternate.constant && ast.consequent.constant;\n ast.toWatch = ast.constant ? [] : [ast];\n break;\n case AST.Identifier:\n ast.constant = false;\n ast.toWatch = [ast];\n break;\n case AST.MemberExpression:\n findConstantAndWatchExpressions(ast.object, $filter);\n if (ast.computed) {\n findConstantAndWatchExpressions(ast.property, $filter);\n }\n ast.constant = ast.object.constant && (!ast.computed || ast.property.constant);\n ast.toWatch = [ast];\n break;\n case AST.CallExpression:\n allConstants = ast.filter ? isStateless($filter, ast.callee.name) : false;\n argsToWatch = [];\n forEach(ast.arguments, function(expr) {\n findConstantAndWatchExpressions(expr, $filter);\n allConstants = allConstants && expr.constant;\n if (!expr.constant) {\n argsToWatch.push.apply(argsToWatch, expr.toWatch);\n }\n });\n ast.constant = allConstants;\n ast.toWatch = ast.filter && isStateless($filter, ast.callee.name) ? argsToWatch : [ast];\n break;\n case AST.AssignmentExpression:\n findConstantAndWatchExpressions(ast.left, $filter);\n findConstantAndWatchExpressions(ast.right, $filter);\n ast.constant = ast.left.constant && ast.right.constant;\n ast.toWatch = [ast];\n break;\n case AST.ArrayExpression:\n allConstants = true;\n argsToWatch = [];\n forEach(ast.elements, function(expr) {\n findConstantAndWatchExpressions(expr, $filter);\n allConstants = allConstants && expr.constant;\n if (!expr.constant) {\n argsToWatch.push.apply(argsToWatch, expr.toWatch);\n }\n });\n ast.constant = allConstants;\n ast.toWatch = argsToWatch;\n break;\n case AST.ObjectExpression:\n allConstants = true;\n argsToWatch = [];\n forEach(ast.properties, function(property) {\n findConstantAndWatchExpressions(property.value, $filter);\n allConstants = allConstants && property.value.constant;\n if (!property.value.constant) {\n argsToWatch.push.apply(argsToWatch, property.value.toWatch);\n }\n });\n ast.constant = allConstants;\n ast.toWatch = argsToWatch;\n break;\n case AST.ThisExpression:\n ast.constant = false;\n ast.toWatch = [];\n break;\n }\n}\n\nfunction getInputs(body) {\n if (body.length != 1) return;\n var lastExpression = body[0].expression;\n var candidate = lastExpression.toWatch;\n if (candidate.length !== 1) return candidate;\n return candidate[0] !== lastExpression ? candidate : undefined;\n}\n\nfunction isAssignable(ast) {\n return ast.type === AST.Identifier || ast.type === AST.MemberExpression;\n}\n\nfunction assignableAST(ast) {\n if (ast.body.length === 1 && isAssignable(ast.body[0].expression)) {\n return {type: AST.AssignmentExpression, left: ast.body[0].expression, right: {type: AST.NGValueParameter}, operator: '='};\n }\n}\n\nfunction isLiteral(ast) {\n return ast.body.length === 0 ||\n ast.body.length === 1 && (\n ast.body[0].expression.type === AST.Literal ||\n ast.body[0].expression.type === AST.ArrayExpression ||\n ast.body[0].expression.type === AST.ObjectExpression);\n}\n\nfunction isConstant(ast) {\n return ast.constant;\n}\n\nfunction ASTCompiler(astBuilder, $filter) {\n this.astBuilder = astBuilder;\n this.$filter = $filter;\n}\n\nASTCompiler.prototype = {\n compile: function(expression, expensiveChecks) {\n var self = this;\n var ast = this.astBuilder.ast(expression);\n this.state = {\n nextId: 0,\n filters: {},\n expensiveChecks: expensiveChecks,\n fn: {vars: [], body: [], own: {}},\n assign: {vars: [], body: [], own: {}},\n inputs: []\n };\n findConstantAndWatchExpressions(ast, self.$filter);\n var extra = '';\n var assignable;\n this.stage = 'assign';\n if ((assignable = assignableAST(ast))) {\n this.state.computing = 'assign';\n var result = this.nextId();\n this.recurse(assignable, result);\n extra = 'fn.assign=' + this.generateFunction('assign', 's,v,l');\n }\n var toWatch = getInputs(ast.body);\n self.stage = 'inputs';\n forEach(toWatch, function(watch, key) {\n var fnKey = 'fn' + key;\n self.state[fnKey] = {vars: [], body: [], own: {}};\n self.state.computing = fnKey;\n var intoId = self.nextId();\n self.recurse(watch, intoId);\n self.return_(intoId);\n self.state.inputs.push(fnKey);\n watch.watchId = key;\n });\n this.state.computing = 'fn';\n this.stage = 'main';\n this.recurse(ast);\n var fnString =\n // The build and minification steps remove the string \"use strict\" from the code, but this is done using a regex.\n // This is a workaround for this until we do a better job at only removing the prefix only when we should.\n '\"' + this.USE + ' ' + this.STRICT + '\";\\n' +\n this.filterPrefix() +\n 'var fn=' + this.generateFunction('fn', 's,l,a,i') +\n extra +\n this.watchFns() +\n 'return fn;';\n\n /* jshint -W054 */\n var fn = (new Function('$filter',\n 'ensureSafeMemberName',\n 'ensureSafeObject',\n 'ensureSafeFunction',\n 'ifDefined',\n 'plus',\n 'text',\n fnString))(\n this.$filter,\n ensureSafeMemberName,\n ensureSafeObject,\n ensureSafeFunction,\n ifDefined,\n plusFn,\n expression);\n /* jshint +W054 */\n this.state = this.stage = undefined;\n fn.literal = isLiteral(ast);\n fn.constant = isConstant(ast);\n return fn;\n },\n\n USE: 'use',\n\n STRICT: 'strict',\n\n watchFns: function() {\n var result = [];\n var fns = this.state.inputs;\n var self = this;\n forEach(fns, function(name) {\n result.push('var ' + name + '=' + self.generateFunction(name, 's'));\n });\n if (fns.length) {\n result.push('fn.inputs=[' + fns.join(',') + '];');\n }\n return result.join('');\n },\n\n generateFunction: function(name, params) {\n return 'function(' + params + '){' +\n this.varsPrefix(name) +\n this.body(name) +\n '};';\n },\n\n filterPrefix: function() {\n var parts = [];\n var self = this;\n forEach(this.state.filters, function(id, filter) {\n parts.push(id + '=$filter(' + self.escape(filter) + ')');\n });\n if (parts.length) return 'var ' + parts.join(',') + ';';\n return '';\n },\n\n varsPrefix: function(section) {\n return this.state[section].vars.length ? 'var ' + this.state[section].vars.join(',') + ';' : '';\n },\n\n body: function(section) {\n return this.state[section].body.join('');\n },\n\n recurse: function(ast, intoId, nameId, recursionFn, create, skipWatchIdCheck) {\n var left, right, self = this, args, expression;\n recursionFn = recursionFn || noop;\n if (!skipWatchIdCheck && isDefined(ast.watchId)) {\n intoId = intoId || this.nextId();\n this.if_('i',\n this.lazyAssign(intoId, this.computedMember('i', ast.watchId)),\n this.lazyRecurse(ast, intoId, nameId, recursionFn, create, true)\n );\n return;\n }\n switch (ast.type) {\n case AST.Program:\n forEach(ast.body, function(expression, pos) {\n self.recurse(expression.expression, undefined, undefined, function(expr) { right = expr; });\n if (pos !== ast.body.length - 1) {\n self.current().body.push(right, ';');\n } else {\n self.return_(right);\n }\n });\n break;\n case AST.Literal:\n expression = this.escape(ast.value);\n this.assign(intoId, expression);\n recursionFn(expression);\n break;\n case AST.UnaryExpression:\n this.recurse(ast.argument, undefined, undefined, function(expr) { right = expr; });\n expression = ast.operator + '(' + this.ifDefined(right, 0) + ')';\n this.assign(intoId, expression);\n recursionFn(expression);\n break;\n case AST.BinaryExpression:\n this.recurse(ast.left, undefined, undefined, function(expr) { left = expr; });\n this.recurse(ast.right, undefined, undefined, function(expr) { right = expr; });\n if (ast.operator === '+') {\n expression = this.plus(left, right);\n } else if (ast.operator === '-') {\n expression = this.ifDefined(left, 0) + ast.operator + this.ifDefined(right, 0);\n } else {\n expression = '(' + left + ')' + ast.operator + '(' + right + ')';\n }\n this.assign(intoId, expression);\n recursionFn(expression);\n break;\n case AST.LogicalExpression:\n intoId = intoId || this.nextId();\n self.recurse(ast.left, intoId);\n self.if_(ast.operator === '&&' ? intoId : self.not(intoId), self.lazyRecurse(ast.right, intoId));\n recursionFn(intoId);\n break;\n case AST.ConditionalExpression:\n intoId = intoId || this.nextId();\n self.recurse(ast.test, intoId);\n self.if_(intoId, self.lazyRecurse(ast.alternate, intoId), self.lazyRecurse(ast.consequent, intoId));\n recursionFn(intoId);\n break;\n case AST.Identifier:\n intoId = intoId || this.nextId();\n if (nameId) {\n nameId.context = self.stage === 'inputs' ? 's' : this.assign(this.nextId(), this.getHasOwnProperty('l', ast.name) + '?l:s');\n nameId.computed = false;\n nameId.name = ast.name;\n }\n ensureSafeMemberName(ast.name);\n self.if_(self.stage === 'inputs' || self.not(self.getHasOwnProperty('l', ast.name)),\n function() {\n self.if_(self.stage === 'inputs' || 's', function() {\n if (create && create !== 1) {\n self.if_(\n self.not(self.nonComputedMember('s', ast.name)),\n self.lazyAssign(self.nonComputedMember('s', ast.name), '{}'));\n }\n self.assign(intoId, self.nonComputedMember('s', ast.name));\n });\n }, intoId && self.lazyAssign(intoId, self.nonComputedMember('l', ast.name))\n );\n if (self.state.expensiveChecks || isPossiblyDangerousMemberName(ast.name)) {\n self.addEnsureSafeObject(intoId);\n }\n recursionFn(intoId);\n break;\n case AST.MemberExpression:\n left = nameId && (nameId.context = this.nextId()) || this.nextId();\n intoId = intoId || this.nextId();\n self.recurse(ast.object, left, undefined, function() {\n self.if_(self.notNull(left), function() {\n if (ast.computed) {\n right = self.nextId();\n self.recurse(ast.property, right);\n self.addEnsureSafeMemberName(right);\n if (create && create !== 1) {\n self.if_(self.not(self.computedMember(left, right)), self.lazyAssign(self.computedMember(left, right), '{}'));\n }\n expression = self.ensureSafeObject(self.computedMember(left, right));\n self.assign(intoId, expression);\n if (nameId) {\n nameId.computed = true;\n nameId.name = right;\n }\n } else {\n ensureSafeMemberName(ast.property.name);\n if (create && create !== 1) {\n self.if_(self.not(self.nonComputedMember(left, ast.property.name)), self.lazyAssign(self.nonComputedMember(left, ast.property.name), '{}'));\n }\n expression = self.nonComputedMember(left, ast.property.name);\n if (self.state.expensiveChecks || isPossiblyDangerousMemberName(ast.property.name)) {\n expression = self.ensureSafeObject(expression);\n }\n self.assign(intoId, expression);\n if (nameId) {\n nameId.computed = false;\n nameId.name = ast.property.name;\n }\n }\n }, function() {\n self.assign(intoId, 'undefined');\n });\n recursionFn(intoId);\n }, !!create);\n break;\n case AST.CallExpression:\n intoId = intoId || this.nextId();\n if (ast.filter) {\n right = self.filter(ast.callee.name);\n args = [];\n forEach(ast.arguments, function(expr) {\n var argument = self.nextId();\n self.recurse(expr, argument);\n args.push(argument);\n });\n expression = right + '(' + args.join(',') + ')';\n self.assign(intoId, expression);\n recursionFn(intoId);\n } else {\n right = self.nextId();\n left = {};\n args = [];\n self.recurse(ast.callee, right, left, function() {\n self.if_(self.notNull(right), function() {\n self.addEnsureSafeFunction(right);\n forEach(ast.arguments, function(expr) {\n self.recurse(expr, self.nextId(), undefined, function(argument) {\n args.push(self.ensureSafeObject(argument));\n });\n });\n if (left.name) {\n if (!self.state.expensiveChecks) {\n self.addEnsureSafeObject(left.context);\n }\n expression = self.member(left.context, left.name, left.computed) + '(' + args.join(',') + ')';\n } else {\n expression = right + '(' + args.join(',') + ')';\n }\n expression = self.ensureSafeObject(expression);\n self.assign(intoId, expression);\n }, function() {\n self.assign(intoId, 'undefined');\n });\n recursionFn(intoId);\n });\n }\n break;\n case AST.AssignmentExpression:\n right = this.nextId();\n left = {};\n if (!isAssignable(ast.left)) {\n throw $parseMinErr('lval', 'Trying to assing a value to a non l-value');\n }\n this.recurse(ast.left, undefined, left, function() {\n self.if_(self.notNull(left.context), function() {\n self.recurse(ast.right, right);\n self.addEnsureSafeObject(self.member(left.context, left.name, left.computed));\n expression = self.member(left.context, left.name, left.computed) + ast.operator + right;\n self.assign(intoId, expression);\n recursionFn(intoId || expression);\n });\n }, 1);\n break;\n case AST.ArrayExpression:\n args = [];\n forEach(ast.elements, function(expr) {\n self.recurse(expr, self.nextId(), undefined, function(argument) {\n args.push(argument);\n });\n });\n expression = '[' + args.join(',') + ']';\n this.assign(intoId, expression);\n recursionFn(expression);\n break;\n case AST.ObjectExpression:\n args = [];\n forEach(ast.properties, function(property) {\n self.recurse(property.value, self.nextId(), undefined, function(expr) {\n args.push(self.escape(\n property.key.type === AST.Identifier ? property.key.name :\n ('' + property.key.value)) +\n ':' + expr);\n });\n });\n expression = '{' + args.join(',') + '}';\n this.assign(intoId, expression);\n recursionFn(expression);\n break;\n case AST.ThisExpression:\n this.assign(intoId, 's');\n recursionFn('s');\n break;\n case AST.NGValueParameter:\n this.assign(intoId, 'v');\n recursionFn('v');\n break;\n }\n },\n\n getHasOwnProperty: function(element, property) {\n var key = element + '.' + property;\n var own = this.current().own;\n if (!own.hasOwnProperty(key)) {\n own[key] = this.nextId(false, element + '&&(' + this.escape(property) + ' in ' + element + ')');\n }\n return own[key];\n },\n\n assign: function(id, value) {\n if (!id) return;\n this.current().body.push(id, '=', value, ';');\n return id;\n },\n\n filter: function(filterName) {\n if (!this.state.filters.hasOwnProperty(filterName)) {\n this.state.filters[filterName] = this.nextId(true);\n }\n return this.state.filters[filterName];\n },\n\n ifDefined: function(id, defaultValue) {\n return 'ifDefined(' + id + ',' + this.escape(defaultValue) + ')';\n },\n\n plus: function(left, right) {\n return 'plus(' + left + ',' + right + ')';\n },\n\n return_: function(id) {\n this.current().body.push('return ', id, ';');\n },\n\n if_: function(test, alternate, consequent) {\n if (test === true) {\n alternate();\n } else {\n var body = this.current().body;\n body.push('if(', test, '){');\n alternate();\n body.push('}');\n if (consequent) {\n body.push('else{');\n consequent();\n body.push('}');\n }\n }\n },\n\n not: function(expression) {\n return '!(' + expression + ')';\n },\n\n notNull: function(expression) {\n return expression + '!=null';\n },\n\n nonComputedMember: function(left, right) {\n return left + '.' + right;\n },\n\n computedMember: function(left, right) {\n return left + '[' + right + ']';\n },\n\n member: function(left, right, computed) {\n if (computed) return this.computedMember(left, right);\n return this.nonComputedMember(left, right);\n },\n\n addEnsureSafeObject: function(item) {\n this.current().body.push(this.ensureSafeObject(item), ';');\n },\n\n addEnsureSafeMemberName: function(item) {\n this.current().body.push(this.ensureSafeMemberName(item), ';');\n },\n\n addEnsureSafeFunction: function(item) {\n this.current().body.push(this.ensureSafeFunction(item), ';');\n },\n\n ensureSafeObject: function(item) {\n return 'ensureSafeObject(' + item + ',text)';\n },\n\n ensureSafeMemberName: function(item) {\n return 'ensureSafeMemberName(' + item + ',text)';\n },\n\n ensureSafeFunction: function(item) {\n return 'ensureSafeFunction(' + item + ',text)';\n },\n\n lazyRecurse: function(ast, intoId, nameId, recursionFn, create, skipWatchIdCheck) {\n var self = this;\n return function() {\n self.recurse(ast, intoId, nameId, recursionFn, create, skipWatchIdCheck);\n };\n },\n\n lazyAssign: function(id, value) {\n var self = this;\n return function() {\n self.assign(id, value);\n };\n },\n\n stringEscapeRegex: /[^ a-zA-Z0-9]/g,\n\n stringEscapeFn: function(c) {\n return '\\\\u' + ('0000' + c.charCodeAt(0).toString(16)).slice(-4);\n },\n\n escape: function(value) {\n if (isString(value)) return \"'\" + value.replace(this.stringEscapeRegex, this.stringEscapeFn) + \"'\";\n if (isNumber(value)) return value.toString();\n if (value === true) return 'true';\n if (value === false) return 'false';\n if (value === null) return 'null';\n if (typeof value === 'undefined') return 'undefined';\n\n throw $parseMinErr('esc', 'IMPOSSIBLE');\n },\n\n nextId: function(skip, init) {\n var id = 'v' + (this.state.nextId++);\n if (!skip) {\n this.current().vars.push(id + (init ? '=' + init : ''));\n }\n return id;\n },\n\n current: function() {\n return this.state[this.state.computing];\n }\n};\n\n\nfunction ASTInterpreter(astBuilder, $filter) {\n this.astBuilder = astBuilder;\n this.$filter = $filter;\n}\n\nASTInterpreter.prototype = {\n compile: function(expression, expensiveChecks) {\n var self = this;\n var ast = this.astBuilder.ast(expression);\n this.expression = expression;\n this.expensiveChecks = expensiveChecks;\n findConstantAndWatchExpressions(ast, self.$filter);\n var assignable;\n var assign;\n if ((assignable = assignableAST(ast))) {\n assign = this.recurse(assignable);\n }\n var toWatch = getInputs(ast.body);\n var inputs;\n if (toWatch) {\n inputs = [];\n forEach(toWatch, function(watch, key) {\n var input = self.recurse(watch);\n watch.input = input;\n inputs.push(input);\n watch.watchId = key;\n });\n }\n var expressions = [];\n forEach(ast.body, function(expression) {\n expressions.push(self.recurse(expression.expression));\n });\n var fn = ast.body.length === 0 ? function() {} :\n ast.body.length === 1 ? expressions[0] :\n function(scope, locals) {\n var lastValue;\n forEach(expressions, function(exp) {\n lastValue = exp(scope, locals);\n });\n return lastValue;\n };\n if (assign) {\n fn.assign = function(scope, value, locals) {\n return assign(scope, locals, value);\n };\n }\n if (inputs) {\n fn.inputs = inputs;\n }\n fn.literal = isLiteral(ast);\n fn.constant = isConstant(ast);\n return fn;\n },\n\n recurse: function(ast, context, create) {\n var left, right, self = this, args, expression;\n if (ast.input) {\n return this.inputs(ast.input, ast.watchId);\n }\n switch (ast.type) {\n case AST.Literal:\n return this.value(ast.value, context);\n case AST.UnaryExpression:\n right = this.recurse(ast.argument);\n return this['unary' + ast.operator](right, context);\n case AST.BinaryExpression:\n left = this.recurse(ast.left);\n right = this.recurse(ast.right);\n return this['binary' + ast.operator](left, right, context);\n case AST.LogicalExpression:\n left = this.recurse(ast.left);\n right = this.recurse(ast.right);\n return this['binary' + ast.operator](left, right, context);\n case AST.ConditionalExpression:\n return this['ternary?:'](\n this.recurse(ast.test),\n this.recurse(ast.alternate),\n this.recurse(ast.consequent),\n context\n );\n case AST.Identifier:\n ensureSafeMemberName(ast.name, self.expression);\n return self.identifier(ast.name,\n self.expensiveChecks || isPossiblyDangerousMemberName(ast.name),\n context, create, self.expression);\n case AST.MemberExpression:\n left = this.recurse(ast.object, false, !!create);\n if (!ast.computed) {\n ensureSafeMemberName(ast.property.name, self.expression);\n right = ast.property.name;\n }\n if (ast.computed) right = this.recurse(ast.property);\n return ast.computed ?\n this.computedMember(left, right, context, create, self.expression) :\n this.nonComputedMember(left, right, self.expensiveChecks, context, create, self.expression);\n case AST.CallExpression:\n args = [];\n forEach(ast.arguments, function(expr) {\n args.push(self.recurse(expr));\n });\n if (ast.filter) right = this.$filter(ast.callee.name);\n if (!ast.filter) right = this.recurse(ast.callee, true);\n return ast.filter ?\n function(scope, locals, assign, inputs) {\n var values = [];\n for (var i = 0; i < args.length; ++i) {\n values.push(args[i](scope, locals, assign, inputs));\n }\n var value = right.apply(undefined, values, inputs);\n return context ? {context: undefined, name: undefined, value: value} : value;\n } :\n function(scope, locals, assign, inputs) {\n var rhs = right(scope, locals, assign, inputs);\n var value;\n if (rhs.value != null) {\n ensureSafeObject(rhs.context, self.expression);\n ensureSafeFunction(rhs.value, self.expression);\n var values = [];\n for (var i = 0; i < args.length; ++i) {\n values.push(ensureSafeObject(args[i](scope, locals, assign, inputs), self.expression));\n }\n value = ensureSafeObject(rhs.value.apply(rhs.context, values), self.expression);\n }\n return context ? {value: value} : value;\n };\n case AST.AssignmentExpression:\n left = this.recurse(ast.left, true, 1);\n right = this.recurse(ast.right);\n return function(scope, locals, assign, inputs) {\n var lhs = left(scope, locals, assign, inputs);\n var rhs = right(scope, locals, assign, inputs);\n ensureSafeObject(lhs.value, self.expression);\n lhs.context[lhs.name] = rhs;\n return context ? {value: rhs} : rhs;\n };\n case AST.ArrayExpression:\n args = [];\n forEach(ast.elements, function(expr) {\n args.push(self.recurse(expr));\n });\n return function(scope, locals, assign, inputs) {\n var value = [];\n for (var i = 0; i < args.length; ++i) {\n value.push(args[i](scope, locals, assign, inputs));\n }\n return context ? {value: value} : value;\n };\n case AST.ObjectExpression:\n args = [];\n forEach(ast.properties, function(property) {\n args.push({key: property.key.type === AST.Identifier ?\n property.key.name :\n ('' + property.key.value),\n value: self.recurse(property.value)\n });\n });\n return function(scope, locals, assign, inputs) {\n var value = {};\n for (var i = 0; i < args.length; ++i) {\n value[args[i].key] = args[i].value(scope, locals, assign, inputs);\n }\n return context ? {value: value} : value;\n };\n case AST.ThisExpression:\n return function(scope) {\n return context ? {value: scope} : scope;\n };\n case AST.NGValueParameter:\n return function(scope, locals, assign, inputs) {\n return context ? {value: assign} : assign;\n };\n }\n },\n\n 'unary+': function(argument, context) {\n return function(scope, locals, assign, inputs) {\n var arg = argument(scope, locals, assign, inputs);\n if (isDefined(arg)) {\n arg = +arg;\n } else {\n arg = 0;\n }\n return context ? {value: arg} : arg;\n };\n },\n 'unary-': function(argument, context) {\n return function(scope, locals, assign, inputs) {\n var arg = argument(scope, locals, assign, inputs);\n if (isDefined(arg)) {\n arg = -arg;\n } else {\n arg = 0;\n }\n return context ? {value: arg} : arg;\n };\n },\n 'unary!': function(argument, context) {\n return function(scope, locals, assign, inputs) {\n var arg = !argument(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary+': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var lhs = left(scope, locals, assign, inputs);\n var rhs = right(scope, locals, assign, inputs);\n var arg = plusFn(lhs, rhs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary-': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var lhs = left(scope, locals, assign, inputs);\n var rhs = right(scope, locals, assign, inputs);\n var arg = (isDefined(lhs) ? lhs : 0) - (isDefined(rhs) ? rhs : 0);\n return context ? {value: arg} : arg;\n };\n },\n 'binary*': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) * right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary/': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) / right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary%': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) % right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary===': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) === right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary!==': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) !== right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary==': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) == right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary!=': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) != right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary<': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) < right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary>': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) > right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary<=': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) <= right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary>=': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) >= right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary&&': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) && right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'binary||': function(left, right, context) {\n return function(scope, locals, assign, inputs) {\n var arg = left(scope, locals, assign, inputs) || right(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n 'ternary?:': function(test, alternate, consequent, context) {\n return function(scope, locals, assign, inputs) {\n var arg = test(scope, locals, assign, inputs) ? alternate(scope, locals, assign, inputs) : consequent(scope, locals, assign, inputs);\n return context ? {value: arg} : arg;\n };\n },\n value: function(value, context) {\n return function() { return context ? {context: undefined, name: undefined, value: value} : value; };\n },\n identifier: function(name, expensiveChecks, context, create, expression) {\n return function(scope, locals, assign, inputs) {\n var base = locals && (name in locals) ? locals : scope;\n if (create && create !== 1 && base && !(base[name])) {\n base[name] = {};\n }\n var value = base ? base[name] : undefined;\n if (expensiveChecks) {\n ensureSafeObject(value, expression);\n }\n if (context) {\n return {context: base, name: name, value: value};\n } else {\n return value;\n }\n };\n },\n computedMember: function(left, right, context, create, expression) {\n return function(scope, locals, assign, inputs) {\n var lhs = left(scope, locals, assign, inputs);\n var rhs;\n var value;\n if (lhs != null) {\n rhs = right(scope, locals, assign, inputs);\n ensureSafeMemberName(rhs, expression);\n if (create && create !== 1 && lhs && !(lhs[rhs])) {\n lhs[rhs] = {};\n }\n value = lhs[rhs];\n ensureSafeObject(value, expression);\n }\n if (context) {\n return {context: lhs, name: rhs, value: value};\n } else {\n return value;\n }\n };\n },\n nonComputedMember: function(left, right, expensiveChecks, context, create, expression) {\n return function(scope, locals, assign, inputs) {\n var lhs = left(scope, locals, assign, inputs);\n if (create && create !== 1 && lhs && !(lhs[right])) {\n lhs[right] = {};\n }\n var value = lhs != null ? lhs[right] : undefined;\n if (expensiveChecks || isPossiblyDangerousMemberName(right)) {\n ensureSafeObject(value, expression);\n }\n if (context) {\n return {context: lhs, name: right, value: value};\n } else {\n return value;\n }\n };\n },\n inputs: function(input, watchId) {\n return function(scope, value, locals, inputs) {\n if (inputs) return inputs[watchId];\n return input(scope, value, locals);\n };\n }\n};\n\n/**\n * @constructor\n */\nvar Parser = function(lexer, $filter, options) {\n this.lexer = lexer;\n this.$filter = $filter;\n this.options = options;\n this.ast = new AST(this.lexer);\n this.astCompiler = options.csp ? new ASTInterpreter(this.ast, $filter) :\n new ASTCompiler(this.ast, $filter);\n};\n\nParser.prototype = {\n constructor: Parser,\n\n parse: function(text) {\n return this.astCompiler.compile(text, this.options.expensiveChecks);\n }\n};\n\n//////////////////////////////////////////////////\n// Parser helper functions\n//////////////////////////////////////////////////\n\nfunction setter(obj, path, setValue, fullExp) {\n ensureSafeObject(obj, fullExp);\n\n var element = path.split('.'), key;\n for (var i = 0; element.length > 1; i++) {\n key = ensureSafeMemberName(element.shift(), fullExp);\n var propertyObj = ensureSafeObject(obj[key], fullExp);\n if (!propertyObj) {\n propertyObj = {};\n obj[key] = propertyObj;\n }\n obj = propertyObj;\n }\n key = ensureSafeMemberName(element.shift(), fullExp);\n ensureSafeObject(obj[key], fullExp);\n obj[key] = setValue;\n return setValue;\n}\n\nvar getterFnCacheDefault = createMap();\nvar getterFnCacheExpensive = createMap();\n\nfunction isPossiblyDangerousMemberName(name) {\n return name == 'constructor';\n}\n\nvar objectValueOf = Object.prototype.valueOf;\n\nfunction getValueOf(value) {\n return isFunction(value.valueOf) ? value.valueOf() : objectValueOf.call(value);\n}\n\n///////////////////////////////////\n\n/**\n * @ngdoc service\n * @name $parse\n * @kind function\n *\n * @description\n *\n * Converts Angular {@link guide/expression expression} into a function.\n *\n * ```js\n * var getter = $parse('user.name');\n * var setter = getter.assign;\n * var context = {user:{name:'angular'}};\n * var locals = {user:{name:'local'}};\n *\n * expect(getter(context)).toEqual('angular');\n * setter(context, 'newValue');\n * expect(context.user.name).toEqual('newValue');\n * expect(getter(context, locals)).toEqual('local');\n * ```\n *\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n *\n * The returned function also has the following properties:\n * * `literal` – `{boolean}` – whether the expression's top-level node is a JavaScript\n * literal.\n * * `constant` – `{boolean}` – whether the expression is made entirely of JavaScript\n * constant literals.\n * * `assign` – `{?function(context, value)}` – if the expression is assignable, this will be\n * set to a function to change its value on the given context.\n *\n */\n\n\n/**\n * @ngdoc provider\n * @name $parseProvider\n *\n * @description\n * `$parseProvider` can be used for configuring the default behavior of the {@link ng.$parse $parse}\n * service.\n */\nfunction $ParseProvider() {\n var cacheDefault = createMap();\n var cacheExpensive = createMap();\n\n this.$get = ['$filter', '$sniffer', function($filter, $sniffer) {\n var $parseOptions = {\n csp: $sniffer.csp,\n expensiveChecks: false\n },\n $parseOptionsExpensive = {\n csp: $sniffer.csp,\n expensiveChecks: true\n };\n\n return function $parse(exp, interceptorFn, expensiveChecks) {\n var parsedExpression, oneTime, cacheKey;\n\n switch (typeof exp) {\n case 'string':\n exp = exp.trim();\n cacheKey = exp;\n\n var cache = (expensiveChecks ? cacheExpensive : cacheDefault);\n parsedExpression = cache[cacheKey];\n\n if (!parsedExpression) {\n if (exp.charAt(0) === ':' && exp.charAt(1) === ':') {\n oneTime = true;\n exp = exp.substring(2);\n }\n var parseOptions = expensiveChecks ? $parseOptionsExpensive : $parseOptions;\n var lexer = new Lexer(parseOptions);\n var parser = new Parser(lexer, $filter, parseOptions);\n parsedExpression = parser.parse(exp);\n if (parsedExpression.constant) {\n parsedExpression.$$watchDelegate = constantWatchDelegate;\n } else if (oneTime) {\n parsedExpression.$$watchDelegate = parsedExpression.literal ?\n oneTimeLiteralWatchDelegate : oneTimeWatchDelegate;\n } else if (parsedExpression.inputs) {\n parsedExpression.$$watchDelegate = inputsWatchDelegate;\n }\n cache[cacheKey] = parsedExpression;\n }\n return addInterceptor(parsedExpression, interceptorFn);\n\n case 'function':\n return addInterceptor(exp, interceptorFn);\n\n default:\n return noop;\n }\n };\n\n function expressionInputDirtyCheck(newValue, oldValueOfValue) {\n\n if (newValue == null || oldValueOfValue == null) { // null/undefined\n return newValue === oldValueOfValue;\n }\n\n if (typeof newValue === 'object') {\n\n // attempt to convert the value to a primitive type\n // TODO(docs): add a note to docs that by implementing valueOf even objects and arrays can\n // be cheaply dirty-checked\n newValue = getValueOf(newValue);\n\n if (typeof newValue === 'object') {\n // objects/arrays are not supported - deep-watching them would be too expensive\n return false;\n }\n\n // fall-through to the primitive equality check\n }\n\n //Primitive or NaN\n return newValue === oldValueOfValue || (newValue !== newValue && oldValueOfValue !== oldValueOfValue);\n }\n\n function inputsWatchDelegate(scope, listener, objectEquality, parsedExpression, prettyPrintExpression) {\n var inputExpressions = parsedExpression.inputs;\n var lastResult;\n\n if (inputExpressions.length === 1) {\n var oldInputValueOf = expressionInputDirtyCheck; // init to something unique so that equals check fails\n inputExpressions = inputExpressions[0];\n return scope.$watch(function expressionInputWatch(scope) {\n var newInputValue = inputExpressions(scope);\n if (!expressionInputDirtyCheck(newInputValue, oldInputValueOf)) {\n lastResult = parsedExpression(scope, undefined, undefined, [newInputValue]);\n oldInputValueOf = newInputValue && getValueOf(newInputValue);\n }\n return lastResult;\n }, listener, objectEquality, prettyPrintExpression);\n }\n\n var oldInputValueOfValues = [];\n var oldInputValues = [];\n for (var i = 0, ii = inputExpressions.length; i < ii; i++) {\n oldInputValueOfValues[i] = expressionInputDirtyCheck; // init to something unique so that equals check fails\n oldInputValues[i] = null;\n }\n\n return scope.$watch(function expressionInputsWatch(scope) {\n var changed = false;\n\n for (var i = 0, ii = inputExpressions.length; i < ii; i++) {\n var newInputValue = inputExpressions[i](scope);\n if (changed || (changed = !expressionInputDirtyCheck(newInputValue, oldInputValueOfValues[i]))) {\n oldInputValues[i] = newInputValue;\n oldInputValueOfValues[i] = newInputValue && getValueOf(newInputValue);\n }\n }\n\n if (changed) {\n lastResult = parsedExpression(scope, undefined, undefined, oldInputValues);\n }\n\n return lastResult;\n }, listener, objectEquality, prettyPrintExpression);\n }\n\n function oneTimeWatchDelegate(scope, listener, objectEquality, parsedExpression) {\n var unwatch, lastValue;\n return unwatch = scope.$watch(function oneTimeWatch(scope) {\n return parsedExpression(scope);\n }, function oneTimeListener(value, old, scope) {\n lastValue = value;\n if (isFunction(listener)) {\n listener.apply(this, arguments);\n }\n if (isDefined(value)) {\n scope.$$postDigest(function() {\n if (isDefined(lastValue)) {\n unwatch();\n }\n });\n }\n }, objectEquality);\n }\n\n function oneTimeLiteralWatchDelegate(scope, listener, objectEquality, parsedExpression) {\n var unwatch, lastValue;\n return unwatch = scope.$watch(function oneTimeWatch(scope) {\n return parsedExpression(scope);\n }, function oneTimeListener(value, old, scope) {\n lastValue = value;\n if (isFunction(listener)) {\n listener.call(this, value, old, scope);\n }\n if (isAllDefined(value)) {\n scope.$$postDigest(function() {\n if (isAllDefined(lastValue)) unwatch();\n });\n }\n }, objectEquality);\n\n function isAllDefined(value) {\n var allDefined = true;\n forEach(value, function(val) {\n if (!isDefined(val)) allDefined = false;\n });\n return allDefined;\n }\n }\n\n function constantWatchDelegate(scope, listener, objectEquality, parsedExpression) {\n var unwatch;\n return unwatch = scope.$watch(function constantWatch(scope) {\n return parsedExpression(scope);\n }, function constantListener(value, old, scope) {\n if (isFunction(listener)) {\n listener.apply(this, arguments);\n }\n unwatch();\n }, objectEquality);\n }\n\n function addInterceptor(parsedExpression, interceptorFn) {\n if (!interceptorFn) return parsedExpression;\n var watchDelegate = parsedExpression.$$watchDelegate;\n\n var regularWatch =\n watchDelegate !== oneTimeLiteralWatchDelegate &&\n watchDelegate !== oneTimeWatchDelegate;\n\n var fn = regularWatch ? function regularInterceptedExpression(scope, locals, assign, inputs) {\n var value = parsedExpression(scope, locals, assign, inputs);\n return interceptorFn(value, scope, locals);\n } : function oneTimeInterceptedExpression(scope, locals, assign, inputs) {\n var value = parsedExpression(scope, locals, assign, inputs);\n var result = interceptorFn(value, scope, locals);\n // we only return the interceptor's result if the\n // initial value is defined (for bind-once)\n return isDefined(value) ? result : value;\n };\n\n // Propagate $$watchDelegates other then inputsWatchDelegate\n if (parsedExpression.$$watchDelegate &&\n parsedExpression.$$watchDelegate !== inputsWatchDelegate) {\n fn.$$watchDelegate = parsedExpression.$$watchDelegate;\n } else if (!interceptorFn.$stateful) {\n // If there is an interceptor, but no watchDelegate then treat the interceptor like\n // we treat filters - it is assumed to be a pure function unless flagged with $stateful\n fn.$$watchDelegate = inputsWatchDelegate;\n fn.inputs = parsedExpression.inputs ? parsedExpression.inputs : [parsedExpression];\n }\n\n return fn;\n }\n }];\n}\n\n/**\n * @ngdoc service\n * @name $q\n * @requires $rootScope\n *\n * @description\n * A service that helps you run functions asynchronously, and use their return values (or exceptions)\n * when they are done processing.\n *\n * This is an implementation of promises/deferred objects inspired by\n * [Kris Kowal's Q](https://github.com/kriskowal/q).\n *\n * $q can be used in two fashions --- one which is more similar to Kris Kowal's Q or jQuery's Deferred\n * implementations, and the other which resembles ES6 promises to some degree.\n *\n * # $q constructor\n *\n * The streamlined ES6 style promise is essentially just using $q as a constructor which takes a `resolver`\n * function as the first argument. This is similar to the native Promise implementation from ES6 Harmony,\n * see [MDN](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise).\n *\n * While the constructor-style use is supported, not all of the supporting methods from ES6 Harmony promises are\n * available yet.\n *\n * It can be used like so:\n *\n * ```js\n * // for the purpose of this example let's assume that variables `$q` and `okToGreet`\n * // are available in the current lexical scope (they could have been injected or passed in).\n *\n * function asyncGreet(name) {\n * // perform some asynchronous operation, resolve or reject the promise when appropriate.\n * return $q(function(resolve, reject) {\n * setTimeout(function() {\n * if (okToGreet(name)) {\n * resolve('Hello, ' + name + '!');\n * } else {\n * reject('Greeting ' + name + ' is not allowed.');\n * }\n * }, 1000);\n * });\n * }\n *\n * var promise = asyncGreet('Robin Hood');\n * promise.then(function(greeting) {\n * alert('Success: ' + greeting);\n * }, function(reason) {\n * alert('Failed: ' + reason);\n * });\n * ```\n *\n * Note: progress/notify callbacks are not currently supported via the ES6-style interface.\n *\n * However, the more traditional CommonJS-style usage is still available, and documented below.\n *\n * [The CommonJS Promise proposal](http://wiki.commonjs.org/wiki/Promises) describes a promise as an\n * interface for interacting with an object that represents the result of an action that is\n * performed asynchronously, and may or may not be finished at any given point in time.\n *\n * From the perspective of dealing with error handling, deferred and promise APIs are to\n * asynchronous programming what `try`, `catch` and `throw` keywords are to synchronous programming.\n *\n * ```js\n * // for the purpose of this example let's assume that variables `$q` and `okToGreet`\n * // are available in the current lexical scope (they could have been injected or passed in).\n *\n * function asyncGreet(name) {\n * var deferred = $q.defer();\n *\n * setTimeout(function() {\n * deferred.notify('About to greet ' + name + '.');\n *\n * if (okToGreet(name)) {\n * deferred.resolve('Hello, ' + name + '!');\n * } else {\n * deferred.reject('Greeting ' + name + ' is not allowed.');\n * }\n * }, 1000);\n *\n * return deferred.promise;\n * }\n *\n * var promise = asyncGreet('Robin Hood');\n * promise.then(function(greeting) {\n * alert('Success: ' + greeting);\n * }, function(reason) {\n * alert('Failed: ' + reason);\n * }, function(update) {\n * alert('Got notification: ' + update);\n * });\n * ```\n *\n * At first it might not be obvious why this extra complexity is worth the trouble. The payoff\n * comes in the way of guarantees that promise and deferred APIs make, see\n * https://github.com/kriskowal/uncommonjs/blob/master/promises/specification.md.\n *\n * Additionally the promise api allows for composition that is very hard to do with the\n * traditional callback ([CPS](http://en.wikipedia.org/wiki/Continuation-passing_style)) approach.\n * For more on this please see the [Q documentation](https://github.com/kriskowal/q) especially the\n * section on serial or parallel joining of promises.\n *\n * # The Deferred API\n *\n * A new instance of deferred is constructed by calling `$q.defer()`.\n *\n * The purpose of the deferred object is to expose the associated Promise instance as well as APIs\n * that can be used for signaling the successful or unsuccessful completion, as well as the status\n * of the task.\n *\n * **Methods**\n *\n * - `resolve(value)` – resolves the derived promise with the `value`. If the value is a rejection\n * constructed via `$q.reject`, the promise will be rejected instead.\n * - `reject(reason)` – rejects the derived promise with the `reason`. This is equivalent to\n * resolving it with a rejection constructed via `$q.reject`.\n * - `notify(value)` - provides updates on the status of the promise's execution. This may be called\n * multiple times before the promise is either resolved or rejected.\n *\n * **Properties**\n *\n * - promise – `{Promise}` – promise object associated with this deferred.\n *\n *\n * # The Promise API\n *\n * A new promise instance is created when a deferred instance is created and can be retrieved by\n * calling `deferred.promise`.\n *\n * The purpose of the promise object is to allow for interested parties to get access to the result\n * of the deferred task when it completes.\n *\n * **Methods**\n *\n * - `then(successCallback, errorCallback, notifyCallback)` – regardless of when the promise was or\n * will be resolved or rejected, `then` calls one of the success or error callbacks asynchronously\n * as soon as the result is available. The callbacks are called with a single argument: the result\n * or rejection reason. Additionally, the notify callback may be called zero or more times to\n * provide a progress indication, before the promise is resolved or rejected.\n *\n * This method *returns a new promise* which is resolved or rejected via the return value of the\n * `successCallback`, `errorCallback` (unless that value is a promise, in which case it is resolved\n * with the value which is resolved in that promise using\n * [promise chaining](http://www.html5rocks.com/en/tutorials/es6/promises/#toc-promises-queues)).\n * It also notifies via the return value of the `notifyCallback` method. The promise cannot be\n * resolved or rejected from the notifyCallback method.\n *\n * - `catch(errorCallback)` – shorthand for `promise.then(null, errorCallback)`\n *\n * - `finally(callback, notifyCallback)` – allows you to observe either the fulfillment or rejection of a promise,\n * but to do so without modifying the final value. This is useful to release resources or do some\n * clean-up that needs to be done whether the promise was rejected or resolved. See the [full\n * specification](https://github.com/kriskowal/q/wiki/API-Reference#promisefinallycallback) for\n * more information.\n *\n * # Chaining promises\n *\n * Because calling the `then` method of a promise returns a new derived promise, it is easily\n * possible to create a chain of promises:\n *\n * ```js\n * promiseB = promiseA.then(function(result) {\n * return result + 1;\n * });\n *\n * // promiseB will be resolved immediately after promiseA is resolved and its value\n * // will be the result of promiseA incremented by 1\n * ```\n *\n * It is possible to create chains of any length and since a promise can be resolved with another\n * promise (which will defer its resolution further), it is possible to pause/defer resolution of\n * the promises at any point in the chain. This makes it possible to implement powerful APIs like\n * $http's response interceptors.\n *\n *\n * # Differences between Kris Kowal's Q and $q\n *\n * There are two main differences:\n *\n * - $q is integrated with the {@link ng.$rootScope.Scope} Scope model observation\n * mechanism in angular, which means faster propagation of resolution or rejection into your\n * models and avoiding unnecessary browser repaints, which would result in flickering UI.\n * - Q has many more features than $q, but that comes at a cost of bytes. $q is tiny, but contains\n * all the important functionality needed for common async tasks.\n *\n * # Testing\n *\n * ```js\n * it('should simulate promise', inject(function($q, $rootScope) {\n * var deferred = $q.defer();\n * var promise = deferred.promise;\n * var resolvedValue;\n *\n * promise.then(function(value) { resolvedValue = value; });\n * expect(resolvedValue).toBeUndefined();\n *\n * // Simulate resolving of promise\n * deferred.resolve(123);\n * // Note that the 'then' function does not get called synchronously.\n * // This is because we want the promise API to always be async, whether or not\n * // it got called synchronously or asynchronously.\n * expect(resolvedValue).toBeUndefined();\n *\n * // Propagate promise resolution to 'then' functions using $apply().\n * $rootScope.$apply();\n * expect(resolvedValue).toEqual(123);\n * }));\n * ```\n *\n * @param {function(function, function)} resolver Function which is responsible for resolving or\n * rejecting the newly created promise. The first parameter is a function which resolves the\n * promise, the second parameter is a function which rejects the promise.\n *\n * @returns {Promise} The newly created promise.\n */\nfunction $QProvider() {\n\n this.$get = ['$rootScope', '$exceptionHandler', function($rootScope, $exceptionHandler) {\n return qFactory(function(callback) {\n $rootScope.$evalAsync(callback);\n }, $exceptionHandler);\n }];\n}\n\nfunction $$QProvider() {\n this.$get = ['$browser', '$exceptionHandler', function($browser, $exceptionHandler) {\n return qFactory(function(callback) {\n $browser.defer(callback);\n }, $exceptionHandler);\n }];\n}\n\n/**\n * Constructs a promise manager.\n *\n * @param {function(function)} nextTick Function for executing functions in the next turn.\n * @param {function(...*)} exceptionHandler Function into which unexpected exceptions are passed for\n * debugging purposes.\n * @returns {object} Promise manager.\n */\nfunction qFactory(nextTick, exceptionHandler) {\n var $qMinErr = minErr('$q', TypeError);\n function callOnce(self, resolveFn, rejectFn) {\n var called = false;\n function wrap(fn) {\n return function(value) {\n if (called) return;\n called = true;\n fn.call(self, value);\n };\n }\n\n return [wrap(resolveFn), wrap(rejectFn)];\n }\n\n /**\n * @ngdoc method\n * @name ng.$q#defer\n * @kind function\n *\n * @description\n * Creates a `Deferred` object which represents a task which will finish in the future.\n *\n * @returns {Deferred} Returns a new instance of deferred.\n */\n var defer = function() {\n return new Deferred();\n };\n\n function Promise() {\n this.$$state = { status: 0 };\n }\n\n Promise.prototype = {\n then: function(onFulfilled, onRejected, progressBack) {\n var result = new Deferred();\n\n this.$$state.pending = this.$$state.pending || [];\n this.$$state.pending.push([result, onFulfilled, onRejected, progressBack]);\n if (this.$$state.status > 0) scheduleProcessQueue(this.$$state);\n\n return result.promise;\n },\n\n \"catch\": function(callback) {\n return this.then(null, callback);\n },\n\n \"finally\": function(callback, progressBack) {\n return this.then(function(value) {\n return handleCallback(value, true, callback);\n }, function(error) {\n return handleCallback(error, false, callback);\n }, progressBack);\n }\n };\n\n //Faster, more basic than angular.bind http://jsperf.com/angular-bind-vs-custom-vs-native\n function simpleBind(context, fn) {\n return function(value) {\n fn.call(context, value);\n };\n }\n\n function processQueue(state) {\n var fn, deferred, pending;\n\n pending = state.pending;\n state.processScheduled = false;\n state.pending = undefined;\n for (var i = 0, ii = pending.length; i < ii; ++i) {\n deferred = pending[i][0];\n fn = pending[i][state.status];\n try {\n if (isFunction(fn)) {\n deferred.resolve(fn(state.value));\n } else if (state.status === 1) {\n deferred.resolve(state.value);\n } else {\n deferred.reject(state.value);\n }\n } catch (e) {\n deferred.reject(e);\n exceptionHandler(e);\n }\n }\n }\n\n function scheduleProcessQueue(state) {\n if (state.processScheduled || !state.pending) return;\n state.processScheduled = true;\n nextTick(function() { processQueue(state); });\n }\n\n function Deferred() {\n this.promise = new Promise();\n //Necessary to support unbound execution :/\n this.resolve = simpleBind(this, this.resolve);\n this.reject = simpleBind(this, this.reject);\n this.notify = simpleBind(this, this.notify);\n }\n\n Deferred.prototype = {\n resolve: function(val) {\n if (this.promise.$$state.status) return;\n if (val === this.promise) {\n this.$$reject($qMinErr(\n 'qcycle',\n \"Expected promise to be resolved with value other than itself '{0}'\",\n val));\n } else {\n this.$$resolve(val);\n }\n\n },\n\n $$resolve: function(val) {\n var then, fns;\n\n fns = callOnce(this, this.$$resolve, this.$$reject);\n try {\n if ((isObject(val) || isFunction(val))) then = val && val.then;\n if (isFunction(then)) {\n this.promise.$$state.status = -1;\n then.call(val, fns[0], fns[1], this.notify);\n } else {\n this.promise.$$state.value = val;\n this.promise.$$state.status = 1;\n scheduleProcessQueue(this.promise.$$state);\n }\n } catch (e) {\n fns[1](e);\n exceptionHandler(e);\n }\n },\n\n reject: function(reason) {\n if (this.promise.$$state.status) return;\n this.$$reject(reason);\n },\n\n $$reject: function(reason) {\n this.promise.$$state.value = reason;\n this.promise.$$state.status = 2;\n scheduleProcessQueue(this.promise.$$state);\n },\n\n notify: function(progress) {\n var callbacks = this.promise.$$state.pending;\n\n if ((this.promise.$$state.status <= 0) && callbacks && callbacks.length) {\n nextTick(function() {\n var callback, result;\n for (var i = 0, ii = callbacks.length; i < ii; i++) {\n result = callbacks[i][0];\n callback = callbacks[i][3];\n try {\n result.notify(isFunction(callback) ? callback(progress) : progress);\n } catch (e) {\n exceptionHandler(e);\n }\n }\n });\n }\n }\n };\n\n /**\n * @ngdoc method\n * @name $q#reject\n * @kind function\n *\n * @description\n * Creates a promise that is resolved as rejected with the specified `reason`. This api should be\n * used to forward rejection in a chain of promises. If you are dealing with the last promise in\n * a promise chain, you don't need to worry about it.\n *\n * When comparing deferreds/promises to the familiar behavior of try/catch/throw, think of\n * `reject` as the `throw` keyword in JavaScript. This also means that if you \"catch\" an error via\n * a promise error callback and you want to forward the error to the promise derived from the\n * current promise, you have to \"rethrow\" the error by returning a rejection constructed via\n * `reject`.\n *\n * ```js\n * promiseB = promiseA.then(function(result) {\n * // success: do something and resolve promiseB\n * // with the old or a new result\n * return result;\n * }, function(reason) {\n * // error: handle the error if possible and\n * // resolve promiseB with newPromiseOrValue,\n * // otherwise forward the rejection to promiseB\n * if (canHandle(reason)) {\n * // handle the error and recover\n * return newPromiseOrValue;\n * }\n * return $q.reject(reason);\n * });\n * ```\n *\n * @param {*} reason Constant, message, exception or an object representing the rejection reason.\n * @returns {Promise} Returns a promise that was already resolved as rejected with the `reason`.\n */\n var reject = function(reason) {\n var result = new Deferred();\n result.reject(reason);\n return result.promise;\n };\n\n var makePromise = function makePromise(value, resolved) {\n var result = new Deferred();\n if (resolved) {\n result.resolve(value);\n } else {\n result.reject(value);\n }\n return result.promise;\n };\n\n var handleCallback = function handleCallback(value, isResolved, callback) {\n var callbackOutput = null;\n try {\n if (isFunction(callback)) callbackOutput = callback();\n } catch (e) {\n return makePromise(e, false);\n }\n if (isPromiseLike(callbackOutput)) {\n return callbackOutput.then(function() {\n return makePromise(value, isResolved);\n }, function(error) {\n return makePromise(error, false);\n });\n } else {\n return makePromise(value, isResolved);\n }\n };\n\n /**\n * @ngdoc method\n * @name $q#when\n * @kind function\n *\n * @description\n * Wraps an object that might be a value or a (3rd party) then-able promise into a $q promise.\n * This is useful when you are dealing with an object that might or might not be a promise, or if\n * the promise comes from a source that can't be trusted.\n *\n * @param {*} value Value or a promise\n * @returns {Promise} Returns a promise of the passed value or promise\n */\n\n\n var when = function(value, callback, errback, progressBack) {\n var result = new Deferred();\n result.resolve(value);\n return result.promise.then(callback, errback, progressBack);\n };\n\n /**\n * @ngdoc method\n * @name $q#resolve\n * @kind function\n *\n * @description\n * Alias of {@link ng.$q#when when} to maintain naming consistency with ES6.\n *\n * @param {*} value Value or a promise\n * @returns {Promise} Returns a promise of the passed value or promise\n */\n var resolve = when;\n\n /**\n * @ngdoc method\n * @name $q#all\n * @kind function\n *\n * @description\n * Combines multiple promises into a single promise that is resolved when all of the input\n * promises are resolved.\n *\n * @param {Array.|Object.} promises An array or hash of promises.\n * @returns {Promise} Returns a single promise that will be resolved with an array/hash of values,\n * each value corresponding to the promise at the same index/key in the `promises` array/hash.\n * If any of the promises is resolved with a rejection, this resulting promise will be rejected\n * with the same rejection value.\n */\n\n function all(promises) {\n var deferred = new Deferred(),\n counter = 0,\n results = isArray(promises) ? [] : {};\n\n forEach(promises, function(promise, key) {\n counter++;\n when(promise).then(function(value) {\n if (results.hasOwnProperty(key)) return;\n results[key] = value;\n if (!(--counter)) deferred.resolve(results);\n }, function(reason) {\n if (results.hasOwnProperty(key)) return;\n deferred.reject(reason);\n });\n });\n\n if (counter === 0) {\n deferred.resolve(results);\n }\n\n return deferred.promise;\n }\n\n var $Q = function Q(resolver) {\n if (!isFunction(resolver)) {\n throw $qMinErr('norslvr', \"Expected resolverFn, got '{0}'\", resolver);\n }\n\n if (!(this instanceof Q)) {\n // More useful when $Q is the Promise itself.\n return new Q(resolver);\n }\n\n var deferred = new Deferred();\n\n function resolveFn(value) {\n deferred.resolve(value);\n }\n\n function rejectFn(reason) {\n deferred.reject(reason);\n }\n\n resolver(resolveFn, rejectFn);\n\n return deferred.promise;\n };\n\n $Q.defer = defer;\n $Q.reject = reject;\n $Q.when = when;\n $Q.resolve = resolve;\n $Q.all = all;\n\n return $Q;\n}\n\nfunction $$RAFProvider() { //rAF\n this.$get = ['$window', '$timeout', function($window, $timeout) {\n var requestAnimationFrame = $window.requestAnimationFrame ||\n $window.webkitRequestAnimationFrame;\n\n var cancelAnimationFrame = $window.cancelAnimationFrame ||\n $window.webkitCancelAnimationFrame ||\n $window.webkitCancelRequestAnimationFrame;\n\n var rafSupported = !!requestAnimationFrame;\n var rafFn = rafSupported\n ? function(fn) {\n var id = requestAnimationFrame(fn);\n return function() {\n cancelAnimationFrame(id);\n };\n }\n : function(fn) {\n var timer = $timeout(fn, 16.66, false); // 1000 / 60 = 16.666\n return function() {\n $timeout.cancel(timer);\n };\n };\n\n queueFn.supported = rafSupported;\n\n var cancelLastRAF;\n var taskCount = 0;\n var taskQueue = [];\n return queueFn;\n\n function flush() {\n for (var i = 0; i < taskQueue.length; i++) {\n var task = taskQueue[i];\n if (task) {\n taskQueue[i] = null;\n task();\n }\n }\n taskCount = taskQueue.length = 0;\n }\n\n function queueFn(asyncFn) {\n var index = taskQueue.length;\n\n taskCount++;\n taskQueue.push(asyncFn);\n\n if (index === 0) {\n cancelLastRAF = rafFn(flush);\n }\n\n return function cancelQueueFn() {\n if (index >= 0) {\n taskQueue[index] = null;\n index = null;\n\n if (--taskCount === 0 && cancelLastRAF) {\n cancelLastRAF();\n cancelLastRAF = null;\n taskQueue.length = 0;\n }\n }\n };\n }\n }];\n}\n\n/**\n * DESIGN NOTES\n *\n * The design decisions behind the scope are heavily favored for speed and memory consumption.\n *\n * The typical use of scope is to watch the expressions, which most of the time return the same\n * value as last time so we optimize the operation.\n *\n * Closures construction is expensive in terms of speed as well as memory:\n * - No closures, instead use prototypical inheritance for API\n * - Internal state needs to be stored on scope directly, which means that private state is\n * exposed as $$____ properties\n *\n * Loop operations are optimized by using while(count--) { ... }\n * - this means that in order to keep the same order of execution as addition we have to add\n * items to the array at the beginning (unshift) instead of at the end (push)\n *\n * Child scopes are created and removed often\n * - Using an array would be slow since inserts in middle are expensive so we use linked list\n *\n * There are few watches then a lot of observers. This is why you don't want the observer to be\n * implemented in the same way as watch. Watch requires return of initialization function which\n * are expensive to construct.\n */\n\n\n/**\n * @ngdoc provider\n * @name $rootScopeProvider\n * @description\n *\n * Provider for the $rootScope service.\n */\n\n/**\n * @ngdoc method\n * @name $rootScopeProvider#digestTtl\n * @description\n *\n * Sets the number of `$digest` iterations the scope should attempt to execute before giving up and\n * assuming that the model is unstable.\n *\n * The current default is 10 iterations.\n *\n * In complex applications it's possible that the dependencies between `$watch`s will result in\n * several digest iterations. However if an application needs more than the default 10 digest\n * iterations for its model to stabilize then you should investigate what is causing the model to\n * continuously change during the digest.\n *\n * Increasing the TTL could have performance implications, so you should not change it without\n * proper justification.\n *\n * @param {number} limit The number of digest iterations.\n */\n\n\n/**\n * @ngdoc service\n * @name $rootScope\n * @description\n *\n * Every application has a single root {@link ng.$rootScope.Scope scope}.\n * All other scopes are descendant scopes of the root scope. Scopes provide separation\n * between the model and the view, via a mechanism for watching the model for changes.\n * They also provide an event emission/broadcast and subscription facility. See the\n * {@link guide/scope developer guide on scopes}.\n */\nfunction $RootScopeProvider() {\n var TTL = 10;\n var $rootScopeMinErr = minErr('$rootScope');\n var lastDirtyWatch = null;\n var applyAsyncId = null;\n\n this.digestTtl = function(value) {\n if (arguments.length) {\n TTL = value;\n }\n return TTL;\n };\n\n function createChildScopeClass(parent) {\n function ChildScope() {\n this.$$watchers = this.$$nextSibling =\n this.$$childHead = this.$$childTail = null;\n this.$$listeners = {};\n this.$$listenerCount = {};\n this.$$watchersCount = 0;\n this.$id = nextUid();\n this.$$ChildScope = null;\n }\n ChildScope.prototype = parent;\n return ChildScope;\n }\n\n this.$get = ['$injector', '$exceptionHandler', '$parse', '$browser',\n function($injector, $exceptionHandler, $parse, $browser) {\n\n function destroyChildScope($event) {\n $event.currentScope.$$destroyed = true;\n }\n\n /**\n * @ngdoc type\n * @name $rootScope.Scope\n *\n * @description\n * A root scope can be retrieved using the {@link ng.$rootScope $rootScope} key from the\n * {@link auto.$injector $injector}. Child scopes are created using the\n * {@link ng.$rootScope.Scope#$new $new()} method. (Most scopes are created automatically when\n * compiled HTML template is executed.)\n *\n * Here is a simple scope snippet to show how you can interact with the scope.\n * ```html\n * \n * ```\n *\n * # Inheritance\n * A scope can inherit from a parent scope, as in this example:\n * ```js\n var parent = $rootScope;\n var child = parent.$new();\n\n parent.salutation = \"Hello\";\n expect(child.salutation).toEqual('Hello');\n\n child.salutation = \"Welcome\";\n expect(child.salutation).toEqual('Welcome');\n expect(parent.salutation).toEqual('Hello');\n * ```\n *\n * When interacting with `Scope` in tests, additional helper methods are available on the\n * instances of `Scope` type. See {@link ngMock.$rootScope.Scope ngMock Scope} for additional\n * details.\n *\n *\n * @param {Object.=} providers Map of service factory which need to be\n * provided for the current scope. Defaults to {@link ng}.\n * @param {Object.=} instanceCache Provides pre-instantiated services which should\n * append/override services provided by `providers`. This is handy\n * when unit-testing and having the need to override a default\n * service.\n * @returns {Object} Newly created scope.\n *\n */\n function Scope() {\n this.$id = nextUid();\n this.$$phase = this.$parent = this.$$watchers =\n this.$$nextSibling = this.$$prevSibling =\n this.$$childHead = this.$$childTail = null;\n this.$root = this;\n this.$$destroyed = false;\n this.$$listeners = {};\n this.$$listenerCount = {};\n this.$$watchersCount = 0;\n this.$$isolateBindings = null;\n }\n\n /**\n * @ngdoc property\n * @name $rootScope.Scope#$id\n *\n * @description\n * Unique scope ID (monotonically increasing) useful for debugging.\n */\n\n /**\n * @ngdoc property\n * @name $rootScope.Scope#$parent\n *\n * @description\n * Reference to the parent scope.\n */\n\n /**\n * @ngdoc property\n * @name $rootScope.Scope#$root\n *\n * @description\n * Reference to the root scope.\n */\n\n Scope.prototype = {\n constructor: Scope,\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$new\n * @kind function\n *\n * @description\n * Creates a new child {@link ng.$rootScope.Scope scope}.\n *\n * The parent scope will propagate the {@link ng.$rootScope.Scope#$digest $digest()} event.\n * The scope can be removed from the scope hierarchy using {@link ng.$rootScope.Scope#$destroy $destroy()}.\n *\n * {@link ng.$rootScope.Scope#$destroy $destroy()} must be called on a scope when it is\n * desired for the scope and its child scopes to be permanently detached from the parent and\n * thus stop participating in model change detection and listener notification by invoking.\n *\n * @param {boolean} isolate If true, then the scope does not prototypically inherit from the\n * parent scope. The scope is isolated, as it can not see parent scope properties.\n * When creating widgets, it is useful for the widget to not accidentally read parent\n * state.\n *\n * @param {Scope} [parent=this] The {@link ng.$rootScope.Scope `Scope`} that will be the `$parent`\n * of the newly created scope. Defaults to `this` scope if not provided.\n * This is used when creating a transclude scope to correctly place it\n * in the scope hierarchy while maintaining the correct prototypical\n * inheritance.\n *\n * @returns {Object} The newly created child scope.\n *\n */\n $new: function(isolate, parent) {\n var child;\n\n parent = parent || this;\n\n if (isolate) {\n child = new Scope();\n child.$root = this.$root;\n } else {\n // Only create a child scope class if somebody asks for one,\n // but cache it to allow the VM to optimize lookups.\n if (!this.$$ChildScope) {\n this.$$ChildScope = createChildScopeClass(this);\n }\n child = new this.$$ChildScope();\n }\n child.$parent = parent;\n child.$$prevSibling = parent.$$childTail;\n if (parent.$$childHead) {\n parent.$$childTail.$$nextSibling = child;\n parent.$$childTail = child;\n } else {\n parent.$$childHead = parent.$$childTail = child;\n }\n\n // When the new scope is not isolated or we inherit from `this`, and\n // the parent scope is destroyed, the property `$$destroyed` is inherited\n // prototypically. In all other cases, this property needs to be set\n // when the parent scope is destroyed.\n // The listener needs to be added after the parent is set\n if (isolate || parent != this) child.$on('$destroy', destroyChildScope);\n\n return child;\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$watch\n * @kind function\n *\n * @description\n * Registers a `listener` callback to be executed whenever the `watchExpression` changes.\n *\n * - The `watchExpression` is called on every call to {@link ng.$rootScope.Scope#$digest\n * $digest()} and should return the value that will be watched. (Since\n * {@link ng.$rootScope.Scope#$digest $digest()} reruns when it detects changes the\n * `watchExpression` can execute multiple times per\n * {@link ng.$rootScope.Scope#$digest $digest()} and should be idempotent.)\n * - The `listener` is called only when the value from the current `watchExpression` and the\n * previous call to `watchExpression` are not equal (with the exception of the initial run,\n * see below). Inequality is determined according to reference inequality,\n * [strict comparison](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Operators/Comparison_Operators)\n * via the `!==` Javascript operator, unless `objectEquality == true`\n * (see next point)\n * - When `objectEquality == true`, inequality of the `watchExpression` is determined\n * according to the {@link angular.equals} function. To save the value of the object for\n * later comparison, the {@link angular.copy} function is used. This therefore means that\n * watching complex objects will have adverse memory and performance implications.\n * - The watch `listener` may change the model, which may trigger other `listener`s to fire.\n * This is achieved by rerunning the watchers until no changes are detected. The rerun\n * iteration limit is 10 to prevent an infinite loop deadlock.\n *\n *\n * If you want to be notified whenever {@link ng.$rootScope.Scope#$digest $digest} is called,\n * you can register a `watchExpression` function with no `listener`. (Since `watchExpression`\n * can execute multiple times per {@link ng.$rootScope.Scope#$digest $digest} cycle when a\n * change is detected, be prepared for multiple calls to your listener.)\n *\n * After a watcher is registered with the scope, the `listener` fn is called asynchronously\n * (via {@link ng.$rootScope.Scope#$evalAsync $evalAsync}) to initialize the\n * watcher. In rare cases, this is undesirable because the listener is called when the result\n * of `watchExpression` didn't change. To detect this scenario within the `listener` fn, you\n * can compare the `newVal` and `oldVal`. If these two values are identical (`===`) then the\n * listener was called due to initialization.\n *\n *\n *\n * # Example\n * ```js\n // let's assume that scope was dependency injected as the $rootScope\n var scope = $rootScope;\n scope.name = 'misko';\n scope.counter = 0;\n\n expect(scope.counter).toEqual(0);\n scope.$watch('name', function(newValue, oldValue) {\n scope.counter = scope.counter + 1;\n });\n expect(scope.counter).toEqual(0);\n\n scope.$digest();\n // the listener is always called during the first $digest loop after it was registered\n expect(scope.counter).toEqual(1);\n\n scope.$digest();\n // but now it will not be called unless the value changes\n expect(scope.counter).toEqual(1);\n\n scope.name = 'adam';\n scope.$digest();\n expect(scope.counter).toEqual(2);\n\n\n\n // Using a function as a watchExpression\n var food;\n scope.foodCounter = 0;\n expect(scope.foodCounter).toEqual(0);\n scope.$watch(\n // This function returns the value being watched. It is called for each turn of the $digest loop\n function() { return food; },\n // This is the change listener, called when the value returned from the above function changes\n function(newValue, oldValue) {\n if ( newValue !== oldValue ) {\n // Only increment the counter if the value changed\n scope.foodCounter = scope.foodCounter + 1;\n }\n }\n );\n // No digest has been run so the counter will be zero\n expect(scope.foodCounter).toEqual(0);\n\n // Run the digest but since food has not changed count will still be zero\n scope.$digest();\n expect(scope.foodCounter).toEqual(0);\n\n // Update food and run digest. Now the counter will increment\n food = 'cheeseburger';\n scope.$digest();\n expect(scope.foodCounter).toEqual(1);\n\n * ```\n *\n *\n *\n * @param {(function()|string)} watchExpression Expression that is evaluated on each\n * {@link ng.$rootScope.Scope#$digest $digest} cycle. A change in the return value triggers\n * a call to the `listener`.\n *\n * - `string`: Evaluated as {@link guide/expression expression}\n * - `function(scope)`: called with current `scope` as a parameter.\n * @param {function(newVal, oldVal, scope)} listener Callback called whenever the value\n * of `watchExpression` changes.\n *\n * - `newVal` contains the current value of the `watchExpression`\n * - `oldVal` contains the previous value of the `watchExpression`\n * - `scope` refers to the current scope\n * @param {boolean=} objectEquality Compare for object equality using {@link angular.equals} instead of\n * comparing for reference equality.\n * @returns {function()} Returns a deregistration function for this listener.\n */\n $watch: function(watchExp, listener, objectEquality, prettyPrintExpression) {\n var get = $parse(watchExp);\n\n if (get.$$watchDelegate) {\n return get.$$watchDelegate(this, listener, objectEquality, get, watchExp);\n }\n var scope = this,\n array = scope.$$watchers,\n watcher = {\n fn: listener,\n last: initWatchVal,\n get: get,\n exp: prettyPrintExpression || watchExp,\n eq: !!objectEquality\n };\n\n lastDirtyWatch = null;\n\n if (!isFunction(listener)) {\n watcher.fn = noop;\n }\n\n if (!array) {\n array = scope.$$watchers = [];\n }\n // we use unshift since we use a while loop in $digest for speed.\n // the while loop reads in reverse order.\n array.unshift(watcher);\n incrementWatchersCount(this, 1);\n\n return function deregisterWatch() {\n if (arrayRemove(array, watcher) >= 0) {\n incrementWatchersCount(scope, -1);\n }\n lastDirtyWatch = null;\n };\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$watchGroup\n * @kind function\n *\n * @description\n * A variant of {@link ng.$rootScope.Scope#$watch $watch()} where it watches an array of `watchExpressions`.\n * If any one expression in the collection changes the `listener` is executed.\n *\n * - The items in the `watchExpressions` array are observed via standard $watch operation and are examined on every\n * call to $digest() to see if any items changes.\n * - The `listener` is called whenever any expression in the `watchExpressions` array changes.\n *\n * @param {Array.} watchExpressions Array of expressions that will be individually\n * watched using {@link ng.$rootScope.Scope#$watch $watch()}\n *\n * @param {function(newValues, oldValues, scope)} listener Callback called whenever the return value of any\n * expression in `watchExpressions` changes\n * The `newValues` array contains the current values of the `watchExpressions`, with the indexes matching\n * those of `watchExpression`\n * and the `oldValues` array contains the previous values of the `watchExpressions`, with the indexes matching\n * those of `watchExpression`\n * The `scope` refers to the current scope.\n * @returns {function()} Returns a de-registration function for all listeners.\n */\n $watchGroup: function(watchExpressions, listener) {\n var oldValues = new Array(watchExpressions.length);\n var newValues = new Array(watchExpressions.length);\n var deregisterFns = [];\n var self = this;\n var changeReactionScheduled = false;\n var firstRun = true;\n\n if (!watchExpressions.length) {\n // No expressions means we call the listener ASAP\n var shouldCall = true;\n self.$evalAsync(function() {\n if (shouldCall) listener(newValues, newValues, self);\n });\n return function deregisterWatchGroup() {\n shouldCall = false;\n };\n }\n\n if (watchExpressions.length === 1) {\n // Special case size of one\n return this.$watch(watchExpressions[0], function watchGroupAction(value, oldValue, scope) {\n newValues[0] = value;\n oldValues[0] = oldValue;\n listener(newValues, (value === oldValue) ? newValues : oldValues, scope);\n });\n }\n\n forEach(watchExpressions, function(expr, i) {\n var unwatchFn = self.$watch(expr, function watchGroupSubAction(value, oldValue) {\n newValues[i] = value;\n oldValues[i] = oldValue;\n if (!changeReactionScheduled) {\n changeReactionScheduled = true;\n self.$evalAsync(watchGroupAction);\n }\n });\n deregisterFns.push(unwatchFn);\n });\n\n function watchGroupAction() {\n changeReactionScheduled = false;\n\n if (firstRun) {\n firstRun = false;\n listener(newValues, newValues, self);\n } else {\n listener(newValues, oldValues, self);\n }\n }\n\n return function deregisterWatchGroup() {\n while (deregisterFns.length) {\n deregisterFns.shift()();\n }\n };\n },\n\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$watchCollection\n * @kind function\n *\n * @description\n * Shallow watches the properties of an object and fires whenever any of the properties change\n * (for arrays, this implies watching the array items; for object maps, this implies watching\n * the properties). If a change is detected, the `listener` callback is fired.\n *\n * - The `obj` collection is observed via standard $watch operation and is examined on every\n * call to $digest() to see if any items have been added, removed, or moved.\n * - The `listener` is called whenever anything within the `obj` has changed. Examples include\n * adding, removing, and moving items belonging to an object or array.\n *\n *\n * # Example\n * ```js\n $scope.names = ['igor', 'matias', 'misko', 'james'];\n $scope.dataCount = 4;\n\n $scope.$watchCollection('names', function(newNames, oldNames) {\n $scope.dataCount = newNames.length;\n });\n\n expect($scope.dataCount).toEqual(4);\n $scope.$digest();\n\n //still at 4 ... no changes\n expect($scope.dataCount).toEqual(4);\n\n $scope.names.pop();\n $scope.$digest();\n\n //now there's been a change\n expect($scope.dataCount).toEqual(3);\n * ```\n *\n *\n * @param {string|function(scope)} obj Evaluated as {@link guide/expression expression}. The\n * expression value should evaluate to an object or an array which is observed on each\n * {@link ng.$rootScope.Scope#$digest $digest} cycle. Any shallow change within the\n * collection will trigger a call to the `listener`.\n *\n * @param {function(newCollection, oldCollection, scope)} listener a callback function called\n * when a change is detected.\n * - The `newCollection` object is the newly modified data obtained from the `obj` expression\n * - The `oldCollection` object is a copy of the former collection data.\n * Due to performance considerations, the`oldCollection` value is computed only if the\n * `listener` function declares two or more arguments.\n * - The `scope` argument refers to the current scope.\n *\n * @returns {function()} Returns a de-registration function for this listener. When the\n * de-registration function is executed, the internal watch operation is terminated.\n */\n $watchCollection: function(obj, listener) {\n $watchCollectionInterceptor.$stateful = true;\n\n var self = this;\n // the current value, updated on each dirty-check run\n var newValue;\n // a shallow copy of the newValue from the last dirty-check run,\n // updated to match newValue during dirty-check run\n var oldValue;\n // a shallow copy of the newValue from when the last change happened\n var veryOldValue;\n // only track veryOldValue if the listener is asking for it\n var trackVeryOldValue = (listener.length > 1);\n var changeDetected = 0;\n var changeDetector = $parse(obj, $watchCollectionInterceptor);\n var internalArray = [];\n var internalObject = {};\n var initRun = true;\n var oldLength = 0;\n\n function $watchCollectionInterceptor(_value) {\n newValue = _value;\n var newLength, key, bothNaN, newItem, oldItem;\n\n // If the new value is undefined, then return undefined as the watch may be a one-time watch\n if (isUndefined(newValue)) return;\n\n if (!isObject(newValue)) { // if primitive\n if (oldValue !== newValue) {\n oldValue = newValue;\n changeDetected++;\n }\n } else if (isArrayLike(newValue)) {\n if (oldValue !== internalArray) {\n // we are transitioning from something which was not an array into array.\n oldValue = internalArray;\n oldLength = oldValue.length = 0;\n changeDetected++;\n }\n\n newLength = newValue.length;\n\n if (oldLength !== newLength) {\n // if lengths do not match we need to trigger change notification\n changeDetected++;\n oldValue.length = oldLength = newLength;\n }\n // copy the items to oldValue and look for changes.\n for (var i = 0; i < newLength; i++) {\n oldItem = oldValue[i];\n newItem = newValue[i];\n\n bothNaN = (oldItem !== oldItem) && (newItem !== newItem);\n if (!bothNaN && (oldItem !== newItem)) {\n changeDetected++;\n oldValue[i] = newItem;\n }\n }\n } else {\n if (oldValue !== internalObject) {\n // we are transitioning from something which was not an object into object.\n oldValue = internalObject = {};\n oldLength = 0;\n changeDetected++;\n }\n // copy the items to oldValue and look for changes.\n newLength = 0;\n for (key in newValue) {\n if (newValue.hasOwnProperty(key)) {\n newLength++;\n newItem = newValue[key];\n oldItem = oldValue[key];\n\n if (key in oldValue) {\n bothNaN = (oldItem !== oldItem) && (newItem !== newItem);\n if (!bothNaN && (oldItem !== newItem)) {\n changeDetected++;\n oldValue[key] = newItem;\n }\n } else {\n oldLength++;\n oldValue[key] = newItem;\n changeDetected++;\n }\n }\n }\n if (oldLength > newLength) {\n // we used to have more keys, need to find them and destroy them.\n changeDetected++;\n for (key in oldValue) {\n if (!newValue.hasOwnProperty(key)) {\n oldLength--;\n delete oldValue[key];\n }\n }\n }\n }\n return changeDetected;\n }\n\n function $watchCollectionAction() {\n if (initRun) {\n initRun = false;\n listener(newValue, newValue, self);\n } else {\n listener(newValue, veryOldValue, self);\n }\n\n // make a copy for the next time a collection is changed\n if (trackVeryOldValue) {\n if (!isObject(newValue)) {\n //primitive\n veryOldValue = newValue;\n } else if (isArrayLike(newValue)) {\n veryOldValue = new Array(newValue.length);\n for (var i = 0; i < newValue.length; i++) {\n veryOldValue[i] = newValue[i];\n }\n } else { // if object\n veryOldValue = {};\n for (var key in newValue) {\n if (hasOwnProperty.call(newValue, key)) {\n veryOldValue[key] = newValue[key];\n }\n }\n }\n }\n }\n\n return this.$watch(changeDetector, $watchCollectionAction);\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$digest\n * @kind function\n *\n * @description\n * Processes all of the {@link ng.$rootScope.Scope#$watch watchers} of the current scope and\n * its children. Because a {@link ng.$rootScope.Scope#$watch watcher}'s listener can change\n * the model, the `$digest()` keeps calling the {@link ng.$rootScope.Scope#$watch watchers}\n * until no more listeners are firing. This means that it is possible to get into an infinite\n * loop. This function will throw `'Maximum iteration limit exceeded.'` if the number of\n * iterations exceeds 10.\n *\n * Usually, you don't call `$digest()` directly in\n * {@link ng.directive:ngController controllers} or in\n * {@link ng.$compileProvider#directive directives}.\n * Instead, you should call {@link ng.$rootScope.Scope#$apply $apply()} (typically from within\n * a {@link ng.$compileProvider#directive directive}), which will force a `$digest()`.\n *\n * If you want to be notified whenever `$digest()` is called,\n * you can register a `watchExpression` function with\n * {@link ng.$rootScope.Scope#$watch $watch()} with no `listener`.\n *\n * In unit tests, you may need to call `$digest()` to simulate the scope life cycle.\n *\n * # Example\n * ```js\n var scope = ...;\n scope.name = 'misko';\n scope.counter = 0;\n\n expect(scope.counter).toEqual(0);\n scope.$watch('name', function(newValue, oldValue) {\n scope.counter = scope.counter + 1;\n });\n expect(scope.counter).toEqual(0);\n\n scope.$digest();\n // the listener is always called during the first $digest loop after it was registered\n expect(scope.counter).toEqual(1);\n\n scope.$digest();\n // but now it will not be called unless the value changes\n expect(scope.counter).toEqual(1);\n\n scope.name = 'adam';\n scope.$digest();\n expect(scope.counter).toEqual(2);\n * ```\n *\n */\n $digest: function() {\n var watch, value, last,\n watchers,\n length,\n dirty, ttl = TTL,\n next, current, target = this,\n watchLog = [],\n logIdx, logMsg, asyncTask;\n\n beginPhase('$digest');\n // Check for changes to browser url that happened in sync before the call to $digest\n $browser.$$checkUrlChange();\n\n if (this === $rootScope && applyAsyncId !== null) {\n // If this is the root scope, and $applyAsync has scheduled a deferred $apply(), then\n // cancel the scheduled $apply and flush the queue of expressions to be evaluated.\n $browser.defer.cancel(applyAsyncId);\n flushApplyAsync();\n }\n\n lastDirtyWatch = null;\n\n do { // \"while dirty\" loop\n dirty = false;\n current = target;\n\n while (asyncQueue.length) {\n try {\n asyncTask = asyncQueue.shift();\n asyncTask.scope.$eval(asyncTask.expression, asyncTask.locals);\n } catch (e) {\n $exceptionHandler(e);\n }\n lastDirtyWatch = null;\n }\n\n traverseScopesLoop:\n do { // \"traverse the scopes\" loop\n if ((watchers = current.$$watchers)) {\n // process our watches\n length = watchers.length;\n while (length--) {\n try {\n watch = watchers[length];\n // Most common watches are on primitives, in which case we can short\n // circuit it with === operator, only when === fails do we use .equals\n if (watch) {\n if ((value = watch.get(current)) !== (last = watch.last) &&\n !(watch.eq\n ? equals(value, last)\n : (typeof value === 'number' && typeof last === 'number'\n && isNaN(value) && isNaN(last)))) {\n dirty = true;\n lastDirtyWatch = watch;\n watch.last = watch.eq ? copy(value, null) : value;\n watch.fn(value, ((last === initWatchVal) ? value : last), current);\n if (ttl < 5) {\n logIdx = 4 - ttl;\n if (!watchLog[logIdx]) watchLog[logIdx] = [];\n watchLog[logIdx].push({\n msg: isFunction(watch.exp) ? 'fn: ' + (watch.exp.name || watch.exp.toString()) : watch.exp,\n newVal: value,\n oldVal: last\n });\n }\n } else if (watch === lastDirtyWatch) {\n // If the most recently dirty watcher is now clean, short circuit since the remaining watchers\n // have already been tested.\n dirty = false;\n break traverseScopesLoop;\n }\n }\n } catch (e) {\n $exceptionHandler(e);\n }\n }\n }\n\n // Insanity Warning: scope depth-first traversal\n // yes, this code is a bit crazy, but it works and we have tests to prove it!\n // this piece should be kept in sync with the traversal in $broadcast\n if (!(next = ((current.$$watchersCount && current.$$childHead) ||\n (current !== target && current.$$nextSibling)))) {\n while (current !== target && !(next = current.$$nextSibling)) {\n current = current.$parent;\n }\n }\n } while ((current = next));\n\n // `break traverseScopesLoop;` takes us to here\n\n if ((dirty || asyncQueue.length) && !(ttl--)) {\n clearPhase();\n throw $rootScopeMinErr('infdig',\n '{0} $digest() iterations reached. Aborting!\\n' +\n 'Watchers fired in the last 5 iterations: {1}',\n TTL, watchLog);\n }\n\n } while (dirty || asyncQueue.length);\n\n clearPhase();\n\n while (postDigestQueue.length) {\n try {\n postDigestQueue.shift()();\n } catch (e) {\n $exceptionHandler(e);\n }\n }\n },\n\n\n /**\n * @ngdoc event\n * @name $rootScope.Scope#$destroy\n * @eventType broadcast on scope being destroyed\n *\n * @description\n * Broadcasted when a scope and its children are being destroyed.\n *\n * Note that, in AngularJS, there is also a `$destroy` jQuery event, which can be used to\n * clean up DOM bindings before an element is removed from the DOM.\n */\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$destroy\n * @kind function\n *\n * @description\n * Removes the current scope (and all of its children) from the parent scope. Removal implies\n * that calls to {@link ng.$rootScope.Scope#$digest $digest()} will no longer\n * propagate to the current scope and its children. Removal also implies that the current\n * scope is eligible for garbage collection.\n *\n * The `$destroy()` is usually used by directives such as\n * {@link ng.directive:ngRepeat ngRepeat} for managing the\n * unrolling of the loop.\n *\n * Just before a scope is destroyed, a `$destroy` event is broadcasted on this scope.\n * Application code can register a `$destroy` event handler that will give it a chance to\n * perform any necessary cleanup.\n *\n * Note that, in AngularJS, there is also a `$destroy` jQuery event, which can be used to\n * clean up DOM bindings before an element is removed from the DOM.\n */\n $destroy: function() {\n // We can't destroy a scope that has been already destroyed.\n if (this.$$destroyed) return;\n var parent = this.$parent;\n\n this.$broadcast('$destroy');\n this.$$destroyed = true;\n\n if (this === $rootScope) {\n //Remove handlers attached to window when $rootScope is removed\n $browser.$$applicationDestroyed();\n }\n\n incrementWatchersCount(this, -this.$$watchersCount);\n for (var eventName in this.$$listenerCount) {\n decrementListenerCount(this, this.$$listenerCount[eventName], eventName);\n }\n\n // sever all the references to parent scopes (after this cleanup, the current scope should\n // not be retained by any of our references and should be eligible for garbage collection)\n if (parent && parent.$$childHead == this) parent.$$childHead = this.$$nextSibling;\n if (parent && parent.$$childTail == this) parent.$$childTail = this.$$prevSibling;\n if (this.$$prevSibling) this.$$prevSibling.$$nextSibling = this.$$nextSibling;\n if (this.$$nextSibling) this.$$nextSibling.$$prevSibling = this.$$prevSibling;\n\n // Disable listeners, watchers and apply/digest methods\n this.$destroy = this.$digest = this.$apply = this.$evalAsync = this.$applyAsync = noop;\n this.$on = this.$watch = this.$watchGroup = function() { return noop; };\n this.$$listeners = {};\n\n // All of the code below is bogus code that works around V8's memory leak via optimized code\n // and inline caches.\n //\n // see:\n // - https://code.google.com/p/v8/issues/detail?id=2073#c26\n // - https://github.com/angular/angular.js/issues/6794#issuecomment-38648909\n // - https://github.com/angular/angular.js/issues/1313#issuecomment-10378451\n\n this.$parent = this.$$nextSibling = this.$$prevSibling = this.$$childHead =\n this.$$childTail = this.$root = this.$$watchers = null;\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$eval\n * @kind function\n *\n * @description\n * Executes the `expression` on the current scope and returns the result. Any exceptions in\n * the expression are propagated (uncaught). This is useful when evaluating Angular\n * expressions.\n *\n * # Example\n * ```js\n var scope = ng.$rootScope.Scope();\n scope.a = 1;\n scope.b = 2;\n\n expect(scope.$eval('a+b')).toEqual(3);\n expect(scope.$eval(function(scope){ return scope.a + scope.b; })).toEqual(3);\n * ```\n *\n * @param {(string|function())=} expression An angular expression to be executed.\n *\n * - `string`: execute using the rules as defined in {@link guide/expression expression}.\n * - `function(scope)`: execute the function with the current `scope` parameter.\n *\n * @param {(object)=} locals Local variables object, useful for overriding values in scope.\n * @returns {*} The result of evaluating the expression.\n */\n $eval: function(expr, locals) {\n return $parse(expr)(this, locals);\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$evalAsync\n * @kind function\n *\n * @description\n * Executes the expression on the current scope at a later point in time.\n *\n * The `$evalAsync` makes no guarantees as to when the `expression` will be executed, only\n * that:\n *\n * - it will execute after the function that scheduled the evaluation (preferably before DOM\n * rendering).\n * - at least one {@link ng.$rootScope.Scope#$digest $digest cycle} will be performed after\n * `expression` execution.\n *\n * Any exceptions from the execution of the expression are forwarded to the\n * {@link ng.$exceptionHandler $exceptionHandler} service.\n *\n * __Note:__ if this function is called outside of a `$digest` cycle, a new `$digest` cycle\n * will be scheduled. However, it is encouraged to always call code that changes the model\n * from within an `$apply` call. That includes code evaluated via `$evalAsync`.\n *\n * @param {(string|function())=} expression An angular expression to be executed.\n *\n * - `string`: execute using the rules as defined in {@link guide/expression expression}.\n * - `function(scope)`: execute the function with the current `scope` parameter.\n *\n * @param {(object)=} locals Local variables object, useful for overriding values in scope.\n */\n $evalAsync: function(expr, locals) {\n // if we are outside of an $digest loop and this is the first time we are scheduling async\n // task also schedule async auto-flush\n if (!$rootScope.$$phase && !asyncQueue.length) {\n $browser.defer(function() {\n if (asyncQueue.length) {\n $rootScope.$digest();\n }\n });\n }\n\n asyncQueue.push({scope: this, expression: expr, locals: locals});\n },\n\n $$postDigest: function(fn) {\n postDigestQueue.push(fn);\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$apply\n * @kind function\n *\n * @description\n * `$apply()` is used to execute an expression in angular from outside of the angular\n * framework. (For example from browser DOM events, setTimeout, XHR or third party libraries).\n * Because we are calling into the angular framework we need to perform proper scope life\n * cycle of {@link ng.$exceptionHandler exception handling},\n * {@link ng.$rootScope.Scope#$digest executing watches}.\n *\n * ## Life cycle\n *\n * # Pseudo-Code of `$apply()`\n * ```js\n function $apply(expr) {\n try {\n return $eval(expr);\n } catch (e) {\n $exceptionHandler(e);\n } finally {\n $root.$digest();\n }\n }\n * ```\n *\n *\n * Scope's `$apply()` method transitions through the following stages:\n *\n * 1. The {@link guide/expression expression} is executed using the\n * {@link ng.$rootScope.Scope#$eval $eval()} method.\n * 2. Any exceptions from the execution of the expression are forwarded to the\n * {@link ng.$exceptionHandler $exceptionHandler} service.\n * 3. The {@link ng.$rootScope.Scope#$watch watch} listeners are fired immediately after the\n * expression was executed using the {@link ng.$rootScope.Scope#$digest $digest()} method.\n *\n *\n * @param {(string|function())=} exp An angular expression to be executed.\n *\n * - `string`: execute using the rules as defined in {@link guide/expression expression}.\n * - `function(scope)`: execute the function with current `scope` parameter.\n *\n * @returns {*} The result of evaluating the expression.\n */\n $apply: function(expr) {\n try {\n beginPhase('$apply');\n return this.$eval(expr);\n } catch (e) {\n $exceptionHandler(e);\n } finally {\n clearPhase();\n try {\n $rootScope.$digest();\n } catch (e) {\n $exceptionHandler(e);\n throw e;\n }\n }\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$applyAsync\n * @kind function\n *\n * @description\n * Schedule the invocation of $apply to occur at a later time. The actual time difference\n * varies across browsers, but is typically around ~10 milliseconds.\n *\n * This can be used to queue up multiple expressions which need to be evaluated in the same\n * digest.\n *\n * @param {(string|function())=} exp An angular expression to be executed.\n *\n * - `string`: execute using the rules as defined in {@link guide/expression expression}.\n * - `function(scope)`: execute the function with current `scope` parameter.\n */\n $applyAsync: function(expr) {\n var scope = this;\n expr && applyAsyncQueue.push($applyAsyncExpression);\n scheduleApplyAsync();\n\n function $applyAsyncExpression() {\n scope.$eval(expr);\n }\n },\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$on\n * @kind function\n *\n * @description\n * Listens on events of a given type. See {@link ng.$rootScope.Scope#$emit $emit} for\n * discussion of event life cycle.\n *\n * The event listener function format is: `function(event, args...)`. The `event` object\n * passed into the listener has the following attributes:\n *\n * - `targetScope` - `{Scope}`: the scope on which the event was `$emit`-ed or\n * `$broadcast`-ed.\n * - `currentScope` - `{Scope}`: the scope that is currently handling the event. Once the\n * event propagates through the scope hierarchy, this property is set to null.\n * - `name` - `{string}`: name of the event.\n * - `stopPropagation` - `{function=}`: calling `stopPropagation` function will cancel\n * further event propagation (available only for events that were `$emit`-ed).\n * - `preventDefault` - `{function}`: calling `preventDefault` sets `defaultPrevented` flag\n * to true.\n * - `defaultPrevented` - `{boolean}`: true if `preventDefault` was called.\n *\n * @param {string} name Event name to listen on.\n * @param {function(event, ...args)} listener Function to call when the event is emitted.\n * @returns {function()} Returns a deregistration function for this listener.\n */\n $on: function(name, listener) {\n var namedListeners = this.$$listeners[name];\n if (!namedListeners) {\n this.$$listeners[name] = namedListeners = [];\n }\n namedListeners.push(listener);\n\n var current = this;\n do {\n if (!current.$$listenerCount[name]) {\n current.$$listenerCount[name] = 0;\n }\n current.$$listenerCount[name]++;\n } while ((current = current.$parent));\n\n var self = this;\n return function() {\n var indexOfListener = namedListeners.indexOf(listener);\n if (indexOfListener !== -1) {\n namedListeners[indexOfListener] = null;\n decrementListenerCount(self, 1, name);\n }\n };\n },\n\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$emit\n * @kind function\n *\n * @description\n * Dispatches an event `name` upwards through the scope hierarchy notifying the\n * registered {@link ng.$rootScope.Scope#$on} listeners.\n *\n * The event life cycle starts at the scope on which `$emit` was called. All\n * {@link ng.$rootScope.Scope#$on listeners} listening for `name` event on this scope get\n * notified. Afterwards, the event traverses upwards toward the root scope and calls all\n * registered listeners along the way. The event will stop propagating if one of the listeners\n * cancels it.\n *\n * Any exception emitted from the {@link ng.$rootScope.Scope#$on listeners} will be passed\n * onto the {@link ng.$exceptionHandler $exceptionHandler} service.\n *\n * @param {string} name Event name to emit.\n * @param {...*} args Optional one or more arguments which will be passed onto the event listeners.\n * @return {Object} Event object (see {@link ng.$rootScope.Scope#$on}).\n */\n $emit: function(name, args) {\n var empty = [],\n namedListeners,\n scope = this,\n stopPropagation = false,\n event = {\n name: name,\n targetScope: scope,\n stopPropagation: function() {stopPropagation = true;},\n preventDefault: function() {\n event.defaultPrevented = true;\n },\n defaultPrevented: false\n },\n listenerArgs = concat([event], arguments, 1),\n i, length;\n\n do {\n namedListeners = scope.$$listeners[name] || empty;\n event.currentScope = scope;\n for (i = 0, length = namedListeners.length; i < length; i++) {\n\n // if listeners were deregistered, defragment the array\n if (!namedListeners[i]) {\n namedListeners.splice(i, 1);\n i--;\n length--;\n continue;\n }\n try {\n //allow all listeners attached to the current scope to run\n namedListeners[i].apply(null, listenerArgs);\n } catch (e) {\n $exceptionHandler(e);\n }\n }\n //if any listener on the current scope stops propagation, prevent bubbling\n if (stopPropagation) {\n event.currentScope = null;\n return event;\n }\n //traverse upwards\n scope = scope.$parent;\n } while (scope);\n\n event.currentScope = null;\n\n return event;\n },\n\n\n /**\n * @ngdoc method\n * @name $rootScope.Scope#$broadcast\n * @kind function\n *\n * @description\n * Dispatches an event `name` downwards to all child scopes (and their children) notifying the\n * registered {@link ng.$rootScope.Scope#$on} listeners.\n *\n * The event life cycle starts at the scope on which `$broadcast` was called. All\n * {@link ng.$rootScope.Scope#$on listeners} listening for `name` event on this scope get\n * notified. Afterwards, the event propagates to all direct and indirect scopes of the current\n * scope and calls all registered listeners along the way. The event cannot be canceled.\n *\n * Any exception emitted from the {@link ng.$rootScope.Scope#$on listeners} will be passed\n * onto the {@link ng.$exceptionHandler $exceptionHandler} service.\n *\n * @param {string} name Event name to broadcast.\n * @param {...*} args Optional one or more arguments which will be passed onto the event listeners.\n * @return {Object} Event object, see {@link ng.$rootScope.Scope#$on}\n */\n $broadcast: function(name, args) {\n var target = this,\n current = target,\n next = target,\n event = {\n name: name,\n targetScope: target,\n preventDefault: function() {\n event.defaultPrevented = true;\n },\n defaultPrevented: false\n };\n\n if (!target.$$listenerCount[name]) return event;\n\n var listenerArgs = concat([event], arguments, 1),\n listeners, i, length;\n\n //down while you can, then up and next sibling or up and next sibling until back at root\n while ((current = next)) {\n event.currentScope = current;\n listeners = current.$$listeners[name] || [];\n for (i = 0, length = listeners.length; i < length; i++) {\n // if listeners were deregistered, defragment the array\n if (!listeners[i]) {\n listeners.splice(i, 1);\n i--;\n length--;\n continue;\n }\n\n try {\n listeners[i].apply(null, listenerArgs);\n } catch (e) {\n $exceptionHandler(e);\n }\n }\n\n // Insanity Warning: scope depth-first traversal\n // yes, this code is a bit crazy, but it works and we have tests to prove it!\n // this piece should be kept in sync with the traversal in $digest\n // (though it differs due to having the extra check for $$listenerCount)\n if (!(next = ((current.$$listenerCount[name] && current.$$childHead) ||\n (current !== target && current.$$nextSibling)))) {\n while (current !== target && !(next = current.$$nextSibling)) {\n current = current.$parent;\n }\n }\n }\n\n event.currentScope = null;\n return event;\n }\n };\n\n var $rootScope = new Scope();\n\n //The internal queues. Expose them on the $rootScope for debugging/testing purposes.\n var asyncQueue = $rootScope.$$asyncQueue = [];\n var postDigestQueue = $rootScope.$$postDigestQueue = [];\n var applyAsyncQueue = $rootScope.$$applyAsyncQueue = [];\n\n return $rootScope;\n\n\n function beginPhase(phase) {\n if ($rootScope.$$phase) {\n throw $rootScopeMinErr('inprog', '{0} already in progress', $rootScope.$$phase);\n }\n\n $rootScope.$$phase = phase;\n }\n\n function clearPhase() {\n $rootScope.$$phase = null;\n }\n\n function incrementWatchersCount(current, count) {\n do {\n current.$$watchersCount += count;\n } while ((current = current.$parent));\n }\n\n function decrementListenerCount(current, count, name) {\n do {\n current.$$listenerCount[name] -= count;\n\n if (current.$$listenerCount[name] === 0) {\n delete current.$$listenerCount[name];\n }\n } while ((current = current.$parent));\n }\n\n /**\n * function used as an initial value for watchers.\n * because it's unique we can easily tell it apart from other values\n */\n function initWatchVal() {}\n\n function flushApplyAsync() {\n while (applyAsyncQueue.length) {\n try {\n applyAsyncQueue.shift()();\n } catch (e) {\n $exceptionHandler(e);\n }\n }\n applyAsyncId = null;\n }\n\n function scheduleApplyAsync() {\n if (applyAsyncId === null) {\n applyAsyncId = $browser.defer(function() {\n $rootScope.$apply(flushApplyAsync);\n });\n }\n }\n }];\n}\n\n/**\n * @description\n * Private service to sanitize uris for links and images. Used by $compile and $sanitize.\n */\nfunction $$SanitizeUriProvider() {\n var aHrefSanitizationWhitelist = /^\\s*(https?|ftp|mailto|tel|file):/,\n imgSrcSanitizationWhitelist = /^\\s*((https?|ftp|file|blob):|data:image\\/)/;\n\n /**\n * @description\n * Retrieves or overrides the default regular expression that is used for whitelisting of safe\n * urls during a[href] sanitization.\n *\n * The sanitization is a security measure aimed at prevent XSS attacks via html links.\n *\n * Any url about to be assigned to a[href] via data-binding is first normalized and turned into\n * an absolute url. Afterwards, the url is matched against the `aHrefSanitizationWhitelist`\n * regular expression. If a match is found, the original url is written into the dom. Otherwise,\n * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM.\n *\n * @param {RegExp=} regexp New regexp to whitelist urls with.\n * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for\n * chaining otherwise.\n */\n this.aHrefSanitizationWhitelist = function(regexp) {\n if (isDefined(regexp)) {\n aHrefSanitizationWhitelist = regexp;\n return this;\n }\n return aHrefSanitizationWhitelist;\n };\n\n\n /**\n * @description\n * Retrieves or overrides the default regular expression that is used for whitelisting of safe\n * urls during img[src] sanitization.\n *\n * The sanitization is a security measure aimed at prevent XSS attacks via html links.\n *\n * Any url about to be assigned to img[src] via data-binding is first normalized and turned into\n * an absolute url. Afterwards, the url is matched against the `imgSrcSanitizationWhitelist`\n * regular expression. If a match is found, the original url is written into the dom. Otherwise,\n * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM.\n *\n * @param {RegExp=} regexp New regexp to whitelist urls with.\n * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for\n * chaining otherwise.\n */\n this.imgSrcSanitizationWhitelist = function(regexp) {\n if (isDefined(regexp)) {\n imgSrcSanitizationWhitelist = regexp;\n return this;\n }\n return imgSrcSanitizationWhitelist;\n };\n\n this.$get = function() {\n return function sanitizeUri(uri, isImage) {\n var regex = isImage ? imgSrcSanitizationWhitelist : aHrefSanitizationWhitelist;\n var normalizedVal;\n normalizedVal = urlResolve(uri).href;\n if (normalizedVal !== '' && !normalizedVal.match(regex)) {\n return 'unsafe:' + normalizedVal;\n }\n return uri;\n };\n };\n}\n\n/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\n * Any commits to this file should be reviewed with security in mind. *\n * Changes to this file can potentially create security vulnerabilities. *\n * An approval from 2 Core members with history of modifying *\n * this file is required. *\n * *\n * Does the change somehow allow for arbitrary javascript to be executed? *\n * Or allows for someone to change the prototype of built-in objects? *\n * Or gives undesired access to variables likes document or window? *\n * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */\n\nvar $sceMinErr = minErr('$sce');\n\nvar SCE_CONTEXTS = {\n HTML: 'html',\n CSS: 'css',\n URL: 'url',\n // RESOURCE_URL is a subtype of URL used in contexts where a privileged resource is sourced from a\n // url. (e.g. ng-include, script src, templateUrl)\n RESOURCE_URL: 'resourceUrl',\n JS: 'js'\n};\n\n// Helper functions follow.\n\nfunction adjustMatcher(matcher) {\n if (matcher === 'self') {\n return matcher;\n } else if (isString(matcher)) {\n // Strings match exactly except for 2 wildcards - '*' and '**'.\n // '*' matches any character except those from the set ':/.?&'.\n // '**' matches any character (like .* in a RegExp).\n // More than 2 *'s raises an error as it's ill defined.\n if (matcher.indexOf('***') > -1) {\n throw $sceMinErr('iwcard',\n 'Illegal sequence *** in string matcher. String: {0}', matcher);\n }\n matcher = escapeForRegexp(matcher).\n replace('\\\\*\\\\*', '.*').\n replace('\\\\*', '[^:/.?&;]*');\n return new RegExp('^' + matcher + '$');\n } else if (isRegExp(matcher)) {\n // The only other type of matcher allowed is a Regexp.\n // Match entire URL / disallow partial matches.\n // Flags are reset (i.e. no global, ignoreCase or multiline)\n return new RegExp('^' + matcher.source + '$');\n } else {\n throw $sceMinErr('imatcher',\n 'Matchers may only be \"self\", string patterns or RegExp objects');\n }\n}\n\n\nfunction adjustMatchers(matchers) {\n var adjustedMatchers = [];\n if (isDefined(matchers)) {\n forEach(matchers, function(matcher) {\n adjustedMatchers.push(adjustMatcher(matcher));\n });\n }\n return adjustedMatchers;\n}\n\n\n/**\n * @ngdoc service\n * @name $sceDelegate\n * @kind function\n *\n * @description\n *\n * `$sceDelegate` is a service that is used by the `$sce` service to provide {@link ng.$sce Strict\n * Contextual Escaping (SCE)} services to AngularJS.\n *\n * Typically, you would configure or override the {@link ng.$sceDelegate $sceDelegate} instead of\n * the `$sce` service to customize the way Strict Contextual Escaping works in AngularJS. This is\n * because, while the `$sce` provides numerous shorthand methods, etc., you really only need to\n * override 3 core functions (`trustAs`, `getTrusted` and `valueOf`) to replace the way things\n * work because `$sce` delegates to `$sceDelegate` for these operations.\n *\n * Refer {@link ng.$sceDelegateProvider $sceDelegateProvider} to configure this service.\n *\n * The default instance of `$sceDelegate` should work out of the box with little pain. While you\n * can override it completely to change the behavior of `$sce`, the common case would\n * involve configuring the {@link ng.$sceDelegateProvider $sceDelegateProvider} instead by setting\n * your own whitelists and blacklists for trusting URLs used for loading AngularJS resources such as\n * templates. Refer {@link ng.$sceDelegateProvider#resourceUrlWhitelist\n * $sceDelegateProvider.resourceUrlWhitelist} and {@link\n * ng.$sceDelegateProvider#resourceUrlBlacklist $sceDelegateProvider.resourceUrlBlacklist}\n */\n\n/**\n * @ngdoc provider\n * @name $sceDelegateProvider\n * @description\n *\n * The `$sceDelegateProvider` provider allows developers to configure the {@link ng.$sceDelegate\n * $sceDelegate} service. This allows one to get/set the whitelists and blacklists used to ensure\n * that the URLs used for sourcing Angular templates are safe. Refer {@link\n * ng.$sceDelegateProvider#resourceUrlWhitelist $sceDelegateProvider.resourceUrlWhitelist} and\n * {@link ng.$sceDelegateProvider#resourceUrlBlacklist $sceDelegateProvider.resourceUrlBlacklist}\n *\n * For the general details about this service in Angular, read the main page for {@link ng.$sce\n * Strict Contextual Escaping (SCE)}.\n *\n * **Example**: Consider the following case. \n *\n * - your app is hosted at url `http://myapp.example.com/`\n * - but some of your templates are hosted on other domains you control such as\n * `http://srv01.assets.example.com/`,  `http://srv02.assets.example.com/`, etc.\n * - and you have an open redirect at `http://myapp.example.com/clickThru?...`.\n *\n * Here is what a secure configuration for this scenario might look like:\n *\n * ```\n * angular.module('myApp', []).config(function($sceDelegateProvider) {\n * $sceDelegateProvider.resourceUrlWhitelist([\n * // Allow same origin resource loads.\n * 'self',\n * // Allow loading from our assets domain. Notice the difference between * and **.\n * 'http://srv*.assets.example.com/**'\n * ]);\n *\n * // The blacklist overrides the whitelist so the open redirect here is blocked.\n * $sceDelegateProvider.resourceUrlBlacklist([\n * 'http://myapp.example.com/clickThru**'\n * ]);\n * });\n * ```\n */\n\nfunction $SceDelegateProvider() {\n this.SCE_CONTEXTS = SCE_CONTEXTS;\n\n // Resource URLs can also be trusted by policy.\n var resourceUrlWhitelist = ['self'],\n resourceUrlBlacklist = [];\n\n /**\n * @ngdoc method\n * @name $sceDelegateProvider#resourceUrlWhitelist\n * @kind function\n *\n * @param {Array=} whitelist When provided, replaces the resourceUrlWhitelist with the value\n * provided. This must be an array or null. A snapshot of this array is used so further\n * changes to the array are ignored.\n *\n * Follow {@link ng.$sce#resourceUrlPatternItem this link} for a description of the items\n * allowed in this array.\n *\n * Note: **an empty whitelist array will block all URLs**!\n *\n * @return {Array} the currently set whitelist array.\n *\n * The **default value** when no whitelist has been explicitly set is `['self']` allowing only\n * same origin resource requests.\n *\n * @description\n * Sets/Gets the whitelist of trusted resource URLs.\n */\n this.resourceUrlWhitelist = function(value) {\n if (arguments.length) {\n resourceUrlWhitelist = adjustMatchers(value);\n }\n return resourceUrlWhitelist;\n };\n\n /**\n * @ngdoc method\n * @name $sceDelegateProvider#resourceUrlBlacklist\n * @kind function\n *\n * @param {Array=} blacklist When provided, replaces the resourceUrlBlacklist with the value\n * provided. This must be an array or null. A snapshot of this array is used so further\n * changes to the array are ignored.\n *\n * Follow {@link ng.$sce#resourceUrlPatternItem this link} for a description of the items\n * allowed in this array.\n *\n * The typical usage for the blacklist is to **block\n * [open redirects](http://cwe.mitre.org/data/definitions/601.html)** served by your domain as\n * these would otherwise be trusted but actually return content from the redirected domain.\n *\n * Finally, **the blacklist overrides the whitelist** and has the final say.\n *\n * @return {Array} the currently set blacklist array.\n *\n * The **default value** when no whitelist has been explicitly set is the empty array (i.e. there\n * is no blacklist.)\n *\n * @description\n * Sets/Gets the blacklist of trusted resource URLs.\n */\n\n this.resourceUrlBlacklist = function(value) {\n if (arguments.length) {\n resourceUrlBlacklist = adjustMatchers(value);\n }\n return resourceUrlBlacklist;\n };\n\n this.$get = ['$injector', function($injector) {\n\n var htmlSanitizer = function htmlSanitizer(html) {\n throw $sceMinErr('unsafe', 'Attempting to use an unsafe value in a safe context.');\n };\n\n if ($injector.has('$sanitize')) {\n htmlSanitizer = $injector.get('$sanitize');\n }\n\n\n function matchUrl(matcher, parsedUrl) {\n if (matcher === 'self') {\n return urlIsSameOrigin(parsedUrl);\n } else {\n // definitely a regex. See adjustMatchers()\n return !!matcher.exec(parsedUrl.href);\n }\n }\n\n function isResourceUrlAllowedByPolicy(url) {\n var parsedUrl = urlResolve(url.toString());\n var i, n, allowed = false;\n // Ensure that at least one item from the whitelist allows this url.\n for (i = 0, n = resourceUrlWhitelist.length; i < n; i++) {\n if (matchUrl(resourceUrlWhitelist[i], parsedUrl)) {\n allowed = true;\n break;\n }\n }\n if (allowed) {\n // Ensure that no item from the blacklist blocked this url.\n for (i = 0, n = resourceUrlBlacklist.length; i < n; i++) {\n if (matchUrl(resourceUrlBlacklist[i], parsedUrl)) {\n allowed = false;\n break;\n }\n }\n }\n return allowed;\n }\n\n function generateHolderType(Base) {\n var holderType = function TrustedValueHolderType(trustedValue) {\n this.$$unwrapTrustedValue = function() {\n return trustedValue;\n };\n };\n if (Base) {\n holderType.prototype = new Base();\n }\n holderType.prototype.valueOf = function sceValueOf() {\n return this.$$unwrapTrustedValue();\n };\n holderType.prototype.toString = function sceToString() {\n return this.$$unwrapTrustedValue().toString();\n };\n return holderType;\n }\n\n var trustedValueHolderBase = generateHolderType(),\n byType = {};\n\n byType[SCE_CONTEXTS.HTML] = generateHolderType(trustedValueHolderBase);\n byType[SCE_CONTEXTS.CSS] = generateHolderType(trustedValueHolderBase);\n byType[SCE_CONTEXTS.URL] = generateHolderType(trustedValueHolderBase);\n byType[SCE_CONTEXTS.JS] = generateHolderType(trustedValueHolderBase);\n byType[SCE_CONTEXTS.RESOURCE_URL] = generateHolderType(byType[SCE_CONTEXTS.URL]);\n\n /**\n * @ngdoc method\n * @name $sceDelegate#trustAs\n *\n * @description\n * Returns an object that is trusted by angular for use in specified strict\n * contextual escaping contexts (such as ng-bind-html, ng-include, any src\n * attribute interpolation, any dom event binding attribute interpolation\n * such as for onclick, etc.) that uses the provided value.\n * See {@link ng.$sce $sce} for enabling strict contextual escaping.\n *\n * @param {string} type The kind of context in which this value is safe for use. e.g. url,\n * resourceUrl, html, js and css.\n * @param {*} value The value that that should be considered trusted/safe.\n * @returns {*} A value that can be used to stand in for the provided `value` in places\n * where Angular expects a $sce.trustAs() return value.\n */\n function trustAs(type, trustedValue) {\n var Constructor = (byType.hasOwnProperty(type) ? byType[type] : null);\n if (!Constructor) {\n throw $sceMinErr('icontext',\n 'Attempted to trust a value in invalid context. Context: {0}; Value: {1}',\n type, trustedValue);\n }\n if (trustedValue === null || trustedValue === undefined || trustedValue === '') {\n return trustedValue;\n }\n // All the current contexts in SCE_CONTEXTS happen to be strings. In order to avoid trusting\n // mutable objects, we ensure here that the value passed in is actually a string.\n if (typeof trustedValue !== 'string') {\n throw $sceMinErr('itype',\n 'Attempted to trust a non-string value in a content requiring a string: Context: {0}',\n type);\n }\n return new Constructor(trustedValue);\n }\n\n /**\n * @ngdoc method\n * @name $sceDelegate#valueOf\n *\n * @description\n * If the passed parameter had been returned by a prior call to {@link ng.$sceDelegate#trustAs\n * `$sceDelegate.trustAs`}, returns the value that had been passed to {@link\n * ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}.\n *\n * If the passed parameter is not a value that had been returned by {@link\n * ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}, returns it as-is.\n *\n * @param {*} value The result of a prior {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}\n * call or anything else.\n * @returns {*} The `value` that was originally provided to {@link ng.$sceDelegate#trustAs\n * `$sceDelegate.trustAs`} if `value` is the result of such a call. Otherwise, returns\n * `value` unchanged.\n */\n function valueOf(maybeTrusted) {\n if (maybeTrusted instanceof trustedValueHolderBase) {\n return maybeTrusted.$$unwrapTrustedValue();\n } else {\n return maybeTrusted;\n }\n }\n\n /**\n * @ngdoc method\n * @name $sceDelegate#getTrusted\n *\n * @description\n * Takes the result of a {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`} call and\n * returns the originally supplied value if the queried context type is a supertype of the\n * created type. If this condition isn't satisfied, throws an exception.\n *\n * @param {string} type The kind of context in which this value is to be used.\n * @param {*} maybeTrusted The result of a prior {@link ng.$sceDelegate#trustAs\n * `$sceDelegate.trustAs`} call.\n * @returns {*} The value the was originally provided to {@link ng.$sceDelegate#trustAs\n * `$sceDelegate.trustAs`} if valid in this context. Otherwise, throws an exception.\n */\n function getTrusted(type, maybeTrusted) {\n if (maybeTrusted === null || maybeTrusted === undefined || maybeTrusted === '') {\n return maybeTrusted;\n }\n var constructor = (byType.hasOwnProperty(type) ? byType[type] : null);\n if (constructor && maybeTrusted instanceof constructor) {\n return maybeTrusted.$$unwrapTrustedValue();\n }\n // If we get here, then we may only take one of two actions.\n // 1. sanitize the value for the requested type, or\n // 2. throw an exception.\n if (type === SCE_CONTEXTS.RESOURCE_URL) {\n if (isResourceUrlAllowedByPolicy(maybeTrusted)) {\n return maybeTrusted;\n } else {\n throw $sceMinErr('insecurl',\n 'Blocked loading resource from url not allowed by $sceDelegate policy. URL: {0}',\n maybeTrusted.toString());\n }\n } else if (type === SCE_CONTEXTS.HTML) {\n return htmlSanitizer(maybeTrusted);\n }\n throw $sceMinErr('unsafe', 'Attempting to use an unsafe value in a safe context.');\n }\n\n return { trustAs: trustAs,\n getTrusted: getTrusted,\n valueOf: valueOf };\n }];\n}\n\n\n/**\n * @ngdoc provider\n * @name $sceProvider\n * @description\n *\n * The $sceProvider provider allows developers to configure the {@link ng.$sce $sce} service.\n * - enable/disable Strict Contextual Escaping (SCE) in a module\n * - override the default implementation with a custom delegate\n *\n * Read more about {@link ng.$sce Strict Contextual Escaping (SCE)}.\n */\n\n/* jshint maxlen: false*/\n\n/**\n * @ngdoc service\n * @name $sce\n * @kind function\n *\n * @description\n *\n * `$sce` is a service that provides Strict Contextual Escaping services to AngularJS.\n *\n * # Strict Contextual Escaping\n *\n * Strict Contextual Escaping (SCE) is a mode in which AngularJS requires bindings in certain\n * contexts to result in a value that is marked as safe to use for that context. One example of\n * such a context is binding arbitrary html controlled by the user via `ng-bind-html`. We refer\n * to these contexts as privileged or SCE contexts.\n *\n * As of version 1.2, Angular ships with SCE enabled by default.\n *\n * Note: When enabled (the default), IE<11 in quirks mode is not supported. In this mode, IE<11 allow\n * one to execute arbitrary javascript by the use of the expression() syntax. Refer\n * to learn more about them.\n * You can ensure your document is in standards mode and not quirks mode by adding ``\n * to the top of your HTML document.\n *\n * SCE assists in writing code in way that (a) is secure by default and (b) makes auditing for\n * security vulnerabilities such as XSS, clickjacking, etc. a lot easier.\n *\n * Here's an example of a binding in a privileged context:\n *\n * ```\n * \n *
    \n * ```\n *\n * Notice that `ng-bind-html` is bound to `userHtml` controlled by the user. With SCE\n * disabled, this application allows the user to render arbitrary HTML into the DIV.\n * In a more realistic example, one may be rendering user comments, blog articles, etc. via\n * bindings. (HTML is just one example of a context where rendering user controlled input creates\n * security vulnerabilities.)\n *\n * For the case of HTML, you might use a library, either on the client side, or on the server side,\n * to sanitize unsafe HTML before binding to the value and rendering it in the document.\n *\n * How would you ensure that every place that used these types of bindings was bound to a value that\n * was sanitized by your library (or returned as safe for rendering by your server?) How can you\n * ensure that you didn't accidentally delete the line that sanitized the value, or renamed some\n * properties/fields and forgot to update the binding to the sanitized value?\n *\n * To be secure by default, you want to ensure that any such bindings are disallowed unless you can\n * determine that something explicitly says it's safe to use a value for binding in that\n * context. You can then audit your code (a simple grep would do) to ensure that this is only done\n * for those values that you can easily tell are safe - because they were received from your server,\n * sanitized by your library, etc. You can organize your codebase to help with this - perhaps\n * allowing only the files in a specific directory to do this. Ensuring that the internal API\n * exposed by that code doesn't markup arbitrary values as safe then becomes a more manageable task.\n *\n * In the case of AngularJS' SCE service, one uses {@link ng.$sce#trustAs $sce.trustAs}\n * (and shorthand methods such as {@link ng.$sce#trustAsHtml $sce.trustAsHtml}, etc.) to\n * obtain values that will be accepted by SCE / privileged contexts.\n *\n *\n * ## How does it work?\n *\n * In privileged contexts, directives and code will bind to the result of {@link ng.$sce#getTrusted\n * $sce.getTrusted(context, value)} rather than to the value directly. Directives use {@link\n * ng.$sce#parseAs $sce.parseAs} rather than `$parse` to watch attribute bindings, which performs the\n * {@link ng.$sce#getTrusted $sce.getTrusted} behind the scenes on non-constant literals.\n *\n * As an example, {@link ng.directive:ngBindHtml ngBindHtml} uses {@link\n * ng.$sce#parseAsHtml $sce.parseAsHtml(binding expression)}. Here's the actual code (slightly\n * simplified):\n *\n * ```\n * var ngBindHtmlDirective = ['$sce', function($sce) {\n * return function(scope, element, attr) {\n * scope.$watch($sce.parseAsHtml(attr.ngBindHtml), function(value) {\n * element.html(value || '');\n * });\n * };\n * }];\n * ```\n *\n * ## Impact on loading templates\n *\n * This applies both to the {@link ng.directive:ngInclude `ng-include`} directive as well as\n * `templateUrl`'s specified by {@link guide/directive directives}.\n *\n * By default, Angular only loads templates from the same domain and protocol as the application\n * document. This is done by calling {@link ng.$sce#getTrustedResourceUrl\n * $sce.getTrustedResourceUrl} on the template URL. To load templates from other domains and/or\n * protocols, you may either either {@link ng.$sceDelegateProvider#resourceUrlWhitelist whitelist\n * them} or {@link ng.$sce#trustAsResourceUrl wrap it} into a trusted value.\n *\n * *Please note*:\n * The browser's\n * [Same Origin Policy](https://code.google.com/p/browsersec/wiki/Part2#Same-origin_policy_for_XMLHttpRequest)\n * and [Cross-Origin Resource Sharing (CORS)](http://www.w3.org/TR/cors/)\n * policy apply in addition to this and may further restrict whether the template is successfully\n * loaded. This means that without the right CORS policy, loading templates from a different domain\n * won't work on all browsers. Also, loading templates from `file://` URL does not work on some\n * browsers.\n *\n * ## This feels like too much overhead\n *\n * It's important to remember that SCE only applies to interpolation expressions.\n *\n * If your expressions are constant literals, they're automatically trusted and you don't need to\n * call `$sce.trustAs` on them (remember to include the `ngSanitize` module) (e.g.\n * `
    implicitly trusted'\">
    `) just works.\n *\n * Additionally, `a[href]` and `img[src]` automatically sanitize their URLs and do not pass them\n * through {@link ng.$sce#getTrusted $sce.getTrusted}. SCE doesn't play a role here.\n *\n * The included {@link ng.$sceDelegate $sceDelegate} comes with sane defaults to allow you to load\n * templates in `ng-include` from your application's domain without having to even know about SCE.\n * It blocks loading templates from other domains or loading templates over http from an https\n * served document. You can change these by setting your own custom {@link\n * ng.$sceDelegateProvider#resourceUrlWhitelist whitelists} and {@link\n * ng.$sceDelegateProvider#resourceUrlBlacklist blacklists} for matching such URLs.\n *\n * This significantly reduces the overhead. It is far easier to pay the small overhead and have an\n * application that's secure and can be audited to verify that with much more ease than bolting\n * security onto an application later.\n *\n * \n * ## What trusted context types are supported?\n *\n * | Context | Notes |\n * |---------------------|----------------|\n * | `$sce.HTML` | For HTML that's safe to source into the application. The {@link ng.directive:ngBindHtml ngBindHtml} directive uses this context for bindings. If an unsafe value is encountered and the {@link ngSanitize $sanitize} module is present this will sanitize the value instead of throwing an error. |\n * | `$sce.CSS` | For CSS that's safe to source into the application. Currently unused. Feel free to use it in your own directives. |\n * | `$sce.URL` | For URLs that are safe to follow as links. Currently unused (`
    Note that `$sce.RESOURCE_URL` makes a stronger statement about the URL than `$sce.URL` does and therefore contexts requiring values trusted for `$sce.RESOURCE_URL` can be used anywhere that values trusted for `$sce.URL` are required. |\n * | `$sce.JS` | For JavaScript that is safe to execute in your application's context. Currently unused. Feel free to use it in your own directives. |\n *\n * ## Format of items in {@link ng.$sceDelegateProvider#resourceUrlWhitelist resourceUrlWhitelist}/{@link ng.$sceDelegateProvider#resourceUrlBlacklist Blacklist}
    \n *\n * Each element in these arrays must be one of the following:\n *\n * - **'self'**\n * - The special **string**, `'self'`, can be used to match against all URLs of the **same\n * domain** as the application document using the **same protocol**.\n * - **String** (except the special value `'self'`)\n * - The string is matched against the full *normalized / absolute URL* of the resource\n * being tested (substring matches are not good enough.)\n * - There are exactly **two wildcard sequences** - `*` and `**`. All other characters\n * match themselves.\n * - `*`: matches zero or more occurrences of any character other than one of the following 6\n * characters: '`:`', '`/`', '`.`', '`?`', '`&`' and ';'. It's a useful wildcard for use\n * in a whitelist.\n * - `**`: matches zero or more occurrences of *any* character. As such, it's not\n * not appropriate to use in for a scheme, domain, etc. as it would match too much. (e.g.\n * http://**.example.com/ would match http://evil.com/?ignore=.example.com/ and that might\n * not have been the intention.) Its usage at the very end of the path is ok. (e.g.\n * http://foo.example.com/templates/**).\n * - **RegExp** (*see caveat below*)\n * - *Caveat*: While regular expressions are powerful and offer great flexibility, their syntax\n * (and all the inevitable escaping) makes them *harder to maintain*. It's easy to\n * accidentally introduce a bug when one updates a complex expression (imho, all regexes should\n * have good test coverage.). For instance, the use of `.` in the regex is correct only in a\n * small number of cases. A `.` character in the regex used when matching the scheme or a\n * subdomain could be matched against a `:` or literal `.` that was likely not intended. It\n * is highly recommended to use the string patterns and only fall back to regular expressions\n * if they as a last resort.\n * - The regular expression must be an instance of RegExp (i.e. not a string.) It is\n * matched against the **entire** *normalized / absolute URL* of the resource being tested\n * (even when the RegExp did not have the `^` and `$` codes.) In addition, any flags\n * present on the RegExp (such as multiline, global, ignoreCase) are ignored.\n * - If you are generating your JavaScript from some other templating engine (not\n * recommended, e.g. in issue [#4006](https://github.com/angular/angular.js/issues/4006)),\n * remember to escape your regular expression (and be aware that you might need more than\n * one level of escaping depending on your templating engine and the way you interpolated\n * the value.) Do make use of your platform's escaping mechanism as it might be good\n * enough before coding your own. e.g. Ruby has\n * [Regexp.escape(str)](http://www.ruby-doc.org/core-2.0.0/Regexp.html#method-c-escape)\n * and Python has [re.escape](http://docs.python.org/library/re.html#re.escape).\n * Javascript lacks a similar built in function for escaping. Take a look at Google\n * Closure library's [goog.string.regExpEscape(s)](\n * http://docs.closure-library.googlecode.com/git/closure_goog_string_string.js.source.html#line962).\n *\n * Refer {@link ng.$sceDelegateProvider $sceDelegateProvider} for an example.\n *\n * ## Show me an example using SCE.\n *\n * \n * \n *
    \n *

    \n * User comments
    \n * By default, HTML that isn't explicitly trusted (e.g. Alice's comment) is sanitized when\n * $sanitize is available. If $sanitize isn't available, this results in an error instead of an\n * exploit.\n *
    \n *
    \n * {{userComment.name}}:\n * \n *
    \n *
    \n *
    \n *
    \n *
    \n *\n * \n * angular.module('mySceApp', ['ngSanitize'])\n * .controller('AppController', ['$http', '$templateCache', '$sce',\n * function($http, $templateCache, $sce) {\n * var self = this;\n * $http.get(\"test_data.json\", {cache: $templateCache}).success(function(userComments) {\n * self.userComments = userComments;\n * });\n * self.explicitlyTrustedHtml = $sce.trustAsHtml(\n * 'Hover over this text.');\n * }]);\n * \n *\n * \n * [\n * { \"name\": \"Alice\",\n * \"htmlComment\":\n * \"Is anyone reading this?\"\n * },\n * { \"name\": \"Bob\",\n * \"htmlComment\": \"Yes! Am I the only other one?\"\n * }\n * ]\n * \n *\n * \n * describe('SCE doc demo', function() {\n * it('should sanitize untrusted values', function() {\n * expect(element.all(by.css('.htmlComment')).first().getInnerHtml())\n * .toBe('Is anyone reading this?');\n * });\n *\n * it('should NOT sanitize explicitly trusted values', function() {\n * expect(element(by.id('explicitlyTrustedHtml')).getInnerHtml()).toBe(\n * 'Hover over this text.');\n * });\n * });\n * \n *
    \n *\n *\n *\n * ## Can I disable SCE completely?\n *\n * Yes, you can. However, this is strongly discouraged. SCE gives you a lot of security benefits\n * for little coding overhead. It will be much harder to take an SCE disabled application and\n * either secure it on your own or enable SCE at a later stage. It might make sense to disable SCE\n * for cases where you have a lot of existing code that was written before SCE was introduced and\n * you're migrating them a module at a time.\n *\n * That said, here's how you can completely disable SCE:\n *\n * ```\n * angular.module('myAppWithSceDisabledmyApp', []).config(function($sceProvider) {\n * // Completely disable SCE. For demonstration purposes only!\n * // Do not use in new projects.\n * $sceProvider.enabled(false);\n * });\n * ```\n *\n */\n/* jshint maxlen: 100 */\n\nfunction $SceProvider() {\n var enabled = true;\n\n /**\n * @ngdoc method\n * @name $sceProvider#enabled\n * @kind function\n *\n * @param {boolean=} value If provided, then enables/disables SCE.\n * @return {boolean} true if SCE is enabled, false otherwise.\n *\n * @description\n * Enables/disables SCE and returns the current value.\n */\n this.enabled = function(value) {\n if (arguments.length) {\n enabled = !!value;\n }\n return enabled;\n };\n\n\n /* Design notes on the default implementation for SCE.\n *\n * The API contract for the SCE delegate\n * -------------------------------------\n * The SCE delegate object must provide the following 3 methods:\n *\n * - trustAs(contextEnum, value)\n * This method is used to tell the SCE service that the provided value is OK to use in the\n * contexts specified by contextEnum. It must return an object that will be accepted by\n * getTrusted() for a compatible contextEnum and return this value.\n *\n * - valueOf(value)\n * For values that were not produced by trustAs(), return them as is. For values that were\n * produced by trustAs(), return the corresponding input value to trustAs. Basically, if\n * trustAs is wrapping the given values into some type, this operation unwraps it when given\n * such a value.\n *\n * - getTrusted(contextEnum, value)\n * This function should return the a value that is safe to use in the context specified by\n * contextEnum or throw and exception otherwise.\n *\n * NOTE: This contract deliberately does NOT state that values returned by trustAs() must be\n * opaque or wrapped in some holder object. That happens to be an implementation detail. For\n * instance, an implementation could maintain a registry of all trusted objects by context. In\n * such a case, trustAs() would return the same object that was passed in. getTrusted() would\n * return the same object passed in if it was found in the registry under a compatible context or\n * throw an exception otherwise. An implementation might only wrap values some of the time based\n * on some criteria. getTrusted() might return a value and not throw an exception for special\n * constants or objects even if not wrapped. All such implementations fulfill this contract.\n *\n *\n * A note on the inheritance model for SCE contexts\n * ------------------------------------------------\n * I've used inheritance and made RESOURCE_URL wrapped types a subtype of URL wrapped types. This\n * is purely an implementation details.\n *\n * The contract is simply this:\n *\n * getTrusted($sce.RESOURCE_URL, value) succeeding implies that getTrusted($sce.URL, value)\n * will also succeed.\n *\n * Inheritance happens to capture this in a natural way. In some future, we\n * may not use inheritance anymore. That is OK because no code outside of\n * sce.js and sceSpecs.js would need to be aware of this detail.\n */\n\n this.$get = ['$parse', '$sceDelegate', function(\n $parse, $sceDelegate) {\n // Prereq: Ensure that we're not running in IE<11 quirks mode. In that mode, IE < 11 allow\n // the \"expression(javascript expression)\" syntax which is insecure.\n if (enabled && msie < 8) {\n throw $sceMinErr('iequirks',\n 'Strict Contextual Escaping does not support Internet Explorer version < 11 in quirks ' +\n 'mode. You can fix this by adding the text to the top of your HTML ' +\n 'document. See http://docs.angularjs.org/api/ng.$sce for more information.');\n }\n\n var sce = shallowCopy(SCE_CONTEXTS);\n\n /**\n * @ngdoc method\n * @name $sce#isEnabled\n * @kind function\n *\n * @return {Boolean} true if SCE is enabled, false otherwise. If you want to set the value, you\n * have to do it at module config time on {@link ng.$sceProvider $sceProvider}.\n *\n * @description\n * Returns a boolean indicating if SCE is enabled.\n */\n sce.isEnabled = function() {\n return enabled;\n };\n sce.trustAs = $sceDelegate.trustAs;\n sce.getTrusted = $sceDelegate.getTrusted;\n sce.valueOf = $sceDelegate.valueOf;\n\n if (!enabled) {\n sce.trustAs = sce.getTrusted = function(type, value) { return value; };\n sce.valueOf = identity;\n }\n\n /**\n * @ngdoc method\n * @name $sce#parseAs\n *\n * @description\n * Converts Angular {@link guide/expression expression} into a function. This is like {@link\n * ng.$parse $parse} and is identical when the expression is a literal constant. Otherwise, it\n * wraps the expression in a call to {@link ng.$sce#getTrusted $sce.getTrusted(*type*,\n * *result*)}\n *\n * @param {string} type The kind of SCE context in which this result will be used.\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n sce.parseAs = function sceParseAs(type, expr) {\n var parsed = $parse(expr);\n if (parsed.literal && parsed.constant) {\n return parsed;\n } else {\n return $parse(expr, function(value) {\n return sce.getTrusted(type, value);\n });\n }\n };\n\n /**\n * @ngdoc method\n * @name $sce#trustAs\n *\n * @description\n * Delegates to {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}. As such,\n * returns an object that is trusted by angular for use in specified strict contextual\n * escaping contexts (such as ng-bind-html, ng-include, any src attribute\n * interpolation, any dom event binding attribute interpolation such as for onclick, etc.)\n * that uses the provided value. See * {@link ng.$sce $sce} for enabling strict contextual\n * escaping.\n *\n * @param {string} type The kind of context in which this value is safe for use. e.g. url,\n * resourceUrl, html, js and css.\n * @param {*} value The value that that should be considered trusted/safe.\n * @returns {*} A value that can be used to stand in for the provided `value` in places\n * where Angular expects a $sce.trustAs() return value.\n */\n\n /**\n * @ngdoc method\n * @name $sce#trustAsHtml\n *\n * @description\n * Shorthand method. `$sce.trustAsHtml(value)` →\n * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.HTML, value)`}\n *\n * @param {*} value The value to trustAs.\n * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedHtml\n * $sce.getTrustedHtml(value)} to obtain the original value. (privileged directives\n * only accept expressions that are either literal constants or are the\n * return value of {@link ng.$sce#trustAs $sce.trustAs}.)\n */\n\n /**\n * @ngdoc method\n * @name $sce#trustAsUrl\n *\n * @description\n * Shorthand method. `$sce.trustAsUrl(value)` →\n * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.URL, value)`}\n *\n * @param {*} value The value to trustAs.\n * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedUrl\n * $sce.getTrustedUrl(value)} to obtain the original value. (privileged directives\n * only accept expressions that are either literal constants or are the\n * return value of {@link ng.$sce#trustAs $sce.trustAs}.)\n */\n\n /**\n * @ngdoc method\n * @name $sce#trustAsResourceUrl\n *\n * @description\n * Shorthand method. `$sce.trustAsResourceUrl(value)` →\n * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.RESOURCE_URL, value)`}\n *\n * @param {*} value The value to trustAs.\n * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedResourceUrl\n * $sce.getTrustedResourceUrl(value)} to obtain the original value. (privileged directives\n * only accept expressions that are either literal constants or are the return\n * value of {@link ng.$sce#trustAs $sce.trustAs}.)\n */\n\n /**\n * @ngdoc method\n * @name $sce#trustAsJs\n *\n * @description\n * Shorthand method. `$sce.trustAsJs(value)` →\n * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.JS, value)`}\n *\n * @param {*} value The value to trustAs.\n * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedJs\n * $sce.getTrustedJs(value)} to obtain the original value. (privileged directives\n * only accept expressions that are either literal constants or are the\n * return value of {@link ng.$sce#trustAs $sce.trustAs}.)\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrusted\n *\n * @description\n * Delegates to {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted`}. As such,\n * takes the result of a {@link ng.$sce#trustAs `$sce.trustAs`}() call and returns the\n * originally supplied value if the queried context type is a supertype of the created type.\n * If this condition isn't satisfied, throws an exception.\n *\n * @param {string} type The kind of context in which this value is to be used.\n * @param {*} maybeTrusted The result of a prior {@link ng.$sce#trustAs `$sce.trustAs`}\n * call.\n * @returns {*} The value the was originally provided to\n * {@link ng.$sce#trustAs `$sce.trustAs`} if valid in this context.\n * Otherwise, throws an exception.\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrustedHtml\n *\n * @description\n * Shorthand method. `$sce.getTrustedHtml(value)` →\n * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.HTML, value)`}\n *\n * @param {*} value The value to pass to `$sce.getTrusted`.\n * @returns {*} The return value of `$sce.getTrusted($sce.HTML, value)`\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrustedCss\n *\n * @description\n * Shorthand method. `$sce.getTrustedCss(value)` →\n * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.CSS, value)`}\n *\n * @param {*} value The value to pass to `$sce.getTrusted`.\n * @returns {*} The return value of `$sce.getTrusted($sce.CSS, value)`\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrustedUrl\n *\n * @description\n * Shorthand method. `$sce.getTrustedUrl(value)` →\n * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.URL, value)`}\n *\n * @param {*} value The value to pass to `$sce.getTrusted`.\n * @returns {*} The return value of `$sce.getTrusted($sce.URL, value)`\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrustedResourceUrl\n *\n * @description\n * Shorthand method. `$sce.getTrustedResourceUrl(value)` →\n * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.RESOURCE_URL, value)`}\n *\n * @param {*} value The value to pass to `$sceDelegate.getTrusted`.\n * @returns {*} The return value of `$sce.getTrusted($sce.RESOURCE_URL, value)`\n */\n\n /**\n * @ngdoc method\n * @name $sce#getTrustedJs\n *\n * @description\n * Shorthand method. `$sce.getTrustedJs(value)` →\n * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.JS, value)`}\n *\n * @param {*} value The value to pass to `$sce.getTrusted`.\n * @returns {*} The return value of `$sce.getTrusted($sce.JS, value)`\n */\n\n /**\n * @ngdoc method\n * @name $sce#parseAsHtml\n *\n * @description\n * Shorthand method. `$sce.parseAsHtml(expression string)` →\n * {@link ng.$sce#parseAs `$sce.parseAs($sce.HTML, value)`}\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n\n /**\n * @ngdoc method\n * @name $sce#parseAsCss\n *\n * @description\n * Shorthand method. `$sce.parseAsCss(value)` →\n * {@link ng.$sce#parseAs `$sce.parseAs($sce.CSS, value)`}\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n\n /**\n * @ngdoc method\n * @name $sce#parseAsUrl\n *\n * @description\n * Shorthand method. `$sce.parseAsUrl(value)` →\n * {@link ng.$sce#parseAs `$sce.parseAs($sce.URL, value)`}\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n\n /**\n * @ngdoc method\n * @name $sce#parseAsResourceUrl\n *\n * @description\n * Shorthand method. `$sce.parseAsResourceUrl(value)` →\n * {@link ng.$sce#parseAs `$sce.parseAs($sce.RESOURCE_URL, value)`}\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n\n /**\n * @ngdoc method\n * @name $sce#parseAsJs\n *\n * @description\n * Shorthand method. `$sce.parseAsJs(value)` →\n * {@link ng.$sce#parseAs `$sce.parseAs($sce.JS, value)`}\n *\n * @param {string} expression String expression to compile.\n * @returns {function(context, locals)} a function which represents the compiled expression:\n *\n * * `context` – `{object}` – an object against which any expressions embedded in the strings\n * are evaluated against (typically a scope object).\n * * `locals` – `{object=}` – local variables context object, useful for overriding values in\n * `context`.\n */\n\n // Shorthand delegations.\n var parse = sce.parseAs,\n getTrusted = sce.getTrusted,\n trustAs = sce.trustAs;\n\n forEach(SCE_CONTEXTS, function(enumValue, name) {\n var lName = lowercase(name);\n sce[camelCase(\"parse_as_\" + lName)] = function(expr) {\n return parse(enumValue, expr);\n };\n sce[camelCase(\"get_trusted_\" + lName)] = function(value) {\n return getTrusted(enumValue, value);\n };\n sce[camelCase(\"trust_as_\" + lName)] = function(value) {\n return trustAs(enumValue, value);\n };\n });\n\n return sce;\n }];\n}\n\n/**\n * !!! This is an undocumented \"private\" service !!!\n *\n * @name $sniffer\n * @requires $window\n * @requires $document\n *\n * @property {boolean} history Does the browser support html5 history api ?\n * @property {boolean} transitions Does the browser support CSS transition events ?\n * @property {boolean} animations Does the browser support CSS animation events ?\n *\n * @description\n * This is very simple implementation of testing browser's features.\n */\nfunction $SnifferProvider() {\n this.$get = ['$window', '$document', function($window, $document) {\n var eventSupport = {},\n android =\n toInt((/android (\\d+)/.exec(lowercase(($window.navigator || {}).userAgent)) || [])[1]),\n boxee = /Boxee/i.test(($window.navigator || {}).userAgent),\n document = $document[0] || {},\n vendorPrefix,\n vendorRegex = /^(Moz|webkit|ms)(?=[A-Z])/,\n bodyStyle = document.body && document.body.style,\n transitions = false,\n animations = false,\n match;\n\n if (bodyStyle) {\n for (var prop in bodyStyle) {\n if (match = vendorRegex.exec(prop)) {\n vendorPrefix = match[0];\n vendorPrefix = vendorPrefix.substr(0, 1).toUpperCase() + vendorPrefix.substr(1);\n break;\n }\n }\n\n if (!vendorPrefix) {\n vendorPrefix = ('WebkitOpacity' in bodyStyle) && 'webkit';\n }\n\n transitions = !!(('transition' in bodyStyle) || (vendorPrefix + 'Transition' in bodyStyle));\n animations = !!(('animation' in bodyStyle) || (vendorPrefix + 'Animation' in bodyStyle));\n\n if (android && (!transitions || !animations)) {\n transitions = isString(bodyStyle.webkitTransition);\n animations = isString(bodyStyle.webkitAnimation);\n }\n }\n\n\n return {\n // Android has history.pushState, but it does not update location correctly\n // so let's not use the history API at all.\n // http://code.google.com/p/android/issues/detail?id=17471\n // https://github.com/angular/angular.js/issues/904\n\n // older webkit browser (533.9) on Boxee box has exactly the same problem as Android has\n // so let's not use the history API also\n // We are purposefully using `!(android < 4)` to cover the case when `android` is undefined\n // jshint -W018\n history: !!($window.history && $window.history.pushState && !(android < 4) && !boxee),\n // jshint +W018\n hasEvent: function(event) {\n // IE9 implements 'input' event it's so fubared that we rather pretend that it doesn't have\n // it. In particular the event is not fired when backspace or delete key are pressed or\n // when cut operation is performed.\n // IE10+ implements 'input' event but it erroneously fires under various situations,\n // e.g. when placeholder changes, or a form is focused.\n if (event === 'input' && msie <= 11) return false;\n\n if (isUndefined(eventSupport[event])) {\n var divElm = document.createElement('div');\n eventSupport[event] = 'on' + event in divElm;\n }\n\n return eventSupport[event];\n },\n csp: csp(),\n vendorPrefix: vendorPrefix,\n transitions: transitions,\n animations: animations,\n android: android\n };\n }];\n}\n\nvar $compileMinErr = minErr('$compile');\n\n/**\n * @ngdoc service\n * @name $templateRequest\n *\n * @description\n * The `$templateRequest` service runs security checks then downloads the provided template using\n * `$http` and, upon success, stores the contents inside of `$templateCache`. If the HTTP request\n * fails or the response data of the HTTP request is empty, a `$compile` error will be thrown (the\n * exception can be thwarted by setting the 2nd parameter of the function to true). Note that the\n * contents of `$templateCache` are trusted, so the call to `$sce.getTrustedUrl(tpl)` is omitted\n * when `tpl` is of type string and `$templateCache` has the matching entry.\n *\n * @param {string|TrustedResourceUrl} tpl The HTTP request template URL\n * @param {boolean=} ignoreRequestError Whether or not to ignore the exception when the request fails or the template is empty\n *\n * @return {Promise} a promise for the HTTP response data of the given URL.\n *\n * @property {number} totalPendingRequests total amount of pending template requests being downloaded.\n */\nfunction $TemplateRequestProvider() {\n this.$get = ['$templateCache', '$http', '$q', '$sce', function($templateCache, $http, $q, $sce) {\n function handleRequestFn(tpl, ignoreRequestError) {\n handleRequestFn.totalPendingRequests++;\n\n // We consider the template cache holds only trusted templates, so\n // there's no need to go through whitelisting again for keys that already\n // are included in there. This also makes Angular accept any script\n // directive, no matter its name. However, we still need to unwrap trusted\n // types.\n if (!isString(tpl) || !$templateCache.get(tpl)) {\n tpl = $sce.getTrustedResourceUrl(tpl);\n }\n\n var transformResponse = $http.defaults && $http.defaults.transformResponse;\n\n if (isArray(transformResponse)) {\n transformResponse = transformResponse.filter(function(transformer) {\n return transformer !== defaultHttpResponseTransform;\n });\n } else if (transformResponse === defaultHttpResponseTransform) {\n transformResponse = null;\n }\n\n var httpOptions = {\n cache: $templateCache,\n transformResponse: transformResponse\n };\n\n return $http.get(tpl, httpOptions)\n ['finally'](function() {\n handleRequestFn.totalPendingRequests--;\n })\n .then(function(response) {\n $templateCache.put(tpl, response.data);\n return response.data;\n }, handleError);\n\n function handleError(resp) {\n if (!ignoreRequestError) {\n throw $compileMinErr('tpload', 'Failed to load template: {0} (HTTP status: {1} {2})',\n tpl, resp.status, resp.statusText);\n }\n return $q.reject(resp);\n }\n }\n\n handleRequestFn.totalPendingRequests = 0;\n\n return handleRequestFn;\n }];\n}\n\nfunction $$TestabilityProvider() {\n this.$get = ['$rootScope', '$browser', '$location',\n function($rootScope, $browser, $location) {\n\n /**\n * @name $testability\n *\n * @description\n * The private $$testability service provides a collection of methods for use when debugging\n * or by automated test and debugging tools.\n */\n var testability = {};\n\n /**\n * @name $$testability#findBindings\n *\n * @description\n * Returns an array of elements that are bound (via ng-bind or {{}})\n * to expressions matching the input.\n *\n * @param {Element} element The element root to search from.\n * @param {string} expression The binding expression to match.\n * @param {boolean} opt_exactMatch If true, only returns exact matches\n * for the expression. Filters and whitespace are ignored.\n */\n testability.findBindings = function(element, expression, opt_exactMatch) {\n var bindings = element.getElementsByClassName('ng-binding');\n var matches = [];\n forEach(bindings, function(binding) {\n var dataBinding = angular.element(binding).data('$binding');\n if (dataBinding) {\n forEach(dataBinding, function(bindingName) {\n if (opt_exactMatch) {\n var matcher = new RegExp('(^|\\\\s)' + escapeForRegexp(expression) + '(\\\\s|\\\\||$)');\n if (matcher.test(bindingName)) {\n matches.push(binding);\n }\n } else {\n if (bindingName.indexOf(expression) != -1) {\n matches.push(binding);\n }\n }\n });\n }\n });\n return matches;\n };\n\n /**\n * @name $$testability#findModels\n *\n * @description\n * Returns an array of elements that are two-way found via ng-model to\n * expressions matching the input.\n *\n * @param {Element} element The element root to search from.\n * @param {string} expression The model expression to match.\n * @param {boolean} opt_exactMatch If true, only returns exact matches\n * for the expression.\n */\n testability.findModels = function(element, expression, opt_exactMatch) {\n var prefixes = ['ng-', 'data-ng-', 'ng\\\\:'];\n for (var p = 0; p < prefixes.length; ++p) {\n var attributeEquals = opt_exactMatch ? '=' : '*=';\n var selector = '[' + prefixes[p] + 'model' + attributeEquals + '\"' + expression + '\"]';\n var elements = element.querySelectorAll(selector);\n if (elements.length) {\n return elements;\n }\n }\n };\n\n /**\n * @name $$testability#getLocation\n *\n * @description\n * Shortcut for getting the location in a browser agnostic way. Returns\n * the path, search, and hash. (e.g. /path?a=b#hash)\n */\n testability.getLocation = function() {\n return $location.url();\n };\n\n /**\n * @name $$testability#setLocation\n *\n * @description\n * Shortcut for navigating to a location without doing a full page reload.\n *\n * @param {string} url The location url (path, search and hash,\n * e.g. /path?a=b#hash) to go to.\n */\n testability.setLocation = function(url) {\n if (url !== $location.url()) {\n $location.url(url);\n $rootScope.$digest();\n }\n };\n\n /**\n * @name $$testability#whenStable\n *\n * @description\n * Calls the callback when $timeout and $http requests are completed.\n *\n * @param {function} callback\n */\n testability.whenStable = function(callback) {\n $browser.notifyWhenNoOutstandingRequests(callback);\n };\n\n return testability;\n }];\n}\n\nfunction $TimeoutProvider() {\n this.$get = ['$rootScope', '$browser', '$q', '$$q', '$exceptionHandler',\n function($rootScope, $browser, $q, $$q, $exceptionHandler) {\n\n var deferreds = {};\n\n\n /**\n * @ngdoc service\n * @name $timeout\n *\n * @description\n * Angular's wrapper for `window.setTimeout`. The `fn` function is wrapped into a try/catch\n * block and delegates any exceptions to\n * {@link ng.$exceptionHandler $exceptionHandler} service.\n *\n * The return value of calling `$timeout` is a promise, which will be resolved when\n * the delay has passed and the timeout function, if provided, is executed.\n *\n * To cancel a timeout request, call `$timeout.cancel(promise)`.\n *\n * In tests you can use {@link ngMock.$timeout `$timeout.flush()`} to\n * synchronously flush the queue of deferred functions.\n *\n * If you only want a promise that will be resolved after some specified delay\n * then you can call `$timeout` without the `fn` function.\n *\n * @param {function()=} fn A function, whose execution should be delayed.\n * @param {number=} [delay=0] Delay in milliseconds.\n * @param {boolean=} [invokeApply=true] If set to `false` skips model dirty checking, otherwise\n * will invoke `fn` within the {@link ng.$rootScope.Scope#$apply $apply} block.\n * @param {...*=} Pass additional parameters to the executed function.\n * @returns {Promise} Promise that will be resolved when the timeout is reached. The value this\n * promise will be resolved with is the return value of the `fn` function.\n *\n */\n function timeout(fn, delay, invokeApply) {\n if (!isFunction(fn)) {\n invokeApply = delay;\n delay = fn;\n fn = noop;\n }\n\n var args = sliceArgs(arguments, 3),\n skipApply = (isDefined(invokeApply) && !invokeApply),\n deferred = (skipApply ? $$q : $q).defer(),\n promise = deferred.promise,\n timeoutId;\n\n timeoutId = $browser.defer(function() {\n try {\n deferred.resolve(fn.apply(null, args));\n } catch (e) {\n deferred.reject(e);\n $exceptionHandler(e);\n }\n finally {\n delete deferreds[promise.$$timeoutId];\n }\n\n if (!skipApply) $rootScope.$apply();\n }, delay);\n\n promise.$$timeoutId = timeoutId;\n deferreds[timeoutId] = deferred;\n\n return promise;\n }\n\n\n /**\n * @ngdoc method\n * @name $timeout#cancel\n *\n * @description\n * Cancels a task associated with the `promise`. As a result of this, the promise will be\n * resolved with a rejection.\n *\n * @param {Promise=} promise Promise returned by the `$timeout` function.\n * @returns {boolean} Returns `true` if the task hasn't executed yet and was successfully\n * canceled.\n */\n timeout.cancel = function(promise) {\n if (promise && promise.$$timeoutId in deferreds) {\n deferreds[promise.$$timeoutId].reject('canceled');\n delete deferreds[promise.$$timeoutId];\n return $browser.defer.cancel(promise.$$timeoutId);\n }\n return false;\n };\n\n return timeout;\n }];\n}\n\n// NOTE: The usage of window and document instead of $window and $document here is\n// deliberate. This service depends on the specific behavior of anchor nodes created by the\n// browser (resolving and parsing URLs) that is unlikely to be provided by mock objects and\n// cause us to break tests. In addition, when the browser resolves a URL for XHR, it\n// doesn't know about mocked locations and resolves URLs to the real document - which is\n// exactly the behavior needed here. There is little value is mocking these out for this\n// service.\nvar urlParsingNode = document.createElement(\"a\");\nvar originUrl = urlResolve(window.location.href);\n\n\n/**\n *\n * Implementation Notes for non-IE browsers\n * ----------------------------------------\n * Assigning a URL to the href property of an anchor DOM node, even one attached to the DOM,\n * results both in the normalizing and parsing of the URL. Normalizing means that a relative\n * URL will be resolved into an absolute URL in the context of the application document.\n * Parsing means that the anchor node's host, hostname, protocol, port, pathname and related\n * properties are all populated to reflect the normalized URL. This approach has wide\n * compatibility - Safari 1+, Mozilla 1+, Opera 7+,e etc. See\n * http://www.aptana.com/reference/html/api/HTMLAnchorElement.html\n *\n * Implementation Notes for IE\n * ---------------------------\n * IE >= 8 and <= 10 normalizes the URL when assigned to the anchor node similar to the other\n * browsers. However, the parsed components will not be set if the URL assigned did not specify\n * them. (e.g. if you assign a.href = \"foo\", then a.protocol, a.host, etc. will be empty.) We\n * work around that by performing the parsing in a 2nd step by taking a previously normalized\n * URL (e.g. by assigning to a.href) and assigning it a.href again. This correctly populates the\n * properties such as protocol, hostname, port, etc.\n *\n * IE7 does not normalize the URL when assigned to an anchor node. (Apparently, it does, if one\n * uses the inner HTML approach to assign the URL as part of an HTML snippet -\n * http://stackoverflow.com/a/472729) However, setting img[src] does normalize the URL.\n * Unfortunately, setting img[src] to something like \"javascript:foo\" on IE throws an exception.\n * Since the primary usage for normalizing URLs is to sanitize such URLs, we can't use that\n * method and IE < 8 is unsupported.\n *\n * References:\n * http://developer.mozilla.org/en-US/docs/Web/API/HTMLAnchorElement\n * http://www.aptana.com/reference/html/api/HTMLAnchorElement.html\n * http://url.spec.whatwg.org/#urlutils\n * https://github.com/angular/angular.js/pull/2902\n * http://james.padolsey.com/javascript/parsing-urls-with-the-dom/\n *\n * @kind function\n * @param {string} url The URL to be parsed.\n * @description Normalizes and parses a URL.\n * @returns {object} Returns the normalized URL as a dictionary.\n *\n * | member name | Description |\n * |---------------|----------------|\n * | href | A normalized version of the provided URL if it was not an absolute URL |\n * | protocol | The protocol including the trailing colon |\n * | host | The host and port (if the port is non-default) of the normalizedUrl |\n * | search | The search params, minus the question mark |\n * | hash | The hash string, minus the hash symbol\n * | hostname | The hostname\n * | port | The port, without \":\"\n * | pathname | The pathname, beginning with \"/\"\n *\n */\nfunction urlResolve(url) {\n var href = url;\n\n if (msie) {\n // Normalize before parse. Refer Implementation Notes on why this is\n // done in two steps on IE.\n urlParsingNode.setAttribute(\"href\", href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/')\n ? urlParsingNode.pathname\n : '/' + urlParsingNode.pathname\n };\n}\n\n/**\n * Parse a request URL and determine whether this is a same-origin request as the application document.\n *\n * @param {string|object} requestUrl The url of the request as a string that will be resolved\n * or a parsed URL object.\n * @returns {boolean} Whether the request is for the same origin as the application document.\n */\nfunction urlIsSameOrigin(requestUrl) {\n var parsed = (isString(requestUrl)) ? urlResolve(requestUrl) : requestUrl;\n return (parsed.protocol === originUrl.protocol &&\n parsed.host === originUrl.host);\n}\n\n/**\n * @ngdoc service\n * @name $window\n *\n * @description\n * A reference to the browser's `window` object. While `window`\n * is globally available in JavaScript, it causes testability problems, because\n * it is a global variable. In angular we always refer to it through the\n * `$window` service, so it may be overridden, removed or mocked for testing.\n *\n * Expressions, like the one defined for the `ngClick` directive in the example\n * below, are evaluated with respect to the current scope. Therefore, there is\n * no risk of inadvertently coding in a dependency on a global value in such an\n * expression.\n *\n * @example\n \n \n \n
    \n \n \n
    \n
    \n \n it('should display the greeting in the input box', function() {\n element(by.model('greeting')).sendKeys('Hello, E2E Tests');\n // If we click the button it will block the test runner\n // element(':button').click();\n });\n \n
    \n */\nfunction $WindowProvider() {\n this.$get = valueFn(window);\n}\n\n/**\n * @name $$cookieReader\n * @requires $document\n *\n * @description\n * This is a private service for reading cookies used by $http and ngCookies\n *\n * @return {Object} a key/value map of the current cookies\n */\nfunction $$CookieReader($document) {\n var rawDocument = $document[0] || {};\n var lastCookies = {};\n var lastCookieString = '';\n\n function safeDecodeURIComponent(str) {\n try {\n return decodeURIComponent(str);\n } catch (e) {\n return str;\n }\n }\n\n return function() {\n var cookieArray, cookie, i, index, name;\n var currentCookieString = rawDocument.cookie || '';\n\n if (currentCookieString !== lastCookieString) {\n lastCookieString = currentCookieString;\n cookieArray = lastCookieString.split('; ');\n lastCookies = {};\n\n for (i = 0; i < cookieArray.length; i++) {\n cookie = cookieArray[i];\n index = cookie.indexOf('=');\n if (index > 0) { //ignore nameless cookies\n name = safeDecodeURIComponent(cookie.substring(0, index));\n // the first value that is seen for a cookie is the most\n // specific one. values for the same cookie name that\n // follow are for less specific paths.\n if (lastCookies[name] === undefined) {\n lastCookies[name] = safeDecodeURIComponent(cookie.substring(index + 1));\n }\n }\n }\n }\n return lastCookies;\n };\n}\n\n$$CookieReader.$inject = ['$document'];\n\nfunction $$CookieReaderProvider() {\n this.$get = $$CookieReader;\n}\n\n/* global currencyFilter: true,\n dateFilter: true,\n filterFilter: true,\n jsonFilter: true,\n limitToFilter: true,\n lowercaseFilter: true,\n numberFilter: true,\n orderByFilter: true,\n uppercaseFilter: true,\n */\n\n/**\n * @ngdoc provider\n * @name $filterProvider\n * @description\n *\n * Filters are just functions which transform input to an output. However filters need to be\n * Dependency Injected. To achieve this a filter definition consists of a factory function which is\n * annotated with dependencies and is responsible for creating a filter function.\n *\n *
    \n * **Note:** Filter names must be valid angular {@link expression} identifiers, such as `uppercase` or `orderBy`.\n * Names with special characters, such as hyphens and dots, are not allowed. If you wish to namespace\n * your filters, then you can use capitalization (`myappSubsectionFilterx`) or underscores\n * (`myapp_subsection_filterx`).\n *
    \n *\n * ```js\n * // Filter registration\n * function MyModule($provide, $filterProvider) {\n * // create a service to demonstrate injection (not always needed)\n * $provide.value('greet', function(name){\n * return 'Hello ' + name + '!';\n * });\n *\n * // register a filter factory which uses the\n * // greet service to demonstrate DI.\n * $filterProvider.register('greet', function(greet){\n * // return the filter function which uses the greet service\n * // to generate salutation\n * return function(text) {\n * // filters need to be forgiving so check input validity\n * return text && greet(text) || text;\n * };\n * });\n * }\n * ```\n *\n * The filter function is registered with the `$injector` under the filter name suffix with\n * `Filter`.\n *\n * ```js\n * it('should be the same instance', inject(\n * function($filterProvider) {\n * $filterProvider.register('reverse', function(){\n * return ...;\n * });\n * },\n * function($filter, reverseFilter) {\n * expect($filter('reverse')).toBe(reverseFilter);\n * });\n * ```\n *\n *\n * For more information about how angular filters work, and how to create your own filters, see\n * {@link guide/filter Filters} in the Angular Developer Guide.\n */\n\n/**\n * @ngdoc service\n * @name $filter\n * @kind function\n * @description\n * Filters are used for formatting data displayed to the user.\n *\n * The general syntax in templates is as follows:\n *\n * {{ expression [| filter_name[:parameter_value] ... ] }}\n *\n * @param {String} name Name of the filter function to retrieve\n * @return {Function} the filter function\n * @example\n \n \n
    \n

    {{ originalText }}

    \n

    {{ filteredText }}

    \n
    \n
    \n\n \n angular.module('filterExample', [])\n .controller('MainCtrl', function($scope, $filter) {\n $scope.originalText = 'hello';\n $scope.filteredText = $filter('uppercase')($scope.originalText);\n });\n \n
    \n */\n$FilterProvider.$inject = ['$provide'];\nfunction $FilterProvider($provide) {\n var suffix = 'Filter';\n\n /**\n * @ngdoc method\n * @name $filterProvider#register\n * @param {string|Object} name Name of the filter function, or an object map of filters where\n * the keys are the filter names and the values are the filter factories.\n *\n *
    \n * **Note:** Filter names must be valid angular {@link expression} identifiers, such as `uppercase` or `orderBy`.\n * Names with special characters, such as hyphens and dots, are not allowed. If you wish to namespace\n * your filters, then you can use capitalization (`myappSubsectionFilterx`) or underscores\n * (`myapp_subsection_filterx`).\n *
    \n * @returns {Object} Registered filter instance, or if a map of filters was provided then a map\n * of the registered filter instances.\n */\n function register(name, factory) {\n if (isObject(name)) {\n var filters = {};\n forEach(name, function(filter, key) {\n filters[key] = register(key, filter);\n });\n return filters;\n } else {\n return $provide.factory(name + suffix, factory);\n }\n }\n this.register = register;\n\n this.$get = ['$injector', function($injector) {\n return function(name) {\n return $injector.get(name + suffix);\n };\n }];\n\n ////////////////////////////////////////\n\n /* global\n currencyFilter: false,\n dateFilter: false,\n filterFilter: false,\n jsonFilter: false,\n limitToFilter: false,\n lowercaseFilter: false,\n numberFilter: false,\n orderByFilter: false,\n uppercaseFilter: false,\n */\n\n register('currency', currencyFilter);\n register('date', dateFilter);\n register('filter', filterFilter);\n register('json', jsonFilter);\n register('limitTo', limitToFilter);\n register('lowercase', lowercaseFilter);\n register('number', numberFilter);\n register('orderBy', orderByFilter);\n register('uppercase', uppercaseFilter);\n}\n\n/**\n * @ngdoc filter\n * @name filter\n * @kind function\n *\n * @description\n * Selects a subset of items from `array` and returns it as a new array.\n *\n * @param {Array} array The source array.\n * @param {string|Object|function()} expression The predicate to be used for selecting items from\n * `array`.\n *\n * Can be one of:\n *\n * - `string`: The string is used for matching against the contents of the `array`. All strings or\n * objects with string properties in `array` that match this string will be returned. This also\n * applies to nested object properties.\n * The predicate can be negated by prefixing the string with `!`.\n *\n * - `Object`: A pattern object can be used to filter specific properties on objects contained\n * by `array`. For example `{name:\"M\", phone:\"1\"}` predicate will return an array of items\n * which have property `name` containing \"M\" and property `phone` containing \"1\". A special\n * property name `$` can be used (as in `{$:\"text\"}`) to accept a match against any\n * property of the object or its nested object properties. That's equivalent to the simple\n * substring match with a `string` as described above. The predicate can be negated by prefixing\n * the string with `!`.\n * For example `{name: \"!M\"}` predicate will return an array of items which have property `name`\n * not containing \"M\".\n *\n * Note that a named property will match properties on the same level only, while the special\n * `$` property will match properties on the same level or deeper. E.g. an array item like\n * `{name: {first: 'John', last: 'Doe'}}` will **not** be matched by `{name: 'John'}`, but\n * **will** be matched by `{$: 'John'}`.\n *\n * - `function(value, index, array)`: A predicate function can be used to write arbitrary filters.\n * The function is called for each element of the array, with the element, its index, and\n * the entire array itself as arguments.\n *\n * The final result is an array of those elements that the predicate returned true for.\n *\n * @param {function(actual, expected)|true|undefined} comparator Comparator which is used in\n * determining if the expected value (from the filter expression) and actual value (from\n * the object in the array) should be considered a match.\n *\n * Can be one of:\n *\n * - `function(actual, expected)`:\n * The function will be given the object value and the predicate value to compare and\n * should return true if both values should be considered equal.\n *\n * - `true`: A shorthand for `function(actual, expected) { return angular.equals(actual, expected)}`.\n * This is essentially strict comparison of expected and actual.\n *\n * - `false|undefined`: A short hand for a function which will look for a substring match in case\n * insensitive way.\n *\n * Primitive values are converted to strings. Objects are not compared against primitives,\n * unless they have a custom `toString` method (e.g. `Date` objects).\n *\n * @example\n \n \n
    \n\n \n \n \n \n \n \n \n
    NamePhone
    {{friend.name}}{{friend.phone}}
    \n
    \n
    \n
    \n
    \n
    \n \n \n \n \n \n \n
    NamePhone
    {{friendObj.name}}{{friendObj.phone}}
    \n
    \n \n var expectFriendNames = function(expectedNames, key) {\n element.all(by.repeater(key + ' in friends').column(key + '.name')).then(function(arr) {\n arr.forEach(function(wd, i) {\n expect(wd.getText()).toMatch(expectedNames[i]);\n });\n });\n };\n\n it('should search across all fields when filtering with a string', function() {\n var searchText = element(by.model('searchText'));\n searchText.clear();\n searchText.sendKeys('m');\n expectFriendNames(['Mary', 'Mike', 'Adam'], 'friend');\n\n searchText.clear();\n searchText.sendKeys('76');\n expectFriendNames(['John', 'Julie'], 'friend');\n });\n\n it('should search in specific fields when filtering with a predicate object', function() {\n var searchAny = element(by.model('search.$'));\n searchAny.clear();\n searchAny.sendKeys('i');\n expectFriendNames(['Mary', 'Mike', 'Julie', 'Juliette'], 'friendObj');\n });\n it('should use a equal comparison when comparator is true', function() {\n var searchName = element(by.model('search.name'));\n var strict = element(by.model('strict'));\n searchName.clear();\n searchName.sendKeys('Julie');\n strict.click();\n expectFriendNames(['Julie'], 'friendObj');\n });\n \n
    \n */\nfunction filterFilter() {\n return function(array, expression, comparator) {\n if (!isArrayLike(array)) {\n if (array == null) {\n return array;\n } else {\n throw minErr('filter')('notarray', 'Expected array but received: {0}', array);\n }\n }\n\n var expressionType = getTypeForFilter(expression);\n var predicateFn;\n var matchAgainstAnyProp;\n\n switch (expressionType) {\n case 'function':\n predicateFn = expression;\n break;\n case 'boolean':\n case 'null':\n case 'number':\n case 'string':\n matchAgainstAnyProp = true;\n //jshint -W086\n case 'object':\n //jshint +W086\n predicateFn = createPredicateFn(expression, comparator, matchAgainstAnyProp);\n break;\n default:\n return array;\n }\n\n return Array.prototype.filter.call(array, predicateFn);\n };\n}\n\n// Helper functions for `filterFilter`\nfunction createPredicateFn(expression, comparator, matchAgainstAnyProp) {\n var shouldMatchPrimitives = isObject(expression) && ('$' in expression);\n var predicateFn;\n\n if (comparator === true) {\n comparator = equals;\n } else if (!isFunction(comparator)) {\n comparator = function(actual, expected) {\n if (isUndefined(actual)) {\n // No substring matching against `undefined`\n return false;\n }\n if ((actual === null) || (expected === null)) {\n // No substring matching against `null`; only match against `null`\n return actual === expected;\n }\n if (isObject(expected) || (isObject(actual) && !hasCustomToString(actual))) {\n // Should not compare primitives against objects, unless they have custom `toString` method\n return false;\n }\n\n actual = lowercase('' + actual);\n expected = lowercase('' + expected);\n return actual.indexOf(expected) !== -1;\n };\n }\n\n predicateFn = function(item) {\n if (shouldMatchPrimitives && !isObject(item)) {\n return deepCompare(item, expression.$, comparator, false);\n }\n return deepCompare(item, expression, comparator, matchAgainstAnyProp);\n };\n\n return predicateFn;\n}\n\nfunction deepCompare(actual, expected, comparator, matchAgainstAnyProp, dontMatchWholeObject) {\n var actualType = getTypeForFilter(actual);\n var expectedType = getTypeForFilter(expected);\n\n if ((expectedType === 'string') && (expected.charAt(0) === '!')) {\n return !deepCompare(actual, expected.substring(1), comparator, matchAgainstAnyProp);\n } else if (isArray(actual)) {\n // In case `actual` is an array, consider it a match\n // if ANY of it's items matches `expected`\n return actual.some(function(item) {\n return deepCompare(item, expected, comparator, matchAgainstAnyProp);\n });\n }\n\n switch (actualType) {\n case 'object':\n var key;\n if (matchAgainstAnyProp) {\n for (key in actual) {\n if ((key.charAt(0) !== '$') && deepCompare(actual[key], expected, comparator, true)) {\n return true;\n }\n }\n return dontMatchWholeObject ? false : deepCompare(actual, expected, comparator, false);\n } else if (expectedType === 'object') {\n for (key in expected) {\n var expectedVal = expected[key];\n if (isFunction(expectedVal) || isUndefined(expectedVal)) {\n continue;\n }\n\n var matchAnyProperty = key === '$';\n var actualVal = matchAnyProperty ? actual : actual[key];\n if (!deepCompare(actualVal, expectedVal, comparator, matchAnyProperty, matchAnyProperty)) {\n return false;\n }\n }\n return true;\n } else {\n return comparator(actual, expected);\n }\n break;\n case 'function':\n return false;\n default:\n return comparator(actual, expected);\n }\n}\n\n// Used for easily differentiating between `null` and actual `object`\nfunction getTypeForFilter(val) {\n return (val === null) ? 'null' : typeof val;\n}\n\n/**\n * @ngdoc filter\n * @name currency\n * @kind function\n *\n * @description\n * Formats a number as a currency (ie $1,234.56). When no currency symbol is provided, default\n * symbol for current locale is used.\n *\n * @param {number} amount Input to filter.\n * @param {string=} symbol Currency symbol or identifier to be displayed.\n * @param {number=} fractionSize Number of decimal places to round the amount to, defaults to default max fraction size for current locale\n * @returns {string} Formatted number.\n *\n *\n * @example\n \n \n \n
    \n
    \n default currency symbol ($): {{amount | currency}}
    \n custom currency identifier (USD$): {{amount | currency:\"USD$\"}}\n no fractions (0): {{amount | currency:\"USD$\":0}}\n
    \n
    \n \n it('should init with 1234.56', function() {\n expect(element(by.id('currency-default')).getText()).toBe('$1,234.56');\n expect(element(by.id('currency-custom')).getText()).toBe('USD$1,234.56');\n expect(element(by.id('currency-no-fractions')).getText()).toBe('USD$1,235');\n });\n it('should update', function() {\n if (browser.params.browser == 'safari') {\n // Safari does not understand the minus key. See\n // https://github.com/angular/protractor/issues/481\n return;\n }\n element(by.model('amount')).clear();\n element(by.model('amount')).sendKeys('-1234');\n expect(element(by.id('currency-default')).getText()).toBe('($1,234.00)');\n expect(element(by.id('currency-custom')).getText()).toBe('(USD$1,234.00)');\n expect(element(by.id('currency-no-fractions')).getText()).toBe('(USD$1,234)');\n });\n \n
    \n */\ncurrencyFilter.$inject = ['$locale'];\nfunction currencyFilter($locale) {\n var formats = $locale.NUMBER_FORMATS;\n return function(amount, currencySymbol, fractionSize) {\n if (isUndefined(currencySymbol)) {\n currencySymbol = formats.CURRENCY_SYM;\n }\n\n if (isUndefined(fractionSize)) {\n fractionSize = formats.PATTERNS[1].maxFrac;\n }\n\n // if null or undefined pass it through\n return (amount == null)\n ? amount\n : formatNumber(amount, formats.PATTERNS[1], formats.GROUP_SEP, formats.DECIMAL_SEP, fractionSize).\n replace(/\\u00A4/g, currencySymbol);\n };\n}\n\n/**\n * @ngdoc filter\n * @name number\n * @kind function\n *\n * @description\n * Formats a number as text.\n *\n * If the input is null or undefined, it will just be returned.\n * If the input is infinite (Infinity/-Infinity) the Infinity symbol '∞' is returned.\n * If the input is not a number an empty string is returned.\n *\n *\n * @param {number|string} number Number to format.\n * @param {(number|string)=} fractionSize Number of decimal places to round the number to.\n * If this is not provided then the fraction size is computed from the current locale's number\n * formatting pattern. In the case of the default locale, it will be 3.\n * @returns {string} Number rounded to decimalPlaces and places a “,” after each third digit.\n *\n * @example\n \n \n \n
    \n
    \n Default formatting: {{val | number}}
    \n No fractions: {{val | number:0}}
    \n Negative number: {{-val | number:4}}\n
    \n
    \n \n it('should format numbers', function() {\n expect(element(by.id('number-default')).getText()).toBe('1,234.568');\n expect(element(by.binding('val | number:0')).getText()).toBe('1,235');\n expect(element(by.binding('-val | number:4')).getText()).toBe('-1,234.5679');\n });\n\n it('should update', function() {\n element(by.model('val')).clear();\n element(by.model('val')).sendKeys('3374.333');\n expect(element(by.id('number-default')).getText()).toBe('3,374.333');\n expect(element(by.binding('val | number:0')).getText()).toBe('3,374');\n expect(element(by.binding('-val | number:4')).getText()).toBe('-3,374.3330');\n });\n \n
    \n */\n\n\nnumberFilter.$inject = ['$locale'];\nfunction numberFilter($locale) {\n var formats = $locale.NUMBER_FORMATS;\n return function(number, fractionSize) {\n\n // if null or undefined pass it through\n return (number == null)\n ? number\n : formatNumber(number, formats.PATTERNS[0], formats.GROUP_SEP, formats.DECIMAL_SEP,\n fractionSize);\n };\n}\n\nvar DECIMAL_SEP = '.';\nfunction formatNumber(number, pattern, groupSep, decimalSep, fractionSize) {\n if (isObject(number)) return '';\n\n var isNegative = number < 0;\n number = Math.abs(number);\n\n var isInfinity = number === Infinity;\n if (!isInfinity && !isFinite(number)) return '';\n\n var numStr = number + '',\n formatedText = '',\n hasExponent = false,\n parts = [];\n\n if (isInfinity) formatedText = '\\u221e';\n\n if (!isInfinity && numStr.indexOf('e') !== -1) {\n var match = numStr.match(/([\\d\\.]+)e(-?)(\\d+)/);\n if (match && match[2] == '-' && match[3] > fractionSize + 1) {\n number = 0;\n } else {\n formatedText = numStr;\n hasExponent = true;\n }\n }\n\n if (!isInfinity && !hasExponent) {\n var fractionLen = (numStr.split(DECIMAL_SEP)[1] || '').length;\n\n // determine fractionSize if it is not specified\n if (isUndefined(fractionSize)) {\n fractionSize = Math.min(Math.max(pattern.minFrac, fractionLen), pattern.maxFrac);\n }\n\n // safely round numbers in JS without hitting imprecisions of floating-point arithmetics\n // inspired by:\n // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/round\n number = +(Math.round(+(number.toString() + 'e' + fractionSize)).toString() + 'e' + -fractionSize);\n\n var fraction = ('' + number).split(DECIMAL_SEP);\n var whole = fraction[0];\n fraction = fraction[1] || '';\n\n var i, pos = 0,\n lgroup = pattern.lgSize,\n group = pattern.gSize;\n\n if (whole.length >= (lgroup + group)) {\n pos = whole.length - lgroup;\n for (i = 0; i < pos; i++) {\n if ((pos - i) % group === 0 && i !== 0) {\n formatedText += groupSep;\n }\n formatedText += whole.charAt(i);\n }\n }\n\n for (i = pos; i < whole.length; i++) {\n if ((whole.length - i) % lgroup === 0 && i !== 0) {\n formatedText += groupSep;\n }\n formatedText += whole.charAt(i);\n }\n\n // format fraction part.\n while (fraction.length < fractionSize) {\n fraction += '0';\n }\n\n if (fractionSize && fractionSize !== \"0\") formatedText += decimalSep + fraction.substr(0, fractionSize);\n } else {\n if (fractionSize > 0 && number < 1) {\n formatedText = number.toFixed(fractionSize);\n number = parseFloat(formatedText);\n }\n }\n\n if (number === 0) {\n isNegative = false;\n }\n\n parts.push(isNegative ? pattern.negPre : pattern.posPre,\n formatedText,\n isNegative ? pattern.negSuf : pattern.posSuf);\n return parts.join('');\n}\n\nfunction padNumber(num, digits, trim) {\n var neg = '';\n if (num < 0) {\n neg = '-';\n num = -num;\n }\n num = '' + num;\n while (num.length < digits) num = '0' + num;\n if (trim) {\n num = num.substr(num.length - digits);\n }\n return neg + num;\n}\n\n\nfunction dateGetter(name, size, offset, trim) {\n offset = offset || 0;\n return function(date) {\n var value = date['get' + name]();\n if (offset > 0 || value > -offset) {\n value += offset;\n }\n if (value === 0 && offset == -12) value = 12;\n return padNumber(value, size, trim);\n };\n}\n\nfunction dateStrGetter(name, shortForm) {\n return function(date, formats) {\n var value = date['get' + name]();\n var get = uppercase(shortForm ? ('SHORT' + name) : name);\n\n return formats[get][value];\n };\n}\n\nfunction timeZoneGetter(date, formats, offset) {\n var zone = -1 * offset;\n var paddedZone = (zone >= 0) ? \"+\" : \"\";\n\n paddedZone += padNumber(Math[zone > 0 ? 'floor' : 'ceil'](zone / 60), 2) +\n padNumber(Math.abs(zone % 60), 2);\n\n return paddedZone;\n}\n\nfunction getFirstThursdayOfYear(year) {\n // 0 = index of January\n var dayOfWeekOnFirst = (new Date(year, 0, 1)).getDay();\n // 4 = index of Thursday (+1 to account for 1st = 5)\n // 11 = index of *next* Thursday (+1 account for 1st = 12)\n return new Date(year, 0, ((dayOfWeekOnFirst <= 4) ? 5 : 12) - dayOfWeekOnFirst);\n}\n\nfunction getThursdayThisWeek(datetime) {\n return new Date(datetime.getFullYear(), datetime.getMonth(),\n // 4 = index of Thursday\n datetime.getDate() + (4 - datetime.getDay()));\n}\n\nfunction weekGetter(size) {\n return function(date) {\n var firstThurs = getFirstThursdayOfYear(date.getFullYear()),\n thisThurs = getThursdayThisWeek(date);\n\n var diff = +thisThurs - +firstThurs,\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n\n return padNumber(result, size);\n };\n}\n\nfunction ampmGetter(date, formats) {\n return date.getHours() < 12 ? formats.AMPMS[0] : formats.AMPMS[1];\n}\n\nfunction eraGetter(date, formats) {\n return date.getFullYear() <= 0 ? formats.ERAS[0] : formats.ERAS[1];\n}\n\nfunction longEraGetter(date, formats) {\n return date.getFullYear() <= 0 ? formats.ERANAMES[0] : formats.ERANAMES[1];\n}\n\nvar DATE_FORMATS = {\n yyyy: dateGetter('FullYear', 4),\n yy: dateGetter('FullYear', 2, 0, true),\n y: dateGetter('FullYear', 1),\n MMMM: dateStrGetter('Month'),\n MMM: dateStrGetter('Month', true),\n MM: dateGetter('Month', 2, 1),\n M: dateGetter('Month', 1, 1),\n dd: dateGetter('Date', 2),\n d: dateGetter('Date', 1),\n HH: dateGetter('Hours', 2),\n H: dateGetter('Hours', 1),\n hh: dateGetter('Hours', 2, -12),\n h: dateGetter('Hours', 1, -12),\n mm: dateGetter('Minutes', 2),\n m: dateGetter('Minutes', 1),\n ss: dateGetter('Seconds', 2),\n s: dateGetter('Seconds', 1),\n // while ISO 8601 requires fractions to be prefixed with `.` or `,`\n // we can be just safely rely on using `sss` since we currently don't support single or two digit fractions\n sss: dateGetter('Milliseconds', 3),\n EEEE: dateStrGetter('Day'),\n EEE: dateStrGetter('Day', true),\n a: ampmGetter,\n Z: timeZoneGetter,\n ww: weekGetter(2),\n w: weekGetter(1),\n G: eraGetter,\n GG: eraGetter,\n GGG: eraGetter,\n GGGG: longEraGetter\n};\n\nvar DATE_FORMATS_SPLIT = /((?:[^yMdHhmsaZEwG']+)|(?:'(?:[^']|'')*')|(?:E+|y+|M+|d+|H+|h+|m+|s+|a|Z|G+|w+))(.*)/,\n NUMBER_STRING = /^\\-?\\d+$/;\n\n/**\n * @ngdoc filter\n * @name date\n * @kind function\n *\n * @description\n * Formats `date` to a string based on the requested `format`.\n *\n * `format` string can be composed of the following elements:\n *\n * * `'yyyy'`: 4 digit representation of year (e.g. AD 1 => 0001, AD 2010 => 2010)\n * * `'yy'`: 2 digit representation of year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n * * `'y'`: 1 digit representation of year, e.g. (AD 1 => 1, AD 199 => 199)\n * * `'MMMM'`: Month in year (January-December)\n * * `'MMM'`: Month in year (Jan-Dec)\n * * `'MM'`: Month in year, padded (01-12)\n * * `'M'`: Month in year (1-12)\n * * `'dd'`: Day in month, padded (01-31)\n * * `'d'`: Day in month (1-31)\n * * `'EEEE'`: Day in Week,(Sunday-Saturday)\n * * `'EEE'`: Day in Week, (Sun-Sat)\n * * `'HH'`: Hour in day, padded (00-23)\n * * `'H'`: Hour in day (0-23)\n * * `'hh'`: Hour in AM/PM, padded (01-12)\n * * `'h'`: Hour in AM/PM, (1-12)\n * * `'mm'`: Minute in hour, padded (00-59)\n * * `'m'`: Minute in hour (0-59)\n * * `'ss'`: Second in minute, padded (00-59)\n * * `'s'`: Second in minute (0-59)\n * * `'sss'`: Millisecond in second, padded (000-999)\n * * `'a'`: AM/PM marker\n * * `'Z'`: 4 digit (+sign) representation of the timezone offset (-1200-+1200)\n * * `'ww'`: Week of year, padded (00-53). Week 01 is the week with the first Thursday of the year\n * * `'w'`: Week of year (0-53). Week 1 is the week with the first Thursday of the year\n * * `'G'`, `'GG'`, `'GGG'`: The abbreviated form of the era string (e.g. 'AD')\n * * `'GGGG'`: The long form of the era string (e.g. 'Anno Domini')\n *\n * `format` string can also be one of the following predefined\n * {@link guide/i18n localizable formats}:\n *\n * * `'medium'`: equivalent to `'MMM d, y h:mm:ss a'` for en_US locale\n * (e.g. Sep 3, 2010 12:05:08 PM)\n * * `'short'`: equivalent to `'M/d/yy h:mm a'` for en_US locale (e.g. 9/3/10 12:05 PM)\n * * `'fullDate'`: equivalent to `'EEEE, MMMM d, y'` for en_US locale\n * (e.g. Friday, September 3, 2010)\n * * `'longDate'`: equivalent to `'MMMM d, y'` for en_US locale (e.g. September 3, 2010)\n * * `'mediumDate'`: equivalent to `'MMM d, y'` for en_US locale (e.g. Sep 3, 2010)\n * * `'shortDate'`: equivalent to `'M/d/yy'` for en_US locale (e.g. 9/3/10)\n * * `'mediumTime'`: equivalent to `'h:mm:ss a'` for en_US locale (e.g. 12:05:08 PM)\n * * `'shortTime'`: equivalent to `'h:mm a'` for en_US locale (e.g. 12:05 PM)\n *\n * `format` string can contain literal values. These need to be escaped by surrounding with single quotes (e.g.\n * `\"h 'in the morning'\"`). In order to output a single quote, escape it - i.e., two single quotes in a sequence\n * (e.g. `\"h 'o''clock'\"`).\n *\n * @param {(Date|number|string)} date Date to format either as Date object, milliseconds (string or\n * number) or various ISO 8601 datetime string formats (e.g. yyyy-MM-ddTHH:mm:ss.sssZ and its\n * shorter versions like yyyy-MM-ddTHH:mmZ, yyyy-MM-dd or yyyyMMddTHHmmssZ). If no timezone is\n * specified in the string input, the time is considered to be in the local timezone.\n * @param {string=} format Formatting rules (see Description). If not specified,\n * `mediumDate` is used.\n * @param {string=} timezone Timezone to be used for formatting. It understands UTC/GMT and the\n * continental US time zone abbreviations, but for general use, use a time zone offset, for\n * example, `'+0430'` (4 hours, 30 minutes east of the Greenwich meridian)\n * If not specified, the timezone of the browser will be used.\n * @returns {string} Formatted string or the input if input is not recognized as date/millis.\n *\n * @example\n \n \n {{1288323623006 | date:'medium'}}:\n {{1288323623006 | date:'medium'}}
    \n {{1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'}}:\n {{1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'}}
    \n {{1288323623006 | date:'MM/dd/yyyy @ h:mma'}}:\n {{'1288323623006' | date:'MM/dd/yyyy @ h:mma'}}
    \n {{1288323623006 | date:\"MM/dd/yyyy 'at' h:mma\"}}:\n {{'1288323623006' | date:\"MM/dd/yyyy 'at' h:mma\"}}
    \n
    \n \n it('should format date', function() {\n expect(element(by.binding(\"1288323623006 | date:'medium'\")).getText()).\n toMatch(/Oct 2\\d, 2010 \\d{1,2}:\\d{2}:\\d{2} (AM|PM)/);\n expect(element(by.binding(\"1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'\")).getText()).\n toMatch(/2010\\-10\\-2\\d \\d{2}:\\d{2}:\\d{2} (\\-|\\+)?\\d{4}/);\n expect(element(by.binding(\"'1288323623006' | date:'MM/dd/yyyy @ h:mma'\")).getText()).\n toMatch(/10\\/2\\d\\/2010 @ \\d{1,2}:\\d{2}(AM|PM)/);\n expect(element(by.binding(\"'1288323623006' | date:\\\"MM/dd/yyyy 'at' h:mma\\\"\")).getText()).\n toMatch(/10\\/2\\d\\/2010 at \\d{1,2}:\\d{2}(AM|PM)/);\n });\n \n
    \n */\ndateFilter.$inject = ['$locale'];\nfunction dateFilter($locale) {\n\n\n var R_ISO8601_STR = /^(\\d{4})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n // 1 2 3 4 5 6 7 8 9 10 11\n function jsonStringToDate(string) {\n var match;\n if (match = string.match(R_ISO8601_STR)) {\n var date = new Date(0),\n tzHour = 0,\n tzMin = 0,\n dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear,\n timeSetter = match[8] ? date.setUTCHours : date.setHours;\n\n if (match[9]) {\n tzHour = toInt(match[9] + match[10]);\n tzMin = toInt(match[9] + match[11]);\n }\n dateSetter.call(date, toInt(match[1]), toInt(match[2]) - 1, toInt(match[3]));\n var h = toInt(match[4] || 0) - tzHour;\n var m = toInt(match[5] || 0) - tzMin;\n var s = toInt(match[6] || 0);\n var ms = Math.round(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n }\n return string;\n }\n\n\n return function(date, format, timezone) {\n var text = '',\n parts = [],\n fn, match;\n\n format = format || 'mediumDate';\n format = $locale.DATETIME_FORMATS[format] || format;\n if (isString(date)) {\n date = NUMBER_STRING.test(date) ? toInt(date) : jsonStringToDate(date);\n }\n\n if (isNumber(date)) {\n date = new Date(date);\n }\n\n if (!isDate(date) || !isFinite(date.getTime())) {\n return date;\n }\n\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = concat(parts, match, 1);\n format = parts.pop();\n } else {\n parts.push(format);\n format = null;\n }\n }\n\n var dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, date.getTimezoneOffset());\n date = convertTimezoneToLocal(date, timezone, true);\n }\n forEach(parts, function(value) {\n fn = DATE_FORMATS[value];\n text += fn ? fn(date, $locale.DATETIME_FORMATS, dateTimezoneOffset)\n : value.replace(/(^'|'$)/g, '').replace(/''/g, \"'\");\n });\n\n return text;\n };\n}\n\n\n/**\n * @ngdoc filter\n * @name json\n * @kind function\n *\n * @description\n * Allows you to convert a JavaScript object into JSON string.\n *\n * This filter is mostly useful for debugging. When using the double curly {{value}} notation\n * the binding is automatically converted to JSON.\n *\n * @param {*} object Any JavaScript object (including arrays and primitive types) to filter.\n * @param {number=} spacing The number of spaces to use per indentation, defaults to 2.\n * @returns {string} JSON string.\n *\n *\n * @example\n \n \n
    {{ {'name':'value'} | json }}
    \n
    {{ {'name':'value'} | json:4 }}
    \n
    \n \n it('should jsonify filtered objects', function() {\n expect(element(by.id('default-spacing')).getText()).toMatch(/\\{\\n \"name\": ?\"value\"\\n}/);\n expect(element(by.id('custom-spacing')).getText()).toMatch(/\\{\\n \"name\": ?\"value\"\\n}/);\n });\n \n
    \n *\n */\nfunction jsonFilter() {\n return function(object, spacing) {\n if (isUndefined(spacing)) {\n spacing = 2;\n }\n return toJson(object, spacing);\n };\n}\n\n\n/**\n * @ngdoc filter\n * @name lowercase\n * @kind function\n * @description\n * Converts string to lowercase.\n * @see angular.lowercase\n */\nvar lowercaseFilter = valueFn(lowercase);\n\n\n/**\n * @ngdoc filter\n * @name uppercase\n * @kind function\n * @description\n * Converts string to uppercase.\n * @see angular.uppercase\n */\nvar uppercaseFilter = valueFn(uppercase);\n\n/**\n * @ngdoc filter\n * @name limitTo\n * @kind function\n *\n * @description\n * Creates a new array or string containing only a specified number of elements. The elements\n * are taken from either the beginning or the end of the source array, string or number, as specified by\n * the value and sign (positive or negative) of `limit`. If a number is used as input, it is\n * converted to a string.\n *\n * @param {Array|string|number} input Source array, string or number to be limited.\n * @param {string|number} limit The length of the returned array or string. If the `limit` number\n * is positive, `limit` number of items from the beginning of the source array/string are copied.\n * If the number is negative, `limit` number of items from the end of the source array/string\n * are copied. The `limit` will be trimmed if it exceeds `array.length`. If `limit` is undefined,\n * the input will be returned unchanged.\n * @param {(string|number)=} begin Index at which to begin limitation. As a negative index, `begin`\n * indicates an offset from the end of `input`. Defaults to `0`.\n * @returns {Array|string} A new sub-array or substring of length `limit` or less if input array\n * had less than `limit` elements.\n *\n * @example\n \n \n \n
    \n \n

    Output numbers: {{ numbers | limitTo:numLimit }}

    \n \n

    Output letters: {{ letters | limitTo:letterLimit }}

    \n \n

    Output long number: {{ longNumber | limitTo:longNumberLimit }}

    \n
    \n
    \n \n var numLimitInput = element(by.model('numLimit'));\n var letterLimitInput = element(by.model('letterLimit'));\n var longNumberLimitInput = element(by.model('longNumberLimit'));\n var limitedNumbers = element(by.binding('numbers | limitTo:numLimit'));\n var limitedLetters = element(by.binding('letters | limitTo:letterLimit'));\n var limitedLongNumber = element(by.binding('longNumber | limitTo:longNumberLimit'));\n\n it('should limit the number array to first three items', function() {\n expect(numLimitInput.getAttribute('value')).toBe('3');\n expect(letterLimitInput.getAttribute('value')).toBe('3');\n expect(longNumberLimitInput.getAttribute('value')).toBe('3');\n expect(limitedNumbers.getText()).toEqual('Output numbers: [1,2,3]');\n expect(limitedLetters.getText()).toEqual('Output letters: abc');\n expect(limitedLongNumber.getText()).toEqual('Output long number: 234');\n });\n\n // There is a bug in safari and protractor that doesn't like the minus key\n // it('should update the output when -3 is entered', function() {\n // numLimitInput.clear();\n // numLimitInput.sendKeys('-3');\n // letterLimitInput.clear();\n // letterLimitInput.sendKeys('-3');\n // longNumberLimitInput.clear();\n // longNumberLimitInput.sendKeys('-3');\n // expect(limitedNumbers.getText()).toEqual('Output numbers: [7,8,9]');\n // expect(limitedLetters.getText()).toEqual('Output letters: ghi');\n // expect(limitedLongNumber.getText()).toEqual('Output long number: 342');\n // });\n\n it('should not exceed the maximum size of input array', function() {\n numLimitInput.clear();\n numLimitInput.sendKeys('100');\n letterLimitInput.clear();\n letterLimitInput.sendKeys('100');\n longNumberLimitInput.clear();\n longNumberLimitInput.sendKeys('100');\n expect(limitedNumbers.getText()).toEqual('Output numbers: [1,2,3,4,5,6,7,8,9]');\n expect(limitedLetters.getText()).toEqual('Output letters: abcdefghi');\n expect(limitedLongNumber.getText()).toEqual('Output long number: 2345432342');\n });\n \n
    \n*/\nfunction limitToFilter() {\n return function(input, limit, begin) {\n if (Math.abs(Number(limit)) === Infinity) {\n limit = Number(limit);\n } else {\n limit = toInt(limit);\n }\n if (isNaN(limit)) return input;\n\n if (isNumber(input)) input = input.toString();\n if (!isArray(input) && !isString(input)) return input;\n\n begin = (!begin || isNaN(begin)) ? 0 : toInt(begin);\n begin = (begin < 0 && begin >= -input.length) ? input.length + begin : begin;\n\n if (limit >= 0) {\n return input.slice(begin, begin + limit);\n } else {\n if (begin === 0) {\n return input.slice(limit, input.length);\n } else {\n return input.slice(Math.max(0, begin + limit), begin);\n }\n }\n };\n}\n\n/**\n * @ngdoc filter\n * @name orderBy\n * @kind function\n *\n * @description\n * Orders a specified `array` by the `expression` predicate. It is ordered alphabetically\n * for strings and numerically for numbers. Note: if you notice numbers are not being sorted\n * as expected, make sure they are actually being saved as numbers and not strings.\n *\n * @param {Array} array The array to sort.\n * @param {function(*)|string|Array.<(function(*)|string)>=} expression A predicate to be\n * used by the comparator to determine the order of elements.\n *\n * Can be one of:\n *\n * - `function`: Getter function. The result of this function will be sorted using the\n * `<`, `===`, `>` operator.\n * - `string`: An Angular expression. The result of this expression is used to compare elements\n * (for example `name` to sort by a property called `name` or `name.substr(0, 3)` to sort by\n * 3 first characters of a property called `name`). The result of a constant expression\n * is interpreted as a property name to be used in comparisons (for example `\"special name\"`\n * to sort object by the value of their `special name` property). An expression can be\n * optionally prefixed with `+` or `-` to control ascending or descending sort order\n * (for example, `+name` or `-name`). If no property is provided, (e.g. `'+'`) then the array\n * element itself is used to compare where sorting.\n * - `Array`: An array of function or string predicates. The first predicate in the array\n * is used for sorting, but when two items are equivalent, the next predicate is used.\n *\n * If the predicate is missing or empty then it defaults to `'+'`.\n *\n * @param {boolean=} reverse Reverse the order of the array.\n * @returns {Array} Sorted copy of the source array.\n *\n *\n * @example\n * The example below demonstrates a simple ngRepeat, where the data is sorted\n * by age in descending order (predicate is set to `'-age'`).\n * `reverse` is not set, which means it defaults to `false`.\n \n \n \n
    \n \n \n \n \n \n \n \n \n \n \n \n
    NamePhone NumberAge
    {{friend.name}}{{friend.phone}}{{friend.age}}
    \n
    \n
    \n
    \n *\n * The predicate and reverse parameters can be controlled dynamically through scope properties,\n * as shown in the next example.\n * @example\n \n \n \n \n
    \n
    Sorting predicate = {{predicate}}; reverse = {{reverse}}
    \n
    \n [ unsorted ]\n \n \n \n \n \n \n \n \n \n \n \n
    \n Name\n \n \n Phone Number\n \n \n Age\n \n
    {{friend.name}}{{friend.phone}}{{friend.age}}
    \n
    \n
    \n
    \n *\n * It's also possible to call the orderBy filter manually, by injecting `$filter`, retrieving the\n * filter routine with `$filter('orderBy')`, and calling the returned filter routine with the\n * desired parameters.\n *\n * Example:\n *\n * @example\n \n \n
    \n \n \n \n \n \n \n \n \n \n \n \n
    Name\n (^)Phone NumberAge
    {{friend.name}}{{friend.phone}}{{friend.age}}
    \n
    \n
    \n\n \n angular.module('orderByExample', [])\n .controller('ExampleController', ['$scope', '$filter', function($scope, $filter) {\n var orderBy = $filter('orderBy');\n $scope.friends = [\n { name: 'John', phone: '555-1212', age: 10 },\n { name: 'Mary', phone: '555-9876', age: 19 },\n { name: 'Mike', phone: '555-4321', age: 21 },\n { name: 'Adam', phone: '555-5678', age: 35 },\n { name: 'Julie', phone: '555-8765', age: 29 }\n ];\n $scope.order = function(predicate, reverse) {\n $scope.friends = orderBy($scope.friends, predicate, reverse);\n };\n $scope.order('-age',false);\n }]);\n \n
    \n */\norderByFilter.$inject = ['$parse'];\nfunction orderByFilter($parse) {\n return function(array, sortPredicate, reverseOrder) {\n\n if (!(isArrayLike(array))) return array;\n\n if (!isArray(sortPredicate)) { sortPredicate = [sortPredicate]; }\n if (sortPredicate.length === 0) { sortPredicate = ['+']; }\n\n var predicates = processPredicates(sortPredicate, reverseOrder);\n\n // The next three lines are a version of a Swartzian Transform idiom from Perl\n // (sometimes called the Decorate-Sort-Undecorate idiom)\n // See https://en.wikipedia.org/wiki/Schwartzian_transform\n var compareValues = Array.prototype.map.call(array, getComparisonObject);\n compareValues.sort(doComparison);\n array = compareValues.map(function(item) { return item.value; });\n\n return array;\n\n function getComparisonObject(value, index) {\n return {\n value: value,\n predicateValues: predicates.map(function(predicate) {\n return getPredicateValue(predicate.get(value), index);\n })\n };\n }\n\n function doComparison(v1, v2) {\n var result = 0;\n for (var index=0, length = predicates.length; index < length; ++index) {\n result = compare(v1.predicateValues[index], v2.predicateValues[index]) * predicates[index].descending;\n if (result) break;\n }\n return result;\n }\n };\n\n function processPredicates(sortPredicate, reverseOrder) {\n reverseOrder = reverseOrder ? -1 : 1;\n return sortPredicate.map(function(predicate) {\n var descending = 1, get = identity;\n\n if (isFunction(predicate)) {\n get = predicate;\n } else if (isString(predicate)) {\n if ((predicate.charAt(0) == '+' || predicate.charAt(0) == '-')) {\n descending = predicate.charAt(0) == '-' ? -1 : 1;\n predicate = predicate.substring(1);\n }\n if (predicate !== '') {\n get = $parse(predicate);\n if (get.constant) {\n var key = get();\n get = function(value) { return value[key]; };\n }\n }\n }\n return { get: get, descending: descending * reverseOrder };\n });\n }\n\n function isPrimitive(value) {\n switch (typeof value) {\n case 'number': /* falls through */\n case 'boolean': /* falls through */\n case 'string':\n return true;\n default:\n return false;\n }\n }\n\n function objectValue(value, index) {\n // If `valueOf` is a valid function use that\n if (typeof value.valueOf === 'function') {\n value = value.valueOf();\n if (isPrimitive(value)) return value;\n }\n // If `toString` is a valid function and not the one from `Object.prototype` use that\n if (hasCustomToString(value)) {\n value = value.toString();\n if (isPrimitive(value)) return value;\n }\n // We have a basic object so we use the position of the object in the collection\n return index;\n }\n\n function getPredicateValue(value, index) {\n var type = typeof value;\n if (value === null) {\n type = 'string';\n value = 'null';\n } else if (type === 'string') {\n value = value.toLowerCase();\n } else if (type === 'object') {\n value = objectValue(value, index);\n }\n return { value: value, type: type };\n }\n\n function compare(v1, v2) {\n var result = 0;\n if (v1.type === v2.type) {\n if (v1.value !== v2.value) {\n result = v1.value < v2.value ? -1 : 1;\n }\n } else {\n result = v1.type < v2.type ? -1 : 1;\n }\n return result;\n }\n}\n\nfunction ngDirective(directive) {\n if (isFunction(directive)) {\n directive = {\n link: directive\n };\n }\n directive.restrict = directive.restrict || 'AC';\n return valueFn(directive);\n}\n\n/**\n * @ngdoc directive\n * @name a\n * @restrict E\n *\n * @description\n * Modifies the default behavior of the html A tag so that the default action is prevented when\n * the href attribute is empty.\n *\n * This change permits the easy creation of action links with the `ngClick` directive\n * without changing the location or causing page reloads, e.g.:\n * `Add Item`\n */\nvar htmlAnchorDirective = valueFn({\n restrict: 'E',\n compile: function(element, attr) {\n if (!attr.href && !attr.xlinkHref) {\n return function(scope, element) {\n // If the linked element is not an anchor tag anymore, do nothing\n if (element[0].nodeName.toLowerCase() !== 'a') return;\n\n // SVGAElement does not use the href attribute, but rather the 'xlinkHref' attribute.\n var href = toString.call(element.prop('href')) === '[object SVGAnimatedString]' ?\n 'xlink:href' : 'href';\n element.on('click', function(event) {\n // if we have no href url, then don't navigate anywhere.\n if (!element.attr(href)) {\n event.preventDefault();\n }\n });\n };\n }\n }\n});\n\n/**\n * @ngdoc directive\n * @name ngHref\n * @restrict A\n * @priority 99\n *\n * @description\n * Using Angular markup like `{{hash}}` in an href attribute will\n * make the link go to the wrong URL if the user clicks it before\n * Angular has a chance to replace the `{{hash}}` markup with its\n * value. Until Angular replaces the markup the link will be broken\n * and will most likely return a 404 error. The `ngHref` directive\n * solves this problem.\n *\n * The wrong way to write it:\n * ```html\n * link1\n * ```\n *\n * The correct way to write it:\n * ```html\n * link1\n * ```\n *\n * @element A\n * @param {template} ngHref any string which can contain `{{}}` markup.\n *\n * @example\n * This example shows various combinations of `href`, `ng-href` and `ng-click` attributes\n * in links and their different behaviors:\n \n \n
    \n link 1 (link, don't reload)
    \n link 2 (link, don't reload)
    \n link 3 (link, reload!)
    \n anchor (link, don't reload)
    \n anchor (no link)
    \n link (link, change location)\n
    \n \n it('should execute ng-click but not reload when href without value', function() {\n element(by.id('link-1')).click();\n expect(element(by.model('value')).getAttribute('value')).toEqual('1');\n expect(element(by.id('link-1')).getAttribute('href')).toBe('');\n });\n\n it('should execute ng-click but not reload when href empty string', function() {\n element(by.id('link-2')).click();\n expect(element(by.model('value')).getAttribute('value')).toEqual('2');\n expect(element(by.id('link-2')).getAttribute('href')).toBe('');\n });\n\n it('should execute ng-click and change url when ng-href specified', function() {\n expect(element(by.id('link-3')).getAttribute('href')).toMatch(/\\/123$/);\n\n element(by.id('link-3')).click();\n\n // At this point, we navigate away from an Angular page, so we need\n // to use browser.driver to get the base webdriver.\n\n browser.wait(function() {\n return browser.driver.getCurrentUrl().then(function(url) {\n return url.match(/\\/123$/);\n });\n }, 5000, 'page should navigate to /123');\n });\n\n it('should execute ng-click but not reload when href empty string and name specified', function() {\n element(by.id('link-4')).click();\n expect(element(by.model('value')).getAttribute('value')).toEqual('4');\n expect(element(by.id('link-4')).getAttribute('href')).toBe('');\n });\n\n it('should execute ng-click but not reload when no href but name specified', function() {\n element(by.id('link-5')).click();\n expect(element(by.model('value')).getAttribute('value')).toEqual('5');\n expect(element(by.id('link-5')).getAttribute('href')).toBe(null);\n });\n\n it('should only change url when only ng-href', function() {\n element(by.model('value')).clear();\n element(by.model('value')).sendKeys('6');\n expect(element(by.id('link-6')).getAttribute('href')).toMatch(/\\/6$/);\n\n element(by.id('link-6')).click();\n\n // At this point, we navigate away from an Angular page, so we need\n // to use browser.driver to get the base webdriver.\n browser.wait(function() {\n return browser.driver.getCurrentUrl().then(function(url) {\n return url.match(/\\/6$/);\n });\n }, 5000, 'page should navigate to /6');\n });\n \n
    \n */\n\n/**\n * @ngdoc directive\n * @name ngSrc\n * @restrict A\n * @priority 99\n *\n * @description\n * Using Angular markup like `{{hash}}` in a `src` attribute doesn't\n * work right: The browser will fetch from the URL with the literal\n * text `{{hash}}` until Angular replaces the expression inside\n * `{{hash}}`. The `ngSrc` directive solves this problem.\n *\n * The buggy way to write it:\n * ```html\n * \"Description\"/\n * ```\n *\n * The correct way to write it:\n * ```html\n * \"Description\"\n * ```\n *\n * @element IMG\n * @param {template} ngSrc any string which can contain `{{}}` markup.\n */\n\n/**\n * @ngdoc directive\n * @name ngSrcset\n * @restrict A\n * @priority 99\n *\n * @description\n * Using Angular markup like `{{hash}}` in a `srcset` attribute doesn't\n * work right: The browser will fetch from the URL with the literal\n * text `{{hash}}` until Angular replaces the expression inside\n * `{{hash}}`. The `ngSrcset` directive solves this problem.\n *\n * The buggy way to write it:\n * ```html\n * \"Description\"/\n * ```\n *\n * The correct way to write it:\n * ```html\n * \"Description\"\n * ```\n *\n * @element IMG\n * @param {template} ngSrcset any string which can contain `{{}}` markup.\n */\n\n/**\n * @ngdoc directive\n * @name ngDisabled\n * @restrict A\n * @priority 100\n *\n * @description\n *\n * This directive sets the `disabled` attribute on the element if the\n * {@link guide/expression expression} inside `ngDisabled` evaluates to truthy.\n *\n * A special directive is necessary because we cannot use interpolation inside the `disabled`\n * attribute. The following example would make the button enabled on Chrome/Firefox\n * but not on older IEs:\n *\n * ```html\n * \n *
    \n * \n *
    \n * ```\n *\n * This is because the HTML specification does not require browsers to preserve the values of\n * boolean attributes such as `disabled` (Their presence means true and their absence means false.)\n * If we put an Angular interpolation expression into such an attribute then the\n * binding information would be lost when the browser removes the attribute.\n *\n * @example\n \n \n
    \n \n
    \n \n it('should toggle button', function() {\n expect(element(by.css('button')).getAttribute('disabled')).toBeFalsy();\n element(by.model('checked')).click();\n expect(element(by.css('button')).getAttribute('disabled')).toBeTruthy();\n });\n \n
    \n *\n * @element INPUT\n * @param {expression} ngDisabled If the {@link guide/expression expression} is truthy,\n * then the `disabled` attribute will be set on the element\n */\n\n\n/**\n * @ngdoc directive\n * @name ngChecked\n * @restrict A\n * @priority 100\n *\n * @description\n * Sets the `checked` attribute on the element, if the expression inside `ngChecked` is truthy.\n *\n * Note that this directive should not be used together with {@link ngModel `ngModel`},\n * as this can lead to unexpected behavior.\n *\n * ### Why do we need `ngChecked`?\n *\n * The HTML specification does not require browsers to preserve the values of boolean attributes\n * such as checked. (Their presence means true and their absence means false.)\n * If we put an Angular interpolation expression into such an attribute then the\n * binding information would be lost when the browser removes the attribute.\n * The `ngChecked` directive solves this problem for the `checked` attribute.\n * This complementary directive is not removed by the browser and so provides\n * a permanent reliable place to store the binding information.\n * @example\n \n \n
    \n \n
    \n \n it('should check both checkBoxes', function() {\n expect(element(by.id('checkSlave')).getAttribute('checked')).toBeFalsy();\n element(by.model('master')).click();\n expect(element(by.id('checkSlave')).getAttribute('checked')).toBeTruthy();\n });\n \n
    \n *\n * @element INPUT\n * @param {expression} ngChecked If the {@link guide/expression expression} is truthy,\n * then the `checked` attribute will be set on the element\n */\n\n\n/**\n * @ngdoc directive\n * @name ngReadonly\n * @restrict A\n * @priority 100\n *\n * @description\n * The HTML specification does not require browsers to preserve the values of boolean attributes\n * such as readonly. (Their presence means true and their absence means false.)\n * If we put an Angular interpolation expression into such an attribute then the\n * binding information would be lost when the browser removes the attribute.\n * The `ngReadonly` directive solves this problem for the `readonly` attribute.\n * This complementary directive is not removed by the browser and so provides\n * a permanent reliable place to store the binding information.\n * @example\n \n \n
    \n \n
    \n \n it('should toggle readonly attr', function() {\n expect(element(by.css('[type=\"text\"]')).getAttribute('readonly')).toBeFalsy();\n element(by.model('checked')).click();\n expect(element(by.css('[type=\"text\"]')).getAttribute('readonly')).toBeTruthy();\n });\n \n
    \n *\n * @element INPUT\n * @param {expression} ngReadonly If the {@link guide/expression expression} is truthy,\n * then special attribute \"readonly\" will be set on the element\n */\n\n\n/**\n * @ngdoc directive\n * @name ngSelected\n * @restrict A\n * @priority 100\n *\n * @description\n * The HTML specification does not require browsers to preserve the values of boolean attributes\n * such as selected. (Their presence means true and their absence means false.)\n * If we put an Angular interpolation expression into such an attribute then the\n * binding information would be lost when the browser removes the attribute.\n * The `ngSelected` directive solves this problem for the `selected` attribute.\n * This complementary directive is not removed by the browser and so provides\n * a permanent reliable place to store the binding information.\n *\n * @example\n \n \n
    \n \n
    \n \n it('should select Greetings!', function() {\n expect(element(by.id('greet')).getAttribute('selected')).toBeFalsy();\n element(by.model('selected')).click();\n expect(element(by.id('greet')).getAttribute('selected')).toBeTruthy();\n });\n \n
    \n *\n * @element OPTION\n * @param {expression} ngSelected If the {@link guide/expression expression} is truthy,\n * then special attribute \"selected\" will be set on the element\n */\n\n/**\n * @ngdoc directive\n * @name ngOpen\n * @restrict A\n * @priority 100\n *\n * @description\n * The HTML specification does not require browsers to preserve the values of boolean attributes\n * such as open. (Their presence means true and their absence means false.)\n * If we put an Angular interpolation expression into such an attribute then the\n * binding information would be lost when the browser removes the attribute.\n * The `ngOpen` directive solves this problem for the `open` attribute.\n * This complementary directive is not removed by the browser and so provides\n * a permanent reliable place to store the binding information.\n * @example\n \n \n
    \n
    \n Show/Hide me\n
    \n
    \n \n it('should toggle open', function() {\n expect(element(by.id('details')).getAttribute('open')).toBeFalsy();\n element(by.model('open')).click();\n expect(element(by.id('details')).getAttribute('open')).toBeTruthy();\n });\n \n
    \n *\n * @element DETAILS\n * @param {expression} ngOpen If the {@link guide/expression expression} is truthy,\n * then special attribute \"open\" will be set on the element\n */\n\nvar ngAttributeAliasDirectives = {};\n\n// boolean attrs are evaluated\nforEach(BOOLEAN_ATTR, function(propName, attrName) {\n // binding to multiple is not supported\n if (propName == \"multiple\") return;\n\n function defaultLinkFn(scope, element, attr) {\n scope.$watch(attr[normalized], function ngBooleanAttrWatchAction(value) {\n attr.$set(attrName, !!value);\n });\n }\n\n var normalized = directiveNormalize('ng-' + attrName);\n var linkFn = defaultLinkFn;\n\n if (propName === 'checked') {\n linkFn = function(scope, element, attr) {\n // ensuring ngChecked doesn't interfere with ngModel when both are set on the same input\n if (attr.ngModel !== attr[normalized]) {\n defaultLinkFn(scope, element, attr);\n }\n };\n }\n\n ngAttributeAliasDirectives[normalized] = function() {\n return {\n restrict: 'A',\n priority: 100,\n link: linkFn\n };\n };\n});\n\n// aliased input attrs are evaluated\nforEach(ALIASED_ATTR, function(htmlAttr, ngAttr) {\n ngAttributeAliasDirectives[ngAttr] = function() {\n return {\n priority: 100,\n link: function(scope, element, attr) {\n //special case ngPattern when a literal regular expression value\n //is used as the expression (this way we don't have to watch anything).\n if (ngAttr === \"ngPattern\" && attr.ngPattern.charAt(0) == \"/\") {\n var match = attr.ngPattern.match(REGEX_STRING_REGEXP);\n if (match) {\n attr.$set(\"ngPattern\", new RegExp(match[1], match[2]));\n return;\n }\n }\n\n scope.$watch(attr[ngAttr], function ngAttrAliasWatchAction(value) {\n attr.$set(ngAttr, value);\n });\n }\n };\n };\n});\n\n// ng-src, ng-srcset, ng-href are interpolated\nforEach(['src', 'srcset', 'href'], function(attrName) {\n var normalized = directiveNormalize('ng-' + attrName);\n ngAttributeAliasDirectives[normalized] = function() {\n return {\n priority: 99, // it needs to run after the attributes are interpolated\n link: function(scope, element, attr) {\n var propName = attrName,\n name = attrName;\n\n if (attrName === 'href' &&\n toString.call(element.prop('href')) === '[object SVGAnimatedString]') {\n name = 'xlinkHref';\n attr.$attr[name] = 'xlink:href';\n propName = null;\n }\n\n attr.$observe(normalized, function(value) {\n if (!value) {\n if (attrName === 'href') {\n attr.$set(name, null);\n }\n return;\n }\n\n attr.$set(name, value);\n\n // on IE, if \"ng:src\" directive declaration is used and \"src\" attribute doesn't exist\n // then calling element.setAttribute('src', 'foo') doesn't do anything, so we need\n // to set the property as well to achieve the desired effect.\n // we use attr[attrName] value since $set can sanitize the url.\n if (msie && propName) element.prop(propName, attr[name]);\n });\n }\n };\n };\n});\n\n/* global -nullFormCtrl, -SUBMITTED_CLASS, addSetValidityMethod: true\n */\nvar nullFormCtrl = {\n $addControl: noop,\n $$renameControl: nullFormRenameControl,\n $removeControl: noop,\n $setValidity: noop,\n $setDirty: noop,\n $setPristine: noop,\n $setSubmitted: noop\n},\nSUBMITTED_CLASS = 'ng-submitted';\n\nfunction nullFormRenameControl(control, name) {\n control.$name = name;\n}\n\n/**\n * @ngdoc type\n * @name form.FormController\n *\n * @property {boolean} $pristine True if user has not interacted with the form yet.\n * @property {boolean} $dirty True if user has already interacted with the form.\n * @property {boolean} $valid True if all of the containing forms and controls are valid.\n * @property {boolean} $invalid True if at least one containing control or form is invalid.\n * @property {boolean} $submitted True if user has submitted the form even if its invalid.\n *\n * @property {Object} $error Is an object hash, containing references to controls or\n * forms with failing validators, where:\n *\n * - keys are validation tokens (error names),\n * - values are arrays of controls or forms that have a failing validator for given error name.\n *\n * Built-in validation tokens:\n *\n * - `email`\n * - `max`\n * - `maxlength`\n * - `min`\n * - `minlength`\n * - `number`\n * - `pattern`\n * - `required`\n * - `url`\n * - `date`\n * - `datetimelocal`\n * - `time`\n * - `week`\n * - `month`\n *\n * @description\n * `FormController` keeps track of all its controls and nested forms as well as the state of them,\n * such as being valid/invalid or dirty/pristine.\n *\n * Each {@link ng.directive:form form} directive creates an instance\n * of `FormController`.\n *\n */\n//asks for $scope to fool the BC controller module\nFormController.$inject = ['$element', '$attrs', '$scope', '$animate', '$interpolate'];\nfunction FormController(element, attrs, $scope, $animate, $interpolate) {\n var form = this,\n controls = [];\n\n var parentForm = form.$$parentForm = element.parent().controller('form') || nullFormCtrl;\n\n // init state\n form.$error = {};\n form.$$success = {};\n form.$pending = undefined;\n form.$name = $interpolate(attrs.name || attrs.ngForm || '')($scope);\n form.$dirty = false;\n form.$pristine = true;\n form.$valid = true;\n form.$invalid = false;\n form.$submitted = false;\n\n parentForm.$addControl(form);\n\n /**\n * @ngdoc method\n * @name form.FormController#$rollbackViewValue\n *\n * @description\n * Rollback all form controls pending updates to the `$modelValue`.\n *\n * Updates may be pending by a debounced event or because the input is waiting for a some future\n * event defined in `ng-model-options`. This method is typically needed by the reset button of\n * a form that uses `ng-model-options` to pend updates.\n */\n form.$rollbackViewValue = function() {\n forEach(controls, function(control) {\n control.$rollbackViewValue();\n });\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$commitViewValue\n *\n * @description\n * Commit all form controls pending updates to the `$modelValue`.\n *\n * Updates may be pending by a debounced event or because the input is waiting for a some future\n * event defined in `ng-model-options`. This method is rarely needed as `NgModelController`\n * usually handles calling this in response to input events.\n */\n form.$commitViewValue = function() {\n forEach(controls, function(control) {\n control.$commitViewValue();\n });\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$addControl\n *\n * @description\n * Register a control with the form.\n *\n * Input elements using ngModelController do this automatically when they are linked.\n */\n form.$addControl = function(control) {\n // Breaking change - before, inputs whose name was \"hasOwnProperty\" were quietly ignored\n // and not added to the scope. Now we throw an error.\n assertNotHasOwnProperty(control.$name, 'input');\n controls.push(control);\n\n if (control.$name) {\n form[control.$name] = control;\n }\n };\n\n // Private API: rename a form control\n form.$$renameControl = function(control, newName) {\n var oldName = control.$name;\n\n if (form[oldName] === control) {\n delete form[oldName];\n }\n form[newName] = control;\n control.$name = newName;\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$removeControl\n *\n * @description\n * Deregister a control from the form.\n *\n * Input elements using ngModelController do this automatically when they are destroyed.\n */\n form.$removeControl = function(control) {\n if (control.$name && form[control.$name] === control) {\n delete form[control.$name];\n }\n forEach(form.$pending, function(value, name) {\n form.$setValidity(name, null, control);\n });\n forEach(form.$error, function(value, name) {\n form.$setValidity(name, null, control);\n });\n forEach(form.$$success, function(value, name) {\n form.$setValidity(name, null, control);\n });\n\n arrayRemove(controls, control);\n };\n\n\n /**\n * @ngdoc method\n * @name form.FormController#$setValidity\n *\n * @description\n * Sets the validity of a form control.\n *\n * This method will also propagate to parent forms.\n */\n addSetValidityMethod({\n ctrl: this,\n $element: element,\n set: function(object, property, controller) {\n var list = object[property];\n if (!list) {\n object[property] = [controller];\n } else {\n var index = list.indexOf(controller);\n if (index === -1) {\n list.push(controller);\n }\n }\n },\n unset: function(object, property, controller) {\n var list = object[property];\n if (!list) {\n return;\n }\n arrayRemove(list, controller);\n if (list.length === 0) {\n delete object[property];\n }\n },\n parentForm: parentForm,\n $animate: $animate\n });\n\n /**\n * @ngdoc method\n * @name form.FormController#$setDirty\n *\n * @description\n * Sets the form to a dirty state.\n *\n * This method can be called to add the 'ng-dirty' class and set the form to a dirty\n * state (ng-dirty class). This method will also propagate to parent forms.\n */\n form.$setDirty = function() {\n $animate.removeClass(element, PRISTINE_CLASS);\n $animate.addClass(element, DIRTY_CLASS);\n form.$dirty = true;\n form.$pristine = false;\n parentForm.$setDirty();\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$setPristine\n *\n * @description\n * Sets the form to its pristine state.\n *\n * This method can be called to remove the 'ng-dirty' class and set the form to its pristine\n * state (ng-pristine class). This method will also propagate to all the controls contained\n * in this form.\n *\n * Setting a form back to a pristine state is often useful when we want to 'reuse' a form after\n * saving or resetting it.\n */\n form.$setPristine = function() {\n $animate.setClass(element, PRISTINE_CLASS, DIRTY_CLASS + ' ' + SUBMITTED_CLASS);\n form.$dirty = false;\n form.$pristine = true;\n form.$submitted = false;\n forEach(controls, function(control) {\n control.$setPristine();\n });\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$setUntouched\n *\n * @description\n * Sets the form to its untouched state.\n *\n * This method can be called to remove the 'ng-touched' class and set the form controls to their\n * untouched state (ng-untouched class).\n *\n * Setting a form controls back to their untouched state is often useful when setting the form\n * back to its pristine state.\n */\n form.$setUntouched = function() {\n forEach(controls, function(control) {\n control.$setUntouched();\n });\n };\n\n /**\n * @ngdoc method\n * @name form.FormController#$setSubmitted\n *\n * @description\n * Sets the form to its submitted state.\n */\n form.$setSubmitted = function() {\n $animate.addClass(element, SUBMITTED_CLASS);\n form.$submitted = true;\n parentForm.$setSubmitted();\n };\n}\n\n/**\n * @ngdoc directive\n * @name ngForm\n * @restrict EAC\n *\n * @description\n * Nestable alias of {@link ng.directive:form `form`} directive. HTML\n * does not allow nesting of form elements. It is useful to nest forms, for example if the validity of a\n * sub-group of controls needs to be determined.\n *\n * Note: the purpose of `ngForm` is to group controls,\n * but not to be a replacement for the `
    ` tag with all of its capabilities\n * (e.g. posting to the server, ...).\n *\n * @param {string=} ngForm|name Name of the form. If specified, the form controller will be published into\n * related scope, under this name.\n *\n */\n\n /**\n * @ngdoc directive\n * @name form\n * @restrict E\n *\n * @description\n * Directive that instantiates\n * {@link form.FormController FormController}.\n *\n * If the `name` attribute is specified, the form controller is published onto the current scope under\n * this name.\n *\n * # Alias: {@link ng.directive:ngForm `ngForm`}\n *\n * In Angular, forms can be nested. This means that the outer form is valid when all of the child\n * forms are valid as well. However, browsers do not allow nesting of `` elements, so\n * Angular provides the {@link ng.directive:ngForm `ngForm`} directive which behaves identically to\n * `` but can be nested. This allows you to have nested forms, which is very useful when\n * using Angular validation directives in forms that are dynamically generated using the\n * {@link ng.directive:ngRepeat `ngRepeat`} directive. Since you cannot dynamically generate the `name`\n * attribute of input elements using interpolation, you have to wrap each set of repeated inputs in an\n * `ngForm` directive and nest these in an outer `form` element.\n *\n *\n * # CSS classes\n * - `ng-valid` is set if the form is valid.\n * - `ng-invalid` is set if the form is invalid.\n * - `ng-pristine` is set if the form is pristine.\n * - `ng-dirty` is set if the form is dirty.\n * - `ng-submitted` is set if the form was submitted.\n *\n * Keep in mind that ngAnimate can detect each of these classes when added and removed.\n *\n *\n * # Submitting a form and preventing the default action\n *\n * Since the role of forms in client-side Angular applications is different than in classical\n * roundtrip apps, it is desirable for the browser not to translate the form submission into a full\n * page reload that sends the data to the server. Instead some javascript logic should be triggered\n * to handle the form submission in an application-specific way.\n *\n * For this reason, Angular prevents the default action (form submission to the server) unless the\n * `` element has an `action` attribute specified.\n *\n * You can use one of the following two ways to specify what javascript method should be called when\n * a form is submitted:\n *\n * - {@link ng.directive:ngSubmit ngSubmit} directive on the form element\n * - {@link ng.directive:ngClick ngClick} directive on the first\n * button or input field of type submit (input[type=submit])\n *\n * To prevent double execution of the handler, use only one of the {@link ng.directive:ngSubmit ngSubmit}\n * or {@link ng.directive:ngClick ngClick} directives.\n * This is because of the following form submission rules in the HTML specification:\n *\n * - If a form has only one input field then hitting enter in this field triggers form submit\n * (`ngSubmit`)\n * - if a form has 2+ input fields and no buttons or input[type=submit] then hitting enter\n * doesn't trigger submit\n * - if a form has one or more input fields and one or more buttons or input[type=submit] then\n * hitting enter in any of the input fields will trigger the click handler on the *first* button or\n * input[type=submit] (`ngClick`) *and* a submit handler on the enclosing form (`ngSubmit`)\n *\n * Any pending `ngModelOptions` changes will take place immediately when an enclosing form is\n * submitted. Note that `ngClick` events will occur before the model is updated. Use `ngSubmit`\n * to have access to the updated model.\n *\n * ## Animation Hooks\n *\n * Animations in ngForm are triggered when any of the associated CSS classes are added and removed.\n * These classes are: `.ng-pristine`, `.ng-dirty`, `.ng-invalid` and `.ng-valid` as well as any\n * other validations that are performed within the form. Animations in ngForm are similar to how\n * they work in ngClass and animations can be hooked into using CSS transitions, keyframes as well\n * as JS animations.\n *\n * The following example shows a simple way to utilize CSS transitions to style a form element\n * that has been rendered as invalid after it has been validated:\n *\n *
    \n * //be sure to include ngAnimate as a module to hook into more\n * //advanced animations\n * .my-form {\n *   transition:0.5s linear all;\n *   background: white;\n * }\n * .my-form.ng-invalid {\n *   background: red;\n *   color:white;\n * }\n * 
    \n *\n * @example\n \n \n \n \n \n userType: \n Required!
    \n userType = {{userType}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n \n
    \n \n it('should initialize to model', function() {\n var userType = element(by.binding('userType'));\n var valid = element(by.binding('myForm.input.$valid'));\n\n expect(userType.getText()).toContain('guest');\n expect(valid.getText()).toContain('true');\n });\n\n it('should be invalid if empty', function() {\n var userType = element(by.binding('userType'));\n var valid = element(by.binding('myForm.input.$valid'));\n var userInput = element(by.model('userType'));\n\n userInput.clear();\n userInput.sendKeys('');\n\n expect(userType.getText()).toEqual('userType =');\n expect(valid.getText()).toContain('false');\n });\n \n
    \n *\n * @param {string=} name Name of the form. If specified, the form controller will be published into\n * related scope, under this name.\n */\nvar formDirectiveFactory = function(isNgForm) {\n return ['$timeout', function($timeout) {\n var formDirective = {\n name: 'form',\n restrict: isNgForm ? 'EAC' : 'E',\n controller: FormController,\n compile: function ngFormCompile(formElement, attr) {\n // Setup initial state of the control\n formElement.addClass(PRISTINE_CLASS).addClass(VALID_CLASS);\n\n var nameAttr = attr.name ? 'name' : (isNgForm && attr.ngForm ? 'ngForm' : false);\n\n return {\n pre: function ngFormPreLink(scope, formElement, attr, controller) {\n // if `action` attr is not present on the form, prevent the default action (submission)\n if (!('action' in attr)) {\n // we can't use jq events because if a form is destroyed during submission the default\n // action is not prevented. see #1238\n //\n // IE 9 is not affected because it doesn't fire a submit event and try to do a full\n // page reload if the form was destroyed by submission of the form via a click handler\n // on a button in the form. Looks like an IE9 specific bug.\n var handleFormSubmission = function(event) {\n scope.$apply(function() {\n controller.$commitViewValue();\n controller.$setSubmitted();\n });\n\n event.preventDefault();\n };\n\n addEventListenerFn(formElement[0], 'submit', handleFormSubmission);\n\n // unregister the preventDefault listener so that we don't not leak memory but in a\n // way that will achieve the prevention of the default action.\n formElement.on('$destroy', function() {\n $timeout(function() {\n removeEventListenerFn(formElement[0], 'submit', handleFormSubmission);\n }, 0, false);\n });\n }\n\n var parentFormCtrl = controller.$$parentForm;\n\n if (nameAttr) {\n setter(scope, controller.$name, controller, controller.$name);\n attr.$observe(nameAttr, function(newValue) {\n if (controller.$name === newValue) return;\n setter(scope, controller.$name, undefined, controller.$name);\n parentFormCtrl.$$renameControl(controller, newValue);\n setter(scope, controller.$name, controller, controller.$name);\n });\n }\n formElement.on('$destroy', function() {\n parentFormCtrl.$removeControl(controller);\n if (nameAttr) {\n setter(scope, attr[nameAttr], undefined, controller.$name);\n }\n extend(controller, nullFormCtrl); //stop propagating child destruction handlers upwards\n });\n }\n };\n }\n };\n\n return formDirective;\n }];\n};\n\nvar formDirective = formDirectiveFactory();\nvar ngFormDirective = formDirectiveFactory(true);\n\n/* global VALID_CLASS: false,\n INVALID_CLASS: false,\n PRISTINE_CLASS: false,\n DIRTY_CLASS: false,\n UNTOUCHED_CLASS: false,\n TOUCHED_CLASS: false,\n $ngModelMinErr: false,\n*/\n\n// Regex code is obtained from SO: https://stackoverflow.com/questions/3143070/javascript-regex-iso-datetime#answer-3143231\nvar ISO_DATE_REGEXP = /\\d{4}-[01]\\d-[0-3]\\dT[0-2]\\d:[0-5]\\d:[0-5]\\d\\.\\d+([+-][0-2]\\d:[0-5]\\d|Z)/;\nvar URL_REGEXP = /^(ftp|http|https):\\/\\/(\\w+:{0,1}\\w*@)?(\\S+)(:[0-9]+)?(\\/|\\/([\\w#!:.?+=&%@!\\-\\/]))?$/;\nvar EMAIL_REGEXP = /^[a-z0-9!#$%&'*+\\/=?^_`{|}~.-]+@[a-z0-9]([a-z0-9-]*[a-z0-9])?(\\.[a-z0-9]([a-z0-9-]*[a-z0-9])?)*$/i;\nvar NUMBER_REGEXP = /^\\s*(\\-|\\+)?(\\d+|(\\d*(\\.\\d*)))([eE][+-]?\\d+)?\\s*$/;\nvar DATE_REGEXP = /^(\\d{4})-(\\d{2})-(\\d{2})$/;\nvar DATETIMELOCAL_REGEXP = /^(\\d{4})-(\\d\\d)-(\\d\\d)T(\\d\\d):(\\d\\d)(?::(\\d\\d)(\\.\\d{1,3})?)?$/;\nvar WEEK_REGEXP = /^(\\d{4})-W(\\d\\d)$/;\nvar MONTH_REGEXP = /^(\\d{4})-(\\d\\d)$/;\nvar TIME_REGEXP = /^(\\d\\d):(\\d\\d)(?::(\\d\\d)(\\.\\d{1,3})?)?$/;\n\nvar inputType = {\n\n /**\n * @ngdoc input\n * @name input[text]\n *\n * @description\n * Standard HTML text input with angular data binding, inherited by most of the `input` elements.\n *\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} required Adds `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of\n * any length.\n * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string\n * that contains the regular expression body that will be converted to a regular expression\n * as in the ngPattern directive.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input.\n * This parameter is ignored for input[type=password] controls, which will never trim the\n * input.\n *\n * @example\n \n \n \n
    \n \n
    \n \n Required!\n \n Single word only!\n
    \n text = {{example.text}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var text = element(by.binding('example.text'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.text'));\n\n it('should initialize to model', function() {\n expect(text.getText()).toContain('guest');\n expect(valid.getText()).toContain('true');\n });\n\n it('should be invalid if empty', function() {\n input.clear();\n input.sendKeys('');\n\n expect(text.getText()).toEqual('text =');\n expect(valid.getText()).toContain('false');\n });\n\n it('should be invalid if multi word', function() {\n input.clear();\n input.sendKeys('hello world');\n\n expect(valid.getText()).toContain('false');\n });\n \n
    \n */\n 'text': textInputType,\n\n /**\n * @ngdoc input\n * @name input[date]\n *\n * @description\n * Input with date validation and transformation. In browsers that do not yet support\n * the HTML5 date input, a text element will be used. In that case, text must be entered in a valid ISO-8601\n * date format (yyyy-MM-dd), for example: `2009-01-06`. Since many\n * modern browsers do not yet support this input type, it is important to provide cues to users on the\n * expected input format via a placeholder or label.\n *\n * The model must always be a Date object, otherwise Angular will throw an error.\n * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string.\n *\n * The timezone to be used to read/write the `Date` instance in the model can be defined using\n * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a\n * valid ISO date string (yyyy-MM-dd).\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be\n * a valid ISO date string (yyyy-MM-dd).\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n \n
    \n \n Required!\n \n Not a valid date!\n
    \n value = {{example.value | date: \"yyyy-MM-dd\"}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value | date: \"yyyy-MM-dd\"'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n // currently protractor/webdriver does not support\n // sending keys to all known HTML5 input controls\n // for various browsers (see https://github.com/angular/protractor/issues/562).\n function setInput(val) {\n // set the value of the element and force validation.\n var scr = \"var ipt = document.getElementById('exampleInput'); \" +\n \"ipt.value = '\" + val + \"';\" +\n \"angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('\" + val + \"'); });\";\n browser.executeScript(scr);\n }\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('2013-10-22');\n expect(valid.getText()).toContain('myForm.input.$valid = true');\n });\n\n it('should be invalid if empty', function() {\n setInput('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n\n it('should be invalid if over max', function() {\n setInput('2015-01-01');\n expect(value.getText()).toContain('');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n \n
    \n */\n 'date': createDateInputType('date', DATE_REGEXP,\n createDateParser(DATE_REGEXP, ['yyyy', 'MM', 'dd']),\n 'yyyy-MM-dd'),\n\n /**\n * @ngdoc input\n * @name input[datetime-local]\n *\n * @description\n * Input with datetime validation and transformation. In browsers that do not yet support\n * the HTML5 date input, a text element will be used. In that case, the text must be entered in a valid ISO-8601\n * local datetime format (yyyy-MM-ddTHH:mm:ss), for example: `2010-12-28T14:57:00`.\n *\n * The model must always be a Date object, otherwise Angular will throw an error.\n * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string.\n *\n * The timezone to be used to read/write the `Date` instance in the model can be defined using\n * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a\n * valid ISO datetime format (yyyy-MM-ddTHH:mm:ss).\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be\n * a valid ISO datetime format (yyyy-MM-ddTHH:mm:ss).\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n \n
    \n \n Required!\n \n Not a valid date!\n
    \n value = {{example.value | date: \"yyyy-MM-ddTHH:mm:ss\"}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value | date: \"yyyy-MM-ddTHH:mm:ss\"'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n // currently protractor/webdriver does not support\n // sending keys to all known HTML5 input controls\n // for various browsers (https://github.com/angular/protractor/issues/562).\n function setInput(val) {\n // set the value of the element and force validation.\n var scr = \"var ipt = document.getElementById('exampleInput'); \" +\n \"ipt.value = '\" + val + \"';\" +\n \"angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('\" + val + \"'); });\";\n browser.executeScript(scr);\n }\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('2010-12-28T14:57:00');\n expect(valid.getText()).toContain('myForm.input.$valid = true');\n });\n\n it('should be invalid if empty', function() {\n setInput('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n\n it('should be invalid if over max', function() {\n setInput('2015-01-01T23:59:00');\n expect(value.getText()).toContain('');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n \n
    \n */\n 'datetime-local': createDateInputType('datetimelocal', DATETIMELOCAL_REGEXP,\n createDateParser(DATETIMELOCAL_REGEXP, ['yyyy', 'MM', 'dd', 'HH', 'mm', 'ss', 'sss']),\n 'yyyy-MM-ddTHH:mm:ss.sss'),\n\n /**\n * @ngdoc input\n * @name input[time]\n *\n * @description\n * Input with time validation and transformation. In browsers that do not yet support\n * the HTML5 date input, a text element will be used. In that case, the text must be entered in a valid ISO-8601\n * local time format (HH:mm:ss), for example: `14:57:00`. Model must be a Date object. This binding will always output a\n * Date object to the model of January 1, 1970, or local date `new Date(1970, 0, 1, HH, mm, ss)`.\n *\n * The model must always be a Date object, otherwise Angular will throw an error.\n * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string.\n *\n * The timezone to be used to read/write the `Date` instance in the model can be defined using\n * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a\n * valid ISO time format (HH:mm:ss).\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be a\n * valid ISO time format (HH:mm:ss).\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n \n
    \n \n Required!\n \n Not a valid date!\n
    \n value = {{example.value | date: \"HH:mm:ss\"}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value | date: \"HH:mm:ss\"'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n // currently protractor/webdriver does not support\n // sending keys to all known HTML5 input controls\n // for various browsers (https://github.com/angular/protractor/issues/562).\n function setInput(val) {\n // set the value of the element and force validation.\n var scr = \"var ipt = document.getElementById('exampleInput'); \" +\n \"ipt.value = '\" + val + \"';\" +\n \"angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('\" + val + \"'); });\";\n browser.executeScript(scr);\n }\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('14:57:00');\n expect(valid.getText()).toContain('myForm.input.$valid = true');\n });\n\n it('should be invalid if empty', function() {\n setInput('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n\n it('should be invalid if over max', function() {\n setInput('23:59:00');\n expect(value.getText()).toContain('');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n \n
    \n */\n 'time': createDateInputType('time', TIME_REGEXP,\n createDateParser(TIME_REGEXP, ['HH', 'mm', 'ss', 'sss']),\n 'HH:mm:ss.sss'),\n\n /**\n * @ngdoc input\n * @name input[week]\n *\n * @description\n * Input with week-of-the-year validation and transformation to Date. In browsers that do not yet support\n * the HTML5 week input, a text element will be used. In that case, the text must be entered in a valid ISO-8601\n * week format (yyyy-W##), for example: `2013-W02`.\n *\n * The model must always be a Date object, otherwise Angular will throw an error.\n * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string.\n *\n * The timezone to be used to read/write the `Date` instance in the model can be defined using\n * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a\n * valid ISO week format (yyyy-W##).\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be\n * a valid ISO week format (yyyy-W##).\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n
    \n \n Required!\n \n Not a valid date!\n
    \n value = {{example.value | date: \"yyyy-Www\"}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value | date: \"yyyy-Www\"'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n // currently protractor/webdriver does not support\n // sending keys to all known HTML5 input controls\n // for various browsers (https://github.com/angular/protractor/issues/562).\n function setInput(val) {\n // set the value of the element and force validation.\n var scr = \"var ipt = document.getElementById('exampleInput'); \" +\n \"ipt.value = '\" + val + \"';\" +\n \"angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('\" + val + \"'); });\";\n browser.executeScript(scr);\n }\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('2013-W01');\n expect(valid.getText()).toContain('myForm.input.$valid = true');\n });\n\n it('should be invalid if empty', function() {\n setInput('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n\n it('should be invalid if over max', function() {\n setInput('2015-W01');\n expect(value.getText()).toContain('');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n \n
    \n */\n 'week': createDateInputType('week', WEEK_REGEXP, weekParser, 'yyyy-Www'),\n\n /**\n * @ngdoc input\n * @name input[month]\n *\n * @description\n * Input with month validation and transformation. In browsers that do not yet support\n * the HTML5 month input, a text element will be used. In that case, the text must be entered in a valid ISO-8601\n * month format (yyyy-MM), for example: `2009-01`.\n *\n * The model must always be a Date object, otherwise Angular will throw an error.\n * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string.\n * If the model is not set to the first of the month, the next view to model update will set it\n * to the first of the month.\n *\n * The timezone to be used to read/write the `Date` instance in the model can be defined using\n * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be\n * a valid ISO month format (yyyy-MM).\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must\n * be a valid ISO month format (yyyy-MM).\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n \n
    \n \n Required!\n \n Not a valid month!\n
    \n value = {{example.value | date: \"yyyy-MM\"}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value | date: \"yyyy-MM\"'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n // currently protractor/webdriver does not support\n // sending keys to all known HTML5 input controls\n // for various browsers (https://github.com/angular/protractor/issues/562).\n function setInput(val) {\n // set the value of the element and force validation.\n var scr = \"var ipt = document.getElementById('exampleInput'); \" +\n \"ipt.value = '\" + val + \"';\" +\n \"angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('\" + val + \"'); });\";\n browser.executeScript(scr);\n }\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('2013-10');\n expect(valid.getText()).toContain('myForm.input.$valid = true');\n });\n\n it('should be invalid if empty', function() {\n setInput('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n\n it('should be invalid if over max', function() {\n setInput('2015-01');\n expect(value.getText()).toContain('');\n expect(valid.getText()).toContain('myForm.input.$valid = false');\n });\n \n
    \n */\n 'month': createDateInputType('month', MONTH_REGEXP,\n createDateParser(MONTH_REGEXP, ['yyyy', 'MM']),\n 'yyyy-MM'),\n\n /**\n * @ngdoc input\n * @name input[number]\n *\n * @description\n * Text input with number validation and transformation. Sets the `number` validation\n * error if not a valid number.\n *\n *
    \n * The model must always be of type `number` otherwise Angular will throw an error.\n * Be aware that a string containing a number is not enough. See the {@link ngModel:numfmt}\n * error docs for more information and an example of how to convert your model if necessary.\n *
    \n *\n * ## Issues with HTML5 constraint validation\n *\n * In browsers that follow the\n * [HTML5 specification](https://html.spec.whatwg.org/multipage/forms.html#number-state-%28type=number%29),\n * `input[number]` does not work as expected with {@link ngModelOptions `ngModelOptions.allowInvalid`}.\n * If a non-number is entered in the input, the browser will report the value as an empty string,\n * which means the view / model values in `ngModel` and subsequently the scope value\n * will also be an empty string.\n *\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`.\n * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`.\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of\n * any length.\n * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string\n * that contains the regular expression body that will be converted to a regular expression\n * as in the ngPattern directive.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n
    \n \n Required!\n \n Not valid number!\n
    \n value = {{example.value}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n
    \n
    \n \n var value = element(by.binding('example.value'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('example.value'));\n\n it('should initialize to model', function() {\n expect(value.getText()).toContain('12');\n expect(valid.getText()).toContain('true');\n });\n\n it('should be invalid if empty', function() {\n input.clear();\n input.sendKeys('');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('false');\n });\n\n it('should be invalid if over max', function() {\n input.clear();\n input.sendKeys('123');\n expect(value.getText()).toEqual('value =');\n expect(valid.getText()).toContain('false');\n });\n \n
    \n */\n 'number': numberInputType,\n\n\n /**\n * @ngdoc input\n * @name input[url]\n *\n * @description\n * Text input with URL validation. Sets the `url` validation error key if the content is not a\n * valid URL.\n *\n *
    \n * **Note:** `input[url]` uses a regex to validate urls that is derived from the regex\n * used in Chromium. If you need stricter validation, you can use `ng-pattern` or modify\n * the built-in validators (see the {@link guide/forms Forms guide})\n *
    \n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of\n * any length.\n * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string\n * that contains the regular expression body that will be converted to a regular expression\n * as in the ngPattern directive.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n
    \n \n var text = element(by.binding('url.text'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('url.text'));\n\n it('should initialize to model', function() {\n expect(text.getText()).toContain('http://google.com');\n expect(valid.getText()).toContain('true');\n });\n\n it('should be invalid if empty', function() {\n input.clear();\n input.sendKeys('');\n\n expect(text.getText()).toEqual('text =');\n expect(valid.getText()).toContain('false');\n });\n\n it('should be invalid if not url', function() {\n input.clear();\n input.sendKeys('box');\n\n expect(valid.getText()).toContain('false');\n });\n \n
    \n */\n 'url': urlInputType,\n\n\n /**\n * @ngdoc input\n * @name input[email]\n *\n * @description\n * Text input with email validation. Sets the `email` validation error key if not a valid email\n * address.\n *\n *
    \n * **Note:** `input[email]` uses a regex to validate email addresses that is derived from the regex\n * used in Chromium. If you need stricter validation (e.g. requiring a top-level domain), you can\n * use `ng-pattern` or modify the built-in validators (see the {@link guide/forms Forms guide})\n *
    \n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of\n * any length.\n * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string\n * that contains the regular expression body that will be converted to a regular expression\n * as in the ngPattern directive.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n \n
    \n \n Required!\n \n Not valid email!\n
    \n text = {{email.text}}
    \n myForm.input.$valid = {{myForm.input.$valid}}
    \n myForm.input.$error = {{myForm.input.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n myForm.$error.email = {{!!myForm.$error.email}}
    \n
    \n
    \n \n var text = element(by.binding('email.text'));\n var valid = element(by.binding('myForm.input.$valid'));\n var input = element(by.model('email.text'));\n\n it('should initialize to model', function() {\n expect(text.getText()).toContain('me@example.com');\n expect(valid.getText()).toContain('true');\n });\n\n it('should be invalid if empty', function() {\n input.clear();\n input.sendKeys('');\n expect(text.getText()).toEqual('text =');\n expect(valid.getText()).toContain('false');\n });\n\n it('should be invalid if not email', function() {\n input.clear();\n input.sendKeys('xxx');\n\n expect(valid.getText()).toContain('false');\n });\n \n
    \n */\n 'email': emailInputType,\n\n\n /**\n * @ngdoc input\n * @name input[radio]\n *\n * @description\n * HTML radio button.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string} value The value to which the `ngModel` expression should be set when selected.\n * Note that `value` only supports `string` values, i.e. the scope model needs to be a string,\n * too. Use `ngValue` if you need complex models (`number`, `object`, ...).\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n * @param {string} ngValue Angular expression to which `ngModel` will be be set when the radio\n * is selected. Should be used instead of the `value` attribute if you need\n * a non-string `ngModel` (`boolean`, `array`, ...).\n *\n * @example\n \n \n \n
    \n
    \n
    \n
    \n color = {{color.name | json}}
    \n
    \n Note that `ng-value=\"specialValue\"` sets radio item's value to be the value of `$scope.specialValue`.\n
    \n \n it('should change state', function() {\n var color = element(by.binding('color.name'));\n\n expect(color.getText()).toContain('blue');\n\n element.all(by.model('color.name')).get(0).click();\n\n expect(color.getText()).toContain('red');\n });\n \n
    \n */\n 'radio': radioInputType,\n\n\n /**\n * @ngdoc input\n * @name input[checkbox]\n *\n * @description\n * HTML checkbox.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {expression=} ngTrueValue The value to which the expression should be set when selected.\n * @param {expression=} ngFalseValue The value to which the expression should be set when not selected.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n *\n * @example\n \n \n \n
    \n
    \n
    \n value1 = {{checkboxModel.value1}}
    \n value2 = {{checkboxModel.value2}}
    \n
    \n
    \n \n it('should change state', function() {\n var value1 = element(by.binding('checkboxModel.value1'));\n var value2 = element(by.binding('checkboxModel.value2'));\n\n expect(value1.getText()).toContain('true');\n expect(value2.getText()).toContain('YES');\n\n element(by.model('checkboxModel.value1')).click();\n element(by.model('checkboxModel.value2')).click();\n\n expect(value1.getText()).toContain('false');\n expect(value2.getText()).toContain('NO');\n });\n \n
    \n */\n 'checkbox': checkboxInputType,\n\n 'hidden': noop,\n 'button': noop,\n 'submit': noop,\n 'reset': noop,\n 'file': noop\n};\n\nfunction stringBasedInputType(ctrl) {\n ctrl.$formatters.push(function(value) {\n return ctrl.$isEmpty(value) ? value : value.toString();\n });\n}\n\nfunction textInputType(scope, element, attr, ctrl, $sniffer, $browser) {\n baseInputType(scope, element, attr, ctrl, $sniffer, $browser);\n stringBasedInputType(ctrl);\n}\n\nfunction baseInputType(scope, element, attr, ctrl, $sniffer, $browser) {\n var type = lowercase(element[0].type);\n\n // In composition mode, users are still inputing intermediate text buffer,\n // hold the listener until composition is done.\n // More about composition events: https://developer.mozilla.org/en-US/docs/Web/API/CompositionEvent\n if (!$sniffer.android) {\n var composing = false;\n\n element.on('compositionstart', function(data) {\n composing = true;\n });\n\n element.on('compositionend', function() {\n composing = false;\n listener();\n });\n }\n\n var listener = function(ev) {\n if (timeout) {\n $browser.defer.cancel(timeout);\n timeout = null;\n }\n if (composing) return;\n var value = element.val(),\n event = ev && ev.type;\n\n // By default we will trim the value\n // If the attribute ng-trim exists we will avoid trimming\n // If input type is 'password', the value is never trimmed\n if (type !== 'password' && (!attr.ngTrim || attr.ngTrim !== 'false')) {\n value = trim(value);\n }\n\n // If a control is suffering from bad input (due to native validators), browsers discard its\n // value, so it may be necessary to revalidate (by calling $setViewValue again) even if the\n // control's value is the same empty value twice in a row.\n if (ctrl.$viewValue !== value || (value === '' && ctrl.$$hasNativeValidators)) {\n ctrl.$setViewValue(value, event);\n }\n };\n\n // if the browser does support \"input\" event, we are fine - except on IE9 which doesn't fire the\n // input event on backspace, delete or cut\n if ($sniffer.hasEvent('input')) {\n element.on('input', listener);\n } else {\n var timeout;\n\n var deferListener = function(ev, input, origValue) {\n if (!timeout) {\n timeout = $browser.defer(function() {\n timeout = null;\n if (!input || input.value !== origValue) {\n listener(ev);\n }\n });\n }\n };\n\n element.on('keydown', function(event) {\n var key = event.keyCode;\n\n // ignore\n // command modifiers arrows\n if (key === 91 || (15 < key && key < 19) || (37 <= key && key <= 40)) return;\n\n deferListener(event, this, this.value);\n });\n\n // if user modifies input value using context menu in IE, we need \"paste\" and \"cut\" events to catch it\n if ($sniffer.hasEvent('paste')) {\n element.on('paste cut', deferListener);\n }\n }\n\n // if user paste into input using mouse on older browser\n // or form autocomplete on newer browser, we need \"change\" event to catch it\n element.on('change', listener);\n\n ctrl.$render = function() {\n element.val(ctrl.$isEmpty(ctrl.$viewValue) ? '' : ctrl.$viewValue);\n };\n}\n\nfunction weekParser(isoWeek, existingDate) {\n if (isDate(isoWeek)) {\n return isoWeek;\n }\n\n if (isString(isoWeek)) {\n WEEK_REGEXP.lastIndex = 0;\n var parts = WEEK_REGEXP.exec(isoWeek);\n if (parts) {\n var year = +parts[1],\n week = +parts[2],\n hours = 0,\n minutes = 0,\n seconds = 0,\n milliseconds = 0,\n firstThurs = getFirstThursdayOfYear(year),\n addDays = (week - 1) * 7;\n\n if (existingDate) {\n hours = existingDate.getHours();\n minutes = existingDate.getMinutes();\n seconds = existingDate.getSeconds();\n milliseconds = existingDate.getMilliseconds();\n }\n\n return new Date(year, 0, firstThurs.getDate() + addDays, hours, minutes, seconds, milliseconds);\n }\n }\n\n return NaN;\n}\n\nfunction createDateParser(regexp, mapping) {\n return function(iso, date) {\n var parts, map;\n\n if (isDate(iso)) {\n return iso;\n }\n\n if (isString(iso)) {\n // When a date is JSON'ified to wraps itself inside of an extra\n // set of double quotes. This makes the date parsing code unable\n // to match the date string and parse it as a date.\n if (iso.charAt(0) == '\"' && iso.charAt(iso.length - 1) == '\"') {\n iso = iso.substring(1, iso.length - 1);\n }\n if (ISO_DATE_REGEXP.test(iso)) {\n return new Date(iso);\n }\n regexp.lastIndex = 0;\n parts = regexp.exec(iso);\n\n if (parts) {\n parts.shift();\n if (date) {\n map = {\n yyyy: date.getFullYear(),\n MM: date.getMonth() + 1,\n dd: date.getDate(),\n HH: date.getHours(),\n mm: date.getMinutes(),\n ss: date.getSeconds(),\n sss: date.getMilliseconds() / 1000\n };\n } else {\n map = { yyyy: 1970, MM: 1, dd: 1, HH: 0, mm: 0, ss: 0, sss: 0 };\n }\n\n forEach(parts, function(part, index) {\n if (index < mapping.length) {\n map[mapping[index]] = +part;\n }\n });\n return new Date(map.yyyy, map.MM - 1, map.dd, map.HH, map.mm, map.ss || 0, map.sss * 1000 || 0);\n }\n }\n\n return NaN;\n };\n}\n\nfunction createDateInputType(type, regexp, parseDate, format) {\n return function dynamicDateInputType(scope, element, attr, ctrl, $sniffer, $browser, $filter) {\n badInputChecker(scope, element, attr, ctrl);\n baseInputType(scope, element, attr, ctrl, $sniffer, $browser);\n var timezone = ctrl && ctrl.$options && ctrl.$options.timezone;\n var previousDate;\n\n ctrl.$$parserName = type;\n ctrl.$parsers.push(function(value) {\n if (ctrl.$isEmpty(value)) return null;\n if (regexp.test(value)) {\n // Note: We cannot read ctrl.$modelValue, as there might be a different\n // parser/formatter in the processing chain so that the model\n // contains some different data format!\n var parsedDate = parseDate(value, previousDate);\n if (timezone) {\n parsedDate = convertTimezoneToLocal(parsedDate, timezone);\n }\n return parsedDate;\n }\n return undefined;\n });\n\n ctrl.$formatters.push(function(value) {\n if (value && !isDate(value)) {\n throw $ngModelMinErr('datefmt', 'Expected `{0}` to be a date', value);\n }\n if (isValidDate(value)) {\n previousDate = value;\n if (previousDate && timezone) {\n previousDate = convertTimezoneToLocal(previousDate, timezone, true);\n }\n return $filter('date')(value, format, timezone);\n } else {\n previousDate = null;\n return '';\n }\n });\n\n if (isDefined(attr.min) || attr.ngMin) {\n var minVal;\n ctrl.$validators.min = function(value) {\n return !isValidDate(value) || isUndefined(minVal) || parseDate(value) >= minVal;\n };\n attr.$observe('min', function(val) {\n minVal = parseObservedDateValue(val);\n ctrl.$validate();\n });\n }\n\n if (isDefined(attr.max) || attr.ngMax) {\n var maxVal;\n ctrl.$validators.max = function(value) {\n return !isValidDate(value) || isUndefined(maxVal) || parseDate(value) <= maxVal;\n };\n attr.$observe('max', function(val) {\n maxVal = parseObservedDateValue(val);\n ctrl.$validate();\n });\n }\n\n function isValidDate(value) {\n // Invalid Date: getTime() returns NaN\n return value && !(value.getTime && value.getTime() !== value.getTime());\n }\n\n function parseObservedDateValue(val) {\n return isDefined(val) ? (isDate(val) ? val : parseDate(val)) : undefined;\n }\n };\n}\n\nfunction badInputChecker(scope, element, attr, ctrl) {\n var node = element[0];\n var nativeValidation = ctrl.$$hasNativeValidators = isObject(node.validity);\n if (nativeValidation) {\n ctrl.$parsers.push(function(value) {\n var validity = element.prop(VALIDITY_STATE_PROPERTY) || {};\n // Detect bug in FF35 for input[email] (https://bugzilla.mozilla.org/show_bug.cgi?id=1064430):\n // - also sets validity.badInput (should only be validity.typeMismatch).\n // - see http://www.whatwg.org/specs/web-apps/current-work/multipage/forms.html#e-mail-state-(type=email)\n // - can ignore this case as we can still read out the erroneous email...\n return validity.badInput && !validity.typeMismatch ? undefined : value;\n });\n }\n}\n\nfunction numberInputType(scope, element, attr, ctrl, $sniffer, $browser) {\n badInputChecker(scope, element, attr, ctrl);\n baseInputType(scope, element, attr, ctrl, $sniffer, $browser);\n\n ctrl.$$parserName = 'number';\n ctrl.$parsers.push(function(value) {\n if (ctrl.$isEmpty(value)) return null;\n if (NUMBER_REGEXP.test(value)) return parseFloat(value);\n return undefined;\n });\n\n ctrl.$formatters.push(function(value) {\n if (!ctrl.$isEmpty(value)) {\n if (!isNumber(value)) {\n throw $ngModelMinErr('numfmt', 'Expected `{0}` to be a number', value);\n }\n value = value.toString();\n }\n return value;\n });\n\n if (isDefined(attr.min) || attr.ngMin) {\n var minVal;\n ctrl.$validators.min = function(value) {\n return ctrl.$isEmpty(value) || isUndefined(minVal) || value >= minVal;\n };\n\n attr.$observe('min', function(val) {\n if (isDefined(val) && !isNumber(val)) {\n val = parseFloat(val, 10);\n }\n minVal = isNumber(val) && !isNaN(val) ? val : undefined;\n // TODO(matsko): implement validateLater to reduce number of validations\n ctrl.$validate();\n });\n }\n\n if (isDefined(attr.max) || attr.ngMax) {\n var maxVal;\n ctrl.$validators.max = function(value) {\n return ctrl.$isEmpty(value) || isUndefined(maxVal) || value <= maxVal;\n };\n\n attr.$observe('max', function(val) {\n if (isDefined(val) && !isNumber(val)) {\n val = parseFloat(val, 10);\n }\n maxVal = isNumber(val) && !isNaN(val) ? val : undefined;\n // TODO(matsko): implement validateLater to reduce number of validations\n ctrl.$validate();\n });\n }\n}\n\nfunction urlInputType(scope, element, attr, ctrl, $sniffer, $browser) {\n // Note: no badInputChecker here by purpose as `url` is only a validation\n // in browsers, i.e. we can always read out input.value even if it is not valid!\n baseInputType(scope, element, attr, ctrl, $sniffer, $browser);\n stringBasedInputType(ctrl);\n\n ctrl.$$parserName = 'url';\n ctrl.$validators.url = function(modelValue, viewValue) {\n var value = modelValue || viewValue;\n return ctrl.$isEmpty(value) || URL_REGEXP.test(value);\n };\n}\n\nfunction emailInputType(scope, element, attr, ctrl, $sniffer, $browser) {\n // Note: no badInputChecker here by purpose as `url` is only a validation\n // in browsers, i.e. we can always read out input.value even if it is not valid!\n baseInputType(scope, element, attr, ctrl, $sniffer, $browser);\n stringBasedInputType(ctrl);\n\n ctrl.$$parserName = 'email';\n ctrl.$validators.email = function(modelValue, viewValue) {\n var value = modelValue || viewValue;\n return ctrl.$isEmpty(value) || EMAIL_REGEXP.test(value);\n };\n}\n\nfunction radioInputType(scope, element, attr, ctrl) {\n // make the name unique, if not defined\n if (isUndefined(attr.name)) {\n element.attr('name', nextUid());\n }\n\n var listener = function(ev) {\n if (element[0].checked) {\n ctrl.$setViewValue(attr.value, ev && ev.type);\n }\n };\n\n element.on('click', listener);\n\n ctrl.$render = function() {\n var value = attr.value;\n element[0].checked = (value == ctrl.$viewValue);\n };\n\n attr.$observe('value', ctrl.$render);\n}\n\nfunction parseConstantExpr($parse, context, name, expression, fallback) {\n var parseFn;\n if (isDefined(expression)) {\n parseFn = $parse(expression);\n if (!parseFn.constant) {\n throw minErr('ngModel')('constexpr', 'Expected constant expression for `{0}`, but saw ' +\n '`{1}`.', name, expression);\n }\n return parseFn(context);\n }\n return fallback;\n}\n\nfunction checkboxInputType(scope, element, attr, ctrl, $sniffer, $browser, $filter, $parse) {\n var trueValue = parseConstantExpr($parse, scope, 'ngTrueValue', attr.ngTrueValue, true);\n var falseValue = parseConstantExpr($parse, scope, 'ngFalseValue', attr.ngFalseValue, false);\n\n var listener = function(ev) {\n ctrl.$setViewValue(element[0].checked, ev && ev.type);\n };\n\n element.on('click', listener);\n\n ctrl.$render = function() {\n element[0].checked = ctrl.$viewValue;\n };\n\n // Override the standard `$isEmpty` because the $viewValue of an empty checkbox is always set to `false`\n // This is because of the parser below, which compares the `$modelValue` with `trueValue` to convert\n // it to a boolean.\n ctrl.$isEmpty = function(value) {\n return value === false;\n };\n\n ctrl.$formatters.push(function(value) {\n return equals(value, trueValue);\n });\n\n ctrl.$parsers.push(function(value) {\n return value ? trueValue : falseValue;\n });\n}\n\n\n/**\n * @ngdoc directive\n * @name textarea\n * @restrict E\n *\n * @description\n * HTML textarea element control with angular data-binding. The data-binding and validation\n * properties of this element are exactly the same as those of the\n * {@link ng.directive:input input element}.\n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to\n * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of\n * `required` when you want to data-bind to the `required` attribute.\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of any\n * length.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input.\n */\n\n\n/**\n * @ngdoc directive\n * @name input\n * @restrict E\n *\n * @description\n * HTML input element control. When used together with {@link ngModel `ngModel`}, it provides data-binding,\n * input state control, and validation.\n * Input control follows HTML5 input types and polyfills the HTML5 validation behavior for older browsers.\n *\n *
    \n * **Note:** Not every feature offered is available for all input types.\n * Specifically, data binding and event handling via `ng-model` is unsupported for `input[file]`.\n *
    \n *\n * @param {string} ngModel Assignable angular expression to data-bind to.\n * @param {string=} name Property name of the form under which the control is published.\n * @param {string=} required Sets `required` validation error key if the value is not entered.\n * @param {boolean=} ngRequired Sets `required` attribute if set to true\n * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than\n * minlength.\n * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than\n * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of any\n * length.\n * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match\n * a RegExp found by evaluating the Angular expression given in the attribute value.\n * If the expression evaluates to a RegExp object, then this is used directly.\n * If the expression evaluates to a string, then it will be converted to a RegExp\n * after wrapping it in `^` and `$` characters. For instance, `\"abc\"` will be converted to\n * `new RegExp('^abc$')`.
    \n * **Note:** Avoid using the `g` flag on the RegExp, as it will cause each successive search to\n * start at the index of the last search's match, thus not taking the whole input value into\n * account.\n * @param {string=} ngChange Angular expression to be executed when input changes due to user\n * interaction with the input element.\n * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input.\n * This parameter is ignored for input[type=password] controls, which will never trim the\n * input.\n *\n * @example\n \n \n \n
    \n
    \n \n
    \n \n Required!\n
    \n \n
    \n \n Too short!\n \n Too long!\n
    \n
    \n
    \n user = {{user}}
    \n myForm.userName.$valid = {{myForm.userName.$valid}}
    \n myForm.userName.$error = {{myForm.userName.$error}}
    \n myForm.lastName.$valid = {{myForm.lastName.$valid}}
    \n myForm.lastName.$error = {{myForm.lastName.$error}}
    \n myForm.$valid = {{myForm.$valid}}
    \n myForm.$error.required = {{!!myForm.$error.required}}
    \n myForm.$error.minlength = {{!!myForm.$error.minlength}}
    \n myForm.$error.maxlength = {{!!myForm.$error.maxlength}}
    \n
    \n
    \n \n var user = element(by.exactBinding('user'));\n var userNameValid = element(by.binding('myForm.userName.$valid'));\n var lastNameValid = element(by.binding('myForm.lastName.$valid'));\n var lastNameError = element(by.binding('myForm.lastName.$error'));\n var formValid = element(by.binding('myForm.$valid'));\n var userNameInput = element(by.model('user.name'));\n var userLastInput = element(by.model('user.last'));\n\n it('should initialize to model', function() {\n expect(user.getText()).toContain('{\"name\":\"guest\",\"last\":\"visitor\"}');\n expect(userNameValid.getText()).toContain('true');\n expect(formValid.getText()).toContain('true');\n });\n\n it('should be invalid if empty when required', function() {\n userNameInput.clear();\n userNameInput.sendKeys('');\n\n expect(user.getText()).toContain('{\"last\":\"visitor\"}');\n expect(userNameValid.getText()).toContain('false');\n expect(formValid.getText()).toContain('false');\n });\n\n it('should be valid if empty when min length is set', function() {\n userLastInput.clear();\n userLastInput.sendKeys('');\n\n expect(user.getText()).toContain('{\"name\":\"guest\",\"last\":\"\"}');\n expect(lastNameValid.getText()).toContain('true');\n expect(formValid.getText()).toContain('true');\n });\n\n it('should be invalid if less than required min length', function() {\n userLastInput.clear();\n userLastInput.sendKeys('xx');\n\n expect(user.getText()).toContain('{\"name\":\"guest\"}');\n expect(lastNameValid.getText()).toContain('false');\n expect(lastNameError.getText()).toContain('minlength');\n expect(formValid.getText()).toContain('false');\n });\n\n it('should be invalid if longer than max length', function() {\n userLastInput.clear();\n userLastInput.sendKeys('some ridiculously long name');\n\n expect(user.getText()).toContain('{\"name\":\"guest\"}');\n expect(lastNameValid.getText()).toContain('false');\n expect(lastNameError.getText()).toContain('maxlength');\n expect(formValid.getText()).toContain('false');\n });\n \n
    \n */\nvar inputDirective = ['$browser', '$sniffer', '$filter', '$parse',\n function($browser, $sniffer, $filter, $parse) {\n return {\n restrict: 'E',\n require: ['?ngModel'],\n link: {\n pre: function(scope, element, attr, ctrls) {\n if (ctrls[0]) {\n (inputType[lowercase(attr.type)] || inputType.text)(scope, element, attr, ctrls[0], $sniffer,\n $browser, $filter, $parse);\n }\n }\n }\n };\n}];\n\n\n\nvar CONSTANT_VALUE_REGEXP = /^(true|false|\\d+)$/;\n/**\n * @ngdoc directive\n * @name ngValue\n *\n * @description\n * Binds the given expression to the value of `
    \n \n it('should check ng-options', function() {\n expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('red');\n element.all(by.model('myColor')).first().click();\n element.all(by.css('select[ng-model=\"myColor\"] option')).first().click();\n expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('black');\n element(by.css('.nullable select[ng-model=\"myColor\"]')).click();\n element.all(by.css('.nullable select[ng-model=\"myColor\"] option')).first().click();\n expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('null');\n });\n \n \n */\n\n// jshint maxlen: false\n// //00001111111111000000000002222222222000000000000000000000333333333300000000000000000000000004444444444400000000000005555555555555550000000006666666666666660000000777777777777777000000000000000888888888800000000000000000009999999999\nvar NG_OPTIONS_REGEXP = /^\\s*([\\s\\S]+?)(?:\\s+as\\s+([\\s\\S]+?))?(?:\\s+group\\s+by\\s+([\\s\\S]+?))?(?:\\s+disable\\s+when\\s+([\\s\\S]+?))?\\s+for\\s+(?:([\\$\\w][\\$\\w]*)|(?:\\(\\s*([\\$\\w][\\$\\w]*)\\s*,\\s*([\\$\\w][\\$\\w]*)\\s*\\)))\\s+in\\s+([\\s\\S]+?)(?:\\s+track\\s+by\\s+([\\s\\S]+?))?$/;\n // 1: value expression (valueFn)\n // 2: label expression (displayFn)\n // 3: group by expression (groupByFn)\n // 4: disable when expression (disableWhenFn)\n // 5: array item variable name\n // 6: object item key variable name\n // 7: object item value variable name\n // 8: collection expression\n // 9: track by expression\n// jshint maxlen: 100\n\n\nvar ngOptionsDirective = ['$compile', '$parse', function($compile, $parse) {\n\n function parseOptionsExpression(optionsExp, selectElement, scope) {\n\n var match = optionsExp.match(NG_OPTIONS_REGEXP);\n if (!(match)) {\n throw ngOptionsMinErr('iexp',\n \"Expected expression in form of \" +\n \"'_select_ (as _label_)? for (_key_,)?_value_ in _collection_'\" +\n \" but got '{0}'. Element: {1}\",\n optionsExp, startingTag(selectElement));\n }\n\n // Extract the parts from the ngOptions expression\n\n // The variable name for the value of the item in the collection\n var valueName = match[5] || match[7];\n // The variable name for the key of the item in the collection\n var keyName = match[6];\n\n // An expression that generates the viewValue for an option if there is a label expression\n var selectAs = / as /.test(match[0]) && match[1];\n // An expression that is used to track the id of each object in the options collection\n var trackBy = match[9];\n // An expression that generates the viewValue for an option if there is no label expression\n var valueFn = $parse(match[2] ? match[1] : valueName);\n var selectAsFn = selectAs && $parse(selectAs);\n var viewValueFn = selectAsFn || valueFn;\n var trackByFn = trackBy && $parse(trackBy);\n\n // Get the value by which we are going to track the option\n // if we have a trackFn then use that (passing scope and locals)\n // otherwise just hash the given viewValue\n var getTrackByValueFn = trackBy ?\n function(value, locals) { return trackByFn(scope, locals); } :\n function getHashOfValue(value) { return hashKey(value); };\n var getTrackByValue = function(value, key) {\n return getTrackByValueFn(value, getLocals(value, key));\n };\n\n var displayFn = $parse(match[2] || match[1]);\n var groupByFn = $parse(match[3] || '');\n var disableWhenFn = $parse(match[4] || '');\n var valuesFn = $parse(match[8]);\n\n var locals = {};\n var getLocals = keyName ? function(value, key) {\n locals[keyName] = key;\n locals[valueName] = value;\n return locals;\n } : function(value) {\n locals[valueName] = value;\n return locals;\n };\n\n\n function Option(selectValue, viewValue, label, group, disabled) {\n this.selectValue = selectValue;\n this.viewValue = viewValue;\n this.label = label;\n this.group = group;\n this.disabled = disabled;\n }\n\n function getOptionValuesKeys(optionValues) {\n var optionValuesKeys;\n\n if (!keyName && isArrayLike(optionValues)) {\n optionValuesKeys = optionValues;\n } else {\n // if object, extract keys, in enumeration order, unsorted\n optionValuesKeys = [];\n for (var itemKey in optionValues) {\n if (optionValues.hasOwnProperty(itemKey) && itemKey.charAt(0) !== '$') {\n optionValuesKeys.push(itemKey);\n }\n }\n }\n return optionValuesKeys;\n }\n\n return {\n trackBy: trackBy,\n getTrackByValue: getTrackByValue,\n getWatchables: $parse(valuesFn, function(optionValues) {\n // Create a collection of things that we would like to watch (watchedArray)\n // so that they can all be watched using a single $watchCollection\n // that only runs the handler once if anything changes\n var watchedArray = [];\n optionValues = optionValues || [];\n\n var optionValuesKeys = getOptionValuesKeys(optionValues);\n var optionValuesLength = optionValuesKeys.length;\n for (var index = 0; index < optionValuesLength; index++) {\n var key = (optionValues === optionValuesKeys) ? index : optionValuesKeys[index];\n var value = optionValues[key];\n\n var locals = getLocals(optionValues[key], key);\n var selectValue = getTrackByValueFn(optionValues[key], locals);\n watchedArray.push(selectValue);\n\n // Only need to watch the displayFn if there is a specific label expression\n if (match[2] || match[1]) {\n var label = displayFn(scope, locals);\n watchedArray.push(label);\n }\n\n // Only need to watch the disableWhenFn if there is a specific disable expression\n if (match[4]) {\n var disableWhen = disableWhenFn(scope, locals);\n watchedArray.push(disableWhen);\n }\n }\n return watchedArray;\n }),\n\n getOptions: function() {\n\n var optionItems = [];\n var selectValueMap = {};\n\n // The option values were already computed in the `getWatchables` fn,\n // which must have been called to trigger `getOptions`\n var optionValues = valuesFn(scope) || [];\n var optionValuesKeys = getOptionValuesKeys(optionValues);\n var optionValuesLength = optionValuesKeys.length;\n\n for (var index = 0; index < optionValuesLength; index++) {\n var key = (optionValues === optionValuesKeys) ? index : optionValuesKeys[index];\n var value = optionValues[key];\n var locals = getLocals(value, key);\n var viewValue = viewValueFn(scope, locals);\n var selectValue = getTrackByValueFn(viewValue, locals);\n var label = displayFn(scope, locals);\n var group = groupByFn(scope, locals);\n var disabled = disableWhenFn(scope, locals);\n var optionItem = new Option(selectValue, viewValue, label, group, disabled);\n\n optionItems.push(optionItem);\n selectValueMap[selectValue] = optionItem;\n }\n\n return {\n items: optionItems,\n selectValueMap: selectValueMap,\n getOptionFromViewValue: function(value) {\n return selectValueMap[getTrackByValue(value)];\n },\n getViewValueFromOption: function(option) {\n // If the viewValue could be an object that may be mutated by the application,\n // we need to make a copy and not return the reference to the value on the option.\n return trackBy ? angular.copy(option.viewValue) : option.viewValue;\n }\n };\n }\n };\n }\n\n\n // we can't just jqLite('\n * \n * \n * \n * {{ model }}\n * \n * \n * angular.module('nonStringSelect', [])\n * .run(function($rootScope) {\n * $rootScope.model = { id: 2 };\n * })\n * .directive('convertToNumber', function() {\n * return {\n * require: 'ngModel',\n * link: function(scope, element, attrs, ngModel) {\n * ngModel.$parsers.push(function(val) {\n * return parseInt(val, 10);\n * });\n * ngModel.$formatters.push(function(val) {\n * return '' + val;\n * });\n * }\n * };\n * });\n * \n * \n * it('should initialize to model', function() {\n * var select = element(by.css('select'));\n * expect(element(by.model('model.id')).$('option:checked').getText()).toEqual('Two');\n * });\n * \n * \n *\n */\nvar selectDirective = function() {\n\n return {\n restrict: 'E',\n require: ['select', '?ngModel'],\n controller: SelectController,\n link: function(scope, element, attr, ctrls) {\n\n // if ngModel is not defined, we don't need to do anything\n var ngModelCtrl = ctrls[1];\n if (!ngModelCtrl) return;\n\n var selectCtrl = ctrls[0];\n\n selectCtrl.ngModelCtrl = ngModelCtrl;\n\n // We delegate rendering to the `writeValue` method, which can be changed\n // if the select can have multiple selected values or if the options are being\n // generated by `ngOptions`\n ngModelCtrl.$render = function() {\n selectCtrl.writeValue(ngModelCtrl.$viewValue);\n };\n\n // When the selected item(s) changes we delegate getting the value of the select control\n // to the `readValue` method, which can be changed if the select can have multiple\n // selected values or if the options are being generated by `ngOptions`\n element.on('change', function() {\n scope.$apply(function() {\n ngModelCtrl.$setViewValue(selectCtrl.readValue());\n });\n });\n\n // If the select allows multiple values then we need to modify how we read and write\n // values from and to the control; also what it means for the value to be empty and\n // we have to add an extra watch since ngModel doesn't work well with arrays - it\n // doesn't trigger rendering if only an item in the array changes.\n if (attr.multiple) {\n\n // Read value now needs to check each option to see if it is selected\n selectCtrl.readValue = function readMultipleValue() {\n var array = [];\n forEach(element.find('option'), function(option) {\n if (option.selected) {\n array.push(option.value);\n }\n });\n return array;\n };\n\n // Write value now needs to set the selected property of each matching option\n selectCtrl.writeValue = function writeMultipleValue(value) {\n var items = new HashMap(value);\n forEach(element.find('option'), function(option) {\n option.selected = isDefined(items.get(option.value));\n });\n };\n\n // we have to do it on each watch since ngModel watches reference, but\n // we need to work of an array, so we need to see if anything was inserted/removed\n var lastView, lastViewRef = NaN;\n scope.$watch(function selectMultipleWatch() {\n if (lastViewRef === ngModelCtrl.$viewValue && !equals(lastView, ngModelCtrl.$viewValue)) {\n lastView = shallowCopy(ngModelCtrl.$viewValue);\n ngModelCtrl.$render();\n }\n lastViewRef = ngModelCtrl.$viewValue;\n });\n\n // If we are a multiple select then value is now a collection\n // so the meaning of $isEmpty changes\n ngModelCtrl.$isEmpty = function(value) {\n return !value || value.length === 0;\n };\n\n }\n }\n };\n};\n\n\n// The option directive is purely designed to communicate the existence (or lack of)\n// of dynamically created (and destroyed) option elements to their containing select\n// directive via its controller.\nvar optionDirective = ['$interpolate', function($interpolate) {\n\n function chromeHack(optionElement) {\n // Workaround for https://code.google.com/p/chromium/issues/detail?id=381459\n // Adding an